diff --git a/.github/workflows/gen_orig.yml b/.github/workflows/gen_orig.yml
new file mode 100644
index 000000000..cfc302a86
--- /dev/null
+++ b/.github/workflows/gen_orig.yml
@@ -0,0 +1,33 @@
+name: Generate source release tarball
+run-name: Generating source release tarball
+on:
+  push:
+    tags: # vX.Y.Z+rptYYYMMDD
+      - 'v[0-9]+.[0-9]+.[0-9]+\+rpt[0-9][0-9][0-9][0-9][0-9][0-9][0-9][0-9]'
+  workflow_dispatch:
+jobs:
+  publish_tarball:
+    permissions:
+      contents: write
+    runs-on: ubuntu-latest
+    steps:
+      - name: Install dependencies
+        run: | # Local cmake needs to be removed for pybind11 to be detected
+          sudo rm -rf /usr/local/bin/cmake
+          sudo apt-get update
+          sudo apt-get install -y meson pkgconf cmake libgtest-dev libyaml-dev python3 python3-dev pybind11-dev python3-jinja2 python3-ply python3-yaml
+      - name: Check out repository code
+        uses: actions/checkout@v4
+        with:
+          fetch-depth: 0 # Required for 'git describe' to work
+      - name: Generate tarball
+        run: |
+          meson setup build -Dpycamera=enabled
+          meson dist --no-tests --include-subprojects -C build
+          mv build/meson-dist/*.tar.xz "build/meson-dist/libcamera-${GITHUB_REF_NAME:1}.tar.xz"
+      - name: Release tarball
+        uses: softprops/action-gh-release@v1
+        with:
+          files: build/meson-dist/*.tar.xz
+      - if: failure()
+        run: cat build/meson-logs/meson-log.txt
diff --git a/Documentation/guides/pipeline-handler.rst b/Documentation/guides/pipeline-handler.rst
index 26dc93589..a96dbe178 100644
--- a/Documentation/guides/pipeline-handler.rst
+++ b/Documentation/guides/pipeline-handler.rst
@@ -183,7 +183,7 @@ to the libcamera build options in the top level ``meson_options.txt``.
 
    option('pipelines',
            type : 'array',
-           choices : ['ipu3', 'rkisp1', 'rpi/vc4', 'simple', 'uvcvideo', 'vimc', 'vivid'],
+           choices : ['ipu3', 'rkisp1', 'rpi/pisp', 'rpi/vc4', 'simple', 'uvcvideo', 'vimc', 'vivid'],
            description : 'Select which pipeline handlers to include')
 
 
diff --git a/include/libcamera/internal/bayer_format.h b/include/libcamera/internal/bayer_format.h
index 78ba39699..164743f7e 100644
--- a/include/libcamera/internal/bayer_format.h
+++ b/include/libcamera/internal/bayer_format.h
@@ -34,6 +34,8 @@ class BayerFormat
 		None = 0,
 		CSI2 = 1,
 		IPU3 = 2,
+		PISP1 = 3,
+		PISP2 = 4,
 	};
 
 	constexpr BayerFormat()
diff --git a/include/libcamera/ipa/meson.build b/include/libcamera/ipa/meson.build
index f3b4881c9..c1d913f51 100644
--- a/include/libcamera/ipa/meson.build
+++ b/include/libcamera/ipa/meson.build
@@ -64,6 +64,7 @@ libcamera_generated_ipa_headers += custom_target('core_ipa_serializer_h',
 pipeline_ipa_mojom_mapping = {
     'ipu3': 'ipu3.mojom',
     'rkisp1': 'rkisp1.mojom',
+    'rpi/pisp': 'raspberrypi.mojom',
     'rpi/vc4': 'raspberrypi.mojom',
     'vimc': 'vimc.mojom',
 }
diff --git a/include/libcamera/meson.build b/include/libcamera/meson.build
index bab858a37..6334e1641 100644
--- a/include/libcamera/meson.build
+++ b/include/libcamera/meson.build
@@ -36,6 +36,8 @@ controls_map = {
     'controls': {
         'draft': 'control_ids_draft.yaml',
         'core': 'control_ids_core.yaml',
+        'rpi/pisp': 'control_ids_rpi.yaml',
+        'rpi/vc4': 'control_ids_rpi.yaml',
     },
 
     'properties': {
diff --git a/include/linux/drm_fourcc.h b/include/linux/drm_fourcc.h
index 1496e0970..da81a44d0 100644
--- a/include/linux/drm_fourcc.h
+++ b/include/linux/drm_fourcc.h
@@ -174,6 +174,10 @@ extern "C" {
 #define DRM_FORMAT_RGBA1010102	fourcc_code('R', 'A', '3', '0') /* [31:0] R:G:B:A 10:10:10:2 little endian */
 #define DRM_FORMAT_BGRA1010102	fourcc_code('B', 'A', '3', '0') /* [31:0] B:G:R:A 10:10:10:2 little endian */
 
+/* 48 bpp RGB */
+#define DRM_FORMAT_RGB161616	fourcc_code('R', 'G', '4', '8') /* [48:0] R:G:B 16:16:16 little endian */
+#define DRM_FORMAT_BGR161616	fourcc_code('B', 'G', '4', '8') /* [48:0] R:G:B 16:16:16 little endian */
+
 /* 64 bpp RGB */
 #define DRM_FORMAT_XRGB16161616	fourcc_code('X', 'R', '4', '8') /* [63:0] x:R:G:B 16:16:16:16 little endian */
 #define DRM_FORMAT_XBGR16161616	fourcc_code('X', 'B', '4', '8') /* [63:0] x:B:G:R 16:16:16:16 little endian */
@@ -448,6 +452,7 @@ extern "C" {
 #define DRM_FORMAT_MOD_VENDOR_ALLWINNER 0x09
 #define DRM_FORMAT_MOD_VENDOR_AMLOGIC 0x0a
 #define DRM_FORMAT_MOD_VENDOR_MIPI 0x0b
+#define DRM_FORMAT_MOD_VENDOR_RPI 0x0c
 
 /* add more to the end as needed */
 
@@ -1554,6 +1559,10 @@ drm_fourcc_canonicalize_nvidia_format_mod(__u64 modifier)
  */
 #define MIPI_FORMAT_MOD_CSI2_PACKED fourcc_mod_code(MIPI, 1)
 
+#define PISP_FORMAT_MOD_COMPRESS_MODE1 fourcc_mod_code(RPI, 1)
+#define PISP_FORMAT_MOD_COMPRESS_MODE2 fourcc_mod_code(RPI, 2)
+#define PISP_FORMAT_MOD_VERIFICATION fourcc_mod_code(RPI, 3)
+
 #if defined(__cplusplus)
 }
 #endif
diff --git a/include/linux/media-bus-format.h b/include/linux/media-bus-format.h
index 0dfc11ee2..d3c765775 100644
--- a/include/linux/media-bus-format.h
+++ b/include/linux/media-bus-format.h
@@ -88,6 +88,7 @@
 #define MEDIA_BUS_FMT_YUYV12_2X12		0x201e
 #define MEDIA_BUS_FMT_YVYU12_2X12		0x201f
 #define MEDIA_BUS_FMT_Y14_1X14			0x202d
+#define MEDIA_BUS_FMT_Y16_1X16			0x202e
 #define MEDIA_BUS_FMT_UYVY8_1X16		0x200f
 #define MEDIA_BUS_FMT_VYUY8_1X16		0x2010
 #define MEDIA_BUS_FMT_YUYV8_1X16		0x2011
diff --git a/include/linux/videodev2.h b/include/linux/videodev2.h
index bfb315d6d..6a312aa8d 100644
--- a/include/linux/videodev2.h
+++ b/include/linux/videodev2.h
@@ -550,6 +550,10 @@ struct v4l2_pix_format {
 #define V4L2_PIX_FMT_ARGB32  v4l2_fourcc('B', 'A', '2', '4') /* 32  ARGB-8-8-8-8  */
 #define V4L2_PIX_FMT_XRGB32  v4l2_fourcc('B', 'X', '2', '4') /* 32  XRGB-8-8-8-8  */
 
+/* RGB formats (6 bytes per pixel) */
+#define V4L2_PIX_FMT_BGR48 v4l2_fourcc('B', 'G', 'R', '6') /* 16  BGR-16-16-16 */
+#define V4L2_PIX_FMT_RGB48 v4l2_fourcc('R', 'G', 'B', '6') /* 16  RGB-16-16-16 */
+
 /* Grey formats */
 #define V4L2_PIX_FMT_GREY    v4l2_fourcc('G', 'R', 'E', 'Y') /*  8  Greyscale     */
 #define V4L2_PIX_FMT_Y4      v4l2_fourcc('Y', '0', '4', ' ') /*  4  Greyscale     */
@@ -752,6 +756,19 @@ struct v4l2_pix_format {
 #define V4L2_PIX_FMT_IPU3_SGRBG10	v4l2_fourcc('i', 'p', '3', 'G') /* IPU3 packed 10-bit GRBG bayer */
 #define V4L2_PIX_FMT_IPU3_SRGGB10	v4l2_fourcc('i', 'p', '3', 'r') /* IPU3 packed 10-bit RGGB bayer */
 
+/* The pixel format for all our buffers (the precise format is found in the config buffer). */
+#define V4L2_PIX_FMT_RPI_BE		v4l2_fourcc('R', 'P', 'B', 'P')
+#define V4L2_PIX_FMT_PISP_COMP1_RGGB	v4l2_fourcc('P', 'C', '1', 'R')
+#define V4L2_PIX_FMT_PISP_COMP1_GRBG	v4l2_fourcc('P', 'C', '1', 'G')
+#define V4L2_PIX_FMT_PISP_COMP1_GBRG	v4l2_fourcc('P', 'C', '1', 'g')
+#define V4L2_PIX_FMT_PISP_COMP1_BGGR	v4l2_fourcc('P', 'C', '1', 'B')
+#define V4L2_PIX_FMT_PISP_COMP1_MONO	v4l2_fourcc('P', 'C', '1', 'M')
+#define V4L2_PIX_FMT_PISP_COMP2_RGGB	v4l2_fourcc('P', 'C', '2', 'R')
+#define V4L2_PIX_FMT_PISP_COMP2_GRBG	v4l2_fourcc('P', 'C', '2', 'G')
+#define V4L2_PIX_FMT_PISP_COMP2_GBRG	v4l2_fourcc('P', 'C', '2', 'g')
+#define V4L2_PIX_FMT_PISP_COMP2_BGGR	v4l2_fourcc('P', 'C', '2', 'B')
+#define V4L2_PIX_FMT_PISP_COMP2_MONO	v4l2_fourcc('P', 'C', '2', 'M')
+
 /* SDR formats - used only for Software Defined Radio devices */
 #define V4L2_SDR_FMT_CU8          v4l2_fourcc('C', 'U', '0', '8') /* IQ u8 */
 #define V4L2_SDR_FMT_CU16LE       v4l2_fourcc('C', 'U', '1', '6') /* IQ u16le */
@@ -781,6 +798,15 @@ struct v4l2_pix_format {
 #define V4L2_META_FMT_RK_ISP1_PARAMS	v4l2_fourcc('R', 'K', '1', 'P') /* Rockchip ISP1 3A Parameters */
 #define V4L2_META_FMT_RK_ISP1_STAT_3A	v4l2_fourcc('R', 'K', '1', 'S') /* Rockchip ISP1 3A Statistics */
 
+/* The metadata format identifier for BE configuration buffers. */
+#define V4L2_META_FMT_RPI_BE_CFG v4l2_fourcc('R', 'P', 'B', 'C')
+
+/* The metadata format identifier for FE configuration buffers. */
+#define V4L2_META_FMT_RPI_FE_CFG v4l2_fourcc('R', 'P', 'F', 'C')
+
+/* The metadata format identifier for FE stats buffers. */
+#define V4L2_META_FMT_RPI_FE_STATS v4l2_fourcc('R', 'P', 'F', 'S')
+
 /* priv field value to indicates that subsequent fields are valid. */
 #define V4L2_PIX_FMT_PRIV_MAGIC		0xfeedcafe
 
diff --git a/meson.build b/meson.build
index ee57cb780..5d6a33e87 100644
--- a/meson.build
+++ b/meson.build
@@ -199,6 +199,7 @@ pipelines_support = {
     'imx8-isi':     arch_arm,
     'ipu3':         arch_x86,
     'rkisp1':       arch_arm,
+    'rpi/pisp':     arch_arm,
     'rpi/vc4':      arch_arm,
     'simple':       arch_arm,
     'uvcvideo':     ['any'],
diff --git a/meson_options.txt b/meson_options.txt
index fad928af4..44f228aed 100644
--- a/meson_options.txt
+++ b/meson_options.txt
@@ -27,7 +27,7 @@ option('gstreamer',
 
 option('ipas',
         type : 'array',
-        choices : ['ipu3', 'rkisp1', 'rpi/vc4', 'vimc'],
+        choices : ['ipu3', 'rkisp1', 'rpi/pisp', 'rpi/vc4', 'vimc'],
         description : 'Select which IPA modules to build')
 
 option('lc-compliance',
@@ -44,6 +44,7 @@ option('pipelines',
             'imx8-isi',
             'ipu3',
             'rkisp1',
+            'rpi/pisp',
             'rpi/vc4',
             'simple',
             'uvcvideo',
diff --git a/src/ipa/rpi/common/ipa_base.cpp b/src/ipa/rpi/common/ipa_base.cpp
index 6ac9d5de2..891417637 100644
--- a/src/ipa/rpi/common/ipa_base.cpp
+++ b/src/ipa/rpi/common/ipa_base.cpp
@@ -24,6 +24,7 @@
 #include "controller/ccm_status.h"
 #include "controller/contrast_algorithm.h"
 #include "controller/denoise_algorithm.h"
+#include "controller/hdr_algorithm.h"
 #include "controller/lux_status.h"
 #include "controller/sharpen_algorithm.h"
 #include "controller/statistics.h"
@@ -67,6 +68,7 @@ const ControlInfoMap::Map ipaControls{
 	{ &controls::AeFlickerPeriod, ControlInfo(100, 1000000) },
 	{ &controls::Brightness, ControlInfo(-1.0f, 1.0f, 0.0f) },
 	{ &controls::Contrast, ControlInfo(0.0f, 32.0f, 1.0f) },
+	{ &controls::HdrMode, ControlInfo(controls::HdrModeValues) },
 	{ &controls::Sharpness, ControlInfo(0.0f, 16.0f, 1.0f) },
 	{ &controls::ScalerCrop, ControlInfo(Rectangle{}, Rectangle(65535, 65535, 65535, 65535), Rectangle{}) },
 	{ &controls::FrameDurationLimits, ControlInfo(INT64_C(33333), INT64_C(120000)) },
@@ -101,7 +103,8 @@ namespace ipa::RPi {
 
 IpaBase::IpaBase()
 	: controller_(), frameLengths_(FrameLengthsQueueSize, 0s), frameCount_(0),
-	  mistrustCount_(0), lastRunTimestamp_(0), firstStart_(true), flickerState_({ 0, 0s })
+	  mistrustCount_(0), lastRunTimestamp_(0), firstStart_(true), flickerState_({ 0, 0s }),
+	  stitchSwapBuffers_(false), statsMetadataOutput_(false)
 {
 }
 
@@ -282,18 +285,23 @@ void IpaBase::start(const ControlList &controls, StartResult *result)
 	frameLengths_.clear();
 	frameLengths_.resize(FrameLengthsQueueSize, 0s);
 
-	/* SwitchMode may supply updated exposure/gain values to use. */
-	AgcStatus agcStatus;
-	agcStatus.shutterTime = 0.0s;
-	agcStatus.analogueGain = 0.0;
+	/*
+	 * SwitchMode may supply updated exposure/gain values to use.
+	 * agcStatus_ will store these values for us to use until delayed_status values
+	 * start to appear.
+	 */
+	agcStatus_.shutterTime = 0.0s;
+	agcStatus_.analogueGain = 0.0;
 
-	metadata.get("agc.status", agcStatus);
-	if (agcStatus.shutterTime && agcStatus.analogueGain) {
+	metadata.get("agc.status", agcStatus_);
+	if (agcStatus_.shutterTime && agcStatus_.analogueGain) {
 		ControlList ctrls(sensorCtrls_);
-		applyAGC(&agcStatus, ctrls);
+		applyAGC(&agcStatus_, ctrls);
 		result->controls = std::move(ctrls);
 		setCameraTimeoutValue();
 	}
+	/* Make a note of this as it tells us the HDR status of the first few frames. */
+	hdrStatus_ = agcStatus_.hdr;
 
 	/*
 	 * Initialise frame counts, and decide how many frames must be hidden or
@@ -397,11 +405,17 @@ void IpaBase::prepareIsp(const PrepareParams &params)
 	 * sensor exposure/gain changes. So fetch it from the metadata list
 	 * indexed by the IPA cookie returned, and put it in the current frame
 	 * metadata.
+	 *
+	 * Note if the HDR mode has changed, as things like tonemaps may need updating.
 	 */
 	AgcStatus agcStatus;
+	bool hdrChange = false;
 	RPiController::Metadata &delayedMetadata = rpiMetadata_[params.delayContext];
-	if (!delayedMetadata.get<AgcStatus>("agc.status", agcStatus))
+	if (!delayedMetadata.get<AgcStatus>("agc.status", agcStatus)) {
 		rpiMetadata.set("agc.delayed_status", agcStatus);
+		hdrChange = agcStatus.hdr.mode != hdrStatus_.mode;
+		hdrStatus_ = agcStatus.hdr;
+	}
 
 	/*
 	 * This may overwrite the DeviceStatus using values from the sensor
@@ -412,7 +426,7 @@ void IpaBase::prepareIsp(const PrepareParams &params)
 	/* Allow a 10% margin on the comparison below. */
 	Duration delta = (frameTimestamp - lastRunTimestamp_) * 1.0ns;
 	if (lastRunTimestamp_ && frameCount_ > dropFrameCount_ &&
-	    delta < controllerMinFrameDuration * 0.9) {
+	    delta < controllerMinFrameDuration * 0.9 && !hdrChange) {
 		/*
 		 * Ensure we merge the previous frame's metadata with the current
 		 * frame. This will not overwrite exposure/gain values for the
@@ -440,7 +454,9 @@ void IpaBase::prepareIsp(const PrepareParams &params)
 		controller_.prepare(&rpiMetadata);
 		/* Actually prepare the ISP parameters for the frame. */
 		platformPrepareIsp(params, rpiMetadata);
-	}
+		platformPrepareAgc(rpiMetadata);
+	} else
+		platformPrepareAgc(rpiMetadata);
 
 	frameCount_++;
 
@@ -449,16 +465,15 @@ void IpaBase::prepareIsp(const PrepareParams &params)
 		reportMetadata(ipaContext);
 
 	/* Ready to push the input buffer into the ISP. */
-	prepareIspComplete.emit(params.buffers, false);
+	prepareIspComplete.emit(params.buffers, stitchSwapBuffers_);
 }
 
 void IpaBase::processStats(const ProcessParams &params)
 {
 	unsigned int ipaContext = params.ipaContext % rpiMetadata_.size();
+	RPiController::Metadata &rpiMetadata = rpiMetadata_[ipaContext];
 
 	if (processPending_ && frameCount_ >= mistrustCount_) {
-		RPiController::Metadata &rpiMetadata = rpiMetadata_[ipaContext];
-
 		auto it = buffers_.find(params.buffers.stats);
 		if (it == buffers_.end()) {
 			LOG(IPARPI, Error) << "Could not find stats buffer!";
@@ -472,14 +487,16 @@ void IpaBase::processStats(const ProcessParams &params)
 
 		helper_->process(statistics, rpiMetadata);
 		controller_.process(statistics, &rpiMetadata);
+	}
 
-		struct AgcStatus agcStatus;
-		if (rpiMetadata.get("agc.status", agcStatus) == 0) {
-			ControlList ctrls(sensorCtrls_);
-			applyAGC(&agcStatus, ctrls);
-			setDelayedControls.emit(ctrls, ipaContext);
-			setCameraTimeoutValue();
-		}
+	/* Do this even when we didn't call process, so that delayContext gets advanced. */
+	struct AgcStatus agcStatus;
+	if (rpiMetadata.get("agc.status", agcStatus) == 0) {
+		ControlList ctrls(sensorCtrls_);
+		applyAGC(&agcStatus, ctrls);
+		rpiMetadata.set("agc.status", agcStatus);
+		setDelayedControls.emit(ctrls, ipaContext);
+		setCameraTimeoutValue();
 	}
 
 	/*
@@ -661,9 +678,21 @@ static const std::map<int32_t, RPiController::AfAlgorithm::AfPause> AfPauseTable
 	{ controls::AfPauseResume, RPiController::AfAlgorithm::AfPauseResume },
 };
 
+static const std::map<int32_t, std::string> HdrModeTable = {
+	{ controls::HdrModeOff, "Off" },
+	{ controls::HdrModeMultiExposureUnmerged, "MultiExposureUnmerged" },
+	{ controls::HdrModeMultiExposure, "MultiExposure" },
+	{ controls::HdrModeSingleExposure, "SingleExposure" },
+	{ controls::HdrModeNight, "Night" },
+};
+
 void IpaBase::applyControls(const ControlList &controls)
 {
+	using RPiController::AgcAlgorithm;
 	using RPiController::AfAlgorithm;
+	using RPiController::ContrastAlgorithm;
+	using RPiController::DenoiseAlgorithm;
+	using RPiController::HdrAlgorithm;
 
 	/* Clear the return metadata buffer. */
 	libcameraMetadata_.clear();
@@ -735,7 +764,7 @@ void IpaBase::applyControls(const ControlList &controls)
 				break;
 			}
 
-			agc->setFixedAnalogueGain(0, ctrl.second.get<float>());
+			agc->setFixedGain(0, ctrl.second.get<float>());
 
 			libcameraMetadata_.set(controls::AnalogueGain,
 					       ctrl.second.get<float>());
@@ -1135,6 +1164,62 @@ void IpaBase::applyControls(const ControlList &controls)
 			break;
 		}
 
+		case controls::HDR_MODE: {
+			HdrAlgorithm *hdr = dynamic_cast<HdrAlgorithm *>(controller_.getAlgorithm("hdr"));
+			if (!hdr) {
+				LOG(IPARPI, Warning) << "No HDR algorithm available";
+				break;
+			}
+
+			auto mode = HdrModeTable.find(ctrl.second.get<int32_t>());
+			if (mode == HdrModeTable.end()) {
+				LOG(IPARPI, Warning) << "Unrecognised HDR mode";
+				break;
+			}
+
+			AgcAlgorithm *agc = dynamic_cast<AgcAlgorithm *>(controller_.getAlgorithm("agc"));
+			if (!agc) {
+				LOG(IPARPI, Warning) << "HDR requires an AGC algorithm";
+				break;
+			}
+
+			if (hdr->setMode(mode->second) == 0) {
+				agc->setActiveChannels(hdr->getChannels());
+
+				/* We also disable adpative contrast enhancement if HDR is running. */
+				ContrastAlgorithm *contrast =
+					dynamic_cast<ContrastAlgorithm *>(controller_.getAlgorithm("contrast"));
+				if (contrast) {
+					if (mode->second == "Off")
+						contrast->restoreCe();
+					else
+						contrast->enableCe(false);
+				}
+
+				DenoiseAlgorithm *denoise =
+					dynamic_cast<DenoiseAlgorithm *>(controller_.getAlgorithm("denoise"));
+				if (denoise) {
+					/* \todo - make the HDR mode say what denoise it wants? */
+					if (mode->second == "Night")
+						denoise->setConfig("night");
+					else if (mode->second == "SingleExposure")
+						denoise->setConfig("hdr");
+					/* MultiExposure doesn't need extra extra denoise. */
+					else
+						denoise->setConfig("normal");
+				}
+			} else
+				LOG(IPARPI, Warning)
+					<< "HDR mode " << mode->second << " not supported";
+
+			break;
+		}
+
+		case controls::rpi::STATS_OUTPUT_ENABLE: {
+			statsMetadataOutput_ = ctrl.second.get<bool>();
+			break;
+		}
+
 		default:
 			LOG(IPARPI, Warning)
 				<< "Ctrl " << controls::controls.at(ctrl.first)->name()
@@ -1197,9 +1282,15 @@ void IpaBase::reportMetadata(unsigned int ipaContext)
 	AgcPrepareStatus *agcPrepareStatus = rpiMetadata.getLocked<AgcPrepareStatus>("agc.prepare_status");
 	if (agcPrepareStatus) {
 		libcameraMetadata_.set(controls::AeLocked, agcPrepareStatus->locked);
-		libcameraMetadata_.set(controls::DigitalGain, agcPrepareStatus->digitalGain);
 	}
 
+	const AgcStatus *agcStatus = rpiMetadata.getLocked<AgcStatus>("agc.delayed_status");
+	if (agcStatus)
+		libcameraMetadata_.set(controls::DigitalGain, agcStatus->digitalGain);
+	else
+		libcameraMetadata_.set(controls::DigitalGain, agcStatus_.digitalGain);
+	/* The HDR metadata reporting will use this agcStatus too. */
+
 	LuxStatus *luxStatus = rpiMetadata.getLocked<LuxStatus>("lux.status");
 	if (luxStatus)
 		libcameraMetadata_.set(controls::Lux, luxStatus->lux);
@@ -1282,6 +1373,34 @@ void IpaBase::reportMetadata(unsigned int ipaContext)
 		libcameraMetadata_.set(controls::AfPauseState, p);
 	}
 
+	/*
+	 * THe HDR algorithm sets the HDR channel into the agc.status at the time that those
+	 * AGC parameters were calculated several frames ago, so it comes back to us now in
+	 * the delayed_status. If this frame is too soon after a mode switch for the
+	 * delayed_status to be available, we use the HDR status that came out of the
+	 * switchMode call.
+	 */
+	const HdrStatus &hdrStatus = agcStatus ? agcStatus->hdr : hdrStatus_;
+	if (!hdrStatus.mode.empty() && hdrStatus.mode != "Off") {
+		int32_t hdrMode = controls::HdrModeOff;
+		for (auto const &[mode, name] : HdrModeTable) {
+			if (hdrStatus.mode == name) {
+				hdrMode = mode;
+				break;
+			}
+		}
+		libcameraMetadata_.set(controls::HdrMode, hdrMode);
+
+		if (hdrStatus.channel == "short")
+			libcameraMetadata_.set(controls::HdrChannel, controls::HdrChannelShort);
+		else if (hdrStatus.channel == "long")
+			libcameraMetadata_.set(controls::HdrChannel, controls::HdrChannelLong);
+		else if (hdrStatus.channel == "medium")
+			libcameraMetadata_.set(controls::HdrChannel, controls::HdrChannelMedium);
+		else
+			libcameraMetadata_.set(controls::HdrChannel, controls::HdrChannelNone);
+	}
+
 	metadataReady.emit(libcameraMetadata_);
 }
 
@@ -1317,7 +1436,7 @@ void IpaBase::applyFrameDurations(Duration minFrameDuration, Duration maxFrameDu
 	agc->setMaxShutter(maxShutter);
 }
 
-void IpaBase::applyAGC(const struct AgcStatus *agcStatus, ControlList &ctrls)
+void IpaBase::applyAGC(struct AgcStatus *agcStatus, ControlList &ctrls)
 {
 	const int32_t minGainCode = helper_->gainCode(mode_.minAnalogueGain);
 	const int32_t maxGainCode = helper_->gainCode(mode_.maxAnalogueGain);
@@ -1346,6 +1465,19 @@ void IpaBase::applyAGC(const struct AgcStatus *agcStatus, ControlList &ctrls)
 	ctrls.set(V4L2_CID_EXPOSURE, exposureLines);
 	ctrls.set(V4L2_CID_ANALOGUE_GAIN, gainCode);
 
+	/*
+	 * We must update the digital gain to make up for any quantisation that happens, and
+	 * communicate that back into the metadata so that it will appear as the "delayed" status.
+	 * (Note that "exposure" is already the "actual" exposure.)
+	 */
+	double actualGain = helper_->gain(gainCode);
+	double ratio = agcStatus->analogueGain / actualGain;
+	ratio *= agcStatus->shutterTime / exposure;
+	double newDigitalGain = agcStatus->digitalGain * ratio;
+	agcStatus->digitalGain = newDigitalGain;
+	agcStatus->analogueGain = actualGain;
+	agcStatus->shutterTime = exposure;
+
 	/*
 	 * At present, there is no way of knowing if a control is read-only.
 	 * As a workaround, assume that if the minimum and maximum values of
diff --git a/src/ipa/rpi/common/ipa_base.h b/src/ipa/rpi/common/ipa_base.h
index eaa9f7118..11aca074d 100644
--- a/src/ipa/rpi/common/ipa_base.h
+++ b/src/ipa/rpi/common/ipa_base.h
@@ -22,6 +22,7 @@
 #include "controller/agc_status.h"
 #include "controller/camera_mode.h"
 #include "controller/controller.h"
+#include "controller/hdr_status.h"
 #include "controller/metadata.h"
 
 namespace libcamera {
@@ -72,6 +73,7 @@ class IpaBase : public IPARPiInterface
 
 	virtual void platformPrepareIsp(const PrepareParams &params,
 					RPiController::Metadata &rpiMetadata) = 0;
+	virtual void platformPrepareAgc(RPiController::Metadata &rpiMetadata) = 0;
 	virtual RPiController::StatisticsPtr platformProcessStats(Span<uint8_t> mem) = 0;
 
 	void setMode(const IPACameraSensorInfo &sensorInfo);
@@ -83,13 +85,10 @@ class IpaBase : public IPARPiInterface
 	void fillDeviceStatus(const ControlList &sensorControls, unsigned int ipaContext);
 	void reportMetadata(unsigned int ipaContext);
 	void applyFrameDurations(utils::Duration minFrameDuration, utils::Duration maxFrameDuration);
-	void applyAGC(const struct AgcStatus *agcStatus, ControlList &ctrls);
+	void applyAGC(struct AgcStatus *agcStatus, ControlList &ctrls);
 
 	std::map<unsigned int, MappedFrameBuffer> buffers_;
 
-	bool lensPresent_;
-	bool monoSensor_;
-	ControlList libcameraMetadata_;
 
 	std::array<RPiController::Metadata, numMetadataContexts> rpiMetadata_;
 
@@ -123,6 +122,20 @@ class IpaBase : public IPARPiInterface
 		int32_t mode;
 		utils::Duration manualPeriod;
 	} flickerState_;
+
+protected:
+	/* Remember the HDR status after a mode switch. */
+	HdrStatus hdrStatus_;
+
+	/* Remember the AGC status after a mode switch. */
+	AgcStatus agcStatus_;
+
+	/* Whether the stitch block (if available) needs to swap buffers. */
+	bool stitchSwapBuffers_;
+	bool monoSensor_;
+	bool lensPresent_;
+	bool statsMetadataOutput_;
+	ControlList libcameraMetadata_;
 };
 
 } /* namespace ipa::RPi */
diff --git a/src/ipa/rpi/controller/agc_algorithm.h b/src/ipa/rpi/controller/agc_algorithm.h
index 534e38e2b..5f2185572 100644
--- a/src/ipa/rpi/controller/agc_algorithm.h
+++ b/src/ipa/rpi/controller/agc_algorithm.h
@@ -26,7 +26,7 @@ class AgcAlgorithm : public Algorithm
 	virtual void setFixedShutter(unsigned int channel,
 				     libcamera::utils::Duration fixedShutter) = 0;
 	virtual void setMaxShutter(libcamera::utils::Duration maxShutter) = 0;
-	virtual void setFixedAnalogueGain(unsigned int channel, double fixedAnalogueGain) = 0;
+	virtual void setFixedGain(unsigned int channel, double fixedGain) = 0;
 	virtual void setMeteringMode(std::string const &meteringModeName) = 0;
 	virtual void setExposureMode(std::string const &exposureModeName) = 0;
 	virtual void setConstraintMode(std::string const &contraintModeName) = 0;
diff --git a/src/ipa/rpi/controller/agc_status.h b/src/ipa/rpi/controller/agc_status.h
index 68f899585..3afe0cea9 100644
--- a/src/ipa/rpi/controller/agc_status.h
+++ b/src/ipa/rpi/controller/agc_status.h
@@ -30,6 +30,7 @@ struct AgcStatus {
 	libcamera::utils::Duration targetExposureValue; /* (unfiltered) target total exposure AGC is aiming for */
 	libcamera::utils::Duration shutterTime;
 	double analogueGain;
+	double digitalGain;
 	std::string exposureMode;
 	std::string constraintMode;
 	std::string meteringMode;
@@ -37,12 +38,11 @@ struct AgcStatus {
 	libcamera::utils::Duration flickerPeriod;
 	int floatingRegionEnable;
 	libcamera::utils::Duration fixedShutter;
-	double fixedAnalogueGain;
+	double fixedGain;
 	unsigned int channel;
 	HdrStatus hdr;
 };
 
 struct AgcPrepareStatus {
-	double digitalGain;
 	int locked;
 };
diff --git a/src/ipa/rpi/controller/awb_algorithm.h b/src/ipa/rpi/controller/awb_algorithm.h
index 8462c4db8..6009bdaca 100644
--- a/src/ipa/rpi/controller/awb_algorithm.h
+++ b/src/ipa/rpi/controller/awb_algorithm.h
@@ -16,6 +16,7 @@ class AwbAlgorithm : public Algorithm
 	AwbAlgorithm(Controller *controller) : Algorithm(controller) {}
 	/* An AWB algorithm must provide the following: */
 	virtual unsigned int getConvergenceFrames() const = 0;
+	virtual void initialValues(double &gainR, double &gainB) = 0;
 	virtual void setMode(std::string const &modeName) = 0;
 	virtual void setManualGains(double manualR, double manualB) = 0;
 	virtual void enableAuto() = 0;
diff --git a/src/ipa/rpi/controller/black_level_algorithm.h b/src/ipa/rpi/controller/black_level_algorithm.h
new file mode 100644
index 000000000..c2cff2f56
--- /dev/null
+++ b/src/ipa/rpi/controller/black_level_algorithm.h
@@ -0,0 +1,23 @@
+/* SPDX-License-Identifier: BSD-2-Clause */
+/*
+ * Copyright (C) 2023, Raspberry Pi Ltd
+ *
+ * black_level_algorithm.h - black level control algorithm interface
+ */
+#pragma once
+
+#include "algorithm.h"
+
+namespace RPiController {
+
+class BlackLevelAlgorithm : public Algorithm
+{
+public:
+	BlackLevelAlgorithm(Controller *controller)
+		: Algorithm(controller) {}
+	/* A black level algorithm must provide the following: */
+	virtual void initialValues(uint16_t &blackLevelR, uint16_t &blackLevelG,
+				   uint16_t &blackLevelB) = 0;
+};
+
+} /* namespace RPiController */
diff --git a/src/ipa/rpi/controller/rpi/agc.cpp b/src/ipa/rpi/controller/rpi/agc.cpp
index 6549dedd0..33f6526f4 100644
--- a/src/ipa/rpi/controller/rpi/agc.cpp
+++ b/src/ipa/rpi/controller/rpi/agc.cpp
@@ -144,14 +144,14 @@ void Agc::setFixedShutter(unsigned int channelIndex, Duration fixedShutter)
 	channelData_[channelIndex].channel.setFixedShutter(fixedShutter);
 }
 
-void Agc::setFixedAnalogueGain(unsigned int channelIndex, double fixedAnalogueGain)
+void Agc::setFixedGain(unsigned int channelIndex, double fixedGain)
 {
 	if (checkChannel(channelIndex))
 		return;
 
-	LOG(RPiAgc, Debug) << "setFixedAnalogueGain " << fixedAnalogueGain
+	LOG(RPiAgc, Debug) << "setFixedGain " << fixedGain
 			   << " for channel " << channelIndex;
-	channelData_[channelIndex].channel.setFixedAnalogueGain(fixedAnalogueGain);
+	channelData_[channelIndex].channel.setFixedGain(fixedGain);
 }
 
 void Agc::setMeteringMode(std::string const &meteringModeName)
diff --git a/src/ipa/rpi/controller/rpi/agc.h b/src/ipa/rpi/controller/rpi/agc.h
index 7d26bdf6d..a94e2017b 100644
--- a/src/ipa/rpi/controller/rpi/agc.h
+++ b/src/ipa/rpi/controller/rpi/agc.h
@@ -35,8 +35,8 @@ class Agc : public AgcAlgorithm
 	void setMaxShutter(libcamera::utils::Duration maxShutter) override;
 	void setFixedShutter(unsigned int channelIndex,
 			     libcamera::utils::Duration fixedShutter) override;
-	void setFixedAnalogueGain(unsigned int channelIndex,
-				  double fixedAnalogueGain) override;
+	void setFixedGain(unsigned int channelIndex,
+			  double fixedGain) override;
 	void setMeteringMode(std::string const &meteringModeName) override;
 	void setExposureMode(std::string const &exposureModeName) override;
 	void setConstraintMode(std::string const &contraintModeName) override;
diff --git a/src/ipa/rpi/controller/rpi/agc_channel.cpp b/src/ipa/rpi/controller/rpi/agc_channel.cpp
index 8116c6c1e..3ad9c564c 100644
--- a/src/ipa/rpi/controller/rpi/agc_channel.cpp
+++ b/src/ipa/rpi/controller/rpi/agc_channel.cpp
@@ -255,11 +255,13 @@ int AgcConfig::read(const libcamera::YamlObject &params)
 
 	desaturate = params["desaturate"].get<int>(1);
 
+	maxDigitalGain = params["max_digital_gain"].get<double>(4.0);
+
 	return 0;
 }
 
 AgcChannel::ExposureValues::ExposureValues()
-	: shutter(0s), analogueGain(0),
+	: shutter(0s), analogueGain(0), digitalGain(0),
 	  totalExposure(0s), totalExposureNoDG(0s)
 {
 }
@@ -268,7 +270,7 @@ AgcChannel::AgcChannel()
 	: meteringMode_(nullptr), exposureMode_(nullptr), constraintMode_(nullptr),
 	  frameCount_(0), lockCount_(0),
 	  lastTargetExposure_(0s), ev_(1.0), flickerPeriod_(0s),
-	  maxShutter_(0s), fixedShutter_(0s), fixedAnalogueGain_(0.0)
+	  maxShutter_(0s), fixedShutter_(0s), fixedGain_(0.0)
 {
 	/* Set AWB default values in case early frames have no updates in metadata. */
 	awb_.gainR = 1.0;
@@ -318,13 +320,13 @@ int AgcChannel::read(const libcamera::YamlObject &params,
 void AgcChannel::disableAuto()
 {
 	fixedShutter_ = status_.shutterTime;
-	fixedAnalogueGain_ = status_.analogueGain;
+	fixedGain_ = status_.analogueGain;
 }
 
 void AgcChannel::enableAuto()
 {
 	fixedShutter_ = 0s;
-	fixedAnalogueGain_ = 0;
+	fixedGain_ = 0;
 }
 
 unsigned int AgcChannel::getConvergenceFrames() const
@@ -333,7 +335,7 @@ unsigned int AgcChannel::getConvergenceFrames() const
 	 * If shutter and gain have been explicitly set, there is no
 	 * convergence to happen, so no need to drop any frames - return zero.
 	 */
-	if (fixedShutter_ && fixedAnalogueGain_)
+	if (fixedShutter_ && fixedGain_)
 		return 0;
 	else
 		return config_.convergenceFrames;
@@ -369,15 +371,11 @@ void AgcChannel::setMaxShutter(Duration maxShutter)
 void AgcChannel::setFixedShutter(Duration fixedShutter)
 {
 	fixedShutter_ = fixedShutter;
-	/* Set this in case someone calls disableAuto() straight after. */
-	status_.shutterTime = limitShutter(fixedShutter_);
 }
 
-void AgcChannel::setFixedAnalogueGain(double fixedAnalogueGain)
+void AgcChannel::setFixedGain(double fixedGain)
 {
-	fixedAnalogueGain_ = fixedAnalogueGain;
-	/* Set this in case someone calls disableAuto() straight after. */
-	status_.analogueGain = limitGain(fixedAnalogueGain);
+	fixedGain_ = fixedGain;
 }
 
 void AgcChannel::setMeteringMode(std::string const &meteringModeName)
@@ -411,22 +409,10 @@ void AgcChannel::switchMode(CameraMode const &cameraMode,
 	mode_ = cameraMode;
 
 	Duration fixedShutter = limitShutter(fixedShutter_);
-	if (fixedShutter && fixedAnalogueGain_) {
-		/* We're going to reset the algorithm here with these fixed values. */
-		fetchAwbStatus(metadata);
-		double minColourGain = std::min({ awb_.gainR, awb_.gainG, awb_.gainB, 1.0 });
-		ASSERT(minColourGain != 0.0);
-
-		/* This is the equivalent of computeTargetExposure and applyDigitalGain. */
-		target_.totalExposureNoDG = fixedShutter_ * fixedAnalogueGain_;
-		target_.totalExposure = target_.totalExposureNoDG / minColourGain;
-
-		/* Equivalent of filterExposure. This resets any "history". */
-		filtered_ = target_;
-
-		/* Equivalent of divideUpExposure. */
-		filtered_.shutter = fixedShutter;
-		filtered_.analogueGain = fixedAnalogueGain_;
+	double fixedGain = limitGain(fixedGain_);
+	if (fixedShutter_ && fixedGain_) {
+		filtered_.totalExposureNoDG = fixedShutter * fixedGain;
+		filtered_.totalExposure = filtered_.totalExposureNoDG;
 	} else if (status_.totalExposureValue) {
 		/*
 		 * On a mode switch, various things could happen:
@@ -439,12 +425,8 @@ void AgcChannel::switchMode(CameraMode const &cameraMode,
 		 */
 
 		double ratio = lastSensitivity / cameraMode.sensitivity;
-		target_.totalExposureNoDG *= ratio;
-		target_.totalExposure *= ratio;
-		filtered_.totalExposureNoDG *= ratio;
 		filtered_.totalExposure *= ratio;
-
-		divideUpExposure();
+		filtered_.totalExposureNoDG = filtered_.totalExposure;
 	} else {
 		/*
 		 * We come through here on startup, when at least one of the shutter
@@ -453,54 +435,30 @@ void AgcChannel::switchMode(CameraMode const &cameraMode,
 		 * for any that weren't set.
 		 */
 
-		/* Equivalent of divideUpExposure. */
-		filtered_.shutter = fixedShutter ? fixedShutter : config_.defaultExposureTime;
-		filtered_.analogueGain = fixedAnalogueGain_ ? fixedAnalogueGain_ : config_.defaultAnalogueGain;
+		Duration shutter = fixedShutter ? fixedShutter : config_.defaultExposureTime;
+		double gain = fixedGain ? fixedGain : config_.defaultAnalogueGain;
+		filtered_.totalExposure = shutter * gain;
+		filtered_.totalExposureNoDG = filtered_.totalExposure;
 	}
 
+	/* Setting target_ to filtered_ removes any history from before the mode switch. */
+	target_ = filtered_;
+	divideUpExposure();
+
 	writeAndFinish(metadata, false);
 }
 
 void AgcChannel::prepare(Metadata *imageMetadata)
 {
-	Duration totalExposureValue = status_.totalExposureValue;
-	AgcStatus delayedStatus;
+	DeviceStatus deviceStatus;
 	AgcPrepareStatus prepareStatus;
 
-	/* Fetch the AWB status now because AWB also sets it in the prepare method. */
-	fetchAwbStatus(imageMetadata);
-
-	if (!imageMetadata->get("agc.delayed_status", delayedStatus))
-		totalExposureValue = delayedStatus.totalExposureValue;
-
-	prepareStatus.digitalGain = 1.0;
 	prepareStatus.locked = false;
 
-	if (status_.totalExposureValue) {
-		/* Process has run, so we have meaningful values. */
-		DeviceStatus deviceStatus;
-		if (imageMetadata->get("device.status", deviceStatus) == 0) {
-			Duration actualExposure = deviceStatus.shutterSpeed *
-						  deviceStatus.analogueGain;
-			if (actualExposure) {
-				double digitalGain = totalExposureValue / actualExposure;
-				LOG(RPiAgc, Debug) << "Want total exposure " << totalExposureValue;
-				/*
-				 * Never ask for a gain < 1.0, and also impose
-				 * some upper limit. Make it customisable?
-				 */
-				prepareStatus.digitalGain = std::max(1.0, std::min(digitalGain, 4.0));
-				LOG(RPiAgc, Debug) << "Actual exposure " << actualExposure;
-				LOG(RPiAgc, Debug) << "Use digitalGain " << prepareStatus.digitalGain;
-				LOG(RPiAgc, Debug) << "Effective exposure "
-						   << actualExposure * prepareStatus.digitalGain;
-				/* Decide whether AEC/AGC has converged. */
-				prepareStatus.locked = updateLockStatus(deviceStatus);
-			}
-		} else
-			LOG(RPiAgc, Warning) << "AgcChannel: no device metadata";
-		imageMetadata->set("agc.prepare_status", prepareStatus);
-	}
+	if (!imageMetadata->get("device.status", deviceStatus))
+		prepareStatus.locked = updateLockStatus(deviceStatus);
+
+	imageMetadata->set("agc.prepare_status", prepareStatus);
 }
 
 void AgcChannel::process(StatisticsPtr &stats, DeviceStatus const &deviceStatus,
@@ -586,11 +544,11 @@ void AgcChannel::housekeepConfig()
 	/* First fetch all the up-to-date settings, so no one else has to do it. */
 	status_.ev = ev_;
 	status_.fixedShutter = limitShutter(fixedShutter_);
-	status_.fixedAnalogueGain = fixedAnalogueGain_;
+	status_.fixedGain = limitGain(fixedGain_);
 	status_.flickerPeriod = flickerPeriod_;
 	LOG(RPiAgc, Debug) << "ev " << status_.ev << " fixedShutter "
-			   << status_.fixedShutter << " fixedAnalogueGain "
-			   << status_.fixedAnalogueGain;
+			   << status_.fixedShutter << " fixedGain "
+			   << status_.fixedGain;
 	/*
 	 * Make sure the "mode" pointers point to the up-to-date things, if
 	 * they've changed.
@@ -637,6 +595,9 @@ void AgcChannel::fetchCurrentExposure(DeviceStatus const &deviceStatus)
 	current_.analogueGain = deviceStatus.analogueGain;
 	current_.totalExposure = 0s; /* this value is unused */
 	current_.totalExposureNoDG = current_.shutter * current_.analogueGain;
+	LOG(RPiAgc, Debug) << "Current frame: shutter " << current_.shutter
+			   << " ag " << current_.analogueGain
+			   << " (total " << current_.totalExposureNoDG << ")";
 }
 
 void AgcChannel::fetchAwbStatus(Metadata *imageMetadata)
@@ -693,9 +654,17 @@ static double computeInitialY(StatisticsPtr &stats, AwbStatus const &awb,
 	double ySum;
 	/* Factor in the AWB correction if needed. */
 	if (stats->agcStatsPos == Statistics::AgcStatsPos::PreWb) {
-		ySum = rSum * awb.gainR * .299 +
-		       gSum * awb.gainG * .587 +
-		       bSum * awb.gainB * .114;
+		/*
+		 * We apply any extra gain that will automatically be added by the pipeline
+		 * on account of low colour gains. This means that this statistic should then
+		 * drive the exposure to the correct point. The hard-coded 0.1 here doesn't
+		 * really mean anything, just stops arithmetic errors and extreme behaviour.
+		 */
+		double minColourGain = std::min({ awb.gainR, awb.gainG, awb.gainB, 1.0 });
+		double extraGain = 1.0 / std::max({ minColourGain, 0.1 });
+		ySum = rSum * awb.gainR * extraGain * .299 +
+		       gSum * awb.gainG * extraGain * .587 +
+		       bSum * awb.gainB * extraGain * .114;
 	} else
 		ySum = rSum * .299 + gSum * .587 + bSum * .114;
 
@@ -774,17 +743,9 @@ void AgcChannel::computeGain(StatisticsPtr &statistics, Metadata *imageMetadata,
 
 void AgcChannel::computeTargetExposure(double gain)
 {
-	if (status_.fixedShutter && status_.fixedAnalogueGain) {
-		/*
-		 * When ag and shutter are both fixed, we need to drive the
-		 * total exposure so that we end up with a digital gain of at least
-		 * 1/minColourGain. Otherwise we'd desaturate channels causing
-		 * white to go cyan or magenta.
-		 */
-		double minColourGain = std::min({ awb_.gainR, awb_.gainG, awb_.gainB, 1.0 });
-		ASSERT(minColourGain != 0.0);
+	if (status_.fixedShutter && status_.fixedGain) {
 		target_.totalExposure =
-			status_.fixedShutter * status_.fixedAnalogueGain / minColourGain;
+			status_.fixedShutter * status_.fixedGain;
 	} else {
 		/*
 		 * The statistics reflect the image without digital gain, so the final
@@ -796,11 +757,9 @@ void AgcChannel::computeTargetExposure(double gain)
 					      ? status_.fixedShutter
 					      : exposureMode_->shutter.back();
 		maxShutter = limitShutter(maxShutter);
-		Duration maxTotalExposure =
-			maxShutter *
-			(status_.fixedAnalogueGain != 0.0
-				 ? status_.fixedAnalogueGain
-				 : exposureMode_->gain.back());
+		double maxGain = status_.fixedGain ? status_.fixedGain : exposureMode_->gain.back();
+		maxGain = limitGain(maxGain);
+		Duration maxTotalExposure = maxShutter * maxGain;
 		target_.totalExposure = std::min(target_.totalExposure, maxTotalExposure);
 	}
 	LOG(RPiAgc, Debug) << "Target totalExposure " << target_.totalExposure;
@@ -809,8 +768,6 @@ void AgcChannel::computeTargetExposure(double gain)
 bool AgcChannel::applyChannelConstraints(const AgcChannelTotalExposures &channelTotalExposures)
 {
 	bool channelBound = false;
-	LOG(RPiAgc, Debug)
-		<< "Total exposure before channel constraints " << filtered_.totalExposure;
 
 	for (const auto &constraint : config_.channelConstraints) {
 		LOG(RPiAgc, Debug)
@@ -845,15 +802,8 @@ bool AgcChannel::applyChannelConstraints(const AgcChannelTotalExposures &channel
 
 bool AgcChannel::applyDigitalGain(double gain, double targetY, bool channelBound)
 {
-	double minColourGain = std::min({ awb_.gainR, awb_.gainG, awb_.gainB, 1.0 });
-	ASSERT(minColourGain != 0.0);
-	double dg = 1.0 / minColourGain;
-	/*
-	 * I think this pipeline subtracts black level and rescales before we
-	 * get the stats, so no need to worry about it.
-	 */
-	LOG(RPiAgc, Debug) << "after AWB, target dg " << dg << " gain " << gain
-			   << " target_Y " << targetY;
+	filtered_.totalExposureNoDG = filtered_.totalExposure;
+
 	/*
 	 * Finally, if we're trying to reduce exposure but the target_Y is
 	 * "close" to 1.0, then the gain computed for that constraint will be
@@ -863,15 +813,14 @@ bool AgcChannel::applyDigitalGain(double gain, double targetY, bool channelBound
 	 * quickly (and we then approach the correct value more quickly from
 	 * below).
 	 */
-	bool desaturate = false;
-	if (config_.desaturate)
-		desaturate = !channelBound &&
-			     targetY > config_.fastReduceThreshold && gain < sqrt(targetY);
-	if (desaturate)
-		dg /= config_.fastReduceThreshold;
-	LOG(RPiAgc, Debug) << "Digital gain " << dg << " desaturate? " << desaturate;
-	filtered_.totalExposureNoDG = filtered_.totalExposure / dg;
-	LOG(RPiAgc, Debug) << "Target totalExposureNoDG " << filtered_.totalExposureNoDG;
+	bool desaturate = config_.desaturate && !channelBound &&
+			  targetY > config_.fastReduceThreshold && gain < sqrt(targetY);
+
+	if (desaturate) {
+		filtered_.totalExposureNoDG *= config_.fastReduceThreshold;
+		LOG(RPiAgc, Debug) << "Desaturating, exposure no dg " << filtered_.totalExposureNoDG;
+	}
+
 	return desaturate;
 }
 
@@ -884,7 +833,7 @@ void AgcChannel::filterExposure()
 	 * AGC adapts instantly if both shutter and gain are directly specified
 	 * or we're in the startup phase.
 	 */
-	if ((status_.fixedShutter && status_.fixedAnalogueGain) ||
+	if ((status_.fixedShutter && status_.fixedGain) ||
 	    frameCount_ <= config_.startupFrames)
 		speed = 1.0;
 	if (!filtered_.totalExposure) {
@@ -903,8 +852,7 @@ void AgcChannel::filterExposure()
 		filtered_.totalExposure = speed * target_.totalExposure +
 					  filtered_.totalExposure * (1.0 - speed);
 	}
-	LOG(RPiAgc, Debug) << "After filtering, totalExposure " << filtered_.totalExposure
-			   << " no dg " << filtered_.totalExposureNoDG;
+	LOG(RPiAgc, Debug) << "After filtering, totalExposure " << filtered_.totalExposure;
 }
 
 void AgcChannel::divideUpExposure()
@@ -916,62 +864,69 @@ void AgcChannel::divideUpExposure()
 	 */
 	Duration exposureValue = filtered_.totalExposureNoDG;
 	Duration shutterTime;
-	double analogueGain;
+	double gain;
 	shutterTime = status_.fixedShutter ? status_.fixedShutter
 					   : exposureMode_->shutter[0];
 	shutterTime = limitShutter(shutterTime);
-	analogueGain = status_.fixedAnalogueGain != 0.0 ? status_.fixedAnalogueGain
-							: exposureMode_->gain[0];
-	analogueGain = limitGain(analogueGain);
-	if (shutterTime * analogueGain < exposureValue) {
+	gain = status_.fixedGain != 0.0 ? status_.fixedGain
+					: exposureMode_->gain[0];
+	gain = limitGain(gain);
+	if (shutterTime * gain < exposureValue) {
 		for (unsigned int stage = 1;
 		     stage < exposureMode_->gain.size(); stage++) {
 			if (!status_.fixedShutter) {
 				Duration stageShutter =
 					limitShutter(exposureMode_->shutter[stage]);
-				if (stageShutter * analogueGain >= exposureValue) {
-					shutterTime = exposureValue / analogueGain;
+				if (stageShutter * gain >= exposureValue) {
+					shutterTime = exposureValue / gain;
 					break;
 				}
 				shutterTime = stageShutter;
 			}
-			if (status_.fixedAnalogueGain == 0.0) {
+			if (status_.fixedGain == 0.0) {
 				if (exposureMode_->gain[stage] * shutterTime >= exposureValue) {
-					analogueGain = exposureValue / shutterTime;
+					gain = exposureValue / shutterTime;
 					break;
 				}
-				analogueGain = exposureMode_->gain[stage];
-				analogueGain = limitGain(analogueGain);
+				gain = exposureMode_->gain[stage];
+				gain = limitGain(gain);
 			}
 		}
 	}
-	LOG(RPiAgc, Debug) << "Divided up shutter and gain are " << shutterTime << " and "
-			   << analogueGain;
+
 	/*
-	 * Finally adjust shutter time for flicker avoidance (require both
+	 * Adjust shutter time for flicker avoidance (require both
 	 * shutter and gain not to be fixed).
 	 */
-	if (!status_.fixedShutter && !status_.fixedAnalogueGain &&
+	if (!status_.fixedShutter && !status_.fixedGain &&
 	    status_.flickerPeriod) {
 		int flickerPeriods = shutterTime / status_.flickerPeriod;
 		if (flickerPeriods) {
 			Duration newShutterTime = flickerPeriods * status_.flickerPeriod;
-			analogueGain *= shutterTime / newShutterTime;
-			/*
-			 * We should still not allow the ag to go over the
-			 * largest value in the exposure mode. Note that this
-			 * may force more of the total exposure into the digital
-			 * gain as a side-effect.
-			 */
-			analogueGain = std::min(analogueGain, exposureMode_->gain.back());
-			analogueGain = limitGain(analogueGain);
+			gain *= shutterTime / newShutterTime;
 			shutterTime = newShutterTime;
 		}
 		LOG(RPiAgc, Debug) << "After flicker avoidance, shutter "
-				   << shutterTime << " gain " << analogueGain;
+				   << shutterTime << " gain " << gain;
+	}
+
+	/*
+	 * Now limit the analogue gain to the maximum allowed, so that we can figure
+	 * out how much digital gain we need.
+	 */
+	double digitalGain = 1.0;
+	if (gain > mode_.maxAnalogueGain) {
+		digitalGain = gain / mode_.maxAnalogueGain;
+		gain = mode_.maxAnalogueGain;
 	}
+
+	filtered_.totalExposureNoDG = gain * shutterTime;
+	filtered_.totalExposure = filtered_.totalExposureNoDG * digitalGain;
 	filtered_.shutter = shutterTime;
-	filtered_.analogueGain = analogueGain;
+	filtered_.analogueGain = gain;
+	filtered_.digitalGain = digitalGain;
+	LOG(RPiAgc, Debug) << "DivideUpExposure: " << shutterTime << " ag " << gain
+			   << " dg " << digitalGain;
 }
 
 void AgcChannel::writeAndFinish(Metadata *imageMetadata, bool desaturate)
@@ -980,6 +935,7 @@ void AgcChannel::writeAndFinish(Metadata *imageMetadata, bool desaturate)
 	status_.targetExposureValue = desaturate ? 0s : target_.totalExposure;
 	status_.shutterTime = filtered_.shutter;
 	status_.analogueGain = filtered_.analogueGain;
+	status_.digitalGain = filtered_.digitalGain;
 	/*
 	 * Write to metadata as well, in case anyone wants to update the camera
 	 * immediately.
@@ -987,8 +943,6 @@ void AgcChannel::writeAndFinish(Metadata *imageMetadata, bool desaturate)
 	imageMetadata->set("agc.status", status_);
 	LOG(RPiAgc, Debug) << "Output written, total exposure requested is "
 			   << filtered_.totalExposure;
-	LOG(RPiAgc, Debug) << "Camera exposure update: shutter time " << filtered_.shutter
-			   << " analogue gain " << filtered_.analogueGain;
 }
 
 Duration AgcChannel::limitShutter(Duration shutter)
@@ -1017,6 +971,7 @@ double AgcChannel::limitGain(double gain) const
 	if (!gain)
 		return gain;
 
-	gain = std::max(gain, mode_.minAnalogueGain);
+	gain = std::clamp(gain, mode_.minAnalogueGain,
+			  mode_.maxAnalogueGain * config_.maxDigitalGain);
 	return gain;
 }
diff --git a/src/ipa/rpi/controller/rpi/agc_channel.h b/src/ipa/rpi/controller/rpi/agc_channel.h
index 4cf7233ee..99449e7ba 100644
--- a/src/ipa/rpi/controller/rpi/agc_channel.h
+++ b/src/ipa/rpi/controller/rpi/agc_channel.h
@@ -77,6 +77,7 @@ struct AgcConfig {
 	double defaultAnalogueGain;
 	double stableRegion;
 	bool desaturate;
+	double maxDigitalGain;
 };
 
 class AgcChannel
@@ -91,7 +92,7 @@ class AgcChannel
 	void setFlickerPeriod(libcamera::utils::Duration flickerPeriod);
 	void setMaxShutter(libcamera::utils::Duration maxShutter);
 	void setFixedShutter(libcamera::utils::Duration fixedShutter);
-	void setFixedAnalogueGain(double fixedAnalogueGain);
+	void setFixedGain(double fixedGain);
 	void setMeteringMode(std::string const &meteringModeName);
 	void setExposureMode(std::string const &exposureModeName);
 	void setConstraintMode(std::string const &contraintModeName);
@@ -129,6 +130,7 @@ class AgcChannel
 
 		libcamera::utils::Duration shutter;
 		double analogueGain;
+		double digitalGain;
 		libcamera::utils::Duration totalExposure;
 		libcamera::utils::Duration totalExposureNoDG; /* without digital gain */
 	};
@@ -147,7 +149,7 @@ class AgcChannel
 	libcamera::utils::Duration flickerPeriod_;
 	libcamera::utils::Duration maxShutter_;
 	libcamera::utils::Duration fixedShutter_;
-	double fixedAnalogueGain_;
+	double fixedGain_;
 };
 
 } /* namespace RPiController */
diff --git a/src/ipa/rpi/controller/rpi/awb.cpp b/src/ipa/rpi/controller/rpi/awb.cpp
index 5ae0c2fad..dde5785a0 100644
--- a/src/ipa/rpi/controller/rpi/awb.cpp
+++ b/src/ipa/rpi/controller/rpi/awb.cpp
@@ -220,6 +220,12 @@ void Awb::initialise()
 	asyncResults_ = syncResults_;
 }
 
+void Awb::initialValues(double &gainR, double &gainB)
+{
+	gainR = syncResults_.gainR;
+	gainB = syncResults_.gainB;
+}
+
 void Awb::disableAuto()
 {
 	/* Freeze the most recent values, and treat them as manual gains */
diff --git a/src/ipa/rpi/controller/rpi/awb.h b/src/ipa/rpi/controller/rpi/awb.h
index e7d49cd80..cde6a62f6 100644
--- a/src/ipa/rpi/controller/rpi/awb.h
+++ b/src/ipa/rpi/controller/rpi/awb.h
@@ -95,6 +95,7 @@ class Awb : public AwbAlgorithm
 	void initialise() override;
 	int read(const libcamera::YamlObject &params) override;
 	unsigned int getConvergenceFrames() const override;
+	void initialValues(double &gainR, double &gainB) override;
 	void setMode(std::string const &name) override;
 	void setManualGains(double manualR, double manualB) override;
 	void enableAuto() override;
diff --git a/src/ipa/rpi/controller/rpi/black_level.cpp b/src/ipa/rpi/controller/rpi/black_level.cpp
index 85baec3fc..2e3db51fe 100644
--- a/src/ipa/rpi/controller/rpi/black_level.cpp
+++ b/src/ipa/rpi/controller/rpi/black_level.cpp
@@ -22,7 +22,7 @@ LOG_DEFINE_CATEGORY(RPiBlackLevel)
 #define NAME "rpi.black_level"
 
 BlackLevel::BlackLevel(Controller *controller)
-	: Algorithm(controller)
+	: BlackLevelAlgorithm(controller)
 {
 }
 
@@ -45,6 +45,14 @@ int BlackLevel::read(const libcamera::YamlObject &params)
 	return 0;
 }
 
+void BlackLevel::initialValues(uint16_t &blackLevelR, uint16_t &blackLevelG,
+			       uint16_t &blackLevelB)
+{
+	blackLevelR = blackLevelR_;
+	blackLevelG = blackLevelG_;
+	blackLevelB = blackLevelB_;
+}
+
 void BlackLevel::prepare(Metadata *imageMetadata)
 {
 	/*
diff --git a/src/ipa/rpi/controller/rpi/black_level.h b/src/ipa/rpi/controller/rpi/black_level.h
index 2403f7f77..d8c41c621 100644
--- a/src/ipa/rpi/controller/rpi/black_level.h
+++ b/src/ipa/rpi/controller/rpi/black_level.h
@@ -6,19 +6,21 @@
  */
 #pragma once
 
-#include "../algorithm.h"
+#include "../black_level_algorithm.h"
 #include "../black_level_status.h"
 
 /* This is our implementation of the "black level algorithm". */
 
 namespace RPiController {
 
-class BlackLevel : public Algorithm
+class BlackLevel : public BlackLevelAlgorithm
 {
 public:
 	BlackLevel(Controller *controller);
 	char const *name() const override;
 	int read(const libcamera::YamlObject &params) override;
+	void initialValues(uint16_t &blackLevelR, uint16_t &blackLevelG,
+			   uint16_t &blackLevelB) override;
 	void prepare(Metadata *imageMetadata) override;
 
 private:
diff --git a/src/ipa/rpi/controller/rpi/hdr.cpp b/src/ipa/rpi/controller/rpi/hdr.cpp
index fb580548d..28c2280a0 100644
--- a/src/ipa/rpi/controller/rpi/hdr.cpp
+++ b/src/ipa/rpi/controller/rpi/hdr.cpp
@@ -7,6 +7,8 @@
 
 #include "hdr.h"
 
+#include <cmath>
+
 #include <libcamera/base/log.h>
 
 #include "../agc_status.h"
@@ -39,25 +41,52 @@ void HdrConfig::read(const libcamera::YamlObject &params, const std::string &mod
 		channelMap[v.get<unsigned int>().value()] = k;
 
 	/* Lens shading related parameters. */
-	if (params.contains("spatial_gain")) {
-		spatialGain.read(params["spatial_gain"]);
-		diffusion = params["diffusion"].get<unsigned int>(3);
-		/* Clip to an arbitrary limit just to stop typos from killing the system! */
-		const unsigned int MAX_DIFFUSION = 15;
-		if (diffusion > MAX_DIFFUSION) {
-			diffusion = MAX_DIFFUSION;
-			LOG(RPiHdr, Warning) << "Diffusion value clipped to " << MAX_DIFFUSION;
-		}
+	if (params.contains("spatial_gain_curve")) {
+		spatialGainCurve.read(params["spatial_gain_curve"]);
+	} else if (params.contains("spatial_gain")) {
+		double spatialGain = params["spatial_gain"].get<double>(2.0);
+		spatialGainCurve.append(0.0, spatialGain);
+		spatialGainCurve.append(0.01, spatialGain);
+		spatialGainCurve.append(0.06, 1.0); /* maybe make this programmable? */
+		spatialGainCurve.append(1.0, 1.0);
+	}
+
+	diffusion = params["diffusion"].get<unsigned int>(3);
+	/* Clip to an arbitrary limit just to stop typos from killing the system! */
+	const unsigned int MAX_DIFFUSION = 15;
+	if (diffusion > MAX_DIFFUSION) {
+		diffusion = MAX_DIFFUSION;
+		LOG(RPiHdr, Warning) << "Diffusion value clipped to " << MAX_DIFFUSION;
 	}
 
 	/* Read any tonemap parameters. */
 	tonemapEnable = params["tonemap_enable"].get<int>(0);
-	detailConstant = params["detail_constant"].get<uint16_t>(50);
-	detailSlope = params["detail_slope"].get<double>(8.0);
+	detailConstant = params["detail_constant"].get<uint16_t>(0);
+	detailSlope = params["detail_slope"].get<double>(0.0);
 	iirStrength = params["iir_strength"].get<double>(8.0);
 	strength = params["strength"].get<double>(1.5);
 	if (tonemapEnable)
 		tonemap.read(params["tonemap"]);
+	speed = params["speed"].get<double>(1.0);
+	if (params.contains("hi_quantile_targets")) {
+		hiQuantileTargets = params["hi_quantile_targets"].getList<double>().value();
+		if (hiQuantileTargets.empty() || hiQuantileTargets.size() % 2)
+			LOG(RPiHdr, Fatal) << "hi_quantile_targets much be even and non-empty";
+	} else
+		hiQuantileTargets = { 0.95, 0.65, 0.5, 0.28, 0.3, 0.25 };
+	hiQuantileMaxGain = params["hi_quantile_max_gain"].get<double>(1.6);
+	if (params.contains("quantile_targets")) {
+		quantileTargets = params["quantile_targets"].getList<double>().value();
+		if (quantileTargets.empty() || quantileTargets.size() % 2)
+			LOG(RPiHdr, Fatal) << "quantile_targets much be even and non-empty";
+	} else
+		quantileTargets = { 0.2, 0.03, 1.0, 0.15 };
+	powerMin = params["power_min"].get<double>(0.65);
+	powerMax = params["power_max"].get<double>(1.0);
+	if (params.contains("contrast_adjustments")) {
+		contrastAdjustments = params["contrast_adjustments"].getList<double>().value();
+	} else
+		contrastAdjustments = { 0.5, 0.75 };
 
 	/* Read any stitch parameters. */
 	stitchEnable = params["stitch_enable"].get<int>(0);
@@ -159,7 +188,7 @@ void Hdr::prepare(Metadata *imageMetadata)
 	}
 
 	HdrConfig &config = it->second;
-	if (config.spatialGain.empty())
+	if (config.spatialGainCurve.empty())
 		return;
 
 	AlscStatus alscStatus{}; /* some compilers seem to require the braces */
@@ -205,10 +234,61 @@ bool Hdr::updateTonemap([[maybe_unused]] StatisticsPtr &stats, HdrConfig &config
 		return true;
 
 	/*
-	 * If we wanted to build or adjust tonemaps dynamically, this would be the place
-	 * to do it. But for now we seem to be getting by without.
+	 * Create a tonemap dynamically. We have three ingredients.
+	 *
+	 * 1. We have a list of "hi quantiles" and "targets". We use these to judge if
+	 * the image does seem to be reasonably saturated. If it isn't, we calculate
+	 * a gain that we will feed as a linear factor into the tonemap generation.
+	 * This prevents unsaturated images from beoming quite so "flat".
+	 *
+	 * 2. We have a list of quantile/target pairs for the bottom of the histogram.
+	 * We use these to calculate how much gain we must apply to the bottom of the
+	 * tonemap. We apply this gain as a power curve so as not to blow out the top
+	 * end.
+	 *
+	 * 3. Finally, when we generate the tonemap, we have some contrast adjustments
+	 * for the bottom because we know that power curves can start quite steeply and
+	 * cause a washed-out look.
 	 */
 
+	/* Compute the linear gain from the headroom for saturation at the top. */
+	double gain = 10; /* arbitrary, but hiQuantileMaxGain will clamp it later */
+	for (unsigned int i = 0; i < config.hiQuantileTargets.size(); i += 2) {
+		double quantile = config.hiQuantileTargets[i];
+		double target = config.hiQuantileTargets[i + 1];
+		double value = stats->yHist.interQuantileMean(quantile, 1.0) / 1024.0;
+		double newGain = target / (value + 0.01);
+		gain = std::min(gain, newGain);
+	}
+	gain = std::clamp(gain, 1.0, config.hiQuantileMaxGain);
+
+	/* Compute the power curve from the amount of gain needed at the bottom. */
+	double min_power = 2; /* arbitrary, but config.powerMax will clamp it later */
+	for (unsigned int i = 0; i < config.quantileTargets.size(); i += 2) {
+		double quantile = config.quantileTargets[i];
+		double target = config.quantileTargets[i + 1];
+		double value = stats->yHist.interQuantileMean(0, quantile) / 1024.0;
+		value = std::min(value * gain, 1.0);
+		double power = log(target + 1e-6) / log(value + 1e-6);
+		min_power = std::min(min_power, power);
+	}
+	double power = std::clamp(min_power, config.powerMin, config.powerMax);
+
+	/* Generate the tonemap, including the contrast adjustment factors. */
+	Pwl tonemap;
+	tonemap.append(0, 0);
+	for (unsigned int i = 0; i <= 6; i++) {
+		double x = 1 << (i + 9); /* x loops from 512 to 32768 inclusive */
+		double y = pow(std::min(x * gain, 65535.0) / 65536.0, power) * 65536;
+		if (i < config.contrastAdjustments.size())
+			y *= config.contrastAdjustments[i];
+		if (!tonemap_.empty())
+			y = y * config.speed + tonemap_.eval(x) * (1 - config.speed);
+		tonemap.append(x, y);
+	}
+	tonemap.append(65535, 65535);
+	tonemap_ = tonemap;
+
 	return true;
 }
 
@@ -255,7 +335,7 @@ static void averageGains(std::vector<double> &src, std::vector<double> &dst, con
 
 void Hdr::updateGains(StatisticsPtr &stats, HdrConfig &config)
 {
-	if (config.spatialGain.empty())
+	if (config.spatialGainCurve.empty())
 		return;
 
 	/* When alternating exposures, only compute these gains for the short frame. */
@@ -270,7 +350,7 @@ void Hdr::updateGains(StatisticsPtr &stats, HdrConfig &config)
 		double g = region.val.gSum / counted;
 		double b = region.val.bSum / counted;
 		double brightness = std::max({ r, g, b }) / 65535;
-		gains_[0][i] = config.spatialGain.eval(brightness);
+		gains_[0][i] = config.spatialGainCurve.eval(brightness);
 	}
 
 	/* Ping-pong between the two gains_ buffers. */
diff --git a/src/ipa/rpi/controller/rpi/hdr.h b/src/ipa/rpi/controller/rpi/hdr.h
index 980aa3d18..ac855b223 100644
--- a/src/ipa/rpi/controller/rpi/hdr.h
+++ b/src/ipa/rpi/controller/rpi/hdr.h
@@ -26,7 +26,7 @@ struct HdrConfig {
 	std::map<unsigned int, std::string> channelMap;
 
 	/* Lens shading related parameters. */
-	Pwl spatialGain; /* Brightness to gain curve for different image regions. */
+	Pwl spatialGainCurve; /* Brightness to gain curve for different image regions. */
 	unsigned int diffusion; /* How much to diffuse the gain spatially. */
 
 	/* Tonemap related parameters. */
@@ -36,6 +36,14 @@ struct HdrConfig {
 	double iirStrength;
 	double strength;
 	Pwl tonemap;
+	/* These relate to adaptive tonemap calculation. */
+	double speed;
+	std::vector<double> hiQuantileTargets; /* quantiles to check for unsaturated images */
+	double hiQuantileMaxGain; /* the max gain we'll apply when unsaturated */
+	std::vector<double> quantileTargets; /* target values for histogram quantiles */
+	double powerMin; /* minimum tonemap power */
+	double powerMax; /* maximum tonemap power */
+	std::vector<double> contrastAdjustments; /* any contrast adjustment factors */
 
 	/* Stitch related parameters. */
 	bool stitchEnable;
diff --git a/src/ipa/rpi/pisp/data/imx219.json b/src/ipa/rpi/pisp/data/imx219.json
new file mode 100644
index 000000000..5254e60da
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx219.json
@@ -0,0 +1,1187 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 21965,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 800,
+                "reference_Y": 11460
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 3.661
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 239,
+                "slope": 0.00766
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2860.0, 0.9514, 0.4156,
+                    2960.0, 0.9289, 0.4372,
+                    3603.0, 0.8305, 0.5251,
+                    4650.0, 0.6756, 0.6433,
+                    5858.0, 0.6193, 0.6807,
+                    7580.0, 0.5019, 0.7495
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.03392,
+                "transverse_neg": 0.034
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 10.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 10.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.418, 1.428, 1.446, 1.454, 1.454, 1.451, 1.441, 1.428, 1.411, 1.391, 1.371, 1.349, 1.334, 1.327, 1.325, 1.325, 1.325, 1.325, 1.331, 1.344, 1.363, 1.383, 1.402, 1.418, 1.433, 1.446, 1.452, 1.453, 1.446, 1.435, 1.415, 1.404,
+                            1.428, 1.442, 1.453, 1.455, 1.454, 1.447, 1.431, 1.413, 1.392, 1.371, 1.349, 1.331, 1.318, 1.307, 1.299, 1.299, 1.299, 1.303, 1.313, 1.328, 1.344, 1.363, 1.383, 1.404, 1.424, 1.439, 1.451, 1.453, 1.453, 1.445, 1.431, 1.415,
+                            1.436, 1.448, 1.453, 1.455, 1.449, 1.435, 1.415, 1.393, 1.369, 1.345, 1.322, 1.303, 1.287, 1.276, 1.269, 1.268, 1.268, 1.272, 1.283, 1.298, 1.316, 1.337, 1.362, 1.384, 1.406, 1.427, 1.444, 1.454, 1.454, 1.452, 1.438, 1.426,
+                            1.441, 1.451, 1.454, 1.451, 1.439, 1.422, 1.396, 1.372, 1.345, 1.319, 1.295, 1.274, 1.257, 1.245, 1.239, 1.238, 1.238, 1.245, 1.255, 1.269, 1.289, 1.311, 1.336, 1.362, 1.388, 1.412, 1.433, 1.448, 1.454, 1.453, 1.445, 1.433,
+                            1.445, 1.452, 1.452, 1.445, 1.428, 1.405, 1.379, 1.349, 1.319, 1.295, 1.269, 1.247, 1.229, 1.219, 1.212, 1.211, 1.211, 1.217, 1.228, 1.242, 1.261, 1.286, 1.311, 1.339, 1.367, 1.395, 1.419, 1.439, 1.452, 1.452, 1.451, 1.436,
+                            1.448, 1.451, 1.451, 1.435, 1.414, 1.387, 1.358, 1.327, 1.296, 1.269, 1.245, 1.222, 1.205, 1.193, 1.187, 1.185, 1.186, 1.191, 1.202, 1.217, 1.237, 1.261, 1.286, 1.316, 1.346, 1.378, 1.404, 1.429, 1.445, 1.451, 1.451, 1.442,
+                            1.448, 1.448, 1.445, 1.427, 1.401, 1.371, 1.338, 1.306, 1.274, 1.245, 1.222, 1.199, 1.183, 1.171, 1.164, 1.162, 1.162, 1.168, 1.181, 1.194, 1.215, 1.237, 1.264, 1.294, 1.325, 1.359, 1.389, 1.418, 1.441, 1.449, 1.449, 1.443,
+                            1.449, 1.448, 1.438, 1.415, 1.387, 1.352, 1.318, 1.284, 1.252, 1.223, 1.199, 1.179, 1.161, 1.149, 1.142, 1.142, 1.142, 1.149, 1.159, 1.174, 1.194, 1.215, 1.242, 1.272, 1.307, 1.341, 1.376, 1.405, 1.431, 1.447, 1.447, 1.444,
+                            1.448, 1.447, 1.431, 1.405, 1.373, 1.336, 1.301, 1.264, 1.234, 1.204, 1.179, 1.161, 1.143, 1.131, 1.124, 1.123, 1.123, 1.131, 1.141, 1.156, 1.174, 1.197, 1.224, 1.254, 1.288, 1.324, 1.361, 1.394, 1.423, 1.442, 1.444, 1.444,
+                            1.447, 1.442, 1.424, 1.393, 1.359, 1.322, 1.284, 1.248, 1.216, 1.187, 1.162, 1.143, 1.128, 1.115, 1.109, 1.108, 1.108, 1.113, 1.124, 1.139, 1.156, 1.179, 1.206, 1.236, 1.272, 1.309, 1.347, 1.382, 1.411, 1.435, 1.443, 1.444,
+                            1.444, 1.439, 1.417, 1.383, 1.347, 1.308, 1.271, 1.233, 1.201, 1.173, 1.147, 1.128, 1.115, 1.101, 1.095, 1.093, 1.093, 1.099, 1.111, 1.124, 1.142, 1.165, 1.191, 1.222, 1.258, 1.296, 1.333, 1.372, 1.404, 1.429, 1.441, 1.442,
+                            1.443, 1.434, 1.409, 1.375, 1.336, 1.297, 1.257, 1.221, 1.189, 1.159, 1.136, 1.116, 1.101, 1.092, 1.083, 1.082, 1.082, 1.089, 1.099, 1.111, 1.131, 1.153, 1.181, 1.211, 1.246, 1.284, 1.324, 1.361, 1.398, 1.425, 1.441, 1.441,
+                            1.443, 1.431, 1.405, 1.369, 1.328, 1.287, 1.247, 1.211, 1.178, 1.149, 1.126, 1.107, 1.092, 1.083, 1.075, 1.073, 1.073, 1.082, 1.089, 1.101, 1.121, 1.143, 1.171, 1.201, 1.237, 1.274, 1.314, 1.353, 1.389, 1.421, 1.439, 1.441,
+                            1.442, 1.429, 1.401, 1.364, 1.323, 1.279, 1.241, 1.205, 1.172, 1.144, 1.119, 1.101, 1.085, 1.075, 1.071, 1.067, 1.067, 1.073, 1.082, 1.096, 1.114, 1.136, 1.163, 1.194, 1.229, 1.268, 1.308, 1.348, 1.387, 1.417, 1.439, 1.439,
+                            1.443, 1.429, 1.399, 1.362, 1.319, 1.276, 1.237, 1.199, 1.169, 1.141, 1.115, 1.096, 1.081, 1.071, 1.066, 1.063, 1.066, 1.068, 1.078, 1.092, 1.109, 1.132, 1.159, 1.191, 1.226, 1.263, 1.304, 1.346, 1.384, 1.416, 1.438, 1.439,
+                            1.443, 1.428, 1.399, 1.361, 1.319, 1.276, 1.236, 1.199, 1.167, 1.139, 1.115, 1.096, 1.081, 1.071, 1.064, 1.062, 1.062, 1.067, 1.077, 1.091, 1.109, 1.131, 1.158, 1.189, 1.224, 1.262, 1.303, 1.345, 1.383, 1.416, 1.438, 1.439,
+                            1.444, 1.429, 1.399, 1.361, 1.319, 1.276, 1.236, 1.199, 1.167, 1.139, 1.116, 1.096, 1.081, 1.071, 1.064, 1.063, 1.063, 1.067, 1.077, 1.091, 1.109, 1.131, 1.159, 1.189, 1.224, 1.262, 1.303, 1.345, 1.384, 1.416, 1.438, 1.441,
+                            1.444, 1.431, 1.402, 1.364, 1.322, 1.281, 1.239, 1.202, 1.171, 1.142, 1.118, 1.099, 1.084, 1.073, 1.069, 1.065, 1.067, 1.071, 1.079, 1.094, 1.112, 1.135, 1.163, 1.191, 1.227, 1.265, 1.307, 1.348, 1.386, 1.418, 1.438, 1.441,
+                            1.447, 1.433, 1.406, 1.369, 1.328, 1.286, 1.244, 1.209, 1.177, 1.148, 1.124, 1.105, 1.089, 1.081, 1.073, 1.071, 1.071, 1.079, 1.085, 1.099, 1.118, 1.141, 1.168, 1.198, 1.233, 1.271, 1.312, 1.352, 1.391, 1.422, 1.441, 1.444,
+                            1.448, 1.438, 1.412, 1.376, 1.335, 1.295, 1.255, 1.218, 1.186, 1.157, 1.134, 1.113, 1.098, 1.089, 1.081, 1.079, 1.079, 1.085, 1.094, 1.107, 1.125, 1.149, 1.175, 1.207, 1.242, 1.281, 1.319, 1.359, 1.396, 1.425, 1.445, 1.447,
+                            1.449, 1.443, 1.417, 1.384, 1.345, 1.305, 1.266, 1.229, 1.197, 1.169, 1.145, 1.124, 1.111, 1.098, 1.091, 1.089, 1.089, 1.094, 1.107, 1.118, 1.137, 1.159, 1.187, 1.218, 1.253, 1.291, 1.329, 1.369, 1.405, 1.433, 1.447, 1.449,
+                            1.453, 1.449, 1.425, 1.395, 1.358, 1.318, 1.281, 1.244, 1.211, 1.183, 1.158, 1.138, 1.124, 1.111, 1.104, 1.103, 1.103, 1.107, 1.118, 1.133, 1.151, 1.174, 1.201, 1.232, 1.267, 1.304, 1.344, 1.379, 1.413, 1.437, 1.449, 1.449,
+                            1.457, 1.453, 1.434, 1.405, 1.371, 1.335, 1.297, 1.261, 1.229, 1.199, 1.174, 1.155, 1.138, 1.126, 1.119, 1.117, 1.117, 1.124, 1.133, 1.149, 1.167, 1.189, 1.217, 1.248, 1.284, 1.319, 1.357, 1.393, 1.423, 1.444, 1.452, 1.452,
+                            1.459, 1.457, 1.443, 1.418, 1.385, 1.352, 1.314, 1.279, 1.246, 1.218, 1.193, 1.174, 1.155, 1.144, 1.137, 1.136, 1.136, 1.141, 1.151, 1.167, 1.187, 1.208, 1.236, 1.267, 1.301, 1.337, 1.373, 1.405, 1.434, 1.453, 1.455, 1.455,
+                            1.461, 1.461, 1.454, 1.429, 1.401, 1.369, 1.333, 1.301, 1.269, 1.239, 1.216, 1.193, 1.177, 1.165, 1.158, 1.156, 1.156, 1.161, 1.171, 1.187, 1.208, 1.229, 1.258, 1.288, 1.321, 1.356, 1.389, 1.419, 1.445, 1.459, 1.459, 1.455,
+                            1.462, 1.462, 1.459, 1.442, 1.418, 1.386, 1.354, 1.322, 1.292, 1.262, 1.239, 1.216, 1.199, 1.187, 1.179, 1.178, 1.178, 1.184, 1.194, 1.208, 1.229, 1.253, 1.279, 1.309, 1.342, 1.375, 1.406, 1.433, 1.452, 1.464, 1.464, 1.454,
+                            1.461, 1.465, 1.465, 1.454, 1.431, 1.405, 1.376, 1.346, 1.316, 1.288, 1.262, 1.242, 1.223, 1.212, 1.205, 1.203, 1.203, 1.208, 1.218, 1.234, 1.253, 1.279, 1.305, 1.334, 1.363, 1.393, 1.421, 1.445, 1.461, 1.465, 1.464, 1.452,
+                            1.459, 1.465, 1.466, 1.461, 1.443, 1.421, 1.395, 1.368, 1.341, 1.316, 1.288, 1.268, 1.251, 1.238, 1.232, 1.229, 1.229, 1.235, 1.246, 1.261, 1.279, 1.305, 1.331, 1.356, 1.385, 1.411, 1.435, 1.454, 1.466, 1.466, 1.464, 1.451,
+                            1.454, 1.465, 1.467, 1.466, 1.456, 1.436, 1.414, 1.389, 1.367, 1.341, 1.318, 1.297, 1.279, 1.269, 1.261, 1.259, 1.259, 1.265, 1.274, 1.288, 1.308, 1.331, 1.355, 1.381, 1.404, 1.428, 1.447, 1.462, 1.468, 1.467, 1.457, 1.445,
+                            1.447, 1.459, 1.466, 1.467, 1.463, 1.451, 1.434, 1.411, 1.389, 1.367, 1.344, 1.325, 1.311, 1.297, 1.292, 1.289, 1.289, 1.295, 1.303, 1.317, 1.336, 1.356, 1.381, 1.402, 1.423, 1.441, 1.457, 1.467, 1.468, 1.463, 1.451, 1.439,
+                            1.438, 1.449, 1.462, 1.464, 1.464, 1.459, 1.446, 1.429, 1.408, 1.388, 1.369, 1.353, 1.339, 1.329, 1.321, 1.321, 1.321, 1.325, 1.333, 1.348, 1.362, 1.379, 1.401, 1.421, 1.439, 1.454, 1.463, 1.465, 1.465, 1.456, 1.442, 1.427,
+                            1.429, 1.439, 1.454, 1.464, 1.464, 1.459, 1.449, 1.435, 1.421, 1.402, 1.385, 1.369, 1.353, 1.341, 1.338, 1.337, 1.337, 1.338, 1.348, 1.362, 1.378, 1.395, 1.411, 1.429, 1.445, 1.455, 1.463, 1.464, 1.457, 1.447, 1.427, 1.419
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            2.163, 2.177, 2.194, 2.196, 2.197, 2.192, 2.181, 2.161, 2.139, 2.113, 2.088, 2.063, 2.047, 2.041, 2.036, 2.036, 2.036, 2.037, 2.046, 2.059, 2.083, 2.113, 2.135, 2.158, 2.181, 2.193, 2.205, 2.205, 2.202, 2.189, 2.171, 2.158,
+                            2.169, 2.184, 2.195, 2.196, 2.194, 2.182, 2.163, 2.141, 2.116, 2.088, 2.063, 2.042, 2.025, 2.013, 2.004, 2.004, 2.006, 2.011, 2.022, 2.038, 2.059, 2.083, 2.113, 2.137, 2.162, 2.182, 2.197, 2.204, 2.203, 2.199, 2.183, 2.171,
+                            2.177, 2.187, 2.193, 2.193, 2.184, 2.166, 2.142, 2.116, 2.087, 2.057, 2.033, 2.008, 1.991, 1.977, 1.969, 1.969, 1.969, 1.975, 1.988, 2.006, 2.028, 2.055, 2.083, 2.114, 2.139, 2.166, 2.187, 2.199, 2.202, 2.201, 2.189, 2.179,
+                            2.183, 2.189, 2.192, 2.186, 2.172, 2.146, 2.119, 2.089, 2.058, 2.026, 2.001, 1.975, 1.956, 1.942, 1.934, 1.932, 1.933, 1.941, 1.955, 1.971, 1.995, 2.023, 2.055, 2.084, 2.119, 2.146, 2.171, 2.191, 2.201, 2.201, 2.194, 2.183,
+                            2.186, 2.189, 2.189, 2.177, 2.158, 2.127, 2.096, 2.059, 2.026, 1.998, 1.969, 1.944, 1.925, 1.911, 1.901, 1.901, 1.903, 1.912, 1.924, 1.941, 1.964, 1.995, 2.023, 2.058, 2.091, 2.126, 2.155, 2.181, 2.195, 2.199, 2.198, 2.188,
+                            2.189, 2.189, 2.184, 2.166, 2.138, 2.108, 2.071, 2.036, 1.999, 1.969, 1.941, 1.914, 1.894, 1.879, 1.871, 1.871, 1.872, 1.879, 1.893, 1.913, 1.937, 1.964, 1.997, 2.029, 2.065, 2.104, 2.137, 2.169, 2.187, 2.199, 2.199, 2.189,
+                            2.187, 2.186, 2.176, 2.154, 2.123, 2.087, 2.044, 2.011, 1.974, 1.941, 1.913, 1.887, 1.868, 1.852, 1.844, 1.843, 1.844, 1.852, 1.866, 1.885, 1.912, 1.937, 1.972, 2.004, 2.042, 2.081, 2.119, 2.154, 2.179, 2.195, 2.196, 2.193,
+                            2.187, 2.181, 2.167, 2.141, 2.103, 2.062, 2.023, 1.984, 1.947, 1.916, 1.887, 1.864, 1.841, 1.828, 1.821, 1.819, 1.819, 1.828, 1.842, 1.862, 1.885, 1.913, 1.945, 1.982, 2.021, 2.058, 2.102, 2.137, 2.168, 2.192, 2.193, 2.193,
+                            2.182, 2.181, 2.161, 2.127, 2.083, 2.044, 2.002, 1.961, 1.924, 1.891, 1.864, 1.841, 1.819, 1.806, 1.797, 1.797, 1.797, 1.805, 1.819, 1.841, 1.862, 1.892, 1.924, 1.959, 1.999, 2.041, 2.082, 2.123, 2.161, 2.185, 2.191, 2.192,
+                            2.182, 2.172, 2.149, 2.112, 2.069, 2.026, 1.982, 1.941, 1.904, 1.871, 1.841, 1.819, 1.799, 1.785, 1.776, 1.776, 1.778, 1.784, 1.798, 1.819, 1.841, 1.869, 1.903, 1.939, 1.977, 2.021, 2.067, 2.108, 2.145, 2.174, 2.189, 2.191,
+                            2.181, 2.167, 2.139, 2.098, 2.056, 2.006, 1.965, 1.921, 1.883, 1.851, 1.823, 1.799, 1.783, 1.767, 1.759, 1.758, 1.758, 1.767, 1.783, 1.798, 1.825, 1.851, 1.883, 1.919, 1.959, 2.004, 2.049, 2.094, 2.136, 2.167, 2.187, 2.189,
+                            2.179, 2.163, 2.131, 2.087, 2.041, 1.994, 1.948, 1.907, 1.871, 1.835, 1.806, 1.784, 1.767, 1.754, 1.744, 1.742, 1.742, 1.752, 1.767, 1.783, 1.808, 1.838, 1.869, 1.905, 1.945, 1.989, 2.036, 2.083, 2.128, 2.159, 2.183, 2.187,
+                            2.178, 2.161, 2.126, 2.082, 2.032, 1.982, 1.936, 1.896, 1.857, 1.823, 1.795, 1.772, 1.754, 1.744, 1.732, 1.731, 1.732, 1.742, 1.752, 1.771, 1.796, 1.824, 1.857, 1.895, 1.934, 1.977, 2.024, 2.071, 2.116, 2.154, 2.181, 2.185,
+                            2.177, 2.157, 2.121, 2.074, 2.025, 1.973, 1.927, 1.886, 1.849, 1.815, 1.787, 1.765, 1.746, 1.732, 1.725, 1.722, 1.724, 1.732, 1.743, 1.762, 1.786, 1.813, 1.848, 1.886, 1.924, 1.969, 2.017, 2.066, 2.111, 2.153, 2.179, 2.183,
+                            2.177, 2.155, 2.119, 2.072, 2.022, 1.969, 1.925, 1.881, 1.844, 1.811, 1.782, 1.758, 1.739, 1.725, 1.721, 1.717, 1.721, 1.724, 1.739, 1.757, 1.781, 1.809, 1.842, 1.879, 1.921, 1.965, 2.012, 2.062, 2.108, 2.151, 2.179, 2.182,
+                            2.177, 2.156, 2.121, 2.071, 2.021, 1.968, 1.922, 1.879, 1.842, 1.811, 1.781, 1.757, 1.739, 1.725, 1.717, 1.715, 1.715, 1.723, 1.737, 1.757, 1.779, 1.808, 1.841, 1.877, 1.918, 1.963, 2.011, 2.061, 2.107, 2.148, 2.179, 2.183,
+                            2.178, 2.157, 2.121, 2.072, 2.021, 1.969, 1.922, 1.881, 1.842, 1.811, 1.781, 1.758, 1.739, 1.726, 1.718, 1.717, 1.718, 1.723, 1.737, 1.757, 1.781, 1.809, 1.841, 1.877, 1.918, 1.964, 2.012, 2.061, 2.108, 2.149, 2.179, 2.183,
+                            2.178, 2.159, 2.124, 2.074, 2.024, 1.974, 1.926, 1.885, 1.847, 1.813, 1.784, 1.762, 1.743, 1.731, 1.725, 1.719, 1.723, 1.728, 1.742, 1.762, 1.785, 1.814, 1.847, 1.881, 1.922, 1.966, 2.017, 2.065, 2.109, 2.151, 2.181, 2.184,
+                            2.181, 2.163, 2.129, 2.082, 2.032, 1.982, 1.934, 1.891, 1.854, 1.822, 1.794, 1.769, 1.751, 1.739, 1.731, 1.727, 1.728, 1.739, 1.747, 1.768, 1.791, 1.821, 1.852, 1.889, 1.929, 1.972, 2.022, 2.071, 2.117, 2.155, 2.182, 2.189,
+                            2.184, 2.169, 2.135, 2.091, 2.041, 1.994, 1.947, 1.902, 1.865, 1.833, 1.805, 1.779, 1.762, 1.751, 1.739, 1.739, 1.739, 1.747, 1.761, 1.779, 1.803, 1.831, 1.864, 1.898, 1.941, 1.984, 2.033, 2.079, 2.123, 2.163, 2.188, 2.193,
+                            2.185, 2.174, 2.142, 2.099, 2.054, 2.004, 1.959, 1.917, 1.879, 1.846, 1.819, 1.794, 1.779, 1.762, 1.754, 1.753, 1.753, 1.761, 1.777, 1.793, 1.816, 1.843, 1.877, 1.913, 1.953, 1.995, 2.043, 2.091, 2.135, 2.169, 2.191, 2.196,
+                            2.191, 2.179, 2.154, 2.118, 2.069, 2.023, 1.977, 1.935, 1.898, 1.865, 1.834, 1.813, 1.794, 1.779, 1.769, 1.769, 1.769, 1.777, 1.793, 1.809, 1.834, 1.863, 1.895, 1.929, 1.972, 2.015, 2.061, 2.105, 2.145, 2.178, 2.195, 2.199,
+                            2.197, 2.188, 2.166, 2.129, 2.087, 2.041, 1.997, 1.956, 1.918, 1.884, 1.855, 1.834, 1.813, 1.798, 1.788, 1.788, 1.788, 1.796, 1.809, 1.832, 1.853, 1.881, 1.912, 1.949, 1.991, 2.033, 2.076, 2.119, 2.159, 2.187, 2.202, 2.205,
+                            2.202, 2.197, 2.176, 2.148, 2.106, 2.065, 2.021, 1.979, 1.943, 1.909, 1.879, 1.855, 1.835, 1.819, 1.811, 1.811, 1.811, 1.818, 1.832, 1.853, 1.875, 1.904, 1.937, 1.972, 2.013, 2.055, 2.097, 2.138, 2.175, 2.197, 2.206, 2.207,
+                            2.205, 2.202, 2.189, 2.162, 2.126, 2.084, 2.044, 2.004, 1.967, 1.935, 1.907, 1.879, 1.861, 1.845, 1.838, 1.835, 1.835, 1.844, 1.855, 1.875, 1.902, 1.928, 1.961, 1.998, 2.033, 2.076, 2.118, 2.155, 2.186, 2.205, 2.208, 2.208,
+                            2.207, 2.205, 2.195, 2.175, 2.145, 2.108, 2.069, 2.029, 1.996, 1.963, 1.934, 1.908, 1.885, 1.872, 1.864, 1.863, 1.863, 1.869, 1.884, 1.902, 1.928, 1.956, 1.989, 2.023, 2.059, 2.099, 2.137, 2.172, 2.199, 2.212, 2.213, 2.209,
+                            2.207, 2.207, 2.203, 2.188, 2.162, 2.128, 2.094, 2.058, 2.023, 1.993, 1.963, 1.936, 1.916, 1.899, 1.893, 1.892, 1.893, 1.899, 1.912, 1.929, 1.956, 1.986, 2.016, 2.049, 2.084, 2.121, 2.156, 2.187, 2.208, 2.215, 2.215, 2.208,
+                            2.205, 2.208, 2.209, 2.199, 2.178, 2.149, 2.117, 2.083, 2.052, 2.023, 1.993, 1.967, 1.947, 1.933, 1.925, 1.922, 1.922, 1.929, 1.943, 1.961, 1.986, 2.015, 2.045, 2.076, 2.109, 2.143, 2.173, 2.198, 2.214, 2.218, 2.216, 2.205,
+                            2.201, 2.207, 2.211, 2.211, 2.193, 2.168, 2.141, 2.112, 2.082, 2.052, 2.025, 2.001, 1.981, 1.967, 1.959, 1.958, 1.958, 1.967, 1.975, 1.992, 2.018, 2.046, 2.076, 2.105, 2.136, 2.163, 2.189, 2.208, 2.217, 2.217, 2.212, 2.203,
+                            2.194, 2.204, 2.212, 2.213, 2.203, 2.187, 2.165, 2.139, 2.112, 2.083, 2.055, 2.034, 2.016, 2.001, 1.993, 1.993, 1.994, 1.999, 2.011, 2.027, 2.051, 2.077, 2.105, 2.133, 2.158, 2.181, 2.202, 2.217, 2.218, 2.218, 2.206, 2.193,
+                            2.185, 2.198, 2.213, 2.214, 2.212, 2.201, 2.184, 2.163, 2.135, 2.111, 2.089, 2.071, 2.052, 2.039, 2.032, 2.031, 2.031, 2.036, 2.048, 2.065, 2.085, 2.106, 2.131, 2.155, 2.178, 2.198, 2.212, 2.219, 2.219, 2.215, 2.201, 2.185,
+                            2.176, 2.191, 2.208, 2.217, 2.216, 2.205, 2.195, 2.177, 2.156, 2.133, 2.109, 2.089, 2.071, 2.055, 2.053, 2.053, 2.053, 2.057, 2.065, 2.085, 2.105, 2.123, 2.149, 2.171, 2.192, 2.205, 2.217, 2.219, 2.219, 2.202, 2.185, 2.181
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.518, 2.513, 2.503, 2.496, 2.488, 2.484, 2.485, 2.485, 2.486, 2.487, 2.487, 2.489, 2.494, 2.496, 2.496, 2.497, 2.499, 2.499, 2.496, 2.495, 2.492, 2.491, 2.491, 2.491, 2.492, 2.493, 2.495, 2.501, 2.508, 2.516, 2.528, 2.533,
+                            2.515, 2.508, 2.495, 2.487, 2.483, 2.481, 2.482, 2.483, 2.485, 2.487, 2.489, 2.491, 2.495, 2.497, 2.498, 2.501, 2.502, 2.502, 2.499, 2.496, 2.494, 2.491, 2.491, 2.489, 2.489, 2.491, 2.493, 2.496, 2.502, 2.511, 2.521, 2.531,
+                            2.507, 2.495, 2.486, 2.482, 2.478, 2.477, 2.481, 2.482, 2.484, 2.488, 2.491, 2.495, 2.499, 2.502, 2.506, 2.508, 2.509, 2.508, 2.505, 2.501, 2.497, 2.493, 2.491, 2.489, 2.488, 2.489, 2.489, 2.492, 2.496, 2.501, 2.511, 2.524,
+                            2.501, 2.487, 2.482, 2.481, 2.478, 2.477, 2.481, 2.483, 2.487, 2.491, 2.501, 2.503, 2.509, 2.511, 2.518, 2.519, 2.519, 2.519, 2.516, 2.509, 2.504, 2.498, 2.495, 2.493, 2.489, 2.489, 2.488, 2.489, 2.492, 2.498, 2.505, 2.523,
+                            2.499, 2.484, 2.481, 2.476, 2.476, 2.476, 2.481, 2.485, 2.492, 2.501, 2.509, 2.514, 2.519, 2.524, 2.528, 2.531, 2.533, 2.533, 2.525, 2.519, 2.514, 2.507, 2.501, 2.497, 2.493, 2.489, 2.489, 2.488, 2.491, 2.494, 2.501, 2.514,
+                            2.497, 2.483, 2.478, 2.476, 2.476, 2.478, 2.482, 2.491, 2.499, 2.509, 2.515, 2.522, 2.528, 2.535, 2.539, 2.541, 2.543, 2.542, 2.539, 2.529, 2.522, 2.516, 2.507, 2.502, 2.497, 2.491, 2.489, 2.488, 2.489, 2.492, 2.498, 2.514,
+                            2.492, 2.479, 2.476, 2.475, 2.476, 2.481, 2.488, 2.496, 2.505, 2.516, 2.524, 2.532, 2.541, 2.545, 2.552, 2.554, 2.554, 2.554, 2.548, 2.541, 2.532, 2.522, 2.516, 2.507, 2.502, 2.494, 2.491, 2.489, 2.489, 2.492, 2.494, 2.511,
+                            2.491, 2.479, 2.476, 2.477, 2.478, 2.482, 2.491, 2.502, 2.514, 2.524, 2.533, 2.543, 2.548, 2.555, 2.562, 2.566, 2.567, 2.562, 2.557, 2.551, 2.541, 2.531, 2.523, 2.512, 2.506, 2.498, 2.493, 2.491, 2.491, 2.491, 2.493, 2.507,
+                            2.489, 2.478, 2.476, 2.477, 2.481, 2.485, 2.494, 2.507, 2.517, 2.529, 2.542, 2.548, 2.557, 2.563, 2.567, 2.571, 2.572, 2.571, 2.565, 2.558, 2.549, 2.538, 2.528, 2.521, 2.509, 2.501, 2.494, 2.492, 2.491, 2.491, 2.491, 2.505,
+                            2.488, 2.478, 2.477, 2.478, 2.482, 2.489, 2.499, 2.509, 2.523, 2.538, 2.548, 2.556, 2.563, 2.568, 2.573, 2.577, 2.578, 2.577, 2.573, 2.564, 2.555, 2.543, 2.535, 2.524, 2.515, 2.504, 2.495, 2.492, 2.489, 2.488, 2.489, 2.501,
+                            2.486, 2.476, 2.475, 2.477, 2.483, 2.491, 2.503, 2.515, 2.529, 2.542, 2.553, 2.562, 2.568, 2.574, 2.581, 2.583, 2.584, 2.581, 2.578, 2.571, 2.562, 2.551, 2.539, 2.531, 2.517, 2.508, 2.497, 2.492, 2.488, 2.487, 2.489, 2.498,
+                            2.486, 2.476, 2.475, 2.479, 2.484, 2.492, 2.504, 2.519, 2.533, 2.544, 2.557, 2.566, 2.573, 2.581, 2.584, 2.588, 2.588, 2.586, 2.581, 2.575, 2.567, 2.555, 2.546, 2.534, 2.517, 2.509, 2.499, 2.492, 2.489, 2.485, 2.488, 2.497,
+                            2.487, 2.476, 2.476, 2.479, 2.486, 2.494, 2.506, 2.521, 2.535, 2.549, 2.559, 2.571, 2.578, 2.583, 2.589, 2.591, 2.591, 2.591, 2.587, 2.579, 2.571, 2.559, 2.551, 2.538, 2.523, 2.513, 2.503, 2.493, 2.489, 2.486, 2.487, 2.499,
+                            2.486, 2.475, 2.475, 2.479, 2.486, 2.495, 2.509, 2.525, 2.541, 2.555, 2.563, 2.573, 2.582, 2.588, 2.591, 2.594, 2.595, 2.592, 2.591, 2.585, 2.574, 2.564, 2.552, 2.541, 2.525, 2.514, 2.503, 2.493, 2.489, 2.486, 2.486, 2.501,
+                            2.486, 2.475, 2.475, 2.479, 2.488, 2.497, 2.509, 2.526, 2.542, 2.556, 2.564, 2.575, 2.584, 2.591, 2.595, 2.596, 2.597, 2.595, 2.592, 2.587, 2.577, 2.568, 2.554, 2.542, 2.527, 2.515, 2.504, 2.494, 2.491, 2.487, 2.487, 2.505,
+                            2.484, 2.476, 2.475, 2.478, 2.488, 2.498, 2.509, 2.526, 2.542, 2.555, 2.565, 2.576, 2.584, 2.589, 2.595, 2.598, 2.598, 2.597, 2.593, 2.587, 2.578, 2.569, 2.556, 2.543, 2.528, 2.515, 2.504, 2.494, 2.489, 2.485, 2.485, 2.501,
+                            2.484, 2.475, 2.475, 2.478, 2.489, 2.498, 2.509, 2.524, 2.539, 2.553, 2.565, 2.576, 2.584, 2.589, 2.594, 2.597, 2.597, 2.596, 2.593, 2.587, 2.577, 2.569, 2.555, 2.543, 2.529, 2.515, 2.503, 2.496, 2.491, 2.485, 2.486, 2.497,
+                            2.484, 2.474, 2.474, 2.479, 2.487, 2.497, 2.509, 2.523, 2.539, 2.551, 2.563, 2.574, 2.581, 2.587, 2.592, 2.595, 2.596, 2.595, 2.591, 2.584, 2.574, 2.567, 2.554, 2.541, 2.526, 2.514, 2.503, 2.495, 2.489, 2.485, 2.486, 2.497,
+                            2.484, 2.475, 2.475, 2.478, 2.485, 2.494, 2.507, 2.522, 2.535, 2.546, 2.559, 2.568, 2.579, 2.584, 2.589, 2.592, 2.593, 2.592, 2.588, 2.579, 2.571, 2.562, 2.551, 2.537, 2.524, 2.514, 2.501, 2.493, 2.489, 2.486, 2.487, 2.498,
+                            2.485, 2.476, 2.475, 2.477, 2.485, 2.491, 2.506, 2.519, 2.531, 2.544, 2.555, 2.563, 2.571, 2.581, 2.584, 2.589, 2.589, 2.588, 2.583, 2.576, 2.566, 2.555, 2.546, 2.534, 2.522, 2.511, 2.499, 2.491, 2.488, 2.486, 2.487, 2.502,
+                            2.487, 2.477, 2.475, 2.477, 2.483, 2.489, 2.503, 2.515, 2.525, 2.541, 2.551, 2.559, 2.567, 2.573, 2.579, 2.582, 2.583, 2.582, 2.576, 2.569, 2.562, 2.549, 2.542, 2.527, 2.518, 2.505, 2.497, 2.491, 2.489, 2.487, 2.487, 2.502,
+                            2.487, 2.478, 2.475, 2.477, 2.482, 2.489, 2.497, 2.512, 2.522, 2.536, 2.544, 2.551, 2.562, 2.566, 2.573, 2.578, 2.578, 2.575, 2.571, 2.564, 2.556, 2.548, 2.536, 2.523, 2.513, 2.503, 2.493, 2.489, 2.487, 2.486, 2.487, 2.502,
+                            2.488, 2.479, 2.477, 2.478, 2.482, 2.488, 2.496, 2.505, 2.516, 2.528, 2.538, 2.547, 2.553, 2.561, 2.565, 2.569, 2.569, 2.568, 2.564, 2.558, 2.549, 2.541, 2.531, 2.517, 2.509, 2.499, 2.492, 2.488, 2.486, 2.484, 2.486, 2.503,
+                            2.492, 2.482, 2.479, 2.479, 2.482, 2.487, 2.491, 2.501, 2.512, 2.523, 2.531, 2.541, 2.549, 2.552, 2.558, 2.561, 2.562, 2.559, 2.558, 2.552, 2.542, 2.535, 2.525, 2.514, 2.505, 2.497, 2.491, 2.486, 2.485, 2.484, 2.487, 2.503,
+                            2.495, 2.483, 2.479, 2.479, 2.482, 2.487, 2.491, 2.498, 2.508, 2.515, 2.526, 2.533, 2.541, 2.547, 2.551, 2.554, 2.555, 2.554, 2.552, 2.541, 2.537, 2.527, 2.519, 2.507, 2.502, 2.495, 2.488, 2.485, 2.484, 2.485, 2.488, 2.503,
+                            2.499, 2.485, 2.483, 2.481, 2.482, 2.486, 2.489, 2.494, 2.504, 2.511, 2.519, 2.527, 2.531, 2.539, 2.542, 2.546, 2.546, 2.545, 2.539, 2.535, 2.527, 2.522, 2.509, 2.505, 2.497, 2.491, 2.486, 2.485, 2.485, 2.487, 2.491, 2.506,
+                            2.499, 2.489, 2.483, 2.481, 2.481, 2.483, 2.488, 2.491, 2.499, 2.506, 2.512, 2.519, 2.524, 2.529, 2.535, 2.537, 2.536, 2.534, 2.532, 2.525, 2.522, 2.514, 2.506, 2.499, 2.492, 2.489, 2.485, 2.484, 2.485, 2.488, 2.492, 2.506,
+                            2.507, 2.494, 2.486, 2.483, 2.482, 2.482, 2.486, 2.488, 2.495, 2.501, 2.507, 2.511, 2.517, 2.519, 2.523, 2.525, 2.525, 2.523, 2.523, 2.521, 2.514, 2.506, 2.502, 2.496, 2.491, 2.488, 2.485, 2.485, 2.487, 2.489, 2.496, 2.516,
+                            2.511, 2.503, 2.489, 2.486, 2.485, 2.485, 2.485, 2.487, 2.489, 2.495, 2.501, 2.505, 2.509, 2.514, 2.517, 2.519, 2.518, 2.517, 2.515, 2.511, 2.505, 2.501, 2.495, 2.492, 2.488, 2.486, 2.485, 2.486, 2.488, 2.492, 2.499, 2.519,
+                            2.517, 2.505, 2.494, 2.489, 2.487, 2.486, 2.486, 2.486, 2.489, 2.491, 2.496, 2.499, 2.503, 2.506, 2.508, 2.509, 2.511, 2.509, 2.507, 2.503, 2.501, 2.496, 2.493, 2.489, 2.485, 2.485, 2.486, 2.487, 2.491, 2.495, 2.505, 2.526,
+                            2.526, 2.516, 2.504, 2.494, 2.493, 2.489, 2.489, 2.489, 2.489, 2.491, 2.496, 2.498, 2.501, 2.504, 2.506, 2.506, 2.506, 2.505, 2.503, 2.501, 2.499, 2.496, 2.494, 2.491, 2.487, 2.486, 2.489, 2.492, 2.497, 2.505, 2.517, 2.528,
+                            2.529, 2.526, 2.508, 2.502, 2.501, 2.498, 2.495, 2.495, 2.495, 2.495, 2.497, 2.499, 2.501, 2.503, 2.504, 2.506, 2.505, 2.505, 2.503, 2.501, 2.499, 2.496, 2.495, 2.494, 2.492, 2.494, 2.494, 2.498, 2.504, 2.513, 2.525, 2.536
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.427, 1.425, 1.423, 1.422, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.422, 1.423, 1.424, 1.425, 1.426, 1.426, 1.426, 1.425, 1.425, 1.424, 1.422, 1.421, 1.421, 1.421, 1.421, 1.422, 1.422, 1.422, 1.424, 1.424, 1.426, 1.428,
+                            1.426, 1.424, 1.422, 1.421, 1.419, 1.419, 1.419, 1.421, 1.421, 1.422, 1.423, 1.424, 1.425, 1.426, 1.427, 1.427, 1.427, 1.426, 1.425, 1.424, 1.422, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.422, 1.424, 1.427,
+                            1.423, 1.421, 1.421, 1.419, 1.419, 1.418, 1.419, 1.419, 1.421, 1.423, 1.425, 1.426, 1.428, 1.429, 1.431, 1.431, 1.431, 1.431, 1.429, 1.426, 1.424, 1.422, 1.421, 1.421, 1.421, 1.419, 1.419, 1.419, 1.421, 1.421, 1.422, 1.425,
+                            1.422, 1.419, 1.419, 1.419, 1.418, 1.418, 1.419, 1.421, 1.422, 1.426, 1.428, 1.429, 1.433, 1.434, 1.436, 1.436, 1.436, 1.434, 1.432, 1.429, 1.426, 1.424, 1.423, 1.422, 1.421, 1.419, 1.419, 1.419, 1.419, 1.419, 1.421, 1.425,
+                            1.422, 1.419, 1.419, 1.418, 1.418, 1.419, 1.419, 1.422, 1.425, 1.429, 1.432, 1.435, 1.436, 1.438, 1.439, 1.439, 1.441, 1.439, 1.435, 1.433, 1.429, 1.427, 1.425, 1.423, 1.422, 1.419, 1.419, 1.418, 1.418, 1.418, 1.419, 1.425,
+                            1.422, 1.419, 1.418, 1.418, 1.418, 1.419, 1.421, 1.424, 1.428, 1.432, 1.436, 1.437, 1.439, 1.442, 1.443, 1.445, 1.444, 1.443, 1.441, 1.436, 1.434, 1.431, 1.427, 1.425, 1.422, 1.421, 1.419, 1.418, 1.418, 1.418, 1.419, 1.424,
+                            1.422, 1.418, 1.417, 1.418, 1.419, 1.421, 1.423, 1.427, 1.431, 1.436, 1.438, 1.442, 1.444, 1.446, 1.448, 1.449, 1.448, 1.446, 1.445, 1.441, 1.436, 1.434, 1.429, 1.427, 1.423, 1.421, 1.419, 1.418, 1.418, 1.418, 1.418, 1.423,
+                            1.421, 1.418, 1.418, 1.418, 1.419, 1.421, 1.424, 1.429, 1.434, 1.438, 1.442, 1.445, 1.447, 1.449, 1.451, 1.452, 1.452, 1.449, 1.447, 1.445, 1.441, 1.436, 1.433, 1.429, 1.425, 1.422, 1.419, 1.419, 1.418, 1.417, 1.418, 1.423,
+                            1.421, 1.418, 1.418, 1.419, 1.419, 1.423, 1.426, 1.432, 1.436, 1.441, 1.445, 1.448, 1.449, 1.452, 1.453, 1.454, 1.454, 1.453, 1.451, 1.447, 1.444, 1.439, 1.433, 1.431, 1.427, 1.422, 1.421, 1.419, 1.418, 1.417, 1.418, 1.423,
+                            1.421, 1.418, 1.418, 1.419, 1.421, 1.423, 1.428, 1.433, 1.439, 1.443, 1.448, 1.449, 1.453, 1.454, 1.455, 1.456, 1.456, 1.454, 1.453, 1.449, 1.446, 1.441, 1.437, 1.433, 1.429, 1.423, 1.421, 1.419, 1.418, 1.416, 1.417, 1.423,
+                            1.421, 1.417, 1.417, 1.419, 1.422, 1.424, 1.429, 1.435, 1.441, 1.444, 1.449, 1.453, 1.454, 1.456, 1.458, 1.459, 1.458, 1.456, 1.454, 1.451, 1.448, 1.442, 1.439, 1.435, 1.429, 1.426, 1.421, 1.419, 1.418, 1.416, 1.417, 1.422,
+                            1.419, 1.418, 1.417, 1.419, 1.422, 1.425, 1.429, 1.436, 1.442, 1.446, 1.451, 1.454, 1.456, 1.458, 1.461, 1.461, 1.461, 1.459, 1.456, 1.453, 1.451, 1.446, 1.441, 1.436, 1.431, 1.427, 1.422, 1.419, 1.418, 1.416, 1.417, 1.422,
+                            1.419, 1.418, 1.418, 1.421, 1.423, 1.426, 1.431, 1.437, 1.444, 1.449, 1.452, 1.456, 1.458, 1.461, 1.462, 1.463, 1.463, 1.461, 1.458, 1.454, 1.452, 1.447, 1.443, 1.438, 1.432, 1.428, 1.423, 1.421, 1.419, 1.417, 1.417, 1.421,
+                            1.419, 1.418, 1.417, 1.421, 1.423, 1.428, 1.432, 1.439, 1.445, 1.451, 1.453, 1.457, 1.459, 1.462, 1.464, 1.465, 1.465, 1.463, 1.461, 1.457, 1.453, 1.449, 1.444, 1.441, 1.432, 1.429, 1.425, 1.421, 1.419, 1.417, 1.418, 1.422,
+                            1.418, 1.417, 1.417, 1.419, 1.423, 1.428, 1.433, 1.439, 1.446, 1.451, 1.453, 1.457, 1.461, 1.464, 1.465, 1.466, 1.466, 1.464, 1.462, 1.459, 1.454, 1.451, 1.445, 1.441, 1.436, 1.429, 1.425, 1.422, 1.421, 1.417, 1.417, 1.423,
+                            1.417, 1.416, 1.416, 1.419, 1.423, 1.428, 1.433, 1.441, 1.446, 1.451, 1.454, 1.458, 1.461, 1.463, 1.465, 1.466, 1.466, 1.465, 1.463, 1.459, 1.454, 1.451, 1.446, 1.441, 1.437, 1.431, 1.426, 1.422, 1.421, 1.418, 1.418, 1.423,
+                            1.417, 1.416, 1.417, 1.418, 1.423, 1.428, 1.433, 1.439, 1.445, 1.451, 1.453, 1.457, 1.461, 1.463, 1.465, 1.466, 1.466, 1.464, 1.462, 1.459, 1.454, 1.451, 1.446, 1.441, 1.437, 1.431, 1.426, 1.422, 1.419, 1.417, 1.417, 1.422,
+                            1.417, 1.416, 1.416, 1.418, 1.422, 1.428, 1.433, 1.438, 1.444, 1.449, 1.453, 1.456, 1.459, 1.462, 1.464, 1.465, 1.465, 1.463, 1.461, 1.458, 1.453, 1.449, 1.445, 1.441, 1.435, 1.429, 1.426, 1.421, 1.419, 1.417, 1.417, 1.422,
+                            1.418, 1.416, 1.416, 1.418, 1.421, 1.426, 1.432, 1.438, 1.443, 1.447, 1.451, 1.454, 1.458, 1.459, 1.462, 1.463, 1.463, 1.462, 1.459, 1.455, 1.451, 1.447, 1.443, 1.439, 1.434, 1.429, 1.425, 1.421, 1.419, 1.417, 1.417, 1.422,
+                            1.418, 1.416, 1.416, 1.418, 1.421, 1.425, 1.431, 1.435, 1.442, 1.445, 1.449, 1.452, 1.455, 1.458, 1.458, 1.461, 1.461, 1.459, 1.456, 1.453, 1.449, 1.445, 1.442, 1.436, 1.433, 1.427, 1.425, 1.421, 1.419, 1.418, 1.418, 1.422,
+                            1.419, 1.416, 1.415, 1.417, 1.419, 1.424, 1.429, 1.434, 1.439, 1.443, 1.446, 1.449, 1.452, 1.454, 1.456, 1.457, 1.457, 1.456, 1.453, 1.451, 1.447, 1.443, 1.441, 1.435, 1.431, 1.426, 1.424, 1.421, 1.419, 1.418, 1.418, 1.422,
+                            1.419, 1.416, 1.415, 1.416, 1.419, 1.422, 1.426, 1.433, 1.437, 1.441, 1.444, 1.447, 1.449, 1.452, 1.453, 1.455, 1.455, 1.453, 1.451, 1.447, 1.444, 1.441, 1.438, 1.432, 1.428, 1.424, 1.421, 1.419, 1.418, 1.417, 1.417, 1.421,
+                            1.419, 1.416, 1.415, 1.416, 1.418, 1.421, 1.425, 1.431, 1.435, 1.438, 1.442, 1.445, 1.446, 1.449, 1.451, 1.451, 1.451, 1.451, 1.447, 1.445, 1.443, 1.439, 1.434, 1.431, 1.427, 1.422, 1.421, 1.418, 1.417, 1.417, 1.417, 1.421,
+                            1.418, 1.416, 1.415, 1.416, 1.417, 1.421, 1.423, 1.428, 1.433, 1.437, 1.439, 1.442, 1.444, 1.446, 1.448, 1.449, 1.449, 1.447, 1.445, 1.443, 1.439, 1.437, 1.432, 1.429, 1.425, 1.422, 1.419, 1.417, 1.417, 1.416, 1.416, 1.419,
+                            1.418, 1.416, 1.416, 1.416, 1.417, 1.421, 1.422, 1.426, 1.429, 1.433, 1.436, 1.438, 1.441, 1.443, 1.445, 1.446, 1.445, 1.445, 1.443, 1.439, 1.437, 1.434, 1.431, 1.427, 1.424, 1.421, 1.419, 1.417, 1.417, 1.416, 1.416, 1.421,
+                            1.419, 1.417, 1.416, 1.416, 1.417, 1.421, 1.422, 1.424, 1.427, 1.429, 1.432, 1.436, 1.437, 1.439, 1.442, 1.443, 1.443, 1.441, 1.439, 1.437, 1.434, 1.431, 1.429, 1.425, 1.422, 1.421, 1.419, 1.417, 1.416, 1.416, 1.417, 1.419,
+                            1.421, 1.418, 1.416, 1.417, 1.418, 1.421, 1.421, 1.423, 1.424, 1.427, 1.429, 1.432, 1.434, 1.436, 1.438, 1.439, 1.439, 1.438, 1.436, 1.434, 1.431, 1.429, 1.426, 1.423, 1.422, 1.421, 1.418, 1.417, 1.417, 1.417, 1.417, 1.421,
+                            1.423, 1.419, 1.418, 1.418, 1.419, 1.419, 1.421, 1.422, 1.423, 1.424, 1.427, 1.429, 1.432, 1.432, 1.434, 1.435, 1.435, 1.434, 1.433, 1.431, 1.429, 1.426, 1.424, 1.422, 1.421, 1.419, 1.418, 1.417, 1.417, 1.417, 1.418, 1.421,
+                            1.425, 1.421, 1.419, 1.419, 1.419, 1.421, 1.421, 1.421, 1.421, 1.423, 1.424, 1.426, 1.428, 1.431, 1.431, 1.432, 1.432, 1.431, 1.431, 1.428, 1.425, 1.425, 1.422, 1.421, 1.419, 1.419, 1.418, 1.418, 1.418, 1.418, 1.419, 1.425,
+                            1.426, 1.422, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.421, 1.422, 1.424, 1.426, 1.427, 1.428, 1.429, 1.429, 1.429, 1.427, 1.424, 1.423, 1.422, 1.421, 1.419, 1.418, 1.418, 1.418, 1.418, 1.418, 1.418, 1.419, 1.426,
+                            1.428, 1.425, 1.421, 1.421, 1.421, 1.421, 1.421, 1.419, 1.419, 1.421, 1.422, 1.423, 1.424, 1.426, 1.426, 1.426, 1.426, 1.425, 1.424, 1.424, 1.422, 1.422, 1.421, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.423, 1.426,
+                            1.429, 1.427, 1.424, 1.422, 1.422, 1.422, 1.421, 1.421, 1.421, 1.422, 1.422, 1.422, 1.424, 1.425, 1.426, 1.426, 1.425, 1.425, 1.424, 1.423, 1.422, 1.422, 1.421, 1.421, 1.421, 1.421, 1.419, 1.419, 1.421, 1.422, 1.424, 1.426
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    2.964, 2.872, 2.691, 2.544, 2.416, 2.302, 2.196, 2.093, 2.006, 1.928, 1.852, 1.801, 1.769, 1.752, 1.743, 1.743, 1.743, 1.746, 1.759, 1.784, 1.824, 1.888, 1.968, 2.052, 2.149, 2.253, 2.359, 2.483, 2.626, 2.785, 2.988, 3.051,
+                    2.872, 2.748, 2.583, 2.442, 2.313, 2.201, 2.104, 2.012, 1.928, 1.852, 1.791, 1.742, 1.701, 1.671, 1.651, 1.643, 1.643, 1.659, 1.685, 1.721, 1.768, 1.824, 1.888, 1.971, 2.068, 2.152, 2.259, 2.381, 2.514, 2.669, 2.853, 2.988,
+                    2.761, 2.655, 2.497, 2.356, 2.226, 2.114, 2.012, 1.928, 1.845, 1.769, 1.707, 1.653, 1.612, 1.583, 1.562, 1.556, 1.556, 1.572, 1.599, 1.635, 1.681, 1.742, 1.806, 1.888, 1.971, 2.068, 2.175, 2.292, 2.431, 2.576, 2.747, 2.853,
+                    2.679, 2.571, 2.415, 2.275, 2.151, 2.035, 1.936, 1.845, 1.769, 1.689, 1.623, 1.572, 1.532, 1.501, 1.481, 1.473, 1.473, 1.492, 1.517, 1.556, 1.599, 1.659, 1.731, 1.806, 1.895, 1.992, 2.101, 2.218, 2.349, 2.493, 2.664, 2.753,
+                    2.609, 2.492, 2.339, 2.204, 2.079, 1.971, 1.865, 1.772, 1.689, 1.619, 1.551, 1.499, 1.457, 1.423, 1.405, 1.397, 1.397, 1.411, 1.438, 1.477, 1.525, 1.585, 1.659, 1.731, 1.823, 1.922, 2.027, 2.148, 2.275, 2.422, 2.586, 2.683,
+                    2.545, 2.426, 2.279, 2.139, 2.014, 1.903, 1.799, 1.702, 1.619, 1.551, 1.482, 1.427, 1.385, 1.353, 1.331, 1.325, 1.325, 1.338, 1.364, 1.403, 1.455, 1.522, 1.585, 1.665, 1.757, 1.858, 1.963, 2.081, 2.207, 2.356, 2.518, 2.615,
+                    2.489, 2.367, 2.218, 2.079, 1.956, 1.844, 1.739, 1.642, 1.559, 1.482, 1.426, 1.363, 1.321, 1.287, 1.266, 1.259, 1.259, 1.274, 1.301, 1.339, 1.395, 1.455, 1.523, 1.606, 1.697, 1.797, 1.905, 2.024, 2.154, 2.296, 2.455, 2.563,
+                    2.439, 2.316, 2.164, 2.028, 1.906, 1.793, 1.686, 1.589, 1.505, 1.427, 1.363, 1.308, 1.261, 1.229, 1.207, 1.202, 1.202, 1.215, 1.242, 1.283, 1.339, 1.395, 1.467, 1.551, 1.639, 1.742, 1.851, 1.972, 2.104, 2.243, 2.402, 2.515,
+                    2.398, 2.262, 2.116, 1.982, 1.861, 1.745, 1.639, 1.541, 1.456, 1.377, 1.308, 1.261, 1.208, 1.177, 1.157, 1.153, 1.153, 1.167, 1.191, 1.233, 1.283, 1.343, 1.418, 1.499, 1.591, 1.696, 1.804, 1.928, 2.057, 2.194, 2.352, 2.471,
+                    2.363, 2.222, 2.078, 1.942, 1.818, 1.706, 1.597, 1.501, 1.412, 1.334, 1.266, 1.208, 1.171, 1.134, 1.113, 1.109, 1.109, 1.123, 1.149, 1.191, 1.233, 1.296, 1.371, 1.457, 1.546, 1.654, 1.768, 1.886, 2.014, 2.155, 2.312, 2.436,
+                    2.334, 2.188, 2.042, 1.909, 1.783, 1.668, 1.561, 1.464, 1.374, 1.295, 1.228, 1.171, 1.134, 1.098, 1.076, 1.072, 1.072, 1.087, 1.119, 1.149, 1.196, 1.259, 1.332, 1.419, 1.514, 1.616, 1.728, 1.849, 1.981, 2.123, 2.276, 2.406,
+                    2.306, 2.159, 2.015, 1.881, 1.753, 1.639, 1.533, 1.434, 1.341, 1.263, 1.195, 1.139, 1.098, 1.074, 1.046, 1.044, 1.045, 1.059, 1.087, 1.119, 1.165, 1.227, 1.302, 1.387, 1.482, 1.586, 1.698, 1.819, 1.953, 2.093, 2.248, 2.383,
+                    2.291, 2.141, 1.991, 1.856, 1.732, 1.615, 1.508, 1.409, 1.318, 1.238, 1.171, 1.114, 1.074, 1.046, 1.027, 1.023, 1.025, 1.043, 1.059, 1.095, 1.142, 1.203, 1.278, 1.362, 1.456, 1.559, 1.673, 1.796, 1.928, 2.071, 2.225, 2.359,
+                    2.279, 2.118, 1.972, 1.839, 1.715, 1.599, 1.488, 1.389, 1.298, 1.219, 1.153, 1.097, 1.057, 1.027, 1.018, 1.009, 1.013, 1.025, 1.044, 1.078, 1.125, 1.186, 1.258, 1.342, 1.438, 1.541, 1.655, 1.779, 1.909, 2.053, 2.211, 2.351,
+                    2.274, 2.108, 1.963, 1.831, 1.706, 1.588, 1.477, 1.376, 1.288, 1.207, 1.139, 1.086, 1.049, 1.021, 1.005, 1.002, 1.004, 1.013, 1.035, 1.069, 1.116, 1.176, 1.246, 1.331, 1.427, 1.531, 1.645, 1.767, 1.899, 2.045, 2.197, 2.351,
+                    2.274, 2.106, 1.961, 1.827, 1.701, 1.585, 1.474, 1.374, 1.285, 1.206, 1.139, 1.085, 1.047, 1.019, 1.003, 1.001, 1.001, 1.012, 1.033, 1.067, 1.113, 1.173, 1.245, 1.329, 1.423, 1.529, 1.642, 1.765, 1.897, 2.042, 2.196, 2.349,
+                    2.274, 2.108, 1.961, 1.827, 1.701, 1.585, 1.474, 1.374, 1.285, 1.206, 1.139, 1.085, 1.047, 1.021, 1.005, 1.001, 1.004, 1.012, 1.033, 1.068, 1.113, 1.173, 1.246, 1.329, 1.423, 1.529, 1.642, 1.766, 1.897, 2.042, 2.198, 2.349,
+                    2.278, 2.116, 1.968, 1.833, 1.707, 1.591, 1.482, 1.382, 1.291, 1.214, 1.147, 1.091, 1.055, 1.028, 1.016, 1.006, 1.012, 1.018, 1.039, 1.074, 1.121, 1.182, 1.255, 1.339, 1.433, 1.538, 1.651, 1.777, 1.911, 2.051, 2.207, 2.351,
+                    2.283, 2.127, 1.979, 1.846, 1.723, 1.605, 1.496, 1.397, 1.309, 1.229, 1.162, 1.108, 1.067, 1.041, 1.027, 1.018, 1.018, 1.036, 1.051, 1.087, 1.136, 1.197, 1.269, 1.354, 1.448, 1.554, 1.664, 1.789, 1.922, 2.065, 2.222, 2.365,
+                    2.298, 2.145, 1.999, 1.865, 1.744, 1.627, 1.518, 1.421, 1.331, 1.251, 1.183, 1.129, 1.087, 1.065, 1.041, 1.036, 1.036, 1.051, 1.074, 1.107, 1.158, 1.219, 1.292, 1.378, 1.471, 1.575, 1.687, 1.809, 1.942, 2.085, 2.239, 2.378,
+                    2.315, 2.174, 2.024, 1.893, 1.768, 1.652, 1.543, 1.445, 1.355, 1.278, 1.211, 1.155, 1.116, 1.087, 1.066, 1.061, 1.061, 1.074, 1.105, 1.137, 1.186, 1.248, 1.322, 1.405, 1.498, 1.602, 1.713, 1.835, 1.965, 2.109, 2.267, 2.399,
+                    2.341, 2.206, 2.057, 1.923, 1.799, 1.685, 1.576, 1.479, 1.392, 1.312, 1.244, 1.187, 1.154, 1.116, 1.096, 1.092, 1.092, 1.106, 1.137, 1.173, 1.221, 1.282, 1.356, 1.439, 1.532, 1.635, 1.747, 1.869, 1.997, 2.141, 2.298, 2.425,
+                    2.375, 2.244, 2.098, 1.965, 1.839, 1.722, 1.614, 1.519, 1.434, 1.355, 1.288, 1.234, 1.187, 1.155, 1.136, 1.132, 1.132, 1.147, 1.173, 1.219, 1.263, 1.324, 1.398, 1.479, 1.571, 1.674, 1.784, 1.904, 2.035, 2.177, 2.336, 2.455,
+                    2.414, 2.286, 2.144, 2.011, 1.883, 1.767, 1.661, 1.566, 1.479, 1.401, 1.335, 1.286, 1.234, 1.202, 1.183, 1.178, 1.178, 1.195, 1.222, 1.263, 1.313, 1.372, 1.444, 1.526, 1.618, 1.718, 1.827, 1.951, 2.081, 2.221, 2.379, 2.498,
+                    2.463, 2.339, 2.191, 2.056, 1.931, 1.819, 1.712, 1.616, 1.529, 1.452, 1.392, 1.335, 1.286, 1.254, 1.235, 1.232, 1.232, 1.248, 1.275, 1.313, 1.371, 1.425, 1.495, 1.576, 1.671, 1.768, 1.877, 1.999, 2.128, 2.269, 2.428, 2.541,
+                    2.514, 2.396, 2.247, 2.112, 1.988, 1.873, 1.766, 1.671, 1.588, 1.513, 1.452, 1.392, 1.348, 1.316, 1.298, 1.292, 1.292, 1.307, 1.336, 1.373, 1.425, 1.486, 1.552, 1.636, 1.728, 1.826, 1.933, 2.051, 2.183, 2.327, 2.488, 2.587,
+                    2.573, 2.459, 2.307, 2.171, 2.049, 1.931, 1.828, 1.731, 1.649, 1.582, 1.513, 1.459, 1.415, 1.381, 1.363, 1.358, 1.358, 1.373, 1.399, 1.439, 1.486, 1.552, 1.617, 1.696, 1.787, 1.888, 1.995, 2.112, 2.244, 2.391, 2.552, 2.652,
+                    2.635, 2.525, 2.377, 2.239, 2.111, 1.996, 1.895, 1.799, 1.719, 1.649, 1.582, 1.531, 1.486, 1.454, 1.434, 1.429, 1.429, 1.444, 1.469, 1.507, 1.555, 1.617, 1.692, 1.766, 1.854, 1.954, 2.065, 2.181, 2.313, 2.459, 2.623, 2.722,
+                    2.714, 2.604, 2.452, 2.313, 2.188, 2.071, 1.966, 1.876, 1.799, 1.719, 1.656, 1.604, 1.562, 1.529, 1.511, 1.504, 1.504, 1.519, 1.544, 1.583, 1.632, 1.692, 1.766, 1.839, 1.929, 2.029, 2.138, 2.259, 2.391, 2.539, 2.712, 2.811,
+                    2.809, 2.698, 2.537, 2.396, 2.277, 2.163, 2.053, 1.965, 1.876, 1.799, 1.741, 1.688, 1.643, 1.613, 1.592, 1.586, 1.586, 1.601, 1.628, 1.666, 1.715, 1.773, 1.839, 1.927, 2.012, 2.111, 2.222, 2.342, 2.477, 2.625, 2.811, 2.926,
+                    2.921, 2.809, 2.637, 2.493, 2.376, 2.256, 2.149, 2.053, 1.966, 1.893, 1.832, 1.778, 1.736, 1.708, 1.687, 1.681, 1.681, 1.696, 1.721, 1.757, 1.806, 1.864, 1.929, 2.012, 2.106, 2.199, 2.313, 2.437, 2.577, 2.731, 2.926, 3.051,
+                    3.029, 2.921, 2.745, 2.591, 2.474, 2.355, 2.246, 2.146, 2.049, 1.966, 1.893, 1.832, 1.799, 1.776, 1.768, 1.768, 1.768, 1.771, 1.783, 1.809, 1.864, 1.929, 2.012, 2.097, 2.195, 2.297, 2.412, 2.539, 2.682, 2.846, 3.051, 3.123
+                ],
+                "sigma": 0.00463,
+                "sigma_Cb": 0.00149
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "lo_max": 1000,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2860,
+                        "ccm":
+                        [
+                            2.12089, -0.52461, -0.59629,
+                            -0.85342, 2.80445, -0.95103,
+                            -0.26897, -1.14788, 2.41685
+                        ]
+                    },
+                    {
+                        "ct": 2960,
+                        "ccm":
+                        [
+                            2.26962, -0.54174, -0.72789,
+                            -0.77008, 2.60271, -0.83262,
+                            -0.26036, -1.51254, 2.77289
+                        ]
+                    },
+                    {
+                        "ct": 3603,
+                        "ccm":
+                        [
+                            2.18644, -0.66148, -0.52496,
+                            -0.77828, 2.69474, -0.91645,
+                            -0.25239, -0.83059, 2.08298
+                        ]
+                    },
+                    {
+                        "ct": 4650,
+                        "ccm":
+                        [
+                            2.18174, -0.70887, -0.47287,
+                            -0.70196, 2.76426, -1.06231,
+                            -0.25157, -0.71978, 1.97135
+                        ]
+                    },
+                    {
+                        "ct": 5858,
+                        "ccm":
+                        [
+                            2.32392, -0.88421, -0.43971,
+                            -0.63821, 2.58348, -0.94527,
+                            -0.28541, -0.54112, 1.82653
+                        ]
+                    },
+                    {
+                        "ct": 7580,
+                        "ccm":
+                        [
+                            2.21175, -0.53242, -0.67933,
+                            -0.57875, 3.07922, -1.50047,
+                            -0.27709, -0.73338, 2.01048
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx219_noir.json b/src/ipa/rpi/pisp/data/imx219_noir.json
new file mode 100644
index 000000000..8a8ad330f
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx219_noir.json
@@ -0,0 +1,1112 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 21965,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 800,
+                "reference_Y": 11460
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 3.661
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 239,
+                "slope": 0.00766
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "bayes": 0
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 10.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 10.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.418, 1.428, 1.446, 1.454, 1.454, 1.451, 1.441, 1.428, 1.411, 1.391, 1.371, 1.349, 1.334, 1.327, 1.325, 1.325, 1.325, 1.325, 1.331, 1.344, 1.363, 1.383, 1.402, 1.418, 1.433, 1.446, 1.452, 1.453, 1.446, 1.435, 1.415, 1.404,
+                            1.428, 1.442, 1.453, 1.455, 1.454, 1.447, 1.431, 1.413, 1.392, 1.371, 1.349, 1.331, 1.318, 1.307, 1.299, 1.299, 1.299, 1.303, 1.313, 1.328, 1.344, 1.363, 1.383, 1.404, 1.424, 1.439, 1.451, 1.453, 1.453, 1.445, 1.431, 1.415,
+                            1.436, 1.448, 1.453, 1.455, 1.449, 1.435, 1.415, 1.393, 1.369, 1.345, 1.322, 1.303, 1.287, 1.276, 1.269, 1.268, 1.268, 1.272, 1.283, 1.298, 1.316, 1.337, 1.362, 1.384, 1.406, 1.427, 1.444, 1.454, 1.454, 1.452, 1.438, 1.426,
+                            1.441, 1.451, 1.454, 1.451, 1.439, 1.422, 1.396, 1.372, 1.345, 1.319, 1.295, 1.274, 1.257, 1.245, 1.239, 1.238, 1.238, 1.245, 1.255, 1.269, 1.289, 1.311, 1.336, 1.362, 1.388, 1.412, 1.433, 1.448, 1.454, 1.453, 1.445, 1.433,
+                            1.445, 1.452, 1.452, 1.445, 1.428, 1.405, 1.379, 1.349, 1.319, 1.295, 1.269, 1.247, 1.229, 1.219, 1.212, 1.211, 1.211, 1.217, 1.228, 1.242, 1.261, 1.286, 1.311, 1.339, 1.367, 1.395, 1.419, 1.439, 1.452, 1.452, 1.451, 1.436,
+                            1.448, 1.451, 1.451, 1.435, 1.414, 1.387, 1.358, 1.327, 1.296, 1.269, 1.245, 1.222, 1.205, 1.193, 1.187, 1.185, 1.186, 1.191, 1.202, 1.217, 1.237, 1.261, 1.286, 1.316, 1.346, 1.378, 1.404, 1.429, 1.445, 1.451, 1.451, 1.442,
+                            1.448, 1.448, 1.445, 1.427, 1.401, 1.371, 1.338, 1.306, 1.274, 1.245, 1.222, 1.199, 1.183, 1.171, 1.164, 1.162, 1.162, 1.168, 1.181, 1.194, 1.215, 1.237, 1.264, 1.294, 1.325, 1.359, 1.389, 1.418, 1.441, 1.449, 1.449, 1.443,
+                            1.449, 1.448, 1.438, 1.415, 1.387, 1.352, 1.318, 1.284, 1.252, 1.223, 1.199, 1.179, 1.161, 1.149, 1.142, 1.142, 1.142, 1.149, 1.159, 1.174, 1.194, 1.215, 1.242, 1.272, 1.307, 1.341, 1.376, 1.405, 1.431, 1.447, 1.447, 1.444,
+                            1.448, 1.447, 1.431, 1.405, 1.373, 1.336, 1.301, 1.264, 1.234, 1.204, 1.179, 1.161, 1.143, 1.131, 1.124, 1.123, 1.123, 1.131, 1.141, 1.156, 1.174, 1.197, 1.224, 1.254, 1.288, 1.324, 1.361, 1.394, 1.423, 1.442, 1.444, 1.444,
+                            1.447, 1.442, 1.424, 1.393, 1.359, 1.322, 1.284, 1.248, 1.216, 1.187, 1.162, 1.143, 1.128, 1.115, 1.109, 1.108, 1.108, 1.113, 1.124, 1.139, 1.156, 1.179, 1.206, 1.236, 1.272, 1.309, 1.347, 1.382, 1.411, 1.435, 1.443, 1.444,
+                            1.444, 1.439, 1.417, 1.383, 1.347, 1.308, 1.271, 1.233, 1.201, 1.173, 1.147, 1.128, 1.115, 1.101, 1.095, 1.093, 1.093, 1.099, 1.111, 1.124, 1.142, 1.165, 1.191, 1.222, 1.258, 1.296, 1.333, 1.372, 1.404, 1.429, 1.441, 1.442,
+                            1.443, 1.434, 1.409, 1.375, 1.336, 1.297, 1.257, 1.221, 1.189, 1.159, 1.136, 1.116, 1.101, 1.092, 1.083, 1.082, 1.082, 1.089, 1.099, 1.111, 1.131, 1.153, 1.181, 1.211, 1.246, 1.284, 1.324, 1.361, 1.398, 1.425, 1.441, 1.441,
+                            1.443, 1.431, 1.405, 1.369, 1.328, 1.287, 1.247, 1.211, 1.178, 1.149, 1.126, 1.107, 1.092, 1.083, 1.075, 1.073, 1.073, 1.082, 1.089, 1.101, 1.121, 1.143, 1.171, 1.201, 1.237, 1.274, 1.314, 1.353, 1.389, 1.421, 1.439, 1.441,
+                            1.442, 1.429, 1.401, 1.364, 1.323, 1.279, 1.241, 1.205, 1.172, 1.144, 1.119, 1.101, 1.085, 1.075, 1.071, 1.067, 1.067, 1.073, 1.082, 1.096, 1.114, 1.136, 1.163, 1.194, 1.229, 1.268, 1.308, 1.348, 1.387, 1.417, 1.439, 1.439,
+                            1.443, 1.429, 1.399, 1.362, 1.319, 1.276, 1.237, 1.199, 1.169, 1.141, 1.115, 1.096, 1.081, 1.071, 1.066, 1.063, 1.066, 1.068, 1.078, 1.092, 1.109, 1.132, 1.159, 1.191, 1.226, 1.263, 1.304, 1.346, 1.384, 1.416, 1.438, 1.439,
+                            1.443, 1.428, 1.399, 1.361, 1.319, 1.276, 1.236, 1.199, 1.167, 1.139, 1.115, 1.096, 1.081, 1.071, 1.064, 1.062, 1.062, 1.067, 1.077, 1.091, 1.109, 1.131, 1.158, 1.189, 1.224, 1.262, 1.303, 1.345, 1.383, 1.416, 1.438, 1.439,
+                            1.444, 1.429, 1.399, 1.361, 1.319, 1.276, 1.236, 1.199, 1.167, 1.139, 1.116, 1.096, 1.081, 1.071, 1.064, 1.063, 1.063, 1.067, 1.077, 1.091, 1.109, 1.131, 1.159, 1.189, 1.224, 1.262, 1.303, 1.345, 1.384, 1.416, 1.438, 1.441,
+                            1.444, 1.431, 1.402, 1.364, 1.322, 1.281, 1.239, 1.202, 1.171, 1.142, 1.118, 1.099, 1.084, 1.073, 1.069, 1.065, 1.067, 1.071, 1.079, 1.094, 1.112, 1.135, 1.163, 1.191, 1.227, 1.265, 1.307, 1.348, 1.386, 1.418, 1.438, 1.441,
+                            1.447, 1.433, 1.406, 1.369, 1.328, 1.286, 1.244, 1.209, 1.177, 1.148, 1.124, 1.105, 1.089, 1.081, 1.073, 1.071, 1.071, 1.079, 1.085, 1.099, 1.118, 1.141, 1.168, 1.198, 1.233, 1.271, 1.312, 1.352, 1.391, 1.422, 1.441, 1.444,
+                            1.448, 1.438, 1.412, 1.376, 1.335, 1.295, 1.255, 1.218, 1.186, 1.157, 1.134, 1.113, 1.098, 1.089, 1.081, 1.079, 1.079, 1.085, 1.094, 1.107, 1.125, 1.149, 1.175, 1.207, 1.242, 1.281, 1.319, 1.359, 1.396, 1.425, 1.445, 1.447,
+                            1.449, 1.443, 1.417, 1.384, 1.345, 1.305, 1.266, 1.229, 1.197, 1.169, 1.145, 1.124, 1.111, 1.098, 1.091, 1.089, 1.089, 1.094, 1.107, 1.118, 1.137, 1.159, 1.187, 1.218, 1.253, 1.291, 1.329, 1.369, 1.405, 1.433, 1.447, 1.449,
+                            1.453, 1.449, 1.425, 1.395, 1.358, 1.318, 1.281, 1.244, 1.211, 1.183, 1.158, 1.138, 1.124, 1.111, 1.104, 1.103, 1.103, 1.107, 1.118, 1.133, 1.151, 1.174, 1.201, 1.232, 1.267, 1.304, 1.344, 1.379, 1.413, 1.437, 1.449, 1.449,
+                            1.457, 1.453, 1.434, 1.405, 1.371, 1.335, 1.297, 1.261, 1.229, 1.199, 1.174, 1.155, 1.138, 1.126, 1.119, 1.117, 1.117, 1.124, 1.133, 1.149, 1.167, 1.189, 1.217, 1.248, 1.284, 1.319, 1.357, 1.393, 1.423, 1.444, 1.452, 1.452,
+                            1.459, 1.457, 1.443, 1.418, 1.385, 1.352, 1.314, 1.279, 1.246, 1.218, 1.193, 1.174, 1.155, 1.144, 1.137, 1.136, 1.136, 1.141, 1.151, 1.167, 1.187, 1.208, 1.236, 1.267, 1.301, 1.337, 1.373, 1.405, 1.434, 1.453, 1.455, 1.455,
+                            1.461, 1.461, 1.454, 1.429, 1.401, 1.369, 1.333, 1.301, 1.269, 1.239, 1.216, 1.193, 1.177, 1.165, 1.158, 1.156, 1.156, 1.161, 1.171, 1.187, 1.208, 1.229, 1.258, 1.288, 1.321, 1.356, 1.389, 1.419, 1.445, 1.459, 1.459, 1.455,
+                            1.462, 1.462, 1.459, 1.442, 1.418, 1.386, 1.354, 1.322, 1.292, 1.262, 1.239, 1.216, 1.199, 1.187, 1.179, 1.178, 1.178, 1.184, 1.194, 1.208, 1.229, 1.253, 1.279, 1.309, 1.342, 1.375, 1.406, 1.433, 1.452, 1.464, 1.464, 1.454,
+                            1.461, 1.465, 1.465, 1.454, 1.431, 1.405, 1.376, 1.346, 1.316, 1.288, 1.262, 1.242, 1.223, 1.212, 1.205, 1.203, 1.203, 1.208, 1.218, 1.234, 1.253, 1.279, 1.305, 1.334, 1.363, 1.393, 1.421, 1.445, 1.461, 1.465, 1.464, 1.452,
+                            1.459, 1.465, 1.466, 1.461, 1.443, 1.421, 1.395, 1.368, 1.341, 1.316, 1.288, 1.268, 1.251, 1.238, 1.232, 1.229, 1.229, 1.235, 1.246, 1.261, 1.279, 1.305, 1.331, 1.356, 1.385, 1.411, 1.435, 1.454, 1.466, 1.466, 1.464, 1.451,
+                            1.454, 1.465, 1.467, 1.466, 1.456, 1.436, 1.414, 1.389, 1.367, 1.341, 1.318, 1.297, 1.279, 1.269, 1.261, 1.259, 1.259, 1.265, 1.274, 1.288, 1.308, 1.331, 1.355, 1.381, 1.404, 1.428, 1.447, 1.462, 1.468, 1.467, 1.457, 1.445,
+                            1.447, 1.459, 1.466, 1.467, 1.463, 1.451, 1.434, 1.411, 1.389, 1.367, 1.344, 1.325, 1.311, 1.297, 1.292, 1.289, 1.289, 1.295, 1.303, 1.317, 1.336, 1.356, 1.381, 1.402, 1.423, 1.441, 1.457, 1.467, 1.468, 1.463, 1.451, 1.439,
+                            1.438, 1.449, 1.462, 1.464, 1.464, 1.459, 1.446, 1.429, 1.408, 1.388, 1.369, 1.353, 1.339, 1.329, 1.321, 1.321, 1.321, 1.325, 1.333, 1.348, 1.362, 1.379, 1.401, 1.421, 1.439, 1.454, 1.463, 1.465, 1.465, 1.456, 1.442, 1.427,
+                            1.429, 1.439, 1.454, 1.464, 1.464, 1.459, 1.449, 1.435, 1.421, 1.402, 1.385, 1.369, 1.353, 1.341, 1.338, 1.337, 1.337, 1.338, 1.348, 1.362, 1.378, 1.395, 1.411, 1.429, 1.445, 1.455, 1.463, 1.464, 1.457, 1.447, 1.427, 1.419
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            2.163, 2.177, 2.194, 2.196, 2.197, 2.192, 2.181, 2.161, 2.139, 2.113, 2.088, 2.063, 2.047, 2.041, 2.036, 2.036, 2.036, 2.037, 2.046, 2.059, 2.083, 2.113, 2.135, 2.158, 2.181, 2.193, 2.205, 2.205, 2.202, 2.189, 2.171, 2.158,
+                            2.169, 2.184, 2.195, 2.196, 2.194, 2.182, 2.163, 2.141, 2.116, 2.088, 2.063, 2.042, 2.025, 2.013, 2.004, 2.004, 2.006, 2.011, 2.022, 2.038, 2.059, 2.083, 2.113, 2.137, 2.162, 2.182, 2.197, 2.204, 2.203, 2.199, 2.183, 2.171,
+                            2.177, 2.187, 2.193, 2.193, 2.184, 2.166, 2.142, 2.116, 2.087, 2.057, 2.033, 2.008, 1.991, 1.977, 1.969, 1.969, 1.969, 1.975, 1.988, 2.006, 2.028, 2.055, 2.083, 2.114, 2.139, 2.166, 2.187, 2.199, 2.202, 2.201, 2.189, 2.179,
+                            2.183, 2.189, 2.192, 2.186, 2.172, 2.146, 2.119, 2.089, 2.058, 2.026, 2.001, 1.975, 1.956, 1.942, 1.934, 1.932, 1.933, 1.941, 1.955, 1.971, 1.995, 2.023, 2.055, 2.084, 2.119, 2.146, 2.171, 2.191, 2.201, 2.201, 2.194, 2.183,
+                            2.186, 2.189, 2.189, 2.177, 2.158, 2.127, 2.096, 2.059, 2.026, 1.998, 1.969, 1.944, 1.925, 1.911, 1.901, 1.901, 1.903, 1.912, 1.924, 1.941, 1.964, 1.995, 2.023, 2.058, 2.091, 2.126, 2.155, 2.181, 2.195, 2.199, 2.198, 2.188,
+                            2.189, 2.189, 2.184, 2.166, 2.138, 2.108, 2.071, 2.036, 1.999, 1.969, 1.941, 1.914, 1.894, 1.879, 1.871, 1.871, 1.872, 1.879, 1.893, 1.913, 1.937, 1.964, 1.997, 2.029, 2.065, 2.104, 2.137, 2.169, 2.187, 2.199, 2.199, 2.189,
+                            2.187, 2.186, 2.176, 2.154, 2.123, 2.087, 2.044, 2.011, 1.974, 1.941, 1.913, 1.887, 1.868, 1.852, 1.844, 1.843, 1.844, 1.852, 1.866, 1.885, 1.912, 1.937, 1.972, 2.004, 2.042, 2.081, 2.119, 2.154, 2.179, 2.195, 2.196, 2.193,
+                            2.187, 2.181, 2.167, 2.141, 2.103, 2.062, 2.023, 1.984, 1.947, 1.916, 1.887, 1.864, 1.841, 1.828, 1.821, 1.819, 1.819, 1.828, 1.842, 1.862, 1.885, 1.913, 1.945, 1.982, 2.021, 2.058, 2.102, 2.137, 2.168, 2.192, 2.193, 2.193,
+                            2.182, 2.181, 2.161, 2.127, 2.083, 2.044, 2.002, 1.961, 1.924, 1.891, 1.864, 1.841, 1.819, 1.806, 1.797, 1.797, 1.797, 1.805, 1.819, 1.841, 1.862, 1.892, 1.924, 1.959, 1.999, 2.041, 2.082, 2.123, 2.161, 2.185, 2.191, 2.192,
+                            2.182, 2.172, 2.149, 2.112, 2.069, 2.026, 1.982, 1.941, 1.904, 1.871, 1.841, 1.819, 1.799, 1.785, 1.776, 1.776, 1.778, 1.784, 1.798, 1.819, 1.841, 1.869, 1.903, 1.939, 1.977, 2.021, 2.067, 2.108, 2.145, 2.174, 2.189, 2.191,
+                            2.181, 2.167, 2.139, 2.098, 2.056, 2.006, 1.965, 1.921, 1.883, 1.851, 1.823, 1.799, 1.783, 1.767, 1.759, 1.758, 1.758, 1.767, 1.783, 1.798, 1.825, 1.851, 1.883, 1.919, 1.959, 2.004, 2.049, 2.094, 2.136, 2.167, 2.187, 2.189,
+                            2.179, 2.163, 2.131, 2.087, 2.041, 1.994, 1.948, 1.907, 1.871, 1.835, 1.806, 1.784, 1.767, 1.754, 1.744, 1.742, 1.742, 1.752, 1.767, 1.783, 1.808, 1.838, 1.869, 1.905, 1.945, 1.989, 2.036, 2.083, 2.128, 2.159, 2.183, 2.187,
+                            2.178, 2.161, 2.126, 2.082, 2.032, 1.982, 1.936, 1.896, 1.857, 1.823, 1.795, 1.772, 1.754, 1.744, 1.732, 1.731, 1.732, 1.742, 1.752, 1.771, 1.796, 1.824, 1.857, 1.895, 1.934, 1.977, 2.024, 2.071, 2.116, 2.154, 2.181, 2.185,
+                            2.177, 2.157, 2.121, 2.074, 2.025, 1.973, 1.927, 1.886, 1.849, 1.815, 1.787, 1.765, 1.746, 1.732, 1.725, 1.722, 1.724, 1.732, 1.743, 1.762, 1.786, 1.813, 1.848, 1.886, 1.924, 1.969, 2.017, 2.066, 2.111, 2.153, 2.179, 2.183,
+                            2.177, 2.155, 2.119, 2.072, 2.022, 1.969, 1.925, 1.881, 1.844, 1.811, 1.782, 1.758, 1.739, 1.725, 1.721, 1.717, 1.721, 1.724, 1.739, 1.757, 1.781, 1.809, 1.842, 1.879, 1.921, 1.965, 2.012, 2.062, 2.108, 2.151, 2.179, 2.182,
+                            2.177, 2.156, 2.121, 2.071, 2.021, 1.968, 1.922, 1.879, 1.842, 1.811, 1.781, 1.757, 1.739, 1.725, 1.717, 1.715, 1.715, 1.723, 1.737, 1.757, 1.779, 1.808, 1.841, 1.877, 1.918, 1.963, 2.011, 2.061, 2.107, 2.148, 2.179, 2.183,
+                            2.178, 2.157, 2.121, 2.072, 2.021, 1.969, 1.922, 1.881, 1.842, 1.811, 1.781, 1.758, 1.739, 1.726, 1.718, 1.717, 1.718, 1.723, 1.737, 1.757, 1.781, 1.809, 1.841, 1.877, 1.918, 1.964, 2.012, 2.061, 2.108, 2.149, 2.179, 2.183,
+                            2.178, 2.159, 2.124, 2.074, 2.024, 1.974, 1.926, 1.885, 1.847, 1.813, 1.784, 1.762, 1.743, 1.731, 1.725, 1.719, 1.723, 1.728, 1.742, 1.762, 1.785, 1.814, 1.847, 1.881, 1.922, 1.966, 2.017, 2.065, 2.109, 2.151, 2.181, 2.184,
+                            2.181, 2.163, 2.129, 2.082, 2.032, 1.982, 1.934, 1.891, 1.854, 1.822, 1.794, 1.769, 1.751, 1.739, 1.731, 1.727, 1.728, 1.739, 1.747, 1.768, 1.791, 1.821, 1.852, 1.889, 1.929, 1.972, 2.022, 2.071, 2.117, 2.155, 2.182, 2.189,
+                            2.184, 2.169, 2.135, 2.091, 2.041, 1.994, 1.947, 1.902, 1.865, 1.833, 1.805, 1.779, 1.762, 1.751, 1.739, 1.739, 1.739, 1.747, 1.761, 1.779, 1.803, 1.831, 1.864, 1.898, 1.941, 1.984, 2.033, 2.079, 2.123, 2.163, 2.188, 2.193,
+                            2.185, 2.174, 2.142, 2.099, 2.054, 2.004, 1.959, 1.917, 1.879, 1.846, 1.819, 1.794, 1.779, 1.762, 1.754, 1.753, 1.753, 1.761, 1.777, 1.793, 1.816, 1.843, 1.877, 1.913, 1.953, 1.995, 2.043, 2.091, 2.135, 2.169, 2.191, 2.196,
+                            2.191, 2.179, 2.154, 2.118, 2.069, 2.023, 1.977, 1.935, 1.898, 1.865, 1.834, 1.813, 1.794, 1.779, 1.769, 1.769, 1.769, 1.777, 1.793, 1.809, 1.834, 1.863, 1.895, 1.929, 1.972, 2.015, 2.061, 2.105, 2.145, 2.178, 2.195, 2.199,
+                            2.197, 2.188, 2.166, 2.129, 2.087, 2.041, 1.997, 1.956, 1.918, 1.884, 1.855, 1.834, 1.813, 1.798, 1.788, 1.788, 1.788, 1.796, 1.809, 1.832, 1.853, 1.881, 1.912, 1.949, 1.991, 2.033, 2.076, 2.119, 2.159, 2.187, 2.202, 2.205,
+                            2.202, 2.197, 2.176, 2.148, 2.106, 2.065, 2.021, 1.979, 1.943, 1.909, 1.879, 1.855, 1.835, 1.819, 1.811, 1.811, 1.811, 1.818, 1.832, 1.853, 1.875, 1.904, 1.937, 1.972, 2.013, 2.055, 2.097, 2.138, 2.175, 2.197, 2.206, 2.207,
+                            2.205, 2.202, 2.189, 2.162, 2.126, 2.084, 2.044, 2.004, 1.967, 1.935, 1.907, 1.879, 1.861, 1.845, 1.838, 1.835, 1.835, 1.844, 1.855, 1.875, 1.902, 1.928, 1.961, 1.998, 2.033, 2.076, 2.118, 2.155, 2.186, 2.205, 2.208, 2.208,
+                            2.207, 2.205, 2.195, 2.175, 2.145, 2.108, 2.069, 2.029, 1.996, 1.963, 1.934, 1.908, 1.885, 1.872, 1.864, 1.863, 1.863, 1.869, 1.884, 1.902, 1.928, 1.956, 1.989, 2.023, 2.059, 2.099, 2.137, 2.172, 2.199, 2.212, 2.213, 2.209,
+                            2.207, 2.207, 2.203, 2.188, 2.162, 2.128, 2.094, 2.058, 2.023, 1.993, 1.963, 1.936, 1.916, 1.899, 1.893, 1.892, 1.893, 1.899, 1.912, 1.929, 1.956, 1.986, 2.016, 2.049, 2.084, 2.121, 2.156, 2.187, 2.208, 2.215, 2.215, 2.208,
+                            2.205, 2.208, 2.209, 2.199, 2.178, 2.149, 2.117, 2.083, 2.052, 2.023, 1.993, 1.967, 1.947, 1.933, 1.925, 1.922, 1.922, 1.929, 1.943, 1.961, 1.986, 2.015, 2.045, 2.076, 2.109, 2.143, 2.173, 2.198, 2.214, 2.218, 2.216, 2.205,
+                            2.201, 2.207, 2.211, 2.211, 2.193, 2.168, 2.141, 2.112, 2.082, 2.052, 2.025, 2.001, 1.981, 1.967, 1.959, 1.958, 1.958, 1.967, 1.975, 1.992, 2.018, 2.046, 2.076, 2.105, 2.136, 2.163, 2.189, 2.208, 2.217, 2.217, 2.212, 2.203,
+                            2.194, 2.204, 2.212, 2.213, 2.203, 2.187, 2.165, 2.139, 2.112, 2.083, 2.055, 2.034, 2.016, 2.001, 1.993, 1.993, 1.994, 1.999, 2.011, 2.027, 2.051, 2.077, 2.105, 2.133, 2.158, 2.181, 2.202, 2.217, 2.218, 2.218, 2.206, 2.193,
+                            2.185, 2.198, 2.213, 2.214, 2.212, 2.201, 2.184, 2.163, 2.135, 2.111, 2.089, 2.071, 2.052, 2.039, 2.032, 2.031, 2.031, 2.036, 2.048, 2.065, 2.085, 2.106, 2.131, 2.155, 2.178, 2.198, 2.212, 2.219, 2.219, 2.215, 2.201, 2.185,
+                            2.176, 2.191, 2.208, 2.217, 2.216, 2.205, 2.195, 2.177, 2.156, 2.133, 2.109, 2.089, 2.071, 2.055, 2.053, 2.053, 2.053, 2.057, 2.065, 2.085, 2.105, 2.123, 2.149, 2.171, 2.192, 2.205, 2.217, 2.219, 2.219, 2.202, 2.185, 2.181
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.518, 2.513, 2.503, 2.496, 2.488, 2.484, 2.485, 2.485, 2.486, 2.487, 2.487, 2.489, 2.494, 2.496, 2.496, 2.497, 2.499, 2.499, 2.496, 2.495, 2.492, 2.491, 2.491, 2.491, 2.492, 2.493, 2.495, 2.501, 2.508, 2.516, 2.528, 2.533,
+                            2.515, 2.508, 2.495, 2.487, 2.483, 2.481, 2.482, 2.483, 2.485, 2.487, 2.489, 2.491, 2.495, 2.497, 2.498, 2.501, 2.502, 2.502, 2.499, 2.496, 2.494, 2.491, 2.491, 2.489, 2.489, 2.491, 2.493, 2.496, 2.502, 2.511, 2.521, 2.531,
+                            2.507, 2.495, 2.486, 2.482, 2.478, 2.477, 2.481, 2.482, 2.484, 2.488, 2.491, 2.495, 2.499, 2.502, 2.506, 2.508, 2.509, 2.508, 2.505, 2.501, 2.497, 2.493, 2.491, 2.489, 2.488, 2.489, 2.489, 2.492, 2.496, 2.501, 2.511, 2.524,
+                            2.501, 2.487, 2.482, 2.481, 2.478, 2.477, 2.481, 2.483, 2.487, 2.491, 2.501, 2.503, 2.509, 2.511, 2.518, 2.519, 2.519, 2.519, 2.516, 2.509, 2.504, 2.498, 2.495, 2.493, 2.489, 2.489, 2.488, 2.489, 2.492, 2.498, 2.505, 2.523,
+                            2.499, 2.484, 2.481, 2.476, 2.476, 2.476, 2.481, 2.485, 2.492, 2.501, 2.509, 2.514, 2.519, 2.524, 2.528, 2.531, 2.533, 2.533, 2.525, 2.519, 2.514, 2.507, 2.501, 2.497, 2.493, 2.489, 2.489, 2.488, 2.491, 2.494, 2.501, 2.514,
+                            2.497, 2.483, 2.478, 2.476, 2.476, 2.478, 2.482, 2.491, 2.499, 2.509, 2.515, 2.522, 2.528, 2.535, 2.539, 2.541, 2.543, 2.542, 2.539, 2.529, 2.522, 2.516, 2.507, 2.502, 2.497, 2.491, 2.489, 2.488, 2.489, 2.492, 2.498, 2.514,
+                            2.492, 2.479, 2.476, 2.475, 2.476, 2.481, 2.488, 2.496, 2.505, 2.516, 2.524, 2.532, 2.541, 2.545, 2.552, 2.554, 2.554, 2.554, 2.548, 2.541, 2.532, 2.522, 2.516, 2.507, 2.502, 2.494, 2.491, 2.489, 2.489, 2.492, 2.494, 2.511,
+                            2.491, 2.479, 2.476, 2.477, 2.478, 2.482, 2.491, 2.502, 2.514, 2.524, 2.533, 2.543, 2.548, 2.555, 2.562, 2.566, 2.567, 2.562, 2.557, 2.551, 2.541, 2.531, 2.523, 2.512, 2.506, 2.498, 2.493, 2.491, 2.491, 2.491, 2.493, 2.507,
+                            2.489, 2.478, 2.476, 2.477, 2.481, 2.485, 2.494, 2.507, 2.517, 2.529, 2.542, 2.548, 2.557, 2.563, 2.567, 2.571, 2.572, 2.571, 2.565, 2.558, 2.549, 2.538, 2.528, 2.521, 2.509, 2.501, 2.494, 2.492, 2.491, 2.491, 2.491, 2.505,
+                            2.488, 2.478, 2.477, 2.478, 2.482, 2.489, 2.499, 2.509, 2.523, 2.538, 2.548, 2.556, 2.563, 2.568, 2.573, 2.577, 2.578, 2.577, 2.573, 2.564, 2.555, 2.543, 2.535, 2.524, 2.515, 2.504, 2.495, 2.492, 2.489, 2.488, 2.489, 2.501,
+                            2.486, 2.476, 2.475, 2.477, 2.483, 2.491, 2.503, 2.515, 2.529, 2.542, 2.553, 2.562, 2.568, 2.574, 2.581, 2.583, 2.584, 2.581, 2.578, 2.571, 2.562, 2.551, 2.539, 2.531, 2.517, 2.508, 2.497, 2.492, 2.488, 2.487, 2.489, 2.498,
+                            2.486, 2.476, 2.475, 2.479, 2.484, 2.492, 2.504, 2.519, 2.533, 2.544, 2.557, 2.566, 2.573, 2.581, 2.584, 2.588, 2.588, 2.586, 2.581, 2.575, 2.567, 2.555, 2.546, 2.534, 2.517, 2.509, 2.499, 2.492, 2.489, 2.485, 2.488, 2.497,
+                            2.487, 2.476, 2.476, 2.479, 2.486, 2.494, 2.506, 2.521, 2.535, 2.549, 2.559, 2.571, 2.578, 2.583, 2.589, 2.591, 2.591, 2.591, 2.587, 2.579, 2.571, 2.559, 2.551, 2.538, 2.523, 2.513, 2.503, 2.493, 2.489, 2.486, 2.487, 2.499,
+                            2.486, 2.475, 2.475, 2.479, 2.486, 2.495, 2.509, 2.525, 2.541, 2.555, 2.563, 2.573, 2.582, 2.588, 2.591, 2.594, 2.595, 2.592, 2.591, 2.585, 2.574, 2.564, 2.552, 2.541, 2.525, 2.514, 2.503, 2.493, 2.489, 2.486, 2.486, 2.501,
+                            2.486, 2.475, 2.475, 2.479, 2.488, 2.497, 2.509, 2.526, 2.542, 2.556, 2.564, 2.575, 2.584, 2.591, 2.595, 2.596, 2.597, 2.595, 2.592, 2.587, 2.577, 2.568, 2.554, 2.542, 2.527, 2.515, 2.504, 2.494, 2.491, 2.487, 2.487, 2.505,
+                            2.484, 2.476, 2.475, 2.478, 2.488, 2.498, 2.509, 2.526, 2.542, 2.555, 2.565, 2.576, 2.584, 2.589, 2.595, 2.598, 2.598, 2.597, 2.593, 2.587, 2.578, 2.569, 2.556, 2.543, 2.528, 2.515, 2.504, 2.494, 2.489, 2.485, 2.485, 2.501,
+                            2.484, 2.475, 2.475, 2.478, 2.489, 2.498, 2.509, 2.524, 2.539, 2.553, 2.565, 2.576, 2.584, 2.589, 2.594, 2.597, 2.597, 2.596, 2.593, 2.587, 2.577, 2.569, 2.555, 2.543, 2.529, 2.515, 2.503, 2.496, 2.491, 2.485, 2.486, 2.497,
+                            2.484, 2.474, 2.474, 2.479, 2.487, 2.497, 2.509, 2.523, 2.539, 2.551, 2.563, 2.574, 2.581, 2.587, 2.592, 2.595, 2.596, 2.595, 2.591, 2.584, 2.574, 2.567, 2.554, 2.541, 2.526, 2.514, 2.503, 2.495, 2.489, 2.485, 2.486, 2.497,
+                            2.484, 2.475, 2.475, 2.478, 2.485, 2.494, 2.507, 2.522, 2.535, 2.546, 2.559, 2.568, 2.579, 2.584, 2.589, 2.592, 2.593, 2.592, 2.588, 2.579, 2.571, 2.562, 2.551, 2.537, 2.524, 2.514, 2.501, 2.493, 2.489, 2.486, 2.487, 2.498,
+                            2.485, 2.476, 2.475, 2.477, 2.485, 2.491, 2.506, 2.519, 2.531, 2.544, 2.555, 2.563, 2.571, 2.581, 2.584, 2.589, 2.589, 2.588, 2.583, 2.576, 2.566, 2.555, 2.546, 2.534, 2.522, 2.511, 2.499, 2.491, 2.488, 2.486, 2.487, 2.502,
+                            2.487, 2.477, 2.475, 2.477, 2.483, 2.489, 2.503, 2.515, 2.525, 2.541, 2.551, 2.559, 2.567, 2.573, 2.579, 2.582, 2.583, 2.582, 2.576, 2.569, 2.562, 2.549, 2.542, 2.527, 2.518, 2.505, 2.497, 2.491, 2.489, 2.487, 2.487, 2.502,
+                            2.487, 2.478, 2.475, 2.477, 2.482, 2.489, 2.497, 2.512, 2.522, 2.536, 2.544, 2.551, 2.562, 2.566, 2.573, 2.578, 2.578, 2.575, 2.571, 2.564, 2.556, 2.548, 2.536, 2.523, 2.513, 2.503, 2.493, 2.489, 2.487, 2.486, 2.487, 2.502,
+                            2.488, 2.479, 2.477, 2.478, 2.482, 2.488, 2.496, 2.505, 2.516, 2.528, 2.538, 2.547, 2.553, 2.561, 2.565, 2.569, 2.569, 2.568, 2.564, 2.558, 2.549, 2.541, 2.531, 2.517, 2.509, 2.499, 2.492, 2.488, 2.486, 2.484, 2.486, 2.503,
+                            2.492, 2.482, 2.479, 2.479, 2.482, 2.487, 2.491, 2.501, 2.512, 2.523, 2.531, 2.541, 2.549, 2.552, 2.558, 2.561, 2.562, 2.559, 2.558, 2.552, 2.542, 2.535, 2.525, 2.514, 2.505, 2.497, 2.491, 2.486, 2.485, 2.484, 2.487, 2.503,
+                            2.495, 2.483, 2.479, 2.479, 2.482, 2.487, 2.491, 2.498, 2.508, 2.515, 2.526, 2.533, 2.541, 2.547, 2.551, 2.554, 2.555, 2.554, 2.552, 2.541, 2.537, 2.527, 2.519, 2.507, 2.502, 2.495, 2.488, 2.485, 2.484, 2.485, 2.488, 2.503,
+                            2.499, 2.485, 2.483, 2.481, 2.482, 2.486, 2.489, 2.494, 2.504, 2.511, 2.519, 2.527, 2.531, 2.539, 2.542, 2.546, 2.546, 2.545, 2.539, 2.535, 2.527, 2.522, 2.509, 2.505, 2.497, 2.491, 2.486, 2.485, 2.485, 2.487, 2.491, 2.506,
+                            2.499, 2.489, 2.483, 2.481, 2.481, 2.483, 2.488, 2.491, 2.499, 2.506, 2.512, 2.519, 2.524, 2.529, 2.535, 2.537, 2.536, 2.534, 2.532, 2.525, 2.522, 2.514, 2.506, 2.499, 2.492, 2.489, 2.485, 2.484, 2.485, 2.488, 2.492, 2.506,
+                            2.507, 2.494, 2.486, 2.483, 2.482, 2.482, 2.486, 2.488, 2.495, 2.501, 2.507, 2.511, 2.517, 2.519, 2.523, 2.525, 2.525, 2.523, 2.523, 2.521, 2.514, 2.506, 2.502, 2.496, 2.491, 2.488, 2.485, 2.485, 2.487, 2.489, 2.496, 2.516,
+                            2.511, 2.503, 2.489, 2.486, 2.485, 2.485, 2.485, 2.487, 2.489, 2.495, 2.501, 2.505, 2.509, 2.514, 2.517, 2.519, 2.518, 2.517, 2.515, 2.511, 2.505, 2.501, 2.495, 2.492, 2.488, 2.486, 2.485, 2.486, 2.488, 2.492, 2.499, 2.519,
+                            2.517, 2.505, 2.494, 2.489, 2.487, 2.486, 2.486, 2.486, 2.489, 2.491, 2.496, 2.499, 2.503, 2.506, 2.508, 2.509, 2.511, 2.509, 2.507, 2.503, 2.501, 2.496, 2.493, 2.489, 2.485, 2.485, 2.486, 2.487, 2.491, 2.495, 2.505, 2.526,
+                            2.526, 2.516, 2.504, 2.494, 2.493, 2.489, 2.489, 2.489, 2.489, 2.491, 2.496, 2.498, 2.501, 2.504, 2.506, 2.506, 2.506, 2.505, 2.503, 2.501, 2.499, 2.496, 2.494, 2.491, 2.487, 2.486, 2.489, 2.492, 2.497, 2.505, 2.517, 2.528,
+                            2.529, 2.526, 2.508, 2.502, 2.501, 2.498, 2.495, 2.495, 2.495, 2.495, 2.497, 2.499, 2.501, 2.503, 2.504, 2.506, 2.505, 2.505, 2.503, 2.501, 2.499, 2.496, 2.495, 2.494, 2.492, 2.494, 2.494, 2.498, 2.504, 2.513, 2.525, 2.536
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.427, 1.425, 1.423, 1.422, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.422, 1.423, 1.424, 1.425, 1.426, 1.426, 1.426, 1.425, 1.425, 1.424, 1.422, 1.421, 1.421, 1.421, 1.421, 1.422, 1.422, 1.422, 1.424, 1.424, 1.426, 1.428,
+                            1.426, 1.424, 1.422, 1.421, 1.419, 1.419, 1.419, 1.421, 1.421, 1.422, 1.423, 1.424, 1.425, 1.426, 1.427, 1.427, 1.427, 1.426, 1.425, 1.424, 1.422, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.421, 1.422, 1.424, 1.427,
+                            1.423, 1.421, 1.421, 1.419, 1.419, 1.418, 1.419, 1.419, 1.421, 1.423, 1.425, 1.426, 1.428, 1.429, 1.431, 1.431, 1.431, 1.431, 1.429, 1.426, 1.424, 1.422, 1.421, 1.421, 1.421, 1.419, 1.419, 1.419, 1.421, 1.421, 1.422, 1.425,
+                            1.422, 1.419, 1.419, 1.419, 1.418, 1.418, 1.419, 1.421, 1.422, 1.426, 1.428, 1.429, 1.433, 1.434, 1.436, 1.436, 1.436, 1.434, 1.432, 1.429, 1.426, 1.424, 1.423, 1.422, 1.421, 1.419, 1.419, 1.419, 1.419, 1.419, 1.421, 1.425,
+                            1.422, 1.419, 1.419, 1.418, 1.418, 1.419, 1.419, 1.422, 1.425, 1.429, 1.432, 1.435, 1.436, 1.438, 1.439, 1.439, 1.441, 1.439, 1.435, 1.433, 1.429, 1.427, 1.425, 1.423, 1.422, 1.419, 1.419, 1.418, 1.418, 1.418, 1.419, 1.425,
+                            1.422, 1.419, 1.418, 1.418, 1.418, 1.419, 1.421, 1.424, 1.428, 1.432, 1.436, 1.437, 1.439, 1.442, 1.443, 1.445, 1.444, 1.443, 1.441, 1.436, 1.434, 1.431, 1.427, 1.425, 1.422, 1.421, 1.419, 1.418, 1.418, 1.418, 1.419, 1.424,
+                            1.422, 1.418, 1.417, 1.418, 1.419, 1.421, 1.423, 1.427, 1.431, 1.436, 1.438, 1.442, 1.444, 1.446, 1.448, 1.449, 1.448, 1.446, 1.445, 1.441, 1.436, 1.434, 1.429, 1.427, 1.423, 1.421, 1.419, 1.418, 1.418, 1.418, 1.418, 1.423,
+                            1.421, 1.418, 1.418, 1.418, 1.419, 1.421, 1.424, 1.429, 1.434, 1.438, 1.442, 1.445, 1.447, 1.449, 1.451, 1.452, 1.452, 1.449, 1.447, 1.445, 1.441, 1.436, 1.433, 1.429, 1.425, 1.422, 1.419, 1.419, 1.418, 1.417, 1.418, 1.423,
+                            1.421, 1.418, 1.418, 1.419, 1.419, 1.423, 1.426, 1.432, 1.436, 1.441, 1.445, 1.448, 1.449, 1.452, 1.453, 1.454, 1.454, 1.453, 1.451, 1.447, 1.444, 1.439, 1.433, 1.431, 1.427, 1.422, 1.421, 1.419, 1.418, 1.417, 1.418, 1.423,
+                            1.421, 1.418, 1.418, 1.419, 1.421, 1.423, 1.428, 1.433, 1.439, 1.443, 1.448, 1.449, 1.453, 1.454, 1.455, 1.456, 1.456, 1.454, 1.453, 1.449, 1.446, 1.441, 1.437, 1.433, 1.429, 1.423, 1.421, 1.419, 1.418, 1.416, 1.417, 1.423,
+                            1.421, 1.417, 1.417, 1.419, 1.422, 1.424, 1.429, 1.435, 1.441, 1.444, 1.449, 1.453, 1.454, 1.456, 1.458, 1.459, 1.458, 1.456, 1.454, 1.451, 1.448, 1.442, 1.439, 1.435, 1.429, 1.426, 1.421, 1.419, 1.418, 1.416, 1.417, 1.422,
+                            1.419, 1.418, 1.417, 1.419, 1.422, 1.425, 1.429, 1.436, 1.442, 1.446, 1.451, 1.454, 1.456, 1.458, 1.461, 1.461, 1.461, 1.459, 1.456, 1.453, 1.451, 1.446, 1.441, 1.436, 1.431, 1.427, 1.422, 1.419, 1.418, 1.416, 1.417, 1.422,
+                            1.419, 1.418, 1.418, 1.421, 1.423, 1.426, 1.431, 1.437, 1.444, 1.449, 1.452, 1.456, 1.458, 1.461, 1.462, 1.463, 1.463, 1.461, 1.458, 1.454, 1.452, 1.447, 1.443, 1.438, 1.432, 1.428, 1.423, 1.421, 1.419, 1.417, 1.417, 1.421,
+                            1.419, 1.418, 1.417, 1.421, 1.423, 1.428, 1.432, 1.439, 1.445, 1.451, 1.453, 1.457, 1.459, 1.462, 1.464, 1.465, 1.465, 1.463, 1.461, 1.457, 1.453, 1.449, 1.444, 1.441, 1.432, 1.429, 1.425, 1.421, 1.419, 1.417, 1.418, 1.422,
+                            1.418, 1.417, 1.417, 1.419, 1.423, 1.428, 1.433, 1.439, 1.446, 1.451, 1.453, 1.457, 1.461, 1.464, 1.465, 1.466, 1.466, 1.464, 1.462, 1.459, 1.454, 1.451, 1.445, 1.441, 1.436, 1.429, 1.425, 1.422, 1.421, 1.417, 1.417, 1.423,
+                            1.417, 1.416, 1.416, 1.419, 1.423, 1.428, 1.433, 1.441, 1.446, 1.451, 1.454, 1.458, 1.461, 1.463, 1.465, 1.466, 1.466, 1.465, 1.463, 1.459, 1.454, 1.451, 1.446, 1.441, 1.437, 1.431, 1.426, 1.422, 1.421, 1.418, 1.418, 1.423,
+                            1.417, 1.416, 1.417, 1.418, 1.423, 1.428, 1.433, 1.439, 1.445, 1.451, 1.453, 1.457, 1.461, 1.463, 1.465, 1.466, 1.466, 1.464, 1.462, 1.459, 1.454, 1.451, 1.446, 1.441, 1.437, 1.431, 1.426, 1.422, 1.419, 1.417, 1.417, 1.422,
+                            1.417, 1.416, 1.416, 1.418, 1.422, 1.428, 1.433, 1.438, 1.444, 1.449, 1.453, 1.456, 1.459, 1.462, 1.464, 1.465, 1.465, 1.463, 1.461, 1.458, 1.453, 1.449, 1.445, 1.441, 1.435, 1.429, 1.426, 1.421, 1.419, 1.417, 1.417, 1.422,
+                            1.418, 1.416, 1.416, 1.418, 1.421, 1.426, 1.432, 1.438, 1.443, 1.447, 1.451, 1.454, 1.458, 1.459, 1.462, 1.463, 1.463, 1.462, 1.459, 1.455, 1.451, 1.447, 1.443, 1.439, 1.434, 1.429, 1.425, 1.421, 1.419, 1.417, 1.417, 1.422,
+                            1.418, 1.416, 1.416, 1.418, 1.421, 1.425, 1.431, 1.435, 1.442, 1.445, 1.449, 1.452, 1.455, 1.458, 1.458, 1.461, 1.461, 1.459, 1.456, 1.453, 1.449, 1.445, 1.442, 1.436, 1.433, 1.427, 1.425, 1.421, 1.419, 1.418, 1.418, 1.422,
+                            1.419, 1.416, 1.415, 1.417, 1.419, 1.424, 1.429, 1.434, 1.439, 1.443, 1.446, 1.449, 1.452, 1.454, 1.456, 1.457, 1.457, 1.456, 1.453, 1.451, 1.447, 1.443, 1.441, 1.435, 1.431, 1.426, 1.424, 1.421, 1.419, 1.418, 1.418, 1.422,
+                            1.419, 1.416, 1.415, 1.416, 1.419, 1.422, 1.426, 1.433, 1.437, 1.441, 1.444, 1.447, 1.449, 1.452, 1.453, 1.455, 1.455, 1.453, 1.451, 1.447, 1.444, 1.441, 1.438, 1.432, 1.428, 1.424, 1.421, 1.419, 1.418, 1.417, 1.417, 1.421,
+                            1.419, 1.416, 1.415, 1.416, 1.418, 1.421, 1.425, 1.431, 1.435, 1.438, 1.442, 1.445, 1.446, 1.449, 1.451, 1.451, 1.451, 1.451, 1.447, 1.445, 1.443, 1.439, 1.434, 1.431, 1.427, 1.422, 1.421, 1.418, 1.417, 1.417, 1.417, 1.421,
+                            1.418, 1.416, 1.415, 1.416, 1.417, 1.421, 1.423, 1.428, 1.433, 1.437, 1.439, 1.442, 1.444, 1.446, 1.448, 1.449, 1.449, 1.447, 1.445, 1.443, 1.439, 1.437, 1.432, 1.429, 1.425, 1.422, 1.419, 1.417, 1.417, 1.416, 1.416, 1.419,
+                            1.418, 1.416, 1.416, 1.416, 1.417, 1.421, 1.422, 1.426, 1.429, 1.433, 1.436, 1.438, 1.441, 1.443, 1.445, 1.446, 1.445, 1.445, 1.443, 1.439, 1.437, 1.434, 1.431, 1.427, 1.424, 1.421, 1.419, 1.417, 1.417, 1.416, 1.416, 1.421,
+                            1.419, 1.417, 1.416, 1.416, 1.417, 1.421, 1.422, 1.424, 1.427, 1.429, 1.432, 1.436, 1.437, 1.439, 1.442, 1.443, 1.443, 1.441, 1.439, 1.437, 1.434, 1.431, 1.429, 1.425, 1.422, 1.421, 1.419, 1.417, 1.416, 1.416, 1.417, 1.419,
+                            1.421, 1.418, 1.416, 1.417, 1.418, 1.421, 1.421, 1.423, 1.424, 1.427, 1.429, 1.432, 1.434, 1.436, 1.438, 1.439, 1.439, 1.438, 1.436, 1.434, 1.431, 1.429, 1.426, 1.423, 1.422, 1.421, 1.418, 1.417, 1.417, 1.417, 1.417, 1.421,
+                            1.423, 1.419, 1.418, 1.418, 1.419, 1.419, 1.421, 1.422, 1.423, 1.424, 1.427, 1.429, 1.432, 1.432, 1.434, 1.435, 1.435, 1.434, 1.433, 1.431, 1.429, 1.426, 1.424, 1.422, 1.421, 1.419, 1.418, 1.417, 1.417, 1.417, 1.418, 1.421,
+                            1.425, 1.421, 1.419, 1.419, 1.419, 1.421, 1.421, 1.421, 1.421, 1.423, 1.424, 1.426, 1.428, 1.431, 1.431, 1.432, 1.432, 1.431, 1.431, 1.428, 1.425, 1.425, 1.422, 1.421, 1.419, 1.419, 1.418, 1.418, 1.418, 1.418, 1.419, 1.425,
+                            1.426, 1.422, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.421, 1.422, 1.424, 1.426, 1.427, 1.428, 1.429, 1.429, 1.429, 1.427, 1.424, 1.423, 1.422, 1.421, 1.419, 1.418, 1.418, 1.418, 1.418, 1.418, 1.418, 1.419, 1.426,
+                            1.428, 1.425, 1.421, 1.421, 1.421, 1.421, 1.421, 1.419, 1.419, 1.421, 1.422, 1.423, 1.424, 1.426, 1.426, 1.426, 1.426, 1.425, 1.424, 1.424, 1.422, 1.422, 1.421, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.419, 1.423, 1.426,
+                            1.429, 1.427, 1.424, 1.422, 1.422, 1.422, 1.421, 1.421, 1.421, 1.422, 1.422, 1.422, 1.424, 1.425, 1.426, 1.426, 1.425, 1.425, 1.424, 1.423, 1.422, 1.422, 1.421, 1.421, 1.421, 1.421, 1.419, 1.419, 1.421, 1.422, 1.424, 1.426
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    2.964, 2.872, 2.691, 2.544, 2.416, 2.302, 2.196, 2.093, 2.006, 1.928, 1.852, 1.801, 1.769, 1.752, 1.743, 1.743, 1.743, 1.746, 1.759, 1.784, 1.824, 1.888, 1.968, 2.052, 2.149, 2.253, 2.359, 2.483, 2.626, 2.785, 2.988, 3.051,
+                    2.872, 2.748, 2.583, 2.442, 2.313, 2.201, 2.104, 2.012, 1.928, 1.852, 1.791, 1.742, 1.701, 1.671, 1.651, 1.643, 1.643, 1.659, 1.685, 1.721, 1.768, 1.824, 1.888, 1.971, 2.068, 2.152, 2.259, 2.381, 2.514, 2.669, 2.853, 2.988,
+                    2.761, 2.655, 2.497, 2.356, 2.226, 2.114, 2.012, 1.928, 1.845, 1.769, 1.707, 1.653, 1.612, 1.583, 1.562, 1.556, 1.556, 1.572, 1.599, 1.635, 1.681, 1.742, 1.806, 1.888, 1.971, 2.068, 2.175, 2.292, 2.431, 2.576, 2.747, 2.853,
+                    2.679, 2.571, 2.415, 2.275, 2.151, 2.035, 1.936, 1.845, 1.769, 1.689, 1.623, 1.572, 1.532, 1.501, 1.481, 1.473, 1.473, 1.492, 1.517, 1.556, 1.599, 1.659, 1.731, 1.806, 1.895, 1.992, 2.101, 2.218, 2.349, 2.493, 2.664, 2.753,
+                    2.609, 2.492, 2.339, 2.204, 2.079, 1.971, 1.865, 1.772, 1.689, 1.619, 1.551, 1.499, 1.457, 1.423, 1.405, 1.397, 1.397, 1.411, 1.438, 1.477, 1.525, 1.585, 1.659, 1.731, 1.823, 1.922, 2.027, 2.148, 2.275, 2.422, 2.586, 2.683,
+                    2.545, 2.426, 2.279, 2.139, 2.014, 1.903, 1.799, 1.702, 1.619, 1.551, 1.482, 1.427, 1.385, 1.353, 1.331, 1.325, 1.325, 1.338, 1.364, 1.403, 1.455, 1.522, 1.585, 1.665, 1.757, 1.858, 1.963, 2.081, 2.207, 2.356, 2.518, 2.615,
+                    2.489, 2.367, 2.218, 2.079, 1.956, 1.844, 1.739, 1.642, 1.559, 1.482, 1.426, 1.363, 1.321, 1.287, 1.266, 1.259, 1.259, 1.274, 1.301, 1.339, 1.395, 1.455, 1.523, 1.606, 1.697, 1.797, 1.905, 2.024, 2.154, 2.296, 2.455, 2.563,
+                    2.439, 2.316, 2.164, 2.028, 1.906, 1.793, 1.686, 1.589, 1.505, 1.427, 1.363, 1.308, 1.261, 1.229, 1.207, 1.202, 1.202, 1.215, 1.242, 1.283, 1.339, 1.395, 1.467, 1.551, 1.639, 1.742, 1.851, 1.972, 2.104, 2.243, 2.402, 2.515,
+                    2.398, 2.262, 2.116, 1.982, 1.861, 1.745, 1.639, 1.541, 1.456, 1.377, 1.308, 1.261, 1.208, 1.177, 1.157, 1.153, 1.153, 1.167, 1.191, 1.233, 1.283, 1.343, 1.418, 1.499, 1.591, 1.696, 1.804, 1.928, 2.057, 2.194, 2.352, 2.471,
+                    2.363, 2.222, 2.078, 1.942, 1.818, 1.706, 1.597, 1.501, 1.412, 1.334, 1.266, 1.208, 1.171, 1.134, 1.113, 1.109, 1.109, 1.123, 1.149, 1.191, 1.233, 1.296, 1.371, 1.457, 1.546, 1.654, 1.768, 1.886, 2.014, 2.155, 2.312, 2.436,
+                    2.334, 2.188, 2.042, 1.909, 1.783, 1.668, 1.561, 1.464, 1.374, 1.295, 1.228, 1.171, 1.134, 1.098, 1.076, 1.072, 1.072, 1.087, 1.119, 1.149, 1.196, 1.259, 1.332, 1.419, 1.514, 1.616, 1.728, 1.849, 1.981, 2.123, 2.276, 2.406,
+                    2.306, 2.159, 2.015, 1.881, 1.753, 1.639, 1.533, 1.434, 1.341, 1.263, 1.195, 1.139, 1.098, 1.074, 1.046, 1.044, 1.045, 1.059, 1.087, 1.119, 1.165, 1.227, 1.302, 1.387, 1.482, 1.586, 1.698, 1.819, 1.953, 2.093, 2.248, 2.383,
+                    2.291, 2.141, 1.991, 1.856, 1.732, 1.615, 1.508, 1.409, 1.318, 1.238, 1.171, 1.114, 1.074, 1.046, 1.027, 1.023, 1.025, 1.043, 1.059, 1.095, 1.142, 1.203, 1.278, 1.362, 1.456, 1.559, 1.673, 1.796, 1.928, 2.071, 2.225, 2.359,
+                    2.279, 2.118, 1.972, 1.839, 1.715, 1.599, 1.488, 1.389, 1.298, 1.219, 1.153, 1.097, 1.057, 1.027, 1.018, 1.009, 1.013, 1.025, 1.044, 1.078, 1.125, 1.186, 1.258, 1.342, 1.438, 1.541, 1.655, 1.779, 1.909, 2.053, 2.211, 2.351,
+                    2.274, 2.108, 1.963, 1.831, 1.706, 1.588, 1.477, 1.376, 1.288, 1.207, 1.139, 1.086, 1.049, 1.021, 1.005, 1.002, 1.004, 1.013, 1.035, 1.069, 1.116, 1.176, 1.246, 1.331, 1.427, 1.531, 1.645, 1.767, 1.899, 2.045, 2.197, 2.351,
+                    2.274, 2.106, 1.961, 1.827, 1.701, 1.585, 1.474, 1.374, 1.285, 1.206, 1.139, 1.085, 1.047, 1.019, 1.003, 1.001, 1.001, 1.012, 1.033, 1.067, 1.113, 1.173, 1.245, 1.329, 1.423, 1.529, 1.642, 1.765, 1.897, 2.042, 2.196, 2.349,
+                    2.274, 2.108, 1.961, 1.827, 1.701, 1.585, 1.474, 1.374, 1.285, 1.206, 1.139, 1.085, 1.047, 1.021, 1.005, 1.001, 1.004, 1.012, 1.033, 1.068, 1.113, 1.173, 1.246, 1.329, 1.423, 1.529, 1.642, 1.766, 1.897, 2.042, 2.198, 2.349,
+                    2.278, 2.116, 1.968, 1.833, 1.707, 1.591, 1.482, 1.382, 1.291, 1.214, 1.147, 1.091, 1.055, 1.028, 1.016, 1.006, 1.012, 1.018, 1.039, 1.074, 1.121, 1.182, 1.255, 1.339, 1.433, 1.538, 1.651, 1.777, 1.911, 2.051, 2.207, 2.351,
+                    2.283, 2.127, 1.979, 1.846, 1.723, 1.605, 1.496, 1.397, 1.309, 1.229, 1.162, 1.108, 1.067, 1.041, 1.027, 1.018, 1.018, 1.036, 1.051, 1.087, 1.136, 1.197, 1.269, 1.354, 1.448, 1.554, 1.664, 1.789, 1.922, 2.065, 2.222, 2.365,
+                    2.298, 2.145, 1.999, 1.865, 1.744, 1.627, 1.518, 1.421, 1.331, 1.251, 1.183, 1.129, 1.087, 1.065, 1.041, 1.036, 1.036, 1.051, 1.074, 1.107, 1.158, 1.219, 1.292, 1.378, 1.471, 1.575, 1.687, 1.809, 1.942, 2.085, 2.239, 2.378,
+                    2.315, 2.174, 2.024, 1.893, 1.768, 1.652, 1.543, 1.445, 1.355, 1.278, 1.211, 1.155, 1.116, 1.087, 1.066, 1.061, 1.061, 1.074, 1.105, 1.137, 1.186, 1.248, 1.322, 1.405, 1.498, 1.602, 1.713, 1.835, 1.965, 2.109, 2.267, 2.399,
+                    2.341, 2.206, 2.057, 1.923, 1.799, 1.685, 1.576, 1.479, 1.392, 1.312, 1.244, 1.187, 1.154, 1.116, 1.096, 1.092, 1.092, 1.106, 1.137, 1.173, 1.221, 1.282, 1.356, 1.439, 1.532, 1.635, 1.747, 1.869, 1.997, 2.141, 2.298, 2.425,
+                    2.375, 2.244, 2.098, 1.965, 1.839, 1.722, 1.614, 1.519, 1.434, 1.355, 1.288, 1.234, 1.187, 1.155, 1.136, 1.132, 1.132, 1.147, 1.173, 1.219, 1.263, 1.324, 1.398, 1.479, 1.571, 1.674, 1.784, 1.904, 2.035, 2.177, 2.336, 2.455,
+                    2.414, 2.286, 2.144, 2.011, 1.883, 1.767, 1.661, 1.566, 1.479, 1.401, 1.335, 1.286, 1.234, 1.202, 1.183, 1.178, 1.178, 1.195, 1.222, 1.263, 1.313, 1.372, 1.444, 1.526, 1.618, 1.718, 1.827, 1.951, 2.081, 2.221, 2.379, 2.498,
+                    2.463, 2.339, 2.191, 2.056, 1.931, 1.819, 1.712, 1.616, 1.529, 1.452, 1.392, 1.335, 1.286, 1.254, 1.235, 1.232, 1.232, 1.248, 1.275, 1.313, 1.371, 1.425, 1.495, 1.576, 1.671, 1.768, 1.877, 1.999, 2.128, 2.269, 2.428, 2.541,
+                    2.514, 2.396, 2.247, 2.112, 1.988, 1.873, 1.766, 1.671, 1.588, 1.513, 1.452, 1.392, 1.348, 1.316, 1.298, 1.292, 1.292, 1.307, 1.336, 1.373, 1.425, 1.486, 1.552, 1.636, 1.728, 1.826, 1.933, 2.051, 2.183, 2.327, 2.488, 2.587,
+                    2.573, 2.459, 2.307, 2.171, 2.049, 1.931, 1.828, 1.731, 1.649, 1.582, 1.513, 1.459, 1.415, 1.381, 1.363, 1.358, 1.358, 1.373, 1.399, 1.439, 1.486, 1.552, 1.617, 1.696, 1.787, 1.888, 1.995, 2.112, 2.244, 2.391, 2.552, 2.652,
+                    2.635, 2.525, 2.377, 2.239, 2.111, 1.996, 1.895, 1.799, 1.719, 1.649, 1.582, 1.531, 1.486, 1.454, 1.434, 1.429, 1.429, 1.444, 1.469, 1.507, 1.555, 1.617, 1.692, 1.766, 1.854, 1.954, 2.065, 2.181, 2.313, 2.459, 2.623, 2.722,
+                    2.714, 2.604, 2.452, 2.313, 2.188, 2.071, 1.966, 1.876, 1.799, 1.719, 1.656, 1.604, 1.562, 1.529, 1.511, 1.504, 1.504, 1.519, 1.544, 1.583, 1.632, 1.692, 1.766, 1.839, 1.929, 2.029, 2.138, 2.259, 2.391, 2.539, 2.712, 2.811,
+                    2.809, 2.698, 2.537, 2.396, 2.277, 2.163, 2.053, 1.965, 1.876, 1.799, 1.741, 1.688, 1.643, 1.613, 1.592, 1.586, 1.586, 1.601, 1.628, 1.666, 1.715, 1.773, 1.839, 1.927, 2.012, 2.111, 2.222, 2.342, 2.477, 2.625, 2.811, 2.926,
+                    2.921, 2.809, 2.637, 2.493, 2.376, 2.256, 2.149, 2.053, 1.966, 1.893, 1.832, 1.778, 1.736, 1.708, 1.687, 1.681, 1.681, 1.696, 1.721, 1.757, 1.806, 1.864, 1.929, 2.012, 2.106, 2.199, 2.313, 2.437, 2.577, 2.731, 2.926, 3.051,
+                    3.029, 2.921, 2.745, 2.591, 2.474, 2.355, 2.246, 2.146, 2.049, 1.966, 1.893, 1.832, 1.799, 1.776, 1.768, 1.768, 1.768, 1.771, 1.783, 1.809, 1.864, 1.929, 2.012, 2.097, 2.195, 2.297, 2.412, 2.539, 2.682, 2.846, 3.051, 3.123
+                ],
+                "sigma": 0.00463,
+                "sigma_Cb": 0.00149
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "lo_max": 1000,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2498,
+                        "ccm":
+                        [
+                            1.58731, -0.18011, -0.40721,
+                            -0.60639, 2.03422, -0.42782,
+                            -0.19612, -1.69203, 2.88815
+                        ]
+                    },
+                    {
+                        "ct": 2811,
+                        "ccm":
+                        [
+                            1.61593, -0.33164, -0.28429,
+                            -0.55048, 1.97779, -0.42731,
+                            -0.12042, -1.42847, 2.54889
+                        ]
+                    },
+                    {
+                        "ct": 2911,
+                        "ccm":
+                        [
+                            1.62771, -0.41282, -0.21489,
+                            -0.57991, 2.04176, -0.46186,
+                            -0.07613, -1.13359, 2.20972
+                        ]
+                    },
+                    {
+                        "ct": 2919,
+                        "ccm":
+                        [
+                            1.62661, -0.37736, -0.24925,
+                            -0.52519, 1.95233, -0.42714,
+                            -0.10842, -1.34929, 2.45771
+                        ]
+                    },
+                    {
+                        "ct": 3627,
+                        "ccm":
+                        [
+                            1.70385, -0.57231, -0.13154,
+                            -0.47763, 1.85998, -0.38235,
+                            -0.07467, -0.82678, 1.90145
+                        ]
+                    },
+                    {
+                        "ct": 4600,
+                        "ccm":
+                        [
+                            1.68486, -0.61085, -0.07402,
+                            -0.41927, 2.04016, -0.62089,
+                            -0.08633, -0.67672, 1.76305
+                        ]
+                    },
+                    {
+                        "ct": 5716,
+                        "ccm":
+                        [
+                            1.80439, -0.73699, -0.06739,
+                            -0.36073, 1.83327, -0.47255,
+                            -0.08378, -0.56403, 1.64781
+                        ]
+                    },
+                    {
+                        "ct": 8575,
+                        "ccm":
+                        [
+                            1.89357, -0.76427, -0.12931,
+                            -0.27399, 2.15605, -0.88206,
+                            -0.12035, -0.68256, 1.80292
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx296.json b/src/ipa/rpi/pisp/data/imx296.json
new file mode 100644
index 000000000..d9dde898e
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx296.json
@@ -0,0 +1,1194 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 3840
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 4724,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 860,
+                "reference_Y": 14551
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.751
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 226,
+                "slope": 0.01032
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2875.0, 0.4699, 0.3209,
+                    3610.0, 0.4089, 0.4265,
+                    4640.0, 0.3281, 0.5417,
+                    5912.0, 0.2992, 0.5771,
+                    7630.0, 0.2285, 0.6524
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.01783,
+                "transverse_neg": 0.02154
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.16,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.084, 2.084, 2.085, 2.085, 2.085, 2.087, 2.088, 2.087, 2.086, 2.082, 2.082, 2.084, 2.086, 2.088, 2.088, 2.088, 2.087, 2.088, 2.088, 2.091, 2.092, 2.093, 2.093, 2.093, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.091, 2.088,
+                            2.086, 2.086, 2.087, 2.088, 2.089, 2.089, 2.091, 2.089, 2.087, 2.086, 2.087, 2.088, 2.091, 2.089, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.093, 2.093, 2.094, 2.095, 2.094, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.093,
+                            2.087, 2.087, 2.088, 2.091, 2.091, 2.091, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.092, 2.092, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.097, 2.097, 2.097, 2.097, 2.096,
+                            2.089, 2.088, 2.089, 2.091, 2.091, 2.092, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.092, 2.092, 2.092, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.097, 2.098, 2.097, 2.097, 2.097,
+                            2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.091, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.095, 2.096, 2.096, 2.097, 2.099, 2.098, 2.097, 2.097, 2.097,
+                            2.091, 2.091, 2.092, 2.093, 2.093, 2.093, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.095, 2.096, 2.096, 2.097, 2.097, 2.099, 2.099, 2.099, 2.098, 2.097,
+                            2.092, 2.092, 2.092, 2.093, 2.093, 2.092, 2.091, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.095, 2.096, 2.096, 2.097, 2.097, 2.099, 2.099, 2.101, 2.099, 2.098,
+                            2.092, 2.092, 2.093, 2.093, 2.093, 2.092, 2.091, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.092, 2.094, 2.095, 2.096, 2.097, 2.098, 2.098, 2.098, 2.101, 2.101, 2.099, 2.098,
+                            2.092, 2.092, 2.093, 2.093, 2.094, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.089, 2.089, 2.091, 2.092, 2.092, 2.092, 2.092, 2.094, 2.096, 2.096, 2.097, 2.098, 2.099, 2.099, 2.099, 2.099, 2.099, 2.097,
+                            2.093, 2.094, 2.094, 2.094, 2.095, 2.093, 2.092, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.094, 2.096, 2.096, 2.097, 2.098, 2.098, 2.101, 2.101, 2.099, 2.099, 2.099,
+                            2.094, 2.094, 2.094, 2.095, 2.095, 2.095, 2.091, 2.089, 2.091, 2.089, 2.089, 2.089, 2.091, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.093, 2.095, 2.096, 2.097, 2.098, 2.098, 2.099, 2.101, 2.101, 2.099, 2.099,
+                            2.095, 2.094, 2.094, 2.095, 2.096, 2.095, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.093, 2.093, 2.093, 2.093, 2.094, 2.096, 2.097, 2.098, 2.099, 2.101, 2.101, 2.102, 2.101, 2.099,
+                            2.095, 2.095, 2.095, 2.095, 2.095, 2.095, 2.092, 2.089, 2.089, 2.088, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.093, 2.093, 2.093, 2.093, 2.095, 2.096, 2.099, 2.099, 2.101, 2.102, 2.103, 2.102, 2.101,
+                            2.095, 2.095, 2.095, 2.095, 2.095, 2.094, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.093, 2.093, 2.093, 2.092, 2.092, 2.094, 2.094, 2.094, 2.096, 2.096, 2.098, 2.099, 2.102, 2.103, 2.103, 2.102, 2.102,
+                            2.095, 2.095, 2.095, 2.096, 2.096, 2.094, 2.093, 2.091, 2.091, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.092, 2.093, 2.094, 2.094, 2.095, 2.096, 2.097, 2.098, 2.099, 2.103, 2.103, 2.103, 2.101, 2.101,
+                            2.095, 2.096, 2.096, 2.097, 2.096, 2.095, 2.093, 2.092, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.092, 2.092, 2.094, 2.093, 2.093, 2.094, 2.095, 2.096, 2.096, 2.097, 2.099, 2.101, 2.103, 2.103, 2.103, 2.101, 2.099,
+                            2.096, 2.096, 2.097, 2.096, 2.097, 2.096, 2.094, 2.092, 2.092, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.093, 2.094, 2.093, 2.093, 2.093, 2.095, 2.096, 2.097, 2.099, 2.099, 2.101, 2.103, 2.103, 2.102, 2.101, 2.101,
+                            2.096, 2.096, 2.097, 2.097, 2.097, 2.096, 2.094, 2.093, 2.092, 2.092, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.094, 2.093, 2.093, 2.094, 2.095, 2.096, 2.097, 2.099, 2.101, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101,
+                            2.097, 2.096, 2.097, 2.097, 2.097, 2.097, 2.095, 2.093, 2.093, 2.093, 2.093, 2.092, 2.091, 2.091, 2.092, 2.092, 2.093, 2.094, 2.093, 2.093, 2.093, 2.095, 2.096, 2.097, 2.099, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101, 2.101,
+                            2.098, 2.097, 2.096, 2.097, 2.097, 2.097, 2.095, 2.094, 2.094, 2.094, 2.092, 2.092, 2.092, 2.092, 2.092, 2.092, 2.094, 2.095, 2.095, 2.094, 2.093, 2.095, 2.096, 2.099, 2.101, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101, 2.102,
+                            2.098, 2.097, 2.096, 2.096, 2.097, 2.097, 2.095, 2.094, 2.095, 2.093, 2.093, 2.092, 2.092, 2.092, 2.094, 2.094, 2.096, 2.095, 2.095, 2.095, 2.095, 2.096, 2.098, 2.099, 2.099, 2.101, 2.102, 2.103, 2.102, 2.102, 2.101, 2.102,
+                            2.098, 2.097, 2.097, 2.098, 2.097, 2.096, 2.095, 2.095, 2.095, 2.094, 2.093, 2.093, 2.094, 2.094, 2.094, 2.095, 2.096, 2.096, 2.096, 2.095, 2.097, 2.097, 2.098, 2.099, 2.099, 2.101, 2.101, 2.103, 2.104, 2.103, 2.102, 2.101,
+                            2.099, 2.098, 2.098, 2.098, 2.097, 2.096, 2.096, 2.095, 2.095, 2.095, 2.095, 2.095, 2.094, 2.094, 2.094, 2.094, 2.096, 2.097, 2.097, 2.097, 2.097, 2.098, 2.099, 2.101, 2.101, 2.101, 2.101, 2.104, 2.105, 2.105, 2.103, 2.102,
+                            2.101, 2.099, 2.099, 2.099, 2.099, 2.098, 2.097, 2.097, 2.097, 2.096, 2.096, 2.095, 2.095, 2.095, 2.095, 2.095, 2.096, 2.098, 2.098, 2.097, 2.097, 2.098, 2.099, 2.101, 2.101, 2.102, 2.103, 2.104, 2.105, 2.105, 2.104, 2.103,
+                            2.102, 2.102, 2.099, 2.098, 2.099, 2.099, 2.099, 2.098, 2.097, 2.097, 2.097, 2.097, 2.097, 2.096, 2.096, 2.097, 2.098, 2.098, 2.099, 2.099, 2.099, 2.101, 2.101, 2.102, 2.104, 2.105, 2.106, 2.106, 2.106, 2.104, 2.104, 2.104,
+                            2.102, 2.101, 2.099, 2.099, 2.099, 2.101, 2.101, 2.101, 2.099, 2.098, 2.098, 2.098, 2.098, 2.098, 2.098, 2.098, 2.099, 2.099, 2.099, 2.099, 2.101, 2.101, 2.102, 2.103, 2.105, 2.106, 2.106, 2.106, 2.106, 2.105, 2.104, 2.104,
+                            2.099, 2.099, 2.099, 2.098, 2.098, 2.099, 2.101, 2.101, 2.099, 2.098, 2.097, 2.098, 2.098, 2.099, 2.098, 2.098, 2.099, 2.099, 2.101, 2.101, 2.101, 2.101, 2.102, 2.104, 2.105, 2.105, 2.105, 2.106, 2.106, 2.104, 2.104, 2.103,
+                            2.096, 2.097, 2.097, 2.097, 2.097, 2.099, 2.099, 2.099, 2.099, 2.097, 2.097, 2.098, 2.098, 2.099, 2.098, 2.097, 2.097, 2.099, 2.101, 2.101, 2.101, 2.101, 2.101, 2.103, 2.105, 2.105, 2.105, 2.104, 2.104, 2.103, 2.101, 2.101,
+                            2.096, 2.096, 2.096, 2.097, 2.097, 2.098, 2.098, 2.099, 2.097, 2.096, 2.096, 2.097, 2.098, 2.098, 2.097, 2.097, 2.096, 2.098, 2.098, 2.099, 2.101, 2.101, 2.101, 2.102, 2.104, 2.105, 2.104, 2.104, 2.103, 2.101, 2.099, 2.098,
+                            2.096, 2.096, 2.096, 2.096, 2.097, 2.097, 2.097, 2.097, 2.097, 2.097, 2.096, 2.097, 2.098, 2.097, 2.097, 2.096, 2.096, 2.098, 2.098, 2.098, 2.099, 2.099, 2.101, 2.101, 2.103, 2.103, 2.104, 2.104, 2.102, 2.101, 2.099, 2.098,
+                            2.097, 2.096, 2.095, 2.096, 2.098, 2.098, 2.098, 2.098, 2.097, 2.098, 2.097, 2.097, 2.097, 2.097, 2.096, 2.096, 2.096, 2.097, 2.097, 2.098, 2.099, 2.099, 2.099, 2.101, 2.102, 2.103, 2.104, 2.104, 2.104, 2.101, 2.099, 2.098,
+                            2.097, 2.096, 2.095, 2.097, 2.099, 2.099, 2.099, 2.099, 2.099, 2.099, 2.098, 2.098, 2.097, 2.096, 2.096, 2.097, 2.097, 2.098, 2.097, 2.099, 2.101, 2.099, 2.099, 2.099, 2.102, 2.102, 2.104, 2.105, 2.105, 2.102, 2.099, 2.098
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.431, 3.437, 3.439, 3.439, 3.436, 3.438, 3.441, 3.441, 3.441, 3.441, 3.442, 3.443, 3.443, 3.444, 3.446, 3.448, 3.451, 3.451, 3.452, 3.451, 3.449, 3.449, 3.452, 3.453, 3.454, 3.454, 3.453, 3.456, 3.456, 3.456, 3.451, 3.448,
+                            3.445, 3.446, 3.445, 3.449, 3.453, 3.451, 3.451, 3.446, 3.447, 3.446, 3.447, 3.451, 3.453, 3.455, 3.454, 3.453, 3.453, 3.454, 3.455, 3.456, 3.457, 3.459, 3.461, 3.462, 3.463, 3.463, 3.465, 3.466, 3.467, 3.465, 3.459, 3.457,
+                            3.449, 3.449, 3.449, 3.454, 3.455, 3.454, 3.453, 3.451, 3.451, 3.448, 3.451, 3.451, 3.455, 3.456, 3.457, 3.456, 3.456, 3.458, 3.457, 3.459, 3.459, 3.461, 3.464, 3.467, 3.467, 3.466, 3.468, 3.469, 3.471, 3.468, 3.465, 3.462,
+                            3.451, 3.448, 3.451, 3.453, 3.457, 3.455, 3.454, 3.449, 3.449, 3.448, 3.449, 3.449, 3.455, 3.455, 3.456, 3.455, 3.454, 3.455, 3.455, 3.457, 3.458, 3.458, 3.461, 3.464, 3.466, 3.468, 3.469, 3.469, 3.469, 3.468, 3.465, 3.463,
+                            3.449, 3.449, 3.451, 3.453, 3.456, 3.455, 3.452, 3.449, 3.448, 3.447, 3.446, 3.448, 3.451, 3.452, 3.454, 3.455, 3.455, 3.454, 3.457, 3.458, 3.458, 3.459, 3.461, 3.464, 3.464, 3.466, 3.467, 3.469, 3.469, 3.467, 3.463, 3.459,
+                            3.449, 3.451, 3.452, 3.454, 3.455, 3.454, 3.452, 3.449, 3.447, 3.447, 3.446, 3.449, 3.449, 3.451, 3.452, 3.452, 3.452, 3.452, 3.454, 3.455, 3.457, 3.459, 3.461, 3.464, 3.464, 3.466, 3.465, 3.468, 3.468, 3.469, 3.465, 3.462,
+                            3.451, 3.451, 3.452, 3.453, 3.453, 3.453, 3.451, 3.449, 3.449, 3.447, 3.446, 3.447, 3.448, 3.451, 3.451, 3.451, 3.453, 3.452, 3.452, 3.452, 3.457, 3.458, 3.461, 3.463, 3.464, 3.465, 3.464, 3.466, 3.468, 3.469, 3.466, 3.463,
+                            3.451, 3.451, 3.451, 3.454, 3.453, 3.453, 3.451, 3.448, 3.448, 3.444, 3.444, 3.444, 3.448, 3.449, 3.449, 3.448, 3.449, 3.449, 3.451, 3.452, 3.454, 3.457, 3.461, 3.462, 3.464, 3.466, 3.466, 3.467, 3.468, 3.469, 3.466, 3.465,
+                            3.451, 3.451, 3.452, 3.455, 3.454, 3.453, 3.449, 3.448, 3.447, 3.447, 3.444, 3.446, 3.446, 3.446, 3.446, 3.447, 3.449, 3.449, 3.451, 3.452, 3.455, 3.457, 3.461, 3.462, 3.464, 3.466, 3.466, 3.468, 3.469, 3.468, 3.465, 3.462,
+                            3.453, 3.452, 3.454, 3.456, 3.455, 3.453, 3.449, 3.447, 3.446, 3.446, 3.445, 3.448, 3.447, 3.446, 3.445, 3.446, 3.448, 3.448, 3.449, 3.453, 3.455, 3.457, 3.459, 3.461, 3.464, 3.466, 3.467, 3.468, 3.468, 3.467, 3.465, 3.463,
+                            3.453, 3.453, 3.454, 3.456, 3.456, 3.451, 3.448, 3.447, 3.447, 3.446, 3.445, 3.446, 3.446, 3.446, 3.446, 3.446, 3.448, 3.448, 3.449, 3.452, 3.454, 3.456, 3.459, 3.459, 3.461, 3.465, 3.466, 3.468, 3.468, 3.468, 3.467, 3.465,
+                            3.451, 3.451, 3.452, 3.455, 3.456, 3.452, 3.448, 3.446, 3.446, 3.444, 3.446, 3.445, 3.446, 3.446, 3.447, 3.448, 3.449, 3.449, 3.449, 3.452, 3.453, 3.454, 3.458, 3.458, 3.461, 3.461, 3.464, 3.469, 3.469, 3.468, 3.466, 3.466,
+                            3.452, 3.452, 3.453, 3.454, 3.454, 3.453, 3.447, 3.446, 3.444, 3.444, 3.444, 3.444, 3.445, 3.446, 3.448, 3.451, 3.452, 3.453, 3.451, 3.453, 3.453, 3.455, 3.458, 3.459, 3.461, 3.462, 3.463, 3.468, 3.471, 3.469, 3.467, 3.467,
+                            3.454, 3.455, 3.457, 3.458, 3.458, 3.455, 3.449, 3.446, 3.445, 3.445, 3.445, 3.445, 3.447, 3.447, 3.448, 3.451, 3.452, 3.453, 3.452, 3.452, 3.452, 3.454, 3.457, 3.459, 3.459, 3.462, 3.464, 3.468, 3.469, 3.467, 3.465, 3.465,
+                            3.457, 3.455, 3.455, 3.459, 3.458, 3.454, 3.451, 3.448, 3.445, 3.445, 3.445, 3.446, 3.448, 3.449, 3.451, 3.452, 3.451, 3.453, 3.452, 3.452, 3.453, 3.457, 3.457, 3.461, 3.461, 3.463, 3.465, 3.468, 3.471, 3.468, 3.465, 3.463,
+                            3.458, 3.456, 3.456, 3.459, 3.457, 3.454, 3.452, 3.449, 3.447, 3.445, 3.446, 3.447, 3.447, 3.448, 3.449, 3.448, 3.449, 3.451, 3.451, 3.451, 3.451, 3.455, 3.456, 3.458, 3.462, 3.463, 3.464, 3.465, 3.467, 3.466, 3.464, 3.462,
+                            3.457, 3.456, 3.455, 3.457, 3.457, 3.454, 3.449, 3.447, 3.445, 3.445, 3.446, 3.446, 3.448, 3.446, 3.448, 3.449, 3.449, 3.451, 3.451, 3.451, 3.453, 3.455, 3.457, 3.459, 3.462, 3.464, 3.464, 3.465, 3.467, 3.464, 3.464, 3.463,
+                            3.458, 3.457, 3.455, 3.456, 3.456, 3.456, 3.453, 3.449, 3.447, 3.448, 3.447, 3.447, 3.447, 3.447, 3.447, 3.448, 3.449, 3.451, 3.451, 3.452, 3.453, 3.455, 3.458, 3.459, 3.459, 3.463, 3.464, 3.463, 3.464, 3.463, 3.464, 3.464,
+                            3.457, 3.456, 3.456, 3.456, 3.456, 3.456, 3.455, 3.449, 3.447, 3.448, 3.451, 3.449, 3.449, 3.449, 3.448, 3.449, 3.449, 3.451, 3.451, 3.452, 3.453, 3.456, 3.458, 3.459, 3.461, 3.462, 3.464, 3.464, 3.465, 3.464, 3.464, 3.463,
+                            3.457, 3.456, 3.455, 3.455, 3.455, 3.455, 3.453, 3.451, 3.449, 3.448, 3.448, 3.449, 3.449, 3.449, 3.448, 3.449, 3.451, 3.452, 3.452, 3.453, 3.454, 3.457, 3.458, 3.459, 3.462, 3.464, 3.465, 3.464, 3.465, 3.464, 3.463, 3.463,
+                            3.456, 3.456, 3.454, 3.453, 3.454, 3.453, 3.452, 3.451, 3.449, 3.448, 3.448, 3.449, 3.451, 3.451, 3.448, 3.449, 3.451, 3.454, 3.454, 3.454, 3.455, 3.457, 3.458, 3.461, 3.461, 3.462, 3.464, 3.464, 3.466, 3.465, 3.464, 3.464,
+                            3.459, 3.457, 3.456, 3.455, 3.454, 3.453, 3.453, 3.452, 3.452, 3.451, 3.449, 3.449, 3.449, 3.448, 3.447, 3.449, 3.451, 3.454, 3.455, 3.455, 3.456, 3.458, 3.459, 3.461, 3.461, 3.462, 3.463, 3.466, 3.469, 3.465, 3.465, 3.464,
+                            3.463, 3.461, 3.458, 3.458, 3.457, 3.456, 3.456, 3.454, 3.454, 3.452, 3.452, 3.451, 3.451, 3.449, 3.448, 3.448, 3.452, 3.454, 3.456, 3.455, 3.457, 3.458, 3.461, 3.464, 3.462, 3.461, 3.463, 3.466, 3.469, 3.469, 3.467, 3.467,
+                            3.466, 3.462, 3.461, 3.461, 3.459, 3.457, 3.457, 3.457, 3.456, 3.454, 3.455, 3.455, 3.455, 3.451, 3.452, 3.453, 3.454, 3.455, 3.456, 3.456, 3.459, 3.462, 3.463, 3.466, 3.466, 3.467, 3.466, 3.469, 3.471, 3.469, 3.468, 3.466,
+                            3.467, 3.463, 3.463, 3.459, 3.461, 3.459, 3.461, 3.459, 3.458, 3.456, 3.457, 3.456, 3.457, 3.455, 3.456, 3.455, 3.456, 3.457, 3.459, 3.461, 3.461, 3.464, 3.465, 3.468, 3.469, 3.469, 3.469, 3.469, 3.471, 3.468, 3.467, 3.468,
+                            3.467, 3.464, 3.459, 3.459, 3.462, 3.462, 3.462, 3.461, 3.461, 3.462, 3.461, 3.459, 3.461, 3.459, 3.458, 3.457, 3.459, 3.461, 3.462, 3.463, 3.464, 3.466, 3.468, 3.469, 3.471, 3.469, 3.471, 3.472, 3.471, 3.467, 3.466, 3.464,
+                            3.464, 3.462, 3.458, 3.457, 3.458, 3.461, 3.461, 3.461, 3.461, 3.462, 3.462, 3.461, 3.461, 3.459, 3.459, 3.459, 3.461, 3.461, 3.464, 3.465, 3.465, 3.468, 3.468, 3.469, 3.471, 3.469, 3.469, 3.469, 3.469, 3.464, 3.462, 3.459,
+                            3.457, 3.458, 3.455, 3.456, 3.456, 3.457, 3.459, 3.459, 3.459, 3.459, 3.458, 3.456, 3.458, 3.457, 3.458, 3.458, 3.458, 3.459, 3.461, 3.463, 3.465, 3.466, 3.468, 3.469, 3.471, 3.468, 3.466, 3.466, 3.465, 3.461, 3.459, 3.457,
+                            3.456, 3.455, 3.454, 3.454, 3.455, 3.456, 3.458, 3.459, 3.459, 3.456, 3.456, 3.456, 3.455, 3.456, 3.455, 3.455, 3.455, 3.454, 3.457, 3.461, 3.462, 3.464, 3.465, 3.467, 3.467, 3.466, 3.464, 3.464, 3.463, 3.461, 3.457, 3.456,
+                            3.456, 3.454, 3.453, 3.454, 3.454, 3.455, 3.458, 3.459, 3.459, 3.456, 3.455, 3.455, 3.455, 3.451, 3.453, 3.454, 3.454, 3.455, 3.455, 3.458, 3.461, 3.462, 3.461, 3.463, 3.465, 3.464, 3.463, 3.463, 3.462, 3.459, 3.456, 3.451,
+                            3.455, 3.452, 3.452, 3.452, 3.455, 3.457, 3.459, 3.459, 3.459, 3.458, 3.456, 3.456, 3.455, 3.453, 3.453, 3.455, 3.457, 3.457, 3.457, 3.461, 3.461, 3.461, 3.459, 3.462, 3.464, 3.464, 3.464, 3.463, 3.463, 3.459, 3.454, 3.451,
+                            3.452, 3.452, 3.452, 3.453, 3.457, 3.458, 3.458, 3.459, 3.459, 3.458, 3.457, 3.457, 3.455, 3.455, 3.458, 3.459, 3.458, 3.459, 3.459, 3.461, 3.461, 3.461, 3.459, 3.461, 3.463, 3.464, 3.466, 3.463, 3.461, 3.458, 3.453, 3.449
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.403, 3.399, 3.395, 3.391, 3.392, 3.394, 3.401, 3.403, 3.404, 3.404, 3.403, 3.399, 3.398, 3.396, 3.395, 3.396, 3.399, 3.403, 3.404, 3.401, 3.399, 3.398, 3.397, 3.401, 3.401, 3.401, 3.396, 3.394, 3.397, 3.396, 3.388, 3.364,
+                            3.403, 3.399, 3.393, 3.389, 3.391, 3.395, 3.401, 3.404, 3.406, 3.404, 3.403, 3.399, 3.399, 3.397, 3.397, 3.397, 3.401, 3.404, 3.404, 3.402, 3.398, 3.396, 3.397, 3.401, 3.401, 3.401, 3.395, 3.394, 3.396, 3.393, 3.387, 3.364,
+                            3.399, 3.398, 3.391, 3.385, 3.386, 3.395, 3.402, 3.405, 3.405, 3.404, 3.402, 3.399, 3.399, 3.398, 3.398, 3.398, 3.401, 3.404, 3.405, 3.403, 3.399, 3.396, 3.396, 3.398, 3.401, 3.401, 3.398, 3.394, 3.392, 3.389, 3.386, 3.364,
+                            3.398, 3.393, 3.386, 3.382, 3.385, 3.392, 3.399, 3.403, 3.405, 3.404, 3.402, 3.398, 3.398, 3.397, 3.397, 3.398, 3.401, 3.404, 3.405, 3.403, 3.398, 3.394, 3.394, 3.398, 3.401, 3.401, 3.396, 3.392, 3.391, 3.388, 3.383, 3.362,
+                            3.396, 3.391, 3.384, 3.381, 3.384, 3.389, 3.398, 3.402, 3.402, 3.401, 3.399, 3.395, 3.395, 3.395, 3.397, 3.397, 3.401, 3.402, 3.404, 3.403, 3.399, 3.394, 3.393, 3.395, 3.399, 3.399, 3.397, 3.391, 3.388, 3.384, 3.381, 3.363,
+                            3.391, 3.386, 3.382, 3.381, 3.385, 3.389, 3.396, 3.398, 3.399, 3.399, 3.398, 3.395, 3.394, 3.394, 3.395, 3.397, 3.399, 3.401, 3.403, 3.401, 3.398, 3.394, 3.393, 3.393, 3.394, 3.396, 3.395, 3.392, 3.387, 3.382, 3.378, 3.361,
+                            3.389, 3.386, 3.379, 3.379, 3.383, 3.388, 3.394, 3.397, 3.397, 3.397, 3.395, 3.393, 3.393, 3.393, 3.395, 3.395, 3.397, 3.398, 3.401, 3.399, 3.397, 3.395, 3.394, 3.391, 3.393, 3.393, 3.393, 3.389, 3.387, 3.381, 3.374, 3.357,
+                            3.386, 3.383, 3.376, 3.375, 3.381, 3.386, 3.394, 3.396, 3.396, 3.394, 3.392, 3.392, 3.394, 3.394, 3.395, 3.394, 3.396, 3.398, 3.399, 3.397, 3.397, 3.394, 3.393, 3.391, 3.389, 3.391, 3.392, 3.388, 3.386, 3.379, 3.372, 3.355,
+                            3.386, 3.379, 3.373, 3.373, 3.378, 3.384, 3.391, 3.396, 3.395, 3.393, 3.389, 3.391, 3.391, 3.393, 3.394, 3.393, 3.394, 3.396, 3.397, 3.396, 3.393, 3.394, 3.393, 3.392, 3.389, 3.389, 3.389, 3.389, 3.386, 3.378, 3.371, 3.351,
+                            3.379, 3.375, 3.371, 3.371, 3.376, 3.381, 3.388, 3.393, 3.394, 3.391, 3.386, 3.386, 3.388, 3.393, 3.392, 3.392, 3.393, 3.395, 3.394, 3.392, 3.389, 3.391, 3.391, 3.392, 3.389, 3.388, 3.389, 3.389, 3.383, 3.377, 3.369, 3.351,
+                            3.373, 3.371, 3.367, 3.368, 3.373, 3.381, 3.387, 3.389, 3.391, 3.389, 3.385, 3.386, 3.383, 3.389, 3.389, 3.392, 3.392, 3.394, 3.393, 3.389, 3.387, 3.387, 3.388, 3.389, 3.389, 3.388, 3.386, 3.386, 3.382, 3.374, 3.367, 3.345,
+                            3.371, 3.369, 3.365, 3.366, 3.373, 3.379, 3.386, 3.389, 3.391, 3.389, 3.385, 3.384, 3.382, 3.386, 3.387, 3.389, 3.391, 3.392, 3.391, 3.387, 3.385, 3.385, 3.386, 3.388, 3.388, 3.388, 3.386, 3.385, 3.381, 3.373, 3.367, 3.345,
+                            3.367, 3.365, 3.365, 3.366, 3.374, 3.379, 3.384, 3.388, 3.389, 3.387, 3.384, 3.383, 3.383, 3.385, 3.385, 3.386, 3.388, 3.389, 3.388, 3.386, 3.383, 3.382, 3.384, 3.386, 3.387, 3.386, 3.381, 3.381, 3.379, 3.372, 3.364, 3.344,
+                            3.365, 3.363, 3.362, 3.367, 3.375, 3.379, 3.383, 3.384, 3.386, 3.384, 3.381, 3.379, 3.379, 3.383, 3.383, 3.384, 3.385, 3.387, 3.387, 3.385, 3.381, 3.381, 3.382, 3.384, 3.384, 3.385, 3.382, 3.379, 3.374, 3.369, 3.359, 3.343,
+                            3.359, 3.358, 3.361, 3.364, 3.373, 3.381, 3.384, 3.384, 3.385, 3.384, 3.381, 3.377, 3.379, 3.379, 3.382, 3.383, 3.384, 3.386, 3.386, 3.385, 3.381, 3.379, 3.381, 3.382, 3.382, 3.383, 3.379, 3.377, 3.371, 3.364, 3.357, 3.339,
+                            3.357, 3.356, 3.356, 3.362, 3.372, 3.379, 3.384, 3.384, 3.383, 3.381, 3.378, 3.376, 3.377, 3.379, 3.381, 3.382, 3.383, 3.385, 3.385, 3.383, 3.379, 3.379, 3.379, 3.381, 3.381, 3.382, 3.379, 3.372, 3.367, 3.362, 3.354, 3.334,
+                            3.357, 3.354, 3.357, 3.361, 3.372, 3.381, 3.385, 3.385, 3.384, 3.379, 3.376, 3.376, 3.376, 3.379, 3.381, 3.383, 3.383, 3.384, 3.383, 3.379, 3.378, 3.381, 3.379, 3.379, 3.379, 3.379, 3.378, 3.371, 3.363, 3.358, 3.354, 3.332,
+                            3.354, 3.351, 3.354, 3.359, 3.371, 3.379, 3.382, 3.384, 3.381, 3.378, 3.375, 3.374, 3.376, 3.378, 3.381, 3.383, 3.384, 3.382, 3.377, 3.377, 3.376, 3.377, 3.378, 3.378, 3.379, 3.379, 3.376, 3.367, 3.361, 3.357, 3.352, 3.333,
+                            3.352, 3.349, 3.351, 3.357, 3.372, 3.381, 3.383, 3.383, 3.381, 3.376, 3.372, 3.373, 3.375, 3.377, 3.382, 3.384, 3.384, 3.379, 3.376, 3.374, 3.374, 3.375, 3.375, 3.376, 3.377, 3.376, 3.373, 3.366, 3.361, 3.356, 3.347, 3.332,
+                            3.347, 3.346, 3.346, 3.355, 3.371, 3.377, 3.382, 3.381, 3.379, 3.372, 3.371, 3.371, 3.372, 3.375, 3.379, 3.383, 3.384, 3.379, 3.374, 3.373, 3.371, 3.373, 3.374, 3.375, 3.374, 3.374, 3.371, 3.365, 3.359, 3.352, 3.343, 3.331,
+                            3.345, 3.344, 3.345, 3.353, 3.367, 3.374, 3.382, 3.382, 3.376, 3.371, 3.369, 3.368, 3.369, 3.373, 3.377, 3.381, 3.379, 3.376, 3.373, 3.369, 3.368, 3.371, 3.372, 3.373, 3.371, 3.371, 3.369, 3.363, 3.357, 3.349, 3.341, 3.326,
+                            3.343, 3.341, 3.344, 3.351, 3.362, 3.371, 3.376, 3.376, 3.372, 3.369, 3.367, 3.366, 3.367, 3.369, 3.376, 3.378, 3.378, 3.375, 3.371, 3.367, 3.367, 3.368, 3.369, 3.369, 3.369, 3.368, 3.365, 3.361, 3.354, 3.347, 3.338, 3.321,
+                            3.341, 3.339, 3.342, 3.349, 3.359, 3.367, 3.371, 3.372, 3.371, 3.368, 3.366, 3.363, 3.365, 3.368, 3.371, 3.374, 3.376, 3.374, 3.368, 3.365, 3.365, 3.366, 3.368, 3.367, 3.367, 3.363, 3.361, 3.356, 3.352, 3.346, 3.336, 3.317,
+                            3.338, 3.336, 3.338, 3.346, 3.359, 3.364, 3.368, 3.369, 3.367, 3.366, 3.363, 3.362, 3.364, 3.364, 3.367, 3.371, 3.372, 3.369, 3.365, 3.362, 3.362, 3.365, 3.367, 3.367, 3.366, 3.362, 3.357, 3.353, 3.349, 3.342, 3.335, 3.317,
+                            3.334, 3.334, 3.336, 3.346, 3.354, 3.361, 3.365, 3.365, 3.365, 3.362, 3.361, 3.361, 3.362, 3.362, 3.364, 3.366, 3.368, 3.366, 3.361, 3.357, 3.357, 3.359, 3.363, 3.365, 3.363, 3.361, 3.355, 3.351, 3.346, 3.339, 3.336, 3.317,
+                            3.332, 3.332, 3.334, 3.344, 3.354, 3.359, 3.363, 3.365, 3.363, 3.361, 3.359, 3.359, 3.363, 3.363, 3.365, 3.365, 3.367, 3.366, 3.358, 3.356, 3.356, 3.358, 3.362, 3.364, 3.363, 3.359, 3.353, 3.348, 3.345, 3.339, 3.336, 3.315,
+                            3.332, 3.328, 3.331, 3.343, 3.351, 3.357, 3.358, 3.362, 3.361, 3.359, 3.357, 3.357, 3.361, 3.362, 3.364, 3.363, 3.363, 3.359, 3.356, 3.354, 3.354, 3.355, 3.358, 3.359, 3.361, 3.359, 3.351, 3.346, 3.344, 3.339, 3.336, 3.313,
+                            3.324, 3.324, 3.327, 3.334, 3.345, 3.351, 3.354, 3.356, 3.356, 3.354, 3.353, 3.354, 3.357, 3.358, 3.361, 3.358, 3.359, 3.355, 3.352, 3.348, 3.347, 3.351, 3.354, 3.358, 3.359, 3.355, 3.346, 3.343, 3.341, 3.336, 3.331, 3.312,
+                            3.318, 3.319, 3.321, 3.328, 3.337, 3.339, 3.345, 3.348, 3.346, 3.345, 3.347, 3.348, 3.351, 3.354, 3.356, 3.353, 3.354, 3.344, 3.343, 3.343, 3.343, 3.344, 3.347, 3.349, 3.353, 3.346, 3.341, 3.339, 3.331, 3.329, 3.325, 3.311,
+                            3.309, 3.313, 3.317, 3.325, 3.329, 3.332, 3.338, 3.339, 3.341, 3.339, 3.339, 3.342, 3.346, 3.346, 3.351, 3.351, 3.343, 3.338, 3.338, 3.339, 3.339, 3.339, 3.341, 3.341, 3.346, 3.343, 3.339, 3.332, 3.327, 3.326, 3.322, 3.309,
+                            3.305, 3.309, 3.317, 3.325, 3.328, 3.331, 3.334, 3.336, 3.337, 3.336, 3.339, 3.341, 3.344, 3.346, 3.348, 3.347, 3.341, 3.336, 3.335, 3.337, 3.339, 3.341, 3.339, 3.339, 3.342, 3.341, 3.337, 3.329, 3.326, 3.325, 3.321, 3.314,
+                            3.302, 3.306, 3.319, 3.325, 3.329, 3.331, 3.334, 3.335, 3.337, 3.337, 3.339, 3.341, 3.344, 3.346, 3.348, 3.347, 3.342, 3.336, 3.336, 3.338, 3.339, 3.341, 3.341, 3.341, 3.339, 3.338, 3.336, 3.331, 3.327, 3.324, 3.321, 3.314
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.726, 1.725, 1.723, 1.721, 1.723, 1.724, 1.724, 1.726, 1.727, 1.728, 1.729, 1.728, 1.725, 1.724, 1.726, 1.726, 1.727, 1.729, 1.727, 1.727, 1.724, 1.725, 1.724, 1.726, 1.725, 1.725, 1.724, 1.724, 1.722, 1.721, 1.719, 1.714,
+                            1.726, 1.724, 1.722, 1.721, 1.722, 1.723, 1.725, 1.726, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.726, 1.727, 1.728, 1.728, 1.727, 1.725, 1.724, 1.724, 1.725, 1.726, 1.725, 1.724, 1.723, 1.722, 1.721, 1.719, 1.714,
+                            1.724, 1.722, 1.719, 1.719, 1.721, 1.723, 1.726, 1.726, 1.727, 1.727, 1.727, 1.725, 1.726, 1.725, 1.725, 1.725, 1.726, 1.727, 1.728, 1.728, 1.725, 1.724, 1.724, 1.724, 1.726, 1.725, 1.724, 1.722, 1.722, 1.721, 1.719, 1.712,
+                            1.723, 1.721, 1.719, 1.719, 1.719, 1.723, 1.725, 1.726, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.726, 1.726, 1.728, 1.729, 1.728, 1.725, 1.723, 1.723, 1.725, 1.726, 1.725, 1.724, 1.722, 1.721, 1.719, 1.718, 1.711,
+                            1.722, 1.719, 1.719, 1.718, 1.719, 1.722, 1.725, 1.726, 1.726, 1.727, 1.727, 1.726, 1.725, 1.726, 1.726, 1.726, 1.727, 1.727, 1.728, 1.727, 1.726, 1.725, 1.724, 1.725, 1.726, 1.725, 1.724, 1.722, 1.721, 1.719, 1.715, 1.711,
+                            1.721, 1.717, 1.717, 1.716, 1.719, 1.722, 1.724, 1.726, 1.726, 1.727, 1.726, 1.726, 1.726, 1.726, 1.726, 1.727, 1.727, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.725, 1.725, 1.724, 1.722, 1.721, 1.718, 1.715, 1.707,
+                            1.718, 1.717, 1.716, 1.716, 1.718, 1.721, 1.725, 1.726, 1.726, 1.726, 1.725, 1.725, 1.725, 1.725, 1.726, 1.727, 1.727, 1.727, 1.727, 1.726, 1.726, 1.726, 1.725, 1.724, 1.724, 1.724, 1.723, 1.722, 1.721, 1.718, 1.715, 1.709,
+                            1.718, 1.716, 1.716, 1.715, 1.717, 1.721, 1.724, 1.725, 1.726, 1.725, 1.725, 1.724, 1.724, 1.725, 1.726, 1.726, 1.727, 1.727, 1.727, 1.726, 1.726, 1.726, 1.725, 1.723, 1.723, 1.723, 1.722, 1.722, 1.719, 1.718, 1.714, 1.709,
+                            1.718, 1.716, 1.715, 1.715, 1.717, 1.721, 1.723, 1.725, 1.726, 1.725, 1.724, 1.723, 1.724, 1.725, 1.725, 1.726, 1.726, 1.726, 1.726, 1.726, 1.726, 1.726, 1.725, 1.724, 1.724, 1.723, 1.722, 1.722, 1.721, 1.717, 1.714, 1.707,
+                            1.717, 1.716, 1.714, 1.714, 1.716, 1.721, 1.723, 1.725, 1.725, 1.725, 1.723, 1.723, 1.724, 1.726, 1.726, 1.726, 1.726, 1.725, 1.726, 1.725, 1.725, 1.725, 1.725, 1.725, 1.724, 1.723, 1.722, 1.721, 1.718, 1.716, 1.714, 1.706,
+                            1.715, 1.714, 1.714, 1.714, 1.716, 1.719, 1.722, 1.724, 1.725, 1.725, 1.723, 1.723, 1.724, 1.725, 1.725, 1.725, 1.726, 1.725, 1.725, 1.725, 1.724, 1.724, 1.724, 1.725, 1.724, 1.723, 1.722, 1.721, 1.718, 1.716, 1.713, 1.705,
+                            1.714, 1.714, 1.713, 1.714, 1.717, 1.719, 1.722, 1.724, 1.724, 1.724, 1.723, 1.722, 1.723, 1.724, 1.724, 1.724, 1.726, 1.725, 1.726, 1.725, 1.723, 1.723, 1.724, 1.724, 1.724, 1.723, 1.721, 1.719, 1.717, 1.715, 1.713, 1.706,
+                            1.712, 1.712, 1.712, 1.713, 1.718, 1.719, 1.721, 1.723, 1.724, 1.724, 1.722, 1.722, 1.723, 1.724, 1.724, 1.724, 1.725, 1.725, 1.725, 1.725, 1.723, 1.722, 1.724, 1.723, 1.723, 1.722, 1.721, 1.719, 1.717, 1.714, 1.711, 1.706,
+                            1.712, 1.711, 1.711, 1.713, 1.717, 1.719, 1.722, 1.724, 1.724, 1.723, 1.722, 1.722, 1.723, 1.724, 1.724, 1.724, 1.724, 1.725, 1.725, 1.724, 1.723, 1.722, 1.722, 1.722, 1.723, 1.722, 1.721, 1.718, 1.716, 1.714, 1.711, 1.706,
+                            1.711, 1.709, 1.711, 1.713, 1.716, 1.719, 1.722, 1.724, 1.724, 1.723, 1.722, 1.721, 1.722, 1.724, 1.724, 1.724, 1.723, 1.724, 1.724, 1.724, 1.722, 1.722, 1.722, 1.722, 1.722, 1.721, 1.719, 1.718, 1.714, 1.712, 1.709, 1.702,
+                            1.709, 1.709, 1.709, 1.712, 1.717, 1.719, 1.721, 1.723, 1.723, 1.723, 1.721, 1.721, 1.722, 1.723, 1.724, 1.723, 1.724, 1.724, 1.724, 1.724, 1.723, 1.722, 1.721, 1.721, 1.721, 1.721, 1.719, 1.716, 1.713, 1.711, 1.709, 1.701,
+                            1.708, 1.707, 1.709, 1.712, 1.716, 1.719, 1.722, 1.723, 1.723, 1.723, 1.721, 1.721, 1.721, 1.722, 1.723, 1.723, 1.723, 1.723, 1.724, 1.723, 1.722, 1.722, 1.721, 1.721, 1.721, 1.721, 1.719, 1.714, 1.712, 1.709, 1.708, 1.702,
+                            1.707, 1.707, 1.708, 1.711, 1.716, 1.721, 1.722, 1.722, 1.722, 1.721, 1.721, 1.721, 1.722, 1.722, 1.723, 1.723, 1.723, 1.722, 1.722, 1.722, 1.722, 1.721, 1.721, 1.721, 1.721, 1.721, 1.717, 1.714, 1.711, 1.709, 1.707, 1.702,
+                            1.706, 1.706, 1.707, 1.711, 1.714, 1.719, 1.722, 1.722, 1.722, 1.721, 1.719, 1.721, 1.721, 1.722, 1.723, 1.724, 1.723, 1.722, 1.722, 1.721, 1.719, 1.719, 1.721, 1.721, 1.719, 1.719, 1.716, 1.713, 1.711, 1.709, 1.706, 1.701,
+                            1.705, 1.704, 1.706, 1.709, 1.713, 1.718, 1.721, 1.722, 1.721, 1.719, 1.718, 1.719, 1.721, 1.722, 1.723, 1.724, 1.724, 1.721, 1.721, 1.721, 1.719, 1.719, 1.719, 1.719, 1.719, 1.717, 1.715, 1.713, 1.711, 1.707, 1.704, 1.699,
+                            1.703, 1.703, 1.704, 1.709, 1.712, 1.717, 1.719, 1.721, 1.719, 1.718, 1.717, 1.718, 1.719, 1.721, 1.722, 1.723, 1.723, 1.722, 1.719, 1.719, 1.718, 1.719, 1.719, 1.718, 1.717, 1.716, 1.714, 1.712, 1.709, 1.706, 1.703, 1.697,
+                            1.702, 1.703, 1.704, 1.708, 1.712, 1.715, 1.718, 1.719, 1.719, 1.717, 1.717, 1.717, 1.717, 1.718, 1.721, 1.722, 1.722, 1.721, 1.719, 1.718, 1.717, 1.718, 1.718, 1.717, 1.716, 1.714, 1.714, 1.711, 1.709, 1.706, 1.703, 1.697,
+                            1.702, 1.702, 1.703, 1.706, 1.709, 1.715, 1.717, 1.718, 1.717, 1.717, 1.716, 1.716, 1.717, 1.717, 1.719, 1.721, 1.721, 1.721, 1.719, 1.717, 1.716, 1.717, 1.717, 1.716, 1.714, 1.713, 1.712, 1.711, 1.708, 1.706, 1.702, 1.696,
+                            1.701, 1.701, 1.702, 1.706, 1.709, 1.714, 1.716, 1.717, 1.716, 1.716, 1.716, 1.715, 1.716, 1.716, 1.717, 1.718, 1.719, 1.719, 1.716, 1.715, 1.715, 1.715, 1.715, 1.715, 1.714, 1.713, 1.711, 1.709, 1.708, 1.704, 1.701, 1.695,
+                            1.699, 1.699, 1.702, 1.706, 1.708, 1.712, 1.714, 1.715, 1.715, 1.715, 1.714, 1.715, 1.714, 1.715, 1.716, 1.716, 1.716, 1.716, 1.714, 1.713, 1.713, 1.714, 1.715, 1.714, 1.714, 1.712, 1.709, 1.707, 1.706, 1.703, 1.701, 1.695,
+                            1.698, 1.699, 1.701, 1.705, 1.708, 1.711, 1.714, 1.714, 1.714, 1.714, 1.714, 1.714, 1.714, 1.715, 1.715, 1.716, 1.716, 1.715, 1.713, 1.713, 1.713, 1.714, 1.714, 1.714, 1.713, 1.712, 1.709, 1.707, 1.706, 1.703, 1.701, 1.696,
+                            1.698, 1.699, 1.701, 1.705, 1.707, 1.711, 1.712, 1.713, 1.713, 1.713, 1.713, 1.714, 1.714, 1.715, 1.715, 1.716, 1.715, 1.714, 1.713, 1.712, 1.712, 1.712, 1.713, 1.713, 1.713, 1.711, 1.709, 1.707, 1.705, 1.703, 1.701, 1.696,
+                            1.698, 1.697, 1.699, 1.702, 1.705, 1.707, 1.711, 1.711, 1.711, 1.711, 1.711, 1.712, 1.712, 1.713, 1.714, 1.714, 1.713, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.708, 1.706, 1.704, 1.703, 1.699, 1.696,
+                            1.694, 1.695, 1.697, 1.699, 1.702, 1.705, 1.706, 1.707, 1.707, 1.708, 1.708, 1.708, 1.709, 1.711, 1.711, 1.711, 1.708, 1.708, 1.708, 1.707, 1.707, 1.707, 1.708, 1.708, 1.709, 1.708, 1.706, 1.703, 1.702, 1.701, 1.698, 1.696,
+                            1.692, 1.692, 1.695, 1.698, 1.699, 1.701, 1.704, 1.704, 1.704, 1.704, 1.705, 1.706, 1.707, 1.709, 1.709, 1.707, 1.706, 1.704, 1.704, 1.705, 1.705, 1.706, 1.706, 1.706, 1.706, 1.706, 1.703, 1.702, 1.701, 1.699, 1.696, 1.694,
+                            1.691, 1.692, 1.695, 1.697, 1.699, 1.699, 1.702, 1.703, 1.703, 1.702, 1.703, 1.704, 1.706, 1.707, 1.708, 1.706, 1.705, 1.703, 1.703, 1.703, 1.704, 1.705, 1.705, 1.705, 1.705, 1.704, 1.703, 1.701, 1.699, 1.698, 1.696, 1.695,
+                            1.689, 1.691, 1.696, 1.698, 1.699, 1.699, 1.701, 1.702, 1.702, 1.702, 1.703, 1.703, 1.706, 1.707, 1.708, 1.706, 1.705, 1.703, 1.703, 1.703, 1.703, 1.704, 1.704, 1.705, 1.704, 1.704, 1.702, 1.701, 1.698, 1.698, 1.696, 1.696
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.425, 1.393, 1.341, 1.295, 1.258, 1.226, 1.201, 1.181, 1.162, 1.146, 1.133, 1.123, 1.115, 1.111, 1.107, 1.106, 1.106, 1.107, 1.108, 1.111, 1.114, 1.122, 1.133, 1.148, 1.164, 1.184, 1.208, 1.236, 1.271, 1.309, 1.359, 1.381,
+                    1.397, 1.367, 1.317, 1.274, 1.237, 1.207, 1.183, 1.163, 1.146, 1.133, 1.123, 1.114, 1.107, 1.101, 1.098, 1.096, 1.096, 1.096, 1.097, 1.102, 1.106, 1.112, 1.122, 1.133, 1.148, 1.166, 1.187, 1.215, 1.249, 1.288, 1.335, 1.359,
+                    1.374, 1.341, 1.292, 1.251, 1.215, 1.186, 1.166, 1.146, 1.131, 1.117, 1.108, 1.099, 1.091, 1.088, 1.084, 1.082, 1.081, 1.082, 1.084, 1.088, 1.093, 1.098, 1.107, 1.118, 1.133, 1.149, 1.169, 1.195, 1.228, 1.267, 1.313, 1.335,
+                    1.352, 1.318, 1.271, 1.231, 1.196, 1.169, 1.149, 1.131, 1.115, 1.103, 1.093, 1.086, 1.079, 1.074, 1.071, 1.069, 1.069, 1.069, 1.071, 1.076, 1.079, 1.085, 1.094, 1.102, 1.117, 1.133, 1.152, 1.176, 1.208, 1.246, 1.289, 1.313,
+                    1.333, 1.298, 1.253, 1.212, 1.179, 1.153, 1.134, 1.116, 1.102, 1.089, 1.079, 1.072, 1.066, 1.062, 1.059, 1.058, 1.057, 1.057, 1.059, 1.064, 1.068, 1.072, 1.081, 1.091, 1.102, 1.119, 1.137, 1.161, 1.191, 1.227, 1.271, 1.293,
+                    1.317, 1.281, 1.235, 1.196, 1.165, 1.139, 1.119, 1.104, 1.089, 1.078, 1.068, 1.062, 1.055, 1.051, 1.048, 1.047, 1.047, 1.047, 1.048, 1.053, 1.056, 1.061, 1.069, 1.079, 1.091, 1.105, 1.126, 1.147, 1.177, 1.212, 1.253, 1.278,
+                    1.301, 1.265, 1.221, 1.181, 1.151, 1.127, 1.108, 1.091, 1.078, 1.068, 1.059, 1.051, 1.045, 1.041, 1.038, 1.037, 1.036, 1.037, 1.038, 1.042, 1.046, 1.051, 1.059, 1.069, 1.081, 1.096, 1.113, 1.135, 1.164, 1.198, 1.238, 1.264,
+                    1.286, 1.251, 1.207, 1.169, 1.141, 1.116, 1.098, 1.081, 1.068, 1.058, 1.049, 1.042, 1.037, 1.033, 1.031, 1.029, 1.028, 1.028, 1.029, 1.033, 1.037, 1.043, 1.051, 1.059, 1.071, 1.086, 1.104, 1.124, 1.152, 1.185, 1.225, 1.252,
+                    1.275, 1.239, 1.196, 1.161, 1.132, 1.107, 1.089, 1.073, 1.059, 1.049, 1.041, 1.035, 1.028, 1.024, 1.023, 1.021, 1.021, 1.021, 1.022, 1.024, 1.029, 1.036, 1.043, 1.051, 1.063, 1.078, 1.095, 1.115, 1.143, 1.175, 1.214, 1.243,
+                    1.267, 1.227, 1.187, 1.152, 1.122, 1.101, 1.081, 1.067, 1.054, 1.042, 1.035, 1.028, 1.023, 1.018, 1.015, 1.014, 1.014, 1.014, 1.016, 1.019, 1.024, 1.029, 1.036, 1.045, 1.056, 1.071, 1.088, 1.107, 1.134, 1.167, 1.204, 1.234,
+                    1.261, 1.219, 1.179, 1.145, 1.116, 1.095, 1.076, 1.061, 1.047, 1.037, 1.031, 1.023, 1.018, 1.014, 1.011, 1.009, 1.009, 1.009, 1.011, 1.013, 1.018, 1.024, 1.031, 1.039, 1.049, 1.065, 1.083, 1.102, 1.128, 1.161, 1.196, 1.228,
+                    1.256, 1.213, 1.173, 1.139, 1.111, 1.091, 1.071, 1.056, 1.043, 1.033, 1.026, 1.019, 1.014, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.009, 1.013, 1.018, 1.026, 1.035, 1.046, 1.061, 1.078, 1.097, 1.123, 1.154, 1.191, 1.222,
+                    1.251, 1.208, 1.169, 1.137, 1.108, 1.088, 1.069, 1.053, 1.039, 1.029, 1.023, 1.015, 1.011, 1.006, 1.004, 1.003, 1.001, 1.002, 1.003, 1.006, 1.009, 1.015, 1.022, 1.032, 1.044, 1.057, 1.076, 1.094, 1.119, 1.149, 1.186, 1.218,
+                    1.249, 1.205, 1.167, 1.133, 1.107, 1.085, 1.067, 1.052, 1.038, 1.029, 1.021, 1.013, 1.008, 1.004, 1.003, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.013, 1.021, 1.031, 1.042, 1.055, 1.073, 1.093, 1.116, 1.147, 1.182, 1.218,
+                    1.249, 1.204, 1.165, 1.132, 1.106, 1.085, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.007, 1.003, 1.002, 1.001, 1.001, 1.001, 1.001, 1.004, 1.007, 1.013, 1.021, 1.029, 1.042, 1.055, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.249, 1.204, 1.165, 1.132, 1.107, 1.086, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.008, 1.004, 1.002, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.014, 1.021, 1.029, 1.042, 1.056, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.251, 1.205, 1.166, 1.133, 1.108, 1.087, 1.068, 1.052, 1.039, 1.031, 1.021, 1.014, 1.009, 1.006, 1.003, 1.002, 1.001, 1.001, 1.003, 1.006, 1.009, 1.014, 1.022, 1.031, 1.043, 1.056, 1.073, 1.093, 1.116, 1.145, 1.182, 1.218,
+                    1.252, 1.208, 1.168, 1.137, 1.111, 1.089, 1.071, 1.055, 1.043, 1.033, 1.023, 1.016, 1.012, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.008, 1.012, 1.017, 1.024, 1.034, 1.045, 1.059, 1.075, 1.095, 1.119, 1.149, 1.185, 1.218,
+                    1.256, 1.213, 1.173, 1.142, 1.115, 1.093, 1.075, 1.059, 1.047, 1.036, 1.027, 1.021, 1.016, 1.012, 1.011, 1.009, 1.008, 1.008, 1.009, 1.012, 1.016, 1.021, 1.028, 1.038, 1.049, 1.064, 1.081, 1.099, 1.126, 1.155, 1.192, 1.223,
+                    1.261, 1.221, 1.179, 1.148, 1.121, 1.099, 1.081, 1.065, 1.052, 1.042, 1.032, 1.026, 1.021, 1.017, 1.015, 1.014, 1.014, 1.013, 1.013, 1.016, 1.021, 1.026, 1.033, 1.043, 1.054, 1.068, 1.085, 1.106, 1.132, 1.161, 1.199, 1.228,
+                    1.267, 1.228, 1.188, 1.155, 1.128, 1.105, 1.086, 1.071, 1.059, 1.047, 1.038, 1.031, 1.027, 1.022, 1.021, 1.019, 1.019, 1.019, 1.019, 1.022, 1.026, 1.032, 1.038, 1.049, 1.061, 1.075, 1.092, 1.112, 1.138, 1.169, 1.207, 1.236,
+                    1.278, 1.241, 1.199, 1.164, 1.137, 1.114, 1.094, 1.078, 1.066, 1.055, 1.046, 1.038, 1.032, 1.029, 1.027, 1.027, 1.027, 1.027, 1.027, 1.029, 1.032, 1.038, 1.047, 1.056, 1.067, 1.083, 1.099, 1.121, 1.146, 1.178, 1.217, 1.244,
+                    1.291, 1.252, 1.211, 1.175, 1.147, 1.124, 1.103, 1.088, 1.075, 1.063, 1.054, 1.046, 1.041, 1.036, 1.035, 1.035, 1.035, 1.035, 1.036, 1.038, 1.041, 1.047, 1.055, 1.065, 1.075, 1.092, 1.111, 1.132, 1.157, 1.189, 1.231, 1.255,
+                    1.303, 1.265, 1.222, 1.187, 1.158, 1.133, 1.112, 1.097, 1.083, 1.072, 1.063, 1.054, 1.048, 1.043, 1.043, 1.043, 1.043, 1.043, 1.043, 1.046, 1.049, 1.055, 1.065, 1.074, 1.086, 1.102, 1.119, 1.144, 1.171, 1.203, 1.243, 1.268,
+                    1.317, 1.282, 1.236, 1.201, 1.171, 1.146, 1.125, 1.109, 1.095, 1.083, 1.072, 1.064, 1.058, 1.054, 1.052, 1.051, 1.051, 1.053, 1.054, 1.057, 1.061, 1.065, 1.074, 1.086, 1.099, 1.113, 1.133, 1.156, 1.183, 1.217, 1.259, 1.282,
+                    1.335, 1.301, 1.254, 1.218, 1.186, 1.159, 1.138, 1.121, 1.108, 1.095, 1.085, 1.076, 1.069, 1.066, 1.065, 1.063, 1.062, 1.063, 1.065, 1.068, 1.073, 1.078, 1.087, 1.098, 1.113, 1.126, 1.146, 1.171, 1.199, 1.235, 1.277, 1.299,
+                    1.356, 1.321, 1.274, 1.235, 1.202, 1.175, 1.153, 1.137, 1.121, 1.108, 1.097, 1.089, 1.084, 1.081, 1.077, 1.075, 1.075, 1.075, 1.077, 1.081, 1.086, 1.091, 1.099, 1.113, 1.126, 1.144, 1.162, 1.187, 1.218, 1.255, 1.297, 1.321,
+                    1.376, 1.344, 1.296, 1.257, 1.223, 1.194, 1.171, 1.153, 1.137, 1.124, 1.112, 1.104, 1.099, 1.095, 1.093, 1.091, 1.089, 1.091, 1.092, 1.095, 1.101, 1.108, 1.116, 1.128, 1.144, 1.161, 1.181, 1.206, 1.237, 1.275, 1.321, 1.347,
+                    1.403, 1.369, 1.319, 1.279, 1.244, 1.214, 1.191, 1.171, 1.154, 1.139, 1.129, 1.121, 1.115, 1.111, 1.109, 1.106, 1.105, 1.105, 1.108, 1.112, 1.117, 1.124, 1.135, 1.147, 1.162, 1.181, 1.203, 1.228, 1.262, 1.301, 1.347, 1.377,
+                    1.429, 1.398, 1.348, 1.306, 1.269, 1.237, 1.214, 1.191, 1.173, 1.158, 1.146, 1.138, 1.132, 1.128, 1.125, 1.123, 1.122, 1.123, 1.125, 1.129, 1.136, 1.142, 1.154, 1.166, 1.182, 1.203, 1.226, 1.253, 1.288, 1.329, 1.377, 1.406,
+                    1.465, 1.429, 1.377, 1.335, 1.295, 1.262, 1.236, 1.214, 1.194, 1.179, 1.167, 1.157, 1.151, 1.146, 1.144, 1.142, 1.142, 1.142, 1.144, 1.149, 1.154, 1.163, 1.174, 1.187, 1.205, 1.226, 1.251, 1.279, 1.315, 1.357, 1.406, 1.437,
+                    1.493, 1.465, 1.409, 1.364, 1.323, 1.289, 1.261, 1.235, 1.214, 1.194, 1.179, 1.171, 1.166, 1.163, 1.161, 1.161, 1.161, 1.161, 1.162, 1.164, 1.168, 1.175, 1.187, 1.205, 1.225, 1.251, 1.276, 1.306, 1.344, 1.387, 1.437, 1.455
+                ],
+                "sigma": 0.0007,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2500,
+                        "ccm":
+                        [
+                            1.95054, -0.57435, -0.37619,
+                            -0.46945, 1.86661, -0.39716,
+                            0.07977, -1.14072, 2.06095
+                        ]
+                    },
+                    {
+                        "ct": 2800,
+                        "ccm":
+                        [
+                            1.94104, -0.60261, -0.33844,
+                            -0.43162, 1.85422, -0.42261,
+                            0.03799, -0.95022, 1.91222
+                        ]
+                    },
+                    {
+                        "ct": 2900,
+                        "ccm":
+                        [
+                            1.91828, -0.59569, -0.32258,
+                            -0.51902, 2.09091, -0.57189,
+                            -0.03324, -0.73462, 1.76785
+                        ]
+                    },
+                    {
+                        "ct": 3620,
+                        "ccm":
+                        [
+                            1.97199, -0.66403, -0.30797,
+                            -0.46411, 2.02612, -0.56201,
+                            -0.07764, -0.61178, 1.68942
+                        ]
+                    },
+                    {
+                        "ct": 4560,
+                        "ccm":
+                        [
+                            2.15256, -0.84787, -0.30469,
+                            -0.48422, 2.28962, -0.80541,
+                            -0.15113, -0.53014, 1.68127
+                        ]
+                    },
+                    {
+                        "ct": 5600,
+                        "ccm":
+                        [
+                            2.04576, -0.74771, -0.29805,
+                            -0.36332, 1.98993, -0.62662,
+                            -0.09328, -0.46543, 1.55871
+                        ]
+                    },
+                    {
+                        "ct": 7400,
+                        "ccm":
+                        [
+                            2.37532, -0.83069, -0.54462,
+                            -0.48279, 2.84309, -1.36031,
+                            -0.21178, -0.66532, 1.87709
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.06,
+                "strength": 0.5,
+                "limit": 0.5
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx296_16mm.json b/src/ipa/rpi/pisp/data/imx296_16mm.json
new file mode 100644
index 000000000..874437451
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx296_16mm.json
@@ -0,0 +1,1247 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 3840
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 4724,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 860,
+                "reference_Y": 14551
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.751
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 226,
+                "slope": 0.01032
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2875.0, 0.4699, 0.3209,
+                    3610.0, 0.4089, 0.4265,
+                    4640.0, 0.3281, 0.5417,
+                    5912.0, 0.2992, 0.5771,
+                    7630.0, 0.2285, 0.6524
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.01783,
+                "transverse_neg": 0.02154
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.16,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.084, 2.084, 2.085, 2.085, 2.085, 2.087, 2.088, 2.087, 2.086, 2.082, 2.082, 2.084, 2.086, 2.088, 2.088, 2.088, 2.087, 2.088, 2.088, 2.091, 2.092, 2.093, 2.093, 2.093, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.091, 2.088,
+                            2.086, 2.086, 2.087, 2.088, 2.089, 2.089, 2.091, 2.089, 2.087, 2.086, 2.087, 2.088, 2.091, 2.089, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.093, 2.093, 2.094, 2.095, 2.094, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.093,
+                            2.087, 2.087, 2.088, 2.091, 2.091, 2.091, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.092, 2.092, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.097, 2.097, 2.097, 2.097, 2.096,
+                            2.089, 2.088, 2.089, 2.091, 2.091, 2.092, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.092, 2.092, 2.092, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.097, 2.098, 2.097, 2.097, 2.097,
+                            2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.091, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.095, 2.096, 2.096, 2.097, 2.099, 2.098, 2.097, 2.097, 2.097,
+                            2.091, 2.091, 2.092, 2.093, 2.093, 2.093, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.095, 2.096, 2.096, 2.097, 2.097, 2.099, 2.099, 2.099, 2.098, 2.097,
+                            2.092, 2.092, 2.092, 2.093, 2.093, 2.092, 2.091, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.095, 2.096, 2.096, 2.097, 2.097, 2.099, 2.099, 2.101, 2.099, 2.098,
+                            2.092, 2.092, 2.093, 2.093, 2.093, 2.092, 2.091, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.092, 2.094, 2.095, 2.096, 2.097, 2.098, 2.098, 2.098, 2.101, 2.101, 2.099, 2.098,
+                            2.092, 2.092, 2.093, 2.093, 2.094, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.089, 2.089, 2.091, 2.092, 2.092, 2.092, 2.092, 2.094, 2.096, 2.096, 2.097, 2.098, 2.099, 2.099, 2.099, 2.099, 2.099, 2.097,
+                            2.093, 2.094, 2.094, 2.094, 2.095, 2.093, 2.092, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.094, 2.096, 2.096, 2.097, 2.098, 2.098, 2.101, 2.101, 2.099, 2.099, 2.099,
+                            2.094, 2.094, 2.094, 2.095, 2.095, 2.095, 2.091, 2.089, 2.091, 2.089, 2.089, 2.089, 2.091, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.093, 2.095, 2.096, 2.097, 2.098, 2.098, 2.099, 2.101, 2.101, 2.099, 2.099,
+                            2.095, 2.094, 2.094, 2.095, 2.096, 2.095, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.093, 2.093, 2.093, 2.093, 2.094, 2.096, 2.097, 2.098, 2.099, 2.101, 2.101, 2.102, 2.101, 2.099,
+                            2.095, 2.095, 2.095, 2.095, 2.095, 2.095, 2.092, 2.089, 2.089, 2.088, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.093, 2.093, 2.093, 2.093, 2.095, 2.096, 2.099, 2.099, 2.101, 2.102, 2.103, 2.102, 2.101,
+                            2.095, 2.095, 2.095, 2.095, 2.095, 2.094, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.093, 2.093, 2.093, 2.092, 2.092, 2.094, 2.094, 2.094, 2.096, 2.096, 2.098, 2.099, 2.102, 2.103, 2.103, 2.102, 2.102,
+                            2.095, 2.095, 2.095, 2.096, 2.096, 2.094, 2.093, 2.091, 2.091, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.092, 2.093, 2.094, 2.094, 2.095, 2.096, 2.097, 2.098, 2.099, 2.103, 2.103, 2.103, 2.101, 2.101,
+                            2.095, 2.096, 2.096, 2.097, 2.096, 2.095, 2.093, 2.092, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.092, 2.092, 2.094, 2.093, 2.093, 2.094, 2.095, 2.096, 2.096, 2.097, 2.099, 2.101, 2.103, 2.103, 2.103, 2.101, 2.099,
+                            2.096, 2.096, 2.097, 2.096, 2.097, 2.096, 2.094, 2.092, 2.092, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.093, 2.094, 2.093, 2.093, 2.093, 2.095, 2.096, 2.097, 2.099, 2.099, 2.101, 2.103, 2.103, 2.102, 2.101, 2.101,
+                            2.096, 2.096, 2.097, 2.097, 2.097, 2.096, 2.094, 2.093, 2.092, 2.092, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.094, 2.093, 2.093, 2.094, 2.095, 2.096, 2.097, 2.099, 2.101, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101,
+                            2.097, 2.096, 2.097, 2.097, 2.097, 2.097, 2.095, 2.093, 2.093, 2.093, 2.093, 2.092, 2.091, 2.091, 2.092, 2.092, 2.093, 2.094, 2.093, 2.093, 2.093, 2.095, 2.096, 2.097, 2.099, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101, 2.101,
+                            2.098, 2.097, 2.096, 2.097, 2.097, 2.097, 2.095, 2.094, 2.094, 2.094, 2.092, 2.092, 2.092, 2.092, 2.092, 2.092, 2.094, 2.095, 2.095, 2.094, 2.093, 2.095, 2.096, 2.099, 2.101, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101, 2.102,
+                            2.098, 2.097, 2.096, 2.096, 2.097, 2.097, 2.095, 2.094, 2.095, 2.093, 2.093, 2.092, 2.092, 2.092, 2.094, 2.094, 2.096, 2.095, 2.095, 2.095, 2.095, 2.096, 2.098, 2.099, 2.099, 2.101, 2.102, 2.103, 2.102, 2.102, 2.101, 2.102,
+                            2.098, 2.097, 2.097, 2.098, 2.097, 2.096, 2.095, 2.095, 2.095, 2.094, 2.093, 2.093, 2.094, 2.094, 2.094, 2.095, 2.096, 2.096, 2.096, 2.095, 2.097, 2.097, 2.098, 2.099, 2.099, 2.101, 2.101, 2.103, 2.104, 2.103, 2.102, 2.101,
+                            2.099, 2.098, 2.098, 2.098, 2.097, 2.096, 2.096, 2.095, 2.095, 2.095, 2.095, 2.095, 2.094, 2.094, 2.094, 2.094, 2.096, 2.097, 2.097, 2.097, 2.097, 2.098, 2.099, 2.101, 2.101, 2.101, 2.101, 2.104, 2.105, 2.105, 2.103, 2.102,
+                            2.101, 2.099, 2.099, 2.099, 2.099, 2.098, 2.097, 2.097, 2.097, 2.096, 2.096, 2.095, 2.095, 2.095, 2.095, 2.095, 2.096, 2.098, 2.098, 2.097, 2.097, 2.098, 2.099, 2.101, 2.101, 2.102, 2.103, 2.104, 2.105, 2.105, 2.104, 2.103,
+                            2.102, 2.102, 2.099, 2.098, 2.099, 2.099, 2.099, 2.098, 2.097, 2.097, 2.097, 2.097, 2.097, 2.096, 2.096, 2.097, 2.098, 2.098, 2.099, 2.099, 2.099, 2.101, 2.101, 2.102, 2.104, 2.105, 2.106, 2.106, 2.106, 2.104, 2.104, 2.104,
+                            2.102, 2.101, 2.099, 2.099, 2.099, 2.101, 2.101, 2.101, 2.099, 2.098, 2.098, 2.098, 2.098, 2.098, 2.098, 2.098, 2.099, 2.099, 2.099, 2.099, 2.101, 2.101, 2.102, 2.103, 2.105, 2.106, 2.106, 2.106, 2.106, 2.105, 2.104, 2.104,
+                            2.099, 2.099, 2.099, 2.098, 2.098, 2.099, 2.101, 2.101, 2.099, 2.098, 2.097, 2.098, 2.098, 2.099, 2.098, 2.098, 2.099, 2.099, 2.101, 2.101, 2.101, 2.101, 2.102, 2.104, 2.105, 2.105, 2.105, 2.106, 2.106, 2.104, 2.104, 2.103,
+                            2.096, 2.097, 2.097, 2.097, 2.097, 2.099, 2.099, 2.099, 2.099, 2.097, 2.097, 2.098, 2.098, 2.099, 2.098, 2.097, 2.097, 2.099, 2.101, 2.101, 2.101, 2.101, 2.101, 2.103, 2.105, 2.105, 2.105, 2.104, 2.104, 2.103, 2.101, 2.101,
+                            2.096, 2.096, 2.096, 2.097, 2.097, 2.098, 2.098, 2.099, 2.097, 2.096, 2.096, 2.097, 2.098, 2.098, 2.097, 2.097, 2.096, 2.098, 2.098, 2.099, 2.101, 2.101, 2.101, 2.102, 2.104, 2.105, 2.104, 2.104, 2.103, 2.101, 2.099, 2.098,
+                            2.096, 2.096, 2.096, 2.096, 2.097, 2.097, 2.097, 2.097, 2.097, 2.097, 2.096, 2.097, 2.098, 2.097, 2.097, 2.096, 2.096, 2.098, 2.098, 2.098, 2.099, 2.099, 2.101, 2.101, 2.103, 2.103, 2.104, 2.104, 2.102, 2.101, 2.099, 2.098,
+                            2.097, 2.096, 2.095, 2.096, 2.098, 2.098, 2.098, 2.098, 2.097, 2.098, 2.097, 2.097, 2.097, 2.097, 2.096, 2.096, 2.096, 2.097, 2.097, 2.098, 2.099, 2.099, 2.099, 2.101, 2.102, 2.103, 2.104, 2.104, 2.104, 2.101, 2.099, 2.098,
+                            2.097, 2.096, 2.095, 2.097, 2.099, 2.099, 2.099, 2.099, 2.099, 2.099, 2.098, 2.098, 2.097, 2.096, 2.096, 2.097, 2.097, 2.098, 2.097, 2.099, 2.101, 2.099, 2.099, 2.099, 2.102, 2.102, 2.104, 2.105, 2.105, 2.102, 2.099, 2.098
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.431, 3.437, 3.439, 3.439, 3.436, 3.438, 3.441, 3.441, 3.441, 3.441, 3.442, 3.443, 3.443, 3.444, 3.446, 3.448, 3.451, 3.451, 3.452, 3.451, 3.449, 3.449, 3.452, 3.453, 3.454, 3.454, 3.453, 3.456, 3.456, 3.456, 3.451, 3.448,
+                            3.445, 3.446, 3.445, 3.449, 3.453, 3.451, 3.451, 3.446, 3.447, 3.446, 3.447, 3.451, 3.453, 3.455, 3.454, 3.453, 3.453, 3.454, 3.455, 3.456, 3.457, 3.459, 3.461, 3.462, 3.463, 3.463, 3.465, 3.466, 3.467, 3.465, 3.459, 3.457,
+                            3.449, 3.449, 3.449, 3.454, 3.455, 3.454, 3.453, 3.451, 3.451, 3.448, 3.451, 3.451, 3.455, 3.456, 3.457, 3.456, 3.456, 3.458, 3.457, 3.459, 3.459, 3.461, 3.464, 3.467, 3.467, 3.466, 3.468, 3.469, 3.471, 3.468, 3.465, 3.462,
+                            3.451, 3.448, 3.451, 3.453, 3.457, 3.455, 3.454, 3.449, 3.449, 3.448, 3.449, 3.449, 3.455, 3.455, 3.456, 3.455, 3.454, 3.455, 3.455, 3.457, 3.458, 3.458, 3.461, 3.464, 3.466, 3.468, 3.469, 3.469, 3.469, 3.468, 3.465, 3.463,
+                            3.449, 3.449, 3.451, 3.453, 3.456, 3.455, 3.452, 3.449, 3.448, 3.447, 3.446, 3.448, 3.451, 3.452, 3.454, 3.455, 3.455, 3.454, 3.457, 3.458, 3.458, 3.459, 3.461, 3.464, 3.464, 3.466, 3.467, 3.469, 3.469, 3.467, 3.463, 3.459,
+                            3.449, 3.451, 3.452, 3.454, 3.455, 3.454, 3.452, 3.449, 3.447, 3.447, 3.446, 3.449, 3.449, 3.451, 3.452, 3.452, 3.452, 3.452, 3.454, 3.455, 3.457, 3.459, 3.461, 3.464, 3.464, 3.466, 3.465, 3.468, 3.468, 3.469, 3.465, 3.462,
+                            3.451, 3.451, 3.452, 3.453, 3.453, 3.453, 3.451, 3.449, 3.449, 3.447, 3.446, 3.447, 3.448, 3.451, 3.451, 3.451, 3.453, 3.452, 3.452, 3.452, 3.457, 3.458, 3.461, 3.463, 3.464, 3.465, 3.464, 3.466, 3.468, 3.469, 3.466, 3.463,
+                            3.451, 3.451, 3.451, 3.454, 3.453, 3.453, 3.451, 3.448, 3.448, 3.444, 3.444, 3.444, 3.448, 3.449, 3.449, 3.448, 3.449, 3.449, 3.451, 3.452, 3.454, 3.457, 3.461, 3.462, 3.464, 3.466, 3.466, 3.467, 3.468, 3.469, 3.466, 3.465,
+                            3.451, 3.451, 3.452, 3.455, 3.454, 3.453, 3.449, 3.448, 3.447, 3.447, 3.444, 3.446, 3.446, 3.446, 3.446, 3.447, 3.449, 3.449, 3.451, 3.452, 3.455, 3.457, 3.461, 3.462, 3.464, 3.466, 3.466, 3.468, 3.469, 3.468, 3.465, 3.462,
+                            3.453, 3.452, 3.454, 3.456, 3.455, 3.453, 3.449, 3.447, 3.446, 3.446, 3.445, 3.448, 3.447, 3.446, 3.445, 3.446, 3.448, 3.448, 3.449, 3.453, 3.455, 3.457, 3.459, 3.461, 3.464, 3.466, 3.467, 3.468, 3.468, 3.467, 3.465, 3.463,
+                            3.453, 3.453, 3.454, 3.456, 3.456, 3.451, 3.448, 3.447, 3.447, 3.446, 3.445, 3.446, 3.446, 3.446, 3.446, 3.446, 3.448, 3.448, 3.449, 3.452, 3.454, 3.456, 3.459, 3.459, 3.461, 3.465, 3.466, 3.468, 3.468, 3.468, 3.467, 3.465,
+                            3.451, 3.451, 3.452, 3.455, 3.456, 3.452, 3.448, 3.446, 3.446, 3.444, 3.446, 3.445, 3.446, 3.446, 3.447, 3.448, 3.449, 3.449, 3.449, 3.452, 3.453, 3.454, 3.458, 3.458, 3.461, 3.461, 3.464, 3.469, 3.469, 3.468, 3.466, 3.466,
+                            3.452, 3.452, 3.453, 3.454, 3.454, 3.453, 3.447, 3.446, 3.444, 3.444, 3.444, 3.444, 3.445, 3.446, 3.448, 3.451, 3.452, 3.453, 3.451, 3.453, 3.453, 3.455, 3.458, 3.459, 3.461, 3.462, 3.463, 3.468, 3.471, 3.469, 3.467, 3.467,
+                            3.454, 3.455, 3.457, 3.458, 3.458, 3.455, 3.449, 3.446, 3.445, 3.445, 3.445, 3.445, 3.447, 3.447, 3.448, 3.451, 3.452, 3.453, 3.452, 3.452, 3.452, 3.454, 3.457, 3.459, 3.459, 3.462, 3.464, 3.468, 3.469, 3.467, 3.465, 3.465,
+                            3.457, 3.455, 3.455, 3.459, 3.458, 3.454, 3.451, 3.448, 3.445, 3.445, 3.445, 3.446, 3.448, 3.449, 3.451, 3.452, 3.451, 3.453, 3.452, 3.452, 3.453, 3.457, 3.457, 3.461, 3.461, 3.463, 3.465, 3.468, 3.471, 3.468, 3.465, 3.463,
+                            3.458, 3.456, 3.456, 3.459, 3.457, 3.454, 3.452, 3.449, 3.447, 3.445, 3.446, 3.447, 3.447, 3.448, 3.449, 3.448, 3.449, 3.451, 3.451, 3.451, 3.451, 3.455, 3.456, 3.458, 3.462, 3.463, 3.464, 3.465, 3.467, 3.466, 3.464, 3.462,
+                            3.457, 3.456, 3.455, 3.457, 3.457, 3.454, 3.449, 3.447, 3.445, 3.445, 3.446, 3.446, 3.448, 3.446, 3.448, 3.449, 3.449, 3.451, 3.451, 3.451, 3.453, 3.455, 3.457, 3.459, 3.462, 3.464, 3.464, 3.465, 3.467, 3.464, 3.464, 3.463,
+                            3.458, 3.457, 3.455, 3.456, 3.456, 3.456, 3.453, 3.449, 3.447, 3.448, 3.447, 3.447, 3.447, 3.447, 3.447, 3.448, 3.449, 3.451, 3.451, 3.452, 3.453, 3.455, 3.458, 3.459, 3.459, 3.463, 3.464, 3.463, 3.464, 3.463, 3.464, 3.464,
+                            3.457, 3.456, 3.456, 3.456, 3.456, 3.456, 3.455, 3.449, 3.447, 3.448, 3.451, 3.449, 3.449, 3.449, 3.448, 3.449, 3.449, 3.451, 3.451, 3.452, 3.453, 3.456, 3.458, 3.459, 3.461, 3.462, 3.464, 3.464, 3.465, 3.464, 3.464, 3.463,
+                            3.457, 3.456, 3.455, 3.455, 3.455, 3.455, 3.453, 3.451, 3.449, 3.448, 3.448, 3.449, 3.449, 3.449, 3.448, 3.449, 3.451, 3.452, 3.452, 3.453, 3.454, 3.457, 3.458, 3.459, 3.462, 3.464, 3.465, 3.464, 3.465, 3.464, 3.463, 3.463,
+                            3.456, 3.456, 3.454, 3.453, 3.454, 3.453, 3.452, 3.451, 3.449, 3.448, 3.448, 3.449, 3.451, 3.451, 3.448, 3.449, 3.451, 3.454, 3.454, 3.454, 3.455, 3.457, 3.458, 3.461, 3.461, 3.462, 3.464, 3.464, 3.466, 3.465, 3.464, 3.464,
+                            3.459, 3.457, 3.456, 3.455, 3.454, 3.453, 3.453, 3.452, 3.452, 3.451, 3.449, 3.449, 3.449, 3.448, 3.447, 3.449, 3.451, 3.454, 3.455, 3.455, 3.456, 3.458, 3.459, 3.461, 3.461, 3.462, 3.463, 3.466, 3.469, 3.465, 3.465, 3.464,
+                            3.463, 3.461, 3.458, 3.458, 3.457, 3.456, 3.456, 3.454, 3.454, 3.452, 3.452, 3.451, 3.451, 3.449, 3.448, 3.448, 3.452, 3.454, 3.456, 3.455, 3.457, 3.458, 3.461, 3.464, 3.462, 3.461, 3.463, 3.466, 3.469, 3.469, 3.467, 3.467,
+                            3.466, 3.462, 3.461, 3.461, 3.459, 3.457, 3.457, 3.457, 3.456, 3.454, 3.455, 3.455, 3.455, 3.451, 3.452, 3.453, 3.454, 3.455, 3.456, 3.456, 3.459, 3.462, 3.463, 3.466, 3.466, 3.467, 3.466, 3.469, 3.471, 3.469, 3.468, 3.466,
+                            3.467, 3.463, 3.463, 3.459, 3.461, 3.459, 3.461, 3.459, 3.458, 3.456, 3.457, 3.456, 3.457, 3.455, 3.456, 3.455, 3.456, 3.457, 3.459, 3.461, 3.461, 3.464, 3.465, 3.468, 3.469, 3.469, 3.469, 3.469, 3.471, 3.468, 3.467, 3.468,
+                            3.467, 3.464, 3.459, 3.459, 3.462, 3.462, 3.462, 3.461, 3.461, 3.462, 3.461, 3.459, 3.461, 3.459, 3.458, 3.457, 3.459, 3.461, 3.462, 3.463, 3.464, 3.466, 3.468, 3.469, 3.471, 3.469, 3.471, 3.472, 3.471, 3.467, 3.466, 3.464,
+                            3.464, 3.462, 3.458, 3.457, 3.458, 3.461, 3.461, 3.461, 3.461, 3.462, 3.462, 3.461, 3.461, 3.459, 3.459, 3.459, 3.461, 3.461, 3.464, 3.465, 3.465, 3.468, 3.468, 3.469, 3.471, 3.469, 3.469, 3.469, 3.469, 3.464, 3.462, 3.459,
+                            3.457, 3.458, 3.455, 3.456, 3.456, 3.457, 3.459, 3.459, 3.459, 3.459, 3.458, 3.456, 3.458, 3.457, 3.458, 3.458, 3.458, 3.459, 3.461, 3.463, 3.465, 3.466, 3.468, 3.469, 3.471, 3.468, 3.466, 3.466, 3.465, 3.461, 3.459, 3.457,
+                            3.456, 3.455, 3.454, 3.454, 3.455, 3.456, 3.458, 3.459, 3.459, 3.456, 3.456, 3.456, 3.455, 3.456, 3.455, 3.455, 3.455, 3.454, 3.457, 3.461, 3.462, 3.464, 3.465, 3.467, 3.467, 3.466, 3.464, 3.464, 3.463, 3.461, 3.457, 3.456,
+                            3.456, 3.454, 3.453, 3.454, 3.454, 3.455, 3.458, 3.459, 3.459, 3.456, 3.455, 3.455, 3.455, 3.451, 3.453, 3.454, 3.454, 3.455, 3.455, 3.458, 3.461, 3.462, 3.461, 3.463, 3.465, 3.464, 3.463, 3.463, 3.462, 3.459, 3.456, 3.451,
+                            3.455, 3.452, 3.452, 3.452, 3.455, 3.457, 3.459, 3.459, 3.459, 3.458, 3.456, 3.456, 3.455, 3.453, 3.453, 3.455, 3.457, 3.457, 3.457, 3.461, 3.461, 3.461, 3.459, 3.462, 3.464, 3.464, 3.464, 3.463, 3.463, 3.459, 3.454, 3.451,
+                            3.452, 3.452, 3.452, 3.453, 3.457, 3.458, 3.458, 3.459, 3.459, 3.458, 3.457, 3.457, 3.455, 3.455, 3.458, 3.459, 3.458, 3.459, 3.459, 3.461, 3.461, 3.461, 3.459, 3.461, 3.463, 3.464, 3.466, 3.463, 3.461, 3.458, 3.453, 3.449
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.403, 3.399, 3.395, 3.391, 3.392, 3.394, 3.401, 3.403, 3.404, 3.404, 3.403, 3.399, 3.398, 3.396, 3.395, 3.396, 3.399, 3.403, 3.404, 3.401, 3.399, 3.398, 3.397, 3.401, 3.401, 3.401, 3.396, 3.394, 3.397, 3.396, 3.388, 3.364,
+                            3.403, 3.399, 3.393, 3.389, 3.391, 3.395, 3.401, 3.404, 3.406, 3.404, 3.403, 3.399, 3.399, 3.397, 3.397, 3.397, 3.401, 3.404, 3.404, 3.402, 3.398, 3.396, 3.397, 3.401, 3.401, 3.401, 3.395, 3.394, 3.396, 3.393, 3.387, 3.364,
+                            3.399, 3.398, 3.391, 3.385, 3.386, 3.395, 3.402, 3.405, 3.405, 3.404, 3.402, 3.399, 3.399, 3.398, 3.398, 3.398, 3.401, 3.404, 3.405, 3.403, 3.399, 3.396, 3.396, 3.398, 3.401, 3.401, 3.398, 3.394, 3.392, 3.389, 3.386, 3.364,
+                            3.398, 3.393, 3.386, 3.382, 3.385, 3.392, 3.399, 3.403, 3.405, 3.404, 3.402, 3.398, 3.398, 3.397, 3.397, 3.398, 3.401, 3.404, 3.405, 3.403, 3.398, 3.394, 3.394, 3.398, 3.401, 3.401, 3.396, 3.392, 3.391, 3.388, 3.383, 3.362,
+                            3.396, 3.391, 3.384, 3.381, 3.384, 3.389, 3.398, 3.402, 3.402, 3.401, 3.399, 3.395, 3.395, 3.395, 3.397, 3.397, 3.401, 3.402, 3.404, 3.403, 3.399, 3.394, 3.393, 3.395, 3.399, 3.399, 3.397, 3.391, 3.388, 3.384, 3.381, 3.363,
+                            3.391, 3.386, 3.382, 3.381, 3.385, 3.389, 3.396, 3.398, 3.399, 3.399, 3.398, 3.395, 3.394, 3.394, 3.395, 3.397, 3.399, 3.401, 3.403, 3.401, 3.398, 3.394, 3.393, 3.393, 3.394, 3.396, 3.395, 3.392, 3.387, 3.382, 3.378, 3.361,
+                            3.389, 3.386, 3.379, 3.379, 3.383, 3.388, 3.394, 3.397, 3.397, 3.397, 3.395, 3.393, 3.393, 3.393, 3.395, 3.395, 3.397, 3.398, 3.401, 3.399, 3.397, 3.395, 3.394, 3.391, 3.393, 3.393, 3.393, 3.389, 3.387, 3.381, 3.374, 3.357,
+                            3.386, 3.383, 3.376, 3.375, 3.381, 3.386, 3.394, 3.396, 3.396, 3.394, 3.392, 3.392, 3.394, 3.394, 3.395, 3.394, 3.396, 3.398, 3.399, 3.397, 3.397, 3.394, 3.393, 3.391, 3.389, 3.391, 3.392, 3.388, 3.386, 3.379, 3.372, 3.355,
+                            3.386, 3.379, 3.373, 3.373, 3.378, 3.384, 3.391, 3.396, 3.395, 3.393, 3.389, 3.391, 3.391, 3.393, 3.394, 3.393, 3.394, 3.396, 3.397, 3.396, 3.393, 3.394, 3.393, 3.392, 3.389, 3.389, 3.389, 3.389, 3.386, 3.378, 3.371, 3.351,
+                            3.379, 3.375, 3.371, 3.371, 3.376, 3.381, 3.388, 3.393, 3.394, 3.391, 3.386, 3.386, 3.388, 3.393, 3.392, 3.392, 3.393, 3.395, 3.394, 3.392, 3.389, 3.391, 3.391, 3.392, 3.389, 3.388, 3.389, 3.389, 3.383, 3.377, 3.369, 3.351,
+                            3.373, 3.371, 3.367, 3.368, 3.373, 3.381, 3.387, 3.389, 3.391, 3.389, 3.385, 3.386, 3.383, 3.389, 3.389, 3.392, 3.392, 3.394, 3.393, 3.389, 3.387, 3.387, 3.388, 3.389, 3.389, 3.388, 3.386, 3.386, 3.382, 3.374, 3.367, 3.345,
+                            3.371, 3.369, 3.365, 3.366, 3.373, 3.379, 3.386, 3.389, 3.391, 3.389, 3.385, 3.384, 3.382, 3.386, 3.387, 3.389, 3.391, 3.392, 3.391, 3.387, 3.385, 3.385, 3.386, 3.388, 3.388, 3.388, 3.386, 3.385, 3.381, 3.373, 3.367, 3.345,
+                            3.367, 3.365, 3.365, 3.366, 3.374, 3.379, 3.384, 3.388, 3.389, 3.387, 3.384, 3.383, 3.383, 3.385, 3.385, 3.386, 3.388, 3.389, 3.388, 3.386, 3.383, 3.382, 3.384, 3.386, 3.387, 3.386, 3.381, 3.381, 3.379, 3.372, 3.364, 3.344,
+                            3.365, 3.363, 3.362, 3.367, 3.375, 3.379, 3.383, 3.384, 3.386, 3.384, 3.381, 3.379, 3.379, 3.383, 3.383, 3.384, 3.385, 3.387, 3.387, 3.385, 3.381, 3.381, 3.382, 3.384, 3.384, 3.385, 3.382, 3.379, 3.374, 3.369, 3.359, 3.343,
+                            3.359, 3.358, 3.361, 3.364, 3.373, 3.381, 3.384, 3.384, 3.385, 3.384, 3.381, 3.377, 3.379, 3.379, 3.382, 3.383, 3.384, 3.386, 3.386, 3.385, 3.381, 3.379, 3.381, 3.382, 3.382, 3.383, 3.379, 3.377, 3.371, 3.364, 3.357, 3.339,
+                            3.357, 3.356, 3.356, 3.362, 3.372, 3.379, 3.384, 3.384, 3.383, 3.381, 3.378, 3.376, 3.377, 3.379, 3.381, 3.382, 3.383, 3.385, 3.385, 3.383, 3.379, 3.379, 3.379, 3.381, 3.381, 3.382, 3.379, 3.372, 3.367, 3.362, 3.354, 3.334,
+                            3.357, 3.354, 3.357, 3.361, 3.372, 3.381, 3.385, 3.385, 3.384, 3.379, 3.376, 3.376, 3.376, 3.379, 3.381, 3.383, 3.383, 3.384, 3.383, 3.379, 3.378, 3.381, 3.379, 3.379, 3.379, 3.379, 3.378, 3.371, 3.363, 3.358, 3.354, 3.332,
+                            3.354, 3.351, 3.354, 3.359, 3.371, 3.379, 3.382, 3.384, 3.381, 3.378, 3.375, 3.374, 3.376, 3.378, 3.381, 3.383, 3.384, 3.382, 3.377, 3.377, 3.376, 3.377, 3.378, 3.378, 3.379, 3.379, 3.376, 3.367, 3.361, 3.357, 3.352, 3.333,
+                            3.352, 3.349, 3.351, 3.357, 3.372, 3.381, 3.383, 3.383, 3.381, 3.376, 3.372, 3.373, 3.375, 3.377, 3.382, 3.384, 3.384, 3.379, 3.376, 3.374, 3.374, 3.375, 3.375, 3.376, 3.377, 3.376, 3.373, 3.366, 3.361, 3.356, 3.347, 3.332,
+                            3.347, 3.346, 3.346, 3.355, 3.371, 3.377, 3.382, 3.381, 3.379, 3.372, 3.371, 3.371, 3.372, 3.375, 3.379, 3.383, 3.384, 3.379, 3.374, 3.373, 3.371, 3.373, 3.374, 3.375, 3.374, 3.374, 3.371, 3.365, 3.359, 3.352, 3.343, 3.331,
+                            3.345, 3.344, 3.345, 3.353, 3.367, 3.374, 3.382, 3.382, 3.376, 3.371, 3.369, 3.368, 3.369, 3.373, 3.377, 3.381, 3.379, 3.376, 3.373, 3.369, 3.368, 3.371, 3.372, 3.373, 3.371, 3.371, 3.369, 3.363, 3.357, 3.349, 3.341, 3.326,
+                            3.343, 3.341, 3.344, 3.351, 3.362, 3.371, 3.376, 3.376, 3.372, 3.369, 3.367, 3.366, 3.367, 3.369, 3.376, 3.378, 3.378, 3.375, 3.371, 3.367, 3.367, 3.368, 3.369, 3.369, 3.369, 3.368, 3.365, 3.361, 3.354, 3.347, 3.338, 3.321,
+                            3.341, 3.339, 3.342, 3.349, 3.359, 3.367, 3.371, 3.372, 3.371, 3.368, 3.366, 3.363, 3.365, 3.368, 3.371, 3.374, 3.376, 3.374, 3.368, 3.365, 3.365, 3.366, 3.368, 3.367, 3.367, 3.363, 3.361, 3.356, 3.352, 3.346, 3.336, 3.317,
+                            3.338, 3.336, 3.338, 3.346, 3.359, 3.364, 3.368, 3.369, 3.367, 3.366, 3.363, 3.362, 3.364, 3.364, 3.367, 3.371, 3.372, 3.369, 3.365, 3.362, 3.362, 3.365, 3.367, 3.367, 3.366, 3.362, 3.357, 3.353, 3.349, 3.342, 3.335, 3.317,
+                            3.334, 3.334, 3.336, 3.346, 3.354, 3.361, 3.365, 3.365, 3.365, 3.362, 3.361, 3.361, 3.362, 3.362, 3.364, 3.366, 3.368, 3.366, 3.361, 3.357, 3.357, 3.359, 3.363, 3.365, 3.363, 3.361, 3.355, 3.351, 3.346, 3.339, 3.336, 3.317,
+                            3.332, 3.332, 3.334, 3.344, 3.354, 3.359, 3.363, 3.365, 3.363, 3.361, 3.359, 3.359, 3.363, 3.363, 3.365, 3.365, 3.367, 3.366, 3.358, 3.356, 3.356, 3.358, 3.362, 3.364, 3.363, 3.359, 3.353, 3.348, 3.345, 3.339, 3.336, 3.315,
+                            3.332, 3.328, 3.331, 3.343, 3.351, 3.357, 3.358, 3.362, 3.361, 3.359, 3.357, 3.357, 3.361, 3.362, 3.364, 3.363, 3.363, 3.359, 3.356, 3.354, 3.354, 3.355, 3.358, 3.359, 3.361, 3.359, 3.351, 3.346, 3.344, 3.339, 3.336, 3.313,
+                            3.324, 3.324, 3.327, 3.334, 3.345, 3.351, 3.354, 3.356, 3.356, 3.354, 3.353, 3.354, 3.357, 3.358, 3.361, 3.358, 3.359, 3.355, 3.352, 3.348, 3.347, 3.351, 3.354, 3.358, 3.359, 3.355, 3.346, 3.343, 3.341, 3.336, 3.331, 3.312,
+                            3.318, 3.319, 3.321, 3.328, 3.337, 3.339, 3.345, 3.348, 3.346, 3.345, 3.347, 3.348, 3.351, 3.354, 3.356, 3.353, 3.354, 3.344, 3.343, 3.343, 3.343, 3.344, 3.347, 3.349, 3.353, 3.346, 3.341, 3.339, 3.331, 3.329, 3.325, 3.311,
+                            3.309, 3.313, 3.317, 3.325, 3.329, 3.332, 3.338, 3.339, 3.341, 3.339, 3.339, 3.342, 3.346, 3.346, 3.351, 3.351, 3.343, 3.338, 3.338, 3.339, 3.339, 3.339, 3.341, 3.341, 3.346, 3.343, 3.339, 3.332, 3.327, 3.326, 3.322, 3.309,
+                            3.305, 3.309, 3.317, 3.325, 3.328, 3.331, 3.334, 3.336, 3.337, 3.336, 3.339, 3.341, 3.344, 3.346, 3.348, 3.347, 3.341, 3.336, 3.335, 3.337, 3.339, 3.341, 3.339, 3.339, 3.342, 3.341, 3.337, 3.329, 3.326, 3.325, 3.321, 3.314,
+                            3.302, 3.306, 3.319, 3.325, 3.329, 3.331, 3.334, 3.335, 3.337, 3.337, 3.339, 3.341, 3.344, 3.346, 3.348, 3.347, 3.342, 3.336, 3.336, 3.338, 3.339, 3.341, 3.341, 3.341, 3.339, 3.338, 3.336, 3.331, 3.327, 3.324, 3.321, 3.314
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.726, 1.725, 1.723, 1.721, 1.723, 1.724, 1.724, 1.726, 1.727, 1.728, 1.729, 1.728, 1.725, 1.724, 1.726, 1.726, 1.727, 1.729, 1.727, 1.727, 1.724, 1.725, 1.724, 1.726, 1.725, 1.725, 1.724, 1.724, 1.722, 1.721, 1.719, 1.714,
+                            1.726, 1.724, 1.722, 1.721, 1.722, 1.723, 1.725, 1.726, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.726, 1.727, 1.728, 1.728, 1.727, 1.725, 1.724, 1.724, 1.725, 1.726, 1.725, 1.724, 1.723, 1.722, 1.721, 1.719, 1.714,
+                            1.724, 1.722, 1.719, 1.719, 1.721, 1.723, 1.726, 1.726, 1.727, 1.727, 1.727, 1.725, 1.726, 1.725, 1.725, 1.725, 1.726, 1.727, 1.728, 1.728, 1.725, 1.724, 1.724, 1.724, 1.726, 1.725, 1.724, 1.722, 1.722, 1.721, 1.719, 1.712,
+                            1.723, 1.721, 1.719, 1.719, 1.719, 1.723, 1.725, 1.726, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.726, 1.726, 1.728, 1.729, 1.728, 1.725, 1.723, 1.723, 1.725, 1.726, 1.725, 1.724, 1.722, 1.721, 1.719, 1.718, 1.711,
+                            1.722, 1.719, 1.719, 1.718, 1.719, 1.722, 1.725, 1.726, 1.726, 1.727, 1.727, 1.726, 1.725, 1.726, 1.726, 1.726, 1.727, 1.727, 1.728, 1.727, 1.726, 1.725, 1.724, 1.725, 1.726, 1.725, 1.724, 1.722, 1.721, 1.719, 1.715, 1.711,
+                            1.721, 1.717, 1.717, 1.716, 1.719, 1.722, 1.724, 1.726, 1.726, 1.727, 1.726, 1.726, 1.726, 1.726, 1.726, 1.727, 1.727, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.725, 1.725, 1.724, 1.722, 1.721, 1.718, 1.715, 1.707,
+                            1.718, 1.717, 1.716, 1.716, 1.718, 1.721, 1.725, 1.726, 1.726, 1.726, 1.725, 1.725, 1.725, 1.725, 1.726, 1.727, 1.727, 1.727, 1.727, 1.726, 1.726, 1.726, 1.725, 1.724, 1.724, 1.724, 1.723, 1.722, 1.721, 1.718, 1.715, 1.709,
+                            1.718, 1.716, 1.716, 1.715, 1.717, 1.721, 1.724, 1.725, 1.726, 1.725, 1.725, 1.724, 1.724, 1.725, 1.726, 1.726, 1.727, 1.727, 1.727, 1.726, 1.726, 1.726, 1.725, 1.723, 1.723, 1.723, 1.722, 1.722, 1.719, 1.718, 1.714, 1.709,
+                            1.718, 1.716, 1.715, 1.715, 1.717, 1.721, 1.723, 1.725, 1.726, 1.725, 1.724, 1.723, 1.724, 1.725, 1.725, 1.726, 1.726, 1.726, 1.726, 1.726, 1.726, 1.726, 1.725, 1.724, 1.724, 1.723, 1.722, 1.722, 1.721, 1.717, 1.714, 1.707,
+                            1.717, 1.716, 1.714, 1.714, 1.716, 1.721, 1.723, 1.725, 1.725, 1.725, 1.723, 1.723, 1.724, 1.726, 1.726, 1.726, 1.726, 1.725, 1.726, 1.725, 1.725, 1.725, 1.725, 1.725, 1.724, 1.723, 1.722, 1.721, 1.718, 1.716, 1.714, 1.706,
+                            1.715, 1.714, 1.714, 1.714, 1.716, 1.719, 1.722, 1.724, 1.725, 1.725, 1.723, 1.723, 1.724, 1.725, 1.725, 1.725, 1.726, 1.725, 1.725, 1.725, 1.724, 1.724, 1.724, 1.725, 1.724, 1.723, 1.722, 1.721, 1.718, 1.716, 1.713, 1.705,
+                            1.714, 1.714, 1.713, 1.714, 1.717, 1.719, 1.722, 1.724, 1.724, 1.724, 1.723, 1.722, 1.723, 1.724, 1.724, 1.724, 1.726, 1.725, 1.726, 1.725, 1.723, 1.723, 1.724, 1.724, 1.724, 1.723, 1.721, 1.719, 1.717, 1.715, 1.713, 1.706,
+                            1.712, 1.712, 1.712, 1.713, 1.718, 1.719, 1.721, 1.723, 1.724, 1.724, 1.722, 1.722, 1.723, 1.724, 1.724, 1.724, 1.725, 1.725, 1.725, 1.725, 1.723, 1.722, 1.724, 1.723, 1.723, 1.722, 1.721, 1.719, 1.717, 1.714, 1.711, 1.706,
+                            1.712, 1.711, 1.711, 1.713, 1.717, 1.719, 1.722, 1.724, 1.724, 1.723, 1.722, 1.722, 1.723, 1.724, 1.724, 1.724, 1.724, 1.725, 1.725, 1.724, 1.723, 1.722, 1.722, 1.722, 1.723, 1.722, 1.721, 1.718, 1.716, 1.714, 1.711, 1.706,
+                            1.711, 1.709, 1.711, 1.713, 1.716, 1.719, 1.722, 1.724, 1.724, 1.723, 1.722, 1.721, 1.722, 1.724, 1.724, 1.724, 1.723, 1.724, 1.724, 1.724, 1.722, 1.722, 1.722, 1.722, 1.722, 1.721, 1.719, 1.718, 1.714, 1.712, 1.709, 1.702,
+                            1.709, 1.709, 1.709, 1.712, 1.717, 1.719, 1.721, 1.723, 1.723, 1.723, 1.721, 1.721, 1.722, 1.723, 1.724, 1.723, 1.724, 1.724, 1.724, 1.724, 1.723, 1.722, 1.721, 1.721, 1.721, 1.721, 1.719, 1.716, 1.713, 1.711, 1.709, 1.701,
+                            1.708, 1.707, 1.709, 1.712, 1.716, 1.719, 1.722, 1.723, 1.723, 1.723, 1.721, 1.721, 1.721, 1.722, 1.723, 1.723, 1.723, 1.723, 1.724, 1.723, 1.722, 1.722, 1.721, 1.721, 1.721, 1.721, 1.719, 1.714, 1.712, 1.709, 1.708, 1.702,
+                            1.707, 1.707, 1.708, 1.711, 1.716, 1.721, 1.722, 1.722, 1.722, 1.721, 1.721, 1.721, 1.722, 1.722, 1.723, 1.723, 1.723, 1.722, 1.722, 1.722, 1.722, 1.721, 1.721, 1.721, 1.721, 1.721, 1.717, 1.714, 1.711, 1.709, 1.707, 1.702,
+                            1.706, 1.706, 1.707, 1.711, 1.714, 1.719, 1.722, 1.722, 1.722, 1.721, 1.719, 1.721, 1.721, 1.722, 1.723, 1.724, 1.723, 1.722, 1.722, 1.721, 1.719, 1.719, 1.721, 1.721, 1.719, 1.719, 1.716, 1.713, 1.711, 1.709, 1.706, 1.701,
+                            1.705, 1.704, 1.706, 1.709, 1.713, 1.718, 1.721, 1.722, 1.721, 1.719, 1.718, 1.719, 1.721, 1.722, 1.723, 1.724, 1.724, 1.721, 1.721, 1.721, 1.719, 1.719, 1.719, 1.719, 1.719, 1.717, 1.715, 1.713, 1.711, 1.707, 1.704, 1.699,
+                            1.703, 1.703, 1.704, 1.709, 1.712, 1.717, 1.719, 1.721, 1.719, 1.718, 1.717, 1.718, 1.719, 1.721, 1.722, 1.723, 1.723, 1.722, 1.719, 1.719, 1.718, 1.719, 1.719, 1.718, 1.717, 1.716, 1.714, 1.712, 1.709, 1.706, 1.703, 1.697,
+                            1.702, 1.703, 1.704, 1.708, 1.712, 1.715, 1.718, 1.719, 1.719, 1.717, 1.717, 1.717, 1.717, 1.718, 1.721, 1.722, 1.722, 1.721, 1.719, 1.718, 1.717, 1.718, 1.718, 1.717, 1.716, 1.714, 1.714, 1.711, 1.709, 1.706, 1.703, 1.697,
+                            1.702, 1.702, 1.703, 1.706, 1.709, 1.715, 1.717, 1.718, 1.717, 1.717, 1.716, 1.716, 1.717, 1.717, 1.719, 1.721, 1.721, 1.721, 1.719, 1.717, 1.716, 1.717, 1.717, 1.716, 1.714, 1.713, 1.712, 1.711, 1.708, 1.706, 1.702, 1.696,
+                            1.701, 1.701, 1.702, 1.706, 1.709, 1.714, 1.716, 1.717, 1.716, 1.716, 1.716, 1.715, 1.716, 1.716, 1.717, 1.718, 1.719, 1.719, 1.716, 1.715, 1.715, 1.715, 1.715, 1.715, 1.714, 1.713, 1.711, 1.709, 1.708, 1.704, 1.701, 1.695,
+                            1.699, 1.699, 1.702, 1.706, 1.708, 1.712, 1.714, 1.715, 1.715, 1.715, 1.714, 1.715, 1.714, 1.715, 1.716, 1.716, 1.716, 1.716, 1.714, 1.713, 1.713, 1.714, 1.715, 1.714, 1.714, 1.712, 1.709, 1.707, 1.706, 1.703, 1.701, 1.695,
+                            1.698, 1.699, 1.701, 1.705, 1.708, 1.711, 1.714, 1.714, 1.714, 1.714, 1.714, 1.714, 1.714, 1.715, 1.715, 1.716, 1.716, 1.715, 1.713, 1.713, 1.713, 1.714, 1.714, 1.714, 1.713, 1.712, 1.709, 1.707, 1.706, 1.703, 1.701, 1.696,
+                            1.698, 1.699, 1.701, 1.705, 1.707, 1.711, 1.712, 1.713, 1.713, 1.713, 1.713, 1.714, 1.714, 1.715, 1.715, 1.716, 1.715, 1.714, 1.713, 1.712, 1.712, 1.712, 1.713, 1.713, 1.713, 1.711, 1.709, 1.707, 1.705, 1.703, 1.701, 1.696,
+                            1.698, 1.697, 1.699, 1.702, 1.705, 1.707, 1.711, 1.711, 1.711, 1.711, 1.711, 1.712, 1.712, 1.713, 1.714, 1.714, 1.713, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.708, 1.706, 1.704, 1.703, 1.699, 1.696,
+                            1.694, 1.695, 1.697, 1.699, 1.702, 1.705, 1.706, 1.707, 1.707, 1.708, 1.708, 1.708, 1.709, 1.711, 1.711, 1.711, 1.708, 1.708, 1.708, 1.707, 1.707, 1.707, 1.708, 1.708, 1.709, 1.708, 1.706, 1.703, 1.702, 1.701, 1.698, 1.696,
+                            1.692, 1.692, 1.695, 1.698, 1.699, 1.701, 1.704, 1.704, 1.704, 1.704, 1.705, 1.706, 1.707, 1.709, 1.709, 1.707, 1.706, 1.704, 1.704, 1.705, 1.705, 1.706, 1.706, 1.706, 1.706, 1.706, 1.703, 1.702, 1.701, 1.699, 1.696, 1.694,
+                            1.691, 1.692, 1.695, 1.697, 1.699, 1.699, 1.702, 1.703, 1.703, 1.702, 1.703, 1.704, 1.706, 1.707, 1.708, 1.706, 1.705, 1.703, 1.703, 1.703, 1.704, 1.705, 1.705, 1.705, 1.705, 1.704, 1.703, 1.701, 1.699, 1.698, 1.696, 1.695,
+                            1.689, 1.691, 1.696, 1.698, 1.699, 1.699, 1.701, 1.702, 1.702, 1.702, 1.703, 1.703, 1.706, 1.707, 1.708, 1.706, 1.705, 1.703, 1.703, 1.703, 1.703, 1.704, 1.704, 1.705, 1.704, 1.704, 1.702, 1.701, 1.698, 1.698, 1.696, 1.696
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.425, 1.393, 1.341, 1.295, 1.258, 1.226, 1.201, 1.181, 1.162, 1.146, 1.133, 1.123, 1.115, 1.111, 1.107, 1.106, 1.106, 1.107, 1.108, 1.111, 1.114, 1.122, 1.133, 1.148, 1.164, 1.184, 1.208, 1.236, 1.271, 1.309, 1.359, 1.381,
+                    1.397, 1.367, 1.317, 1.274, 1.237, 1.207, 1.183, 1.163, 1.146, 1.133, 1.123, 1.114, 1.107, 1.101, 1.098, 1.096, 1.096, 1.096, 1.097, 1.102, 1.106, 1.112, 1.122, 1.133, 1.148, 1.166, 1.187, 1.215, 1.249, 1.288, 1.335, 1.359,
+                    1.374, 1.341, 1.292, 1.251, 1.215, 1.186, 1.166, 1.146, 1.131, 1.117, 1.108, 1.099, 1.091, 1.088, 1.084, 1.082, 1.081, 1.082, 1.084, 1.088, 1.093, 1.098, 1.107, 1.118, 1.133, 1.149, 1.169, 1.195, 1.228, 1.267, 1.313, 1.335,
+                    1.352, 1.318, 1.271, 1.231, 1.196, 1.169, 1.149, 1.131, 1.115, 1.103, 1.093, 1.086, 1.079, 1.074, 1.071, 1.069, 1.069, 1.069, 1.071, 1.076, 1.079, 1.085, 1.094, 1.102, 1.117, 1.133, 1.152, 1.176, 1.208, 1.246, 1.289, 1.313,
+                    1.333, 1.298, 1.253, 1.212, 1.179, 1.153, 1.134, 1.116, 1.102, 1.089, 1.079, 1.072, 1.066, 1.062, 1.059, 1.058, 1.057, 1.057, 1.059, 1.064, 1.068, 1.072, 1.081, 1.091, 1.102, 1.119, 1.137, 1.161, 1.191, 1.227, 1.271, 1.293,
+                    1.317, 1.281, 1.235, 1.196, 1.165, 1.139, 1.119, 1.104, 1.089, 1.078, 1.068, 1.062, 1.055, 1.051, 1.048, 1.047, 1.047, 1.047, 1.048, 1.053, 1.056, 1.061, 1.069, 1.079, 1.091, 1.105, 1.126, 1.147, 1.177, 1.212, 1.253, 1.278,
+                    1.301, 1.265, 1.221, 1.181, 1.151, 1.127, 1.108, 1.091, 1.078, 1.068, 1.059, 1.051, 1.045, 1.041, 1.038, 1.037, 1.036, 1.037, 1.038, 1.042, 1.046, 1.051, 1.059, 1.069, 1.081, 1.096, 1.113, 1.135, 1.164, 1.198, 1.238, 1.264,
+                    1.286, 1.251, 1.207, 1.169, 1.141, 1.116, 1.098, 1.081, 1.068, 1.058, 1.049, 1.042, 1.037, 1.033, 1.031, 1.029, 1.028, 1.028, 1.029, 1.033, 1.037, 1.043, 1.051, 1.059, 1.071, 1.086, 1.104, 1.124, 1.152, 1.185, 1.225, 1.252,
+                    1.275, 1.239, 1.196, 1.161, 1.132, 1.107, 1.089, 1.073, 1.059, 1.049, 1.041, 1.035, 1.028, 1.024, 1.023, 1.021, 1.021, 1.021, 1.022, 1.024, 1.029, 1.036, 1.043, 1.051, 1.063, 1.078, 1.095, 1.115, 1.143, 1.175, 1.214, 1.243,
+                    1.267, 1.227, 1.187, 1.152, 1.122, 1.101, 1.081, 1.067, 1.054, 1.042, 1.035, 1.028, 1.023, 1.018, 1.015, 1.014, 1.014, 1.014, 1.016, 1.019, 1.024, 1.029, 1.036, 1.045, 1.056, 1.071, 1.088, 1.107, 1.134, 1.167, 1.204, 1.234,
+                    1.261, 1.219, 1.179, 1.145, 1.116, 1.095, 1.076, 1.061, 1.047, 1.037, 1.031, 1.023, 1.018, 1.014, 1.011, 1.009, 1.009, 1.009, 1.011, 1.013, 1.018, 1.024, 1.031, 1.039, 1.049, 1.065, 1.083, 1.102, 1.128, 1.161, 1.196, 1.228,
+                    1.256, 1.213, 1.173, 1.139, 1.111, 1.091, 1.071, 1.056, 1.043, 1.033, 1.026, 1.019, 1.014, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.009, 1.013, 1.018, 1.026, 1.035, 1.046, 1.061, 1.078, 1.097, 1.123, 1.154, 1.191, 1.222,
+                    1.251, 1.208, 1.169, 1.137, 1.108, 1.088, 1.069, 1.053, 1.039, 1.029, 1.023, 1.015, 1.011, 1.006, 1.004, 1.003, 1.001, 1.002, 1.003, 1.006, 1.009, 1.015, 1.022, 1.032, 1.044, 1.057, 1.076, 1.094, 1.119, 1.149, 1.186, 1.218,
+                    1.249, 1.205, 1.167, 1.133, 1.107, 1.085, 1.067, 1.052, 1.038, 1.029, 1.021, 1.013, 1.008, 1.004, 1.003, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.013, 1.021, 1.031, 1.042, 1.055, 1.073, 1.093, 1.116, 1.147, 1.182, 1.218,
+                    1.249, 1.204, 1.165, 1.132, 1.106, 1.085, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.007, 1.003, 1.002, 1.001, 1.001, 1.001, 1.001, 1.004, 1.007, 1.013, 1.021, 1.029, 1.042, 1.055, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.249, 1.204, 1.165, 1.132, 1.107, 1.086, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.008, 1.004, 1.002, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.014, 1.021, 1.029, 1.042, 1.056, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.251, 1.205, 1.166, 1.133, 1.108, 1.087, 1.068, 1.052, 1.039, 1.031, 1.021, 1.014, 1.009, 1.006, 1.003, 1.002, 1.001, 1.001, 1.003, 1.006, 1.009, 1.014, 1.022, 1.031, 1.043, 1.056, 1.073, 1.093, 1.116, 1.145, 1.182, 1.218,
+                    1.252, 1.208, 1.168, 1.137, 1.111, 1.089, 1.071, 1.055, 1.043, 1.033, 1.023, 1.016, 1.012, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.008, 1.012, 1.017, 1.024, 1.034, 1.045, 1.059, 1.075, 1.095, 1.119, 1.149, 1.185, 1.218,
+                    1.256, 1.213, 1.173, 1.142, 1.115, 1.093, 1.075, 1.059, 1.047, 1.036, 1.027, 1.021, 1.016, 1.012, 1.011, 1.009, 1.008, 1.008, 1.009, 1.012, 1.016, 1.021, 1.028, 1.038, 1.049, 1.064, 1.081, 1.099, 1.126, 1.155, 1.192, 1.223,
+                    1.261, 1.221, 1.179, 1.148, 1.121, 1.099, 1.081, 1.065, 1.052, 1.042, 1.032, 1.026, 1.021, 1.017, 1.015, 1.014, 1.014, 1.013, 1.013, 1.016, 1.021, 1.026, 1.033, 1.043, 1.054, 1.068, 1.085, 1.106, 1.132, 1.161, 1.199, 1.228,
+                    1.267, 1.228, 1.188, 1.155, 1.128, 1.105, 1.086, 1.071, 1.059, 1.047, 1.038, 1.031, 1.027, 1.022, 1.021, 1.019, 1.019, 1.019, 1.019, 1.022, 1.026, 1.032, 1.038, 1.049, 1.061, 1.075, 1.092, 1.112, 1.138, 1.169, 1.207, 1.236,
+                    1.278, 1.241, 1.199, 1.164, 1.137, 1.114, 1.094, 1.078, 1.066, 1.055, 1.046, 1.038, 1.032, 1.029, 1.027, 1.027, 1.027, 1.027, 1.027, 1.029, 1.032, 1.038, 1.047, 1.056, 1.067, 1.083, 1.099, 1.121, 1.146, 1.178, 1.217, 1.244,
+                    1.291, 1.252, 1.211, 1.175, 1.147, 1.124, 1.103, 1.088, 1.075, 1.063, 1.054, 1.046, 1.041, 1.036, 1.035, 1.035, 1.035, 1.035, 1.036, 1.038, 1.041, 1.047, 1.055, 1.065, 1.075, 1.092, 1.111, 1.132, 1.157, 1.189, 1.231, 1.255,
+                    1.303, 1.265, 1.222, 1.187, 1.158, 1.133, 1.112, 1.097, 1.083, 1.072, 1.063, 1.054, 1.048, 1.043, 1.043, 1.043, 1.043, 1.043, 1.043, 1.046, 1.049, 1.055, 1.065, 1.074, 1.086, 1.102, 1.119, 1.144, 1.171, 1.203, 1.243, 1.268,
+                    1.317, 1.282, 1.236, 1.201, 1.171, 1.146, 1.125, 1.109, 1.095, 1.083, 1.072, 1.064, 1.058, 1.054, 1.052, 1.051, 1.051, 1.053, 1.054, 1.057, 1.061, 1.065, 1.074, 1.086, 1.099, 1.113, 1.133, 1.156, 1.183, 1.217, 1.259, 1.282,
+                    1.335, 1.301, 1.254, 1.218, 1.186, 1.159, 1.138, 1.121, 1.108, 1.095, 1.085, 1.076, 1.069, 1.066, 1.065, 1.063, 1.062, 1.063, 1.065, 1.068, 1.073, 1.078, 1.087, 1.098, 1.113, 1.126, 1.146, 1.171, 1.199, 1.235, 1.277, 1.299,
+                    1.356, 1.321, 1.274, 1.235, 1.202, 1.175, 1.153, 1.137, 1.121, 1.108, 1.097, 1.089, 1.084, 1.081, 1.077, 1.075, 1.075, 1.075, 1.077, 1.081, 1.086, 1.091, 1.099, 1.113, 1.126, 1.144, 1.162, 1.187, 1.218, 1.255, 1.297, 1.321,
+                    1.376, 1.344, 1.296, 1.257, 1.223, 1.194, 1.171, 1.153, 1.137, 1.124, 1.112, 1.104, 1.099, 1.095, 1.093, 1.091, 1.089, 1.091, 1.092, 1.095, 1.101, 1.108, 1.116, 1.128, 1.144, 1.161, 1.181, 1.206, 1.237, 1.275, 1.321, 1.347,
+                    1.403, 1.369, 1.319, 1.279, 1.244, 1.214, 1.191, 1.171, 1.154, 1.139, 1.129, 1.121, 1.115, 1.111, 1.109, 1.106, 1.105, 1.105, 1.108, 1.112, 1.117, 1.124, 1.135, 1.147, 1.162, 1.181, 1.203, 1.228, 1.262, 1.301, 1.347, 1.377,
+                    1.429, 1.398, 1.348, 1.306, 1.269, 1.237, 1.214, 1.191, 1.173, 1.158, 1.146, 1.138, 1.132, 1.128, 1.125, 1.123, 1.122, 1.123, 1.125, 1.129, 1.136, 1.142, 1.154, 1.166, 1.182, 1.203, 1.226, 1.253, 1.288, 1.329, 1.377, 1.406,
+                    1.465, 1.429, 1.377, 1.335, 1.295, 1.262, 1.236, 1.214, 1.194, 1.179, 1.167, 1.157, 1.151, 1.146, 1.144, 1.142, 1.142, 1.142, 1.144, 1.149, 1.154, 1.163, 1.174, 1.187, 1.205, 1.226, 1.251, 1.279, 1.315, 1.357, 1.406, 1.437,
+                    1.493, 1.465, 1.409, 1.364, 1.323, 1.289, 1.261, 1.235, 1.214, 1.194, 1.179, 1.171, 1.166, 1.163, 1.161, 1.161, 1.161, 1.161, 1.162, 1.164, 1.168, 1.175, 1.187, 1.205, 1.225, 1.251, 1.276, 1.306, 1.344, 1.387, 1.437, 1.455
+                ],
+                "sigma": 0.0007,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2500,
+                        "ccm":
+                        [
+                            1.95054, -0.57435, -0.37619,
+                            -0.46945, 1.86661, -0.39716,
+                            0.07977, -1.14072, 2.06095
+                        ]
+                    },
+                    {
+                        "ct": 2800,
+                        "ccm":
+                        [
+                            1.94104, -0.60261, -0.33844,
+                            -0.43162, 1.85422, -0.42261,
+                            0.03799, -0.95022, 1.91222
+                        ]
+                    },
+                    {
+                        "ct": 2900,
+                        "ccm":
+                        [
+                            1.91828, -0.59569, -0.32258,
+                            -0.51902, 2.09091, -0.57189,
+                            -0.03324, -0.73462, 1.76785
+                        ]
+                    },
+                    {
+                        "ct": 3620,
+                        "ccm":
+                        [
+                            1.97199, -0.66403, -0.30797,
+                            -0.46411, 2.02612, -0.56201,
+                            -0.07764, -0.61178, 1.68942
+                        ]
+                    },
+                    {
+                        "ct": 4560,
+                        "ccm":
+                        [
+                            2.15256, -0.84787, -0.30469,
+                            -0.48422, 2.28962, -0.80541,
+                            -0.15113, -0.53014, 1.68127
+                        ]
+                    },
+                    {
+                        "ct": 5600,
+                        "ccm":
+                        [
+                            2.04576, -0.74771, -0.29805,
+                            -0.36332, 1.98993, -0.62662,
+                            -0.09328, -0.46543, 1.55871
+                        ]
+                    },
+                    {
+                        "ct": 7400,
+                        "ccm":
+                        [
+                            2.37532, -0.83069, -0.54462,
+                            -0.48279, 2.84309, -1.36031,
+                            -0.21178, -0.66532, 1.87709
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.06,
+                "strength": 0.5,
+                "limit": 0.5
+            }
+        },
+        {
+            "rpi.cac":
+            {
+                "lut_rx":
+                [
+                    -0.15, -0.12, -0.08, -0.03, 0.02, 0.06, 0.11, 0.14, 0.22,
+                    -0.15, -0.12, -0.08, -0.04, 0.01, 0.05, 0.1, 0.14, 0.21,
+                    -0.15, -0.12, -0.08, -0.04, 0.01, 0.06, 0.1, 0.14, 0.21,
+                    -0.14, -0.11, -0.08, -0.04, 0.01, 0.05, 0.1, 0.13, 0.2,
+                    -0.13, -0.11, -0.08, -0.03, 0.01, 0.05, 0.09, 0.13, 0.2,
+                    -0.14, -0.11, -0.07, -0.03, 0.01, 0.06, 0.09, 0.14, 0.21,
+                    -0.14, -0.11, -0.07, -0.03, 0.01, 0.05, 0.09, 0.13, 0.21,
+                    -0.14, -0.11, -0.07, -0.03, 0.01, 0.05, 0.09, 0.13, 0.2,
+                    -0.14, -0.1, -0.07, -0.03, 0.01, 0.06, 0.09, 0.13, 0.2
+                ],
+                "lut_ry":
+                [
+                    -0.13, -0.13, -0.12, -0.13, -0.13, -0.14, -0.14, -0.13, -0.13,
+                    -0.1, -0.1, -0.1, -0.1, -0.11, -0.11, -0.11, -0.11, -0.1,
+                    -0.08, -0.08, -0.09, -0.09, -0.1, -0.09, -0.09, -0.1, -0.09,
+                    -0.07, -0.06, -0.06, -0.07, -0.07, -0.07, -0.07, -0.07, -0.09,
+                    -0.04, -0.03, -0.04, -0.04, -0.04, -0.04, -0.05, -0.04, -0.06,
+                    -0.02, -0.01, -0.01, -0.02, -0.02, -0.02, -0.02, -0.02, -0.03,
+                    -0.0, 0.01, 0.0, -0.0, -0.01, -0.01, -0.0, 0.0, -0.0,
+                    0.02, 0.02, 0.02, 0.01, 0.01, 0.01, 0.01, 0.02, 0.02,
+                    0.04, 0.05, 0.04, 0.03, 0.03, 0.03, 0.03, 0.04, 0.04
+                ],
+                "lut_bx":
+                [
+                    -0.35, -0.28, -0.22, -0.13, -0.05, 0.02, 0.1, 0.16, 0.28,
+                    -0.32, -0.25, -0.19, -0.12, -0.05, 0.02, 0.09, 0.16, 0.28,
+                    -0.32, -0.26, -0.19, -0.12, -0.05, 0.02, 0.09, 0.15, 0.28,
+                    -0.32, -0.25, -0.19, -0.11, -0.05, 0.02, 0.09, 0.16, 0.28,
+                    -0.3, -0.25, -0.19, -0.11, -0.04, 0.02, 0.09, 0.16, 0.28,
+                    -0.3, -0.25, -0.18, -0.11, -0.05, 0.02, 0.09, 0.15, 0.28,
+                    -0.3, -0.25, -0.19, -0.11, -0.05, 0.02, 0.09, 0.15, 0.27,
+                    -0.3, -0.24, -0.17, -0.11, -0.04, 0.02, 0.09, 0.15, 0.27,
+                    -0.27, -0.21, -0.15, -0.09, -0.03, 0.03, 0.09, 0.15, 0.27
+                ],
+                "lut_by":
+                [
+                    -0.23, -0.22, -0.22, -0.21, -0.21, -0.21, -0.21, -0.21, -0.23,
+                    -0.19, -0.17, -0.17, -0.17, -0.17, -0.17, -0.17, -0.17, -0.19,
+                    -0.16, -0.13, -0.13, -0.13, -0.12, -0.13, -0.12, -0.13, -0.15,
+                    -0.11, -0.08, -0.08, -0.08, -0.07, -0.08, -0.08, -0.08, -0.1,
+                    -0.07, -0.04, -0.04, -0.04, -0.03, -0.03, -0.04, -0.04, -0.07,
+                    -0.02, 0.01, 0.01, 0.01, 0.02, 0.02, 0.01, 0.01, -0.02,
+                    0.03, 0.07, 0.07, 0.07, 0.07, 0.07, 0.06, 0.06, 0.05,
+                    0.09, 0.1, 0.1, 0.1, 0.12, 0.12, 0.11, 0.11, 0.09,
+                    0.13, 0.13, 0.13, 0.14, 0.18, 0.2, 0.19, 0.18, 0.16
+                ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx296_6mm.json b/src/ipa/rpi/pisp/data/imx296_6mm.json
new file mode 100644
index 000000000..abbcaa83f
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx296_6mm.json
@@ -0,0 +1,1247 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 3840
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 4724,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 860,
+                "reference_Y": 14551
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.751
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 226,
+                "slope": 0.01032
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2875.0, 0.4699, 0.3209,
+                    3610.0, 0.4089, 0.4265,
+                    4640.0, 0.3281, 0.5417,
+                    5912.0, 0.2992, 0.5771,
+                    7630.0, 0.2285, 0.6524
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.01783,
+                "transverse_neg": 0.02154
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.16,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.084, 2.084, 2.085, 2.085, 2.085, 2.087, 2.088, 2.087, 2.086, 2.082, 2.082, 2.084, 2.086, 2.088, 2.088, 2.088, 2.087, 2.088, 2.088, 2.091, 2.092, 2.093, 2.093, 2.093, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.091, 2.088,
+                            2.086, 2.086, 2.087, 2.088, 2.089, 2.089, 2.091, 2.089, 2.087, 2.086, 2.087, 2.088, 2.091, 2.089, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.093, 2.093, 2.094, 2.095, 2.094, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.093,
+                            2.087, 2.087, 2.088, 2.091, 2.091, 2.091, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.092, 2.092, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.097, 2.097, 2.097, 2.097, 2.096,
+                            2.089, 2.088, 2.089, 2.091, 2.091, 2.092, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.092, 2.092, 2.092, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.096, 2.096, 2.096, 2.096, 2.097, 2.098, 2.097, 2.097, 2.097,
+                            2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.091, 2.091, 2.089, 2.088, 2.088, 2.089, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.094, 2.095, 2.095, 2.096, 2.096, 2.097, 2.099, 2.098, 2.097, 2.097, 2.097,
+                            2.091, 2.091, 2.092, 2.093, 2.093, 2.093, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.095, 2.096, 2.096, 2.097, 2.097, 2.099, 2.099, 2.099, 2.098, 2.097,
+                            2.092, 2.092, 2.092, 2.093, 2.093, 2.092, 2.091, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.095, 2.096, 2.096, 2.097, 2.097, 2.099, 2.099, 2.101, 2.099, 2.098,
+                            2.092, 2.092, 2.093, 2.093, 2.093, 2.092, 2.091, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.092, 2.094, 2.095, 2.096, 2.097, 2.098, 2.098, 2.098, 2.101, 2.101, 2.099, 2.098,
+                            2.092, 2.092, 2.093, 2.093, 2.094, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.089, 2.089, 2.091, 2.092, 2.092, 2.092, 2.092, 2.094, 2.096, 2.096, 2.097, 2.098, 2.099, 2.099, 2.099, 2.099, 2.099, 2.097,
+                            2.093, 2.094, 2.094, 2.094, 2.095, 2.093, 2.092, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.094, 2.096, 2.096, 2.097, 2.098, 2.098, 2.101, 2.101, 2.099, 2.099, 2.099,
+                            2.094, 2.094, 2.094, 2.095, 2.095, 2.095, 2.091, 2.089, 2.091, 2.089, 2.089, 2.089, 2.091, 2.091, 2.089, 2.091, 2.091, 2.091, 2.092, 2.092, 2.093, 2.093, 2.095, 2.096, 2.097, 2.098, 2.098, 2.099, 2.101, 2.101, 2.099, 2.099,
+                            2.095, 2.094, 2.094, 2.095, 2.096, 2.095, 2.091, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.091, 2.093, 2.093, 2.093, 2.093, 2.094, 2.096, 2.097, 2.098, 2.099, 2.101, 2.101, 2.102, 2.101, 2.099,
+                            2.095, 2.095, 2.095, 2.095, 2.095, 2.095, 2.092, 2.089, 2.089, 2.088, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.093, 2.093, 2.093, 2.093, 2.093, 2.095, 2.096, 2.099, 2.099, 2.101, 2.102, 2.103, 2.102, 2.101,
+                            2.095, 2.095, 2.095, 2.095, 2.095, 2.094, 2.092, 2.091, 2.089, 2.089, 2.089, 2.089, 2.091, 2.091, 2.091, 2.093, 2.093, 2.093, 2.092, 2.092, 2.094, 2.094, 2.094, 2.096, 2.096, 2.098, 2.099, 2.102, 2.103, 2.103, 2.102, 2.102,
+                            2.095, 2.095, 2.095, 2.096, 2.096, 2.094, 2.093, 2.091, 2.091, 2.089, 2.089, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.092, 2.093, 2.094, 2.094, 2.095, 2.096, 2.097, 2.098, 2.099, 2.103, 2.103, 2.103, 2.101, 2.101,
+                            2.095, 2.096, 2.096, 2.097, 2.096, 2.095, 2.093, 2.092, 2.091, 2.091, 2.091, 2.092, 2.092, 2.092, 2.092, 2.092, 2.092, 2.094, 2.093, 2.093, 2.094, 2.095, 2.096, 2.096, 2.097, 2.099, 2.101, 2.103, 2.103, 2.103, 2.101, 2.099,
+                            2.096, 2.096, 2.097, 2.096, 2.097, 2.096, 2.094, 2.092, 2.092, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.093, 2.094, 2.093, 2.093, 2.093, 2.095, 2.096, 2.097, 2.099, 2.099, 2.101, 2.103, 2.103, 2.102, 2.101, 2.101,
+                            2.096, 2.096, 2.097, 2.097, 2.097, 2.096, 2.094, 2.093, 2.092, 2.092, 2.091, 2.091, 2.092, 2.092, 2.092, 2.093, 2.093, 2.094, 2.093, 2.093, 2.094, 2.095, 2.096, 2.097, 2.099, 2.101, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101,
+                            2.097, 2.096, 2.097, 2.097, 2.097, 2.097, 2.095, 2.093, 2.093, 2.093, 2.093, 2.092, 2.091, 2.091, 2.092, 2.092, 2.093, 2.094, 2.093, 2.093, 2.093, 2.095, 2.096, 2.097, 2.099, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101, 2.101,
+                            2.098, 2.097, 2.096, 2.097, 2.097, 2.097, 2.095, 2.094, 2.094, 2.094, 2.092, 2.092, 2.092, 2.092, 2.092, 2.092, 2.094, 2.095, 2.095, 2.094, 2.093, 2.095, 2.096, 2.099, 2.101, 2.101, 2.102, 2.102, 2.102, 2.101, 2.101, 2.102,
+                            2.098, 2.097, 2.096, 2.096, 2.097, 2.097, 2.095, 2.094, 2.095, 2.093, 2.093, 2.092, 2.092, 2.092, 2.094, 2.094, 2.096, 2.095, 2.095, 2.095, 2.095, 2.096, 2.098, 2.099, 2.099, 2.101, 2.102, 2.103, 2.102, 2.102, 2.101, 2.102,
+                            2.098, 2.097, 2.097, 2.098, 2.097, 2.096, 2.095, 2.095, 2.095, 2.094, 2.093, 2.093, 2.094, 2.094, 2.094, 2.095, 2.096, 2.096, 2.096, 2.095, 2.097, 2.097, 2.098, 2.099, 2.099, 2.101, 2.101, 2.103, 2.104, 2.103, 2.102, 2.101,
+                            2.099, 2.098, 2.098, 2.098, 2.097, 2.096, 2.096, 2.095, 2.095, 2.095, 2.095, 2.095, 2.094, 2.094, 2.094, 2.094, 2.096, 2.097, 2.097, 2.097, 2.097, 2.098, 2.099, 2.101, 2.101, 2.101, 2.101, 2.104, 2.105, 2.105, 2.103, 2.102,
+                            2.101, 2.099, 2.099, 2.099, 2.099, 2.098, 2.097, 2.097, 2.097, 2.096, 2.096, 2.095, 2.095, 2.095, 2.095, 2.095, 2.096, 2.098, 2.098, 2.097, 2.097, 2.098, 2.099, 2.101, 2.101, 2.102, 2.103, 2.104, 2.105, 2.105, 2.104, 2.103,
+                            2.102, 2.102, 2.099, 2.098, 2.099, 2.099, 2.099, 2.098, 2.097, 2.097, 2.097, 2.097, 2.097, 2.096, 2.096, 2.097, 2.098, 2.098, 2.099, 2.099, 2.099, 2.101, 2.101, 2.102, 2.104, 2.105, 2.106, 2.106, 2.106, 2.104, 2.104, 2.104,
+                            2.102, 2.101, 2.099, 2.099, 2.099, 2.101, 2.101, 2.101, 2.099, 2.098, 2.098, 2.098, 2.098, 2.098, 2.098, 2.098, 2.099, 2.099, 2.099, 2.099, 2.101, 2.101, 2.102, 2.103, 2.105, 2.106, 2.106, 2.106, 2.106, 2.105, 2.104, 2.104,
+                            2.099, 2.099, 2.099, 2.098, 2.098, 2.099, 2.101, 2.101, 2.099, 2.098, 2.097, 2.098, 2.098, 2.099, 2.098, 2.098, 2.099, 2.099, 2.101, 2.101, 2.101, 2.101, 2.102, 2.104, 2.105, 2.105, 2.105, 2.106, 2.106, 2.104, 2.104, 2.103,
+                            2.096, 2.097, 2.097, 2.097, 2.097, 2.099, 2.099, 2.099, 2.099, 2.097, 2.097, 2.098, 2.098, 2.099, 2.098, 2.097, 2.097, 2.099, 2.101, 2.101, 2.101, 2.101, 2.101, 2.103, 2.105, 2.105, 2.105, 2.104, 2.104, 2.103, 2.101, 2.101,
+                            2.096, 2.096, 2.096, 2.097, 2.097, 2.098, 2.098, 2.099, 2.097, 2.096, 2.096, 2.097, 2.098, 2.098, 2.097, 2.097, 2.096, 2.098, 2.098, 2.099, 2.101, 2.101, 2.101, 2.102, 2.104, 2.105, 2.104, 2.104, 2.103, 2.101, 2.099, 2.098,
+                            2.096, 2.096, 2.096, 2.096, 2.097, 2.097, 2.097, 2.097, 2.097, 2.097, 2.096, 2.097, 2.098, 2.097, 2.097, 2.096, 2.096, 2.098, 2.098, 2.098, 2.099, 2.099, 2.101, 2.101, 2.103, 2.103, 2.104, 2.104, 2.102, 2.101, 2.099, 2.098,
+                            2.097, 2.096, 2.095, 2.096, 2.098, 2.098, 2.098, 2.098, 2.097, 2.098, 2.097, 2.097, 2.097, 2.097, 2.096, 2.096, 2.096, 2.097, 2.097, 2.098, 2.099, 2.099, 2.099, 2.101, 2.102, 2.103, 2.104, 2.104, 2.104, 2.101, 2.099, 2.098,
+                            2.097, 2.096, 2.095, 2.097, 2.099, 2.099, 2.099, 2.099, 2.099, 2.099, 2.098, 2.098, 2.097, 2.096, 2.096, 2.097, 2.097, 2.098, 2.097, 2.099, 2.101, 2.099, 2.099, 2.099, 2.102, 2.102, 2.104, 2.105, 2.105, 2.102, 2.099, 2.098
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.431, 3.437, 3.439, 3.439, 3.436, 3.438, 3.441, 3.441, 3.441, 3.441, 3.442, 3.443, 3.443, 3.444, 3.446, 3.448, 3.451, 3.451, 3.452, 3.451, 3.449, 3.449, 3.452, 3.453, 3.454, 3.454, 3.453, 3.456, 3.456, 3.456, 3.451, 3.448,
+                            3.445, 3.446, 3.445, 3.449, 3.453, 3.451, 3.451, 3.446, 3.447, 3.446, 3.447, 3.451, 3.453, 3.455, 3.454, 3.453, 3.453, 3.454, 3.455, 3.456, 3.457, 3.459, 3.461, 3.462, 3.463, 3.463, 3.465, 3.466, 3.467, 3.465, 3.459, 3.457,
+                            3.449, 3.449, 3.449, 3.454, 3.455, 3.454, 3.453, 3.451, 3.451, 3.448, 3.451, 3.451, 3.455, 3.456, 3.457, 3.456, 3.456, 3.458, 3.457, 3.459, 3.459, 3.461, 3.464, 3.467, 3.467, 3.466, 3.468, 3.469, 3.471, 3.468, 3.465, 3.462,
+                            3.451, 3.448, 3.451, 3.453, 3.457, 3.455, 3.454, 3.449, 3.449, 3.448, 3.449, 3.449, 3.455, 3.455, 3.456, 3.455, 3.454, 3.455, 3.455, 3.457, 3.458, 3.458, 3.461, 3.464, 3.466, 3.468, 3.469, 3.469, 3.469, 3.468, 3.465, 3.463,
+                            3.449, 3.449, 3.451, 3.453, 3.456, 3.455, 3.452, 3.449, 3.448, 3.447, 3.446, 3.448, 3.451, 3.452, 3.454, 3.455, 3.455, 3.454, 3.457, 3.458, 3.458, 3.459, 3.461, 3.464, 3.464, 3.466, 3.467, 3.469, 3.469, 3.467, 3.463, 3.459,
+                            3.449, 3.451, 3.452, 3.454, 3.455, 3.454, 3.452, 3.449, 3.447, 3.447, 3.446, 3.449, 3.449, 3.451, 3.452, 3.452, 3.452, 3.452, 3.454, 3.455, 3.457, 3.459, 3.461, 3.464, 3.464, 3.466, 3.465, 3.468, 3.468, 3.469, 3.465, 3.462,
+                            3.451, 3.451, 3.452, 3.453, 3.453, 3.453, 3.451, 3.449, 3.449, 3.447, 3.446, 3.447, 3.448, 3.451, 3.451, 3.451, 3.453, 3.452, 3.452, 3.452, 3.457, 3.458, 3.461, 3.463, 3.464, 3.465, 3.464, 3.466, 3.468, 3.469, 3.466, 3.463,
+                            3.451, 3.451, 3.451, 3.454, 3.453, 3.453, 3.451, 3.448, 3.448, 3.444, 3.444, 3.444, 3.448, 3.449, 3.449, 3.448, 3.449, 3.449, 3.451, 3.452, 3.454, 3.457, 3.461, 3.462, 3.464, 3.466, 3.466, 3.467, 3.468, 3.469, 3.466, 3.465,
+                            3.451, 3.451, 3.452, 3.455, 3.454, 3.453, 3.449, 3.448, 3.447, 3.447, 3.444, 3.446, 3.446, 3.446, 3.446, 3.447, 3.449, 3.449, 3.451, 3.452, 3.455, 3.457, 3.461, 3.462, 3.464, 3.466, 3.466, 3.468, 3.469, 3.468, 3.465, 3.462,
+                            3.453, 3.452, 3.454, 3.456, 3.455, 3.453, 3.449, 3.447, 3.446, 3.446, 3.445, 3.448, 3.447, 3.446, 3.445, 3.446, 3.448, 3.448, 3.449, 3.453, 3.455, 3.457, 3.459, 3.461, 3.464, 3.466, 3.467, 3.468, 3.468, 3.467, 3.465, 3.463,
+                            3.453, 3.453, 3.454, 3.456, 3.456, 3.451, 3.448, 3.447, 3.447, 3.446, 3.445, 3.446, 3.446, 3.446, 3.446, 3.446, 3.448, 3.448, 3.449, 3.452, 3.454, 3.456, 3.459, 3.459, 3.461, 3.465, 3.466, 3.468, 3.468, 3.468, 3.467, 3.465,
+                            3.451, 3.451, 3.452, 3.455, 3.456, 3.452, 3.448, 3.446, 3.446, 3.444, 3.446, 3.445, 3.446, 3.446, 3.447, 3.448, 3.449, 3.449, 3.449, 3.452, 3.453, 3.454, 3.458, 3.458, 3.461, 3.461, 3.464, 3.469, 3.469, 3.468, 3.466, 3.466,
+                            3.452, 3.452, 3.453, 3.454, 3.454, 3.453, 3.447, 3.446, 3.444, 3.444, 3.444, 3.444, 3.445, 3.446, 3.448, 3.451, 3.452, 3.453, 3.451, 3.453, 3.453, 3.455, 3.458, 3.459, 3.461, 3.462, 3.463, 3.468, 3.471, 3.469, 3.467, 3.467,
+                            3.454, 3.455, 3.457, 3.458, 3.458, 3.455, 3.449, 3.446, 3.445, 3.445, 3.445, 3.445, 3.447, 3.447, 3.448, 3.451, 3.452, 3.453, 3.452, 3.452, 3.452, 3.454, 3.457, 3.459, 3.459, 3.462, 3.464, 3.468, 3.469, 3.467, 3.465, 3.465,
+                            3.457, 3.455, 3.455, 3.459, 3.458, 3.454, 3.451, 3.448, 3.445, 3.445, 3.445, 3.446, 3.448, 3.449, 3.451, 3.452, 3.451, 3.453, 3.452, 3.452, 3.453, 3.457, 3.457, 3.461, 3.461, 3.463, 3.465, 3.468, 3.471, 3.468, 3.465, 3.463,
+                            3.458, 3.456, 3.456, 3.459, 3.457, 3.454, 3.452, 3.449, 3.447, 3.445, 3.446, 3.447, 3.447, 3.448, 3.449, 3.448, 3.449, 3.451, 3.451, 3.451, 3.451, 3.455, 3.456, 3.458, 3.462, 3.463, 3.464, 3.465, 3.467, 3.466, 3.464, 3.462,
+                            3.457, 3.456, 3.455, 3.457, 3.457, 3.454, 3.449, 3.447, 3.445, 3.445, 3.446, 3.446, 3.448, 3.446, 3.448, 3.449, 3.449, 3.451, 3.451, 3.451, 3.453, 3.455, 3.457, 3.459, 3.462, 3.464, 3.464, 3.465, 3.467, 3.464, 3.464, 3.463,
+                            3.458, 3.457, 3.455, 3.456, 3.456, 3.456, 3.453, 3.449, 3.447, 3.448, 3.447, 3.447, 3.447, 3.447, 3.447, 3.448, 3.449, 3.451, 3.451, 3.452, 3.453, 3.455, 3.458, 3.459, 3.459, 3.463, 3.464, 3.463, 3.464, 3.463, 3.464, 3.464,
+                            3.457, 3.456, 3.456, 3.456, 3.456, 3.456, 3.455, 3.449, 3.447, 3.448, 3.451, 3.449, 3.449, 3.449, 3.448, 3.449, 3.449, 3.451, 3.451, 3.452, 3.453, 3.456, 3.458, 3.459, 3.461, 3.462, 3.464, 3.464, 3.465, 3.464, 3.464, 3.463,
+                            3.457, 3.456, 3.455, 3.455, 3.455, 3.455, 3.453, 3.451, 3.449, 3.448, 3.448, 3.449, 3.449, 3.449, 3.448, 3.449, 3.451, 3.452, 3.452, 3.453, 3.454, 3.457, 3.458, 3.459, 3.462, 3.464, 3.465, 3.464, 3.465, 3.464, 3.463, 3.463,
+                            3.456, 3.456, 3.454, 3.453, 3.454, 3.453, 3.452, 3.451, 3.449, 3.448, 3.448, 3.449, 3.451, 3.451, 3.448, 3.449, 3.451, 3.454, 3.454, 3.454, 3.455, 3.457, 3.458, 3.461, 3.461, 3.462, 3.464, 3.464, 3.466, 3.465, 3.464, 3.464,
+                            3.459, 3.457, 3.456, 3.455, 3.454, 3.453, 3.453, 3.452, 3.452, 3.451, 3.449, 3.449, 3.449, 3.448, 3.447, 3.449, 3.451, 3.454, 3.455, 3.455, 3.456, 3.458, 3.459, 3.461, 3.461, 3.462, 3.463, 3.466, 3.469, 3.465, 3.465, 3.464,
+                            3.463, 3.461, 3.458, 3.458, 3.457, 3.456, 3.456, 3.454, 3.454, 3.452, 3.452, 3.451, 3.451, 3.449, 3.448, 3.448, 3.452, 3.454, 3.456, 3.455, 3.457, 3.458, 3.461, 3.464, 3.462, 3.461, 3.463, 3.466, 3.469, 3.469, 3.467, 3.467,
+                            3.466, 3.462, 3.461, 3.461, 3.459, 3.457, 3.457, 3.457, 3.456, 3.454, 3.455, 3.455, 3.455, 3.451, 3.452, 3.453, 3.454, 3.455, 3.456, 3.456, 3.459, 3.462, 3.463, 3.466, 3.466, 3.467, 3.466, 3.469, 3.471, 3.469, 3.468, 3.466,
+                            3.467, 3.463, 3.463, 3.459, 3.461, 3.459, 3.461, 3.459, 3.458, 3.456, 3.457, 3.456, 3.457, 3.455, 3.456, 3.455, 3.456, 3.457, 3.459, 3.461, 3.461, 3.464, 3.465, 3.468, 3.469, 3.469, 3.469, 3.469, 3.471, 3.468, 3.467, 3.468,
+                            3.467, 3.464, 3.459, 3.459, 3.462, 3.462, 3.462, 3.461, 3.461, 3.462, 3.461, 3.459, 3.461, 3.459, 3.458, 3.457, 3.459, 3.461, 3.462, 3.463, 3.464, 3.466, 3.468, 3.469, 3.471, 3.469, 3.471, 3.472, 3.471, 3.467, 3.466, 3.464,
+                            3.464, 3.462, 3.458, 3.457, 3.458, 3.461, 3.461, 3.461, 3.461, 3.462, 3.462, 3.461, 3.461, 3.459, 3.459, 3.459, 3.461, 3.461, 3.464, 3.465, 3.465, 3.468, 3.468, 3.469, 3.471, 3.469, 3.469, 3.469, 3.469, 3.464, 3.462, 3.459,
+                            3.457, 3.458, 3.455, 3.456, 3.456, 3.457, 3.459, 3.459, 3.459, 3.459, 3.458, 3.456, 3.458, 3.457, 3.458, 3.458, 3.458, 3.459, 3.461, 3.463, 3.465, 3.466, 3.468, 3.469, 3.471, 3.468, 3.466, 3.466, 3.465, 3.461, 3.459, 3.457,
+                            3.456, 3.455, 3.454, 3.454, 3.455, 3.456, 3.458, 3.459, 3.459, 3.456, 3.456, 3.456, 3.455, 3.456, 3.455, 3.455, 3.455, 3.454, 3.457, 3.461, 3.462, 3.464, 3.465, 3.467, 3.467, 3.466, 3.464, 3.464, 3.463, 3.461, 3.457, 3.456,
+                            3.456, 3.454, 3.453, 3.454, 3.454, 3.455, 3.458, 3.459, 3.459, 3.456, 3.455, 3.455, 3.455, 3.451, 3.453, 3.454, 3.454, 3.455, 3.455, 3.458, 3.461, 3.462, 3.461, 3.463, 3.465, 3.464, 3.463, 3.463, 3.462, 3.459, 3.456, 3.451,
+                            3.455, 3.452, 3.452, 3.452, 3.455, 3.457, 3.459, 3.459, 3.459, 3.458, 3.456, 3.456, 3.455, 3.453, 3.453, 3.455, 3.457, 3.457, 3.457, 3.461, 3.461, 3.461, 3.459, 3.462, 3.464, 3.464, 3.464, 3.463, 3.463, 3.459, 3.454, 3.451,
+                            3.452, 3.452, 3.452, 3.453, 3.457, 3.458, 3.458, 3.459, 3.459, 3.458, 3.457, 3.457, 3.455, 3.455, 3.458, 3.459, 3.458, 3.459, 3.459, 3.461, 3.461, 3.461, 3.459, 3.461, 3.463, 3.464, 3.466, 3.463, 3.461, 3.458, 3.453, 3.449
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.403, 3.399, 3.395, 3.391, 3.392, 3.394, 3.401, 3.403, 3.404, 3.404, 3.403, 3.399, 3.398, 3.396, 3.395, 3.396, 3.399, 3.403, 3.404, 3.401, 3.399, 3.398, 3.397, 3.401, 3.401, 3.401, 3.396, 3.394, 3.397, 3.396, 3.388, 3.364,
+                            3.403, 3.399, 3.393, 3.389, 3.391, 3.395, 3.401, 3.404, 3.406, 3.404, 3.403, 3.399, 3.399, 3.397, 3.397, 3.397, 3.401, 3.404, 3.404, 3.402, 3.398, 3.396, 3.397, 3.401, 3.401, 3.401, 3.395, 3.394, 3.396, 3.393, 3.387, 3.364,
+                            3.399, 3.398, 3.391, 3.385, 3.386, 3.395, 3.402, 3.405, 3.405, 3.404, 3.402, 3.399, 3.399, 3.398, 3.398, 3.398, 3.401, 3.404, 3.405, 3.403, 3.399, 3.396, 3.396, 3.398, 3.401, 3.401, 3.398, 3.394, 3.392, 3.389, 3.386, 3.364,
+                            3.398, 3.393, 3.386, 3.382, 3.385, 3.392, 3.399, 3.403, 3.405, 3.404, 3.402, 3.398, 3.398, 3.397, 3.397, 3.398, 3.401, 3.404, 3.405, 3.403, 3.398, 3.394, 3.394, 3.398, 3.401, 3.401, 3.396, 3.392, 3.391, 3.388, 3.383, 3.362,
+                            3.396, 3.391, 3.384, 3.381, 3.384, 3.389, 3.398, 3.402, 3.402, 3.401, 3.399, 3.395, 3.395, 3.395, 3.397, 3.397, 3.401, 3.402, 3.404, 3.403, 3.399, 3.394, 3.393, 3.395, 3.399, 3.399, 3.397, 3.391, 3.388, 3.384, 3.381, 3.363,
+                            3.391, 3.386, 3.382, 3.381, 3.385, 3.389, 3.396, 3.398, 3.399, 3.399, 3.398, 3.395, 3.394, 3.394, 3.395, 3.397, 3.399, 3.401, 3.403, 3.401, 3.398, 3.394, 3.393, 3.393, 3.394, 3.396, 3.395, 3.392, 3.387, 3.382, 3.378, 3.361,
+                            3.389, 3.386, 3.379, 3.379, 3.383, 3.388, 3.394, 3.397, 3.397, 3.397, 3.395, 3.393, 3.393, 3.393, 3.395, 3.395, 3.397, 3.398, 3.401, 3.399, 3.397, 3.395, 3.394, 3.391, 3.393, 3.393, 3.393, 3.389, 3.387, 3.381, 3.374, 3.357,
+                            3.386, 3.383, 3.376, 3.375, 3.381, 3.386, 3.394, 3.396, 3.396, 3.394, 3.392, 3.392, 3.394, 3.394, 3.395, 3.394, 3.396, 3.398, 3.399, 3.397, 3.397, 3.394, 3.393, 3.391, 3.389, 3.391, 3.392, 3.388, 3.386, 3.379, 3.372, 3.355,
+                            3.386, 3.379, 3.373, 3.373, 3.378, 3.384, 3.391, 3.396, 3.395, 3.393, 3.389, 3.391, 3.391, 3.393, 3.394, 3.393, 3.394, 3.396, 3.397, 3.396, 3.393, 3.394, 3.393, 3.392, 3.389, 3.389, 3.389, 3.389, 3.386, 3.378, 3.371, 3.351,
+                            3.379, 3.375, 3.371, 3.371, 3.376, 3.381, 3.388, 3.393, 3.394, 3.391, 3.386, 3.386, 3.388, 3.393, 3.392, 3.392, 3.393, 3.395, 3.394, 3.392, 3.389, 3.391, 3.391, 3.392, 3.389, 3.388, 3.389, 3.389, 3.383, 3.377, 3.369, 3.351,
+                            3.373, 3.371, 3.367, 3.368, 3.373, 3.381, 3.387, 3.389, 3.391, 3.389, 3.385, 3.386, 3.383, 3.389, 3.389, 3.392, 3.392, 3.394, 3.393, 3.389, 3.387, 3.387, 3.388, 3.389, 3.389, 3.388, 3.386, 3.386, 3.382, 3.374, 3.367, 3.345,
+                            3.371, 3.369, 3.365, 3.366, 3.373, 3.379, 3.386, 3.389, 3.391, 3.389, 3.385, 3.384, 3.382, 3.386, 3.387, 3.389, 3.391, 3.392, 3.391, 3.387, 3.385, 3.385, 3.386, 3.388, 3.388, 3.388, 3.386, 3.385, 3.381, 3.373, 3.367, 3.345,
+                            3.367, 3.365, 3.365, 3.366, 3.374, 3.379, 3.384, 3.388, 3.389, 3.387, 3.384, 3.383, 3.383, 3.385, 3.385, 3.386, 3.388, 3.389, 3.388, 3.386, 3.383, 3.382, 3.384, 3.386, 3.387, 3.386, 3.381, 3.381, 3.379, 3.372, 3.364, 3.344,
+                            3.365, 3.363, 3.362, 3.367, 3.375, 3.379, 3.383, 3.384, 3.386, 3.384, 3.381, 3.379, 3.379, 3.383, 3.383, 3.384, 3.385, 3.387, 3.387, 3.385, 3.381, 3.381, 3.382, 3.384, 3.384, 3.385, 3.382, 3.379, 3.374, 3.369, 3.359, 3.343,
+                            3.359, 3.358, 3.361, 3.364, 3.373, 3.381, 3.384, 3.384, 3.385, 3.384, 3.381, 3.377, 3.379, 3.379, 3.382, 3.383, 3.384, 3.386, 3.386, 3.385, 3.381, 3.379, 3.381, 3.382, 3.382, 3.383, 3.379, 3.377, 3.371, 3.364, 3.357, 3.339,
+                            3.357, 3.356, 3.356, 3.362, 3.372, 3.379, 3.384, 3.384, 3.383, 3.381, 3.378, 3.376, 3.377, 3.379, 3.381, 3.382, 3.383, 3.385, 3.385, 3.383, 3.379, 3.379, 3.379, 3.381, 3.381, 3.382, 3.379, 3.372, 3.367, 3.362, 3.354, 3.334,
+                            3.357, 3.354, 3.357, 3.361, 3.372, 3.381, 3.385, 3.385, 3.384, 3.379, 3.376, 3.376, 3.376, 3.379, 3.381, 3.383, 3.383, 3.384, 3.383, 3.379, 3.378, 3.381, 3.379, 3.379, 3.379, 3.379, 3.378, 3.371, 3.363, 3.358, 3.354, 3.332,
+                            3.354, 3.351, 3.354, 3.359, 3.371, 3.379, 3.382, 3.384, 3.381, 3.378, 3.375, 3.374, 3.376, 3.378, 3.381, 3.383, 3.384, 3.382, 3.377, 3.377, 3.376, 3.377, 3.378, 3.378, 3.379, 3.379, 3.376, 3.367, 3.361, 3.357, 3.352, 3.333,
+                            3.352, 3.349, 3.351, 3.357, 3.372, 3.381, 3.383, 3.383, 3.381, 3.376, 3.372, 3.373, 3.375, 3.377, 3.382, 3.384, 3.384, 3.379, 3.376, 3.374, 3.374, 3.375, 3.375, 3.376, 3.377, 3.376, 3.373, 3.366, 3.361, 3.356, 3.347, 3.332,
+                            3.347, 3.346, 3.346, 3.355, 3.371, 3.377, 3.382, 3.381, 3.379, 3.372, 3.371, 3.371, 3.372, 3.375, 3.379, 3.383, 3.384, 3.379, 3.374, 3.373, 3.371, 3.373, 3.374, 3.375, 3.374, 3.374, 3.371, 3.365, 3.359, 3.352, 3.343, 3.331,
+                            3.345, 3.344, 3.345, 3.353, 3.367, 3.374, 3.382, 3.382, 3.376, 3.371, 3.369, 3.368, 3.369, 3.373, 3.377, 3.381, 3.379, 3.376, 3.373, 3.369, 3.368, 3.371, 3.372, 3.373, 3.371, 3.371, 3.369, 3.363, 3.357, 3.349, 3.341, 3.326,
+                            3.343, 3.341, 3.344, 3.351, 3.362, 3.371, 3.376, 3.376, 3.372, 3.369, 3.367, 3.366, 3.367, 3.369, 3.376, 3.378, 3.378, 3.375, 3.371, 3.367, 3.367, 3.368, 3.369, 3.369, 3.369, 3.368, 3.365, 3.361, 3.354, 3.347, 3.338, 3.321,
+                            3.341, 3.339, 3.342, 3.349, 3.359, 3.367, 3.371, 3.372, 3.371, 3.368, 3.366, 3.363, 3.365, 3.368, 3.371, 3.374, 3.376, 3.374, 3.368, 3.365, 3.365, 3.366, 3.368, 3.367, 3.367, 3.363, 3.361, 3.356, 3.352, 3.346, 3.336, 3.317,
+                            3.338, 3.336, 3.338, 3.346, 3.359, 3.364, 3.368, 3.369, 3.367, 3.366, 3.363, 3.362, 3.364, 3.364, 3.367, 3.371, 3.372, 3.369, 3.365, 3.362, 3.362, 3.365, 3.367, 3.367, 3.366, 3.362, 3.357, 3.353, 3.349, 3.342, 3.335, 3.317,
+                            3.334, 3.334, 3.336, 3.346, 3.354, 3.361, 3.365, 3.365, 3.365, 3.362, 3.361, 3.361, 3.362, 3.362, 3.364, 3.366, 3.368, 3.366, 3.361, 3.357, 3.357, 3.359, 3.363, 3.365, 3.363, 3.361, 3.355, 3.351, 3.346, 3.339, 3.336, 3.317,
+                            3.332, 3.332, 3.334, 3.344, 3.354, 3.359, 3.363, 3.365, 3.363, 3.361, 3.359, 3.359, 3.363, 3.363, 3.365, 3.365, 3.367, 3.366, 3.358, 3.356, 3.356, 3.358, 3.362, 3.364, 3.363, 3.359, 3.353, 3.348, 3.345, 3.339, 3.336, 3.315,
+                            3.332, 3.328, 3.331, 3.343, 3.351, 3.357, 3.358, 3.362, 3.361, 3.359, 3.357, 3.357, 3.361, 3.362, 3.364, 3.363, 3.363, 3.359, 3.356, 3.354, 3.354, 3.355, 3.358, 3.359, 3.361, 3.359, 3.351, 3.346, 3.344, 3.339, 3.336, 3.313,
+                            3.324, 3.324, 3.327, 3.334, 3.345, 3.351, 3.354, 3.356, 3.356, 3.354, 3.353, 3.354, 3.357, 3.358, 3.361, 3.358, 3.359, 3.355, 3.352, 3.348, 3.347, 3.351, 3.354, 3.358, 3.359, 3.355, 3.346, 3.343, 3.341, 3.336, 3.331, 3.312,
+                            3.318, 3.319, 3.321, 3.328, 3.337, 3.339, 3.345, 3.348, 3.346, 3.345, 3.347, 3.348, 3.351, 3.354, 3.356, 3.353, 3.354, 3.344, 3.343, 3.343, 3.343, 3.344, 3.347, 3.349, 3.353, 3.346, 3.341, 3.339, 3.331, 3.329, 3.325, 3.311,
+                            3.309, 3.313, 3.317, 3.325, 3.329, 3.332, 3.338, 3.339, 3.341, 3.339, 3.339, 3.342, 3.346, 3.346, 3.351, 3.351, 3.343, 3.338, 3.338, 3.339, 3.339, 3.339, 3.341, 3.341, 3.346, 3.343, 3.339, 3.332, 3.327, 3.326, 3.322, 3.309,
+                            3.305, 3.309, 3.317, 3.325, 3.328, 3.331, 3.334, 3.336, 3.337, 3.336, 3.339, 3.341, 3.344, 3.346, 3.348, 3.347, 3.341, 3.336, 3.335, 3.337, 3.339, 3.341, 3.339, 3.339, 3.342, 3.341, 3.337, 3.329, 3.326, 3.325, 3.321, 3.314,
+                            3.302, 3.306, 3.319, 3.325, 3.329, 3.331, 3.334, 3.335, 3.337, 3.337, 3.339, 3.341, 3.344, 3.346, 3.348, 3.347, 3.342, 3.336, 3.336, 3.338, 3.339, 3.341, 3.341, 3.341, 3.339, 3.338, 3.336, 3.331, 3.327, 3.324, 3.321, 3.314
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.726, 1.725, 1.723, 1.721, 1.723, 1.724, 1.724, 1.726, 1.727, 1.728, 1.729, 1.728, 1.725, 1.724, 1.726, 1.726, 1.727, 1.729, 1.727, 1.727, 1.724, 1.725, 1.724, 1.726, 1.725, 1.725, 1.724, 1.724, 1.722, 1.721, 1.719, 1.714,
+                            1.726, 1.724, 1.722, 1.721, 1.722, 1.723, 1.725, 1.726, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.726, 1.727, 1.728, 1.728, 1.727, 1.725, 1.724, 1.724, 1.725, 1.726, 1.725, 1.724, 1.723, 1.722, 1.721, 1.719, 1.714,
+                            1.724, 1.722, 1.719, 1.719, 1.721, 1.723, 1.726, 1.726, 1.727, 1.727, 1.727, 1.725, 1.726, 1.725, 1.725, 1.725, 1.726, 1.727, 1.728, 1.728, 1.725, 1.724, 1.724, 1.724, 1.726, 1.725, 1.724, 1.722, 1.722, 1.721, 1.719, 1.712,
+                            1.723, 1.721, 1.719, 1.719, 1.719, 1.723, 1.725, 1.726, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.726, 1.726, 1.728, 1.729, 1.728, 1.725, 1.723, 1.723, 1.725, 1.726, 1.725, 1.724, 1.722, 1.721, 1.719, 1.718, 1.711,
+                            1.722, 1.719, 1.719, 1.718, 1.719, 1.722, 1.725, 1.726, 1.726, 1.727, 1.727, 1.726, 1.725, 1.726, 1.726, 1.726, 1.727, 1.727, 1.728, 1.727, 1.726, 1.725, 1.724, 1.725, 1.726, 1.725, 1.724, 1.722, 1.721, 1.719, 1.715, 1.711,
+                            1.721, 1.717, 1.717, 1.716, 1.719, 1.722, 1.724, 1.726, 1.726, 1.727, 1.726, 1.726, 1.726, 1.726, 1.726, 1.727, 1.727, 1.727, 1.727, 1.727, 1.726, 1.725, 1.725, 1.725, 1.725, 1.725, 1.724, 1.722, 1.721, 1.718, 1.715, 1.707,
+                            1.718, 1.717, 1.716, 1.716, 1.718, 1.721, 1.725, 1.726, 1.726, 1.726, 1.725, 1.725, 1.725, 1.725, 1.726, 1.727, 1.727, 1.727, 1.727, 1.726, 1.726, 1.726, 1.725, 1.724, 1.724, 1.724, 1.723, 1.722, 1.721, 1.718, 1.715, 1.709,
+                            1.718, 1.716, 1.716, 1.715, 1.717, 1.721, 1.724, 1.725, 1.726, 1.725, 1.725, 1.724, 1.724, 1.725, 1.726, 1.726, 1.727, 1.727, 1.727, 1.726, 1.726, 1.726, 1.725, 1.723, 1.723, 1.723, 1.722, 1.722, 1.719, 1.718, 1.714, 1.709,
+                            1.718, 1.716, 1.715, 1.715, 1.717, 1.721, 1.723, 1.725, 1.726, 1.725, 1.724, 1.723, 1.724, 1.725, 1.725, 1.726, 1.726, 1.726, 1.726, 1.726, 1.726, 1.726, 1.725, 1.724, 1.724, 1.723, 1.722, 1.722, 1.721, 1.717, 1.714, 1.707,
+                            1.717, 1.716, 1.714, 1.714, 1.716, 1.721, 1.723, 1.725, 1.725, 1.725, 1.723, 1.723, 1.724, 1.726, 1.726, 1.726, 1.726, 1.725, 1.726, 1.725, 1.725, 1.725, 1.725, 1.725, 1.724, 1.723, 1.722, 1.721, 1.718, 1.716, 1.714, 1.706,
+                            1.715, 1.714, 1.714, 1.714, 1.716, 1.719, 1.722, 1.724, 1.725, 1.725, 1.723, 1.723, 1.724, 1.725, 1.725, 1.725, 1.726, 1.725, 1.725, 1.725, 1.724, 1.724, 1.724, 1.725, 1.724, 1.723, 1.722, 1.721, 1.718, 1.716, 1.713, 1.705,
+                            1.714, 1.714, 1.713, 1.714, 1.717, 1.719, 1.722, 1.724, 1.724, 1.724, 1.723, 1.722, 1.723, 1.724, 1.724, 1.724, 1.726, 1.725, 1.726, 1.725, 1.723, 1.723, 1.724, 1.724, 1.724, 1.723, 1.721, 1.719, 1.717, 1.715, 1.713, 1.706,
+                            1.712, 1.712, 1.712, 1.713, 1.718, 1.719, 1.721, 1.723, 1.724, 1.724, 1.722, 1.722, 1.723, 1.724, 1.724, 1.724, 1.725, 1.725, 1.725, 1.725, 1.723, 1.722, 1.724, 1.723, 1.723, 1.722, 1.721, 1.719, 1.717, 1.714, 1.711, 1.706,
+                            1.712, 1.711, 1.711, 1.713, 1.717, 1.719, 1.722, 1.724, 1.724, 1.723, 1.722, 1.722, 1.723, 1.724, 1.724, 1.724, 1.724, 1.725, 1.725, 1.724, 1.723, 1.722, 1.722, 1.722, 1.723, 1.722, 1.721, 1.718, 1.716, 1.714, 1.711, 1.706,
+                            1.711, 1.709, 1.711, 1.713, 1.716, 1.719, 1.722, 1.724, 1.724, 1.723, 1.722, 1.721, 1.722, 1.724, 1.724, 1.724, 1.723, 1.724, 1.724, 1.724, 1.722, 1.722, 1.722, 1.722, 1.722, 1.721, 1.719, 1.718, 1.714, 1.712, 1.709, 1.702,
+                            1.709, 1.709, 1.709, 1.712, 1.717, 1.719, 1.721, 1.723, 1.723, 1.723, 1.721, 1.721, 1.722, 1.723, 1.724, 1.723, 1.724, 1.724, 1.724, 1.724, 1.723, 1.722, 1.721, 1.721, 1.721, 1.721, 1.719, 1.716, 1.713, 1.711, 1.709, 1.701,
+                            1.708, 1.707, 1.709, 1.712, 1.716, 1.719, 1.722, 1.723, 1.723, 1.723, 1.721, 1.721, 1.721, 1.722, 1.723, 1.723, 1.723, 1.723, 1.724, 1.723, 1.722, 1.722, 1.721, 1.721, 1.721, 1.721, 1.719, 1.714, 1.712, 1.709, 1.708, 1.702,
+                            1.707, 1.707, 1.708, 1.711, 1.716, 1.721, 1.722, 1.722, 1.722, 1.721, 1.721, 1.721, 1.722, 1.722, 1.723, 1.723, 1.723, 1.722, 1.722, 1.722, 1.722, 1.721, 1.721, 1.721, 1.721, 1.721, 1.717, 1.714, 1.711, 1.709, 1.707, 1.702,
+                            1.706, 1.706, 1.707, 1.711, 1.714, 1.719, 1.722, 1.722, 1.722, 1.721, 1.719, 1.721, 1.721, 1.722, 1.723, 1.724, 1.723, 1.722, 1.722, 1.721, 1.719, 1.719, 1.721, 1.721, 1.719, 1.719, 1.716, 1.713, 1.711, 1.709, 1.706, 1.701,
+                            1.705, 1.704, 1.706, 1.709, 1.713, 1.718, 1.721, 1.722, 1.721, 1.719, 1.718, 1.719, 1.721, 1.722, 1.723, 1.724, 1.724, 1.721, 1.721, 1.721, 1.719, 1.719, 1.719, 1.719, 1.719, 1.717, 1.715, 1.713, 1.711, 1.707, 1.704, 1.699,
+                            1.703, 1.703, 1.704, 1.709, 1.712, 1.717, 1.719, 1.721, 1.719, 1.718, 1.717, 1.718, 1.719, 1.721, 1.722, 1.723, 1.723, 1.722, 1.719, 1.719, 1.718, 1.719, 1.719, 1.718, 1.717, 1.716, 1.714, 1.712, 1.709, 1.706, 1.703, 1.697,
+                            1.702, 1.703, 1.704, 1.708, 1.712, 1.715, 1.718, 1.719, 1.719, 1.717, 1.717, 1.717, 1.717, 1.718, 1.721, 1.722, 1.722, 1.721, 1.719, 1.718, 1.717, 1.718, 1.718, 1.717, 1.716, 1.714, 1.714, 1.711, 1.709, 1.706, 1.703, 1.697,
+                            1.702, 1.702, 1.703, 1.706, 1.709, 1.715, 1.717, 1.718, 1.717, 1.717, 1.716, 1.716, 1.717, 1.717, 1.719, 1.721, 1.721, 1.721, 1.719, 1.717, 1.716, 1.717, 1.717, 1.716, 1.714, 1.713, 1.712, 1.711, 1.708, 1.706, 1.702, 1.696,
+                            1.701, 1.701, 1.702, 1.706, 1.709, 1.714, 1.716, 1.717, 1.716, 1.716, 1.716, 1.715, 1.716, 1.716, 1.717, 1.718, 1.719, 1.719, 1.716, 1.715, 1.715, 1.715, 1.715, 1.715, 1.714, 1.713, 1.711, 1.709, 1.708, 1.704, 1.701, 1.695,
+                            1.699, 1.699, 1.702, 1.706, 1.708, 1.712, 1.714, 1.715, 1.715, 1.715, 1.714, 1.715, 1.714, 1.715, 1.716, 1.716, 1.716, 1.716, 1.714, 1.713, 1.713, 1.714, 1.715, 1.714, 1.714, 1.712, 1.709, 1.707, 1.706, 1.703, 1.701, 1.695,
+                            1.698, 1.699, 1.701, 1.705, 1.708, 1.711, 1.714, 1.714, 1.714, 1.714, 1.714, 1.714, 1.714, 1.715, 1.715, 1.716, 1.716, 1.715, 1.713, 1.713, 1.713, 1.714, 1.714, 1.714, 1.713, 1.712, 1.709, 1.707, 1.706, 1.703, 1.701, 1.696,
+                            1.698, 1.699, 1.701, 1.705, 1.707, 1.711, 1.712, 1.713, 1.713, 1.713, 1.713, 1.714, 1.714, 1.715, 1.715, 1.716, 1.715, 1.714, 1.713, 1.712, 1.712, 1.712, 1.713, 1.713, 1.713, 1.711, 1.709, 1.707, 1.705, 1.703, 1.701, 1.696,
+                            1.698, 1.697, 1.699, 1.702, 1.705, 1.707, 1.711, 1.711, 1.711, 1.711, 1.711, 1.712, 1.712, 1.713, 1.714, 1.714, 1.713, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.711, 1.708, 1.706, 1.704, 1.703, 1.699, 1.696,
+                            1.694, 1.695, 1.697, 1.699, 1.702, 1.705, 1.706, 1.707, 1.707, 1.708, 1.708, 1.708, 1.709, 1.711, 1.711, 1.711, 1.708, 1.708, 1.708, 1.707, 1.707, 1.707, 1.708, 1.708, 1.709, 1.708, 1.706, 1.703, 1.702, 1.701, 1.698, 1.696,
+                            1.692, 1.692, 1.695, 1.698, 1.699, 1.701, 1.704, 1.704, 1.704, 1.704, 1.705, 1.706, 1.707, 1.709, 1.709, 1.707, 1.706, 1.704, 1.704, 1.705, 1.705, 1.706, 1.706, 1.706, 1.706, 1.706, 1.703, 1.702, 1.701, 1.699, 1.696, 1.694,
+                            1.691, 1.692, 1.695, 1.697, 1.699, 1.699, 1.702, 1.703, 1.703, 1.702, 1.703, 1.704, 1.706, 1.707, 1.708, 1.706, 1.705, 1.703, 1.703, 1.703, 1.704, 1.705, 1.705, 1.705, 1.705, 1.704, 1.703, 1.701, 1.699, 1.698, 1.696, 1.695,
+                            1.689, 1.691, 1.696, 1.698, 1.699, 1.699, 1.701, 1.702, 1.702, 1.702, 1.703, 1.703, 1.706, 1.707, 1.708, 1.706, 1.705, 1.703, 1.703, 1.703, 1.703, 1.704, 1.704, 1.705, 1.704, 1.704, 1.702, 1.701, 1.698, 1.698, 1.696, 1.696
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.425, 1.393, 1.341, 1.295, 1.258, 1.226, 1.201, 1.181, 1.162, 1.146, 1.133, 1.123, 1.115, 1.111, 1.107, 1.106, 1.106, 1.107, 1.108, 1.111, 1.114, 1.122, 1.133, 1.148, 1.164, 1.184, 1.208, 1.236, 1.271, 1.309, 1.359, 1.381,
+                    1.397, 1.367, 1.317, 1.274, 1.237, 1.207, 1.183, 1.163, 1.146, 1.133, 1.123, 1.114, 1.107, 1.101, 1.098, 1.096, 1.096, 1.096, 1.097, 1.102, 1.106, 1.112, 1.122, 1.133, 1.148, 1.166, 1.187, 1.215, 1.249, 1.288, 1.335, 1.359,
+                    1.374, 1.341, 1.292, 1.251, 1.215, 1.186, 1.166, 1.146, 1.131, 1.117, 1.108, 1.099, 1.091, 1.088, 1.084, 1.082, 1.081, 1.082, 1.084, 1.088, 1.093, 1.098, 1.107, 1.118, 1.133, 1.149, 1.169, 1.195, 1.228, 1.267, 1.313, 1.335,
+                    1.352, 1.318, 1.271, 1.231, 1.196, 1.169, 1.149, 1.131, 1.115, 1.103, 1.093, 1.086, 1.079, 1.074, 1.071, 1.069, 1.069, 1.069, 1.071, 1.076, 1.079, 1.085, 1.094, 1.102, 1.117, 1.133, 1.152, 1.176, 1.208, 1.246, 1.289, 1.313,
+                    1.333, 1.298, 1.253, 1.212, 1.179, 1.153, 1.134, 1.116, 1.102, 1.089, 1.079, 1.072, 1.066, 1.062, 1.059, 1.058, 1.057, 1.057, 1.059, 1.064, 1.068, 1.072, 1.081, 1.091, 1.102, 1.119, 1.137, 1.161, 1.191, 1.227, 1.271, 1.293,
+                    1.317, 1.281, 1.235, 1.196, 1.165, 1.139, 1.119, 1.104, 1.089, 1.078, 1.068, 1.062, 1.055, 1.051, 1.048, 1.047, 1.047, 1.047, 1.048, 1.053, 1.056, 1.061, 1.069, 1.079, 1.091, 1.105, 1.126, 1.147, 1.177, 1.212, 1.253, 1.278,
+                    1.301, 1.265, 1.221, 1.181, 1.151, 1.127, 1.108, 1.091, 1.078, 1.068, 1.059, 1.051, 1.045, 1.041, 1.038, 1.037, 1.036, 1.037, 1.038, 1.042, 1.046, 1.051, 1.059, 1.069, 1.081, 1.096, 1.113, 1.135, 1.164, 1.198, 1.238, 1.264,
+                    1.286, 1.251, 1.207, 1.169, 1.141, 1.116, 1.098, 1.081, 1.068, 1.058, 1.049, 1.042, 1.037, 1.033, 1.031, 1.029, 1.028, 1.028, 1.029, 1.033, 1.037, 1.043, 1.051, 1.059, 1.071, 1.086, 1.104, 1.124, 1.152, 1.185, 1.225, 1.252,
+                    1.275, 1.239, 1.196, 1.161, 1.132, 1.107, 1.089, 1.073, 1.059, 1.049, 1.041, 1.035, 1.028, 1.024, 1.023, 1.021, 1.021, 1.021, 1.022, 1.024, 1.029, 1.036, 1.043, 1.051, 1.063, 1.078, 1.095, 1.115, 1.143, 1.175, 1.214, 1.243,
+                    1.267, 1.227, 1.187, 1.152, 1.122, 1.101, 1.081, 1.067, 1.054, 1.042, 1.035, 1.028, 1.023, 1.018, 1.015, 1.014, 1.014, 1.014, 1.016, 1.019, 1.024, 1.029, 1.036, 1.045, 1.056, 1.071, 1.088, 1.107, 1.134, 1.167, 1.204, 1.234,
+                    1.261, 1.219, 1.179, 1.145, 1.116, 1.095, 1.076, 1.061, 1.047, 1.037, 1.031, 1.023, 1.018, 1.014, 1.011, 1.009, 1.009, 1.009, 1.011, 1.013, 1.018, 1.024, 1.031, 1.039, 1.049, 1.065, 1.083, 1.102, 1.128, 1.161, 1.196, 1.228,
+                    1.256, 1.213, 1.173, 1.139, 1.111, 1.091, 1.071, 1.056, 1.043, 1.033, 1.026, 1.019, 1.014, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.009, 1.013, 1.018, 1.026, 1.035, 1.046, 1.061, 1.078, 1.097, 1.123, 1.154, 1.191, 1.222,
+                    1.251, 1.208, 1.169, 1.137, 1.108, 1.088, 1.069, 1.053, 1.039, 1.029, 1.023, 1.015, 1.011, 1.006, 1.004, 1.003, 1.001, 1.002, 1.003, 1.006, 1.009, 1.015, 1.022, 1.032, 1.044, 1.057, 1.076, 1.094, 1.119, 1.149, 1.186, 1.218,
+                    1.249, 1.205, 1.167, 1.133, 1.107, 1.085, 1.067, 1.052, 1.038, 1.029, 1.021, 1.013, 1.008, 1.004, 1.003, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.013, 1.021, 1.031, 1.042, 1.055, 1.073, 1.093, 1.116, 1.147, 1.182, 1.218,
+                    1.249, 1.204, 1.165, 1.132, 1.106, 1.085, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.007, 1.003, 1.002, 1.001, 1.001, 1.001, 1.001, 1.004, 1.007, 1.013, 1.021, 1.029, 1.042, 1.055, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.249, 1.204, 1.165, 1.132, 1.107, 1.086, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.008, 1.004, 1.002, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.014, 1.021, 1.029, 1.042, 1.056, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.251, 1.205, 1.166, 1.133, 1.108, 1.087, 1.068, 1.052, 1.039, 1.031, 1.021, 1.014, 1.009, 1.006, 1.003, 1.002, 1.001, 1.001, 1.003, 1.006, 1.009, 1.014, 1.022, 1.031, 1.043, 1.056, 1.073, 1.093, 1.116, 1.145, 1.182, 1.218,
+                    1.252, 1.208, 1.168, 1.137, 1.111, 1.089, 1.071, 1.055, 1.043, 1.033, 1.023, 1.016, 1.012, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.008, 1.012, 1.017, 1.024, 1.034, 1.045, 1.059, 1.075, 1.095, 1.119, 1.149, 1.185, 1.218,
+                    1.256, 1.213, 1.173, 1.142, 1.115, 1.093, 1.075, 1.059, 1.047, 1.036, 1.027, 1.021, 1.016, 1.012, 1.011, 1.009, 1.008, 1.008, 1.009, 1.012, 1.016, 1.021, 1.028, 1.038, 1.049, 1.064, 1.081, 1.099, 1.126, 1.155, 1.192, 1.223,
+                    1.261, 1.221, 1.179, 1.148, 1.121, 1.099, 1.081, 1.065, 1.052, 1.042, 1.032, 1.026, 1.021, 1.017, 1.015, 1.014, 1.014, 1.013, 1.013, 1.016, 1.021, 1.026, 1.033, 1.043, 1.054, 1.068, 1.085, 1.106, 1.132, 1.161, 1.199, 1.228,
+                    1.267, 1.228, 1.188, 1.155, 1.128, 1.105, 1.086, 1.071, 1.059, 1.047, 1.038, 1.031, 1.027, 1.022, 1.021, 1.019, 1.019, 1.019, 1.019, 1.022, 1.026, 1.032, 1.038, 1.049, 1.061, 1.075, 1.092, 1.112, 1.138, 1.169, 1.207, 1.236,
+                    1.278, 1.241, 1.199, 1.164, 1.137, 1.114, 1.094, 1.078, 1.066, 1.055, 1.046, 1.038, 1.032, 1.029, 1.027, 1.027, 1.027, 1.027, 1.027, 1.029, 1.032, 1.038, 1.047, 1.056, 1.067, 1.083, 1.099, 1.121, 1.146, 1.178, 1.217, 1.244,
+                    1.291, 1.252, 1.211, 1.175, 1.147, 1.124, 1.103, 1.088, 1.075, 1.063, 1.054, 1.046, 1.041, 1.036, 1.035, 1.035, 1.035, 1.035, 1.036, 1.038, 1.041, 1.047, 1.055, 1.065, 1.075, 1.092, 1.111, 1.132, 1.157, 1.189, 1.231, 1.255,
+                    1.303, 1.265, 1.222, 1.187, 1.158, 1.133, 1.112, 1.097, 1.083, 1.072, 1.063, 1.054, 1.048, 1.043, 1.043, 1.043, 1.043, 1.043, 1.043, 1.046, 1.049, 1.055, 1.065, 1.074, 1.086, 1.102, 1.119, 1.144, 1.171, 1.203, 1.243, 1.268,
+                    1.317, 1.282, 1.236, 1.201, 1.171, 1.146, 1.125, 1.109, 1.095, 1.083, 1.072, 1.064, 1.058, 1.054, 1.052, 1.051, 1.051, 1.053, 1.054, 1.057, 1.061, 1.065, 1.074, 1.086, 1.099, 1.113, 1.133, 1.156, 1.183, 1.217, 1.259, 1.282,
+                    1.335, 1.301, 1.254, 1.218, 1.186, 1.159, 1.138, 1.121, 1.108, 1.095, 1.085, 1.076, 1.069, 1.066, 1.065, 1.063, 1.062, 1.063, 1.065, 1.068, 1.073, 1.078, 1.087, 1.098, 1.113, 1.126, 1.146, 1.171, 1.199, 1.235, 1.277, 1.299,
+                    1.356, 1.321, 1.274, 1.235, 1.202, 1.175, 1.153, 1.137, 1.121, 1.108, 1.097, 1.089, 1.084, 1.081, 1.077, 1.075, 1.075, 1.075, 1.077, 1.081, 1.086, 1.091, 1.099, 1.113, 1.126, 1.144, 1.162, 1.187, 1.218, 1.255, 1.297, 1.321,
+                    1.376, 1.344, 1.296, 1.257, 1.223, 1.194, 1.171, 1.153, 1.137, 1.124, 1.112, 1.104, 1.099, 1.095, 1.093, 1.091, 1.089, 1.091, 1.092, 1.095, 1.101, 1.108, 1.116, 1.128, 1.144, 1.161, 1.181, 1.206, 1.237, 1.275, 1.321, 1.347,
+                    1.403, 1.369, 1.319, 1.279, 1.244, 1.214, 1.191, 1.171, 1.154, 1.139, 1.129, 1.121, 1.115, 1.111, 1.109, 1.106, 1.105, 1.105, 1.108, 1.112, 1.117, 1.124, 1.135, 1.147, 1.162, 1.181, 1.203, 1.228, 1.262, 1.301, 1.347, 1.377,
+                    1.429, 1.398, 1.348, 1.306, 1.269, 1.237, 1.214, 1.191, 1.173, 1.158, 1.146, 1.138, 1.132, 1.128, 1.125, 1.123, 1.122, 1.123, 1.125, 1.129, 1.136, 1.142, 1.154, 1.166, 1.182, 1.203, 1.226, 1.253, 1.288, 1.329, 1.377, 1.406,
+                    1.465, 1.429, 1.377, 1.335, 1.295, 1.262, 1.236, 1.214, 1.194, 1.179, 1.167, 1.157, 1.151, 1.146, 1.144, 1.142, 1.142, 1.142, 1.144, 1.149, 1.154, 1.163, 1.174, 1.187, 1.205, 1.226, 1.251, 1.279, 1.315, 1.357, 1.406, 1.437,
+                    1.493, 1.465, 1.409, 1.364, 1.323, 1.289, 1.261, 1.235, 1.214, 1.194, 1.179, 1.171, 1.166, 1.163, 1.161, 1.161, 1.161, 1.161, 1.162, 1.164, 1.168, 1.175, 1.187, 1.205, 1.225, 1.251, 1.276, 1.306, 1.344, 1.387, 1.437, 1.455
+                ],
+                "sigma": 0.0007,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2500,
+                        "ccm":
+                        [
+                            1.95054, -0.57435, -0.37619,
+                            -0.46945, 1.86661, -0.39716,
+                            0.07977, -1.14072, 2.06095
+                        ]
+                    },
+                    {
+                        "ct": 2800,
+                        "ccm":
+                        [
+                            1.94104, -0.60261, -0.33844,
+                            -0.43162, 1.85422, -0.42261,
+                            0.03799, -0.95022, 1.91222
+                        ]
+                    },
+                    {
+                        "ct": 2900,
+                        "ccm":
+                        [
+                            1.91828, -0.59569, -0.32258,
+                            -0.51902, 2.09091, -0.57189,
+                            -0.03324, -0.73462, 1.76785
+                        ]
+                    },
+                    {
+                        "ct": 3620,
+                        "ccm":
+                        [
+                            1.97199, -0.66403, -0.30797,
+                            -0.46411, 2.02612, -0.56201,
+                            -0.07764, -0.61178, 1.68942
+                        ]
+                    },
+                    {
+                        "ct": 4560,
+                        "ccm":
+                        [
+                            2.15256, -0.84787, -0.30469,
+                            -0.48422, 2.28962, -0.80541,
+                            -0.15113, -0.53014, 1.68127
+                        ]
+                    },
+                    {
+                        "ct": 5600,
+                        "ccm":
+                        [
+                            2.04576, -0.74771, -0.29805,
+                            -0.36332, 1.98993, -0.62662,
+                            -0.09328, -0.46543, 1.55871
+                        ]
+                    },
+                    {
+                        "ct": 7400,
+                        "ccm":
+                        [
+                            2.37532, -0.83069, -0.54462,
+                            -0.48279, 2.84309, -1.36031,
+                            -0.21178, -0.66532, 1.87709
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.06,
+                "strength": 0.5,
+                "limit": 0.5
+            }
+        },
+        {
+            "rpi.cac":
+            {
+                "lut_rx":
+                [
+                    -0.28, -0.22, -0.16, -0.09, -0.02, 0.04, 0.11, 0.17, 0.29,
+                    -0.28, -0.22, -0.16, -0.09, -0.02, 0.04, 0.11, 0.18, 0.3,
+                    -0.28, -0.22, -0.16, -0.09, -0.02, 0.05, 0.11, 0.18, 0.31,
+                    -0.28, -0.22, -0.16, -0.09, -0.02, 0.05, 0.12, 0.18, 0.31,
+                    -0.27, -0.22, -0.16, -0.09, -0.02, 0.05, 0.12, 0.19, 0.31,
+                    -0.27, -0.21, -0.15, -0.08, -0.02, 0.05, 0.12, 0.18, 0.31,
+                    -0.27, -0.21, -0.15, -0.08, -0.02, 0.05, 0.11, 0.18, 0.3,
+                    -0.25, -0.2, -0.15, -0.09, -0.02, 0.05, 0.11, 0.17, 0.29,
+                    -0.24, -0.19, -0.14, -0.08, -0.02, 0.04, 0.11, 0.17, 0.29
+                ],
+                "lut_ry":
+                [
+                    -0.19, -0.18, -0.19, -0.19, -0.19, -0.18, -0.19, -0.19, -0.2,
+                    -0.14, -0.14, -0.15, -0.16, -0.16, -0.16, -0.16, -0.16, -0.17,
+                    -0.11, -0.1, -0.11, -0.12, -0.12, -0.12, -0.12, -0.12, -0.14,
+                    -0.06, -0.05, -0.05, -0.06, -0.07, -0.07, -0.06, -0.06, -0.08,
+                    -0.01, 0.0, -0.01, -0.01, -0.01, -0.01, -0.01, -0.01, -0.02,
+                    0.04, 0.05, 0.04, 0.03, 0.03, 0.03, 0.03, 0.04, 0.03,
+                    0.07, 0.08, 0.07, 0.07, 0.07, 0.07, 0.08, 0.08, 0.07,
+                    0.1, 0.11, 0.1, 0.1, 0.1, 0.1, 0.1, 0.11, 0.1,
+                    0.14, 0.14, 0.14, 0.14, 0.14, 0.14, 0.15, 0.15, 0.14
+                ],
+                "lut_bx":
+                [
+                    -0.21, -0.17, -0.13, -0.06, 0.01, 0.07, 0.13, 0.18, 0.27,
+                    -0.21, -0.17, -0.13, -0.06, 0.01, 0.08, 0.14, 0.2, 0.28,
+                    -0.22, -0.18, -0.13, -0.06, 0.01, 0.08, 0.15, 0.21, 0.3,
+                    -0.22, -0.18, -0.13, -0.06, 0.01, 0.08, 0.15, 0.21, 0.31,
+                    -0.21, -0.17, -0.13, -0.07, 0.01, 0.08, 0.15, 0.2, 0.31,
+                    -0.2, -0.16, -0.12, -0.06, 0.0, 0.07, 0.14, 0.18, 0.28,
+                    -0.19, -0.15, -0.11, -0.06, 0.01, 0.07, 0.13, 0.18, 0.26,
+                    -0.17, -0.14, -0.1, -0.05, 0.01, 0.07, 0.12, 0.16, 0.25,
+                    -0.15, -0.12, -0.08, -0.04, 0.01, 0.07, 0.1, 0.13, 0.22
+                ],
+                "lut_by":
+                [
+                    -0.15, -0.15, -0.17, -0.18, -0.18, -0.18, -0.17, -0.16, -0.14,
+                    -0.12, -0.12, -0.13, -0.14, -0.14, -0.14, -0.13, -0.12, -0.11,
+                    -0.09, -0.08, -0.09, -0.1, -0.1, -0.09, -0.09, -0.08, -0.09,
+                    -0.06, -0.04, -0.04, -0.05, -0.04, -0.04, -0.04, -0.04, -0.06,
+                    -0.02, 0.01, 0.01, 0.02, 0.02, 0.02, 0.02, 0.01, -0.02,
+                    0.02, 0.05, 0.07, 0.08, 0.09, 0.09, 0.08, 0.06, 0.02,
+                    0.05, 0.08, 0.1, 0.12, 0.13, 0.13, 0.12, 0.1, 0.06,
+                    0.07, 0.09, 0.11, 0.14, 0.16, 0.16, 0.14, 0.12, 0.07,
+                    0.09, 0.11, 0.14, 0.17, 0.19, 0.19, 0.18, 0.15, 0.1
+                ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx296_mono.json b/src/ipa/rpi/pisp/data/imx296_mono.json
new file mode 100644
index 000000000..153f86a07
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx296_mono.json
@@ -0,0 +1,960 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 3840
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 4724,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 860,
+                "reference_Y": 14551
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.751
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 226,
+                "slope": 0.01032
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.16,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 4000,
+                        "table":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1                        
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 4000,
+                        "table":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1                        
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.425, 1.393, 1.341, 1.295, 1.258, 1.226, 1.201, 1.181, 1.162, 1.146, 1.133, 1.123, 1.115, 1.111, 1.107, 1.106, 1.106, 1.107, 1.108, 1.111, 1.114, 1.122, 1.133, 1.148, 1.164, 1.184, 1.208, 1.236, 1.271, 1.309, 1.359, 1.381,
+                    1.397, 1.367, 1.317, 1.274, 1.237, 1.207, 1.183, 1.163, 1.146, 1.133, 1.123, 1.114, 1.107, 1.101, 1.098, 1.096, 1.096, 1.096, 1.097, 1.102, 1.106, 1.112, 1.122, 1.133, 1.148, 1.166, 1.187, 1.215, 1.249, 1.288, 1.335, 1.359,
+                    1.374, 1.341, 1.292, 1.251, 1.215, 1.186, 1.166, 1.146, 1.131, 1.117, 1.108, 1.099, 1.091, 1.088, 1.084, 1.082, 1.081, 1.082, 1.084, 1.088, 1.093, 1.098, 1.107, 1.118, 1.133, 1.149, 1.169, 1.195, 1.228, 1.267, 1.313, 1.335,
+                    1.352, 1.318, 1.271, 1.231, 1.196, 1.169, 1.149, 1.131, 1.115, 1.103, 1.093, 1.086, 1.079, 1.074, 1.071, 1.069, 1.069, 1.069, 1.071, 1.076, 1.079, 1.085, 1.094, 1.102, 1.117, 1.133, 1.152, 1.176, 1.208, 1.246, 1.289, 1.313,
+                    1.333, 1.298, 1.253, 1.212, 1.179, 1.153, 1.134, 1.116, 1.102, 1.089, 1.079, 1.072, 1.066, 1.062, 1.059, 1.058, 1.057, 1.057, 1.059, 1.064, 1.068, 1.072, 1.081, 1.091, 1.102, 1.119, 1.137, 1.161, 1.191, 1.227, 1.271, 1.293,
+                    1.317, 1.281, 1.235, 1.196, 1.165, 1.139, 1.119, 1.104, 1.089, 1.078, 1.068, 1.062, 1.055, 1.051, 1.048, 1.047, 1.047, 1.047, 1.048, 1.053, 1.056, 1.061, 1.069, 1.079, 1.091, 1.105, 1.126, 1.147, 1.177, 1.212, 1.253, 1.278,
+                    1.301, 1.265, 1.221, 1.181, 1.151, 1.127, 1.108, 1.091, 1.078, 1.068, 1.059, 1.051, 1.045, 1.041, 1.038, 1.037, 1.036, 1.037, 1.038, 1.042, 1.046, 1.051, 1.059, 1.069, 1.081, 1.096, 1.113, 1.135, 1.164, 1.198, 1.238, 1.264,
+                    1.286, 1.251, 1.207, 1.169, 1.141, 1.116, 1.098, 1.081, 1.068, 1.058, 1.049, 1.042, 1.037, 1.033, 1.031, 1.029, 1.028, 1.028, 1.029, 1.033, 1.037, 1.043, 1.051, 1.059, 1.071, 1.086, 1.104, 1.124, 1.152, 1.185, 1.225, 1.252,
+                    1.275, 1.239, 1.196, 1.161, 1.132, 1.107, 1.089, 1.073, 1.059, 1.049, 1.041, 1.035, 1.028, 1.024, 1.023, 1.021, 1.021, 1.021, 1.022, 1.024, 1.029, 1.036, 1.043, 1.051, 1.063, 1.078, 1.095, 1.115, 1.143, 1.175, 1.214, 1.243,
+                    1.267, 1.227, 1.187, 1.152, 1.122, 1.101, 1.081, 1.067, 1.054, 1.042, 1.035, 1.028, 1.023, 1.018, 1.015, 1.014, 1.014, 1.014, 1.016, 1.019, 1.024, 1.029, 1.036, 1.045, 1.056, 1.071, 1.088, 1.107, 1.134, 1.167, 1.204, 1.234,
+                    1.261, 1.219, 1.179, 1.145, 1.116, 1.095, 1.076, 1.061, 1.047, 1.037, 1.031, 1.023, 1.018, 1.014, 1.011, 1.009, 1.009, 1.009, 1.011, 1.013, 1.018, 1.024, 1.031, 1.039, 1.049, 1.065, 1.083, 1.102, 1.128, 1.161, 1.196, 1.228,
+                    1.256, 1.213, 1.173, 1.139, 1.111, 1.091, 1.071, 1.056, 1.043, 1.033, 1.026, 1.019, 1.014, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.009, 1.013, 1.018, 1.026, 1.035, 1.046, 1.061, 1.078, 1.097, 1.123, 1.154, 1.191, 1.222,
+                    1.251, 1.208, 1.169, 1.137, 1.108, 1.088, 1.069, 1.053, 1.039, 1.029, 1.023, 1.015, 1.011, 1.006, 1.004, 1.003, 1.001, 1.002, 1.003, 1.006, 1.009, 1.015, 1.022, 1.032, 1.044, 1.057, 1.076, 1.094, 1.119, 1.149, 1.186, 1.218,
+                    1.249, 1.205, 1.167, 1.133, 1.107, 1.085, 1.067, 1.052, 1.038, 1.029, 1.021, 1.013, 1.008, 1.004, 1.003, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.013, 1.021, 1.031, 1.042, 1.055, 1.073, 1.093, 1.116, 1.147, 1.182, 1.218,
+                    1.249, 1.204, 1.165, 1.132, 1.106, 1.085, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.007, 1.003, 1.002, 1.001, 1.001, 1.001, 1.001, 1.004, 1.007, 1.013, 1.021, 1.029, 1.042, 1.055, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.249, 1.204, 1.165, 1.132, 1.107, 1.086, 1.067, 1.051, 1.038, 1.029, 1.019, 1.013, 1.008, 1.004, 1.002, 1.001, 1.001, 1.001, 1.002, 1.004, 1.007, 1.014, 1.021, 1.029, 1.042, 1.056, 1.072, 1.091, 1.115, 1.145, 1.181, 1.217,
+                    1.251, 1.205, 1.166, 1.133, 1.108, 1.087, 1.068, 1.052, 1.039, 1.031, 1.021, 1.014, 1.009, 1.006, 1.003, 1.002, 1.001, 1.001, 1.003, 1.006, 1.009, 1.014, 1.022, 1.031, 1.043, 1.056, 1.073, 1.093, 1.116, 1.145, 1.182, 1.218,
+                    1.252, 1.208, 1.168, 1.137, 1.111, 1.089, 1.071, 1.055, 1.043, 1.033, 1.023, 1.016, 1.012, 1.009, 1.006, 1.005, 1.004, 1.004, 1.006, 1.008, 1.012, 1.017, 1.024, 1.034, 1.045, 1.059, 1.075, 1.095, 1.119, 1.149, 1.185, 1.218,
+                    1.256, 1.213, 1.173, 1.142, 1.115, 1.093, 1.075, 1.059, 1.047, 1.036, 1.027, 1.021, 1.016, 1.012, 1.011, 1.009, 1.008, 1.008, 1.009, 1.012, 1.016, 1.021, 1.028, 1.038, 1.049, 1.064, 1.081, 1.099, 1.126, 1.155, 1.192, 1.223,
+                    1.261, 1.221, 1.179, 1.148, 1.121, 1.099, 1.081, 1.065, 1.052, 1.042, 1.032, 1.026, 1.021, 1.017, 1.015, 1.014, 1.014, 1.013, 1.013, 1.016, 1.021, 1.026, 1.033, 1.043, 1.054, 1.068, 1.085, 1.106, 1.132, 1.161, 1.199, 1.228,
+                    1.267, 1.228, 1.188, 1.155, 1.128, 1.105, 1.086, 1.071, 1.059, 1.047, 1.038, 1.031, 1.027, 1.022, 1.021, 1.019, 1.019, 1.019, 1.019, 1.022, 1.026, 1.032, 1.038, 1.049, 1.061, 1.075, 1.092, 1.112, 1.138, 1.169, 1.207, 1.236,
+                    1.278, 1.241, 1.199, 1.164, 1.137, 1.114, 1.094, 1.078, 1.066, 1.055, 1.046, 1.038, 1.032, 1.029, 1.027, 1.027, 1.027, 1.027, 1.027, 1.029, 1.032, 1.038, 1.047, 1.056, 1.067, 1.083, 1.099, 1.121, 1.146, 1.178, 1.217, 1.244,
+                    1.291, 1.252, 1.211, 1.175, 1.147, 1.124, 1.103, 1.088, 1.075, 1.063, 1.054, 1.046, 1.041, 1.036, 1.035, 1.035, 1.035, 1.035, 1.036, 1.038, 1.041, 1.047, 1.055, 1.065, 1.075, 1.092, 1.111, 1.132, 1.157, 1.189, 1.231, 1.255,
+                    1.303, 1.265, 1.222, 1.187, 1.158, 1.133, 1.112, 1.097, 1.083, 1.072, 1.063, 1.054, 1.048, 1.043, 1.043, 1.043, 1.043, 1.043, 1.043, 1.046, 1.049, 1.055, 1.065, 1.074, 1.086, 1.102, 1.119, 1.144, 1.171, 1.203, 1.243, 1.268,
+                    1.317, 1.282, 1.236, 1.201, 1.171, 1.146, 1.125, 1.109, 1.095, 1.083, 1.072, 1.064, 1.058, 1.054, 1.052, 1.051, 1.051, 1.053, 1.054, 1.057, 1.061, 1.065, 1.074, 1.086, 1.099, 1.113, 1.133, 1.156, 1.183, 1.217, 1.259, 1.282,
+                    1.335, 1.301, 1.254, 1.218, 1.186, 1.159, 1.138, 1.121, 1.108, 1.095, 1.085, 1.076, 1.069, 1.066, 1.065, 1.063, 1.062, 1.063, 1.065, 1.068, 1.073, 1.078, 1.087, 1.098, 1.113, 1.126, 1.146, 1.171, 1.199, 1.235, 1.277, 1.299,
+                    1.356, 1.321, 1.274, 1.235, 1.202, 1.175, 1.153, 1.137, 1.121, 1.108, 1.097, 1.089, 1.084, 1.081, 1.077, 1.075, 1.075, 1.075, 1.077, 1.081, 1.086, 1.091, 1.099, 1.113, 1.126, 1.144, 1.162, 1.187, 1.218, 1.255, 1.297, 1.321,
+                    1.376, 1.344, 1.296, 1.257, 1.223, 1.194, 1.171, 1.153, 1.137, 1.124, 1.112, 1.104, 1.099, 1.095, 1.093, 1.091, 1.089, 1.091, 1.092, 1.095, 1.101, 1.108, 1.116, 1.128, 1.144, 1.161, 1.181, 1.206, 1.237, 1.275, 1.321, 1.347,
+                    1.403, 1.369, 1.319, 1.279, 1.244, 1.214, 1.191, 1.171, 1.154, 1.139, 1.129, 1.121, 1.115, 1.111, 1.109, 1.106, 1.105, 1.105, 1.108, 1.112, 1.117, 1.124, 1.135, 1.147, 1.162, 1.181, 1.203, 1.228, 1.262, 1.301, 1.347, 1.377,
+                    1.429, 1.398, 1.348, 1.306, 1.269, 1.237, 1.214, 1.191, 1.173, 1.158, 1.146, 1.138, 1.132, 1.128, 1.125, 1.123, 1.122, 1.123, 1.125, 1.129, 1.136, 1.142, 1.154, 1.166, 1.182, 1.203, 1.226, 1.253, 1.288, 1.329, 1.377, 1.406,
+                    1.465, 1.429, 1.377, 1.335, 1.295, 1.262, 1.236, 1.214, 1.194, 1.179, 1.167, 1.157, 1.151, 1.146, 1.144, 1.142, 1.142, 1.142, 1.144, 1.149, 1.154, 1.163, 1.174, 1.187, 1.205, 1.226, 1.251, 1.279, 1.315, 1.357, 1.406, 1.437,
+                    1.493, 1.465, 1.409, 1.364, 1.323, 1.289, 1.261, 1.235, 1.214, 1.194, 1.179, 1.171, 1.166, 1.163, 1.161, 1.161, 1.161, 1.161, 1.162, 1.164, 1.168, 1.175, 1.187, 1.205, 1.225, 1.251, 1.276, 1.306, 1.344, 1.387, 1.437, 1.455
+                ],
+                "sigma": 0.0007,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.06,
+                "strength": 0.5,
+                "limit": 0.5
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": [ 0.0, 2.5, 0.01, 2.5, 0.06, 1.0, 1.0, 1.0 ],
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": [ 0.0, 2.5, 0.01, 2.5, 0.06, 1.0, 1.0, 1.0 ],
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx477.json b/src/ipa/rpi/pisp/data/imx477.json
new file mode 100644
index 000000000..2fe04c211
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx477.json
@@ -0,0 +1,1186 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 12000,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 740,
+                "reference_Y": 15051
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.809
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 204,
+                "slope": 0.0061
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2850.0, 0.4307, 0.3957,
+                    2960.0, 0.4159, 0.4313,
+                    3580.0, 0.3771, 0.5176,
+                    4559.0, 0.3031, 0.6573,
+                    5881.0, 0.2809, 0.6942,
+                    7600.0, 0.2263, 0.7762
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.02634,
+                "transverse_neg": 0.02255
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.16,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.359, 2.354, 2.351, 2.351, 2.343, 2.337, 2.331, 2.325, 2.323, 2.321, 2.317, 2.315, 2.313, 2.313, 2.311, 2.312, 2.312, 2.313, 2.315, 2.315, 2.316, 2.317, 2.319, 2.323, 2.326, 2.329, 2.332, 2.332, 2.335, 2.337, 2.352, 2.363,
+                            2.352, 2.351, 2.349, 2.346, 2.342, 2.334, 2.328, 2.324, 2.321, 2.317, 2.315, 2.314, 2.312, 2.311, 2.311, 2.311, 2.311, 2.311, 2.312, 2.314, 2.315, 2.316, 2.317, 2.319, 2.324, 2.326, 2.328, 2.329, 2.331, 2.337, 2.348, 2.355,
+                            2.346, 2.346, 2.345, 2.344, 2.338, 2.329, 2.325, 2.319, 2.316, 2.314, 2.311, 2.309, 2.308, 2.306, 2.304, 2.304, 2.305, 2.307, 2.308, 2.309, 2.311, 2.311, 2.313, 2.316, 2.319, 2.322, 2.325, 2.326, 2.328, 2.335, 2.343, 2.349,
+                            2.342, 2.342, 2.341, 2.338, 2.332, 2.326, 2.319, 2.316, 2.312, 2.309, 2.308, 2.305, 2.303, 2.302, 2.301, 2.301, 2.302, 2.303, 2.304, 2.305, 2.305, 2.307, 2.311, 2.313, 2.315, 2.319, 2.321, 2.325, 2.328, 2.333, 2.338, 2.348,
+                            2.337, 2.337, 2.337, 2.336, 2.331, 2.322, 2.317, 2.312, 2.309, 2.307, 2.304, 2.302, 2.299, 2.299, 2.298, 2.298, 2.299, 2.299, 2.301, 2.302, 2.302, 2.304, 2.305, 2.309, 2.314, 2.316, 2.321, 2.324, 2.326, 2.329, 2.335, 2.343,
+                            2.335, 2.334, 2.333, 2.333, 2.326, 2.318, 2.313, 2.309, 2.306, 2.302, 2.299, 2.297, 2.297, 2.296, 2.295, 2.295, 2.294, 2.295, 2.296, 2.298, 2.298, 2.301, 2.303, 2.305, 2.311, 2.315, 2.319, 2.323, 2.325, 2.329, 2.333, 2.339,
+                            2.329, 2.331, 2.329, 2.329, 2.325, 2.315, 2.309, 2.306, 2.302, 2.299, 2.297, 2.295, 2.293, 2.292, 2.291, 2.291, 2.291, 2.291, 2.293, 2.294, 2.296, 2.298, 2.301, 2.304, 2.307, 2.313, 2.317, 2.319, 2.323, 2.327, 2.331, 2.339,
+                            2.329, 2.328, 2.328, 2.328, 2.321, 2.313, 2.307, 2.303, 2.299, 2.295, 2.294, 2.292, 2.289, 2.289, 2.288, 2.288, 2.288, 2.289, 2.289, 2.292, 2.294, 2.295, 2.297, 2.301, 2.306, 2.311, 2.315, 2.318, 2.319, 2.323, 2.329, 2.335,
+                            2.326, 2.327, 2.325, 2.325, 2.319, 2.311, 2.305, 2.299, 2.296, 2.293, 2.291, 2.289, 2.288, 2.287, 2.285, 2.285, 2.286, 2.288, 2.288, 2.289, 2.291, 2.294, 2.295, 2.298, 2.304, 2.308, 2.313, 2.315, 2.317, 2.319, 2.327, 2.335,
+                            2.325, 2.325, 2.323, 2.323, 2.317, 2.309, 2.303, 2.298, 2.294, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.284, 2.284, 2.285, 2.287, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.305, 2.309, 2.313, 2.315, 2.317, 2.325, 2.334,
+                            2.322, 2.324, 2.322, 2.322, 2.316, 2.306, 2.301, 2.296, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.283, 2.283, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.293, 2.296, 2.301, 2.304, 2.308, 2.311, 2.312, 2.315, 2.323, 2.333,
+                            2.321, 2.323, 2.322, 2.322, 2.314, 2.306, 2.299, 2.294, 2.291, 2.288, 2.286, 2.285, 2.284, 2.282, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.306, 2.308, 2.311, 2.312, 2.322, 2.332,
+                            2.319, 2.321, 2.321, 2.321, 2.314, 2.305, 2.297, 2.293, 2.289, 2.287, 2.285, 2.284, 2.283, 2.281, 2.281, 2.281, 2.282, 2.283, 2.283, 2.285, 2.287, 2.289, 2.291, 2.292, 2.297, 2.301, 2.305, 2.307, 2.309, 2.312, 2.321, 2.333,
+                            2.319, 2.321, 2.319, 2.319, 2.314, 2.303, 2.296, 2.293, 2.289, 2.286, 2.285, 2.283, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.296, 2.301, 2.305, 2.307, 2.308, 2.312, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.296, 2.291, 2.289, 2.286, 2.284, 2.282, 2.281, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.287, 2.288, 2.291, 2.295, 2.299, 2.304, 2.306, 2.307, 2.311, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.287, 2.285, 2.282, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.284, 2.285, 2.286, 2.288, 2.291, 2.295, 2.299, 2.303, 2.306, 2.307, 2.312, 2.321, 2.331,
+                            2.318, 2.319, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.286, 2.285, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.285, 2.286, 2.287, 2.291, 2.294, 2.298, 2.303, 2.306, 2.307, 2.311, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.302, 2.297, 2.292, 2.289, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.287, 2.289, 2.294, 2.297, 2.303, 2.305, 2.308, 2.313, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.303, 2.299, 2.293, 2.291, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.288, 2.291, 2.294, 2.298, 2.304, 2.306, 2.308, 2.312, 2.322, 2.331,
+                            2.319, 2.321, 2.321, 2.321, 2.315, 2.305, 2.301, 2.295, 2.292, 2.289, 2.286, 2.285, 2.283, 2.282, 2.282, 2.282, 2.284, 2.283, 2.284, 2.284, 2.285, 2.287, 2.288, 2.291, 2.294, 2.299, 2.304, 2.306, 2.309, 2.313, 2.322, 2.334,
+                            2.321, 2.322, 2.322, 2.322, 2.317, 2.307, 2.301, 2.296, 2.292, 2.291, 2.288, 2.286, 2.285, 2.284, 2.283, 2.284, 2.285, 2.284, 2.285, 2.285, 2.287, 2.288, 2.289, 2.293, 2.297, 2.301, 2.305, 2.308, 2.311, 2.314, 2.323, 2.335,
+                            2.322, 2.324, 2.324, 2.324, 2.319, 2.309, 2.303, 2.297, 2.295, 2.292, 2.291, 2.288, 2.286, 2.286, 2.285, 2.286, 2.286, 2.286, 2.287, 2.288, 2.289, 2.289, 2.291, 2.294, 2.299, 2.302, 2.307, 2.311, 2.312, 2.316, 2.325, 2.335,
+                            2.324, 2.326, 2.325, 2.326, 2.321, 2.311, 2.305, 2.301, 2.297, 2.295, 2.293, 2.291, 2.289, 2.289, 2.288, 2.288, 2.287, 2.288, 2.289, 2.291, 2.292, 2.292, 2.295, 2.299, 2.301, 2.304, 2.309, 2.312, 2.315, 2.319, 2.327, 2.337,
+                            2.329, 2.329, 2.328, 2.328, 2.323, 2.315, 2.308, 2.304, 2.301, 2.298, 2.296, 2.294, 2.291, 2.291, 2.289, 2.291, 2.291, 2.291, 2.292, 2.293, 2.294, 2.295, 2.297, 2.299, 2.303, 2.308, 2.312, 2.315, 2.318, 2.321, 2.329, 2.339,
+                            2.329, 2.331, 2.332, 2.332, 2.326, 2.318, 2.311, 2.306, 2.304, 2.301, 2.299, 2.297, 2.295, 2.293, 2.292, 2.292, 2.292, 2.293, 2.294, 2.294, 2.296, 2.297, 2.299, 2.302, 2.306, 2.311, 2.315, 2.318, 2.319, 2.324, 2.332, 2.342,
+                            2.331, 2.333, 2.334, 2.334, 2.328, 2.321, 2.313, 2.308, 2.305, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.295, 2.294, 2.296, 2.296, 2.297, 2.298, 2.299, 2.302, 2.305, 2.308, 2.314, 2.317, 2.321, 2.323, 2.327, 2.334, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.309, 2.306, 2.304, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.309, 2.315, 2.319, 2.321, 2.324, 2.328, 2.337, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.311, 2.306, 2.304, 2.303, 2.302, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.311, 2.314, 2.319, 2.323, 2.325, 2.329, 2.339, 2.348,
+                            2.329, 2.329, 2.329, 2.331, 2.326, 2.319, 2.312, 2.309, 2.304, 2.303, 2.302, 2.301, 2.298, 2.295, 2.294, 2.294, 2.295, 2.295, 2.296, 2.297, 2.299, 2.301, 2.302, 2.304, 2.308, 2.313, 2.319, 2.322, 2.325, 2.329, 2.339, 2.351,
+                            2.329, 2.329, 2.329, 2.329, 2.326, 2.317, 2.311, 2.308, 2.303, 2.302, 2.301, 2.298, 2.296, 2.295, 2.294, 2.294, 2.294, 2.294, 2.296, 2.297, 2.298, 2.299, 2.301, 2.304, 2.307, 2.312, 2.318, 2.322, 2.326, 2.331, 2.341, 2.355,
+                            2.339, 2.332, 2.331, 2.331, 2.327, 2.323, 2.316, 2.309, 2.306, 2.302, 2.301, 2.299, 2.297, 2.296, 2.295, 2.294, 2.294, 2.296, 2.297, 2.297, 2.299, 2.301, 2.303, 2.306, 2.308, 2.317, 2.322, 2.325, 2.329, 2.341, 2.353, 2.361,
+                            2.347, 2.347, 2.345, 2.343, 2.338, 2.332, 2.326, 2.322, 2.321, 2.318, 2.316, 2.315, 2.313, 2.312, 2.311, 2.311, 2.311, 2.311, 2.312, 2.315, 2.317, 2.318, 2.319, 2.323, 2.324, 2.329, 2.334, 2.337, 2.344, 2.347, 2.361, 2.364
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.869, 3.852, 3.844, 3.842, 3.836, 3.821, 3.807, 3.796, 3.789, 3.784, 3.778, 3.775, 3.769, 3.768, 3.765, 3.765, 3.767, 3.769, 3.772, 3.774, 3.773, 3.775, 3.779, 3.787, 3.793, 3.801, 3.806, 3.804, 3.813, 3.819, 3.855, 3.879,
+                            3.854, 3.844, 3.837, 3.836, 3.824, 3.811, 3.797, 3.789, 3.784, 3.777, 3.774, 3.769, 3.764, 3.758, 3.757, 3.758, 3.758, 3.761, 3.763, 3.764, 3.765, 3.766, 3.772, 3.778, 3.787, 3.792, 3.794, 3.798, 3.802, 3.815, 3.839, 3.873,
+                            3.838, 3.831, 3.826, 3.823, 3.813, 3.799, 3.787, 3.781, 3.773, 3.768, 3.763, 3.759, 3.753, 3.749, 3.745, 3.745, 3.745, 3.752, 3.754, 3.757, 3.757, 3.759, 3.763, 3.769, 3.773, 3.781, 3.786, 3.792, 3.798, 3.811, 3.831, 3.861,
+                            3.833, 3.822, 3.817, 3.816, 3.804, 3.788, 3.779, 3.772, 3.766, 3.759, 3.755, 3.749, 3.744, 3.741, 3.738, 3.739, 3.739, 3.741, 3.743, 3.747, 3.749, 3.751, 3.756, 3.764, 3.769, 3.776, 3.783, 3.789, 3.798, 3.809, 3.821, 3.855,
+                            3.824, 3.818, 3.808, 3.808, 3.797, 3.781, 3.772, 3.764, 3.757, 3.752, 3.747, 3.743, 3.737, 3.735, 3.733, 3.733, 3.733, 3.735, 3.737, 3.738, 3.741, 3.746, 3.749, 3.755, 3.766, 3.771, 3.781, 3.789, 3.794, 3.806, 3.818, 3.849,
+                            3.815, 3.808, 3.799, 3.801, 3.787, 3.775, 3.767, 3.757, 3.751, 3.745, 3.738, 3.734, 3.732, 3.727, 3.725, 3.723, 3.722, 3.722, 3.726, 3.729, 3.734, 3.738, 3.744, 3.749, 3.759, 3.769, 3.781, 3.788, 3.792, 3.799, 3.811, 3.841,
+                            3.804, 3.799, 3.793, 3.793, 3.783, 3.771, 3.759, 3.751, 3.744, 3.735, 3.732, 3.727, 3.723, 3.721, 3.719, 3.716, 3.716, 3.716, 3.718, 3.722, 3.727, 3.731, 3.737, 3.746, 3.756, 3.767, 3.776, 3.782, 3.788, 3.795, 3.808, 3.831,
+                            3.802, 3.797, 3.787, 3.787, 3.779, 3.762, 3.753, 3.744, 3.734, 3.727, 3.725, 3.721, 3.716, 3.714, 3.709, 3.709, 3.711, 3.711, 3.712, 3.717, 3.722, 3.725, 3.731, 3.739, 3.752, 3.762, 3.772, 3.778, 3.779, 3.789, 3.798, 3.826,
+                            3.791, 3.789, 3.784, 3.784, 3.775, 3.759, 3.746, 3.735, 3.729, 3.724, 3.718, 3.714, 3.712, 3.707, 3.704, 3.704, 3.706, 3.708, 3.709, 3.711, 3.716, 3.722, 3.726, 3.735, 3.746, 3.754, 3.767, 3.774, 3.777, 3.781, 3.794, 3.824,
+                            3.789, 3.784, 3.779, 3.781, 3.771, 3.753, 3.741, 3.732, 3.725, 3.719, 3.715, 3.711, 3.707, 3.704, 3.701, 3.701, 3.702, 3.704, 3.708, 3.709, 3.713, 3.718, 3.724, 3.731, 3.742, 3.749, 3.761, 3.768, 3.772, 3.778, 3.791, 3.822,
+                            3.789, 3.781, 3.777, 3.777, 3.764, 3.749, 3.739, 3.729, 3.722, 3.718, 3.711, 3.708, 3.705, 3.701, 3.699, 3.699, 3.699, 3.701, 3.705, 3.707, 3.711, 3.715, 3.721, 3.727, 3.738, 3.746, 3.757, 3.763, 3.765, 3.773, 3.788, 3.821,
+                            3.785, 3.779, 3.774, 3.774, 3.764, 3.747, 3.736, 3.726, 3.719, 3.711, 3.709, 3.706, 3.701, 3.698, 3.696, 3.695, 3.695, 3.698, 3.702, 3.704, 3.707, 3.712, 3.718, 3.725, 3.734, 3.741, 3.753, 3.756, 3.759, 3.764, 3.784, 3.818,
+                            3.779, 3.776, 3.773, 3.773, 3.759, 3.744, 3.733, 3.724, 3.714, 3.709, 3.706, 3.704, 3.699, 3.696, 3.694, 3.694, 3.694, 3.697, 3.701, 3.703, 3.706, 3.709, 3.714, 3.721, 3.731, 3.737, 3.749, 3.753, 3.758, 3.762, 3.783, 3.819,
+                            3.779, 3.776, 3.769, 3.769, 3.757, 3.741, 3.729, 3.721, 3.712, 3.708, 3.705, 3.701, 3.697, 3.695, 3.694, 3.694, 3.695, 3.696, 3.698, 3.702, 3.705, 3.709, 3.712, 3.717, 3.728, 3.736, 3.749, 3.752, 3.756, 3.761, 3.781, 3.815,
+                            3.779, 3.773, 3.768, 3.768, 3.756, 3.738, 3.731, 3.719, 3.711, 3.707, 3.703, 3.698, 3.695, 3.694, 3.694, 3.695, 3.695, 3.695, 3.696, 3.702, 3.705, 3.708, 3.712, 3.717, 3.728, 3.736, 3.747, 3.751, 3.754, 3.761, 3.781, 3.815,
+                            3.782, 3.773, 3.767, 3.767, 3.755, 3.738, 3.728, 3.721, 3.711, 3.707, 3.701, 3.698, 3.695, 3.693, 3.694, 3.696, 3.695, 3.695, 3.695, 3.701, 3.703, 3.706, 3.711, 3.715, 3.726, 3.735, 3.745, 3.751, 3.754, 3.763, 3.779, 3.815,
+                            3.781, 3.771, 3.767, 3.767, 3.754, 3.739, 3.726, 3.721, 3.712, 3.706, 3.701, 3.698, 3.695, 3.693, 3.693, 3.695, 3.695, 3.695, 3.696, 3.698, 3.703, 3.705, 3.709, 3.715, 3.725, 3.734, 3.745, 3.751, 3.755, 3.762, 3.783, 3.818,
+                            3.781, 3.774, 3.767, 3.767, 3.755, 3.741, 3.729, 3.722, 3.712, 3.708, 3.701, 3.699, 3.695, 3.693, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.725, 3.732, 3.746, 3.751, 3.756, 3.763, 3.783, 3.821,
+                            3.781, 3.774, 3.769, 3.769, 3.756, 3.741, 3.731, 3.724, 3.713, 3.711, 3.707, 3.699, 3.697, 3.694, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.724, 3.734, 3.747, 3.751, 3.756, 3.765, 3.784, 3.821,
+                            3.784, 3.776, 3.773, 3.773, 3.759, 3.742, 3.733, 3.726, 3.719, 3.711, 3.709, 3.703, 3.698, 3.695, 3.694, 3.695, 3.697, 3.696, 3.698, 3.699, 3.703, 3.706, 3.711, 3.714, 3.727, 3.735, 3.746, 3.751, 3.757, 3.766, 3.787, 3.822,
+                            3.786, 3.783, 3.774, 3.774, 3.766, 3.747, 3.737, 3.727, 3.722, 3.716, 3.711, 3.706, 3.702, 3.698, 3.697, 3.698, 3.699, 3.699, 3.701, 3.703, 3.706, 3.711, 3.713, 3.719, 3.731, 3.739, 3.748, 3.753, 3.761, 3.769, 3.789, 3.826,
+                            3.786, 3.784, 3.779, 3.779, 3.769, 3.751, 3.742, 3.732, 3.725, 3.719, 3.715, 3.711, 3.706, 3.704, 3.701, 3.701, 3.702, 3.702, 3.705, 3.707, 3.712, 3.714, 3.717, 3.724, 3.733, 3.743, 3.749, 3.758, 3.764, 3.769, 3.791, 3.826,
+                            3.793, 3.787, 3.782, 3.782, 3.774, 3.756, 3.747, 3.737, 3.729, 3.725, 3.719, 3.715, 3.712, 3.708, 3.707, 3.706, 3.707, 3.708, 3.709, 3.713, 3.714, 3.717, 3.723, 3.729, 3.736, 3.747, 3.757, 3.764, 3.768, 3.774, 3.794, 3.829,
+                            3.794, 3.791, 3.786, 3.786, 3.779, 3.762, 3.751, 3.742, 3.735, 3.729, 3.725, 3.719, 3.716, 3.711, 3.709, 3.709, 3.709, 3.711, 3.716, 3.717, 3.721, 3.723, 3.726, 3.732, 3.741, 3.752, 3.761, 3.767, 3.773, 3.779, 3.801, 3.829,
+                            3.802, 3.798, 3.793, 3.793, 3.779, 3.766, 3.754, 3.746, 3.741, 3.736, 3.731, 3.726, 3.719, 3.717, 3.716, 3.715, 3.716, 3.717, 3.719, 3.721, 3.724, 3.726, 3.731, 3.737, 3.744, 3.756, 3.766, 3.772, 3.776, 3.784, 3.807, 3.839,
+                            3.805, 3.799, 3.795, 3.795, 3.784, 3.767, 3.757, 3.749, 3.744, 3.739, 3.736, 3.731, 3.726, 3.722, 3.719, 3.719, 3.719, 3.721, 3.723, 3.725, 3.727, 3.732, 3.738, 3.742, 3.751, 3.761, 3.771, 3.775, 3.782, 3.789, 3.811, 3.841,
+                            3.804, 3.801, 3.799, 3.799, 3.787, 3.772, 3.761, 3.752, 3.746, 3.742, 3.739, 3.735, 3.729, 3.726, 3.723, 3.724, 3.725, 3.726, 3.727, 3.728, 3.732, 3.736, 3.739, 3.745, 3.754, 3.765, 3.775, 3.779, 3.785, 3.795, 3.816, 3.844,
+                            3.801, 3.799, 3.796, 3.796, 3.787, 3.773, 3.761, 3.753, 3.746, 3.743, 3.739, 3.735, 3.731, 3.726, 3.725, 3.725, 3.725, 3.726, 3.727, 3.729, 3.733, 3.736, 3.741, 3.745, 3.755, 3.766, 3.776, 3.783, 3.786, 3.797, 3.819, 3.851,
+                            3.799, 3.795, 3.788, 3.788, 3.783, 3.772, 3.759, 3.749, 3.744, 3.738, 3.735, 3.733, 3.726, 3.724, 3.722, 3.722, 3.723, 3.724, 3.725, 3.727, 3.729, 3.733, 3.736, 3.742, 3.754, 3.762, 3.772, 3.779, 3.784, 3.796, 3.821, 3.859,
+                            3.799, 3.789, 3.787, 3.788, 3.779, 3.766, 3.755, 3.749, 3.742, 3.736, 3.733, 3.727, 3.723, 3.722, 3.721, 3.719, 3.719, 3.721, 3.725, 3.726, 3.728, 3.732, 3.734, 3.741, 3.747, 3.758, 3.771, 3.778, 3.785, 3.796, 3.825, 3.862,
+                            3.824, 3.799, 3.789, 3.789, 3.788, 3.777, 3.761, 3.751, 3.743, 3.739, 3.736, 3.728, 3.726, 3.725, 3.721, 3.719, 3.721, 3.723, 3.727, 3.728, 3.729, 3.733, 3.737, 3.744, 3.755, 3.769, 3.776, 3.784, 3.793, 3.819, 3.863, 3.877,
+                            3.833, 3.833, 3.833, 3.842, 3.825, 3.815, 3.807, 3.799, 3.792, 3.788, 3.785, 3.782, 3.778, 3.777, 3.773, 3.772, 3.772, 3.774, 3.778, 3.779, 3.779, 3.785, 3.792, 3.798, 3.803, 3.811, 3.822, 3.834, 3.843, 3.846, 3.877, 3.886
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.616, 2.616, 2.618, 2.621, 2.619, 2.618, 2.615, 2.615, 2.613, 2.611, 2.609, 2.609, 2.609, 2.611, 2.611, 2.611, 2.611, 2.609, 2.608, 2.608, 2.611, 2.613, 2.613, 2.614, 2.614, 2.615, 2.615, 2.622, 2.624, 2.621, 2.624, 2.641,
+                            2.616, 2.618, 2.621, 2.623, 2.623, 2.619, 2.618, 2.616, 2.616, 2.613, 2.611, 2.611, 2.611, 2.611, 2.612, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.612, 2.613, 2.612, 2.613, 2.615, 2.617, 2.621, 2.621, 2.619, 2.621, 2.641,
+                            2.621, 2.624, 2.627, 2.627, 2.625, 2.623, 2.621, 2.619, 2.618, 2.618, 2.618, 2.617, 2.616, 2.616, 2.615, 2.613, 2.612, 2.613, 2.613, 2.614, 2.614, 2.613, 2.614, 2.613, 2.614, 2.617, 2.619, 2.621, 2.621, 2.619, 2.623, 2.643,
+                            2.626, 2.627, 2.628, 2.629, 2.628, 2.625, 2.622, 2.621, 2.621, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.616, 2.616, 2.616, 2.618, 2.618, 2.617, 2.617, 2.618, 2.619, 2.621, 2.623, 2.624, 2.626, 2.625, 2.624, 2.625, 2.654,
+                            2.627, 2.628, 2.628, 2.628, 2.626, 2.623, 2.622, 2.622, 2.622, 2.622, 2.621, 2.621, 2.619, 2.617, 2.617, 2.616, 2.617, 2.617, 2.618, 2.619, 2.618, 2.618, 2.618, 2.621, 2.622, 2.624, 2.626, 2.627, 2.627, 2.626, 2.628, 2.655,
+                            2.625, 2.626, 2.627, 2.626, 2.625, 2.623, 2.622, 2.621, 2.622, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.616, 2.616, 2.616, 2.616, 2.616, 2.617, 2.618, 2.619, 2.621, 2.622, 2.624, 2.626, 2.628, 2.628, 2.629, 2.629, 2.655,
+                            2.626, 2.625, 2.626, 2.625, 2.625, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.616, 2.614, 2.613, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.618, 2.619, 2.621, 2.623, 2.624, 2.627, 2.629, 2.631, 2.629, 2.631, 2.651,
+                            2.625, 2.625, 2.625, 2.624, 2.623, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.614, 2.613, 2.612, 2.611, 2.611, 2.612, 2.612, 2.613, 2.616, 2.618, 2.619, 2.622, 2.624, 2.626, 2.628, 2.631, 2.631, 2.631, 2.631, 2.651,
+                            2.625, 2.625, 2.624, 2.623, 2.622, 2.622, 2.622, 2.622, 2.622, 2.621, 2.617, 2.615, 2.613, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.613, 2.615, 2.618, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.624, 2.624, 2.622, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.618, 2.616, 2.614, 2.612, 2.611, 2.609, 2.609, 2.608, 2.609, 2.611, 2.611, 2.615, 2.617, 2.619, 2.621, 2.625, 2.628, 2.631, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.622, 2.623, 2.622, 2.622, 2.621, 2.619, 2.619, 2.619, 2.618, 2.616, 2.614, 2.613, 2.611, 2.609, 2.608, 2.606, 2.607, 2.607, 2.609, 2.611, 2.615, 2.617, 2.619, 2.622, 2.626, 2.629, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.622, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.614, 2.613, 2.611, 2.611, 2.607, 2.606, 2.605, 2.604, 2.605, 2.607, 2.609, 2.613, 2.616, 2.619, 2.622, 2.627, 2.631, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.613, 2.609, 2.607, 2.604, 2.602, 2.601, 2.602, 2.603, 2.605, 2.609, 2.612, 2.616, 2.619, 2.624, 2.628, 2.631, 2.632, 2.633, 2.629, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.615, 2.614, 2.612, 2.608, 2.603, 2.601, 2.598, 2.597, 2.599, 2.602, 2.605, 2.608, 2.611, 2.615, 2.622, 2.625, 2.629, 2.631, 2.631, 2.633, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.616, 2.614, 2.611, 2.606, 2.601, 2.598, 2.595, 2.595, 2.597, 2.601, 2.604, 2.608, 2.612, 2.615, 2.623, 2.627, 2.629, 2.631, 2.631, 2.632, 2.631, 2.628, 2.628, 2.651,
+                            2.622, 2.623, 2.624, 2.624, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.609, 2.606, 2.601, 2.596, 2.594, 2.594, 2.596, 2.599, 2.603, 2.609, 2.613, 2.617, 2.623, 2.627, 2.629, 2.631, 2.632, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.623, 2.625, 2.625, 2.624, 2.621, 2.621, 2.619, 2.617, 2.616, 2.613, 2.608, 2.605, 2.601, 2.595, 2.593, 2.593, 2.595, 2.598, 2.604, 2.609, 2.615, 2.619, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.632, 2.629, 2.631, 2.651,
+                            2.624, 2.626, 2.626, 2.623, 2.621, 2.619, 2.618, 2.617, 2.615, 2.612, 2.608, 2.605, 2.601, 2.597, 2.595, 2.595, 2.596, 2.598, 2.605, 2.609, 2.616, 2.621, 2.626, 2.627, 2.629, 2.631, 2.633, 2.633, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.618, 2.617, 2.614, 2.612, 2.609, 2.606, 2.602, 2.599, 2.598, 2.597, 2.598, 2.602, 2.607, 2.612, 2.619, 2.621, 2.626, 2.628, 2.629, 2.632, 2.633, 2.634, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.621, 2.618, 2.617, 2.614, 2.612, 2.611, 2.608, 2.604, 2.602, 2.599, 2.599, 2.603, 2.606, 2.611, 2.616, 2.621, 2.624, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.634, 2.633, 2.633, 2.656,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.611, 2.611, 2.607, 2.604, 2.604, 2.604, 2.606, 2.609, 2.613, 2.619, 2.622, 2.625, 2.628, 2.631, 2.632, 2.633, 2.633, 2.636, 2.636, 2.634, 2.634, 2.658,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.619, 2.618, 2.616, 2.614, 2.613, 2.612, 2.611, 2.609, 2.608, 2.607, 2.608, 2.609, 2.613, 2.617, 2.621, 2.623, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.635, 2.636, 2.636, 2.636, 2.661,
+                            2.623, 2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.616, 2.615, 2.614, 2.613, 2.612, 2.612, 2.611, 2.611, 2.611, 2.614, 2.615, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.633, 2.635, 2.635, 2.637, 2.637, 2.636, 2.637, 2.661,
+                            2.623, 2.624, 2.625, 2.626, 2.624, 2.621, 2.619, 2.617, 2.616, 2.615, 2.615, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.619, 2.621, 2.623, 2.626, 2.628, 2.631, 2.632, 2.634, 2.635, 2.636, 2.637, 2.638, 2.637, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.627, 2.626, 2.623, 2.619, 2.619, 2.618, 2.618, 2.618, 2.617, 2.617, 2.616, 2.616, 2.616, 2.619, 2.622, 2.623, 2.625, 2.628, 2.628, 2.631, 2.632, 2.634, 2.636, 2.638, 2.639, 2.639, 2.638, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.628, 2.626, 2.623, 2.621, 2.619, 2.619, 2.619, 2.619, 2.619, 2.619, 2.618, 2.618, 2.619, 2.623, 2.624, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.635, 2.638, 2.639, 2.639, 2.639, 2.636, 2.636, 2.662,
+                            2.625, 2.627, 2.628, 2.628, 2.626, 2.624, 2.623, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.624, 2.624, 2.625, 2.627, 2.628, 2.631, 2.631, 2.632, 2.634, 2.636, 2.639, 2.639, 2.641, 2.639, 2.635, 2.635, 2.663,
+                            2.625, 2.626, 2.628, 2.628, 2.627, 2.625, 2.624, 2.623, 2.623, 2.622, 2.623, 2.624, 2.624, 2.625, 2.625, 2.625, 2.625, 2.626, 2.627, 2.629, 2.631, 2.632, 2.633, 2.635, 2.638, 2.641, 2.642, 2.643, 2.642, 2.636, 2.636, 2.665,
+                            2.624, 2.626, 2.628, 2.628, 2.628, 2.626, 2.624, 2.624, 2.623, 2.623, 2.623, 2.625, 2.627, 2.627, 2.626, 2.626, 2.626, 2.627, 2.628, 2.629, 2.632, 2.633, 2.635, 2.637, 2.639, 2.642, 2.644, 2.644, 2.642, 2.638, 2.638, 2.665,
+                            2.623, 2.625, 2.626, 2.627, 2.626, 2.626, 2.624, 2.623, 2.623, 2.623, 2.623, 2.623, 2.626, 2.627, 2.626, 2.626, 2.626, 2.626, 2.628, 2.628, 2.629, 2.631, 2.634, 2.636, 2.639, 2.642, 2.644, 2.643, 2.641, 2.637, 2.638, 2.659,
+                            2.623, 2.627, 2.627, 2.627, 2.627, 2.628, 2.627, 2.624, 2.624, 2.623, 2.624, 2.624, 2.628, 2.628, 2.627, 2.628, 2.628, 2.628, 2.629, 2.629, 2.631, 2.635, 2.637, 2.639, 2.641, 2.643, 2.646, 2.645, 2.643, 2.641, 2.654, 2.659,
+                            2.642, 2.641, 2.643, 2.645, 2.645, 2.644, 2.644, 2.643, 2.643, 2.642, 2.642, 2.642, 2.643, 2.644, 2.644, 2.644, 2.646, 2.646, 2.647, 2.649, 2.651, 2.652, 2.654, 2.656, 2.658, 2.661, 2.661, 2.661, 2.659, 2.654, 2.659, 2.659
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.391, 1.394, 1.395, 1.396, 1.398, 1.398, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.398, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.399, 1.397, 1.399, 1.402,
+                            1.393, 1.395, 1.396, 1.398, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.401, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.399, 1.401, 1.401, 1.399, 1.398, 1.399, 1.402,
+                            1.398, 1.401, 1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.401, 1.401, 1.399, 1.399, 1.401, 1.401, 1.401, 1.401, 1.399, 1.401, 1.406,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.402, 1.403, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.405, 1.404, 1.404, 1.404, 1.404, 1.405, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.406, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.408, 1.408, 1.407, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.403, 1.402, 1.402, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.408, 1.407, 1.405, 1.405, 1.414,
+                            1.402, 1.402, 1.402, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.403, 1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.407, 1.409, 1.409, 1.409, 1.409, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.403, 1.404, 1.405, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.408, 1.405, 1.405, 1.413,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.402, 1.401, 1.399, 1.398, 1.398, 1.399, 1.399, 1.401, 1.403, 1.404, 1.405, 1.407, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.403, 1.404, 1.405, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.399, 1.401, 1.403, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.398, 1.401, 1.403, 1.406, 1.407, 1.409, 1.409, 1.411, 1.409, 1.409, 1.409, 1.408, 1.407, 1.407, 1.413,
+                            1.403, 1.404, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.404, 1.404, 1.403, 1.402, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.402, 1.404, 1.406, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.414,
+                            1.403, 1.403, 1.404, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.402, 1.401, 1.399, 1.398, 1.398, 1.398, 1.401, 1.403, 1.404, 1.408, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.402, 1.404, 1.406, 1.407, 1.408, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.409, 1.408, 1.408, 1.415,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.406, 1.408, 1.408, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.405, 1.406, 1.407, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.407, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.416,
+                            1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.406, 1.407, 1.407, 1.407, 1.408, 1.409, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.417,
+                            1.402, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.415,
+                            1.402, 1.402, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.405, 1.406, 1.406, 1.406, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.412, 1.412, 1.413, 1.413, 1.411, 1.408, 1.411, 1.413,
+                            1.406, 1.406, 1.408, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.414, 1.414, 1.414, 1.414, 1.415, 1.415, 1.415, 1.415, 1.416, 1.416, 1.416, 1.417, 1.418, 1.418, 1.417, 1.417, 1.414, 1.411, 1.413, 1.413
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.554, 1.522, 1.466, 1.422, 1.385, 1.351, 1.322, 1.294, 1.269, 1.246, 1.228, 1.214, 1.207, 1.202, 1.199, 1.199, 1.199, 1.199, 1.202, 1.207, 1.218, 1.235, 1.255, 1.279, 1.305, 1.333, 1.365, 1.402, 1.447, 1.508, 1.602, 1.638,
+                    1.522, 1.478, 1.431, 1.391, 1.355, 1.323, 1.298, 1.271, 1.247, 1.228, 1.212, 1.199, 1.187, 1.179, 1.173, 1.172, 1.172, 1.174, 1.179, 1.189, 1.201, 1.216, 1.235, 1.256, 1.282, 1.308, 1.335, 1.368, 1.411, 1.461, 1.535, 1.602,
+                    1.479, 1.449, 1.407, 1.367, 1.332, 1.301, 1.271, 1.247, 1.226, 1.208, 1.191, 1.178, 1.166, 1.158, 1.153, 1.151, 1.151, 1.153, 1.159, 1.168, 1.179, 1.194, 1.212, 1.234, 1.256, 1.282, 1.311, 1.343, 1.382, 1.427, 1.489, 1.535,
+                    1.454, 1.423, 1.383, 1.345, 1.309, 1.278, 1.249, 1.226, 1.206, 1.187, 1.171, 1.158, 1.146, 1.138, 1.132, 1.129, 1.129, 1.133, 1.139, 1.147, 1.159, 1.173, 1.191, 1.212, 1.234, 1.261, 1.288, 1.321, 1.357, 1.401, 1.455, 1.489,
+                    1.433, 1.401, 1.362, 1.325, 1.289, 1.258, 1.231, 1.206, 1.187, 1.169, 1.153, 1.138, 1.129, 1.121, 1.115, 1.112, 1.112, 1.114, 1.121, 1.129, 1.141, 1.155, 1.172, 1.191, 1.214, 1.241, 1.269, 1.301, 1.337, 1.377, 1.428, 1.457,
+                    1.415, 1.382, 1.343, 1.306, 1.273, 1.241, 1.213, 1.189, 1.169, 1.153, 1.137, 1.123, 1.112, 1.105, 1.097, 1.095, 1.095, 1.098, 1.103, 1.112, 1.124, 1.139, 1.155, 1.173, 1.197, 1.222, 1.252, 1.282, 1.317, 1.356, 1.405, 1.434,
+                    1.398, 1.363, 1.325, 1.289, 1.256, 1.224, 1.198, 1.175, 1.155, 1.137, 1.123, 1.108, 1.097, 1.089, 1.083, 1.079, 1.079, 1.083, 1.088, 1.097, 1.109, 1.124, 1.139, 1.158, 1.181, 1.206, 1.234, 1.266, 1.299, 1.339, 1.384, 1.415,
+                    1.382, 1.347, 1.309, 1.274, 1.242, 1.211, 1.185, 1.162, 1.142, 1.124, 1.108, 1.095, 1.083, 1.075, 1.069, 1.066, 1.066, 1.068, 1.074, 1.083, 1.096, 1.109, 1.125, 1.145, 1.166, 1.191, 1.219, 1.251, 1.285, 1.324, 1.367, 1.399,
+                    1.369, 1.334, 1.296, 1.261, 1.228, 1.199, 1.173, 1.151, 1.131, 1.112, 1.095, 1.083, 1.071, 1.062, 1.056, 1.053, 1.053, 1.055, 1.061, 1.069, 1.083, 1.096, 1.112, 1.132, 1.153, 1.178, 1.206, 1.237, 1.271, 1.309, 1.353, 1.385,
+                    1.359, 1.321, 1.284, 1.251, 1.217, 1.189, 1.164, 1.141, 1.121, 1.102, 1.086, 1.071, 1.061, 1.049, 1.045, 1.042, 1.042, 1.043, 1.051, 1.061, 1.069, 1.085, 1.101, 1.121, 1.143, 1.167, 1.195, 1.225, 1.259, 1.298, 1.341, 1.375,
+                    1.351, 1.312, 1.275, 1.241, 1.209, 1.181, 1.155, 1.133, 1.112, 1.092, 1.076, 1.061, 1.049, 1.041, 1.034, 1.032, 1.032, 1.035, 1.041, 1.051, 1.061, 1.075, 1.092, 1.112, 1.133, 1.158, 1.185, 1.216, 1.249, 1.288, 1.331, 1.364,
+                    1.344, 1.303, 1.267, 1.233, 1.201, 1.173, 1.147, 1.124, 1.104, 1.085, 1.067, 1.053, 1.041, 1.033, 1.024, 1.022, 1.022, 1.025, 1.034, 1.041, 1.053, 1.066, 1.083, 1.103, 1.126, 1.149, 1.177, 1.207, 1.241, 1.279, 1.321, 1.357,
+                    1.339, 1.297, 1.261, 1.226, 1.194, 1.166, 1.142, 1.119, 1.098, 1.078, 1.061, 1.046, 1.034, 1.024, 1.017, 1.014, 1.014, 1.017, 1.025, 1.034, 1.046, 1.059, 1.077, 1.096, 1.118, 1.143, 1.169, 1.201, 1.235, 1.273, 1.314, 1.352,
+                    1.337, 1.293, 1.256, 1.223, 1.191, 1.163, 1.136, 1.114, 1.093, 1.074, 1.056, 1.041, 1.027, 1.017, 1.012, 1.006, 1.006, 1.013, 1.017, 1.028, 1.041, 1.055, 1.072, 1.092, 1.114, 1.138, 1.165, 1.195, 1.229, 1.268, 1.309, 1.348,
+                    1.337, 1.291, 1.253, 1.219, 1.187, 1.159, 1.133, 1.109, 1.089, 1.071, 1.053, 1.037, 1.023, 1.012, 1.006, 1.002, 1.003, 1.006, 1.013, 1.023, 1.038, 1.052, 1.069, 1.089, 1.111, 1.135, 1.161, 1.192, 1.226, 1.264, 1.306, 1.348,
+                    1.337, 1.291, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.035, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.341, 1.292, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.034, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.348, 1.298, 1.255, 1.219, 1.188, 1.159, 1.134, 1.111, 1.088, 1.069, 1.051, 1.035, 1.021, 1.009, 1.003, 1.001, 1.002, 1.004, 1.011, 1.022, 1.036, 1.053, 1.071, 1.089, 1.111, 1.135, 1.162, 1.191, 1.226, 1.264, 1.306, 1.347,
+                    1.354, 1.306, 1.258, 1.222, 1.191, 1.162, 1.135, 1.113, 1.092, 1.073, 1.054, 1.038, 1.024, 1.014, 1.008, 1.003, 1.004, 1.008, 1.014, 1.026, 1.039, 1.056, 1.073, 1.093, 1.115, 1.139, 1.165, 1.195, 1.229, 1.267, 1.309, 1.349,
+                    1.358, 1.312, 1.263, 1.227, 1.195, 1.167, 1.141, 1.117, 1.097, 1.078, 1.061, 1.043, 1.029, 1.021, 1.014, 1.008, 1.008, 1.014, 1.021, 1.032, 1.045, 1.061, 1.078, 1.097, 1.119, 1.144, 1.169, 1.201, 1.234, 1.272, 1.315, 1.353,
+                    1.364, 1.319, 1.269, 1.234, 1.201, 1.174, 1.148, 1.124, 1.103, 1.084, 1.067, 1.052, 1.038, 1.029, 1.021, 1.016, 1.016, 1.021, 1.029, 1.038, 1.051, 1.067, 1.084, 1.103, 1.126, 1.151, 1.176, 1.207, 1.241, 1.279, 1.321, 1.358,
+                    1.371, 1.326, 1.277, 1.242, 1.209, 1.181, 1.155, 1.132, 1.111, 1.092, 1.075, 1.061, 1.049, 1.038, 1.029, 1.027, 1.027, 1.029, 1.038, 1.047, 1.061, 1.075, 1.092, 1.111, 1.133, 1.157, 1.185, 1.213, 1.247, 1.286, 1.329, 1.365,
+                    1.379, 1.334, 1.287, 1.251, 1.219, 1.191, 1.164, 1.141, 1.119, 1.101, 1.085, 1.071, 1.061, 1.049, 1.041, 1.038, 1.038, 1.041, 1.047, 1.059, 1.071, 1.084, 1.101, 1.119, 1.141, 1.165, 1.193, 1.223, 1.257, 1.295, 1.338, 1.374,
+                    1.389, 1.343, 1.298, 1.262, 1.231, 1.201, 1.174, 1.151, 1.131, 1.111, 1.095, 1.083, 1.071, 1.061, 1.054, 1.051, 1.051, 1.054, 1.059, 1.071, 1.081, 1.094, 1.111, 1.129, 1.152, 1.176, 1.203, 1.235, 1.269, 1.307, 1.351, 1.384,
+                    1.401, 1.351, 1.311, 1.274, 1.242, 1.214, 1.187, 1.164, 1.142, 1.124, 1.108, 1.095, 1.083, 1.074, 1.068, 1.066, 1.066, 1.068, 1.073, 1.081, 1.094, 1.108, 1.123, 1.141, 1.164, 1.188, 1.215, 1.247, 1.281, 1.321, 1.364, 1.396,
+                    1.412, 1.366, 1.327, 1.289, 1.257, 1.227, 1.201, 1.176, 1.156, 1.137, 1.122, 1.108, 1.096, 1.088, 1.083, 1.081, 1.081, 1.082, 1.087, 1.095, 1.108, 1.122, 1.136, 1.154, 1.177, 1.201, 1.229, 1.261, 1.296, 1.337, 1.382, 1.409,
+                    1.421, 1.383, 1.343, 1.306, 1.273, 1.243, 1.216, 1.192, 1.169, 1.152, 1.137, 1.122, 1.111, 1.103, 1.098, 1.095, 1.095, 1.097, 1.102, 1.111, 1.123, 1.136, 1.152, 1.169, 1.191, 1.217, 1.246, 1.278, 1.314, 1.354, 1.399, 1.429,
+                    1.434, 1.402, 1.362, 1.324, 1.291, 1.261, 1.232, 1.208, 1.187, 1.168, 1.152, 1.138, 1.127, 1.119, 1.114, 1.112, 1.112, 1.115, 1.121, 1.128, 1.139, 1.152, 1.169, 1.186, 1.209, 1.234, 1.262, 1.295, 1.332, 1.372, 1.419, 1.451,
+                    1.453, 1.422, 1.382, 1.344, 1.309, 1.278, 1.249, 1.226, 1.204, 1.187, 1.168, 1.155, 1.144, 1.135, 1.131, 1.131, 1.131, 1.133, 1.138, 1.146, 1.157, 1.171, 1.186, 1.206, 1.227, 1.252, 1.281, 1.314, 1.351, 1.393, 1.442, 1.473,
+                    1.475, 1.446, 1.404, 1.366, 1.329, 1.298, 1.269, 1.245, 1.224, 1.204, 1.188, 1.174, 1.163, 1.154, 1.149, 1.148, 1.148, 1.152, 1.156, 1.164, 1.176, 1.189, 1.206, 1.226, 1.247, 1.274, 1.303, 1.336, 1.374, 1.417, 1.471, 1.505,
+                    1.503, 1.472, 1.428, 1.389, 1.353, 1.321, 1.291, 1.266, 1.245, 1.224, 1.207, 1.192, 1.183, 1.174, 1.169, 1.167, 1.168, 1.169, 1.175, 1.183, 1.195, 1.209, 1.226, 1.247, 1.267, 1.294, 1.325, 1.359, 1.397, 1.445, 1.505, 1.548,
+                    1.534, 1.503, 1.455, 1.413, 1.378, 1.344, 1.315, 1.289, 1.265, 1.243, 1.224, 1.207, 1.196, 1.192, 1.189, 1.189, 1.189, 1.189, 1.192, 1.198, 1.209, 1.226, 1.244, 1.266, 1.291, 1.318, 1.349, 1.383, 1.425, 1.475, 1.548, 1.591
+                ],
+                "sigma": 0.00095,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2850,
+                        "ccm":
+                        [
+                            1.97469, -0.71439, -0.26031,
+                            -0.43521, 2.09769, -0.66248,
+                            -0.04826, -0.84642, 1.89468
+                        ]
+                    },
+                    {
+                        "ct": 2960,
+                        "ccm":
+                        [
+                            2.12952, -0.91185, -0.21768,
+                            -0.38018, 1.90789, -0.52771,
+                            0.03988, -1.10079, 2.06092
+                        ]
+                    },
+                    {
+                        "ct": 3580,
+                        "ccm":
+                        [
+                            2.03422, -0.80048, -0.23374,
+                            -0.39089, 1.97221, -0.58132,
+                            -0.08969, -0.61439, 1.70408
+                        ]
+                    },
+                    {
+                        "ct": 4559,
+                        "ccm":
+                        [
+                            2.15423, -0.98143, -0.17279,
+                            -0.38131, 2.14763, -0.76632,
+                            -0.10069, -0.54383, 1.64452
+                        ]
+                    },
+                    {
+                        "ct": 5881,
+                        "ccm":
+                        [
+                            2.18464, -0.95493, -0.22971,
+                            -0.36826, 2.00298, -0.63471,
+                            -0.15219, -0.38055, 1.53274
+                        ]
+                    },
+                    {
+                        "ct": 7600,
+                        "ccm":
+                        [
+                            2.30687, -0.97295, -0.33392,
+                            -0.30872, 2.32779, -1.01908,
+                            -0.17761, -0.55891, 1.73651
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx477_16mm.json b/src/ipa/rpi/pisp/data/imx477_16mm.json
new file mode 100644
index 000000000..f4e65c92c
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx477_16mm.json
@@ -0,0 +1,1240 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 12000,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 740,
+                "reference_Y": 15051
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.809
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 204,
+                "slope": 0.0061
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2850.0, 0.4307, 0.3957,
+                    2960.0, 0.4159, 0.4313,
+                    3580.0, 0.3771, 0.5176,
+                    4559.0, 0.3031, 0.6573,
+                    5881.0, 0.2809, 0.6942,
+                    7600.0, 0.2263, 0.7762
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.02634,
+                "transverse_neg": 0.02255
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.359, 2.354, 2.351, 2.351, 2.343, 2.337, 2.331, 2.325, 2.323, 2.321, 2.317, 2.315, 2.313, 2.313, 2.311, 2.312, 2.312, 2.313, 2.315, 2.315, 2.316, 2.317, 2.319, 2.323, 2.326, 2.329, 2.332, 2.332, 2.335, 2.337, 2.352, 2.363,
+                            2.352, 2.351, 2.349, 2.346, 2.342, 2.334, 2.328, 2.324, 2.321, 2.317, 2.315, 2.314, 2.312, 2.311, 2.311, 2.311, 2.311, 2.311, 2.312, 2.314, 2.315, 2.316, 2.317, 2.319, 2.324, 2.326, 2.328, 2.329, 2.331, 2.337, 2.348, 2.355,
+                            2.346, 2.346, 2.345, 2.344, 2.338, 2.329, 2.325, 2.319, 2.316, 2.314, 2.311, 2.309, 2.308, 2.306, 2.304, 2.304, 2.305, 2.307, 2.308, 2.309, 2.311, 2.311, 2.313, 2.316, 2.319, 2.322, 2.325, 2.326, 2.328, 2.335, 2.343, 2.349,
+                            2.342, 2.342, 2.341, 2.338, 2.332, 2.326, 2.319, 2.316, 2.312, 2.309, 2.308, 2.305, 2.303, 2.302, 2.301, 2.301, 2.302, 2.303, 2.304, 2.305, 2.305, 2.307, 2.311, 2.313, 2.315, 2.319, 2.321, 2.325, 2.328, 2.333, 2.338, 2.348,
+                            2.337, 2.337, 2.337, 2.336, 2.331, 2.322, 2.317, 2.312, 2.309, 2.307, 2.304, 2.302, 2.299, 2.299, 2.298, 2.298, 2.299, 2.299, 2.301, 2.302, 2.302, 2.304, 2.305, 2.309, 2.314, 2.316, 2.321, 2.324, 2.326, 2.329, 2.335, 2.343,
+                            2.335, 2.334, 2.333, 2.333, 2.326, 2.318, 2.313, 2.309, 2.306, 2.302, 2.299, 2.297, 2.297, 2.296, 2.295, 2.295, 2.294, 2.295, 2.296, 2.298, 2.298, 2.301, 2.303, 2.305, 2.311, 2.315, 2.319, 2.323, 2.325, 2.329, 2.333, 2.339,
+                            2.329, 2.331, 2.329, 2.329, 2.325, 2.315, 2.309, 2.306, 2.302, 2.299, 2.297, 2.295, 2.293, 2.292, 2.291, 2.291, 2.291, 2.291, 2.293, 2.294, 2.296, 2.298, 2.301, 2.304, 2.307, 2.313, 2.317, 2.319, 2.323, 2.327, 2.331, 2.339,
+                            2.329, 2.328, 2.328, 2.328, 2.321, 2.313, 2.307, 2.303, 2.299, 2.295, 2.294, 2.292, 2.289, 2.289, 2.288, 2.288, 2.288, 2.289, 2.289, 2.292, 2.294, 2.295, 2.297, 2.301, 2.306, 2.311, 2.315, 2.318, 2.319, 2.323, 2.329, 2.335,
+                            2.326, 2.327, 2.325, 2.325, 2.319, 2.311, 2.305, 2.299, 2.296, 2.293, 2.291, 2.289, 2.288, 2.287, 2.285, 2.285, 2.286, 2.288, 2.288, 2.289, 2.291, 2.294, 2.295, 2.298, 2.304, 2.308, 2.313, 2.315, 2.317, 2.319, 2.327, 2.335,
+                            2.325, 2.325, 2.323, 2.323, 2.317, 2.309, 2.303, 2.298, 2.294, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.284, 2.284, 2.285, 2.287, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.305, 2.309, 2.313, 2.315, 2.317, 2.325, 2.334,
+                            2.322, 2.324, 2.322, 2.322, 2.316, 2.306, 2.301, 2.296, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.283, 2.283, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.293, 2.296, 2.301, 2.304, 2.308, 2.311, 2.312, 2.315, 2.323, 2.333,
+                            2.321, 2.323, 2.322, 2.322, 2.314, 2.306, 2.299, 2.294, 2.291, 2.288, 2.286, 2.285, 2.284, 2.282, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.306, 2.308, 2.311, 2.312, 2.322, 2.332,
+                            2.319, 2.321, 2.321, 2.321, 2.314, 2.305, 2.297, 2.293, 2.289, 2.287, 2.285, 2.284, 2.283, 2.281, 2.281, 2.281, 2.282, 2.283, 2.283, 2.285, 2.287, 2.289, 2.291, 2.292, 2.297, 2.301, 2.305, 2.307, 2.309, 2.312, 2.321, 2.333,
+                            2.319, 2.321, 2.319, 2.319, 2.314, 2.303, 2.296, 2.293, 2.289, 2.286, 2.285, 2.283, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.296, 2.301, 2.305, 2.307, 2.308, 2.312, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.296, 2.291, 2.289, 2.286, 2.284, 2.282, 2.281, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.287, 2.288, 2.291, 2.295, 2.299, 2.304, 2.306, 2.307, 2.311, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.287, 2.285, 2.282, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.284, 2.285, 2.286, 2.288, 2.291, 2.295, 2.299, 2.303, 2.306, 2.307, 2.312, 2.321, 2.331,
+                            2.318, 2.319, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.286, 2.285, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.285, 2.286, 2.287, 2.291, 2.294, 2.298, 2.303, 2.306, 2.307, 2.311, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.302, 2.297, 2.292, 2.289, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.287, 2.289, 2.294, 2.297, 2.303, 2.305, 2.308, 2.313, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.303, 2.299, 2.293, 2.291, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.288, 2.291, 2.294, 2.298, 2.304, 2.306, 2.308, 2.312, 2.322, 2.331,
+                            2.319, 2.321, 2.321, 2.321, 2.315, 2.305, 2.301, 2.295, 2.292, 2.289, 2.286, 2.285, 2.283, 2.282, 2.282, 2.282, 2.284, 2.283, 2.284, 2.284, 2.285, 2.287, 2.288, 2.291, 2.294, 2.299, 2.304, 2.306, 2.309, 2.313, 2.322, 2.334,
+                            2.321, 2.322, 2.322, 2.322, 2.317, 2.307, 2.301, 2.296, 2.292, 2.291, 2.288, 2.286, 2.285, 2.284, 2.283, 2.284, 2.285, 2.284, 2.285, 2.285, 2.287, 2.288, 2.289, 2.293, 2.297, 2.301, 2.305, 2.308, 2.311, 2.314, 2.323, 2.335,
+                            2.322, 2.324, 2.324, 2.324, 2.319, 2.309, 2.303, 2.297, 2.295, 2.292, 2.291, 2.288, 2.286, 2.286, 2.285, 2.286, 2.286, 2.286, 2.287, 2.288, 2.289, 2.289, 2.291, 2.294, 2.299, 2.302, 2.307, 2.311, 2.312, 2.316, 2.325, 2.335,
+                            2.324, 2.326, 2.325, 2.326, 2.321, 2.311, 2.305, 2.301, 2.297, 2.295, 2.293, 2.291, 2.289, 2.289, 2.288, 2.288, 2.287, 2.288, 2.289, 2.291, 2.292, 2.292, 2.295, 2.299, 2.301, 2.304, 2.309, 2.312, 2.315, 2.319, 2.327, 2.337,
+                            2.329, 2.329, 2.328, 2.328, 2.323, 2.315, 2.308, 2.304, 2.301, 2.298, 2.296, 2.294, 2.291, 2.291, 2.289, 2.291, 2.291, 2.291, 2.292, 2.293, 2.294, 2.295, 2.297, 2.299, 2.303, 2.308, 2.312, 2.315, 2.318, 2.321, 2.329, 2.339,
+                            2.329, 2.331, 2.332, 2.332, 2.326, 2.318, 2.311, 2.306, 2.304, 2.301, 2.299, 2.297, 2.295, 2.293, 2.292, 2.292, 2.292, 2.293, 2.294, 2.294, 2.296, 2.297, 2.299, 2.302, 2.306, 2.311, 2.315, 2.318, 2.319, 2.324, 2.332, 2.342,
+                            2.331, 2.333, 2.334, 2.334, 2.328, 2.321, 2.313, 2.308, 2.305, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.295, 2.294, 2.296, 2.296, 2.297, 2.298, 2.299, 2.302, 2.305, 2.308, 2.314, 2.317, 2.321, 2.323, 2.327, 2.334, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.309, 2.306, 2.304, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.309, 2.315, 2.319, 2.321, 2.324, 2.328, 2.337, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.311, 2.306, 2.304, 2.303, 2.302, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.311, 2.314, 2.319, 2.323, 2.325, 2.329, 2.339, 2.348,
+                            2.329, 2.329, 2.329, 2.331, 2.326, 2.319, 2.312, 2.309, 2.304, 2.303, 2.302, 2.301, 2.298, 2.295, 2.294, 2.294, 2.295, 2.295, 2.296, 2.297, 2.299, 2.301, 2.302, 2.304, 2.308, 2.313, 2.319, 2.322, 2.325, 2.329, 2.339, 2.351,
+                            2.329, 2.329, 2.329, 2.329, 2.326, 2.317, 2.311, 2.308, 2.303, 2.302, 2.301, 2.298, 2.296, 2.295, 2.294, 2.294, 2.294, 2.294, 2.296, 2.297, 2.298, 2.299, 2.301, 2.304, 2.307, 2.312, 2.318, 2.322, 2.326, 2.331, 2.341, 2.355,
+                            2.339, 2.332, 2.331, 2.331, 2.327, 2.323, 2.316, 2.309, 2.306, 2.302, 2.301, 2.299, 2.297, 2.296, 2.295, 2.294, 2.294, 2.296, 2.297, 2.297, 2.299, 2.301, 2.303, 2.306, 2.308, 2.317, 2.322, 2.325, 2.329, 2.341, 2.353, 2.361,
+                            2.347, 2.347, 2.345, 2.343, 2.338, 2.332, 2.326, 2.322, 2.321, 2.318, 2.316, 2.315, 2.313, 2.312, 2.311, 2.311, 2.311, 2.311, 2.312, 2.315, 2.317, 2.318, 2.319, 2.323, 2.324, 2.329, 2.334, 2.337, 2.344, 2.347, 2.361, 2.364
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.869, 3.852, 3.844, 3.842, 3.836, 3.821, 3.807, 3.796, 3.789, 3.784, 3.778, 3.775, 3.769, 3.768, 3.765, 3.765, 3.767, 3.769, 3.772, 3.774, 3.773, 3.775, 3.779, 3.787, 3.793, 3.801, 3.806, 3.804, 3.813, 3.819, 3.855, 3.879,
+                            3.854, 3.844, 3.837, 3.836, 3.824, 3.811, 3.797, 3.789, 3.784, 3.777, 3.774, 3.769, 3.764, 3.758, 3.757, 3.758, 3.758, 3.761, 3.763, 3.764, 3.765, 3.766, 3.772, 3.778, 3.787, 3.792, 3.794, 3.798, 3.802, 3.815, 3.839, 3.873,
+                            3.838, 3.831, 3.826, 3.823, 3.813, 3.799, 3.787, 3.781, 3.773, 3.768, 3.763, 3.759, 3.753, 3.749, 3.745, 3.745, 3.745, 3.752, 3.754, 3.757, 3.757, 3.759, 3.763, 3.769, 3.773, 3.781, 3.786, 3.792, 3.798, 3.811, 3.831, 3.861,
+                            3.833, 3.822, 3.817, 3.816, 3.804, 3.788, 3.779, 3.772, 3.766, 3.759, 3.755, 3.749, 3.744, 3.741, 3.738, 3.739, 3.739, 3.741, 3.743, 3.747, 3.749, 3.751, 3.756, 3.764, 3.769, 3.776, 3.783, 3.789, 3.798, 3.809, 3.821, 3.855,
+                            3.824, 3.818, 3.808, 3.808, 3.797, 3.781, 3.772, 3.764, 3.757, 3.752, 3.747, 3.743, 3.737, 3.735, 3.733, 3.733, 3.733, 3.735, 3.737, 3.738, 3.741, 3.746, 3.749, 3.755, 3.766, 3.771, 3.781, 3.789, 3.794, 3.806, 3.818, 3.849,
+                            3.815, 3.808, 3.799, 3.801, 3.787, 3.775, 3.767, 3.757, 3.751, 3.745, 3.738, 3.734, 3.732, 3.727, 3.725, 3.723, 3.722, 3.722, 3.726, 3.729, 3.734, 3.738, 3.744, 3.749, 3.759, 3.769, 3.781, 3.788, 3.792, 3.799, 3.811, 3.841,
+                            3.804, 3.799, 3.793, 3.793, 3.783, 3.771, 3.759, 3.751, 3.744, 3.735, 3.732, 3.727, 3.723, 3.721, 3.719, 3.716, 3.716, 3.716, 3.718, 3.722, 3.727, 3.731, 3.737, 3.746, 3.756, 3.767, 3.776, 3.782, 3.788, 3.795, 3.808, 3.831,
+                            3.802, 3.797, 3.787, 3.787, 3.779, 3.762, 3.753, 3.744, 3.734, 3.727, 3.725, 3.721, 3.716, 3.714, 3.709, 3.709, 3.711, 3.711, 3.712, 3.717, 3.722, 3.725, 3.731, 3.739, 3.752, 3.762, 3.772, 3.778, 3.779, 3.789, 3.798, 3.826,
+                            3.791, 3.789, 3.784, 3.784, 3.775, 3.759, 3.746, 3.735, 3.729, 3.724, 3.718, 3.714, 3.712, 3.707, 3.704, 3.704, 3.706, 3.708, 3.709, 3.711, 3.716, 3.722, 3.726, 3.735, 3.746, 3.754, 3.767, 3.774, 3.777, 3.781, 3.794, 3.824,
+                            3.789, 3.784, 3.779, 3.781, 3.771, 3.753, 3.741, 3.732, 3.725, 3.719, 3.715, 3.711, 3.707, 3.704, 3.701, 3.701, 3.702, 3.704, 3.708, 3.709, 3.713, 3.718, 3.724, 3.731, 3.742, 3.749, 3.761, 3.768, 3.772, 3.778, 3.791, 3.822,
+                            3.789, 3.781, 3.777, 3.777, 3.764, 3.749, 3.739, 3.729, 3.722, 3.718, 3.711, 3.708, 3.705, 3.701, 3.699, 3.699, 3.699, 3.701, 3.705, 3.707, 3.711, 3.715, 3.721, 3.727, 3.738, 3.746, 3.757, 3.763, 3.765, 3.773, 3.788, 3.821,
+                            3.785, 3.779, 3.774, 3.774, 3.764, 3.747, 3.736, 3.726, 3.719, 3.711, 3.709, 3.706, 3.701, 3.698, 3.696, 3.695, 3.695, 3.698, 3.702, 3.704, 3.707, 3.712, 3.718, 3.725, 3.734, 3.741, 3.753, 3.756, 3.759, 3.764, 3.784, 3.818,
+                            3.779, 3.776, 3.773, 3.773, 3.759, 3.744, 3.733, 3.724, 3.714, 3.709, 3.706, 3.704, 3.699, 3.696, 3.694, 3.694, 3.694, 3.697, 3.701, 3.703, 3.706, 3.709, 3.714, 3.721, 3.731, 3.737, 3.749, 3.753, 3.758, 3.762, 3.783, 3.819,
+                            3.779, 3.776, 3.769, 3.769, 3.757, 3.741, 3.729, 3.721, 3.712, 3.708, 3.705, 3.701, 3.697, 3.695, 3.694, 3.694, 3.695, 3.696, 3.698, 3.702, 3.705, 3.709, 3.712, 3.717, 3.728, 3.736, 3.749, 3.752, 3.756, 3.761, 3.781, 3.815,
+                            3.779, 3.773, 3.768, 3.768, 3.756, 3.738, 3.731, 3.719, 3.711, 3.707, 3.703, 3.698, 3.695, 3.694, 3.694, 3.695, 3.695, 3.695, 3.696, 3.702, 3.705, 3.708, 3.712, 3.717, 3.728, 3.736, 3.747, 3.751, 3.754, 3.761, 3.781, 3.815,
+                            3.782, 3.773, 3.767, 3.767, 3.755, 3.738, 3.728, 3.721, 3.711, 3.707, 3.701, 3.698, 3.695, 3.693, 3.694, 3.696, 3.695, 3.695, 3.695, 3.701, 3.703, 3.706, 3.711, 3.715, 3.726, 3.735, 3.745, 3.751, 3.754, 3.763, 3.779, 3.815,
+                            3.781, 3.771, 3.767, 3.767, 3.754, 3.739, 3.726, 3.721, 3.712, 3.706, 3.701, 3.698, 3.695, 3.693, 3.693, 3.695, 3.695, 3.695, 3.696, 3.698, 3.703, 3.705, 3.709, 3.715, 3.725, 3.734, 3.745, 3.751, 3.755, 3.762, 3.783, 3.818,
+                            3.781, 3.774, 3.767, 3.767, 3.755, 3.741, 3.729, 3.722, 3.712, 3.708, 3.701, 3.699, 3.695, 3.693, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.725, 3.732, 3.746, 3.751, 3.756, 3.763, 3.783, 3.821,
+                            3.781, 3.774, 3.769, 3.769, 3.756, 3.741, 3.731, 3.724, 3.713, 3.711, 3.707, 3.699, 3.697, 3.694, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.724, 3.734, 3.747, 3.751, 3.756, 3.765, 3.784, 3.821,
+                            3.784, 3.776, 3.773, 3.773, 3.759, 3.742, 3.733, 3.726, 3.719, 3.711, 3.709, 3.703, 3.698, 3.695, 3.694, 3.695, 3.697, 3.696, 3.698, 3.699, 3.703, 3.706, 3.711, 3.714, 3.727, 3.735, 3.746, 3.751, 3.757, 3.766, 3.787, 3.822,
+                            3.786, 3.783, 3.774, 3.774, 3.766, 3.747, 3.737, 3.727, 3.722, 3.716, 3.711, 3.706, 3.702, 3.698, 3.697, 3.698, 3.699, 3.699, 3.701, 3.703, 3.706, 3.711, 3.713, 3.719, 3.731, 3.739, 3.748, 3.753, 3.761, 3.769, 3.789, 3.826,
+                            3.786, 3.784, 3.779, 3.779, 3.769, 3.751, 3.742, 3.732, 3.725, 3.719, 3.715, 3.711, 3.706, 3.704, 3.701, 3.701, 3.702, 3.702, 3.705, 3.707, 3.712, 3.714, 3.717, 3.724, 3.733, 3.743, 3.749, 3.758, 3.764, 3.769, 3.791, 3.826,
+                            3.793, 3.787, 3.782, 3.782, 3.774, 3.756, 3.747, 3.737, 3.729, 3.725, 3.719, 3.715, 3.712, 3.708, 3.707, 3.706, 3.707, 3.708, 3.709, 3.713, 3.714, 3.717, 3.723, 3.729, 3.736, 3.747, 3.757, 3.764, 3.768, 3.774, 3.794, 3.829,
+                            3.794, 3.791, 3.786, 3.786, 3.779, 3.762, 3.751, 3.742, 3.735, 3.729, 3.725, 3.719, 3.716, 3.711, 3.709, 3.709, 3.709, 3.711, 3.716, 3.717, 3.721, 3.723, 3.726, 3.732, 3.741, 3.752, 3.761, 3.767, 3.773, 3.779, 3.801, 3.829,
+                            3.802, 3.798, 3.793, 3.793, 3.779, 3.766, 3.754, 3.746, 3.741, 3.736, 3.731, 3.726, 3.719, 3.717, 3.716, 3.715, 3.716, 3.717, 3.719, 3.721, 3.724, 3.726, 3.731, 3.737, 3.744, 3.756, 3.766, 3.772, 3.776, 3.784, 3.807, 3.839,
+                            3.805, 3.799, 3.795, 3.795, 3.784, 3.767, 3.757, 3.749, 3.744, 3.739, 3.736, 3.731, 3.726, 3.722, 3.719, 3.719, 3.719, 3.721, 3.723, 3.725, 3.727, 3.732, 3.738, 3.742, 3.751, 3.761, 3.771, 3.775, 3.782, 3.789, 3.811, 3.841,
+                            3.804, 3.801, 3.799, 3.799, 3.787, 3.772, 3.761, 3.752, 3.746, 3.742, 3.739, 3.735, 3.729, 3.726, 3.723, 3.724, 3.725, 3.726, 3.727, 3.728, 3.732, 3.736, 3.739, 3.745, 3.754, 3.765, 3.775, 3.779, 3.785, 3.795, 3.816, 3.844,
+                            3.801, 3.799, 3.796, 3.796, 3.787, 3.773, 3.761, 3.753, 3.746, 3.743, 3.739, 3.735, 3.731, 3.726, 3.725, 3.725, 3.725, 3.726, 3.727, 3.729, 3.733, 3.736, 3.741, 3.745, 3.755, 3.766, 3.776, 3.783, 3.786, 3.797, 3.819, 3.851,
+                            3.799, 3.795, 3.788, 3.788, 3.783, 3.772, 3.759, 3.749, 3.744, 3.738, 3.735, 3.733, 3.726, 3.724, 3.722, 3.722, 3.723, 3.724, 3.725, 3.727, 3.729, 3.733, 3.736, 3.742, 3.754, 3.762, 3.772, 3.779, 3.784, 3.796, 3.821, 3.859,
+                            3.799, 3.789, 3.787, 3.788, 3.779, 3.766, 3.755, 3.749, 3.742, 3.736, 3.733, 3.727, 3.723, 3.722, 3.721, 3.719, 3.719, 3.721, 3.725, 3.726, 3.728, 3.732, 3.734, 3.741, 3.747, 3.758, 3.771, 3.778, 3.785, 3.796, 3.825, 3.862,
+                            3.824, 3.799, 3.789, 3.789, 3.788, 3.777, 3.761, 3.751, 3.743, 3.739, 3.736, 3.728, 3.726, 3.725, 3.721, 3.719, 3.721, 3.723, 3.727, 3.728, 3.729, 3.733, 3.737, 3.744, 3.755, 3.769, 3.776, 3.784, 3.793, 3.819, 3.863, 3.877,
+                            3.833, 3.833, 3.833, 3.842, 3.825, 3.815, 3.807, 3.799, 3.792, 3.788, 3.785, 3.782, 3.778, 3.777, 3.773, 3.772, 3.772, 3.774, 3.778, 3.779, 3.779, 3.785, 3.792, 3.798, 3.803, 3.811, 3.822, 3.834, 3.843, 3.846, 3.877, 3.886
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.616, 2.616, 2.618, 2.621, 2.619, 2.618, 2.615, 2.615, 2.613, 2.611, 2.609, 2.609, 2.609, 2.611, 2.611, 2.611, 2.611, 2.609, 2.608, 2.608, 2.611, 2.613, 2.613, 2.614, 2.614, 2.615, 2.615, 2.622, 2.624, 2.621, 2.624, 2.641,
+                            2.616, 2.618, 2.621, 2.623, 2.623, 2.619, 2.618, 2.616, 2.616, 2.613, 2.611, 2.611, 2.611, 2.611, 2.612, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.612, 2.613, 2.612, 2.613, 2.615, 2.617, 2.621, 2.621, 2.619, 2.621, 2.641,
+                            2.621, 2.624, 2.627, 2.627, 2.625, 2.623, 2.621, 2.619, 2.618, 2.618, 2.618, 2.617, 2.616, 2.616, 2.615, 2.613, 2.612, 2.613, 2.613, 2.614, 2.614, 2.613, 2.614, 2.613, 2.614, 2.617, 2.619, 2.621, 2.621, 2.619, 2.623, 2.643,
+                            2.626, 2.627, 2.628, 2.629, 2.628, 2.625, 2.622, 2.621, 2.621, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.616, 2.616, 2.616, 2.618, 2.618, 2.617, 2.617, 2.618, 2.619, 2.621, 2.623, 2.624, 2.626, 2.625, 2.624, 2.625, 2.654,
+                            2.627, 2.628, 2.628, 2.628, 2.626, 2.623, 2.622, 2.622, 2.622, 2.622, 2.621, 2.621, 2.619, 2.617, 2.617, 2.616, 2.617, 2.617, 2.618, 2.619, 2.618, 2.618, 2.618, 2.621, 2.622, 2.624, 2.626, 2.627, 2.627, 2.626, 2.628, 2.655,
+                            2.625, 2.626, 2.627, 2.626, 2.625, 2.623, 2.622, 2.621, 2.622, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.616, 2.616, 2.616, 2.616, 2.616, 2.617, 2.618, 2.619, 2.621, 2.622, 2.624, 2.626, 2.628, 2.628, 2.629, 2.629, 2.655,
+                            2.626, 2.625, 2.626, 2.625, 2.625, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.616, 2.614, 2.613, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.618, 2.619, 2.621, 2.623, 2.624, 2.627, 2.629, 2.631, 2.629, 2.631, 2.651,
+                            2.625, 2.625, 2.625, 2.624, 2.623, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.614, 2.613, 2.612, 2.611, 2.611, 2.612, 2.612, 2.613, 2.616, 2.618, 2.619, 2.622, 2.624, 2.626, 2.628, 2.631, 2.631, 2.631, 2.631, 2.651,
+                            2.625, 2.625, 2.624, 2.623, 2.622, 2.622, 2.622, 2.622, 2.622, 2.621, 2.617, 2.615, 2.613, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.613, 2.615, 2.618, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.624, 2.624, 2.622, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.618, 2.616, 2.614, 2.612, 2.611, 2.609, 2.609, 2.608, 2.609, 2.611, 2.611, 2.615, 2.617, 2.619, 2.621, 2.625, 2.628, 2.631, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.622, 2.623, 2.622, 2.622, 2.621, 2.619, 2.619, 2.619, 2.618, 2.616, 2.614, 2.613, 2.611, 2.609, 2.608, 2.606, 2.607, 2.607, 2.609, 2.611, 2.615, 2.617, 2.619, 2.622, 2.626, 2.629, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.622, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.614, 2.613, 2.611, 2.611, 2.607, 2.606, 2.605, 2.604, 2.605, 2.607, 2.609, 2.613, 2.616, 2.619, 2.622, 2.627, 2.631, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.613, 2.609, 2.607, 2.604, 2.602, 2.601, 2.602, 2.603, 2.605, 2.609, 2.612, 2.616, 2.619, 2.624, 2.628, 2.631, 2.632, 2.633, 2.629, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.615, 2.614, 2.612, 2.608, 2.603, 2.601, 2.598, 2.597, 2.599, 2.602, 2.605, 2.608, 2.611, 2.615, 2.622, 2.625, 2.629, 2.631, 2.631, 2.633, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.616, 2.614, 2.611, 2.606, 2.601, 2.598, 2.595, 2.595, 2.597, 2.601, 2.604, 2.608, 2.612, 2.615, 2.623, 2.627, 2.629, 2.631, 2.631, 2.632, 2.631, 2.628, 2.628, 2.651,
+                            2.622, 2.623, 2.624, 2.624, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.609, 2.606, 2.601, 2.596, 2.594, 2.594, 2.596, 2.599, 2.603, 2.609, 2.613, 2.617, 2.623, 2.627, 2.629, 2.631, 2.632, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.623, 2.625, 2.625, 2.624, 2.621, 2.621, 2.619, 2.617, 2.616, 2.613, 2.608, 2.605, 2.601, 2.595, 2.593, 2.593, 2.595, 2.598, 2.604, 2.609, 2.615, 2.619, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.632, 2.629, 2.631, 2.651,
+                            2.624, 2.626, 2.626, 2.623, 2.621, 2.619, 2.618, 2.617, 2.615, 2.612, 2.608, 2.605, 2.601, 2.597, 2.595, 2.595, 2.596, 2.598, 2.605, 2.609, 2.616, 2.621, 2.626, 2.627, 2.629, 2.631, 2.633, 2.633, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.618, 2.617, 2.614, 2.612, 2.609, 2.606, 2.602, 2.599, 2.598, 2.597, 2.598, 2.602, 2.607, 2.612, 2.619, 2.621, 2.626, 2.628, 2.629, 2.632, 2.633, 2.634, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.621, 2.618, 2.617, 2.614, 2.612, 2.611, 2.608, 2.604, 2.602, 2.599, 2.599, 2.603, 2.606, 2.611, 2.616, 2.621, 2.624, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.634, 2.633, 2.633, 2.656,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.611, 2.611, 2.607, 2.604, 2.604, 2.604, 2.606, 2.609, 2.613, 2.619, 2.622, 2.625, 2.628, 2.631, 2.632, 2.633, 2.633, 2.636, 2.636, 2.634, 2.634, 2.658,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.619, 2.618, 2.616, 2.614, 2.613, 2.612, 2.611, 2.609, 2.608, 2.607, 2.608, 2.609, 2.613, 2.617, 2.621, 2.623, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.635, 2.636, 2.636, 2.636, 2.661,
+                            2.623, 2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.616, 2.615, 2.614, 2.613, 2.612, 2.612, 2.611, 2.611, 2.611, 2.614, 2.615, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.633, 2.635, 2.635, 2.637, 2.637, 2.636, 2.637, 2.661,
+                            2.623, 2.624, 2.625, 2.626, 2.624, 2.621, 2.619, 2.617, 2.616, 2.615, 2.615, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.619, 2.621, 2.623, 2.626, 2.628, 2.631, 2.632, 2.634, 2.635, 2.636, 2.637, 2.638, 2.637, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.627, 2.626, 2.623, 2.619, 2.619, 2.618, 2.618, 2.618, 2.617, 2.617, 2.616, 2.616, 2.616, 2.619, 2.622, 2.623, 2.625, 2.628, 2.628, 2.631, 2.632, 2.634, 2.636, 2.638, 2.639, 2.639, 2.638, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.628, 2.626, 2.623, 2.621, 2.619, 2.619, 2.619, 2.619, 2.619, 2.619, 2.618, 2.618, 2.619, 2.623, 2.624, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.635, 2.638, 2.639, 2.639, 2.639, 2.636, 2.636, 2.662,
+                            2.625, 2.627, 2.628, 2.628, 2.626, 2.624, 2.623, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.624, 2.624, 2.625, 2.627, 2.628, 2.631, 2.631, 2.632, 2.634, 2.636, 2.639, 2.639, 2.641, 2.639, 2.635, 2.635, 2.663,
+                            2.625, 2.626, 2.628, 2.628, 2.627, 2.625, 2.624, 2.623, 2.623, 2.622, 2.623, 2.624, 2.624, 2.625, 2.625, 2.625, 2.625, 2.626, 2.627, 2.629, 2.631, 2.632, 2.633, 2.635, 2.638, 2.641, 2.642, 2.643, 2.642, 2.636, 2.636, 2.665,
+                            2.624, 2.626, 2.628, 2.628, 2.628, 2.626, 2.624, 2.624, 2.623, 2.623, 2.623, 2.625, 2.627, 2.627, 2.626, 2.626, 2.626, 2.627, 2.628, 2.629, 2.632, 2.633, 2.635, 2.637, 2.639, 2.642, 2.644, 2.644, 2.642, 2.638, 2.638, 2.665,
+                            2.623, 2.625, 2.626, 2.627, 2.626, 2.626, 2.624, 2.623, 2.623, 2.623, 2.623, 2.623, 2.626, 2.627, 2.626, 2.626, 2.626, 2.626, 2.628, 2.628, 2.629, 2.631, 2.634, 2.636, 2.639, 2.642, 2.644, 2.643, 2.641, 2.637, 2.638, 2.659,
+                            2.623, 2.627, 2.627, 2.627, 2.627, 2.628, 2.627, 2.624, 2.624, 2.623, 2.624, 2.624, 2.628, 2.628, 2.627, 2.628, 2.628, 2.628, 2.629, 2.629, 2.631, 2.635, 2.637, 2.639, 2.641, 2.643, 2.646, 2.645, 2.643, 2.641, 2.654, 2.659,
+                            2.642, 2.641, 2.643, 2.645, 2.645, 2.644, 2.644, 2.643, 2.643, 2.642, 2.642, 2.642, 2.643, 2.644, 2.644, 2.644, 2.646, 2.646, 2.647, 2.649, 2.651, 2.652, 2.654, 2.656, 2.658, 2.661, 2.661, 2.661, 2.659, 2.654, 2.659, 2.659
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.391, 1.394, 1.395, 1.396, 1.398, 1.398, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.398, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.399, 1.397, 1.399, 1.402,
+                            1.393, 1.395, 1.396, 1.398, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.401, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.399, 1.401, 1.401, 1.399, 1.398, 1.399, 1.402,
+                            1.398, 1.401, 1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.401, 1.401, 1.399, 1.399, 1.401, 1.401, 1.401, 1.401, 1.399, 1.401, 1.406,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.402, 1.403, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.405, 1.404, 1.404, 1.404, 1.404, 1.405, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.406, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.408, 1.408, 1.407, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.403, 1.402, 1.402, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.408, 1.407, 1.405, 1.405, 1.414,
+                            1.402, 1.402, 1.402, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.403, 1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.407, 1.409, 1.409, 1.409, 1.409, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.403, 1.404, 1.405, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.408, 1.405, 1.405, 1.413,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.402, 1.401, 1.399, 1.398, 1.398, 1.399, 1.399, 1.401, 1.403, 1.404, 1.405, 1.407, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.403, 1.404, 1.405, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.399, 1.401, 1.403, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.398, 1.401, 1.403, 1.406, 1.407, 1.409, 1.409, 1.411, 1.409, 1.409, 1.409, 1.408, 1.407, 1.407, 1.413,
+                            1.403, 1.404, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.404, 1.404, 1.403, 1.402, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.402, 1.404, 1.406, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.414,
+                            1.403, 1.403, 1.404, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.402, 1.401, 1.399, 1.398, 1.398, 1.398, 1.401, 1.403, 1.404, 1.408, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.402, 1.404, 1.406, 1.407, 1.408, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.409, 1.408, 1.408, 1.415,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.406, 1.408, 1.408, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.405, 1.406, 1.407, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.407, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.416,
+                            1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.406, 1.407, 1.407, 1.407, 1.408, 1.409, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.417,
+                            1.402, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.415,
+                            1.402, 1.402, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.405, 1.406, 1.406, 1.406, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.412, 1.412, 1.413, 1.413, 1.411, 1.408, 1.411, 1.413,
+                            1.406, 1.406, 1.408, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.414, 1.414, 1.414, 1.414, 1.415, 1.415, 1.415, 1.415, 1.416, 1.416, 1.416, 1.417, 1.418, 1.418, 1.417, 1.417, 1.414, 1.411, 1.413, 1.413
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.554, 1.522, 1.466, 1.422, 1.385, 1.351, 1.322, 1.294, 1.269, 1.246, 1.228, 1.214, 1.207, 1.202, 1.199, 1.199, 1.199, 1.199, 1.202, 1.207, 1.218, 1.235, 1.255, 1.279, 1.305, 1.333, 1.365, 1.402, 1.447, 1.508, 1.602, 1.638,
+                    1.522, 1.478, 1.431, 1.391, 1.355, 1.323, 1.298, 1.271, 1.247, 1.228, 1.212, 1.199, 1.187, 1.179, 1.173, 1.172, 1.172, 1.174, 1.179, 1.189, 1.201, 1.216, 1.235, 1.256, 1.282, 1.308, 1.335, 1.368, 1.411, 1.461, 1.535, 1.602,
+                    1.479, 1.449, 1.407, 1.367, 1.332, 1.301, 1.271, 1.247, 1.226, 1.208, 1.191, 1.178, 1.166, 1.158, 1.153, 1.151, 1.151, 1.153, 1.159, 1.168, 1.179, 1.194, 1.212, 1.234, 1.256, 1.282, 1.311, 1.343, 1.382, 1.427, 1.489, 1.535,
+                    1.454, 1.423, 1.383, 1.345, 1.309, 1.278, 1.249, 1.226, 1.206, 1.187, 1.171, 1.158, 1.146, 1.138, 1.132, 1.129, 1.129, 1.133, 1.139, 1.147, 1.159, 1.173, 1.191, 1.212, 1.234, 1.261, 1.288, 1.321, 1.357, 1.401, 1.455, 1.489,
+                    1.433, 1.401, 1.362, 1.325, 1.289, 1.258, 1.231, 1.206, 1.187, 1.169, 1.153, 1.138, 1.129, 1.121, 1.115, 1.112, 1.112, 1.114, 1.121, 1.129, 1.141, 1.155, 1.172, 1.191, 1.214, 1.241, 1.269, 1.301, 1.337, 1.377, 1.428, 1.457,
+                    1.415, 1.382, 1.343, 1.306, 1.273, 1.241, 1.213, 1.189, 1.169, 1.153, 1.137, 1.123, 1.112, 1.105, 1.097, 1.095, 1.095, 1.098, 1.103, 1.112, 1.124, 1.139, 1.155, 1.173, 1.197, 1.222, 1.252, 1.282, 1.317, 1.356, 1.405, 1.434,
+                    1.398, 1.363, 1.325, 1.289, 1.256, 1.224, 1.198, 1.175, 1.155, 1.137, 1.123, 1.108, 1.097, 1.089, 1.083, 1.079, 1.079, 1.083, 1.088, 1.097, 1.109, 1.124, 1.139, 1.158, 1.181, 1.206, 1.234, 1.266, 1.299, 1.339, 1.384, 1.415,
+                    1.382, 1.347, 1.309, 1.274, 1.242, 1.211, 1.185, 1.162, 1.142, 1.124, 1.108, 1.095, 1.083, 1.075, 1.069, 1.066, 1.066, 1.068, 1.074, 1.083, 1.096, 1.109, 1.125, 1.145, 1.166, 1.191, 1.219, 1.251, 1.285, 1.324, 1.367, 1.399,
+                    1.369, 1.334, 1.296, 1.261, 1.228, 1.199, 1.173, 1.151, 1.131, 1.112, 1.095, 1.083, 1.071, 1.062, 1.056, 1.053, 1.053, 1.055, 1.061, 1.069, 1.083, 1.096, 1.112, 1.132, 1.153, 1.178, 1.206, 1.237, 1.271, 1.309, 1.353, 1.385,
+                    1.359, 1.321, 1.284, 1.251, 1.217, 1.189, 1.164, 1.141, 1.121, 1.102, 1.086, 1.071, 1.061, 1.049, 1.045, 1.042, 1.042, 1.043, 1.051, 1.061, 1.069, 1.085, 1.101, 1.121, 1.143, 1.167, 1.195, 1.225, 1.259, 1.298, 1.341, 1.375,
+                    1.351, 1.312, 1.275, 1.241, 1.209, 1.181, 1.155, 1.133, 1.112, 1.092, 1.076, 1.061, 1.049, 1.041, 1.034, 1.032, 1.032, 1.035, 1.041, 1.051, 1.061, 1.075, 1.092, 1.112, 1.133, 1.158, 1.185, 1.216, 1.249, 1.288, 1.331, 1.364,
+                    1.344, 1.303, 1.267, 1.233, 1.201, 1.173, 1.147, 1.124, 1.104, 1.085, 1.067, 1.053, 1.041, 1.033, 1.024, 1.022, 1.022, 1.025, 1.034, 1.041, 1.053, 1.066, 1.083, 1.103, 1.126, 1.149, 1.177, 1.207, 1.241, 1.279, 1.321, 1.357,
+                    1.339, 1.297, 1.261, 1.226, 1.194, 1.166, 1.142, 1.119, 1.098, 1.078, 1.061, 1.046, 1.034, 1.024, 1.017, 1.014, 1.014, 1.017, 1.025, 1.034, 1.046, 1.059, 1.077, 1.096, 1.118, 1.143, 1.169, 1.201, 1.235, 1.273, 1.314, 1.352,
+                    1.337, 1.293, 1.256, 1.223, 1.191, 1.163, 1.136, 1.114, 1.093, 1.074, 1.056, 1.041, 1.027, 1.017, 1.012, 1.006, 1.006, 1.013, 1.017, 1.028, 1.041, 1.055, 1.072, 1.092, 1.114, 1.138, 1.165, 1.195, 1.229, 1.268, 1.309, 1.348,
+                    1.337, 1.291, 1.253, 1.219, 1.187, 1.159, 1.133, 1.109, 1.089, 1.071, 1.053, 1.037, 1.023, 1.012, 1.006, 1.002, 1.003, 1.006, 1.013, 1.023, 1.038, 1.052, 1.069, 1.089, 1.111, 1.135, 1.161, 1.192, 1.226, 1.264, 1.306, 1.348,
+                    1.337, 1.291, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.035, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.341, 1.292, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.034, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.348, 1.298, 1.255, 1.219, 1.188, 1.159, 1.134, 1.111, 1.088, 1.069, 1.051, 1.035, 1.021, 1.009, 1.003, 1.001, 1.002, 1.004, 1.011, 1.022, 1.036, 1.053, 1.071, 1.089, 1.111, 1.135, 1.162, 1.191, 1.226, 1.264, 1.306, 1.347,
+                    1.354, 1.306, 1.258, 1.222, 1.191, 1.162, 1.135, 1.113, 1.092, 1.073, 1.054, 1.038, 1.024, 1.014, 1.008, 1.003, 1.004, 1.008, 1.014, 1.026, 1.039, 1.056, 1.073, 1.093, 1.115, 1.139, 1.165, 1.195, 1.229, 1.267, 1.309, 1.349,
+                    1.358, 1.312, 1.263, 1.227, 1.195, 1.167, 1.141, 1.117, 1.097, 1.078, 1.061, 1.043, 1.029, 1.021, 1.014, 1.008, 1.008, 1.014, 1.021, 1.032, 1.045, 1.061, 1.078, 1.097, 1.119, 1.144, 1.169, 1.201, 1.234, 1.272, 1.315, 1.353,
+                    1.364, 1.319, 1.269, 1.234, 1.201, 1.174, 1.148, 1.124, 1.103, 1.084, 1.067, 1.052, 1.038, 1.029, 1.021, 1.016, 1.016, 1.021, 1.029, 1.038, 1.051, 1.067, 1.084, 1.103, 1.126, 1.151, 1.176, 1.207, 1.241, 1.279, 1.321, 1.358,
+                    1.371, 1.326, 1.277, 1.242, 1.209, 1.181, 1.155, 1.132, 1.111, 1.092, 1.075, 1.061, 1.049, 1.038, 1.029, 1.027, 1.027, 1.029, 1.038, 1.047, 1.061, 1.075, 1.092, 1.111, 1.133, 1.157, 1.185, 1.213, 1.247, 1.286, 1.329, 1.365,
+                    1.379, 1.334, 1.287, 1.251, 1.219, 1.191, 1.164, 1.141, 1.119, 1.101, 1.085, 1.071, 1.061, 1.049, 1.041, 1.038, 1.038, 1.041, 1.047, 1.059, 1.071, 1.084, 1.101, 1.119, 1.141, 1.165, 1.193, 1.223, 1.257, 1.295, 1.338, 1.374,
+                    1.389, 1.343, 1.298, 1.262, 1.231, 1.201, 1.174, 1.151, 1.131, 1.111, 1.095, 1.083, 1.071, 1.061, 1.054, 1.051, 1.051, 1.054, 1.059, 1.071, 1.081, 1.094, 1.111, 1.129, 1.152, 1.176, 1.203, 1.235, 1.269, 1.307, 1.351, 1.384,
+                    1.401, 1.351, 1.311, 1.274, 1.242, 1.214, 1.187, 1.164, 1.142, 1.124, 1.108, 1.095, 1.083, 1.074, 1.068, 1.066, 1.066, 1.068, 1.073, 1.081, 1.094, 1.108, 1.123, 1.141, 1.164, 1.188, 1.215, 1.247, 1.281, 1.321, 1.364, 1.396,
+                    1.412, 1.366, 1.327, 1.289, 1.257, 1.227, 1.201, 1.176, 1.156, 1.137, 1.122, 1.108, 1.096, 1.088, 1.083, 1.081, 1.081, 1.082, 1.087, 1.095, 1.108, 1.122, 1.136, 1.154, 1.177, 1.201, 1.229, 1.261, 1.296, 1.337, 1.382, 1.409,
+                    1.421, 1.383, 1.343, 1.306, 1.273, 1.243, 1.216, 1.192, 1.169, 1.152, 1.137, 1.122, 1.111, 1.103, 1.098, 1.095, 1.095, 1.097, 1.102, 1.111, 1.123, 1.136, 1.152, 1.169, 1.191, 1.217, 1.246, 1.278, 1.314, 1.354, 1.399, 1.429,
+                    1.434, 1.402, 1.362, 1.324, 1.291, 1.261, 1.232, 1.208, 1.187, 1.168, 1.152, 1.138, 1.127, 1.119, 1.114, 1.112, 1.112, 1.115, 1.121, 1.128, 1.139, 1.152, 1.169, 1.186, 1.209, 1.234, 1.262, 1.295, 1.332, 1.372, 1.419, 1.451,
+                    1.453, 1.422, 1.382, 1.344, 1.309, 1.278, 1.249, 1.226, 1.204, 1.187, 1.168, 1.155, 1.144, 1.135, 1.131, 1.131, 1.131, 1.133, 1.138, 1.146, 1.157, 1.171, 1.186, 1.206, 1.227, 1.252, 1.281, 1.314, 1.351, 1.393, 1.442, 1.473,
+                    1.475, 1.446, 1.404, 1.366, 1.329, 1.298, 1.269, 1.245, 1.224, 1.204, 1.188, 1.174, 1.163, 1.154, 1.149, 1.148, 1.148, 1.152, 1.156, 1.164, 1.176, 1.189, 1.206, 1.226, 1.247, 1.274, 1.303, 1.336, 1.374, 1.417, 1.471, 1.505,
+                    1.503, 1.472, 1.428, 1.389, 1.353, 1.321, 1.291, 1.266, 1.245, 1.224, 1.207, 1.192, 1.183, 1.174, 1.169, 1.167, 1.168, 1.169, 1.175, 1.183, 1.195, 1.209, 1.226, 1.247, 1.267, 1.294, 1.325, 1.359, 1.397, 1.445, 1.505, 1.548,
+                    1.534, 1.503, 1.455, 1.413, 1.378, 1.344, 1.315, 1.289, 1.265, 1.243, 1.224, 1.207, 1.196, 1.192, 1.189, 1.189, 1.189, 1.189, 1.192, 1.198, 1.209, 1.226, 1.244, 1.266, 1.291, 1.318, 1.349, 1.383, 1.425, 1.475, 1.548, 1.591
+                ],
+                "sigma": 0.00095,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2850,
+                        "ccm":
+                        [
+                            1.97469, -0.71439, -0.26031,
+                            -0.43521, 2.09769, -0.66248,
+                            -0.04826, -0.84642, 1.89468
+                        ]
+                    },
+                    {
+                        "ct": 2960,
+                        "ccm":
+                        [
+                            2.12952, -0.91185, -0.21768,
+                            -0.38018, 1.90789, -0.52771,
+                            0.03988, -1.10079, 2.06092
+                        ]
+                    },
+                    {
+                        "ct": 3580,
+                        "ccm":
+                        [
+                            2.03422, -0.80048, -0.23374,
+                            -0.39089, 1.97221, -0.58132,
+                            -0.08969, -0.61439, 1.70408
+                        ]
+                    },
+                    {
+                        "ct": 4559,
+                        "ccm":
+                        [
+                            2.15423, -0.98143, -0.17279,
+                            -0.38131, 2.14763, -0.76632,
+                            -0.10069, -0.54383, 1.64452
+                        ]
+                    },
+                    {
+                        "ct": 5881,
+                        "ccm":
+                        [
+                            2.18464, -0.95493, -0.22971,
+                            -0.36826, 2.00298, -0.63471,
+                            -0.15219, -0.38055, 1.53274
+                        ]
+                    },
+                    {
+                        "ct": 7600,
+                        "ccm":
+                        [
+                            2.30687, -0.97295, -0.33392,
+                            -0.30872, 2.32779, -1.01908,
+                            -0.17761, -0.55891, 1.73651
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.cac":
+            {
+                "strength": 1.0,
+                "lut_rx":
+                [
+                    -0.34, -0.26, -0.18, -0.1, -0.02, 0.06, 0.13, 0.22, 0.37,
+                    -0.36, -0.28, -0.19, -0.1, -0.02, 0.06, 0.13, 0.21, 0.36,
+                    -0.37, -0.29, -0.19, -0.1, -0.02, 0.06, 0.13, 0.21, 0.36,
+                    -0.38, -0.27, -0.18, -0.09, -0.01, 0.07, 0.14, 0.22, 0.36,
+                    -0.36, -0.27, -0.18, -0.09, -0.01, 0.07, 0.15, 0.23, 0.38,
+                    -0.35, -0.27, -0.18, -0.09, -0.01, 0.08, 0.15, 0.23, 0.39,
+                    -0.34, -0.26, -0.18, -0.1, -0.01, 0.07, 0.15, 0.22, 0.39,
+                    -0.33, -0.24, -0.17, -0.09, -0.01, 0.08, 0.15, 0.22, 0.37,
+                    -0.3, -0.21, -0.14, -0.07, 0.0, 0.09, 0.16, 0.22, 0.36
+                ],
+                "lut_ry":
+                [
+                    -0.22, -0.23, -0.26, -0.27, -0.27, -0.26, -0.24, -0.23, -0.22,
+                    -0.18, -0.19, -0.21, -0.21, -0.22, -0.21, -0.19, -0.18, -0.16,
+                    -0.15, -0.14, -0.16, -0.17, -0.18, -0.17, -0.16, -0.14, -0.11,
+                    -0.09, -0.07, -0.08, -0.09, -0.1, -0.09, -0.08, -0.06, -0.06,
+                    -0.02, 0.0, -0.01, -0.02, -0.03, -0.03, -0.01, 0.01, 0.01,
+                    0.05, 0.06, 0.04, 0.03, 0.03, 0.03, 0.04, 0.06, 0.07,
+                    0.09, 0.1, 0.09, 0.08, 0.07, 0.07, 0.09, 0.1, 0.12,
+                    0.14, 0.16, 0.15, 0.15, 0.15, 0.14, 0.15, 0.16, 0.16,
+                    0.24, 0.26, 0.25, 0.25, 0.26, 0.26, 0.26, 0.26, 0.25
+                ],
+                "lut_bx":
+                [
+                    -0.03, -0.02, -0.0, 0.0, 0.02, 0.03, 0.04, 0.06, 0.11,
+                    -0.03, -0.01, -0.0, -0.0, 0.01, 0.02, 0.04, 0.06, 0.11,
+                    -0.03, -0.01, 0.0, 0.01, 0.01, 0.02, 0.04, 0.06, 0.1,
+                    -0.03, -0.01, 0.0, 0.01, 0.01, 0.02, 0.04, 0.07, 0.12,
+                    -0.03, -0.01, -0.0, 0.01, 0.01, 0.02, 0.04, 0.07, 0.13,
+                    -0.03, -0.01, 0.0, 0.01, 0.02, 0.02, 0.04, 0.07, 0.14,
+                    -0.03, -0.01, 0.0, 0.01, 0.02, 0.02, 0.04, 0.08, 0.15,
+                    -0.03, -0.01, 0.0, 0.0, 0.01, 0.02, 0.04, 0.08, 0.16,
+                    -0.02, -0.0, 0.0, -0.0, -0.01, 0.0, 0.03, 0.08, 0.16
+                ],
+                "lut_by":
+                [
+                    -0.1, -0.07, -0.05, -0.04, -0.04, -0.04, -0.05, -0.08, -0.13,
+                    -0.08, -0.06, -0.05, -0.04, -0.04, -0.04, -0.04, -0.06, -0.11,
+                    -0.07, -0.04, -0.03, -0.03, -0.02, -0.02, -0.03, -0.04, -0.08,
+                    -0.06, -0.04, -0.02, -0.02, -0.02, -0.02, -0.02, -0.04, -0.06,
+                    -0.04, -0.01, 0.0, 0.02, 0.02, 0.01, 0.0, -0.01, -0.06,
+                    -0.02, 0.01, 0.02, 0.03, 0.04, 0.04, 0.03, 0.01, -0.04,
+                    -0.0, 0.02, 0.04, 0.05, 0.05, 0.05, 0.05, 0.03, -0.02,
+                    0.0, 0.02, 0.04, 0.05, 0.06, 0.05, 0.04, 0.04, 0.01,
+                    -0.0, 0.02, 0.03, 0.04, 0.05, 0.04, 0.02, 0.03, 0.01
+                ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": [ 0.0, 2.5, 0.01, 2.5, 0.06, 1.0, 1.0, 1.0 ],
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": [ 0.0, 2.5, 0.01, 2.5, 0.06, 1.0, 1.0, 1.0 ],
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx477_6mm.json b/src/ipa/rpi/pisp/data/imx477_6mm.json
new file mode 100644
index 000000000..27268c233
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx477_6mm.json
@@ -0,0 +1,1240 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 12000,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 740,
+                "reference_Y": 15051
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.809
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 204,
+                "slope": 0.0061
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2850.0, 0.4307, 0.3957,
+                    2960.0, 0.4159, 0.4313,
+                    3580.0, 0.3771, 0.5176,
+                    4559.0, 0.3031, 0.6573,
+                    5881.0, 0.2809, 0.6942,
+                    7600.0, 0.2263, 0.7762
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.02634,
+                "transverse_neg": 0.02255
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.359, 2.354, 2.351, 2.351, 2.343, 2.337, 2.331, 2.325, 2.323, 2.321, 2.317, 2.315, 2.313, 2.313, 2.311, 2.312, 2.312, 2.313, 2.315, 2.315, 2.316, 2.317, 2.319, 2.323, 2.326, 2.329, 2.332, 2.332, 2.335, 2.337, 2.352, 2.363,
+                            2.352, 2.351, 2.349, 2.346, 2.342, 2.334, 2.328, 2.324, 2.321, 2.317, 2.315, 2.314, 2.312, 2.311, 2.311, 2.311, 2.311, 2.311, 2.312, 2.314, 2.315, 2.316, 2.317, 2.319, 2.324, 2.326, 2.328, 2.329, 2.331, 2.337, 2.348, 2.355,
+                            2.346, 2.346, 2.345, 2.344, 2.338, 2.329, 2.325, 2.319, 2.316, 2.314, 2.311, 2.309, 2.308, 2.306, 2.304, 2.304, 2.305, 2.307, 2.308, 2.309, 2.311, 2.311, 2.313, 2.316, 2.319, 2.322, 2.325, 2.326, 2.328, 2.335, 2.343, 2.349,
+                            2.342, 2.342, 2.341, 2.338, 2.332, 2.326, 2.319, 2.316, 2.312, 2.309, 2.308, 2.305, 2.303, 2.302, 2.301, 2.301, 2.302, 2.303, 2.304, 2.305, 2.305, 2.307, 2.311, 2.313, 2.315, 2.319, 2.321, 2.325, 2.328, 2.333, 2.338, 2.348,
+                            2.337, 2.337, 2.337, 2.336, 2.331, 2.322, 2.317, 2.312, 2.309, 2.307, 2.304, 2.302, 2.299, 2.299, 2.298, 2.298, 2.299, 2.299, 2.301, 2.302, 2.302, 2.304, 2.305, 2.309, 2.314, 2.316, 2.321, 2.324, 2.326, 2.329, 2.335, 2.343,
+                            2.335, 2.334, 2.333, 2.333, 2.326, 2.318, 2.313, 2.309, 2.306, 2.302, 2.299, 2.297, 2.297, 2.296, 2.295, 2.295, 2.294, 2.295, 2.296, 2.298, 2.298, 2.301, 2.303, 2.305, 2.311, 2.315, 2.319, 2.323, 2.325, 2.329, 2.333, 2.339,
+                            2.329, 2.331, 2.329, 2.329, 2.325, 2.315, 2.309, 2.306, 2.302, 2.299, 2.297, 2.295, 2.293, 2.292, 2.291, 2.291, 2.291, 2.291, 2.293, 2.294, 2.296, 2.298, 2.301, 2.304, 2.307, 2.313, 2.317, 2.319, 2.323, 2.327, 2.331, 2.339,
+                            2.329, 2.328, 2.328, 2.328, 2.321, 2.313, 2.307, 2.303, 2.299, 2.295, 2.294, 2.292, 2.289, 2.289, 2.288, 2.288, 2.288, 2.289, 2.289, 2.292, 2.294, 2.295, 2.297, 2.301, 2.306, 2.311, 2.315, 2.318, 2.319, 2.323, 2.329, 2.335,
+                            2.326, 2.327, 2.325, 2.325, 2.319, 2.311, 2.305, 2.299, 2.296, 2.293, 2.291, 2.289, 2.288, 2.287, 2.285, 2.285, 2.286, 2.288, 2.288, 2.289, 2.291, 2.294, 2.295, 2.298, 2.304, 2.308, 2.313, 2.315, 2.317, 2.319, 2.327, 2.335,
+                            2.325, 2.325, 2.323, 2.323, 2.317, 2.309, 2.303, 2.298, 2.294, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.284, 2.284, 2.285, 2.287, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.305, 2.309, 2.313, 2.315, 2.317, 2.325, 2.334,
+                            2.322, 2.324, 2.322, 2.322, 2.316, 2.306, 2.301, 2.296, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.283, 2.283, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.293, 2.296, 2.301, 2.304, 2.308, 2.311, 2.312, 2.315, 2.323, 2.333,
+                            2.321, 2.323, 2.322, 2.322, 2.314, 2.306, 2.299, 2.294, 2.291, 2.288, 2.286, 2.285, 2.284, 2.282, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.306, 2.308, 2.311, 2.312, 2.322, 2.332,
+                            2.319, 2.321, 2.321, 2.321, 2.314, 2.305, 2.297, 2.293, 2.289, 2.287, 2.285, 2.284, 2.283, 2.281, 2.281, 2.281, 2.282, 2.283, 2.283, 2.285, 2.287, 2.289, 2.291, 2.292, 2.297, 2.301, 2.305, 2.307, 2.309, 2.312, 2.321, 2.333,
+                            2.319, 2.321, 2.319, 2.319, 2.314, 2.303, 2.296, 2.293, 2.289, 2.286, 2.285, 2.283, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.296, 2.301, 2.305, 2.307, 2.308, 2.312, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.296, 2.291, 2.289, 2.286, 2.284, 2.282, 2.281, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.287, 2.288, 2.291, 2.295, 2.299, 2.304, 2.306, 2.307, 2.311, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.287, 2.285, 2.282, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.284, 2.285, 2.286, 2.288, 2.291, 2.295, 2.299, 2.303, 2.306, 2.307, 2.312, 2.321, 2.331,
+                            2.318, 2.319, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.286, 2.285, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.285, 2.286, 2.287, 2.291, 2.294, 2.298, 2.303, 2.306, 2.307, 2.311, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.302, 2.297, 2.292, 2.289, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.287, 2.289, 2.294, 2.297, 2.303, 2.305, 2.308, 2.313, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.303, 2.299, 2.293, 2.291, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.288, 2.291, 2.294, 2.298, 2.304, 2.306, 2.308, 2.312, 2.322, 2.331,
+                            2.319, 2.321, 2.321, 2.321, 2.315, 2.305, 2.301, 2.295, 2.292, 2.289, 2.286, 2.285, 2.283, 2.282, 2.282, 2.282, 2.284, 2.283, 2.284, 2.284, 2.285, 2.287, 2.288, 2.291, 2.294, 2.299, 2.304, 2.306, 2.309, 2.313, 2.322, 2.334,
+                            2.321, 2.322, 2.322, 2.322, 2.317, 2.307, 2.301, 2.296, 2.292, 2.291, 2.288, 2.286, 2.285, 2.284, 2.283, 2.284, 2.285, 2.284, 2.285, 2.285, 2.287, 2.288, 2.289, 2.293, 2.297, 2.301, 2.305, 2.308, 2.311, 2.314, 2.323, 2.335,
+                            2.322, 2.324, 2.324, 2.324, 2.319, 2.309, 2.303, 2.297, 2.295, 2.292, 2.291, 2.288, 2.286, 2.286, 2.285, 2.286, 2.286, 2.286, 2.287, 2.288, 2.289, 2.289, 2.291, 2.294, 2.299, 2.302, 2.307, 2.311, 2.312, 2.316, 2.325, 2.335,
+                            2.324, 2.326, 2.325, 2.326, 2.321, 2.311, 2.305, 2.301, 2.297, 2.295, 2.293, 2.291, 2.289, 2.289, 2.288, 2.288, 2.287, 2.288, 2.289, 2.291, 2.292, 2.292, 2.295, 2.299, 2.301, 2.304, 2.309, 2.312, 2.315, 2.319, 2.327, 2.337,
+                            2.329, 2.329, 2.328, 2.328, 2.323, 2.315, 2.308, 2.304, 2.301, 2.298, 2.296, 2.294, 2.291, 2.291, 2.289, 2.291, 2.291, 2.291, 2.292, 2.293, 2.294, 2.295, 2.297, 2.299, 2.303, 2.308, 2.312, 2.315, 2.318, 2.321, 2.329, 2.339,
+                            2.329, 2.331, 2.332, 2.332, 2.326, 2.318, 2.311, 2.306, 2.304, 2.301, 2.299, 2.297, 2.295, 2.293, 2.292, 2.292, 2.292, 2.293, 2.294, 2.294, 2.296, 2.297, 2.299, 2.302, 2.306, 2.311, 2.315, 2.318, 2.319, 2.324, 2.332, 2.342,
+                            2.331, 2.333, 2.334, 2.334, 2.328, 2.321, 2.313, 2.308, 2.305, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.295, 2.294, 2.296, 2.296, 2.297, 2.298, 2.299, 2.302, 2.305, 2.308, 2.314, 2.317, 2.321, 2.323, 2.327, 2.334, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.309, 2.306, 2.304, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.309, 2.315, 2.319, 2.321, 2.324, 2.328, 2.337, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.311, 2.306, 2.304, 2.303, 2.302, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.311, 2.314, 2.319, 2.323, 2.325, 2.329, 2.339, 2.348,
+                            2.329, 2.329, 2.329, 2.331, 2.326, 2.319, 2.312, 2.309, 2.304, 2.303, 2.302, 2.301, 2.298, 2.295, 2.294, 2.294, 2.295, 2.295, 2.296, 2.297, 2.299, 2.301, 2.302, 2.304, 2.308, 2.313, 2.319, 2.322, 2.325, 2.329, 2.339, 2.351,
+                            2.329, 2.329, 2.329, 2.329, 2.326, 2.317, 2.311, 2.308, 2.303, 2.302, 2.301, 2.298, 2.296, 2.295, 2.294, 2.294, 2.294, 2.294, 2.296, 2.297, 2.298, 2.299, 2.301, 2.304, 2.307, 2.312, 2.318, 2.322, 2.326, 2.331, 2.341, 2.355,
+                            2.339, 2.332, 2.331, 2.331, 2.327, 2.323, 2.316, 2.309, 2.306, 2.302, 2.301, 2.299, 2.297, 2.296, 2.295, 2.294, 2.294, 2.296, 2.297, 2.297, 2.299, 2.301, 2.303, 2.306, 2.308, 2.317, 2.322, 2.325, 2.329, 2.341, 2.353, 2.361,
+                            2.347, 2.347, 2.345, 2.343, 2.338, 2.332, 2.326, 2.322, 2.321, 2.318, 2.316, 2.315, 2.313, 2.312, 2.311, 2.311, 2.311, 2.311, 2.312, 2.315, 2.317, 2.318, 2.319, 2.323, 2.324, 2.329, 2.334, 2.337, 2.344, 2.347, 2.361, 2.364
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.869, 3.852, 3.844, 3.842, 3.836, 3.821, 3.807, 3.796, 3.789, 3.784, 3.778, 3.775, 3.769, 3.768, 3.765, 3.765, 3.767, 3.769, 3.772, 3.774, 3.773, 3.775, 3.779, 3.787, 3.793, 3.801, 3.806, 3.804, 3.813, 3.819, 3.855, 3.879,
+                            3.854, 3.844, 3.837, 3.836, 3.824, 3.811, 3.797, 3.789, 3.784, 3.777, 3.774, 3.769, 3.764, 3.758, 3.757, 3.758, 3.758, 3.761, 3.763, 3.764, 3.765, 3.766, 3.772, 3.778, 3.787, 3.792, 3.794, 3.798, 3.802, 3.815, 3.839, 3.873,
+                            3.838, 3.831, 3.826, 3.823, 3.813, 3.799, 3.787, 3.781, 3.773, 3.768, 3.763, 3.759, 3.753, 3.749, 3.745, 3.745, 3.745, 3.752, 3.754, 3.757, 3.757, 3.759, 3.763, 3.769, 3.773, 3.781, 3.786, 3.792, 3.798, 3.811, 3.831, 3.861,
+                            3.833, 3.822, 3.817, 3.816, 3.804, 3.788, 3.779, 3.772, 3.766, 3.759, 3.755, 3.749, 3.744, 3.741, 3.738, 3.739, 3.739, 3.741, 3.743, 3.747, 3.749, 3.751, 3.756, 3.764, 3.769, 3.776, 3.783, 3.789, 3.798, 3.809, 3.821, 3.855,
+                            3.824, 3.818, 3.808, 3.808, 3.797, 3.781, 3.772, 3.764, 3.757, 3.752, 3.747, 3.743, 3.737, 3.735, 3.733, 3.733, 3.733, 3.735, 3.737, 3.738, 3.741, 3.746, 3.749, 3.755, 3.766, 3.771, 3.781, 3.789, 3.794, 3.806, 3.818, 3.849,
+                            3.815, 3.808, 3.799, 3.801, 3.787, 3.775, 3.767, 3.757, 3.751, 3.745, 3.738, 3.734, 3.732, 3.727, 3.725, 3.723, 3.722, 3.722, 3.726, 3.729, 3.734, 3.738, 3.744, 3.749, 3.759, 3.769, 3.781, 3.788, 3.792, 3.799, 3.811, 3.841,
+                            3.804, 3.799, 3.793, 3.793, 3.783, 3.771, 3.759, 3.751, 3.744, 3.735, 3.732, 3.727, 3.723, 3.721, 3.719, 3.716, 3.716, 3.716, 3.718, 3.722, 3.727, 3.731, 3.737, 3.746, 3.756, 3.767, 3.776, 3.782, 3.788, 3.795, 3.808, 3.831,
+                            3.802, 3.797, 3.787, 3.787, 3.779, 3.762, 3.753, 3.744, 3.734, 3.727, 3.725, 3.721, 3.716, 3.714, 3.709, 3.709, 3.711, 3.711, 3.712, 3.717, 3.722, 3.725, 3.731, 3.739, 3.752, 3.762, 3.772, 3.778, 3.779, 3.789, 3.798, 3.826,
+                            3.791, 3.789, 3.784, 3.784, 3.775, 3.759, 3.746, 3.735, 3.729, 3.724, 3.718, 3.714, 3.712, 3.707, 3.704, 3.704, 3.706, 3.708, 3.709, 3.711, 3.716, 3.722, 3.726, 3.735, 3.746, 3.754, 3.767, 3.774, 3.777, 3.781, 3.794, 3.824,
+                            3.789, 3.784, 3.779, 3.781, 3.771, 3.753, 3.741, 3.732, 3.725, 3.719, 3.715, 3.711, 3.707, 3.704, 3.701, 3.701, 3.702, 3.704, 3.708, 3.709, 3.713, 3.718, 3.724, 3.731, 3.742, 3.749, 3.761, 3.768, 3.772, 3.778, 3.791, 3.822,
+                            3.789, 3.781, 3.777, 3.777, 3.764, 3.749, 3.739, 3.729, 3.722, 3.718, 3.711, 3.708, 3.705, 3.701, 3.699, 3.699, 3.699, 3.701, 3.705, 3.707, 3.711, 3.715, 3.721, 3.727, 3.738, 3.746, 3.757, 3.763, 3.765, 3.773, 3.788, 3.821,
+                            3.785, 3.779, 3.774, 3.774, 3.764, 3.747, 3.736, 3.726, 3.719, 3.711, 3.709, 3.706, 3.701, 3.698, 3.696, 3.695, 3.695, 3.698, 3.702, 3.704, 3.707, 3.712, 3.718, 3.725, 3.734, 3.741, 3.753, 3.756, 3.759, 3.764, 3.784, 3.818,
+                            3.779, 3.776, 3.773, 3.773, 3.759, 3.744, 3.733, 3.724, 3.714, 3.709, 3.706, 3.704, 3.699, 3.696, 3.694, 3.694, 3.694, 3.697, 3.701, 3.703, 3.706, 3.709, 3.714, 3.721, 3.731, 3.737, 3.749, 3.753, 3.758, 3.762, 3.783, 3.819,
+                            3.779, 3.776, 3.769, 3.769, 3.757, 3.741, 3.729, 3.721, 3.712, 3.708, 3.705, 3.701, 3.697, 3.695, 3.694, 3.694, 3.695, 3.696, 3.698, 3.702, 3.705, 3.709, 3.712, 3.717, 3.728, 3.736, 3.749, 3.752, 3.756, 3.761, 3.781, 3.815,
+                            3.779, 3.773, 3.768, 3.768, 3.756, 3.738, 3.731, 3.719, 3.711, 3.707, 3.703, 3.698, 3.695, 3.694, 3.694, 3.695, 3.695, 3.695, 3.696, 3.702, 3.705, 3.708, 3.712, 3.717, 3.728, 3.736, 3.747, 3.751, 3.754, 3.761, 3.781, 3.815,
+                            3.782, 3.773, 3.767, 3.767, 3.755, 3.738, 3.728, 3.721, 3.711, 3.707, 3.701, 3.698, 3.695, 3.693, 3.694, 3.696, 3.695, 3.695, 3.695, 3.701, 3.703, 3.706, 3.711, 3.715, 3.726, 3.735, 3.745, 3.751, 3.754, 3.763, 3.779, 3.815,
+                            3.781, 3.771, 3.767, 3.767, 3.754, 3.739, 3.726, 3.721, 3.712, 3.706, 3.701, 3.698, 3.695, 3.693, 3.693, 3.695, 3.695, 3.695, 3.696, 3.698, 3.703, 3.705, 3.709, 3.715, 3.725, 3.734, 3.745, 3.751, 3.755, 3.762, 3.783, 3.818,
+                            3.781, 3.774, 3.767, 3.767, 3.755, 3.741, 3.729, 3.722, 3.712, 3.708, 3.701, 3.699, 3.695, 3.693, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.725, 3.732, 3.746, 3.751, 3.756, 3.763, 3.783, 3.821,
+                            3.781, 3.774, 3.769, 3.769, 3.756, 3.741, 3.731, 3.724, 3.713, 3.711, 3.707, 3.699, 3.697, 3.694, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.724, 3.734, 3.747, 3.751, 3.756, 3.765, 3.784, 3.821,
+                            3.784, 3.776, 3.773, 3.773, 3.759, 3.742, 3.733, 3.726, 3.719, 3.711, 3.709, 3.703, 3.698, 3.695, 3.694, 3.695, 3.697, 3.696, 3.698, 3.699, 3.703, 3.706, 3.711, 3.714, 3.727, 3.735, 3.746, 3.751, 3.757, 3.766, 3.787, 3.822,
+                            3.786, 3.783, 3.774, 3.774, 3.766, 3.747, 3.737, 3.727, 3.722, 3.716, 3.711, 3.706, 3.702, 3.698, 3.697, 3.698, 3.699, 3.699, 3.701, 3.703, 3.706, 3.711, 3.713, 3.719, 3.731, 3.739, 3.748, 3.753, 3.761, 3.769, 3.789, 3.826,
+                            3.786, 3.784, 3.779, 3.779, 3.769, 3.751, 3.742, 3.732, 3.725, 3.719, 3.715, 3.711, 3.706, 3.704, 3.701, 3.701, 3.702, 3.702, 3.705, 3.707, 3.712, 3.714, 3.717, 3.724, 3.733, 3.743, 3.749, 3.758, 3.764, 3.769, 3.791, 3.826,
+                            3.793, 3.787, 3.782, 3.782, 3.774, 3.756, 3.747, 3.737, 3.729, 3.725, 3.719, 3.715, 3.712, 3.708, 3.707, 3.706, 3.707, 3.708, 3.709, 3.713, 3.714, 3.717, 3.723, 3.729, 3.736, 3.747, 3.757, 3.764, 3.768, 3.774, 3.794, 3.829,
+                            3.794, 3.791, 3.786, 3.786, 3.779, 3.762, 3.751, 3.742, 3.735, 3.729, 3.725, 3.719, 3.716, 3.711, 3.709, 3.709, 3.709, 3.711, 3.716, 3.717, 3.721, 3.723, 3.726, 3.732, 3.741, 3.752, 3.761, 3.767, 3.773, 3.779, 3.801, 3.829,
+                            3.802, 3.798, 3.793, 3.793, 3.779, 3.766, 3.754, 3.746, 3.741, 3.736, 3.731, 3.726, 3.719, 3.717, 3.716, 3.715, 3.716, 3.717, 3.719, 3.721, 3.724, 3.726, 3.731, 3.737, 3.744, 3.756, 3.766, 3.772, 3.776, 3.784, 3.807, 3.839,
+                            3.805, 3.799, 3.795, 3.795, 3.784, 3.767, 3.757, 3.749, 3.744, 3.739, 3.736, 3.731, 3.726, 3.722, 3.719, 3.719, 3.719, 3.721, 3.723, 3.725, 3.727, 3.732, 3.738, 3.742, 3.751, 3.761, 3.771, 3.775, 3.782, 3.789, 3.811, 3.841,
+                            3.804, 3.801, 3.799, 3.799, 3.787, 3.772, 3.761, 3.752, 3.746, 3.742, 3.739, 3.735, 3.729, 3.726, 3.723, 3.724, 3.725, 3.726, 3.727, 3.728, 3.732, 3.736, 3.739, 3.745, 3.754, 3.765, 3.775, 3.779, 3.785, 3.795, 3.816, 3.844,
+                            3.801, 3.799, 3.796, 3.796, 3.787, 3.773, 3.761, 3.753, 3.746, 3.743, 3.739, 3.735, 3.731, 3.726, 3.725, 3.725, 3.725, 3.726, 3.727, 3.729, 3.733, 3.736, 3.741, 3.745, 3.755, 3.766, 3.776, 3.783, 3.786, 3.797, 3.819, 3.851,
+                            3.799, 3.795, 3.788, 3.788, 3.783, 3.772, 3.759, 3.749, 3.744, 3.738, 3.735, 3.733, 3.726, 3.724, 3.722, 3.722, 3.723, 3.724, 3.725, 3.727, 3.729, 3.733, 3.736, 3.742, 3.754, 3.762, 3.772, 3.779, 3.784, 3.796, 3.821, 3.859,
+                            3.799, 3.789, 3.787, 3.788, 3.779, 3.766, 3.755, 3.749, 3.742, 3.736, 3.733, 3.727, 3.723, 3.722, 3.721, 3.719, 3.719, 3.721, 3.725, 3.726, 3.728, 3.732, 3.734, 3.741, 3.747, 3.758, 3.771, 3.778, 3.785, 3.796, 3.825, 3.862,
+                            3.824, 3.799, 3.789, 3.789, 3.788, 3.777, 3.761, 3.751, 3.743, 3.739, 3.736, 3.728, 3.726, 3.725, 3.721, 3.719, 3.721, 3.723, 3.727, 3.728, 3.729, 3.733, 3.737, 3.744, 3.755, 3.769, 3.776, 3.784, 3.793, 3.819, 3.863, 3.877,
+                            3.833, 3.833, 3.833, 3.842, 3.825, 3.815, 3.807, 3.799, 3.792, 3.788, 3.785, 3.782, 3.778, 3.777, 3.773, 3.772, 3.772, 3.774, 3.778, 3.779, 3.779, 3.785, 3.792, 3.798, 3.803, 3.811, 3.822, 3.834, 3.843, 3.846, 3.877, 3.886
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.616, 2.616, 2.618, 2.621, 2.619, 2.618, 2.615, 2.615, 2.613, 2.611, 2.609, 2.609, 2.609, 2.611, 2.611, 2.611, 2.611, 2.609, 2.608, 2.608, 2.611, 2.613, 2.613, 2.614, 2.614, 2.615, 2.615, 2.622, 2.624, 2.621, 2.624, 2.641,
+                            2.616, 2.618, 2.621, 2.623, 2.623, 2.619, 2.618, 2.616, 2.616, 2.613, 2.611, 2.611, 2.611, 2.611, 2.612, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.612, 2.613, 2.612, 2.613, 2.615, 2.617, 2.621, 2.621, 2.619, 2.621, 2.641,
+                            2.621, 2.624, 2.627, 2.627, 2.625, 2.623, 2.621, 2.619, 2.618, 2.618, 2.618, 2.617, 2.616, 2.616, 2.615, 2.613, 2.612, 2.613, 2.613, 2.614, 2.614, 2.613, 2.614, 2.613, 2.614, 2.617, 2.619, 2.621, 2.621, 2.619, 2.623, 2.643,
+                            2.626, 2.627, 2.628, 2.629, 2.628, 2.625, 2.622, 2.621, 2.621, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.616, 2.616, 2.616, 2.618, 2.618, 2.617, 2.617, 2.618, 2.619, 2.621, 2.623, 2.624, 2.626, 2.625, 2.624, 2.625, 2.654,
+                            2.627, 2.628, 2.628, 2.628, 2.626, 2.623, 2.622, 2.622, 2.622, 2.622, 2.621, 2.621, 2.619, 2.617, 2.617, 2.616, 2.617, 2.617, 2.618, 2.619, 2.618, 2.618, 2.618, 2.621, 2.622, 2.624, 2.626, 2.627, 2.627, 2.626, 2.628, 2.655,
+                            2.625, 2.626, 2.627, 2.626, 2.625, 2.623, 2.622, 2.621, 2.622, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.616, 2.616, 2.616, 2.616, 2.616, 2.617, 2.618, 2.619, 2.621, 2.622, 2.624, 2.626, 2.628, 2.628, 2.629, 2.629, 2.655,
+                            2.626, 2.625, 2.626, 2.625, 2.625, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.616, 2.614, 2.613, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.618, 2.619, 2.621, 2.623, 2.624, 2.627, 2.629, 2.631, 2.629, 2.631, 2.651,
+                            2.625, 2.625, 2.625, 2.624, 2.623, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.614, 2.613, 2.612, 2.611, 2.611, 2.612, 2.612, 2.613, 2.616, 2.618, 2.619, 2.622, 2.624, 2.626, 2.628, 2.631, 2.631, 2.631, 2.631, 2.651,
+                            2.625, 2.625, 2.624, 2.623, 2.622, 2.622, 2.622, 2.622, 2.622, 2.621, 2.617, 2.615, 2.613, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.613, 2.615, 2.618, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.624, 2.624, 2.622, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.618, 2.616, 2.614, 2.612, 2.611, 2.609, 2.609, 2.608, 2.609, 2.611, 2.611, 2.615, 2.617, 2.619, 2.621, 2.625, 2.628, 2.631, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.622, 2.623, 2.622, 2.622, 2.621, 2.619, 2.619, 2.619, 2.618, 2.616, 2.614, 2.613, 2.611, 2.609, 2.608, 2.606, 2.607, 2.607, 2.609, 2.611, 2.615, 2.617, 2.619, 2.622, 2.626, 2.629, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.622, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.614, 2.613, 2.611, 2.611, 2.607, 2.606, 2.605, 2.604, 2.605, 2.607, 2.609, 2.613, 2.616, 2.619, 2.622, 2.627, 2.631, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.613, 2.609, 2.607, 2.604, 2.602, 2.601, 2.602, 2.603, 2.605, 2.609, 2.612, 2.616, 2.619, 2.624, 2.628, 2.631, 2.632, 2.633, 2.629, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.615, 2.614, 2.612, 2.608, 2.603, 2.601, 2.598, 2.597, 2.599, 2.602, 2.605, 2.608, 2.611, 2.615, 2.622, 2.625, 2.629, 2.631, 2.631, 2.633, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.616, 2.614, 2.611, 2.606, 2.601, 2.598, 2.595, 2.595, 2.597, 2.601, 2.604, 2.608, 2.612, 2.615, 2.623, 2.627, 2.629, 2.631, 2.631, 2.632, 2.631, 2.628, 2.628, 2.651,
+                            2.622, 2.623, 2.624, 2.624, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.609, 2.606, 2.601, 2.596, 2.594, 2.594, 2.596, 2.599, 2.603, 2.609, 2.613, 2.617, 2.623, 2.627, 2.629, 2.631, 2.632, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.623, 2.625, 2.625, 2.624, 2.621, 2.621, 2.619, 2.617, 2.616, 2.613, 2.608, 2.605, 2.601, 2.595, 2.593, 2.593, 2.595, 2.598, 2.604, 2.609, 2.615, 2.619, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.632, 2.629, 2.631, 2.651,
+                            2.624, 2.626, 2.626, 2.623, 2.621, 2.619, 2.618, 2.617, 2.615, 2.612, 2.608, 2.605, 2.601, 2.597, 2.595, 2.595, 2.596, 2.598, 2.605, 2.609, 2.616, 2.621, 2.626, 2.627, 2.629, 2.631, 2.633, 2.633, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.618, 2.617, 2.614, 2.612, 2.609, 2.606, 2.602, 2.599, 2.598, 2.597, 2.598, 2.602, 2.607, 2.612, 2.619, 2.621, 2.626, 2.628, 2.629, 2.632, 2.633, 2.634, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.621, 2.618, 2.617, 2.614, 2.612, 2.611, 2.608, 2.604, 2.602, 2.599, 2.599, 2.603, 2.606, 2.611, 2.616, 2.621, 2.624, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.634, 2.633, 2.633, 2.656,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.611, 2.611, 2.607, 2.604, 2.604, 2.604, 2.606, 2.609, 2.613, 2.619, 2.622, 2.625, 2.628, 2.631, 2.632, 2.633, 2.633, 2.636, 2.636, 2.634, 2.634, 2.658,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.619, 2.618, 2.616, 2.614, 2.613, 2.612, 2.611, 2.609, 2.608, 2.607, 2.608, 2.609, 2.613, 2.617, 2.621, 2.623, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.635, 2.636, 2.636, 2.636, 2.661,
+                            2.623, 2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.616, 2.615, 2.614, 2.613, 2.612, 2.612, 2.611, 2.611, 2.611, 2.614, 2.615, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.633, 2.635, 2.635, 2.637, 2.637, 2.636, 2.637, 2.661,
+                            2.623, 2.624, 2.625, 2.626, 2.624, 2.621, 2.619, 2.617, 2.616, 2.615, 2.615, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.619, 2.621, 2.623, 2.626, 2.628, 2.631, 2.632, 2.634, 2.635, 2.636, 2.637, 2.638, 2.637, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.627, 2.626, 2.623, 2.619, 2.619, 2.618, 2.618, 2.618, 2.617, 2.617, 2.616, 2.616, 2.616, 2.619, 2.622, 2.623, 2.625, 2.628, 2.628, 2.631, 2.632, 2.634, 2.636, 2.638, 2.639, 2.639, 2.638, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.628, 2.626, 2.623, 2.621, 2.619, 2.619, 2.619, 2.619, 2.619, 2.619, 2.618, 2.618, 2.619, 2.623, 2.624, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.635, 2.638, 2.639, 2.639, 2.639, 2.636, 2.636, 2.662,
+                            2.625, 2.627, 2.628, 2.628, 2.626, 2.624, 2.623, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.624, 2.624, 2.625, 2.627, 2.628, 2.631, 2.631, 2.632, 2.634, 2.636, 2.639, 2.639, 2.641, 2.639, 2.635, 2.635, 2.663,
+                            2.625, 2.626, 2.628, 2.628, 2.627, 2.625, 2.624, 2.623, 2.623, 2.622, 2.623, 2.624, 2.624, 2.625, 2.625, 2.625, 2.625, 2.626, 2.627, 2.629, 2.631, 2.632, 2.633, 2.635, 2.638, 2.641, 2.642, 2.643, 2.642, 2.636, 2.636, 2.665,
+                            2.624, 2.626, 2.628, 2.628, 2.628, 2.626, 2.624, 2.624, 2.623, 2.623, 2.623, 2.625, 2.627, 2.627, 2.626, 2.626, 2.626, 2.627, 2.628, 2.629, 2.632, 2.633, 2.635, 2.637, 2.639, 2.642, 2.644, 2.644, 2.642, 2.638, 2.638, 2.665,
+                            2.623, 2.625, 2.626, 2.627, 2.626, 2.626, 2.624, 2.623, 2.623, 2.623, 2.623, 2.623, 2.626, 2.627, 2.626, 2.626, 2.626, 2.626, 2.628, 2.628, 2.629, 2.631, 2.634, 2.636, 2.639, 2.642, 2.644, 2.643, 2.641, 2.637, 2.638, 2.659,
+                            2.623, 2.627, 2.627, 2.627, 2.627, 2.628, 2.627, 2.624, 2.624, 2.623, 2.624, 2.624, 2.628, 2.628, 2.627, 2.628, 2.628, 2.628, 2.629, 2.629, 2.631, 2.635, 2.637, 2.639, 2.641, 2.643, 2.646, 2.645, 2.643, 2.641, 2.654, 2.659,
+                            2.642, 2.641, 2.643, 2.645, 2.645, 2.644, 2.644, 2.643, 2.643, 2.642, 2.642, 2.642, 2.643, 2.644, 2.644, 2.644, 2.646, 2.646, 2.647, 2.649, 2.651, 2.652, 2.654, 2.656, 2.658, 2.661, 2.661, 2.661, 2.659, 2.654, 2.659, 2.659
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.391, 1.394, 1.395, 1.396, 1.398, 1.398, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.398, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.399, 1.397, 1.399, 1.402,
+                            1.393, 1.395, 1.396, 1.398, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.401, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.399, 1.401, 1.401, 1.399, 1.398, 1.399, 1.402,
+                            1.398, 1.401, 1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.401, 1.401, 1.399, 1.399, 1.401, 1.401, 1.401, 1.401, 1.399, 1.401, 1.406,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.402, 1.403, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.405, 1.404, 1.404, 1.404, 1.404, 1.405, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.406, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.408, 1.408, 1.407, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.403, 1.402, 1.402, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.408, 1.407, 1.405, 1.405, 1.414,
+                            1.402, 1.402, 1.402, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.403, 1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.407, 1.409, 1.409, 1.409, 1.409, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.403, 1.404, 1.405, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.408, 1.405, 1.405, 1.413,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.402, 1.401, 1.399, 1.398, 1.398, 1.399, 1.399, 1.401, 1.403, 1.404, 1.405, 1.407, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.403, 1.404, 1.405, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.399, 1.401, 1.403, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.398, 1.401, 1.403, 1.406, 1.407, 1.409, 1.409, 1.411, 1.409, 1.409, 1.409, 1.408, 1.407, 1.407, 1.413,
+                            1.403, 1.404, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.404, 1.404, 1.403, 1.402, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.402, 1.404, 1.406, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.414,
+                            1.403, 1.403, 1.404, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.402, 1.401, 1.399, 1.398, 1.398, 1.398, 1.401, 1.403, 1.404, 1.408, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.402, 1.404, 1.406, 1.407, 1.408, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.409, 1.408, 1.408, 1.415,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.406, 1.408, 1.408, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.405, 1.406, 1.407, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.407, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.416,
+                            1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.406, 1.407, 1.407, 1.407, 1.408, 1.409, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.417,
+                            1.402, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.415,
+                            1.402, 1.402, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.405, 1.406, 1.406, 1.406, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.412, 1.412, 1.413, 1.413, 1.411, 1.408, 1.411, 1.413,
+                            1.406, 1.406, 1.408, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.414, 1.414, 1.414, 1.414, 1.415, 1.415, 1.415, 1.415, 1.416, 1.416, 1.416, 1.417, 1.418, 1.418, 1.417, 1.417, 1.414, 1.411, 1.413, 1.413
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.554, 1.522, 1.466, 1.422, 1.385, 1.351, 1.322, 1.294, 1.269, 1.246, 1.228, 1.214, 1.207, 1.202, 1.199, 1.199, 1.199, 1.199, 1.202, 1.207, 1.218, 1.235, 1.255, 1.279, 1.305, 1.333, 1.365, 1.402, 1.447, 1.508, 1.602, 1.638,
+                    1.522, 1.478, 1.431, 1.391, 1.355, 1.323, 1.298, 1.271, 1.247, 1.228, 1.212, 1.199, 1.187, 1.179, 1.173, 1.172, 1.172, 1.174, 1.179, 1.189, 1.201, 1.216, 1.235, 1.256, 1.282, 1.308, 1.335, 1.368, 1.411, 1.461, 1.535, 1.602,
+                    1.479, 1.449, 1.407, 1.367, 1.332, 1.301, 1.271, 1.247, 1.226, 1.208, 1.191, 1.178, 1.166, 1.158, 1.153, 1.151, 1.151, 1.153, 1.159, 1.168, 1.179, 1.194, 1.212, 1.234, 1.256, 1.282, 1.311, 1.343, 1.382, 1.427, 1.489, 1.535,
+                    1.454, 1.423, 1.383, 1.345, 1.309, 1.278, 1.249, 1.226, 1.206, 1.187, 1.171, 1.158, 1.146, 1.138, 1.132, 1.129, 1.129, 1.133, 1.139, 1.147, 1.159, 1.173, 1.191, 1.212, 1.234, 1.261, 1.288, 1.321, 1.357, 1.401, 1.455, 1.489,
+                    1.433, 1.401, 1.362, 1.325, 1.289, 1.258, 1.231, 1.206, 1.187, 1.169, 1.153, 1.138, 1.129, 1.121, 1.115, 1.112, 1.112, 1.114, 1.121, 1.129, 1.141, 1.155, 1.172, 1.191, 1.214, 1.241, 1.269, 1.301, 1.337, 1.377, 1.428, 1.457,
+                    1.415, 1.382, 1.343, 1.306, 1.273, 1.241, 1.213, 1.189, 1.169, 1.153, 1.137, 1.123, 1.112, 1.105, 1.097, 1.095, 1.095, 1.098, 1.103, 1.112, 1.124, 1.139, 1.155, 1.173, 1.197, 1.222, 1.252, 1.282, 1.317, 1.356, 1.405, 1.434,
+                    1.398, 1.363, 1.325, 1.289, 1.256, 1.224, 1.198, 1.175, 1.155, 1.137, 1.123, 1.108, 1.097, 1.089, 1.083, 1.079, 1.079, 1.083, 1.088, 1.097, 1.109, 1.124, 1.139, 1.158, 1.181, 1.206, 1.234, 1.266, 1.299, 1.339, 1.384, 1.415,
+                    1.382, 1.347, 1.309, 1.274, 1.242, 1.211, 1.185, 1.162, 1.142, 1.124, 1.108, 1.095, 1.083, 1.075, 1.069, 1.066, 1.066, 1.068, 1.074, 1.083, 1.096, 1.109, 1.125, 1.145, 1.166, 1.191, 1.219, 1.251, 1.285, 1.324, 1.367, 1.399,
+                    1.369, 1.334, 1.296, 1.261, 1.228, 1.199, 1.173, 1.151, 1.131, 1.112, 1.095, 1.083, 1.071, 1.062, 1.056, 1.053, 1.053, 1.055, 1.061, 1.069, 1.083, 1.096, 1.112, 1.132, 1.153, 1.178, 1.206, 1.237, 1.271, 1.309, 1.353, 1.385,
+                    1.359, 1.321, 1.284, 1.251, 1.217, 1.189, 1.164, 1.141, 1.121, 1.102, 1.086, 1.071, 1.061, 1.049, 1.045, 1.042, 1.042, 1.043, 1.051, 1.061, 1.069, 1.085, 1.101, 1.121, 1.143, 1.167, 1.195, 1.225, 1.259, 1.298, 1.341, 1.375,
+                    1.351, 1.312, 1.275, 1.241, 1.209, 1.181, 1.155, 1.133, 1.112, 1.092, 1.076, 1.061, 1.049, 1.041, 1.034, 1.032, 1.032, 1.035, 1.041, 1.051, 1.061, 1.075, 1.092, 1.112, 1.133, 1.158, 1.185, 1.216, 1.249, 1.288, 1.331, 1.364,
+                    1.344, 1.303, 1.267, 1.233, 1.201, 1.173, 1.147, 1.124, 1.104, 1.085, 1.067, 1.053, 1.041, 1.033, 1.024, 1.022, 1.022, 1.025, 1.034, 1.041, 1.053, 1.066, 1.083, 1.103, 1.126, 1.149, 1.177, 1.207, 1.241, 1.279, 1.321, 1.357,
+                    1.339, 1.297, 1.261, 1.226, 1.194, 1.166, 1.142, 1.119, 1.098, 1.078, 1.061, 1.046, 1.034, 1.024, 1.017, 1.014, 1.014, 1.017, 1.025, 1.034, 1.046, 1.059, 1.077, 1.096, 1.118, 1.143, 1.169, 1.201, 1.235, 1.273, 1.314, 1.352,
+                    1.337, 1.293, 1.256, 1.223, 1.191, 1.163, 1.136, 1.114, 1.093, 1.074, 1.056, 1.041, 1.027, 1.017, 1.012, 1.006, 1.006, 1.013, 1.017, 1.028, 1.041, 1.055, 1.072, 1.092, 1.114, 1.138, 1.165, 1.195, 1.229, 1.268, 1.309, 1.348,
+                    1.337, 1.291, 1.253, 1.219, 1.187, 1.159, 1.133, 1.109, 1.089, 1.071, 1.053, 1.037, 1.023, 1.012, 1.006, 1.002, 1.003, 1.006, 1.013, 1.023, 1.038, 1.052, 1.069, 1.089, 1.111, 1.135, 1.161, 1.192, 1.226, 1.264, 1.306, 1.348,
+                    1.337, 1.291, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.035, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.341, 1.292, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.034, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.348, 1.298, 1.255, 1.219, 1.188, 1.159, 1.134, 1.111, 1.088, 1.069, 1.051, 1.035, 1.021, 1.009, 1.003, 1.001, 1.002, 1.004, 1.011, 1.022, 1.036, 1.053, 1.071, 1.089, 1.111, 1.135, 1.162, 1.191, 1.226, 1.264, 1.306, 1.347,
+                    1.354, 1.306, 1.258, 1.222, 1.191, 1.162, 1.135, 1.113, 1.092, 1.073, 1.054, 1.038, 1.024, 1.014, 1.008, 1.003, 1.004, 1.008, 1.014, 1.026, 1.039, 1.056, 1.073, 1.093, 1.115, 1.139, 1.165, 1.195, 1.229, 1.267, 1.309, 1.349,
+                    1.358, 1.312, 1.263, 1.227, 1.195, 1.167, 1.141, 1.117, 1.097, 1.078, 1.061, 1.043, 1.029, 1.021, 1.014, 1.008, 1.008, 1.014, 1.021, 1.032, 1.045, 1.061, 1.078, 1.097, 1.119, 1.144, 1.169, 1.201, 1.234, 1.272, 1.315, 1.353,
+                    1.364, 1.319, 1.269, 1.234, 1.201, 1.174, 1.148, 1.124, 1.103, 1.084, 1.067, 1.052, 1.038, 1.029, 1.021, 1.016, 1.016, 1.021, 1.029, 1.038, 1.051, 1.067, 1.084, 1.103, 1.126, 1.151, 1.176, 1.207, 1.241, 1.279, 1.321, 1.358,
+                    1.371, 1.326, 1.277, 1.242, 1.209, 1.181, 1.155, 1.132, 1.111, 1.092, 1.075, 1.061, 1.049, 1.038, 1.029, 1.027, 1.027, 1.029, 1.038, 1.047, 1.061, 1.075, 1.092, 1.111, 1.133, 1.157, 1.185, 1.213, 1.247, 1.286, 1.329, 1.365,
+                    1.379, 1.334, 1.287, 1.251, 1.219, 1.191, 1.164, 1.141, 1.119, 1.101, 1.085, 1.071, 1.061, 1.049, 1.041, 1.038, 1.038, 1.041, 1.047, 1.059, 1.071, 1.084, 1.101, 1.119, 1.141, 1.165, 1.193, 1.223, 1.257, 1.295, 1.338, 1.374,
+                    1.389, 1.343, 1.298, 1.262, 1.231, 1.201, 1.174, 1.151, 1.131, 1.111, 1.095, 1.083, 1.071, 1.061, 1.054, 1.051, 1.051, 1.054, 1.059, 1.071, 1.081, 1.094, 1.111, 1.129, 1.152, 1.176, 1.203, 1.235, 1.269, 1.307, 1.351, 1.384,
+                    1.401, 1.351, 1.311, 1.274, 1.242, 1.214, 1.187, 1.164, 1.142, 1.124, 1.108, 1.095, 1.083, 1.074, 1.068, 1.066, 1.066, 1.068, 1.073, 1.081, 1.094, 1.108, 1.123, 1.141, 1.164, 1.188, 1.215, 1.247, 1.281, 1.321, 1.364, 1.396,
+                    1.412, 1.366, 1.327, 1.289, 1.257, 1.227, 1.201, 1.176, 1.156, 1.137, 1.122, 1.108, 1.096, 1.088, 1.083, 1.081, 1.081, 1.082, 1.087, 1.095, 1.108, 1.122, 1.136, 1.154, 1.177, 1.201, 1.229, 1.261, 1.296, 1.337, 1.382, 1.409,
+                    1.421, 1.383, 1.343, 1.306, 1.273, 1.243, 1.216, 1.192, 1.169, 1.152, 1.137, 1.122, 1.111, 1.103, 1.098, 1.095, 1.095, 1.097, 1.102, 1.111, 1.123, 1.136, 1.152, 1.169, 1.191, 1.217, 1.246, 1.278, 1.314, 1.354, 1.399, 1.429,
+                    1.434, 1.402, 1.362, 1.324, 1.291, 1.261, 1.232, 1.208, 1.187, 1.168, 1.152, 1.138, 1.127, 1.119, 1.114, 1.112, 1.112, 1.115, 1.121, 1.128, 1.139, 1.152, 1.169, 1.186, 1.209, 1.234, 1.262, 1.295, 1.332, 1.372, 1.419, 1.451,
+                    1.453, 1.422, 1.382, 1.344, 1.309, 1.278, 1.249, 1.226, 1.204, 1.187, 1.168, 1.155, 1.144, 1.135, 1.131, 1.131, 1.131, 1.133, 1.138, 1.146, 1.157, 1.171, 1.186, 1.206, 1.227, 1.252, 1.281, 1.314, 1.351, 1.393, 1.442, 1.473,
+                    1.475, 1.446, 1.404, 1.366, 1.329, 1.298, 1.269, 1.245, 1.224, 1.204, 1.188, 1.174, 1.163, 1.154, 1.149, 1.148, 1.148, 1.152, 1.156, 1.164, 1.176, 1.189, 1.206, 1.226, 1.247, 1.274, 1.303, 1.336, 1.374, 1.417, 1.471, 1.505,
+                    1.503, 1.472, 1.428, 1.389, 1.353, 1.321, 1.291, 1.266, 1.245, 1.224, 1.207, 1.192, 1.183, 1.174, 1.169, 1.167, 1.168, 1.169, 1.175, 1.183, 1.195, 1.209, 1.226, 1.247, 1.267, 1.294, 1.325, 1.359, 1.397, 1.445, 1.505, 1.548,
+                    1.534, 1.503, 1.455, 1.413, 1.378, 1.344, 1.315, 1.289, 1.265, 1.243, 1.224, 1.207, 1.196, 1.192, 1.189, 1.189, 1.189, 1.189, 1.192, 1.198, 1.209, 1.226, 1.244, 1.266, 1.291, 1.318, 1.349, 1.383, 1.425, 1.475, 1.548, 1.591
+                ],
+                "sigma": 0.00095,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2850,
+                        "ccm":
+                        [
+                            1.97469, -0.71439, -0.26031,
+                            -0.43521, 2.09769, -0.66248,
+                            -0.04826, -0.84642, 1.89468
+                        ]
+                    },
+                    {
+                        "ct": 2960,
+                        "ccm":
+                        [
+                            2.12952, -0.91185, -0.21768,
+                            -0.38018, 1.90789, -0.52771,
+                            0.03988, -1.10079, 2.06092
+                        ]
+                    },
+                    {
+                        "ct": 3580,
+                        "ccm":
+                        [
+                            2.03422, -0.80048, -0.23374,
+                            -0.39089, 1.97221, -0.58132,
+                            -0.08969, -0.61439, 1.70408
+                        ]
+                    },
+                    {
+                        "ct": 4559,
+                        "ccm":
+                        [
+                            2.15423, -0.98143, -0.17279,
+                            -0.38131, 2.14763, -0.76632,
+                            -0.10069, -0.54383, 1.64452
+                        ]
+                    },
+                    {
+                        "ct": 5881,
+                        "ccm":
+                        [
+                            2.18464, -0.95493, -0.22971,
+                            -0.36826, 2.00298, -0.63471,
+                            -0.15219, -0.38055, 1.53274
+                        ]
+                    },
+                    {
+                        "ct": 7600,
+                        "ccm":
+                        [
+                            2.30687, -0.97295, -0.33392,
+                            -0.30872, 2.32779, -1.01908,
+                            -0.17761, -0.55891, 1.73651
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.cac":
+            {
+                "strength": 1.0,
+                "lut_rx":
+                [
+                    -0.46, -0.31, -0.17, -0.05, 0.04, 0.14, 0.28, 0.36, 0.58,
+                    -0.43, -0.28, -0.16, -0.05, 0.05, 0.14, 0.24, 0.36, 0.58,
+                    -0.42, -0.27, -0.15, -0.05, 0.05, 0.14, 0.23, 0.34, 0.58,
+                    -0.39, -0.25, -0.14, -0.04, 0.05, 0.15, 0.24, 0.35, 0.56,
+                    -0.35, -0.24, -0.14, -0.04, 0.05, 0.14, 0.25, 0.35, 0.56,
+                    -0.33, -0.22, -0.13, -0.04, 0.04, 0.13, 0.24, 0.33, 0.54,
+                    -0.33, -0.22, -0.13, -0.04, 0.04, 0.13, 0.23, 0.31, 0.5,
+                    -0.32, -0.23, -0.13, -0.04, 0.04, 0.12, 0.21, 0.29, 0.46,
+                    -0.33, -0.24, -0.15, -0.05, 0.03, 0.11, 0.19, 0.26, 0.43
+                ],
+                "lut_ry":
+                [
+                    -0.39, -0.34, -0.31, -0.29, -0.27, -0.29, -0.32, -0.31, -0.32,
+                    -0.29, -0.24, -0.22, -0.21, -0.22, -0.21, -0.21, -0.22, -0.23,
+                    -0.22, -0.17, -0.17, -0.17, -0.17, -0.17, -0.16, -0.16, -0.18,
+                    -0.13, -0.09, -0.09, -0.1, -0.1, -0.1, -0.09, -0.08, -0.11,
+                    -0.04, -0.02, -0.03, -0.03, -0.03, -0.03, -0.02, -0.01, -0.02,
+                    0.03, 0.05, 0.03, 0.03, 0.02, 0.03, 0.04, 0.06, 0.05,
+                    0.11, 0.11, 0.09, 0.08, 0.09, 0.09, 0.1, 0.11, 0.11,
+                    0.17, 0.16, 0.14, 0.13, 0.13, 0.13, 0.14, 0.15, 0.15,
+                    0.24, 0.23, 0.21, 0.19, 0.18, 0.2, 0.2, 0.2, 0.21
+                ],
+                "lut_bx":
+                [
+                    -0.33, -0.22, -0.13, -0.05, 0.01, 0.09, 0.19, 0.25, 0.39,
+                    -0.3, -0.19, -0.12, -0.04, 0.01, 0.06, 0.15, 0.23, 0.38,
+                    -0.28, -0.18, -0.1, -0.04, 0.01, 0.06, 0.14, 0.22, 0.38,
+                    -0.25, -0.16, -0.09, -0.04, 0.01, 0.06, 0.14, 0.23, 0.39,
+                    -0.22, -0.15, -0.09, -0.03, 0.01, 0.06, 0.14, 0.23, 0.42,
+                    -0.21, -0.14, -0.09, -0.04, 0.0, 0.06, 0.13, 0.21, 0.39,
+                    -0.21, -0.14, -0.08, -0.04, 0.0, 0.06, 0.13, 0.2, 0.34,
+                    -0.21, -0.14, -0.08, -0.04, 0.0, 0.06, 0.12, 0.19, 0.31,
+                    -0.21, -0.15, -0.08, -0.03, 0.0, 0.06, 0.12, 0.17, 0.29
+                ],
+                "lut_by":
+                [
+                    -0.3, -0.24, -0.21, -0.19, -0.19, -0.19, -0.23, -0.23, -0.27,
+                    -0.23, -0.17, -0.14, -0.12, -0.12, -0.13, -0.15, -0.17, -0.21,
+                    -0.17, -0.11, -0.09, -0.08, -0.08, -0.08, -0.1, -0.11, -0.16,
+                    -0.09, -0.05, -0.04, -0.03, -0.03, -0.03, -0.04, -0.06, -0.11,
+                    -0.03, -0.01, 0.0, 0.01, 0.01, 0.01, 0.0, -0.0, -0.05,
+                    0.02, 0.04, 0.04, 0.04, 0.05, 0.05, 0.05, 0.05, 0.01,
+                    0.07, 0.08, 0.09, 0.09, 0.1, 0.1, 0.1, 0.09, 0.06,
+                    0.11, 0.12, 0.11, 0.12, 0.12, 0.13, 0.13, 0.13, 0.1,
+                    0.16, 0.17, 0.16, 0.16, 0.16, 0.17, 0.17, 0.17, 0.15
+                ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx477_noir.json b/src/ipa/rpi/pisp/data/imx477_noir.json
new file mode 100644
index 000000000..defc4f4d5
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx477_noir.json
@@ -0,0 +1,1148 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 12000,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 740,
+                "reference_Y": 15051
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.809
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 204,
+                "slope": 0.0061
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "bayes": 0
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.359, 2.354, 2.351, 2.351, 2.343, 2.337, 2.331, 2.325, 2.323, 2.321, 2.317, 2.315, 2.313, 2.313, 2.311, 2.312, 2.312, 2.313, 2.315, 2.315, 2.316, 2.317, 2.319, 2.323, 2.326, 2.329, 2.332, 2.332, 2.335, 2.337, 2.352, 2.363,
+                            2.352, 2.351, 2.349, 2.346, 2.342, 2.334, 2.328, 2.324, 2.321, 2.317, 2.315, 2.314, 2.312, 2.311, 2.311, 2.311, 2.311, 2.311, 2.312, 2.314, 2.315, 2.316, 2.317, 2.319, 2.324, 2.326, 2.328, 2.329, 2.331, 2.337, 2.348, 2.355,
+                            2.346, 2.346, 2.345, 2.344, 2.338, 2.329, 2.325, 2.319, 2.316, 2.314, 2.311, 2.309, 2.308, 2.306, 2.304, 2.304, 2.305, 2.307, 2.308, 2.309, 2.311, 2.311, 2.313, 2.316, 2.319, 2.322, 2.325, 2.326, 2.328, 2.335, 2.343, 2.349,
+                            2.342, 2.342, 2.341, 2.338, 2.332, 2.326, 2.319, 2.316, 2.312, 2.309, 2.308, 2.305, 2.303, 2.302, 2.301, 2.301, 2.302, 2.303, 2.304, 2.305, 2.305, 2.307, 2.311, 2.313, 2.315, 2.319, 2.321, 2.325, 2.328, 2.333, 2.338, 2.348,
+                            2.337, 2.337, 2.337, 2.336, 2.331, 2.322, 2.317, 2.312, 2.309, 2.307, 2.304, 2.302, 2.299, 2.299, 2.298, 2.298, 2.299, 2.299, 2.301, 2.302, 2.302, 2.304, 2.305, 2.309, 2.314, 2.316, 2.321, 2.324, 2.326, 2.329, 2.335, 2.343,
+                            2.335, 2.334, 2.333, 2.333, 2.326, 2.318, 2.313, 2.309, 2.306, 2.302, 2.299, 2.297, 2.297, 2.296, 2.295, 2.295, 2.294, 2.295, 2.296, 2.298, 2.298, 2.301, 2.303, 2.305, 2.311, 2.315, 2.319, 2.323, 2.325, 2.329, 2.333, 2.339,
+                            2.329, 2.331, 2.329, 2.329, 2.325, 2.315, 2.309, 2.306, 2.302, 2.299, 2.297, 2.295, 2.293, 2.292, 2.291, 2.291, 2.291, 2.291, 2.293, 2.294, 2.296, 2.298, 2.301, 2.304, 2.307, 2.313, 2.317, 2.319, 2.323, 2.327, 2.331, 2.339,
+                            2.329, 2.328, 2.328, 2.328, 2.321, 2.313, 2.307, 2.303, 2.299, 2.295, 2.294, 2.292, 2.289, 2.289, 2.288, 2.288, 2.288, 2.289, 2.289, 2.292, 2.294, 2.295, 2.297, 2.301, 2.306, 2.311, 2.315, 2.318, 2.319, 2.323, 2.329, 2.335,
+                            2.326, 2.327, 2.325, 2.325, 2.319, 2.311, 2.305, 2.299, 2.296, 2.293, 2.291, 2.289, 2.288, 2.287, 2.285, 2.285, 2.286, 2.288, 2.288, 2.289, 2.291, 2.294, 2.295, 2.298, 2.304, 2.308, 2.313, 2.315, 2.317, 2.319, 2.327, 2.335,
+                            2.325, 2.325, 2.323, 2.323, 2.317, 2.309, 2.303, 2.298, 2.294, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.284, 2.284, 2.285, 2.287, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.305, 2.309, 2.313, 2.315, 2.317, 2.325, 2.334,
+                            2.322, 2.324, 2.322, 2.322, 2.316, 2.306, 2.301, 2.296, 2.292, 2.289, 2.287, 2.286, 2.285, 2.284, 2.283, 2.283, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.293, 2.296, 2.301, 2.304, 2.308, 2.311, 2.312, 2.315, 2.323, 2.333,
+                            2.321, 2.323, 2.322, 2.322, 2.314, 2.306, 2.299, 2.294, 2.291, 2.288, 2.286, 2.285, 2.284, 2.282, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.289, 2.291, 2.291, 2.294, 2.297, 2.302, 2.306, 2.308, 2.311, 2.312, 2.322, 2.332,
+                            2.319, 2.321, 2.321, 2.321, 2.314, 2.305, 2.297, 2.293, 2.289, 2.287, 2.285, 2.284, 2.283, 2.281, 2.281, 2.281, 2.282, 2.283, 2.283, 2.285, 2.287, 2.289, 2.291, 2.292, 2.297, 2.301, 2.305, 2.307, 2.309, 2.312, 2.321, 2.333,
+                            2.319, 2.321, 2.319, 2.319, 2.314, 2.303, 2.296, 2.293, 2.289, 2.286, 2.285, 2.283, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.288, 2.289, 2.291, 2.296, 2.301, 2.305, 2.307, 2.308, 2.312, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.296, 2.291, 2.289, 2.286, 2.284, 2.282, 2.281, 2.281, 2.281, 2.281, 2.282, 2.282, 2.283, 2.284, 2.286, 2.287, 2.288, 2.291, 2.295, 2.299, 2.304, 2.306, 2.307, 2.311, 2.321, 2.332,
+                            2.319, 2.321, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.287, 2.285, 2.282, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.284, 2.285, 2.286, 2.288, 2.291, 2.295, 2.299, 2.303, 2.306, 2.307, 2.312, 2.321, 2.331,
+                            2.318, 2.319, 2.319, 2.319, 2.313, 2.303, 2.297, 2.292, 2.289, 2.286, 2.285, 2.282, 2.281, 2.281, 2.281, 2.282, 2.282, 2.282, 2.282, 2.283, 2.285, 2.286, 2.287, 2.291, 2.294, 2.298, 2.303, 2.306, 2.307, 2.311, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.302, 2.297, 2.292, 2.289, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.287, 2.289, 2.294, 2.297, 2.303, 2.305, 2.308, 2.313, 2.321, 2.331,
+                            2.319, 2.319, 2.319, 2.319, 2.313, 2.303, 2.299, 2.293, 2.291, 2.287, 2.285, 2.283, 2.282, 2.281, 2.281, 2.282, 2.283, 2.283, 2.283, 2.283, 2.285, 2.286, 2.288, 2.291, 2.294, 2.298, 2.304, 2.306, 2.308, 2.312, 2.322, 2.331,
+                            2.319, 2.321, 2.321, 2.321, 2.315, 2.305, 2.301, 2.295, 2.292, 2.289, 2.286, 2.285, 2.283, 2.282, 2.282, 2.282, 2.284, 2.283, 2.284, 2.284, 2.285, 2.287, 2.288, 2.291, 2.294, 2.299, 2.304, 2.306, 2.309, 2.313, 2.322, 2.334,
+                            2.321, 2.322, 2.322, 2.322, 2.317, 2.307, 2.301, 2.296, 2.292, 2.291, 2.288, 2.286, 2.285, 2.284, 2.283, 2.284, 2.285, 2.284, 2.285, 2.285, 2.287, 2.288, 2.289, 2.293, 2.297, 2.301, 2.305, 2.308, 2.311, 2.314, 2.323, 2.335,
+                            2.322, 2.324, 2.324, 2.324, 2.319, 2.309, 2.303, 2.297, 2.295, 2.292, 2.291, 2.288, 2.286, 2.286, 2.285, 2.286, 2.286, 2.286, 2.287, 2.288, 2.289, 2.289, 2.291, 2.294, 2.299, 2.302, 2.307, 2.311, 2.312, 2.316, 2.325, 2.335,
+                            2.324, 2.326, 2.325, 2.326, 2.321, 2.311, 2.305, 2.301, 2.297, 2.295, 2.293, 2.291, 2.289, 2.289, 2.288, 2.288, 2.287, 2.288, 2.289, 2.291, 2.292, 2.292, 2.295, 2.299, 2.301, 2.304, 2.309, 2.312, 2.315, 2.319, 2.327, 2.337,
+                            2.329, 2.329, 2.328, 2.328, 2.323, 2.315, 2.308, 2.304, 2.301, 2.298, 2.296, 2.294, 2.291, 2.291, 2.289, 2.291, 2.291, 2.291, 2.292, 2.293, 2.294, 2.295, 2.297, 2.299, 2.303, 2.308, 2.312, 2.315, 2.318, 2.321, 2.329, 2.339,
+                            2.329, 2.331, 2.332, 2.332, 2.326, 2.318, 2.311, 2.306, 2.304, 2.301, 2.299, 2.297, 2.295, 2.293, 2.292, 2.292, 2.292, 2.293, 2.294, 2.294, 2.296, 2.297, 2.299, 2.302, 2.306, 2.311, 2.315, 2.318, 2.319, 2.324, 2.332, 2.342,
+                            2.331, 2.333, 2.334, 2.334, 2.328, 2.321, 2.313, 2.308, 2.305, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.295, 2.294, 2.296, 2.296, 2.297, 2.298, 2.299, 2.302, 2.305, 2.308, 2.314, 2.317, 2.321, 2.323, 2.327, 2.334, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.309, 2.306, 2.304, 2.303, 2.301, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.309, 2.315, 2.319, 2.321, 2.324, 2.328, 2.337, 2.346,
+                            2.331, 2.332, 2.334, 2.334, 2.329, 2.321, 2.314, 2.311, 2.306, 2.304, 2.303, 2.302, 2.299, 2.297, 2.295, 2.295, 2.296, 2.297, 2.298, 2.298, 2.299, 2.301, 2.303, 2.306, 2.311, 2.314, 2.319, 2.323, 2.325, 2.329, 2.339, 2.348,
+                            2.329, 2.329, 2.329, 2.331, 2.326, 2.319, 2.312, 2.309, 2.304, 2.303, 2.302, 2.301, 2.298, 2.295, 2.294, 2.294, 2.295, 2.295, 2.296, 2.297, 2.299, 2.301, 2.302, 2.304, 2.308, 2.313, 2.319, 2.322, 2.325, 2.329, 2.339, 2.351,
+                            2.329, 2.329, 2.329, 2.329, 2.326, 2.317, 2.311, 2.308, 2.303, 2.302, 2.301, 2.298, 2.296, 2.295, 2.294, 2.294, 2.294, 2.294, 2.296, 2.297, 2.298, 2.299, 2.301, 2.304, 2.307, 2.312, 2.318, 2.322, 2.326, 2.331, 2.341, 2.355,
+                            2.339, 2.332, 2.331, 2.331, 2.327, 2.323, 2.316, 2.309, 2.306, 2.302, 2.301, 2.299, 2.297, 2.296, 2.295, 2.294, 2.294, 2.296, 2.297, 2.297, 2.299, 2.301, 2.303, 2.306, 2.308, 2.317, 2.322, 2.325, 2.329, 2.341, 2.353, 2.361,
+                            2.347, 2.347, 2.345, 2.343, 2.338, 2.332, 2.326, 2.322, 2.321, 2.318, 2.316, 2.315, 2.313, 2.312, 2.311, 2.311, 2.311, 2.311, 2.312, 2.315, 2.317, 2.318, 2.319, 2.323, 2.324, 2.329, 2.334, 2.337, 2.344, 2.347, 2.361, 2.364
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            3.869, 3.852, 3.844, 3.842, 3.836, 3.821, 3.807, 3.796, 3.789, 3.784, 3.778, 3.775, 3.769, 3.768, 3.765, 3.765, 3.767, 3.769, 3.772, 3.774, 3.773, 3.775, 3.779, 3.787, 3.793, 3.801, 3.806, 3.804, 3.813, 3.819, 3.855, 3.879,
+                            3.854, 3.844, 3.837, 3.836, 3.824, 3.811, 3.797, 3.789, 3.784, 3.777, 3.774, 3.769, 3.764, 3.758, 3.757, 3.758, 3.758, 3.761, 3.763, 3.764, 3.765, 3.766, 3.772, 3.778, 3.787, 3.792, 3.794, 3.798, 3.802, 3.815, 3.839, 3.873,
+                            3.838, 3.831, 3.826, 3.823, 3.813, 3.799, 3.787, 3.781, 3.773, 3.768, 3.763, 3.759, 3.753, 3.749, 3.745, 3.745, 3.745, 3.752, 3.754, 3.757, 3.757, 3.759, 3.763, 3.769, 3.773, 3.781, 3.786, 3.792, 3.798, 3.811, 3.831, 3.861,
+                            3.833, 3.822, 3.817, 3.816, 3.804, 3.788, 3.779, 3.772, 3.766, 3.759, 3.755, 3.749, 3.744, 3.741, 3.738, 3.739, 3.739, 3.741, 3.743, 3.747, 3.749, 3.751, 3.756, 3.764, 3.769, 3.776, 3.783, 3.789, 3.798, 3.809, 3.821, 3.855,
+                            3.824, 3.818, 3.808, 3.808, 3.797, 3.781, 3.772, 3.764, 3.757, 3.752, 3.747, 3.743, 3.737, 3.735, 3.733, 3.733, 3.733, 3.735, 3.737, 3.738, 3.741, 3.746, 3.749, 3.755, 3.766, 3.771, 3.781, 3.789, 3.794, 3.806, 3.818, 3.849,
+                            3.815, 3.808, 3.799, 3.801, 3.787, 3.775, 3.767, 3.757, 3.751, 3.745, 3.738, 3.734, 3.732, 3.727, 3.725, 3.723, 3.722, 3.722, 3.726, 3.729, 3.734, 3.738, 3.744, 3.749, 3.759, 3.769, 3.781, 3.788, 3.792, 3.799, 3.811, 3.841,
+                            3.804, 3.799, 3.793, 3.793, 3.783, 3.771, 3.759, 3.751, 3.744, 3.735, 3.732, 3.727, 3.723, 3.721, 3.719, 3.716, 3.716, 3.716, 3.718, 3.722, 3.727, 3.731, 3.737, 3.746, 3.756, 3.767, 3.776, 3.782, 3.788, 3.795, 3.808, 3.831,
+                            3.802, 3.797, 3.787, 3.787, 3.779, 3.762, 3.753, 3.744, 3.734, 3.727, 3.725, 3.721, 3.716, 3.714, 3.709, 3.709, 3.711, 3.711, 3.712, 3.717, 3.722, 3.725, 3.731, 3.739, 3.752, 3.762, 3.772, 3.778, 3.779, 3.789, 3.798, 3.826,
+                            3.791, 3.789, 3.784, 3.784, 3.775, 3.759, 3.746, 3.735, 3.729, 3.724, 3.718, 3.714, 3.712, 3.707, 3.704, 3.704, 3.706, 3.708, 3.709, 3.711, 3.716, 3.722, 3.726, 3.735, 3.746, 3.754, 3.767, 3.774, 3.777, 3.781, 3.794, 3.824,
+                            3.789, 3.784, 3.779, 3.781, 3.771, 3.753, 3.741, 3.732, 3.725, 3.719, 3.715, 3.711, 3.707, 3.704, 3.701, 3.701, 3.702, 3.704, 3.708, 3.709, 3.713, 3.718, 3.724, 3.731, 3.742, 3.749, 3.761, 3.768, 3.772, 3.778, 3.791, 3.822,
+                            3.789, 3.781, 3.777, 3.777, 3.764, 3.749, 3.739, 3.729, 3.722, 3.718, 3.711, 3.708, 3.705, 3.701, 3.699, 3.699, 3.699, 3.701, 3.705, 3.707, 3.711, 3.715, 3.721, 3.727, 3.738, 3.746, 3.757, 3.763, 3.765, 3.773, 3.788, 3.821,
+                            3.785, 3.779, 3.774, 3.774, 3.764, 3.747, 3.736, 3.726, 3.719, 3.711, 3.709, 3.706, 3.701, 3.698, 3.696, 3.695, 3.695, 3.698, 3.702, 3.704, 3.707, 3.712, 3.718, 3.725, 3.734, 3.741, 3.753, 3.756, 3.759, 3.764, 3.784, 3.818,
+                            3.779, 3.776, 3.773, 3.773, 3.759, 3.744, 3.733, 3.724, 3.714, 3.709, 3.706, 3.704, 3.699, 3.696, 3.694, 3.694, 3.694, 3.697, 3.701, 3.703, 3.706, 3.709, 3.714, 3.721, 3.731, 3.737, 3.749, 3.753, 3.758, 3.762, 3.783, 3.819,
+                            3.779, 3.776, 3.769, 3.769, 3.757, 3.741, 3.729, 3.721, 3.712, 3.708, 3.705, 3.701, 3.697, 3.695, 3.694, 3.694, 3.695, 3.696, 3.698, 3.702, 3.705, 3.709, 3.712, 3.717, 3.728, 3.736, 3.749, 3.752, 3.756, 3.761, 3.781, 3.815,
+                            3.779, 3.773, 3.768, 3.768, 3.756, 3.738, 3.731, 3.719, 3.711, 3.707, 3.703, 3.698, 3.695, 3.694, 3.694, 3.695, 3.695, 3.695, 3.696, 3.702, 3.705, 3.708, 3.712, 3.717, 3.728, 3.736, 3.747, 3.751, 3.754, 3.761, 3.781, 3.815,
+                            3.782, 3.773, 3.767, 3.767, 3.755, 3.738, 3.728, 3.721, 3.711, 3.707, 3.701, 3.698, 3.695, 3.693, 3.694, 3.696, 3.695, 3.695, 3.695, 3.701, 3.703, 3.706, 3.711, 3.715, 3.726, 3.735, 3.745, 3.751, 3.754, 3.763, 3.779, 3.815,
+                            3.781, 3.771, 3.767, 3.767, 3.754, 3.739, 3.726, 3.721, 3.712, 3.706, 3.701, 3.698, 3.695, 3.693, 3.693, 3.695, 3.695, 3.695, 3.696, 3.698, 3.703, 3.705, 3.709, 3.715, 3.725, 3.734, 3.745, 3.751, 3.755, 3.762, 3.783, 3.818,
+                            3.781, 3.774, 3.767, 3.767, 3.755, 3.741, 3.729, 3.722, 3.712, 3.708, 3.701, 3.699, 3.695, 3.693, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.725, 3.732, 3.746, 3.751, 3.756, 3.763, 3.783, 3.821,
+                            3.781, 3.774, 3.769, 3.769, 3.756, 3.741, 3.731, 3.724, 3.713, 3.711, 3.707, 3.699, 3.697, 3.694, 3.693, 3.694, 3.695, 3.695, 3.697, 3.698, 3.702, 3.704, 3.709, 3.713, 3.724, 3.734, 3.747, 3.751, 3.756, 3.765, 3.784, 3.821,
+                            3.784, 3.776, 3.773, 3.773, 3.759, 3.742, 3.733, 3.726, 3.719, 3.711, 3.709, 3.703, 3.698, 3.695, 3.694, 3.695, 3.697, 3.696, 3.698, 3.699, 3.703, 3.706, 3.711, 3.714, 3.727, 3.735, 3.746, 3.751, 3.757, 3.766, 3.787, 3.822,
+                            3.786, 3.783, 3.774, 3.774, 3.766, 3.747, 3.737, 3.727, 3.722, 3.716, 3.711, 3.706, 3.702, 3.698, 3.697, 3.698, 3.699, 3.699, 3.701, 3.703, 3.706, 3.711, 3.713, 3.719, 3.731, 3.739, 3.748, 3.753, 3.761, 3.769, 3.789, 3.826,
+                            3.786, 3.784, 3.779, 3.779, 3.769, 3.751, 3.742, 3.732, 3.725, 3.719, 3.715, 3.711, 3.706, 3.704, 3.701, 3.701, 3.702, 3.702, 3.705, 3.707, 3.712, 3.714, 3.717, 3.724, 3.733, 3.743, 3.749, 3.758, 3.764, 3.769, 3.791, 3.826,
+                            3.793, 3.787, 3.782, 3.782, 3.774, 3.756, 3.747, 3.737, 3.729, 3.725, 3.719, 3.715, 3.712, 3.708, 3.707, 3.706, 3.707, 3.708, 3.709, 3.713, 3.714, 3.717, 3.723, 3.729, 3.736, 3.747, 3.757, 3.764, 3.768, 3.774, 3.794, 3.829,
+                            3.794, 3.791, 3.786, 3.786, 3.779, 3.762, 3.751, 3.742, 3.735, 3.729, 3.725, 3.719, 3.716, 3.711, 3.709, 3.709, 3.709, 3.711, 3.716, 3.717, 3.721, 3.723, 3.726, 3.732, 3.741, 3.752, 3.761, 3.767, 3.773, 3.779, 3.801, 3.829,
+                            3.802, 3.798, 3.793, 3.793, 3.779, 3.766, 3.754, 3.746, 3.741, 3.736, 3.731, 3.726, 3.719, 3.717, 3.716, 3.715, 3.716, 3.717, 3.719, 3.721, 3.724, 3.726, 3.731, 3.737, 3.744, 3.756, 3.766, 3.772, 3.776, 3.784, 3.807, 3.839,
+                            3.805, 3.799, 3.795, 3.795, 3.784, 3.767, 3.757, 3.749, 3.744, 3.739, 3.736, 3.731, 3.726, 3.722, 3.719, 3.719, 3.719, 3.721, 3.723, 3.725, 3.727, 3.732, 3.738, 3.742, 3.751, 3.761, 3.771, 3.775, 3.782, 3.789, 3.811, 3.841,
+                            3.804, 3.801, 3.799, 3.799, 3.787, 3.772, 3.761, 3.752, 3.746, 3.742, 3.739, 3.735, 3.729, 3.726, 3.723, 3.724, 3.725, 3.726, 3.727, 3.728, 3.732, 3.736, 3.739, 3.745, 3.754, 3.765, 3.775, 3.779, 3.785, 3.795, 3.816, 3.844,
+                            3.801, 3.799, 3.796, 3.796, 3.787, 3.773, 3.761, 3.753, 3.746, 3.743, 3.739, 3.735, 3.731, 3.726, 3.725, 3.725, 3.725, 3.726, 3.727, 3.729, 3.733, 3.736, 3.741, 3.745, 3.755, 3.766, 3.776, 3.783, 3.786, 3.797, 3.819, 3.851,
+                            3.799, 3.795, 3.788, 3.788, 3.783, 3.772, 3.759, 3.749, 3.744, 3.738, 3.735, 3.733, 3.726, 3.724, 3.722, 3.722, 3.723, 3.724, 3.725, 3.727, 3.729, 3.733, 3.736, 3.742, 3.754, 3.762, 3.772, 3.779, 3.784, 3.796, 3.821, 3.859,
+                            3.799, 3.789, 3.787, 3.788, 3.779, 3.766, 3.755, 3.749, 3.742, 3.736, 3.733, 3.727, 3.723, 3.722, 3.721, 3.719, 3.719, 3.721, 3.725, 3.726, 3.728, 3.732, 3.734, 3.741, 3.747, 3.758, 3.771, 3.778, 3.785, 3.796, 3.825, 3.862,
+                            3.824, 3.799, 3.789, 3.789, 3.788, 3.777, 3.761, 3.751, 3.743, 3.739, 3.736, 3.728, 3.726, 3.725, 3.721, 3.719, 3.721, 3.723, 3.727, 3.728, 3.729, 3.733, 3.737, 3.744, 3.755, 3.769, 3.776, 3.784, 3.793, 3.819, 3.863, 3.877,
+                            3.833, 3.833, 3.833, 3.842, 3.825, 3.815, 3.807, 3.799, 3.792, 3.788, 3.785, 3.782, 3.778, 3.777, 3.773, 3.772, 3.772, 3.774, 3.778, 3.779, 3.779, 3.785, 3.792, 3.798, 3.803, 3.811, 3.822, 3.834, 3.843, 3.846, 3.877, 3.886
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.616, 2.616, 2.618, 2.621, 2.619, 2.618, 2.615, 2.615, 2.613, 2.611, 2.609, 2.609, 2.609, 2.611, 2.611, 2.611, 2.611, 2.609, 2.608, 2.608, 2.611, 2.613, 2.613, 2.614, 2.614, 2.615, 2.615, 2.622, 2.624, 2.621, 2.624, 2.641,
+                            2.616, 2.618, 2.621, 2.623, 2.623, 2.619, 2.618, 2.616, 2.616, 2.613, 2.611, 2.611, 2.611, 2.611, 2.612, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.612, 2.613, 2.612, 2.613, 2.615, 2.617, 2.621, 2.621, 2.619, 2.621, 2.641,
+                            2.621, 2.624, 2.627, 2.627, 2.625, 2.623, 2.621, 2.619, 2.618, 2.618, 2.618, 2.617, 2.616, 2.616, 2.615, 2.613, 2.612, 2.613, 2.613, 2.614, 2.614, 2.613, 2.614, 2.613, 2.614, 2.617, 2.619, 2.621, 2.621, 2.619, 2.623, 2.643,
+                            2.626, 2.627, 2.628, 2.629, 2.628, 2.625, 2.622, 2.621, 2.621, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.616, 2.616, 2.616, 2.618, 2.618, 2.617, 2.617, 2.618, 2.619, 2.621, 2.623, 2.624, 2.626, 2.625, 2.624, 2.625, 2.654,
+                            2.627, 2.628, 2.628, 2.628, 2.626, 2.623, 2.622, 2.622, 2.622, 2.622, 2.621, 2.621, 2.619, 2.617, 2.617, 2.616, 2.617, 2.617, 2.618, 2.619, 2.618, 2.618, 2.618, 2.621, 2.622, 2.624, 2.626, 2.627, 2.627, 2.626, 2.628, 2.655,
+                            2.625, 2.626, 2.627, 2.626, 2.625, 2.623, 2.622, 2.621, 2.622, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.616, 2.616, 2.616, 2.616, 2.616, 2.617, 2.618, 2.619, 2.621, 2.622, 2.624, 2.626, 2.628, 2.628, 2.629, 2.629, 2.655,
+                            2.626, 2.625, 2.626, 2.625, 2.625, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.616, 2.614, 2.613, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.618, 2.619, 2.621, 2.623, 2.624, 2.627, 2.629, 2.631, 2.629, 2.631, 2.651,
+                            2.625, 2.625, 2.625, 2.624, 2.623, 2.623, 2.622, 2.622, 2.622, 2.621, 2.619, 2.617, 2.614, 2.613, 2.612, 2.611, 2.611, 2.612, 2.612, 2.613, 2.616, 2.618, 2.619, 2.622, 2.624, 2.626, 2.628, 2.631, 2.631, 2.631, 2.631, 2.651,
+                            2.625, 2.625, 2.624, 2.623, 2.622, 2.622, 2.622, 2.622, 2.622, 2.621, 2.617, 2.615, 2.613, 2.612, 2.611, 2.611, 2.611, 2.611, 2.611, 2.613, 2.615, 2.618, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.624, 2.624, 2.622, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.618, 2.616, 2.614, 2.612, 2.611, 2.609, 2.609, 2.608, 2.609, 2.611, 2.611, 2.615, 2.617, 2.619, 2.621, 2.625, 2.628, 2.631, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.622, 2.623, 2.622, 2.622, 2.621, 2.619, 2.619, 2.619, 2.618, 2.616, 2.614, 2.613, 2.611, 2.609, 2.608, 2.606, 2.607, 2.607, 2.609, 2.611, 2.615, 2.617, 2.619, 2.622, 2.626, 2.629, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.622, 2.622, 2.621, 2.619, 2.619, 2.618, 2.617, 2.614, 2.613, 2.611, 2.611, 2.607, 2.606, 2.605, 2.604, 2.605, 2.607, 2.609, 2.613, 2.616, 2.619, 2.622, 2.627, 2.631, 2.632, 2.632, 2.631, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.621, 2.621, 2.619, 2.617, 2.616, 2.615, 2.613, 2.609, 2.607, 2.604, 2.602, 2.601, 2.602, 2.603, 2.605, 2.609, 2.612, 2.616, 2.619, 2.624, 2.628, 2.631, 2.632, 2.633, 2.629, 2.627, 2.627, 2.651,
+                            2.619, 2.621, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.615, 2.614, 2.612, 2.608, 2.603, 2.601, 2.598, 2.597, 2.599, 2.602, 2.605, 2.608, 2.611, 2.615, 2.622, 2.625, 2.629, 2.631, 2.631, 2.633, 2.631, 2.627, 2.627, 2.651,
+                            2.621, 2.622, 2.623, 2.623, 2.622, 2.621, 2.618, 2.617, 2.616, 2.614, 2.611, 2.606, 2.601, 2.598, 2.595, 2.595, 2.597, 2.601, 2.604, 2.608, 2.612, 2.615, 2.623, 2.627, 2.629, 2.631, 2.631, 2.632, 2.631, 2.628, 2.628, 2.651,
+                            2.622, 2.623, 2.624, 2.624, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.609, 2.606, 2.601, 2.596, 2.594, 2.594, 2.596, 2.599, 2.603, 2.609, 2.613, 2.617, 2.623, 2.627, 2.629, 2.631, 2.632, 2.632, 2.631, 2.629, 2.631, 2.651,
+                            2.623, 2.625, 2.625, 2.624, 2.621, 2.621, 2.619, 2.617, 2.616, 2.613, 2.608, 2.605, 2.601, 2.595, 2.593, 2.593, 2.595, 2.598, 2.604, 2.609, 2.615, 2.619, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.632, 2.629, 2.631, 2.651,
+                            2.624, 2.626, 2.626, 2.623, 2.621, 2.619, 2.618, 2.617, 2.615, 2.612, 2.608, 2.605, 2.601, 2.597, 2.595, 2.595, 2.596, 2.598, 2.605, 2.609, 2.616, 2.621, 2.626, 2.627, 2.629, 2.631, 2.633, 2.633, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.618, 2.617, 2.614, 2.612, 2.609, 2.606, 2.602, 2.599, 2.598, 2.597, 2.598, 2.602, 2.607, 2.612, 2.619, 2.621, 2.626, 2.628, 2.629, 2.632, 2.633, 2.634, 2.633, 2.631, 2.631, 2.655,
+                            2.624, 2.625, 2.625, 2.623, 2.621, 2.621, 2.618, 2.617, 2.614, 2.612, 2.611, 2.608, 2.604, 2.602, 2.599, 2.599, 2.603, 2.606, 2.611, 2.616, 2.621, 2.624, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.634, 2.633, 2.633, 2.656,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.621, 2.619, 2.617, 2.615, 2.613, 2.611, 2.611, 2.607, 2.604, 2.604, 2.604, 2.606, 2.609, 2.613, 2.619, 2.622, 2.625, 2.628, 2.631, 2.632, 2.633, 2.633, 2.636, 2.636, 2.634, 2.634, 2.658,
+                            2.623, 2.624, 2.625, 2.623, 2.622, 2.619, 2.618, 2.616, 2.614, 2.613, 2.612, 2.611, 2.609, 2.608, 2.607, 2.608, 2.609, 2.613, 2.617, 2.621, 2.623, 2.626, 2.629, 2.631, 2.632, 2.633, 2.634, 2.635, 2.636, 2.636, 2.636, 2.661,
+                            2.623, 2.624, 2.625, 2.625, 2.623, 2.621, 2.619, 2.616, 2.615, 2.614, 2.613, 2.612, 2.612, 2.611, 2.611, 2.611, 2.614, 2.615, 2.619, 2.622, 2.625, 2.627, 2.631, 2.632, 2.633, 2.635, 2.635, 2.637, 2.637, 2.636, 2.637, 2.661,
+                            2.623, 2.624, 2.625, 2.626, 2.624, 2.621, 2.619, 2.617, 2.616, 2.615, 2.615, 2.614, 2.614, 2.614, 2.614, 2.614, 2.616, 2.619, 2.621, 2.623, 2.626, 2.628, 2.631, 2.632, 2.634, 2.635, 2.636, 2.637, 2.638, 2.637, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.627, 2.626, 2.623, 2.619, 2.619, 2.618, 2.618, 2.618, 2.617, 2.617, 2.616, 2.616, 2.616, 2.619, 2.622, 2.623, 2.625, 2.628, 2.628, 2.631, 2.632, 2.634, 2.636, 2.638, 2.639, 2.639, 2.638, 2.638, 2.661,
+                            2.625, 2.626, 2.627, 2.628, 2.626, 2.623, 2.621, 2.619, 2.619, 2.619, 2.619, 2.619, 2.619, 2.618, 2.618, 2.619, 2.623, 2.624, 2.625, 2.627, 2.629, 2.629, 2.632, 2.633, 2.635, 2.638, 2.639, 2.639, 2.639, 2.636, 2.636, 2.662,
+                            2.625, 2.627, 2.628, 2.628, 2.626, 2.624, 2.623, 2.622, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.621, 2.624, 2.624, 2.625, 2.627, 2.628, 2.631, 2.631, 2.632, 2.634, 2.636, 2.639, 2.639, 2.641, 2.639, 2.635, 2.635, 2.663,
+                            2.625, 2.626, 2.628, 2.628, 2.627, 2.625, 2.624, 2.623, 2.623, 2.622, 2.623, 2.624, 2.624, 2.625, 2.625, 2.625, 2.625, 2.626, 2.627, 2.629, 2.631, 2.632, 2.633, 2.635, 2.638, 2.641, 2.642, 2.643, 2.642, 2.636, 2.636, 2.665,
+                            2.624, 2.626, 2.628, 2.628, 2.628, 2.626, 2.624, 2.624, 2.623, 2.623, 2.623, 2.625, 2.627, 2.627, 2.626, 2.626, 2.626, 2.627, 2.628, 2.629, 2.632, 2.633, 2.635, 2.637, 2.639, 2.642, 2.644, 2.644, 2.642, 2.638, 2.638, 2.665,
+                            2.623, 2.625, 2.626, 2.627, 2.626, 2.626, 2.624, 2.623, 2.623, 2.623, 2.623, 2.623, 2.626, 2.627, 2.626, 2.626, 2.626, 2.626, 2.628, 2.628, 2.629, 2.631, 2.634, 2.636, 2.639, 2.642, 2.644, 2.643, 2.641, 2.637, 2.638, 2.659,
+                            2.623, 2.627, 2.627, 2.627, 2.627, 2.628, 2.627, 2.624, 2.624, 2.623, 2.624, 2.624, 2.628, 2.628, 2.627, 2.628, 2.628, 2.628, 2.629, 2.629, 2.631, 2.635, 2.637, 2.639, 2.641, 2.643, 2.646, 2.645, 2.643, 2.641, 2.654, 2.659,
+                            2.642, 2.641, 2.643, 2.645, 2.645, 2.644, 2.644, 2.643, 2.643, 2.642, 2.642, 2.642, 2.643, 2.644, 2.644, 2.644, 2.646, 2.646, 2.647, 2.649, 2.651, 2.652, 2.654, 2.656, 2.658, 2.661, 2.661, 2.661, 2.659, 2.654, 2.659, 2.659
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.391, 1.394, 1.395, 1.396, 1.398, 1.398, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.398, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.398, 1.399, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.399, 1.397, 1.399, 1.402,
+                            1.393, 1.395, 1.396, 1.398, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.401, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.399, 1.398, 1.398, 1.399, 1.401, 1.401, 1.399, 1.398, 1.399, 1.402,
+                            1.398, 1.401, 1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.401, 1.401, 1.399, 1.399, 1.401, 1.401, 1.401, 1.401, 1.399, 1.401, 1.406,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.402, 1.403, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.405, 1.404, 1.404, 1.404, 1.404, 1.405, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.404, 1.405, 1.412,
+                            1.401, 1.401, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.406, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.405, 1.404, 1.404, 1.404, 1.404, 1.404, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.407, 1.408, 1.408, 1.407, 1.405, 1.405, 1.412,
+                            1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.404, 1.405, 1.406, 1.405, 1.405, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.402, 1.402, 1.402, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.403, 1.402, 1.402, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.408, 1.407, 1.405, 1.405, 1.414,
+                            1.402, 1.402, 1.402, 1.402, 1.403, 1.403, 1.405, 1.405, 1.405, 1.405, 1.404, 1.404, 1.403, 1.402, 1.402, 1.401, 1.401, 1.402, 1.403, 1.403, 1.404, 1.405, 1.406, 1.407, 1.409, 1.409, 1.409, 1.409, 1.407, 1.405, 1.405, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.403, 1.404, 1.405, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.408, 1.405, 1.405, 1.413,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.405, 1.404, 1.402, 1.401, 1.399, 1.398, 1.398, 1.399, 1.399, 1.401, 1.403, 1.404, 1.405, 1.407, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.401, 1.398, 1.397, 1.397, 1.398, 1.399, 1.401, 1.403, 1.404, 1.405, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.399, 1.401, 1.403, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.408, 1.406, 1.406, 1.413,
+                            1.403, 1.404, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.404, 1.403, 1.402, 1.399, 1.397, 1.396, 1.396, 1.397, 1.398, 1.401, 1.403, 1.406, 1.407, 1.409, 1.409, 1.411, 1.409, 1.409, 1.409, 1.408, 1.407, 1.407, 1.413,
+                            1.403, 1.404, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.404, 1.404, 1.403, 1.402, 1.399, 1.398, 1.397, 1.397, 1.398, 1.399, 1.402, 1.404, 1.406, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.414,
+                            1.403, 1.403, 1.404, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.402, 1.401, 1.399, 1.398, 1.398, 1.398, 1.401, 1.403, 1.404, 1.408, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.401, 1.401, 1.399, 1.399, 1.401, 1.402, 1.404, 1.407, 1.408, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.407, 1.407, 1.415,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.403, 1.403, 1.403, 1.402, 1.401, 1.401, 1.401, 1.402, 1.404, 1.406, 1.407, 1.408, 1.409, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.409, 1.408, 1.408, 1.415,
+                            1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.405, 1.406, 1.408, 1.408, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.409, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.402, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.403, 1.404, 1.404, 1.404, 1.405, 1.406, 1.407, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.416,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.407, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.405, 1.406, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.409, 1.408, 1.408, 1.417,
+                            1.403, 1.403, 1.403, 1.403, 1.404, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.406, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.416,
+                            1.402, 1.403, 1.403, 1.403, 1.404, 1.404, 1.404, 1.404, 1.405, 1.405, 1.406, 1.407, 1.407, 1.407, 1.408, 1.409, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.409, 1.407, 1.407, 1.417,
+                            1.402, 1.403, 1.403, 1.404, 1.404, 1.404, 1.405, 1.405, 1.405, 1.406, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.415,
+                            1.402, 1.402, 1.403, 1.403, 1.404, 1.404, 1.405, 1.405, 1.405, 1.405, 1.406, 1.407, 1.408, 1.408, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.412, 1.411, 1.409, 1.407, 1.407, 1.413,
+                            1.402, 1.402, 1.403, 1.403, 1.405, 1.406, 1.406, 1.406, 1.406, 1.406, 1.407, 1.408, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.412, 1.412, 1.413, 1.413, 1.411, 1.408, 1.411, 1.413,
+                            1.406, 1.406, 1.408, 1.408, 1.409, 1.409, 1.411, 1.411, 1.411, 1.411, 1.411, 1.411, 1.414, 1.414, 1.414, 1.414, 1.415, 1.415, 1.415, 1.415, 1.416, 1.416, 1.416, 1.417, 1.418, 1.418, 1.417, 1.417, 1.414, 1.411, 1.413, 1.413
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    1.554, 1.522, 1.466, 1.422, 1.385, 1.351, 1.322, 1.294, 1.269, 1.246, 1.228, 1.214, 1.207, 1.202, 1.199, 1.199, 1.199, 1.199, 1.202, 1.207, 1.218, 1.235, 1.255, 1.279, 1.305, 1.333, 1.365, 1.402, 1.447, 1.508, 1.602, 1.638,
+                    1.522, 1.478, 1.431, 1.391, 1.355, 1.323, 1.298, 1.271, 1.247, 1.228, 1.212, 1.199, 1.187, 1.179, 1.173, 1.172, 1.172, 1.174, 1.179, 1.189, 1.201, 1.216, 1.235, 1.256, 1.282, 1.308, 1.335, 1.368, 1.411, 1.461, 1.535, 1.602,
+                    1.479, 1.449, 1.407, 1.367, 1.332, 1.301, 1.271, 1.247, 1.226, 1.208, 1.191, 1.178, 1.166, 1.158, 1.153, 1.151, 1.151, 1.153, 1.159, 1.168, 1.179, 1.194, 1.212, 1.234, 1.256, 1.282, 1.311, 1.343, 1.382, 1.427, 1.489, 1.535,
+                    1.454, 1.423, 1.383, 1.345, 1.309, 1.278, 1.249, 1.226, 1.206, 1.187, 1.171, 1.158, 1.146, 1.138, 1.132, 1.129, 1.129, 1.133, 1.139, 1.147, 1.159, 1.173, 1.191, 1.212, 1.234, 1.261, 1.288, 1.321, 1.357, 1.401, 1.455, 1.489,
+                    1.433, 1.401, 1.362, 1.325, 1.289, 1.258, 1.231, 1.206, 1.187, 1.169, 1.153, 1.138, 1.129, 1.121, 1.115, 1.112, 1.112, 1.114, 1.121, 1.129, 1.141, 1.155, 1.172, 1.191, 1.214, 1.241, 1.269, 1.301, 1.337, 1.377, 1.428, 1.457,
+                    1.415, 1.382, 1.343, 1.306, 1.273, 1.241, 1.213, 1.189, 1.169, 1.153, 1.137, 1.123, 1.112, 1.105, 1.097, 1.095, 1.095, 1.098, 1.103, 1.112, 1.124, 1.139, 1.155, 1.173, 1.197, 1.222, 1.252, 1.282, 1.317, 1.356, 1.405, 1.434,
+                    1.398, 1.363, 1.325, 1.289, 1.256, 1.224, 1.198, 1.175, 1.155, 1.137, 1.123, 1.108, 1.097, 1.089, 1.083, 1.079, 1.079, 1.083, 1.088, 1.097, 1.109, 1.124, 1.139, 1.158, 1.181, 1.206, 1.234, 1.266, 1.299, 1.339, 1.384, 1.415,
+                    1.382, 1.347, 1.309, 1.274, 1.242, 1.211, 1.185, 1.162, 1.142, 1.124, 1.108, 1.095, 1.083, 1.075, 1.069, 1.066, 1.066, 1.068, 1.074, 1.083, 1.096, 1.109, 1.125, 1.145, 1.166, 1.191, 1.219, 1.251, 1.285, 1.324, 1.367, 1.399,
+                    1.369, 1.334, 1.296, 1.261, 1.228, 1.199, 1.173, 1.151, 1.131, 1.112, 1.095, 1.083, 1.071, 1.062, 1.056, 1.053, 1.053, 1.055, 1.061, 1.069, 1.083, 1.096, 1.112, 1.132, 1.153, 1.178, 1.206, 1.237, 1.271, 1.309, 1.353, 1.385,
+                    1.359, 1.321, 1.284, 1.251, 1.217, 1.189, 1.164, 1.141, 1.121, 1.102, 1.086, 1.071, 1.061, 1.049, 1.045, 1.042, 1.042, 1.043, 1.051, 1.061, 1.069, 1.085, 1.101, 1.121, 1.143, 1.167, 1.195, 1.225, 1.259, 1.298, 1.341, 1.375,
+                    1.351, 1.312, 1.275, 1.241, 1.209, 1.181, 1.155, 1.133, 1.112, 1.092, 1.076, 1.061, 1.049, 1.041, 1.034, 1.032, 1.032, 1.035, 1.041, 1.051, 1.061, 1.075, 1.092, 1.112, 1.133, 1.158, 1.185, 1.216, 1.249, 1.288, 1.331, 1.364,
+                    1.344, 1.303, 1.267, 1.233, 1.201, 1.173, 1.147, 1.124, 1.104, 1.085, 1.067, 1.053, 1.041, 1.033, 1.024, 1.022, 1.022, 1.025, 1.034, 1.041, 1.053, 1.066, 1.083, 1.103, 1.126, 1.149, 1.177, 1.207, 1.241, 1.279, 1.321, 1.357,
+                    1.339, 1.297, 1.261, 1.226, 1.194, 1.166, 1.142, 1.119, 1.098, 1.078, 1.061, 1.046, 1.034, 1.024, 1.017, 1.014, 1.014, 1.017, 1.025, 1.034, 1.046, 1.059, 1.077, 1.096, 1.118, 1.143, 1.169, 1.201, 1.235, 1.273, 1.314, 1.352,
+                    1.337, 1.293, 1.256, 1.223, 1.191, 1.163, 1.136, 1.114, 1.093, 1.074, 1.056, 1.041, 1.027, 1.017, 1.012, 1.006, 1.006, 1.013, 1.017, 1.028, 1.041, 1.055, 1.072, 1.092, 1.114, 1.138, 1.165, 1.195, 1.229, 1.268, 1.309, 1.348,
+                    1.337, 1.291, 1.253, 1.219, 1.187, 1.159, 1.133, 1.109, 1.089, 1.071, 1.053, 1.037, 1.023, 1.012, 1.006, 1.002, 1.003, 1.006, 1.013, 1.023, 1.038, 1.052, 1.069, 1.089, 1.111, 1.135, 1.161, 1.192, 1.226, 1.264, 1.306, 1.348,
+                    1.337, 1.291, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.035, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.341, 1.292, 1.253, 1.218, 1.186, 1.157, 1.132, 1.109, 1.088, 1.068, 1.049, 1.034, 1.021, 1.009, 1.001, 1.001, 1.001, 1.003, 1.011, 1.021, 1.035, 1.051, 1.069, 1.087, 1.109, 1.133, 1.161, 1.189, 1.224, 1.262, 1.304, 1.347,
+                    1.348, 1.298, 1.255, 1.219, 1.188, 1.159, 1.134, 1.111, 1.088, 1.069, 1.051, 1.035, 1.021, 1.009, 1.003, 1.001, 1.002, 1.004, 1.011, 1.022, 1.036, 1.053, 1.071, 1.089, 1.111, 1.135, 1.162, 1.191, 1.226, 1.264, 1.306, 1.347,
+                    1.354, 1.306, 1.258, 1.222, 1.191, 1.162, 1.135, 1.113, 1.092, 1.073, 1.054, 1.038, 1.024, 1.014, 1.008, 1.003, 1.004, 1.008, 1.014, 1.026, 1.039, 1.056, 1.073, 1.093, 1.115, 1.139, 1.165, 1.195, 1.229, 1.267, 1.309, 1.349,
+                    1.358, 1.312, 1.263, 1.227, 1.195, 1.167, 1.141, 1.117, 1.097, 1.078, 1.061, 1.043, 1.029, 1.021, 1.014, 1.008, 1.008, 1.014, 1.021, 1.032, 1.045, 1.061, 1.078, 1.097, 1.119, 1.144, 1.169, 1.201, 1.234, 1.272, 1.315, 1.353,
+                    1.364, 1.319, 1.269, 1.234, 1.201, 1.174, 1.148, 1.124, 1.103, 1.084, 1.067, 1.052, 1.038, 1.029, 1.021, 1.016, 1.016, 1.021, 1.029, 1.038, 1.051, 1.067, 1.084, 1.103, 1.126, 1.151, 1.176, 1.207, 1.241, 1.279, 1.321, 1.358,
+                    1.371, 1.326, 1.277, 1.242, 1.209, 1.181, 1.155, 1.132, 1.111, 1.092, 1.075, 1.061, 1.049, 1.038, 1.029, 1.027, 1.027, 1.029, 1.038, 1.047, 1.061, 1.075, 1.092, 1.111, 1.133, 1.157, 1.185, 1.213, 1.247, 1.286, 1.329, 1.365,
+                    1.379, 1.334, 1.287, 1.251, 1.219, 1.191, 1.164, 1.141, 1.119, 1.101, 1.085, 1.071, 1.061, 1.049, 1.041, 1.038, 1.038, 1.041, 1.047, 1.059, 1.071, 1.084, 1.101, 1.119, 1.141, 1.165, 1.193, 1.223, 1.257, 1.295, 1.338, 1.374,
+                    1.389, 1.343, 1.298, 1.262, 1.231, 1.201, 1.174, 1.151, 1.131, 1.111, 1.095, 1.083, 1.071, 1.061, 1.054, 1.051, 1.051, 1.054, 1.059, 1.071, 1.081, 1.094, 1.111, 1.129, 1.152, 1.176, 1.203, 1.235, 1.269, 1.307, 1.351, 1.384,
+                    1.401, 1.351, 1.311, 1.274, 1.242, 1.214, 1.187, 1.164, 1.142, 1.124, 1.108, 1.095, 1.083, 1.074, 1.068, 1.066, 1.066, 1.068, 1.073, 1.081, 1.094, 1.108, 1.123, 1.141, 1.164, 1.188, 1.215, 1.247, 1.281, 1.321, 1.364, 1.396,
+                    1.412, 1.366, 1.327, 1.289, 1.257, 1.227, 1.201, 1.176, 1.156, 1.137, 1.122, 1.108, 1.096, 1.088, 1.083, 1.081, 1.081, 1.082, 1.087, 1.095, 1.108, 1.122, 1.136, 1.154, 1.177, 1.201, 1.229, 1.261, 1.296, 1.337, 1.382, 1.409,
+                    1.421, 1.383, 1.343, 1.306, 1.273, 1.243, 1.216, 1.192, 1.169, 1.152, 1.137, 1.122, 1.111, 1.103, 1.098, 1.095, 1.095, 1.097, 1.102, 1.111, 1.123, 1.136, 1.152, 1.169, 1.191, 1.217, 1.246, 1.278, 1.314, 1.354, 1.399, 1.429,
+                    1.434, 1.402, 1.362, 1.324, 1.291, 1.261, 1.232, 1.208, 1.187, 1.168, 1.152, 1.138, 1.127, 1.119, 1.114, 1.112, 1.112, 1.115, 1.121, 1.128, 1.139, 1.152, 1.169, 1.186, 1.209, 1.234, 1.262, 1.295, 1.332, 1.372, 1.419, 1.451,
+                    1.453, 1.422, 1.382, 1.344, 1.309, 1.278, 1.249, 1.226, 1.204, 1.187, 1.168, 1.155, 1.144, 1.135, 1.131, 1.131, 1.131, 1.133, 1.138, 1.146, 1.157, 1.171, 1.186, 1.206, 1.227, 1.252, 1.281, 1.314, 1.351, 1.393, 1.442, 1.473,
+                    1.475, 1.446, 1.404, 1.366, 1.329, 1.298, 1.269, 1.245, 1.224, 1.204, 1.188, 1.174, 1.163, 1.154, 1.149, 1.148, 1.148, 1.152, 1.156, 1.164, 1.176, 1.189, 1.206, 1.226, 1.247, 1.274, 1.303, 1.336, 1.374, 1.417, 1.471, 1.505,
+                    1.503, 1.472, 1.428, 1.389, 1.353, 1.321, 1.291, 1.266, 1.245, 1.224, 1.207, 1.192, 1.183, 1.174, 1.169, 1.167, 1.168, 1.169, 1.175, 1.183, 1.195, 1.209, 1.226, 1.247, 1.267, 1.294, 1.325, 1.359, 1.397, 1.445, 1.505, 1.548,
+                    1.534, 1.503, 1.455, 1.413, 1.378, 1.344, 1.315, 1.289, 1.265, 1.243, 1.224, 1.207, 1.196, 1.192, 1.189, 1.189, 1.189, 1.189, 1.192, 1.198, 1.209, 1.226, 1.244, 1.266, 1.291, 1.318, 1.349, 1.383, 1.425, 1.475, 1.548, 1.591
+                ],
+                "sigma": 0.00095,
+                "sigma_Cb": 0.00098
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2360,
+                        "ccm":
+                        [
+                            1.66078, -0.23588, -0.42491,
+                            -0.47456, 1.82763, -0.35307,
+                            -0.00545, -1.44729, 2.45273
+                        ]
+                    },
+                    {
+                        "ct": 2870,
+                        "ccm":
+                        [
+                            1.78373, -0.55344, -0.23029,
+                            -0.39951, 1.69701, -0.29751,
+                            0.01986, -1.06525, 2.04539
+                        ]
+                    },
+                    {
+                        "ct": 2970,
+                        "ccm":
+                        [
+                            1.73511, -0.56973, -0.16537,
+                            -0.36338, 1.69878, -0.33539,
+                            -0.02354, -0.76813, 1.79168
+                        ]
+                    },
+                    {
+                        "ct": 3000,
+                        "ccm":
+                        [
+                            2.06374, -0.92218, -0.14156,
+                            -0.41721, 1.69289, -0.27568,
+                            -0.00554, -0.92741, 1.93295
+                        ]
+                    },
+                    {
+                        "ct": 3700,
+                        "ccm":
+                        [
+                            2.13792, -1.08136, -0.05655,
+                            -0.34739, 1.58989, -0.24249,
+                            -0.00349, -0.76789, 1.77138
+                        ]
+                    },
+                    {
+                        "ct": 3870,
+                        "ccm":
+                        [
+                            1.83834, -0.70528, -0.13307,
+                            -0.30499, 1.60523, -0.30024,
+                            -0.05701, -0.58313, 1.64014
+                        ]
+                    },
+                    {
+                        "ct": 4000,
+                        "ccm":
+                        [
+                            2.15741, -1.10295, -0.05447,
+                            -0.34631, 1.61158, -0.26528,
+                            -0.02723, -0.70288, 1.73011
+                        ]
+                    },
+                    {
+                        "ct": 4400,
+                        "ccm":
+                        [
+                            2.05729, -0.95007, -0.10723,
+                            -0.41712, 1.78606, -0.36894,
+                            -0.11899, -0.55727, 1.67626
+                        ]
+                    },
+                    {
+                        "ct": 4715,
+                        "ccm":
+                        [
+                            1.90255, -0.77478, -0.12777,
+                            -0.31338, 1.88197, -0.56858,
+                            -0.06001, -0.61785, 1.67786
+                        ]
+                    },
+                    {
+                        "ct": 5920,
+                        "ccm":
+                        [
+                            1.98691, -0.84671, -0.14019,
+                            -0.26581, 1.70615, -0.44035,
+                            -0.09532, -0.47332, 1.56864
+                        ]
+                    },
+                    {
+                        "ct": 9050,
+                        "ccm":
+                        [
+                            2.09255, -0.76541, -0.32714,
+                            -0.28973, 2.27462, -0.98489,
+                            -0.17299, -0.61275, 1.78574
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx477_scientific.json b/src/ipa/rpi/pisp/data/imx477_scientific.json
new file mode 100644
index 000000000..4ec5a15be
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx477_scientific.json
@@ -0,0 +1,546 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 12000,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 740,
+                "reference_Y": 15051
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.809
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 204,
+                "slope": 0.0061
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "sdn":
+                {
+                    "deviation": 1.6,
+                    "strength": 0.5,
+                    "deviation2": 3.2,
+                    "deviation_no_tdn": 3.2,
+                    "strength_no_tdn": 0.75
+                },
+                "cdn":
+                {
+                    "deviation": 200,
+                    "strength": 0.3
+                },
+                "tdn":
+                {
+                    "deviation": 0.8,
+                    "threshold": 0.05
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2000.0, 0.6331025775790707, 0.27424225990946915,
+                    2200.0, 0.5696117366212947, 0.3116091368689487,
+                    2400.0, 0.5204264653110015, 0.34892179554105873,
+                    2600.0, 0.48148675531667223, 0.38565229719076793,
+                    2800.0, 0.450085403501908, 0.42145684622485047,
+                    3000.0, 0.42436130159169017, 0.45611835670028816,
+                    3200.0, 0.40300023695527337, 0.48950766215198593,
+                    3400.0, 0.3850520052612984, 0.5215567075837261,
+                    3600.0, 0.36981508088230314, 0.5522397906415475,
+                    4100.0, 0.333468007836758, 0.5909770465167908,
+                    4600.0, 0.31196097364221376, 0.6515706327327178,
+                    5100.0, 0.2961860409294588, 0.7068178946570284,
+                    5600.0, 0.2842607232745885, 0.7564837749584288,
+                    6100.0, 0.2750265787051251, 0.8006183524920533,
+                    6600.0, 0.2677057225584924, 0.8398879225373039,
+                    7100.0, 0.2617955199757274, 0.8746456080032436,
+                    7600.0, 0.25693714288250125, 0.905569559506562,
+                    8100.0, 0.25287531441063316, 0.9331696750390895,
+                    8600.0, 0.24946601483331993, 0.9576820904825795
+                ],
+                "sensitivity_r": 1.05,
+                "sensitivity_b": 1.05,
+                "transverse_pos": 0.0238,
+                "transverse_neg": 0.04429,
+                "coarse_step": 0.1
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "metering_modes":
+                {
+                    "centre-weighted":
+                    {
+                        "weights":
+                        [
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                        ]
+                    },
+                    "spot":
+                    {
+                        "weights":
+                        [
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
+                    },
+                    "matrix":
+                    {
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
+                    }
+                },
+                "exposure_modes":
+                {
+                    "normal":
+                    {
+                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                        "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                    },
+                    "short":
+                    {
+                        "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                        "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                    },
+                    "long":
+                    {
+                        "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                    }
+                },
+                "constraint_modes":
+                {
+                    "normal": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.3,
+                                1000, 0.3
+                            ]
+                        }
+                    ],
+                    "highlight": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.3,
+                                1000, 0.3
+                            ]
+                        },
+                        {
+                            "bound": "UPPER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.8,
+                                1000, 0.8
+                            ]
+                        }
+                    ]
+                },
+                "y_target":
+                [
+                    0, 0.16,
+                    1000, 0.165,
+                    10000, 0.17
+                ]
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 0,
+                "gamma_curve":
+                [
+                    0, 0,
+                    512, 2304,
+                    1024, 4608,
+                    1536, 6573,
+                    2048, 8401,
+                    2560, 9992,
+                    3072, 11418,
+                    3584, 12719,
+                    4096, 13922,
+                    4608, 15045,
+                    5120, 16103,
+                    5632, 17104,
+                    6144, 18056,
+                    6656, 18967,
+                    7168, 19839,
+                    7680, 20679,
+                    8192, 21488,
+                    9216, 23028,
+                    10240, 24477,
+                    11264, 25849,
+                    12288, 27154,
+                    13312, 28401,
+                    14336, 29597,
+                    15360, 30747,
+                    16384, 31856,
+                    17408, 32928,
+                    18432, 33966,
+                    19456, 34973,
+                    20480, 35952,
+                    22528, 37832,
+                    24576, 39621,
+                    26624, 41330,
+                    28672, 42969,
+                    30720, 44545,
+                    32768, 46065,
+                    34816, 47534,
+                    36864, 48956,
+                    38912, 50336,
+                    40960, 51677,
+                    43008, 52982,
+                    45056, 54253,
+                    47104, 55493,
+                    49152, 56704,
+                    51200, 57888,
+                    53248, 59046,
+                    55296, 60181,
+                    57344, 61292,
+                    59392, 62382,
+                    61440, 63452,
+                    63488, 64503,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2000,
+                        "ccm":
+                        [
+                            1.5813882365848004, -0.35293683714581114, -0.27378771561617715,
+                            -0.4347297185453639, 1.5792631087746074, -0.12102601986382337,
+                            0.2322290578987574, -1.4382672640468128, 2.1386425781770755
+                        ]
+                    },
+                    {
+                        "ct": 2200,
+                        "ccm":
+                        [
+                            1.6322048484088305, -0.45932286857238486, -0.21373542690252198,
+                            -0.3970719209901105, 1.5877868651467202, -0.17249380832122455,
+                            0.20753774825903412, -1.2660673594740142, 2.005654261091916
+                        ]
+                    },
+                    {
+                        "ct": 2400,
+                        "ccm":
+                        [
+                            1.6766610071470398, -0.5447101051688111, -0.16838641107407676,
+                            -0.3659845183388154, 1.592223692670396, -0.2127091997471162,
+                            0.1833964516767549, -1.1339155942419321, 1.9089342978542396
+                        ]
+                    },
+                    {
+                        "ct": 2600,
+                        "ccm":
+                        [
+                            1.7161984340622154, -0.6152585785678794, -0.1331100845092582,
+                            -0.33972082628066275, 1.5944888273736966, -0.2453979465898787,
+                            0.1615577497676328, -1.0298684958833109, 1.8357854177422053
+                        ]
+                    },
+                    {
+                        "ct": 2800,
+                        "ccm":
+                        [
+                            1.7519307259815728, -0.6748682080165339, -0.10515169074540848,
+                            -0.3171703484479931, 1.5955820297498486, -0.2727395854813966,
+                            0.14230870739974305, -0.9460976023551511, 1.778709391659538
+                        ]
+                    },
+                    {
+                        "ct": 3000,
+                        "ccm":
+                        [
+                            1.7846716625128374, -0.7261240476375332, -0.08274697420358428,
+                            -0.2975654035173307, 1.5960425637021738, -0.2961043416505157,
+                            0.12546426281675097, -0.8773434727076518, 1.7330356805246685
+                        ]
+                    },
+                    {
+                        "ct": 3200,
+                        "ccm":
+                        [
+                            1.8150085872943436, -0.7708109672515514, -0.06469468211419174,
+                            -0.2803468940646277, 1.596168842967451, -0.3164044170681625,
+                            0.11071494533513807, -0.8199772290209191, 1.69572135046367
+                        ]
+                    },
+                    {
+                        "ct": 3400,
+                        "ccm":
+                        [
+                            1.8433668304932087, -0.8102060605062592, -0.05013485852801454,
+                            -0.2650934036324084, 1.5961288492969294, -0.33427554893845535,
+                            0.0977478941863518, -0.7714303112098978, 1.6647070820146963
+                        ]
+                    },
+                    {
+                        "ct": 3600,
+                        "ccm":
+                        [
+                            1.8700575831917468, -0.8452518300291346, -0.03842644337477299,
+                            -0.2514794528347016, 1.5960178299141876, -0.3501774949366156,
+                            0.08628520830733245, -0.729841503339915, 1.638553343939267
+                        ]
+                    },
+                    {
+                        "ct": 4100,
+                        "ccm":
+                        [
+                            1.8988700903560716, -0.8911278803351247, -0.018848644425650693,
+                            -0.21487101487384094, 1.599236541382614, -0.39405450457918206,
+                            0.08251488056482173, -0.7178919368326191, 1.6267009056502704
+                        ]
+                    },
+                    {
+                        "ct": 4600,
+                        "ccm":
+                        [
+                            1.960355191764125, -0.9624344812121991, -0.0017122408632169205,
+                            -0.19444620905212898, 1.5978493736948447, -0.416727638296156,
+                            0.06310261513271084, -0.6483790952487849, 1.5834605477213093
+                        ]
+                    },
+                    {
+                        "ct": 5100,
+                        "ccm":
+                        [
+                            2.014680536961399, -1.0195930302148566, 0.007728256612638915,
+                            -0.17751999660735496, 1.5977081555831, -0.4366085498741474,
+                            0.04741267583041334, -0.5950327902073489, 1.5512919847321853
+                        ]
+                    },
+                    {
+                        "ct": 5600,
+                        "ccm":
+                        [
+                            2.062652337917251, -1.0658386679125478, 0.011886354256281267,
+                            -0.16319197721451495, 1.598363237584736, -0.45422061523742235,
+                            0.03465810928795378, -0.5535454108047286, 1.5269025836946852
+                        ]
+                    },
+                    {
+                        "ct": 6100,
+                        "ccm":
+                        [
+                            2.104985902038069, -1.103597868736314, 0.012503517136539277,
+                            -0.15090797064906178, 1.5994703078166095, -0.4698414300864995,
+                            0.02421766063474242, -0.5208922818196823, 1.5081270847783788
+                        ]
+                    },
+                    {
+                        "ct": 6600,
+                        "ccm":
+                        [
+                            2.1424988751299714, -1.134760232367728, 0.010730356010435522,
+                            -0.14021846798466234, 1.600822462230719, -0.48379204794526487,
+                            0.015521315410496622, -0.49463630325832275, 1.4933313534840327
+                        ]
+                    },
+                    {
+                        "ct": 7100,
+                        "ccm":
+                        [
+                            2.1758034100130925, -1.1607558481037359, 0.007452724895469076,
+                            -0.13085694672641826, 1.6022648614493245, -0.4962330524084075,
+                            0.008226943206113427, -0.4733077192319791, 1.4815336120437468
+                        ]
+                    },
+                    {
+                        "ct": 7600,
+                        "ccm":
+                        [
+                            2.205529206931895, -1.1826662383072108, 0.0032019529917605167,
+                            -0.122572009780486, 1.6037258133595753, -0.5073973734282445,
+                            0.0020132587619863425, -0.4556590236414181, 1.471939788496745
+                        ]
+                    },
+                    {
+                        "ct": 8100,
+                        "ccm":
+                        [
+                            2.232224969223067, -1.2013672897252885, -0.0016234598095482985,
+                            -0.11518026734442414, 1.6051544769439803, -0.5174558699422255,
+                            -0.0033378143542219835, -0.4408590373867774, 1.4640252230667452
+                        ]
+                    },
+                    {
+                        "ct": 8600,
+                        "ccm":
+                        [
+                            2.256082295891265, -1.2173210549996634, -0.0067231350481711675,
+                            -0.10860272839843167, 1.6065150139140594, -0.5264728573611493,
+                            -0.007952618707984149, -0.4284003574050791, 1.4574646927117558
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx708.json b/src/ipa/rpi/pisp/data/imx708.json
new file mode 100644
index 000000000..e8d25c216
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx708.json
@@ -0,0 +1,1270 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 20716,
+                "reference_gain": 1.12,
+                "reference_aperture": 1.0,
+                "reference_lux": 810,
+                "reference_Y": 13994
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 1.856
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 221,
+                "slope": 0.00226
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 3.2,
+                        "strength": 0.75,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2964.0, 0.7451, 0.3213,
+                    3610.0, 0.6119, 0.4443,
+                    4640.0, 0.5168, 0.5419,
+                    5910.0, 0.4436, 0.6229,
+                    7590.0, 0.3847, 0.6921
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.01752,
+                "transverse_neg": 0.01831
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.532, 1.534, 1.535, 1.538, 1.538, 1.533, 1.529, 1.515, 1.506, 1.492, 1.477, 1.465, 1.453, 1.444, 1.437, 1.433, 1.433, 1.435, 1.441, 1.449, 1.461, 1.474, 1.485, 1.499, 1.511, 1.519, 1.525, 1.526, 1.526, 1.523, 1.517, 1.516,
+                            1.532, 1.534, 1.537, 1.538, 1.537, 1.534, 1.525, 1.515, 1.502, 1.486, 1.474, 1.458, 1.449, 1.438, 1.429, 1.427, 1.426, 1.429, 1.436, 1.444, 1.456, 1.468, 1.483, 1.497, 1.509, 1.518, 1.524, 1.526, 1.526, 1.523, 1.521, 1.516,
+                            1.532, 1.534, 1.537, 1.538, 1.536, 1.533, 1.524, 1.512, 1.499, 1.483, 1.468, 1.453, 1.439, 1.429, 1.421, 1.419, 1.419, 1.419, 1.427, 1.438, 1.451, 1.464, 1.479, 1.494, 1.506, 1.516, 1.523, 1.526, 1.526, 1.524, 1.521, 1.518,
+                            1.533, 1.536, 1.537, 1.537, 1.535, 1.532, 1.521, 1.507, 1.491, 1.474, 1.456, 1.441, 1.429, 1.418, 1.409, 1.406, 1.406, 1.408, 1.415, 1.426, 1.439, 1.453, 1.471, 1.485, 1.501, 1.511, 1.522, 1.524, 1.526, 1.525, 1.522, 1.519,
+                            1.537, 1.538, 1.539, 1.538, 1.534, 1.525, 1.513, 1.495, 1.477, 1.459, 1.443, 1.427, 1.413, 1.402, 1.394, 1.391, 1.391, 1.393, 1.399, 1.409, 1.424, 1.439, 1.455, 1.472, 1.489, 1.503, 1.515, 1.523, 1.526, 1.527, 1.525, 1.523,
+                            1.538, 1.539, 1.541, 1.539, 1.531, 1.519, 1.503, 1.484, 1.466, 1.445, 1.427, 1.413, 1.401, 1.386, 1.378, 1.373, 1.373, 1.376, 1.386, 1.398, 1.409, 1.424, 1.441, 1.459, 1.477, 1.495, 1.509, 1.519, 1.526, 1.528, 1.528, 1.526,
+                            1.539, 1.541, 1.541, 1.539, 1.529, 1.516, 1.498, 1.479, 1.456, 1.437, 1.417, 1.401, 1.386, 1.378, 1.369, 1.363, 1.363, 1.367, 1.376, 1.386, 1.399, 1.413, 1.432, 1.451, 1.472, 1.491, 1.507, 1.517, 1.525, 1.527, 1.527, 1.527,
+                            1.539, 1.539, 1.539, 1.538, 1.529, 1.515, 1.497, 1.476, 1.454, 1.433, 1.411, 1.395, 1.381, 1.368, 1.361, 1.356, 1.356, 1.359, 1.367, 1.379, 1.393, 1.409, 1.428, 1.448, 1.471, 1.489, 1.505, 1.516, 1.524, 1.527, 1.527, 1.527,
+                            1.539, 1.539, 1.539, 1.537, 1.528, 1.513, 1.493, 1.471, 1.449, 1.426, 1.406, 1.387, 1.373, 1.361, 1.352, 1.348, 1.348, 1.351, 1.359, 1.372, 1.387, 1.403, 1.422, 1.443, 1.465, 1.484, 1.503, 1.516, 1.525, 1.527, 1.528, 1.526,
+                            1.541, 1.542, 1.539, 1.537, 1.524, 1.506, 1.485, 1.461, 1.438, 1.416, 1.395, 1.377, 1.362, 1.352, 1.344, 1.339, 1.339, 1.342, 1.351, 1.362, 1.376, 1.393, 1.412, 1.434, 1.455, 1.477, 1.495, 1.514, 1.524, 1.528, 1.529, 1.529,
+                            1.543, 1.544, 1.543, 1.534, 1.518, 1.499, 1.476, 1.452, 1.427, 1.405, 1.386, 1.367, 1.354, 1.344, 1.338, 1.329, 1.329, 1.335, 1.342, 1.352, 1.367, 1.382, 1.402, 1.424, 1.445, 1.469, 1.491, 1.507, 1.522, 1.528, 1.529, 1.532,
+                            1.544, 1.544, 1.542, 1.534, 1.518, 1.499, 1.474, 1.449, 1.425, 1.401, 1.379, 1.362, 1.348, 1.338, 1.329, 1.324, 1.325, 1.329, 1.335, 1.347, 1.361, 1.378, 1.397, 1.421, 1.443, 1.467, 1.489, 1.507, 1.521, 1.529, 1.532, 1.533,
+                            1.543, 1.543, 1.541, 1.534, 1.519, 1.499, 1.474, 1.448, 1.424, 1.399, 1.377, 1.359, 1.346, 1.333, 1.324, 1.322, 1.321, 1.324, 1.332, 1.344, 1.359, 1.376, 1.397, 1.419, 1.443, 1.467, 1.489, 1.508, 1.521, 1.528, 1.531, 1.532,
+                            1.543, 1.542, 1.541, 1.533, 1.519, 1.499, 1.474, 1.448, 1.422, 1.399, 1.376, 1.358, 1.344, 1.331, 1.322, 1.319, 1.319, 1.321, 1.331, 1.342, 1.357, 1.375, 1.396, 1.419, 1.443, 1.467, 1.489, 1.508, 1.521, 1.529, 1.531, 1.532,
+                            1.543, 1.542, 1.541, 1.532, 1.518, 1.496, 1.471, 1.445, 1.418, 1.393, 1.373, 1.354, 1.341, 1.329, 1.319, 1.317, 1.316, 1.319, 1.327, 1.338, 1.353, 1.371, 1.392, 1.415, 1.439, 1.465, 1.485, 1.507, 1.519, 1.529, 1.531, 1.531,
+                            1.545, 1.544, 1.542, 1.531, 1.515, 1.493, 1.467, 1.441, 1.414, 1.391, 1.369, 1.351, 1.337, 1.326, 1.318, 1.314, 1.314, 1.317, 1.325, 1.335, 1.351, 1.367, 1.388, 1.411, 1.436, 1.461, 1.483, 1.505, 1.519, 1.531, 1.533, 1.533,
+                            1.545, 1.544, 1.541, 1.531, 1.515, 1.493, 1.467, 1.441, 1.414, 1.391, 1.369, 1.351, 1.337, 1.326, 1.318, 1.314, 1.314, 1.317, 1.325, 1.335, 1.351, 1.367, 1.388, 1.411, 1.436, 1.461, 1.483, 1.505, 1.521, 1.531, 1.534, 1.534,
+                            1.545, 1.544, 1.541, 1.534, 1.519, 1.496, 1.471, 1.446, 1.419, 1.392, 1.372, 1.354, 1.338, 1.328, 1.319, 1.316, 1.315, 1.319, 1.327, 1.338, 1.353, 1.371, 1.392, 1.416, 1.441, 1.465, 1.489, 1.511, 1.522, 1.531, 1.534, 1.535,
+                            1.544, 1.544, 1.542, 1.537, 1.524, 1.501, 1.476, 1.449, 1.424, 1.399, 1.377, 1.359, 1.344, 1.332, 1.324, 1.319, 1.319, 1.323, 1.331, 1.343, 1.358, 1.374, 1.396, 1.419, 1.445, 1.471, 1.493, 1.512, 1.525, 1.532, 1.534, 1.534,
+                            1.545, 1.545, 1.543, 1.538, 1.524, 1.503, 1.479, 1.452, 1.426, 1.402, 1.381, 1.362, 1.348, 1.337, 1.329, 1.324, 1.324, 1.328, 1.335, 1.347, 1.361, 1.379, 1.399, 1.423, 1.447, 1.471, 1.493, 1.513, 1.526, 1.533, 1.534, 1.535,
+                            1.546, 1.546, 1.544, 1.539, 1.525, 1.504, 1.479, 1.453, 1.428, 1.404, 1.383, 1.365, 1.352, 1.339, 1.333, 1.329, 1.329, 1.333, 1.339, 1.349, 1.363, 1.381, 1.402, 1.424, 1.448, 1.472, 1.494, 1.514, 1.526, 1.534, 1.534, 1.534,
+                            1.546, 1.546, 1.544, 1.539, 1.526, 1.505, 1.483, 1.457, 1.432, 1.407, 1.389, 1.371, 1.357, 1.347, 1.339, 1.333, 1.333, 1.339, 1.345, 1.354, 1.368, 1.386, 1.406, 1.428, 1.453, 1.475, 1.496, 1.515, 1.527, 1.535, 1.535, 1.535,
+                            1.545, 1.545, 1.545, 1.541, 1.529, 1.513, 1.491, 1.467, 1.441, 1.418, 1.399, 1.379, 1.366, 1.355, 1.347, 1.341, 1.341, 1.345, 1.354, 1.364, 1.378, 1.395, 1.415, 1.436, 1.459, 1.483, 1.503, 1.519, 1.531, 1.534, 1.535, 1.534,
+                            1.544, 1.545, 1.545, 1.544, 1.535, 1.519, 1.499, 1.476, 1.451, 1.428, 1.409, 1.391, 1.377, 1.366, 1.356, 1.352, 1.352, 1.355, 1.364, 1.374, 1.388, 1.405, 1.426, 1.447, 1.469, 1.492, 1.509, 1.523, 1.532, 1.535, 1.535, 1.533,
+                            1.544, 1.545, 1.546, 1.545, 1.537, 1.523, 1.504, 1.482, 1.458, 1.436, 1.418, 1.401, 1.385, 1.377, 1.367, 1.362, 1.362, 1.365, 1.373, 1.385, 1.398, 1.415, 1.434, 1.455, 1.477, 1.495, 1.514, 1.525, 1.533, 1.536, 1.535, 1.533,
+                            1.545, 1.546, 1.547, 1.545, 1.538, 1.525, 1.508, 1.486, 1.465, 1.444, 1.424, 1.408, 1.394, 1.385, 1.377, 1.371, 1.371, 1.373, 1.384, 1.392, 1.405, 1.421, 1.441, 1.459, 1.481, 1.499, 1.516, 1.528, 1.534, 1.536, 1.536, 1.533,
+                            1.544, 1.546, 1.547, 1.547, 1.541, 1.531, 1.514, 1.494, 1.474, 1.454, 1.434, 1.421, 1.408, 1.394, 1.386, 1.382, 1.382, 1.385, 1.392, 1.405, 1.416, 1.432, 1.449, 1.468, 1.488, 1.505, 1.519, 1.531, 1.536, 1.537, 1.536, 1.533,
+                            1.544, 1.546, 1.548, 1.548, 1.545, 1.536, 1.522, 1.506, 1.486, 1.467, 1.451, 1.434, 1.421, 1.408, 1.401, 1.396, 1.396, 1.399, 1.407, 1.416, 1.431, 1.447, 1.463, 1.481, 1.499, 1.513, 1.526, 1.534, 1.537, 1.537, 1.534, 1.531,
+                            1.543, 1.545, 1.547, 1.549, 1.549, 1.543, 1.531, 1.517, 1.501, 1.483, 1.465, 1.451, 1.438, 1.425, 1.417, 1.412, 1.412, 1.418, 1.423, 1.433, 1.447, 1.462, 1.479, 1.493, 1.511, 1.524, 1.531, 1.536, 1.538, 1.537, 1.533, 1.531,
+                            1.542, 1.545, 1.548, 1.551, 1.551, 1.546, 1.539, 1.524, 1.511, 1.493, 1.479, 1.464, 1.451, 1.442, 1.433, 1.429, 1.429, 1.434, 1.439, 1.449, 1.462, 1.474, 1.491, 1.505, 1.519, 1.529, 1.536, 1.539, 1.539, 1.537, 1.533, 1.531,
+                            1.541, 1.546, 1.549, 1.552, 1.553, 1.551, 1.544, 1.533, 1.521, 1.505, 1.489, 1.477, 1.464, 1.455, 1.447, 1.443, 1.443, 1.446, 1.451, 1.462, 1.472, 1.487, 1.499, 1.514, 1.525, 1.535, 1.541, 1.541, 1.541, 1.539, 1.533, 1.531,
+                            1.541, 1.546, 1.549, 1.553, 1.554, 1.552, 1.546, 1.537, 1.524, 1.512, 1.499, 1.485, 1.474, 1.464, 1.455, 1.451, 1.451, 1.452, 1.461, 1.469, 1.481, 1.495, 1.506, 1.518, 1.529, 1.539, 1.541, 1.542, 1.541, 1.539, 1.533, 1.529
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            2.586, 2.591, 2.597, 2.601, 2.601, 2.599, 2.592, 2.576, 2.561, 2.541, 2.523, 2.503, 2.486, 2.471, 2.459, 2.452, 2.452, 2.454, 2.462, 2.478, 2.495, 2.512, 2.531, 2.555, 2.568, 2.579, 2.587, 2.588, 2.585, 2.579, 2.573, 2.566,
+                            2.587, 2.592, 2.598, 2.601, 2.601, 2.599, 2.587, 2.574, 2.556, 2.532, 2.512, 2.491, 2.474, 2.462, 2.449, 2.443, 2.439, 2.443, 2.454, 2.464, 2.485, 2.505, 2.525, 2.548, 2.566, 2.578, 2.585, 2.588, 2.586, 2.579, 2.575, 2.567,
+                            2.587, 2.593, 2.598, 2.602, 2.601, 2.597, 2.584, 2.569, 2.551, 2.527, 2.503, 2.482, 2.464, 2.448, 2.434, 2.428, 2.427, 2.431, 2.439, 2.455, 2.474, 2.498, 2.521, 2.541, 2.564, 2.577, 2.585, 2.588, 2.589, 2.581, 2.576, 2.569,
+                            2.593, 2.596, 2.601, 2.603, 2.601, 2.594, 2.583, 2.563, 2.539, 2.514, 2.491, 2.466, 2.445, 2.429, 2.417, 2.409, 2.408, 2.411, 2.421, 2.437, 2.457, 2.481, 2.507, 2.531, 2.555, 2.572, 2.583, 2.588, 2.588, 2.585, 2.579, 2.575,
+                            2.597, 2.599, 2.604, 2.603, 2.599, 2.587, 2.567, 2.548, 2.522, 2.493, 2.467, 2.443, 2.419, 2.406, 2.391, 2.385, 2.385, 2.387, 2.397, 2.413, 2.435, 2.459, 2.486, 2.509, 2.538, 2.559, 2.574, 2.586, 2.588, 2.586, 2.582, 2.579,
+                            2.601, 2.603, 2.606, 2.604, 2.596, 2.578, 2.556, 2.531, 2.501, 2.471, 2.444, 2.419, 2.402, 2.381, 2.365, 2.359, 2.359, 2.361, 2.374, 2.396, 2.413, 2.435, 2.465, 2.493, 2.517, 2.542, 2.562, 2.582, 2.588, 2.587, 2.586, 2.584,
+                            2.601, 2.604, 2.605, 2.604, 2.593, 2.575, 2.547, 2.522, 2.488, 2.458, 2.432, 2.402, 2.381, 2.364, 2.349, 2.338, 2.338, 2.345, 2.359, 2.374, 2.396, 2.423, 2.453, 2.481, 2.511, 2.539, 2.561, 2.581, 2.586, 2.588, 2.588, 2.586,
+                            2.599, 2.602, 2.604, 2.602, 2.592, 2.572, 2.546, 2.516, 2.485, 2.451, 2.422, 2.393, 2.368, 2.349, 2.336, 2.328, 2.328, 2.333, 2.345, 2.365, 2.389, 2.417, 2.447, 2.478, 2.509, 2.537, 2.561, 2.577, 2.585, 2.588, 2.588, 2.587,
+                            2.601, 2.602, 2.604, 2.601, 2.589, 2.569, 2.539, 2.509, 2.473, 2.442, 2.409, 2.379, 2.357, 2.336, 2.323, 2.315, 2.315, 2.322, 2.334, 2.354, 2.377, 2.406, 2.436, 2.469, 2.503, 2.529, 2.558, 2.574, 2.585, 2.588, 2.589, 2.587,
+                            2.601, 2.606, 2.606, 2.601, 2.581, 2.557, 2.525, 2.493, 2.459, 2.426, 2.394, 2.365, 2.339, 2.322, 2.308, 2.301, 2.301, 2.305, 2.322, 2.337, 2.361, 2.389, 2.422, 2.454, 2.485, 2.519, 2.546, 2.568, 2.584, 2.589, 2.589, 2.589,
+                            2.608, 2.608, 2.606, 2.597, 2.576, 2.548, 2.515, 2.481, 2.444, 2.409, 2.376, 2.346, 2.323, 2.308, 2.293, 2.282, 2.281, 2.291, 2.305, 2.322, 2.348, 2.371, 2.403, 2.439, 2.472, 2.508, 2.538, 2.565, 2.582, 2.589, 2.592, 2.593,
+                            2.608, 2.608, 2.605, 2.596, 2.575, 2.547, 2.511, 2.474, 2.435, 2.401, 2.366, 2.339, 2.312, 2.293, 2.281, 2.274, 2.274, 2.281, 2.291, 2.311, 2.334, 2.364, 2.399, 2.433, 2.471, 2.506, 2.538, 2.564, 2.581, 2.591, 2.594, 2.595,
+                            2.605, 2.606, 2.605, 2.595, 2.575, 2.547, 2.511, 2.474, 2.433, 2.397, 2.363, 2.333, 2.309, 2.291, 2.274, 2.267, 2.265, 2.272, 2.284, 2.307, 2.331, 2.361, 2.395, 2.431, 2.469, 2.503, 2.539, 2.567, 2.584, 2.591, 2.595, 2.595,
+                            2.605, 2.606, 2.605, 2.595, 2.575, 2.547, 2.509, 2.473, 2.431, 2.395, 2.361, 2.332, 2.306, 2.285, 2.267, 2.261, 2.262, 2.265, 2.281, 2.302, 2.329, 2.359, 2.395, 2.429, 2.468, 2.503, 2.539, 2.567, 2.583, 2.593, 2.595, 2.595,
+                            2.608, 2.607, 2.606, 2.592, 2.572, 2.543, 2.506, 2.468, 2.426, 2.389, 2.354, 2.327, 2.299, 2.279, 2.262, 2.258, 2.257, 2.262, 2.276, 2.297, 2.321, 2.352, 2.387, 2.425, 2.464, 2.498, 2.532, 2.565, 2.582, 2.592, 2.595, 2.596,
+                            2.611, 2.609, 2.605, 2.592, 2.571, 2.538, 2.499, 2.463, 2.421, 2.384, 2.351, 2.322, 2.295, 2.276, 2.259, 2.254, 2.254, 2.256, 2.273, 2.292, 2.318, 2.347, 2.383, 2.418, 2.456, 2.491, 2.529, 2.562, 2.581, 2.593, 2.597, 2.598,
+                            2.609, 2.609, 2.606, 2.593, 2.571, 2.538, 2.499, 2.463, 2.421, 2.384, 2.351, 2.321, 2.295, 2.276, 2.259, 2.251, 2.251, 2.256, 2.273, 2.292, 2.318, 2.347, 2.383, 2.418, 2.456, 2.491, 2.529, 2.559, 2.582, 2.595, 2.597, 2.599,
+                            2.609, 2.609, 2.607, 2.597, 2.576, 2.543, 2.507, 2.467, 2.427, 2.388, 2.356, 2.323, 2.297, 2.278, 2.262, 2.256, 2.255, 2.262, 2.275, 2.296, 2.321, 2.351, 2.388, 2.425, 2.464, 2.502, 2.534, 2.563, 2.586, 2.595, 2.598, 2.599,
+                            2.609, 2.609, 2.608, 2.601, 2.581, 2.547, 2.513, 2.475, 2.434, 2.398, 2.362, 2.332, 2.307, 2.287, 2.269, 2.263, 2.263, 2.269, 2.281, 2.304, 2.328, 2.358, 2.394, 2.429, 2.469, 2.508, 2.538, 2.568, 2.589, 2.597, 2.598, 2.598,
+                            2.609, 2.611, 2.609, 2.601, 2.583, 2.549, 2.518, 2.478, 2.439, 2.402, 2.367, 2.337, 2.313, 2.293, 2.279, 2.271, 2.269, 2.277, 2.291, 2.311, 2.336, 2.363, 2.399, 2.435, 2.473, 2.509, 2.541, 2.571, 2.591, 2.598, 2.599, 2.599,
+                            2.611, 2.611, 2.609, 2.602, 2.585, 2.551, 2.519, 2.481, 2.442, 2.406, 2.374, 2.342, 2.318, 2.297, 2.287, 2.279, 2.278, 2.287, 2.297, 2.315, 2.339, 2.368, 2.402, 2.438, 2.476, 2.511, 2.545, 2.571, 2.591, 2.599, 2.601, 2.599,
+                            2.611, 2.611, 2.609, 2.604, 2.587, 2.557, 2.521, 2.485, 2.447, 2.412, 2.379, 2.352, 2.328, 2.309, 2.297, 2.288, 2.287, 2.297, 2.308, 2.327, 2.349, 2.377, 2.408, 2.446, 2.481, 2.517, 2.547, 2.573, 2.591, 2.599, 2.601, 2.599,
+                            2.608, 2.609, 2.609, 2.606, 2.592, 2.564, 2.533, 2.498, 2.462, 2.427, 2.394, 2.364, 2.343, 2.326, 2.309, 2.302, 2.302, 2.308, 2.324, 2.341, 2.362, 2.391, 2.425, 2.458, 2.494, 2.526, 2.555, 2.584, 2.593, 2.599, 2.599, 2.599,
+                            2.608, 2.609, 2.609, 2.609, 2.597, 2.574, 2.547, 2.511, 2.475, 2.438, 2.411, 2.381, 2.359, 2.342, 2.327, 2.318, 2.318, 2.325, 2.341, 2.358, 2.377, 2.404, 2.439, 2.469, 2.507, 2.537, 2.564, 2.587, 2.596, 2.598, 2.598, 2.597,
+                            2.609, 2.609, 2.611, 2.609, 2.599, 2.579, 2.551, 2.519, 2.486, 2.453, 2.425, 2.397, 2.375, 2.358, 2.345, 2.336, 2.336, 2.341, 2.355, 2.372, 2.393, 2.419, 2.452, 2.481, 2.516, 2.542, 2.571, 2.591, 2.597, 2.599, 2.598, 2.595,
+                            2.607, 2.611, 2.613, 2.611, 2.605, 2.586, 2.561, 2.529, 2.495, 2.462, 2.435, 2.409, 2.387, 2.374, 2.359, 2.351, 2.351, 2.356, 2.372, 2.385, 2.406, 2.431, 2.462, 2.488, 2.524, 2.551, 2.573, 2.591, 2.598, 2.599, 2.598, 2.596,
+                            2.606, 2.609, 2.613, 2.613, 2.607, 2.591, 2.565, 2.539, 2.507, 2.477, 2.449, 2.425, 2.409, 2.387, 2.376, 2.369, 2.369, 2.374, 2.385, 2.406, 2.422, 2.446, 2.473, 2.502, 2.534, 2.557, 2.578, 2.595, 2.599, 2.601, 2.598, 2.595,
+                            2.606, 2.611, 2.613, 2.614, 2.611, 2.598, 2.581, 2.553, 2.523, 2.496, 2.471, 2.449, 2.425, 2.409, 2.398, 2.391, 2.391, 2.395, 2.408, 2.422, 2.445, 2.468, 2.493, 2.522, 2.549, 2.569, 2.589, 2.601, 2.603, 2.602, 2.596, 2.593,
+                            2.605, 2.609, 2.613, 2.616, 2.614, 2.607, 2.591, 2.571, 2.545, 2.518, 2.494, 2.471, 2.452, 2.435, 2.423, 2.417, 2.417, 2.421, 2.431, 2.449, 2.467, 2.493, 2.516, 2.542, 2.566, 2.585, 2.596, 2.606, 2.605, 2.602, 2.595, 2.593,
+                            2.604, 2.608, 2.616, 2.617, 2.618, 2.613, 2.602, 2.584, 2.559, 2.536, 2.514, 2.493, 2.476, 2.459, 2.445, 2.439, 2.439, 2.445, 2.456, 2.471, 2.493, 2.511, 2.534, 2.559, 2.579, 2.592, 2.607, 2.608, 2.607, 2.604, 2.595, 2.592,
+                            2.603, 2.609, 2.615, 2.619, 2.623, 2.619, 2.608, 2.594, 2.573, 2.551, 2.532, 2.512, 2.493, 2.477, 2.468, 2.462, 2.462, 2.468, 2.476, 2.494, 2.509, 2.528, 2.551, 2.574, 2.589, 2.604, 2.611, 2.611, 2.611, 2.604, 2.598, 2.592,
+                            2.602, 2.607, 2.613, 2.621, 2.624, 2.621, 2.617, 2.601, 2.585, 2.567, 2.544, 2.521, 2.507, 2.493, 2.478, 2.474, 2.475, 2.477, 2.489, 2.505, 2.523, 2.544, 2.563, 2.584, 2.598, 2.609, 2.612, 2.613, 2.613, 2.608, 2.599, 2.591
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.263, 3.263, 3.264, 3.269, 3.274, 3.275, 3.277, 3.281, 3.283, 3.285, 3.289, 3.292, 3.291, 3.291, 3.294, 3.298, 3.302, 3.305, 3.303, 3.301, 3.296, 3.294, 3.293, 3.293, 3.295, 3.295, 3.295, 3.287, 3.285, 3.279, 3.282, 3.285,
+                            3.259, 3.259, 3.262, 3.268, 3.271, 3.273, 3.273, 3.274, 3.277, 3.278, 3.282, 3.285, 3.286, 3.286, 3.288, 3.289, 3.292, 3.291, 3.293, 3.291, 3.288, 3.288, 3.288, 3.288, 3.288, 3.287, 3.287, 3.283, 3.281, 3.276, 3.277, 3.281,
+                            3.259, 3.259, 3.262, 3.269, 3.272, 3.274, 3.273, 3.273, 3.273, 3.276, 3.278, 3.279, 3.281, 3.282, 3.283, 3.283, 3.285, 3.286, 3.286, 3.285, 3.283, 3.282, 3.282, 3.286, 3.285, 3.285, 3.285, 3.282, 3.281, 3.276, 3.275, 3.279,
+                            3.267, 3.266, 3.269, 3.273, 3.274, 3.277, 3.276, 3.275, 3.274, 3.277, 3.277, 3.278, 3.279, 3.279, 3.279, 3.279, 3.281, 3.283, 3.283, 3.281, 3.281, 3.281, 3.282, 3.287, 3.287, 3.288, 3.287, 3.286, 3.283, 3.277, 3.278, 3.281,
+                            3.268, 3.271, 3.274, 3.277, 3.283, 3.286, 3.284, 3.281, 3.278, 3.278, 3.279, 3.279, 3.281, 3.281, 3.281, 3.281, 3.282, 3.283, 3.284, 3.283, 3.282, 3.282, 3.284, 3.288, 3.289, 3.291, 3.291, 3.288, 3.288, 3.283, 3.286, 3.288,
+                            3.272, 3.275, 3.279, 3.283, 3.288, 3.289, 3.289, 3.287, 3.282, 3.284, 3.282, 3.284, 3.284, 3.285, 3.284, 3.285, 3.285, 3.288, 3.287, 3.286, 3.283, 3.283, 3.285, 3.289, 3.292, 3.292, 3.293, 3.292, 3.291, 3.288, 3.289, 3.293,
+                            3.276, 3.278, 3.282, 3.289, 3.293, 3.293, 3.291, 3.289, 3.287, 3.286, 3.285, 3.285, 3.286, 3.286, 3.287, 3.288, 3.289, 3.289, 3.289, 3.288, 3.285, 3.283, 3.286, 3.289, 3.292, 3.294, 3.294, 3.294, 3.293, 3.289, 3.292, 3.293,
+                            3.279, 3.281, 3.286, 3.293, 3.297, 3.298, 3.295, 3.292, 3.288, 3.287, 3.285, 3.287, 3.288, 3.288, 3.289, 3.291, 3.292, 3.293, 3.291, 3.288, 3.286, 3.285, 3.285, 3.291, 3.294, 3.295, 3.297, 3.297, 3.298, 3.293, 3.294, 3.294,
+                            3.281, 3.286, 3.291, 3.298, 3.301, 3.301, 3.299, 3.295, 3.289, 3.288, 3.286, 3.288, 3.289, 3.292, 3.293, 3.292, 3.295, 3.296, 3.295, 3.291, 3.287, 3.286, 3.286, 3.289, 3.295, 3.297, 3.298, 3.301, 3.301, 3.298, 3.297, 3.297,
+                            3.284, 3.289, 3.295, 3.302, 3.303, 3.303, 3.301, 3.298, 3.294, 3.292, 3.289, 3.293, 3.296, 3.297, 3.297, 3.297, 3.297, 3.298, 3.298, 3.296, 3.289, 3.288, 3.287, 3.294, 3.298, 3.301, 3.304, 3.305, 3.304, 3.299, 3.299, 3.302,
+                            3.291, 3.292, 3.299, 3.305, 3.308, 3.305, 3.304, 3.302, 3.298, 3.295, 3.295, 3.298, 3.299, 3.302, 3.303, 3.302, 3.301, 3.301, 3.301, 3.299, 3.296, 3.291, 3.292, 3.297, 3.301, 3.304, 3.306, 3.309, 3.308, 3.302, 3.301, 3.304,
+                            3.292, 3.297, 3.303, 3.309, 3.312, 3.311, 3.308, 3.304, 3.301, 3.299, 3.298, 3.299, 3.303, 3.305, 3.306, 3.305, 3.305, 3.303, 3.303, 3.301, 3.299, 3.294, 3.294, 3.297, 3.302, 3.305, 3.309, 3.311, 3.311, 3.305, 3.305, 3.306,
+                            3.295, 3.298, 3.305, 3.309, 3.313, 3.313, 3.312, 3.307, 3.303, 3.301, 3.299, 3.301, 3.304, 3.307, 3.308, 3.306, 3.306, 3.306, 3.306, 3.302, 3.299, 3.296, 3.295, 3.298, 3.303, 3.306, 3.311, 3.312, 3.312, 3.307, 3.308, 3.309,
+                            3.297, 3.298, 3.303, 3.309, 3.313, 3.313, 3.311, 3.307, 3.303, 3.301, 3.299, 3.299, 3.305, 3.307, 3.307, 3.306, 3.306, 3.306, 3.305, 3.299, 3.297, 3.294, 3.294, 3.298, 3.303, 3.305, 3.311, 3.312, 3.313, 3.308, 3.311, 3.309,
+                            3.297, 3.298, 3.304, 3.309, 3.312, 3.313, 3.311, 3.308, 3.304, 3.302, 3.301, 3.301, 3.306, 3.307, 3.308, 3.306, 3.306, 3.307, 3.306, 3.302, 3.297, 3.294, 3.294, 3.299, 3.305, 3.306, 3.309, 3.312, 3.311, 3.306, 3.308, 3.309,
+                            3.298, 3.299, 3.306, 3.311, 3.315, 3.314, 3.311, 3.308, 3.305, 3.303, 3.303, 3.304, 3.307, 3.309, 3.309, 3.308, 3.308, 3.307, 3.306, 3.302, 3.298, 3.296, 3.296, 3.298, 3.304, 3.306, 3.308, 3.309, 3.314, 3.308, 3.309, 3.308,
+                            3.299, 3.301, 3.307, 3.313, 3.316, 3.316, 3.313, 3.311, 3.307, 3.305, 3.305, 3.307, 3.309, 3.311, 3.312, 3.311, 3.309, 3.309, 3.308, 3.306, 3.301, 3.298, 3.297, 3.301, 3.305, 3.309, 3.309, 3.311, 3.313, 3.306, 3.308, 3.307,
+                            3.301, 3.301, 3.307, 3.314, 3.317, 3.318, 3.314, 3.311, 3.308, 3.306, 3.306, 3.308, 3.311, 3.311, 3.312, 3.311, 3.309, 3.309, 3.309, 3.306, 3.302, 3.298, 3.298, 3.301, 3.305, 3.309, 3.311, 3.311, 3.312, 3.309, 3.308, 3.308,
+                            3.301, 3.302, 3.307, 3.316, 3.319, 3.319, 3.315, 3.312, 3.309, 3.306, 3.307, 3.309, 3.311, 3.312, 3.311, 3.311, 3.309, 3.309, 3.309, 3.306, 3.303, 3.299, 3.298, 3.302, 3.305, 3.308, 3.309, 3.309, 3.309, 3.303, 3.306, 3.307,
+                            3.301, 3.303, 3.308, 3.315, 3.318, 3.318, 3.316, 3.313, 3.311, 3.307, 3.307, 3.308, 3.311, 3.311, 3.311, 3.308, 3.308, 3.307, 3.307, 3.306, 3.303, 3.299, 3.297, 3.301, 3.303, 3.306, 3.309, 3.308, 3.306, 3.303, 3.304, 3.306,
+                            3.302, 3.304, 3.306, 3.316, 3.318, 3.318, 3.317, 3.315, 3.311, 3.308, 3.309, 3.311, 3.311, 3.312, 3.311, 3.307, 3.306, 3.307, 3.308, 3.307, 3.304, 3.299, 3.298, 3.301, 3.303, 3.305, 3.306, 3.305, 3.304, 3.302, 3.303, 3.306,
+                            3.302, 3.304, 3.306, 3.312, 3.316, 3.317, 3.317, 3.313, 3.311, 3.309, 3.309, 3.311, 3.311, 3.312, 3.309, 3.307, 3.306, 3.306, 3.308, 3.307, 3.304, 3.298, 3.297, 3.302, 3.304, 3.305, 3.306, 3.305, 3.304, 3.299, 3.302, 3.303,
+                            3.299, 3.299, 3.306, 3.309, 3.315, 3.316, 3.316, 3.312, 3.309, 3.308, 3.308, 3.309, 3.311, 3.311, 3.307, 3.305, 3.305, 3.305, 3.306, 3.304, 3.299, 3.297, 3.296, 3.301, 3.302, 3.304, 3.303, 3.302, 3.301, 3.298, 3.299, 3.301,
+                            3.295, 3.297, 3.305, 3.309, 3.311, 3.311, 3.311, 3.309, 3.307, 3.306, 3.305, 3.305, 3.305, 3.305, 3.304, 3.301, 3.301, 3.301, 3.302, 3.299, 3.296, 3.295, 3.295, 3.298, 3.301, 3.302, 3.303, 3.301, 3.299, 3.295, 3.297, 3.299,
+                            3.294, 3.296, 3.299, 3.306, 3.308, 3.309, 3.309, 3.307, 3.307, 3.303, 3.302, 3.301, 3.302, 3.303, 3.302, 3.299, 3.298, 3.299, 3.299, 3.298, 3.295, 3.292, 3.292, 3.293, 3.297, 3.299, 3.299, 3.299, 3.297, 3.294, 3.295, 3.299,
+                            3.291, 3.292, 3.296, 3.302, 3.306, 3.306, 3.307, 3.306, 3.305, 3.303, 3.302, 3.301, 3.301, 3.303, 3.301, 3.299, 3.298, 3.298, 3.298, 3.297, 3.295, 3.292, 3.291, 3.291, 3.295, 3.295, 3.297, 3.298, 3.296, 3.293, 3.292, 3.291,
+                            3.293, 3.292, 3.294, 3.301, 3.303, 3.305, 3.308, 3.306, 3.306, 3.304, 3.304, 3.303, 3.303, 3.303, 3.302, 3.301, 3.299, 3.299, 3.299, 3.299, 3.294, 3.291, 3.289, 3.291, 3.293, 3.294, 3.294, 3.294, 3.294, 3.289, 3.291, 3.291,
+                            3.288, 3.289, 3.291, 3.299, 3.303, 3.304, 3.304, 3.304, 3.304, 3.303, 3.303, 3.304, 3.306, 3.305, 3.303, 3.301, 3.301, 3.298, 3.299, 3.298, 3.293, 3.291, 3.289, 3.291, 3.291, 3.292, 3.291, 3.291, 3.291, 3.285, 3.288, 3.291,
+                            3.285, 3.284, 3.287, 3.291, 3.299, 3.299, 3.299, 3.299, 3.299, 3.301, 3.302, 3.303, 3.303, 3.302, 3.299, 3.298, 3.298, 3.298, 3.298, 3.293, 3.288, 3.286, 3.285, 3.288, 3.288, 3.288, 3.287, 3.285, 3.284, 3.279, 3.281, 3.284,
+                            3.281, 3.282, 3.282, 3.286, 3.291, 3.294, 3.294, 3.295, 3.295, 3.299, 3.301, 3.304, 3.305, 3.299, 3.299, 3.297, 3.298, 3.298, 3.297, 3.292, 3.288, 3.285, 3.283, 3.284, 3.284, 3.286, 3.284, 3.282, 3.279, 3.275, 3.275, 3.278,
+                            3.282, 3.282, 3.284, 3.286, 3.291, 3.294, 3.295, 3.295, 3.298, 3.301, 3.304, 3.306, 3.306, 3.304, 3.303, 3.301, 3.302, 3.299, 3.299, 3.295, 3.289, 3.287, 3.284, 3.288, 3.287, 3.287, 3.285, 3.283, 3.282, 3.278, 3.281, 3.286,
+                            3.292, 3.291, 3.292, 3.298, 3.307, 3.309, 3.308, 3.312, 3.313, 3.317, 3.324, 3.327, 3.327, 3.325, 3.326, 3.322, 3.319, 3.317, 3.317, 3.315, 3.312, 3.305, 3.303, 3.301, 3.299, 3.297, 3.299, 3.293, 3.289, 3.285, 3.287, 3.293
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.602, 1.603, 1.605, 1.608, 1.611, 1.612, 1.612, 1.614, 1.615, 1.616, 1.619, 1.621, 1.621, 1.622, 1.622, 1.624, 1.624, 1.626, 1.625, 1.625, 1.623, 1.622, 1.621, 1.619, 1.618, 1.617, 1.616, 1.614, 1.612, 1.609, 1.609, 1.611,
+                            1.601, 1.602, 1.605, 1.608, 1.611, 1.612, 1.612, 1.613, 1.614, 1.615, 1.617, 1.619, 1.621, 1.621, 1.621, 1.621, 1.622, 1.624, 1.624, 1.624, 1.622, 1.621, 1.619, 1.618, 1.617, 1.616, 1.615, 1.614, 1.612, 1.609, 1.609, 1.609,
+                            1.602, 1.603, 1.605, 1.609, 1.611, 1.613, 1.613, 1.613, 1.613, 1.615, 1.616, 1.618, 1.618, 1.619, 1.619, 1.619, 1.621, 1.621, 1.622, 1.622, 1.619, 1.618, 1.617, 1.617, 1.616, 1.615, 1.615, 1.615, 1.612, 1.609, 1.609, 1.609,
+                            1.604, 1.605, 1.608, 1.612, 1.613, 1.614, 1.614, 1.614, 1.614, 1.614, 1.616, 1.617, 1.618, 1.618, 1.618, 1.619, 1.619, 1.621, 1.622, 1.621, 1.619, 1.618, 1.617, 1.616, 1.616, 1.616, 1.616, 1.615, 1.615, 1.612, 1.611, 1.611,
+                            1.606, 1.608, 1.611, 1.614, 1.615, 1.615, 1.616, 1.616, 1.615, 1.615, 1.617, 1.618, 1.619, 1.619, 1.618, 1.619, 1.621, 1.622, 1.623, 1.622, 1.619, 1.619, 1.617, 1.617, 1.617, 1.618, 1.618, 1.617, 1.617, 1.614, 1.613, 1.613,
+                            1.608, 1.611, 1.614, 1.617, 1.618, 1.618, 1.618, 1.618, 1.618, 1.618, 1.619, 1.621, 1.621, 1.621, 1.621, 1.621, 1.622, 1.623, 1.624, 1.623, 1.622, 1.619, 1.619, 1.618, 1.618, 1.618, 1.618, 1.618, 1.618, 1.617, 1.615, 1.614,
+                            1.611, 1.613, 1.616, 1.618, 1.621, 1.621, 1.619, 1.619, 1.619, 1.619, 1.619, 1.621, 1.622, 1.623, 1.623, 1.623, 1.623, 1.624, 1.626, 1.624, 1.623, 1.621, 1.619, 1.619, 1.619, 1.619, 1.621, 1.621, 1.619, 1.617, 1.616, 1.616,
+                            1.611, 1.613, 1.617, 1.621, 1.622, 1.622, 1.621, 1.619, 1.619, 1.619, 1.621, 1.622, 1.624, 1.624, 1.624, 1.624, 1.625, 1.626, 1.626, 1.624, 1.623, 1.621, 1.621, 1.619, 1.619, 1.619, 1.621, 1.621, 1.621, 1.619, 1.618, 1.617,
+                            1.613, 1.615, 1.618, 1.621, 1.623, 1.623, 1.622, 1.621, 1.619, 1.619, 1.621, 1.622, 1.625, 1.625, 1.626, 1.626, 1.625, 1.626, 1.626, 1.624, 1.622, 1.621, 1.619, 1.619, 1.619, 1.621, 1.622, 1.622, 1.621, 1.621, 1.619, 1.618,
+                            1.614, 1.617, 1.621, 1.623, 1.624, 1.624, 1.623, 1.621, 1.621, 1.621, 1.622, 1.625, 1.627, 1.627, 1.628, 1.628, 1.628, 1.628, 1.627, 1.626, 1.623, 1.621, 1.621, 1.621, 1.621, 1.623, 1.623, 1.623, 1.623, 1.621, 1.619, 1.619,
+                            1.616, 1.617, 1.622, 1.624, 1.625, 1.625, 1.624, 1.623, 1.622, 1.623, 1.624, 1.627, 1.629, 1.631, 1.631, 1.631, 1.631, 1.631, 1.631, 1.628, 1.626, 1.623, 1.622, 1.622, 1.623, 1.623, 1.624, 1.624, 1.624, 1.622, 1.621, 1.621,
+                            1.617, 1.618, 1.623, 1.625, 1.626, 1.626, 1.625, 1.624, 1.623, 1.624, 1.625, 1.629, 1.631, 1.633, 1.634, 1.634, 1.634, 1.633, 1.633, 1.631, 1.628, 1.624, 1.623, 1.623, 1.623, 1.625, 1.625, 1.625, 1.625, 1.623, 1.622, 1.622,
+                            1.617, 1.619, 1.623, 1.626, 1.627, 1.627, 1.626, 1.625, 1.624, 1.624, 1.625, 1.628, 1.632, 1.634, 1.635, 1.635, 1.635, 1.634, 1.633, 1.631, 1.627, 1.624, 1.623, 1.623, 1.623, 1.624, 1.625, 1.626, 1.625, 1.624, 1.623, 1.623,
+                            1.618, 1.619, 1.623, 1.626, 1.627, 1.626, 1.626, 1.625, 1.624, 1.624, 1.625, 1.628, 1.631, 1.634, 1.634, 1.634, 1.634, 1.634, 1.633, 1.631, 1.628, 1.623, 1.622, 1.622, 1.623, 1.624, 1.625, 1.626, 1.626, 1.624, 1.624, 1.623,
+                            1.618, 1.619, 1.623, 1.626, 1.627, 1.627, 1.625, 1.624, 1.624, 1.624, 1.625, 1.628, 1.632, 1.633, 1.634, 1.634, 1.634, 1.633, 1.633, 1.631, 1.627, 1.623, 1.622, 1.622, 1.623, 1.624, 1.624, 1.625, 1.625, 1.624, 1.623, 1.623,
+                            1.619, 1.621, 1.623, 1.626, 1.627, 1.627, 1.626, 1.625, 1.624, 1.624, 1.626, 1.628, 1.632, 1.634, 1.635, 1.634, 1.634, 1.633, 1.633, 1.631, 1.628, 1.625, 1.622, 1.622, 1.622, 1.623, 1.624, 1.625, 1.625, 1.624, 1.623, 1.623,
+                            1.619, 1.621, 1.623, 1.626, 1.627, 1.627, 1.626, 1.625, 1.624, 1.625, 1.627, 1.629, 1.633, 1.635, 1.635, 1.635, 1.635, 1.634, 1.633, 1.631, 1.628, 1.625, 1.623, 1.622, 1.622, 1.623, 1.624, 1.624, 1.624, 1.623, 1.623, 1.622,
+                            1.619, 1.621, 1.624, 1.626, 1.628, 1.628, 1.627, 1.626, 1.625, 1.626, 1.627, 1.629, 1.633, 1.635, 1.635, 1.635, 1.635, 1.634, 1.633, 1.631, 1.628, 1.625, 1.623, 1.623, 1.623, 1.623, 1.624, 1.624, 1.624, 1.622, 1.622, 1.622,
+                            1.619, 1.621, 1.623, 1.626, 1.628, 1.628, 1.627, 1.626, 1.625, 1.626, 1.627, 1.629, 1.632, 1.634, 1.635, 1.635, 1.634, 1.634, 1.632, 1.631, 1.628, 1.624, 1.622, 1.622, 1.622, 1.623, 1.624, 1.624, 1.624, 1.622, 1.621, 1.621,
+                            1.619, 1.621, 1.623, 1.627, 1.628, 1.628, 1.627, 1.627, 1.626, 1.627, 1.628, 1.629, 1.631, 1.633, 1.634, 1.633, 1.633, 1.632, 1.631, 1.631, 1.627, 1.624, 1.622, 1.622, 1.622, 1.622, 1.623, 1.623, 1.623, 1.621, 1.621, 1.621,
+                            1.621, 1.621, 1.624, 1.627, 1.628, 1.628, 1.627, 1.627, 1.627, 1.627, 1.628, 1.631, 1.632, 1.633, 1.633, 1.632, 1.632, 1.632, 1.631, 1.631, 1.628, 1.625, 1.623, 1.622, 1.622, 1.622, 1.623, 1.623, 1.623, 1.621, 1.621, 1.621,
+                            1.621, 1.621, 1.623, 1.627, 1.628, 1.628, 1.628, 1.627, 1.627, 1.628, 1.628, 1.629, 1.631, 1.632, 1.633, 1.632, 1.631, 1.631, 1.631, 1.629, 1.628, 1.625, 1.624, 1.623, 1.623, 1.623, 1.623, 1.623, 1.623, 1.621, 1.621, 1.619,
+                            1.619, 1.621, 1.623, 1.626, 1.628, 1.629, 1.627, 1.627, 1.627, 1.627, 1.628, 1.629, 1.631, 1.631, 1.631, 1.631, 1.631, 1.629, 1.629, 1.628, 1.626, 1.624, 1.623, 1.623, 1.623, 1.622, 1.623, 1.623, 1.622, 1.621, 1.619, 1.619,
+                            1.618, 1.619, 1.623, 1.625, 1.627, 1.627, 1.627, 1.627, 1.626, 1.627, 1.627, 1.628, 1.628, 1.629, 1.628, 1.628, 1.628, 1.628, 1.628, 1.627, 1.625, 1.623, 1.621, 1.621, 1.621, 1.622, 1.622, 1.622, 1.621, 1.619, 1.618, 1.618,
+                            1.618, 1.619, 1.622, 1.624, 1.626, 1.626, 1.626, 1.626, 1.626, 1.626, 1.626, 1.626, 1.627, 1.627, 1.627, 1.626, 1.626, 1.626, 1.626, 1.626, 1.624, 1.622, 1.621, 1.621, 1.619, 1.621, 1.621, 1.621, 1.621, 1.618, 1.617, 1.617,
+                            1.616, 1.618, 1.621, 1.623, 1.624, 1.625, 1.625, 1.625, 1.625, 1.625, 1.626, 1.626, 1.627, 1.627, 1.625, 1.624, 1.624, 1.625, 1.626, 1.625, 1.623, 1.621, 1.619, 1.619, 1.619, 1.619, 1.621, 1.621, 1.619, 1.616, 1.616, 1.616,
+                            1.615, 1.616, 1.619, 1.621, 1.623, 1.624, 1.625, 1.624, 1.624, 1.625, 1.626, 1.627, 1.627, 1.626, 1.626, 1.625, 1.624, 1.625, 1.625, 1.625, 1.623, 1.621, 1.619, 1.619, 1.619, 1.619, 1.619, 1.619, 1.618, 1.616, 1.615, 1.614,
+                            1.614, 1.615, 1.616, 1.621, 1.621, 1.623, 1.624, 1.623, 1.624, 1.624, 1.625, 1.627, 1.627, 1.627, 1.626, 1.625, 1.625, 1.625, 1.625, 1.624, 1.622, 1.621, 1.619, 1.618, 1.617, 1.617, 1.617, 1.617, 1.616, 1.613, 1.612, 1.612,
+                            1.612, 1.612, 1.615, 1.617, 1.621, 1.621, 1.622, 1.622, 1.622, 1.624, 1.625, 1.626, 1.626, 1.626, 1.625, 1.624, 1.624, 1.624, 1.624, 1.623, 1.621, 1.619, 1.618, 1.616, 1.615, 1.615, 1.615, 1.615, 1.613, 1.611, 1.609, 1.609,
+                            1.611, 1.611, 1.612, 1.615, 1.618, 1.619, 1.621, 1.621, 1.622, 1.623, 1.624, 1.626, 1.626, 1.626, 1.625, 1.624, 1.624, 1.624, 1.623, 1.622, 1.621, 1.618, 1.617, 1.615, 1.615, 1.614, 1.614, 1.613, 1.611, 1.609, 1.609, 1.609,
+                            1.611, 1.611, 1.612, 1.615, 1.618, 1.619, 1.621, 1.622, 1.623, 1.625, 1.625, 1.627, 1.627, 1.627, 1.626, 1.626, 1.626, 1.626, 1.624, 1.622, 1.621, 1.618, 1.617, 1.617, 1.616, 1.615, 1.614, 1.613, 1.612, 1.609, 1.609, 1.609,
+                            1.612, 1.612, 1.614, 1.617, 1.619, 1.621, 1.623, 1.624, 1.625, 1.626, 1.627, 1.629, 1.631, 1.629, 1.629, 1.629, 1.628, 1.629, 1.628, 1.626, 1.624, 1.621, 1.621, 1.619, 1.619, 1.618, 1.616, 1.616, 1.613, 1.611, 1.612, 1.612
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    2.977, 2.794, 2.572, 2.375, 2.218, 2.098, 1.995, 1.903, 1.815, 1.731, 1.647, 1.571, 1.516, 1.493, 1.483, 1.481, 1.481, 1.481, 1.489, 1.511, 1.571, 1.643, 1.729, 1.813, 1.901, 1.993, 2.091, 2.208, 2.364, 2.563, 2.785, 2.971,
+                    2.951, 2.736, 2.512, 2.312, 2.153, 2.031, 1.926, 1.824, 1.736, 1.649, 1.571, 1.506, 1.456, 1.419, 1.396, 1.386, 1.386, 1.392, 1.414, 1.451, 1.505, 1.571, 1.648, 1.733, 1.824, 1.922, 2.025, 2.144, 2.301, 2.499, 2.725, 2.939,
+                    2.883, 2.701, 2.471, 2.266, 2.102, 1.974, 1.861, 1.753, 1.649, 1.571, 1.502, 1.425, 1.361, 1.322, 1.298, 1.286, 1.286, 1.294, 1.317, 1.359, 1.424, 1.501, 1.571, 1.648, 1.751, 1.857, 1.968, 2.095, 2.254, 2.458, 2.688, 2.872,
+                    2.788, 2.632, 2.408, 2.209, 2.056, 1.931, 1.816, 1.704, 1.598, 1.503, 1.425, 1.361, 1.322, 1.298, 1.269, 1.245, 1.243, 1.264, 1.293, 1.317, 1.359, 1.424, 1.501, 1.596, 1.702, 1.812, 1.924, 2.046, 2.197, 2.392, 2.619, 2.777,
+                    2.712, 2.541, 2.327, 2.155, 2.023, 1.908, 1.796, 1.684, 1.578, 1.488, 1.412, 1.351, 1.304, 1.269, 1.245, 1.235, 1.235, 1.243, 1.264, 1.301, 1.349, 1.411, 1.485, 1.577, 1.683, 1.791, 1.902, 2.016, 2.143, 2.312, 2.528, 2.702,
+                    2.678, 2.469, 2.269, 2.117, 1.998, 1.885, 1.773, 1.661, 1.556, 1.469, 1.397, 1.336, 1.277, 1.245, 1.234, 1.226, 1.226, 1.232, 1.244, 1.273, 1.332, 1.392, 1.465, 1.555, 1.659, 1.768, 1.879, 1.991, 2.109, 2.256, 2.454, 2.665,
+                    2.659, 2.433, 2.232, 2.081, 1.957, 1.841, 1.722, 1.606, 1.499, 1.409, 1.337, 1.277, 1.232, 1.198, 1.175, 1.166, 1.166, 1.172, 1.193, 1.228, 1.272, 1.334, 1.408, 1.499, 1.608, 1.717, 1.834, 1.951, 2.073, 2.222, 2.419, 2.648,
+                    2.624, 2.411, 2.204, 2.041, 1.909, 1.784, 1.661, 1.539, 1.431, 1.337, 1.277, 1.219, 1.159, 1.118, 1.096, 1.085, 1.085, 1.092, 1.114, 1.156, 1.219, 1.272, 1.337, 1.429, 1.539, 1.658, 1.779, 1.904, 2.033, 2.193, 2.397, 2.613,
+                    2.564, 2.377, 2.169, 2.012, 1.879, 1.749, 1.623, 1.501, 1.392, 1.299, 1.227, 1.169, 1.125, 1.097, 1.079, 1.063, 1.063, 1.076, 1.093, 1.124, 1.168, 1.227, 1.302, 1.392, 1.501, 1.622, 1.746, 1.875, 2.005, 2.161, 2.362, 2.554,
+                    2.515, 2.325, 2.138, 1.997, 1.869, 1.742, 1.617, 1.501, 1.392, 1.299, 1.227, 1.169, 1.125, 1.095, 1.079, 1.063, 1.063, 1.076, 1.093, 1.124, 1.168, 1.227, 1.302, 1.392, 1.499, 1.615, 1.741, 1.867, 1.991, 2.132, 2.316, 2.505,
+                    2.498, 2.289, 2.121, 1.988, 1.867, 1.741, 1.616, 1.499, 1.391, 1.299, 1.227, 1.169, 1.125, 1.095, 1.082, 1.065, 1.064, 1.079, 1.093, 1.124, 1.168, 1.227, 1.302, 1.392, 1.498, 1.614, 1.738, 1.864, 1.985, 2.116, 2.281, 2.486,
+                    2.498, 2.272, 2.105, 1.971, 1.846, 1.718, 1.592, 1.475, 1.371, 1.279, 1.211, 1.156, 1.112, 1.083, 1.064, 1.055, 1.055, 1.062, 1.081, 1.109, 1.154, 1.212, 1.285, 1.372, 1.473, 1.589, 1.712, 1.843, 1.967, 2.101, 2.263, 2.486,
+                    2.497, 2.267, 2.088, 1.946, 1.813, 1.679, 1.549, 1.431, 1.324, 1.231, 1.159, 1.114, 1.079, 1.035, 1.008, 1.001, 1.001, 1.008, 1.032, 1.076, 1.111, 1.161, 1.235, 1.324, 1.429, 1.547, 1.677, 1.811, 1.941, 2.082, 2.257, 2.484,
+                    2.476, 2.262, 2.077, 1.933, 1.802, 1.671, 1.541, 1.421, 1.317, 1.227, 1.157, 1.101, 1.059, 1.027, 1.004, 1.001, 1.001, 1.004, 1.024, 1.054, 1.098, 1.157, 1.229, 1.317, 1.419, 1.537, 1.667, 1.799, 1.931, 2.071, 2.251, 2.463,
+                    2.455, 2.246, 2.076, 1.933, 1.802, 1.671, 1.541, 1.421, 1.317, 1.227, 1.157, 1.103, 1.064, 1.035, 1.011, 1.003, 1.003, 1.009, 1.032, 1.062, 1.099, 1.157, 1.229, 1.317, 1.419, 1.537, 1.667, 1.799, 1.931, 2.071, 2.236, 2.446,
+                    2.454, 2.239, 2.077, 1.946, 1.817, 1.686, 1.561, 1.444, 1.342, 1.255, 1.189, 1.136, 1.093, 1.059, 1.039, 1.038, 1.038, 1.039, 1.056, 1.091, 1.131, 1.187, 1.258, 1.341, 1.441, 1.556, 1.683, 1.813, 1.939, 2.071, 2.229, 2.445,
+                    2.454, 2.239, 2.079, 1.946, 1.817, 1.686, 1.561, 1.444, 1.342, 1.255, 1.189, 1.136, 1.093, 1.062, 1.039, 1.038, 1.038, 1.039, 1.059, 1.091, 1.131, 1.187, 1.258, 1.341, 1.441, 1.556, 1.683, 1.813, 1.939, 2.071, 2.229, 2.445,
+                    2.458, 2.251, 2.079, 1.941, 1.807, 1.672, 1.543, 1.424, 1.319, 1.231, 1.162, 1.107, 1.065, 1.045, 1.018, 1.003, 1.003, 1.017, 1.044, 1.062, 1.103, 1.159, 1.232, 1.317, 1.419, 1.539, 1.669, 1.802, 1.933, 2.072, 2.239, 2.445,
+                    2.479, 2.265, 2.085, 1.941, 1.807, 1.672, 1.543, 1.424, 1.319, 1.231, 1.162, 1.107, 1.064, 1.031, 1.017, 1.003, 1.003, 1.017, 1.031, 1.059, 1.103, 1.159, 1.232, 1.317, 1.419, 1.539, 1.669, 1.802, 1.933, 2.076, 2.252, 2.468,
+                    2.504, 2.277, 2.099, 1.958, 1.826, 1.695, 1.565, 1.445, 1.338, 1.249, 1.181, 1.129, 1.095, 1.051, 1.027, 1.018, 1.018, 1.028, 1.049, 1.092, 1.127, 1.179, 1.252, 1.339, 1.442, 1.561, 1.691, 1.822, 1.949, 2.089, 2.263, 2.492,
+                    2.509, 2.288, 2.118, 1.982, 1.858, 1.728, 1.604, 1.486, 1.381, 1.293, 1.227, 1.173, 1.127, 1.098, 1.076, 1.067, 1.067, 1.077, 1.097, 1.121, 1.168, 1.225, 1.296, 1.382, 1.483, 1.598, 1.723, 1.852, 1.975, 2.107, 2.274, 2.496,
+                    2.515, 2.312, 2.139, 2.002, 1.877, 1.751, 1.629, 1.512, 1.405, 1.318, 1.248, 1.193, 1.149, 1.118, 1.096, 1.085, 1.085, 1.095, 1.114, 1.145, 1.188, 1.246, 1.319, 1.405, 1.508, 1.623, 1.747, 1.873, 1.995, 2.127, 2.297, 2.501,
+                    2.541, 2.351, 2.161, 2.016, 1.888, 1.762, 1.638, 1.519, 1.411, 1.319, 1.251, 1.197, 1.154, 1.121, 1.099, 1.091, 1.091, 1.099, 1.119, 1.148, 1.192, 1.248, 1.321, 1.411, 1.515, 1.633, 1.758, 1.884, 2.009, 2.149, 2.334, 2.526,
+                    2.588, 2.394, 2.193, 2.036, 1.905, 1.779, 1.656, 1.537, 1.426, 1.329, 1.255, 1.198, 1.161, 1.139, 1.118, 1.096, 1.095, 1.114, 1.138, 1.158, 1.195, 1.256, 1.333, 1.425, 1.533, 1.651, 1.777, 1.902, 2.028, 2.181, 2.378, 2.571,
+                    2.639, 2.431, 2.226, 2.067, 1.937, 1.816, 1.695, 1.577, 1.467, 1.368, 1.298, 1.253, 1.198, 1.161, 1.139, 1.129, 1.129, 1.138, 1.158, 1.195, 1.245, 1.296, 1.374, 1.468, 1.574, 1.692, 1.812, 1.934, 2.059, 2.216, 2.418, 2.626,
+                    2.679, 2.465, 2.261, 2.104, 1.979, 1.862, 1.746, 1.631, 1.522, 1.426, 1.352, 1.297, 1.254, 1.221, 1.201, 1.189, 1.189, 1.198, 1.217, 1.246, 1.293, 1.354, 1.433, 1.526, 1.631, 1.744, 1.859, 1.975, 2.097, 2.252, 2.452, 2.667,
+                    2.711, 2.511, 2.302, 2.141, 2.018, 1.903, 1.791, 1.678, 1.571, 1.475, 1.401, 1.343, 1.297, 1.268, 1.247, 1.236, 1.236, 1.244, 1.263, 1.291, 1.341, 1.403, 1.484, 1.575, 1.679, 1.791, 1.902, 2.012, 2.136, 2.295, 2.501, 2.698,
+                    2.759, 2.582, 2.363, 2.184, 2.049, 1.935, 1.824, 1.714, 1.608, 1.511, 1.431, 1.371, 1.325, 1.295, 1.271, 1.259, 1.259, 1.266, 1.291, 1.318, 1.369, 1.436, 1.517, 1.611, 1.716, 1.825, 1.933, 2.047, 2.179, 2.351, 2.571, 2.748,
+                    2.833, 2.662, 2.433, 2.239, 2.089, 1.968, 1.859, 1.752, 1.646, 1.549, 1.468, 1.411, 1.369, 1.325, 1.296, 1.283, 1.283, 1.292, 1.318, 1.366, 1.411, 1.472, 1.555, 1.651, 1.755, 1.861, 1.969, 2.086, 2.231, 2.422, 2.648, 2.821,
+                    2.909, 2.729, 2.499, 2.298, 2.141, 2.016, 1.907, 1.805, 1.703, 1.611, 1.539, 1.468, 1.411, 1.375, 1.351, 1.339, 1.339, 1.348, 1.372, 1.411, 1.472, 1.543, 1.613, 1.708, 1.807, 1.909, 2.014, 2.135, 2.288, 2.487, 2.716, 2.897,
+                    2.981, 2.789, 2.563, 2.358, 2.197, 2.071, 1.968, 1.868, 1.774, 1.684, 1.607, 1.541, 1.489, 1.453, 1.428, 1.417, 1.417, 1.427, 1.451, 1.489, 1.543, 1.611, 1.686, 1.776, 1.871, 1.966, 2.069, 2.191, 2.349, 2.551, 2.775, 2.964,
+                    3.041, 2.856, 2.629, 2.422, 2.252, 2.127, 2.021, 1.927, 1.834, 1.748, 1.672, 1.604, 1.541, 1.495, 1.483, 1.483, 1.483, 1.483, 1.496, 1.543, 1.608, 1.673, 1.749, 1.835, 1.926, 2.019, 2.122, 2.249, 2.411, 2.614, 2.839, 3.026
+                ],
+                "sigma": 0.00163,
+                "sigma_Cb": 0.0011
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2964,
+                        "ccm":
+                        [
+                            1.72129, -0.45961, -0.26169,
+                            -0.30042, 1.56924, -0.26882,
+                            0.15133, -1.13293, 1.98161
+                        ]
+                    },
+                    {
+                        "ct": 3610,
+                        "ccm":
+                        [
+                            1.54474, -0.35082, -0.19391,
+                            -0.36989, 1.67926, -0.30936,
+                            -0.00524, -0.55197, 1.55722
+                        ]
+                    },
+                    {
+                        "ct": 4640,
+                        "ccm":
+                        [
+                            1.52972, -0.35168, -0.17804,
+                            -0.28309, 1.67098, -0.38788,
+                            0.01695, -0.57209, 1.55515
+                        ]
+                    },
+                    {
+                        "ct": 5910,
+                        "ccm":
+                        [
+                            1.56879, -0.42159, -0.14719,
+                            -0.27275, 1.59354, -0.32079,
+                            -0.02862, -0.40662, 1.43525
+                        ]
+                    },
+                    {
+                        "ct": 7590,
+                        "ccm":
+                        [
+                            1.41424, -0.21092, -0.20332,
+                            -0.17646, 1.71734, -0.54087,
+                            0.01297, -0.63111, 1.61814
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.af":
+            {
+                "ranges":
+                {
+                    "normal":
+                    {
+                        "min": 0.0,
+                        "max": 12.0,
+                        "default": 1.0
+                    },
+                    "macro":
+                    {
+                        "min": 3.0,
+                        "max": 15.0,
+                        "default": 4.0
+                    }
+                },
+                "speeds":
+                {
+                    "normal":
+                    {
+                        "step_coarse": 1.0,
+                        "step_fine": 0.25,
+                        "contrast_ratio": 0.75,
+                        "pdaf_gain": -0.02,
+                        "pdaf_squelch": 0.125,
+                        "max_slew": 2.0,
+                        "pdaf_frames": 20,
+                        "dropout_frames": 6,
+                        "step_frames": 4
+                    }
+                },
+                "conf_epsilon": 8,
+                "conf_thresh": 16,
+                "conf_clip": 512,
+                "skip_frames": 5,
+                "map": [ 0.0, 445, 15.0, 925 ]
+            }
+        },
+        {
+            "rpi.cac":
+            {
+                "strength": 1.0,
+                "lut_rx":
+                [
+                    -0.21, -0.12, -0.06, -0.04, -0.03, -0.0, 0.02, 0.08, 0.21,
+                    -0.2, -0.12, -0.07, -0.05, -0.01, 0.02, 0.02, 0.06, 0.19,
+                    -0.18, -0.12, -0.09, -0.07, -0.01, 0.03, 0.03, 0.04, 0.13,
+                    -0.15, -0.11, -0.1, -0.09, -0.01, 0.04, 0.04, 0.04, 0.09,
+                    -0.15, -0.11, -0.1, -0.09, -0.02, 0.05, 0.05, 0.05, 0.08,
+                    -0.16, -0.11, -0.08, -0.07, -0.02, 0.05, 0.06, 0.07, 0.1,
+                    -0.18, -0.1, -0.07, -0.05, -0.01, 0.03, 0.05, 0.08, 0.15,
+                    -0.21, -0.11, -0.06, -0.04, -0.01, 0.02, 0.04, 0.09, 0.22,
+                    -0.23, -0.14, -0.05, -0.03, -0.01, 0.01, 0.03, 0.1, 0.23
+                ],
+                "lut_ry":
+                [
+                    -0.13, -0.08, -0.06, -0.08, -0.08, -0.06, -0.04, -0.06, -0.08,
+                    -0.09, -0.05, -0.05, -0.09, -0.1, -0.08, -0.05, -0.04, -0.06,
+                    -0.04, -0.05, -0.06, -0.1, -0.13, -0.1, -0.06, -0.04, -0.02,
+                    -0.03, -0.04, -0.06, -0.09, -0.11, -0.1, -0.06, -0.03, 0.01,
+                    -0.01, -0.01, -0.03, -0.03, -0.03, -0.04, -0.03, -0.01, 0.02,
+                    0.03, 0.01, -0.01, 0.0, 0.01, 0.01, -0.0, 0.01, 0.03,
+                    0.05, 0.02, 0.01, 0.02, 0.03, 0.02, 0.01, 0.03, 0.07,
+                    0.08, 0.03, 0.01, 0.01, 0.02, 0.02, 0.02, 0.05, 0.12,
+                    0.11, 0.07, 0.01, 0.0, -0.0, 0.01, 0.03, 0.07, 0.14
+                ],
+                "lut_bx":
+                [
+                    0.27, 0.13, 0.03, -0.01, -0.01, -0.0, -0.04, -0.11, -0.29,
+                    0.23, 0.1, 0.02, -0.01, -0.02, -0.01, -0.03, -0.1, -0.28,
+                    0.22, 0.08, 0.0, -0.01, -0.02, -0.02, -0.02, -0.08, -0.25,
+                    0.2, 0.08, 0.01, 0.0, -0.01, -0.02, -0.01, -0.07, -0.22,
+                    0.19, 0.08, 0.01, 0.0, -0.01, -0.02, -0.02, -0.06, -0.21,
+                    0.2, 0.08, 0.01, 0.0, -0.01, -0.02, -0.02, -0.07, -0.22,
+                    0.21, 0.09, 0.01, -0.01, -0.02, -0.02, -0.03, -0.09, -0.26,
+                    0.21, 0.11, 0.02, -0.01, -0.01, -0.02, -0.04, -0.11, -0.28,
+                    0.23, 0.13, 0.04, -0.01, -0.01, -0.01, -0.06, -0.13, -0.31
+                ],
+                "lut_by":
+                [
+                    0.17, 0.11, 0.07, 0.05, 0.04, 0.05, 0.07, 0.12, 0.19,
+                    0.11, 0.06, 0.04, 0.04, 0.04, 0.03, 0.04, 0.06, 0.13,
+                    0.06, 0.03, 0.02, 0.04, 0.05, 0.04, 0.03, 0.03, 0.06,
+                    0.02, 0.02, 0.03, 0.04, 0.06, 0.05, 0.03, 0.02, 0.01,
+                    -0.0, 0.01, 0.03, 0.04, 0.04, 0.04, 0.02, -0.0, -0.03,
+                    -0.04, -0.01, 0.02, 0.02, 0.02, 0.02, 0.01, -0.02, -0.09,
+                    -0.08, -0.01, 0.04, 0.06, 0.06, 0.05, 0.03, -0.03, -0.14,
+                    -0.1, -0.04, 0.04, 0.08, 0.08, 0.06, 0.02, -0.05, -0.18,
+                    -0.15, -0.08, 0.02, 0.09, 0.11, 0.08, 0.01, -0.09, -0.22
+                ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx708_noir.json b/src/ipa/rpi/pisp/data/imx708_noir.json
new file mode 100644
index 000000000..e69afb0c6
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx708_noir.json
@@ -0,0 +1,1233 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 20716,
+                "reference_gain": 1.12,
+                "reference_aperture": 1.0,
+                "reference_lux": 810,
+                "reference_Y": 13994
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 1.856
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 221,
+                "slope": 0.00226
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "bayes": 0
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.532, 1.534, 1.535, 1.538, 1.538, 1.533, 1.529, 1.515, 1.506, 1.492, 1.477, 1.465, 1.453, 1.444, 1.437, 1.433, 1.433, 1.435, 1.441, 1.449, 1.461, 1.474, 1.485, 1.499, 1.511, 1.519, 1.525, 1.526, 1.526, 1.523, 1.517, 1.516,
+                            1.532, 1.534, 1.537, 1.538, 1.537, 1.534, 1.525, 1.515, 1.502, 1.486, 1.474, 1.458, 1.449, 1.438, 1.429, 1.427, 1.426, 1.429, 1.436, 1.444, 1.456, 1.468, 1.483, 1.497, 1.509, 1.518, 1.524, 1.526, 1.526, 1.523, 1.521, 1.516,
+                            1.532, 1.534, 1.537, 1.538, 1.536, 1.533, 1.524, 1.512, 1.499, 1.483, 1.468, 1.453, 1.439, 1.429, 1.421, 1.419, 1.419, 1.419, 1.427, 1.438, 1.451, 1.464, 1.479, 1.494, 1.506, 1.516, 1.523, 1.526, 1.526, 1.524, 1.521, 1.518,
+                            1.533, 1.536, 1.537, 1.537, 1.535, 1.532, 1.521, 1.507, 1.491, 1.474, 1.456, 1.441, 1.429, 1.418, 1.409, 1.406, 1.406, 1.408, 1.415, 1.426, 1.439, 1.453, 1.471, 1.485, 1.501, 1.511, 1.522, 1.524, 1.526, 1.525, 1.522, 1.519,
+                            1.537, 1.538, 1.539, 1.538, 1.534, 1.525, 1.513, 1.495, 1.477, 1.459, 1.443, 1.427, 1.413, 1.402, 1.394, 1.391, 1.391, 1.393, 1.399, 1.409, 1.424, 1.439, 1.455, 1.472, 1.489, 1.503, 1.515, 1.523, 1.526, 1.527, 1.525, 1.523,
+                            1.538, 1.539, 1.541, 1.539, 1.531, 1.519, 1.503, 1.484, 1.466, 1.445, 1.427, 1.413, 1.401, 1.386, 1.378, 1.373, 1.373, 1.376, 1.386, 1.398, 1.409, 1.424, 1.441, 1.459, 1.477, 1.495, 1.509, 1.519, 1.526, 1.528, 1.528, 1.526,
+                            1.539, 1.541, 1.541, 1.539, 1.529, 1.516, 1.498, 1.479, 1.456, 1.437, 1.417, 1.401, 1.386, 1.378, 1.369, 1.363, 1.363, 1.367, 1.376, 1.386, 1.399, 1.413, 1.432, 1.451, 1.472, 1.491, 1.507, 1.517, 1.525, 1.527, 1.527, 1.527,
+                            1.539, 1.539, 1.539, 1.538, 1.529, 1.515, 1.497, 1.476, 1.454, 1.433, 1.411, 1.395, 1.381, 1.368, 1.361, 1.356, 1.356, 1.359, 1.367, 1.379, 1.393, 1.409, 1.428, 1.448, 1.471, 1.489, 1.505, 1.516, 1.524, 1.527, 1.527, 1.527,
+                            1.539, 1.539, 1.539, 1.537, 1.528, 1.513, 1.493, 1.471, 1.449, 1.426, 1.406, 1.387, 1.373, 1.361, 1.352, 1.348, 1.348, 1.351, 1.359, 1.372, 1.387, 1.403, 1.422, 1.443, 1.465, 1.484, 1.503, 1.516, 1.525, 1.527, 1.528, 1.526,
+                            1.541, 1.542, 1.539, 1.537, 1.524, 1.506, 1.485, 1.461, 1.438, 1.416, 1.395, 1.377, 1.362, 1.352, 1.344, 1.339, 1.339, 1.342, 1.351, 1.362, 1.376, 1.393, 1.412, 1.434, 1.455, 1.477, 1.495, 1.514, 1.524, 1.528, 1.529, 1.529,
+                            1.543, 1.544, 1.543, 1.534, 1.518, 1.499, 1.476, 1.452, 1.427, 1.405, 1.386, 1.367, 1.354, 1.344, 1.338, 1.329, 1.329, 1.335, 1.342, 1.352, 1.367, 1.382, 1.402, 1.424, 1.445, 1.469, 1.491, 1.507, 1.522, 1.528, 1.529, 1.532,
+                            1.544, 1.544, 1.542, 1.534, 1.518, 1.499, 1.474, 1.449, 1.425, 1.401, 1.379, 1.362, 1.348, 1.338, 1.329, 1.324, 1.325, 1.329, 1.335, 1.347, 1.361, 1.378, 1.397, 1.421, 1.443, 1.467, 1.489, 1.507, 1.521, 1.529, 1.532, 1.533,
+                            1.543, 1.543, 1.541, 1.534, 1.519, 1.499, 1.474, 1.448, 1.424, 1.399, 1.377, 1.359, 1.346, 1.333, 1.324, 1.322, 1.321, 1.324, 1.332, 1.344, 1.359, 1.376, 1.397, 1.419, 1.443, 1.467, 1.489, 1.508, 1.521, 1.528, 1.531, 1.532,
+                            1.543, 1.542, 1.541, 1.533, 1.519, 1.499, 1.474, 1.448, 1.422, 1.399, 1.376, 1.358, 1.344, 1.331, 1.322, 1.319, 1.319, 1.321, 1.331, 1.342, 1.357, 1.375, 1.396, 1.419, 1.443, 1.467, 1.489, 1.508, 1.521, 1.529, 1.531, 1.532,
+                            1.543, 1.542, 1.541, 1.532, 1.518, 1.496, 1.471, 1.445, 1.418, 1.393, 1.373, 1.354, 1.341, 1.329, 1.319, 1.317, 1.316, 1.319, 1.327, 1.338, 1.353, 1.371, 1.392, 1.415, 1.439, 1.465, 1.485, 1.507, 1.519, 1.529, 1.531, 1.531,
+                            1.545, 1.544, 1.542, 1.531, 1.515, 1.493, 1.467, 1.441, 1.414, 1.391, 1.369, 1.351, 1.337, 1.326, 1.318, 1.314, 1.314, 1.317, 1.325, 1.335, 1.351, 1.367, 1.388, 1.411, 1.436, 1.461, 1.483, 1.505, 1.519, 1.531, 1.533, 1.533,
+                            1.545, 1.544, 1.541, 1.531, 1.515, 1.493, 1.467, 1.441, 1.414, 1.391, 1.369, 1.351, 1.337, 1.326, 1.318, 1.314, 1.314, 1.317, 1.325, 1.335, 1.351, 1.367, 1.388, 1.411, 1.436, 1.461, 1.483, 1.505, 1.521, 1.531, 1.534, 1.534,
+                            1.545, 1.544, 1.541, 1.534, 1.519, 1.496, 1.471, 1.446, 1.419, 1.392, 1.372, 1.354, 1.338, 1.328, 1.319, 1.316, 1.315, 1.319, 1.327, 1.338, 1.353, 1.371, 1.392, 1.416, 1.441, 1.465, 1.489, 1.511, 1.522, 1.531, 1.534, 1.535,
+                            1.544, 1.544, 1.542, 1.537, 1.524, 1.501, 1.476, 1.449, 1.424, 1.399, 1.377, 1.359, 1.344, 1.332, 1.324, 1.319, 1.319, 1.323, 1.331, 1.343, 1.358, 1.374, 1.396, 1.419, 1.445, 1.471, 1.493, 1.512, 1.525, 1.532, 1.534, 1.534,
+                            1.545, 1.545, 1.543, 1.538, 1.524, 1.503, 1.479, 1.452, 1.426, 1.402, 1.381, 1.362, 1.348, 1.337, 1.329, 1.324, 1.324, 1.328, 1.335, 1.347, 1.361, 1.379, 1.399, 1.423, 1.447, 1.471, 1.493, 1.513, 1.526, 1.533, 1.534, 1.535,
+                            1.546, 1.546, 1.544, 1.539, 1.525, 1.504, 1.479, 1.453, 1.428, 1.404, 1.383, 1.365, 1.352, 1.339, 1.333, 1.329, 1.329, 1.333, 1.339, 1.349, 1.363, 1.381, 1.402, 1.424, 1.448, 1.472, 1.494, 1.514, 1.526, 1.534, 1.534, 1.534,
+                            1.546, 1.546, 1.544, 1.539, 1.526, 1.505, 1.483, 1.457, 1.432, 1.407, 1.389, 1.371, 1.357, 1.347, 1.339, 1.333, 1.333, 1.339, 1.345, 1.354, 1.368, 1.386, 1.406, 1.428, 1.453, 1.475, 1.496, 1.515, 1.527, 1.535, 1.535, 1.535,
+                            1.545, 1.545, 1.545, 1.541, 1.529, 1.513, 1.491, 1.467, 1.441, 1.418, 1.399, 1.379, 1.366, 1.355, 1.347, 1.341, 1.341, 1.345, 1.354, 1.364, 1.378, 1.395, 1.415, 1.436, 1.459, 1.483, 1.503, 1.519, 1.531, 1.534, 1.535, 1.534,
+                            1.544, 1.545, 1.545, 1.544, 1.535, 1.519, 1.499, 1.476, 1.451, 1.428, 1.409, 1.391, 1.377, 1.366, 1.356, 1.352, 1.352, 1.355, 1.364, 1.374, 1.388, 1.405, 1.426, 1.447, 1.469, 1.492, 1.509, 1.523, 1.532, 1.535, 1.535, 1.533,
+                            1.544, 1.545, 1.546, 1.545, 1.537, 1.523, 1.504, 1.482, 1.458, 1.436, 1.418, 1.401, 1.385, 1.377, 1.367, 1.362, 1.362, 1.365, 1.373, 1.385, 1.398, 1.415, 1.434, 1.455, 1.477, 1.495, 1.514, 1.525, 1.533, 1.536, 1.535, 1.533,
+                            1.545, 1.546, 1.547, 1.545, 1.538, 1.525, 1.508, 1.486, 1.465, 1.444, 1.424, 1.408, 1.394, 1.385, 1.377, 1.371, 1.371, 1.373, 1.384, 1.392, 1.405, 1.421, 1.441, 1.459, 1.481, 1.499, 1.516, 1.528, 1.534, 1.536, 1.536, 1.533,
+                            1.544, 1.546, 1.547, 1.547, 1.541, 1.531, 1.514, 1.494, 1.474, 1.454, 1.434, 1.421, 1.408, 1.394, 1.386, 1.382, 1.382, 1.385, 1.392, 1.405, 1.416, 1.432, 1.449, 1.468, 1.488, 1.505, 1.519, 1.531, 1.536, 1.537, 1.536, 1.533,
+                            1.544, 1.546, 1.548, 1.548, 1.545, 1.536, 1.522, 1.506, 1.486, 1.467, 1.451, 1.434, 1.421, 1.408, 1.401, 1.396, 1.396, 1.399, 1.407, 1.416, 1.431, 1.447, 1.463, 1.481, 1.499, 1.513, 1.526, 1.534, 1.537, 1.537, 1.534, 1.531,
+                            1.543, 1.545, 1.547, 1.549, 1.549, 1.543, 1.531, 1.517, 1.501, 1.483, 1.465, 1.451, 1.438, 1.425, 1.417, 1.412, 1.412, 1.418, 1.423, 1.433, 1.447, 1.462, 1.479, 1.493, 1.511, 1.524, 1.531, 1.536, 1.538, 1.537, 1.533, 1.531,
+                            1.542, 1.545, 1.548, 1.551, 1.551, 1.546, 1.539, 1.524, 1.511, 1.493, 1.479, 1.464, 1.451, 1.442, 1.433, 1.429, 1.429, 1.434, 1.439, 1.449, 1.462, 1.474, 1.491, 1.505, 1.519, 1.529, 1.536, 1.539, 1.539, 1.537, 1.533, 1.531,
+                            1.541, 1.546, 1.549, 1.552, 1.553, 1.551, 1.544, 1.533, 1.521, 1.505, 1.489, 1.477, 1.464, 1.455, 1.447, 1.443, 1.443, 1.446, 1.451, 1.462, 1.472, 1.487, 1.499, 1.514, 1.525, 1.535, 1.541, 1.541, 1.541, 1.539, 1.533, 1.531,
+                            1.541, 1.546, 1.549, 1.553, 1.554, 1.552, 1.546, 1.537, 1.524, 1.512, 1.499, 1.485, 1.474, 1.464, 1.455, 1.451, 1.451, 1.452, 1.461, 1.469, 1.481, 1.495, 1.506, 1.518, 1.529, 1.539, 1.541, 1.542, 1.541, 1.539, 1.533, 1.529
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            2.586, 2.591, 2.597, 2.601, 2.601, 2.599, 2.592, 2.576, 2.561, 2.541, 2.523, 2.503, 2.486, 2.471, 2.459, 2.452, 2.452, 2.454, 2.462, 2.478, 2.495, 2.512, 2.531, 2.555, 2.568, 2.579, 2.587, 2.588, 2.585, 2.579, 2.573, 2.566,
+                            2.587, 2.592, 2.598, 2.601, 2.601, 2.599, 2.587, 2.574, 2.556, 2.532, 2.512, 2.491, 2.474, 2.462, 2.449, 2.443, 2.439, 2.443, 2.454, 2.464, 2.485, 2.505, 2.525, 2.548, 2.566, 2.578, 2.585, 2.588, 2.586, 2.579, 2.575, 2.567,
+                            2.587, 2.593, 2.598, 2.602, 2.601, 2.597, 2.584, 2.569, 2.551, 2.527, 2.503, 2.482, 2.464, 2.448, 2.434, 2.428, 2.427, 2.431, 2.439, 2.455, 2.474, 2.498, 2.521, 2.541, 2.564, 2.577, 2.585, 2.588, 2.589, 2.581, 2.576, 2.569,
+                            2.593, 2.596, 2.601, 2.603, 2.601, 2.594, 2.583, 2.563, 2.539, 2.514, 2.491, 2.466, 2.445, 2.429, 2.417, 2.409, 2.408, 2.411, 2.421, 2.437, 2.457, 2.481, 2.507, 2.531, 2.555, 2.572, 2.583, 2.588, 2.588, 2.585, 2.579, 2.575,
+                            2.597, 2.599, 2.604, 2.603, 2.599, 2.587, 2.567, 2.548, 2.522, 2.493, 2.467, 2.443, 2.419, 2.406, 2.391, 2.385, 2.385, 2.387, 2.397, 2.413, 2.435, 2.459, 2.486, 2.509, 2.538, 2.559, 2.574, 2.586, 2.588, 2.586, 2.582, 2.579,
+                            2.601, 2.603, 2.606, 2.604, 2.596, 2.578, 2.556, 2.531, 2.501, 2.471, 2.444, 2.419, 2.402, 2.381, 2.365, 2.359, 2.359, 2.361, 2.374, 2.396, 2.413, 2.435, 2.465, 2.493, 2.517, 2.542, 2.562, 2.582, 2.588, 2.587, 2.586, 2.584,
+                            2.601, 2.604, 2.605, 2.604, 2.593, 2.575, 2.547, 2.522, 2.488, 2.458, 2.432, 2.402, 2.381, 2.364, 2.349, 2.338, 2.338, 2.345, 2.359, 2.374, 2.396, 2.423, 2.453, 2.481, 2.511, 2.539, 2.561, 2.581, 2.586, 2.588, 2.588, 2.586,
+                            2.599, 2.602, 2.604, 2.602, 2.592, 2.572, 2.546, 2.516, 2.485, 2.451, 2.422, 2.393, 2.368, 2.349, 2.336, 2.328, 2.328, 2.333, 2.345, 2.365, 2.389, 2.417, 2.447, 2.478, 2.509, 2.537, 2.561, 2.577, 2.585, 2.588, 2.588, 2.587,
+                            2.601, 2.602, 2.604, 2.601, 2.589, 2.569, 2.539, 2.509, 2.473, 2.442, 2.409, 2.379, 2.357, 2.336, 2.323, 2.315, 2.315, 2.322, 2.334, 2.354, 2.377, 2.406, 2.436, 2.469, 2.503, 2.529, 2.558, 2.574, 2.585, 2.588, 2.589, 2.587,
+                            2.601, 2.606, 2.606, 2.601, 2.581, 2.557, 2.525, 2.493, 2.459, 2.426, 2.394, 2.365, 2.339, 2.322, 2.308, 2.301, 2.301, 2.305, 2.322, 2.337, 2.361, 2.389, 2.422, 2.454, 2.485, 2.519, 2.546, 2.568, 2.584, 2.589, 2.589, 2.589,
+                            2.608, 2.608, 2.606, 2.597, 2.576, 2.548, 2.515, 2.481, 2.444, 2.409, 2.376, 2.346, 2.323, 2.308, 2.293, 2.282, 2.281, 2.291, 2.305, 2.322, 2.348, 2.371, 2.403, 2.439, 2.472, 2.508, 2.538, 2.565, 2.582, 2.589, 2.592, 2.593,
+                            2.608, 2.608, 2.605, 2.596, 2.575, 2.547, 2.511, 2.474, 2.435, 2.401, 2.366, 2.339, 2.312, 2.293, 2.281, 2.274, 2.274, 2.281, 2.291, 2.311, 2.334, 2.364, 2.399, 2.433, 2.471, 2.506, 2.538, 2.564, 2.581, 2.591, 2.594, 2.595,
+                            2.605, 2.606, 2.605, 2.595, 2.575, 2.547, 2.511, 2.474, 2.433, 2.397, 2.363, 2.333, 2.309, 2.291, 2.274, 2.267, 2.265, 2.272, 2.284, 2.307, 2.331, 2.361, 2.395, 2.431, 2.469, 2.503, 2.539, 2.567, 2.584, 2.591, 2.595, 2.595,
+                            2.605, 2.606, 2.605, 2.595, 2.575, 2.547, 2.509, 2.473, 2.431, 2.395, 2.361, 2.332, 2.306, 2.285, 2.267, 2.261, 2.262, 2.265, 2.281, 2.302, 2.329, 2.359, 2.395, 2.429, 2.468, 2.503, 2.539, 2.567, 2.583, 2.593, 2.595, 2.595,
+                            2.608, 2.607, 2.606, 2.592, 2.572, 2.543, 2.506, 2.468, 2.426, 2.389, 2.354, 2.327, 2.299, 2.279, 2.262, 2.258, 2.257, 2.262, 2.276, 2.297, 2.321, 2.352, 2.387, 2.425, 2.464, 2.498, 2.532, 2.565, 2.582, 2.592, 2.595, 2.596,
+                            2.611, 2.609, 2.605, 2.592, 2.571, 2.538, 2.499, 2.463, 2.421, 2.384, 2.351, 2.322, 2.295, 2.276, 2.259, 2.254, 2.254, 2.256, 2.273, 2.292, 2.318, 2.347, 2.383, 2.418, 2.456, 2.491, 2.529, 2.562, 2.581, 2.593, 2.597, 2.598,
+                            2.609, 2.609, 2.606, 2.593, 2.571, 2.538, 2.499, 2.463, 2.421, 2.384, 2.351, 2.321, 2.295, 2.276, 2.259, 2.251, 2.251, 2.256, 2.273, 2.292, 2.318, 2.347, 2.383, 2.418, 2.456, 2.491, 2.529, 2.559, 2.582, 2.595, 2.597, 2.599,
+                            2.609, 2.609, 2.607, 2.597, 2.576, 2.543, 2.507, 2.467, 2.427, 2.388, 2.356, 2.323, 2.297, 2.278, 2.262, 2.256, 2.255, 2.262, 2.275, 2.296, 2.321, 2.351, 2.388, 2.425, 2.464, 2.502, 2.534, 2.563, 2.586, 2.595, 2.598, 2.599,
+                            2.609, 2.609, 2.608, 2.601, 2.581, 2.547, 2.513, 2.475, 2.434, 2.398, 2.362, 2.332, 2.307, 2.287, 2.269, 2.263, 2.263, 2.269, 2.281, 2.304, 2.328, 2.358, 2.394, 2.429, 2.469, 2.508, 2.538, 2.568, 2.589, 2.597, 2.598, 2.598,
+                            2.609, 2.611, 2.609, 2.601, 2.583, 2.549, 2.518, 2.478, 2.439, 2.402, 2.367, 2.337, 2.313, 2.293, 2.279, 2.271, 2.269, 2.277, 2.291, 2.311, 2.336, 2.363, 2.399, 2.435, 2.473, 2.509, 2.541, 2.571, 2.591, 2.598, 2.599, 2.599,
+                            2.611, 2.611, 2.609, 2.602, 2.585, 2.551, 2.519, 2.481, 2.442, 2.406, 2.374, 2.342, 2.318, 2.297, 2.287, 2.279, 2.278, 2.287, 2.297, 2.315, 2.339, 2.368, 2.402, 2.438, 2.476, 2.511, 2.545, 2.571, 2.591, 2.599, 2.601, 2.599,
+                            2.611, 2.611, 2.609, 2.604, 2.587, 2.557, 2.521, 2.485, 2.447, 2.412, 2.379, 2.352, 2.328, 2.309, 2.297, 2.288, 2.287, 2.297, 2.308, 2.327, 2.349, 2.377, 2.408, 2.446, 2.481, 2.517, 2.547, 2.573, 2.591, 2.599, 2.601, 2.599,
+                            2.608, 2.609, 2.609, 2.606, 2.592, 2.564, 2.533, 2.498, 2.462, 2.427, 2.394, 2.364, 2.343, 2.326, 2.309, 2.302, 2.302, 2.308, 2.324, 2.341, 2.362, 2.391, 2.425, 2.458, 2.494, 2.526, 2.555, 2.584, 2.593, 2.599, 2.599, 2.599,
+                            2.608, 2.609, 2.609, 2.609, 2.597, 2.574, 2.547, 2.511, 2.475, 2.438, 2.411, 2.381, 2.359, 2.342, 2.327, 2.318, 2.318, 2.325, 2.341, 2.358, 2.377, 2.404, 2.439, 2.469, 2.507, 2.537, 2.564, 2.587, 2.596, 2.598, 2.598, 2.597,
+                            2.609, 2.609, 2.611, 2.609, 2.599, 2.579, 2.551, 2.519, 2.486, 2.453, 2.425, 2.397, 2.375, 2.358, 2.345, 2.336, 2.336, 2.341, 2.355, 2.372, 2.393, 2.419, 2.452, 2.481, 2.516, 2.542, 2.571, 2.591, 2.597, 2.599, 2.598, 2.595,
+                            2.607, 2.611, 2.613, 2.611, 2.605, 2.586, 2.561, 2.529, 2.495, 2.462, 2.435, 2.409, 2.387, 2.374, 2.359, 2.351, 2.351, 2.356, 2.372, 2.385, 2.406, 2.431, 2.462, 2.488, 2.524, 2.551, 2.573, 2.591, 2.598, 2.599, 2.598, 2.596,
+                            2.606, 2.609, 2.613, 2.613, 2.607, 2.591, 2.565, 2.539, 2.507, 2.477, 2.449, 2.425, 2.409, 2.387, 2.376, 2.369, 2.369, 2.374, 2.385, 2.406, 2.422, 2.446, 2.473, 2.502, 2.534, 2.557, 2.578, 2.595, 2.599, 2.601, 2.598, 2.595,
+                            2.606, 2.611, 2.613, 2.614, 2.611, 2.598, 2.581, 2.553, 2.523, 2.496, 2.471, 2.449, 2.425, 2.409, 2.398, 2.391, 2.391, 2.395, 2.408, 2.422, 2.445, 2.468, 2.493, 2.522, 2.549, 2.569, 2.589, 2.601, 2.603, 2.602, 2.596, 2.593,
+                            2.605, 2.609, 2.613, 2.616, 2.614, 2.607, 2.591, 2.571, 2.545, 2.518, 2.494, 2.471, 2.452, 2.435, 2.423, 2.417, 2.417, 2.421, 2.431, 2.449, 2.467, 2.493, 2.516, 2.542, 2.566, 2.585, 2.596, 2.606, 2.605, 2.602, 2.595, 2.593,
+                            2.604, 2.608, 2.616, 2.617, 2.618, 2.613, 2.602, 2.584, 2.559, 2.536, 2.514, 2.493, 2.476, 2.459, 2.445, 2.439, 2.439, 2.445, 2.456, 2.471, 2.493, 2.511, 2.534, 2.559, 2.579, 2.592, 2.607, 2.608, 2.607, 2.604, 2.595, 2.592,
+                            2.603, 2.609, 2.615, 2.619, 2.623, 2.619, 2.608, 2.594, 2.573, 2.551, 2.532, 2.512, 2.493, 2.477, 2.468, 2.462, 2.462, 2.468, 2.476, 2.494, 2.509, 2.528, 2.551, 2.574, 2.589, 2.604, 2.611, 2.611, 2.611, 2.604, 2.598, 2.592,
+                            2.602, 2.607, 2.613, 2.621, 2.624, 2.621, 2.617, 2.601, 2.585, 2.567, 2.544, 2.521, 2.507, 2.493, 2.478, 2.474, 2.475, 2.477, 2.489, 2.505, 2.523, 2.544, 2.563, 2.584, 2.598, 2.609, 2.612, 2.613, 2.613, 2.608, 2.599, 2.591
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.263, 3.263, 3.264, 3.269, 3.274, 3.275, 3.277, 3.281, 3.283, 3.285, 3.289, 3.292, 3.291, 3.291, 3.294, 3.298, 3.302, 3.305, 3.303, 3.301, 3.296, 3.294, 3.293, 3.293, 3.295, 3.295, 3.295, 3.287, 3.285, 3.279, 3.282, 3.285,
+                            3.259, 3.259, 3.262, 3.268, 3.271, 3.273, 3.273, 3.274, 3.277, 3.278, 3.282, 3.285, 3.286, 3.286, 3.288, 3.289, 3.292, 3.291, 3.293, 3.291, 3.288, 3.288, 3.288, 3.288, 3.288, 3.287, 3.287, 3.283, 3.281, 3.276, 3.277, 3.281,
+                            3.259, 3.259, 3.262, 3.269, 3.272, 3.274, 3.273, 3.273, 3.273, 3.276, 3.278, 3.279, 3.281, 3.282, 3.283, 3.283, 3.285, 3.286, 3.286, 3.285, 3.283, 3.282, 3.282, 3.286, 3.285, 3.285, 3.285, 3.282, 3.281, 3.276, 3.275, 3.279,
+                            3.267, 3.266, 3.269, 3.273, 3.274, 3.277, 3.276, 3.275, 3.274, 3.277, 3.277, 3.278, 3.279, 3.279, 3.279, 3.279, 3.281, 3.283, 3.283, 3.281, 3.281, 3.281, 3.282, 3.287, 3.287, 3.288, 3.287, 3.286, 3.283, 3.277, 3.278, 3.281,
+                            3.268, 3.271, 3.274, 3.277, 3.283, 3.286, 3.284, 3.281, 3.278, 3.278, 3.279, 3.279, 3.281, 3.281, 3.281, 3.281, 3.282, 3.283, 3.284, 3.283, 3.282, 3.282, 3.284, 3.288, 3.289, 3.291, 3.291, 3.288, 3.288, 3.283, 3.286, 3.288,
+                            3.272, 3.275, 3.279, 3.283, 3.288, 3.289, 3.289, 3.287, 3.282, 3.284, 3.282, 3.284, 3.284, 3.285, 3.284, 3.285, 3.285, 3.288, 3.287, 3.286, 3.283, 3.283, 3.285, 3.289, 3.292, 3.292, 3.293, 3.292, 3.291, 3.288, 3.289, 3.293,
+                            3.276, 3.278, 3.282, 3.289, 3.293, 3.293, 3.291, 3.289, 3.287, 3.286, 3.285, 3.285, 3.286, 3.286, 3.287, 3.288, 3.289, 3.289, 3.289, 3.288, 3.285, 3.283, 3.286, 3.289, 3.292, 3.294, 3.294, 3.294, 3.293, 3.289, 3.292, 3.293,
+                            3.279, 3.281, 3.286, 3.293, 3.297, 3.298, 3.295, 3.292, 3.288, 3.287, 3.285, 3.287, 3.288, 3.288, 3.289, 3.291, 3.292, 3.293, 3.291, 3.288, 3.286, 3.285, 3.285, 3.291, 3.294, 3.295, 3.297, 3.297, 3.298, 3.293, 3.294, 3.294,
+                            3.281, 3.286, 3.291, 3.298, 3.301, 3.301, 3.299, 3.295, 3.289, 3.288, 3.286, 3.288, 3.289, 3.292, 3.293, 3.292, 3.295, 3.296, 3.295, 3.291, 3.287, 3.286, 3.286, 3.289, 3.295, 3.297, 3.298, 3.301, 3.301, 3.298, 3.297, 3.297,
+                            3.284, 3.289, 3.295, 3.302, 3.303, 3.303, 3.301, 3.298, 3.294, 3.292, 3.289, 3.293, 3.296, 3.297, 3.297, 3.297, 3.297, 3.298, 3.298, 3.296, 3.289, 3.288, 3.287, 3.294, 3.298, 3.301, 3.304, 3.305, 3.304, 3.299, 3.299, 3.302,
+                            3.291, 3.292, 3.299, 3.305, 3.308, 3.305, 3.304, 3.302, 3.298, 3.295, 3.295, 3.298, 3.299, 3.302, 3.303, 3.302, 3.301, 3.301, 3.301, 3.299, 3.296, 3.291, 3.292, 3.297, 3.301, 3.304, 3.306, 3.309, 3.308, 3.302, 3.301, 3.304,
+                            3.292, 3.297, 3.303, 3.309, 3.312, 3.311, 3.308, 3.304, 3.301, 3.299, 3.298, 3.299, 3.303, 3.305, 3.306, 3.305, 3.305, 3.303, 3.303, 3.301, 3.299, 3.294, 3.294, 3.297, 3.302, 3.305, 3.309, 3.311, 3.311, 3.305, 3.305, 3.306,
+                            3.295, 3.298, 3.305, 3.309, 3.313, 3.313, 3.312, 3.307, 3.303, 3.301, 3.299, 3.301, 3.304, 3.307, 3.308, 3.306, 3.306, 3.306, 3.306, 3.302, 3.299, 3.296, 3.295, 3.298, 3.303, 3.306, 3.311, 3.312, 3.312, 3.307, 3.308, 3.309,
+                            3.297, 3.298, 3.303, 3.309, 3.313, 3.313, 3.311, 3.307, 3.303, 3.301, 3.299, 3.299, 3.305, 3.307, 3.307, 3.306, 3.306, 3.306, 3.305, 3.299, 3.297, 3.294, 3.294, 3.298, 3.303, 3.305, 3.311, 3.312, 3.313, 3.308, 3.311, 3.309,
+                            3.297, 3.298, 3.304, 3.309, 3.312, 3.313, 3.311, 3.308, 3.304, 3.302, 3.301, 3.301, 3.306, 3.307, 3.308, 3.306, 3.306, 3.307, 3.306, 3.302, 3.297, 3.294, 3.294, 3.299, 3.305, 3.306, 3.309, 3.312, 3.311, 3.306, 3.308, 3.309,
+                            3.298, 3.299, 3.306, 3.311, 3.315, 3.314, 3.311, 3.308, 3.305, 3.303, 3.303, 3.304, 3.307, 3.309, 3.309, 3.308, 3.308, 3.307, 3.306, 3.302, 3.298, 3.296, 3.296, 3.298, 3.304, 3.306, 3.308, 3.309, 3.314, 3.308, 3.309, 3.308,
+                            3.299, 3.301, 3.307, 3.313, 3.316, 3.316, 3.313, 3.311, 3.307, 3.305, 3.305, 3.307, 3.309, 3.311, 3.312, 3.311, 3.309, 3.309, 3.308, 3.306, 3.301, 3.298, 3.297, 3.301, 3.305, 3.309, 3.309, 3.311, 3.313, 3.306, 3.308, 3.307,
+                            3.301, 3.301, 3.307, 3.314, 3.317, 3.318, 3.314, 3.311, 3.308, 3.306, 3.306, 3.308, 3.311, 3.311, 3.312, 3.311, 3.309, 3.309, 3.309, 3.306, 3.302, 3.298, 3.298, 3.301, 3.305, 3.309, 3.311, 3.311, 3.312, 3.309, 3.308, 3.308,
+                            3.301, 3.302, 3.307, 3.316, 3.319, 3.319, 3.315, 3.312, 3.309, 3.306, 3.307, 3.309, 3.311, 3.312, 3.311, 3.311, 3.309, 3.309, 3.309, 3.306, 3.303, 3.299, 3.298, 3.302, 3.305, 3.308, 3.309, 3.309, 3.309, 3.303, 3.306, 3.307,
+                            3.301, 3.303, 3.308, 3.315, 3.318, 3.318, 3.316, 3.313, 3.311, 3.307, 3.307, 3.308, 3.311, 3.311, 3.311, 3.308, 3.308, 3.307, 3.307, 3.306, 3.303, 3.299, 3.297, 3.301, 3.303, 3.306, 3.309, 3.308, 3.306, 3.303, 3.304, 3.306,
+                            3.302, 3.304, 3.306, 3.316, 3.318, 3.318, 3.317, 3.315, 3.311, 3.308, 3.309, 3.311, 3.311, 3.312, 3.311, 3.307, 3.306, 3.307, 3.308, 3.307, 3.304, 3.299, 3.298, 3.301, 3.303, 3.305, 3.306, 3.305, 3.304, 3.302, 3.303, 3.306,
+                            3.302, 3.304, 3.306, 3.312, 3.316, 3.317, 3.317, 3.313, 3.311, 3.309, 3.309, 3.311, 3.311, 3.312, 3.309, 3.307, 3.306, 3.306, 3.308, 3.307, 3.304, 3.298, 3.297, 3.302, 3.304, 3.305, 3.306, 3.305, 3.304, 3.299, 3.302, 3.303,
+                            3.299, 3.299, 3.306, 3.309, 3.315, 3.316, 3.316, 3.312, 3.309, 3.308, 3.308, 3.309, 3.311, 3.311, 3.307, 3.305, 3.305, 3.305, 3.306, 3.304, 3.299, 3.297, 3.296, 3.301, 3.302, 3.304, 3.303, 3.302, 3.301, 3.298, 3.299, 3.301,
+                            3.295, 3.297, 3.305, 3.309, 3.311, 3.311, 3.311, 3.309, 3.307, 3.306, 3.305, 3.305, 3.305, 3.305, 3.304, 3.301, 3.301, 3.301, 3.302, 3.299, 3.296, 3.295, 3.295, 3.298, 3.301, 3.302, 3.303, 3.301, 3.299, 3.295, 3.297, 3.299,
+                            3.294, 3.296, 3.299, 3.306, 3.308, 3.309, 3.309, 3.307, 3.307, 3.303, 3.302, 3.301, 3.302, 3.303, 3.302, 3.299, 3.298, 3.299, 3.299, 3.298, 3.295, 3.292, 3.292, 3.293, 3.297, 3.299, 3.299, 3.299, 3.297, 3.294, 3.295, 3.299,
+                            3.291, 3.292, 3.296, 3.302, 3.306, 3.306, 3.307, 3.306, 3.305, 3.303, 3.302, 3.301, 3.301, 3.303, 3.301, 3.299, 3.298, 3.298, 3.298, 3.297, 3.295, 3.292, 3.291, 3.291, 3.295, 3.295, 3.297, 3.298, 3.296, 3.293, 3.292, 3.291,
+                            3.293, 3.292, 3.294, 3.301, 3.303, 3.305, 3.308, 3.306, 3.306, 3.304, 3.304, 3.303, 3.303, 3.303, 3.302, 3.301, 3.299, 3.299, 3.299, 3.299, 3.294, 3.291, 3.289, 3.291, 3.293, 3.294, 3.294, 3.294, 3.294, 3.289, 3.291, 3.291,
+                            3.288, 3.289, 3.291, 3.299, 3.303, 3.304, 3.304, 3.304, 3.304, 3.303, 3.303, 3.304, 3.306, 3.305, 3.303, 3.301, 3.301, 3.298, 3.299, 3.298, 3.293, 3.291, 3.289, 3.291, 3.291, 3.292, 3.291, 3.291, 3.291, 3.285, 3.288, 3.291,
+                            3.285, 3.284, 3.287, 3.291, 3.299, 3.299, 3.299, 3.299, 3.299, 3.301, 3.302, 3.303, 3.303, 3.302, 3.299, 3.298, 3.298, 3.298, 3.298, 3.293, 3.288, 3.286, 3.285, 3.288, 3.288, 3.288, 3.287, 3.285, 3.284, 3.279, 3.281, 3.284,
+                            3.281, 3.282, 3.282, 3.286, 3.291, 3.294, 3.294, 3.295, 3.295, 3.299, 3.301, 3.304, 3.305, 3.299, 3.299, 3.297, 3.298, 3.298, 3.297, 3.292, 3.288, 3.285, 3.283, 3.284, 3.284, 3.286, 3.284, 3.282, 3.279, 3.275, 3.275, 3.278,
+                            3.282, 3.282, 3.284, 3.286, 3.291, 3.294, 3.295, 3.295, 3.298, 3.301, 3.304, 3.306, 3.306, 3.304, 3.303, 3.301, 3.302, 3.299, 3.299, 3.295, 3.289, 3.287, 3.284, 3.288, 3.287, 3.287, 3.285, 3.283, 3.282, 3.278, 3.281, 3.286,
+                            3.292, 3.291, 3.292, 3.298, 3.307, 3.309, 3.308, 3.312, 3.313, 3.317, 3.324, 3.327, 3.327, 3.325, 3.326, 3.322, 3.319, 3.317, 3.317, 3.315, 3.312, 3.305, 3.303, 3.301, 3.299, 3.297, 3.299, 3.293, 3.289, 3.285, 3.287, 3.293
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.602, 1.603, 1.605, 1.608, 1.611, 1.612, 1.612, 1.614, 1.615, 1.616, 1.619, 1.621, 1.621, 1.622, 1.622, 1.624, 1.624, 1.626, 1.625, 1.625, 1.623, 1.622, 1.621, 1.619, 1.618, 1.617, 1.616, 1.614, 1.612, 1.609, 1.609, 1.611,
+                            1.601, 1.602, 1.605, 1.608, 1.611, 1.612, 1.612, 1.613, 1.614, 1.615, 1.617, 1.619, 1.621, 1.621, 1.621, 1.621, 1.622, 1.624, 1.624, 1.624, 1.622, 1.621, 1.619, 1.618, 1.617, 1.616, 1.615, 1.614, 1.612, 1.609, 1.609, 1.609,
+                            1.602, 1.603, 1.605, 1.609, 1.611, 1.613, 1.613, 1.613, 1.613, 1.615, 1.616, 1.618, 1.618, 1.619, 1.619, 1.619, 1.621, 1.621, 1.622, 1.622, 1.619, 1.618, 1.617, 1.617, 1.616, 1.615, 1.615, 1.615, 1.612, 1.609, 1.609, 1.609,
+                            1.604, 1.605, 1.608, 1.612, 1.613, 1.614, 1.614, 1.614, 1.614, 1.614, 1.616, 1.617, 1.618, 1.618, 1.618, 1.619, 1.619, 1.621, 1.622, 1.621, 1.619, 1.618, 1.617, 1.616, 1.616, 1.616, 1.616, 1.615, 1.615, 1.612, 1.611, 1.611,
+                            1.606, 1.608, 1.611, 1.614, 1.615, 1.615, 1.616, 1.616, 1.615, 1.615, 1.617, 1.618, 1.619, 1.619, 1.618, 1.619, 1.621, 1.622, 1.623, 1.622, 1.619, 1.619, 1.617, 1.617, 1.617, 1.618, 1.618, 1.617, 1.617, 1.614, 1.613, 1.613,
+                            1.608, 1.611, 1.614, 1.617, 1.618, 1.618, 1.618, 1.618, 1.618, 1.618, 1.619, 1.621, 1.621, 1.621, 1.621, 1.621, 1.622, 1.623, 1.624, 1.623, 1.622, 1.619, 1.619, 1.618, 1.618, 1.618, 1.618, 1.618, 1.618, 1.617, 1.615, 1.614,
+                            1.611, 1.613, 1.616, 1.618, 1.621, 1.621, 1.619, 1.619, 1.619, 1.619, 1.619, 1.621, 1.622, 1.623, 1.623, 1.623, 1.623, 1.624, 1.626, 1.624, 1.623, 1.621, 1.619, 1.619, 1.619, 1.619, 1.621, 1.621, 1.619, 1.617, 1.616, 1.616,
+                            1.611, 1.613, 1.617, 1.621, 1.622, 1.622, 1.621, 1.619, 1.619, 1.619, 1.621, 1.622, 1.624, 1.624, 1.624, 1.624, 1.625, 1.626, 1.626, 1.624, 1.623, 1.621, 1.621, 1.619, 1.619, 1.619, 1.621, 1.621, 1.621, 1.619, 1.618, 1.617,
+                            1.613, 1.615, 1.618, 1.621, 1.623, 1.623, 1.622, 1.621, 1.619, 1.619, 1.621, 1.622, 1.625, 1.625, 1.626, 1.626, 1.625, 1.626, 1.626, 1.624, 1.622, 1.621, 1.619, 1.619, 1.619, 1.621, 1.622, 1.622, 1.621, 1.621, 1.619, 1.618,
+                            1.614, 1.617, 1.621, 1.623, 1.624, 1.624, 1.623, 1.621, 1.621, 1.621, 1.622, 1.625, 1.627, 1.627, 1.628, 1.628, 1.628, 1.628, 1.627, 1.626, 1.623, 1.621, 1.621, 1.621, 1.621, 1.623, 1.623, 1.623, 1.623, 1.621, 1.619, 1.619,
+                            1.616, 1.617, 1.622, 1.624, 1.625, 1.625, 1.624, 1.623, 1.622, 1.623, 1.624, 1.627, 1.629, 1.631, 1.631, 1.631, 1.631, 1.631, 1.631, 1.628, 1.626, 1.623, 1.622, 1.622, 1.623, 1.623, 1.624, 1.624, 1.624, 1.622, 1.621, 1.621,
+                            1.617, 1.618, 1.623, 1.625, 1.626, 1.626, 1.625, 1.624, 1.623, 1.624, 1.625, 1.629, 1.631, 1.633, 1.634, 1.634, 1.634, 1.633, 1.633, 1.631, 1.628, 1.624, 1.623, 1.623, 1.623, 1.625, 1.625, 1.625, 1.625, 1.623, 1.622, 1.622,
+                            1.617, 1.619, 1.623, 1.626, 1.627, 1.627, 1.626, 1.625, 1.624, 1.624, 1.625, 1.628, 1.632, 1.634, 1.635, 1.635, 1.635, 1.634, 1.633, 1.631, 1.627, 1.624, 1.623, 1.623, 1.623, 1.624, 1.625, 1.626, 1.625, 1.624, 1.623, 1.623,
+                            1.618, 1.619, 1.623, 1.626, 1.627, 1.626, 1.626, 1.625, 1.624, 1.624, 1.625, 1.628, 1.631, 1.634, 1.634, 1.634, 1.634, 1.634, 1.633, 1.631, 1.628, 1.623, 1.622, 1.622, 1.623, 1.624, 1.625, 1.626, 1.626, 1.624, 1.624, 1.623,
+                            1.618, 1.619, 1.623, 1.626, 1.627, 1.627, 1.625, 1.624, 1.624, 1.624, 1.625, 1.628, 1.632, 1.633, 1.634, 1.634, 1.634, 1.633, 1.633, 1.631, 1.627, 1.623, 1.622, 1.622, 1.623, 1.624, 1.624, 1.625, 1.625, 1.624, 1.623, 1.623,
+                            1.619, 1.621, 1.623, 1.626, 1.627, 1.627, 1.626, 1.625, 1.624, 1.624, 1.626, 1.628, 1.632, 1.634, 1.635, 1.634, 1.634, 1.633, 1.633, 1.631, 1.628, 1.625, 1.622, 1.622, 1.622, 1.623, 1.624, 1.625, 1.625, 1.624, 1.623, 1.623,
+                            1.619, 1.621, 1.623, 1.626, 1.627, 1.627, 1.626, 1.625, 1.624, 1.625, 1.627, 1.629, 1.633, 1.635, 1.635, 1.635, 1.635, 1.634, 1.633, 1.631, 1.628, 1.625, 1.623, 1.622, 1.622, 1.623, 1.624, 1.624, 1.624, 1.623, 1.623, 1.622,
+                            1.619, 1.621, 1.624, 1.626, 1.628, 1.628, 1.627, 1.626, 1.625, 1.626, 1.627, 1.629, 1.633, 1.635, 1.635, 1.635, 1.635, 1.634, 1.633, 1.631, 1.628, 1.625, 1.623, 1.623, 1.623, 1.623, 1.624, 1.624, 1.624, 1.622, 1.622, 1.622,
+                            1.619, 1.621, 1.623, 1.626, 1.628, 1.628, 1.627, 1.626, 1.625, 1.626, 1.627, 1.629, 1.632, 1.634, 1.635, 1.635, 1.634, 1.634, 1.632, 1.631, 1.628, 1.624, 1.622, 1.622, 1.622, 1.623, 1.624, 1.624, 1.624, 1.622, 1.621, 1.621,
+                            1.619, 1.621, 1.623, 1.627, 1.628, 1.628, 1.627, 1.627, 1.626, 1.627, 1.628, 1.629, 1.631, 1.633, 1.634, 1.633, 1.633, 1.632, 1.631, 1.631, 1.627, 1.624, 1.622, 1.622, 1.622, 1.622, 1.623, 1.623, 1.623, 1.621, 1.621, 1.621,
+                            1.621, 1.621, 1.624, 1.627, 1.628, 1.628, 1.627, 1.627, 1.627, 1.627, 1.628, 1.631, 1.632, 1.633, 1.633, 1.632, 1.632, 1.632, 1.631, 1.631, 1.628, 1.625, 1.623, 1.622, 1.622, 1.622, 1.623, 1.623, 1.623, 1.621, 1.621, 1.621,
+                            1.621, 1.621, 1.623, 1.627, 1.628, 1.628, 1.628, 1.627, 1.627, 1.628, 1.628, 1.629, 1.631, 1.632, 1.633, 1.632, 1.631, 1.631, 1.631, 1.629, 1.628, 1.625, 1.624, 1.623, 1.623, 1.623, 1.623, 1.623, 1.623, 1.621, 1.621, 1.619,
+                            1.619, 1.621, 1.623, 1.626, 1.628, 1.629, 1.627, 1.627, 1.627, 1.627, 1.628, 1.629, 1.631, 1.631, 1.631, 1.631, 1.631, 1.629, 1.629, 1.628, 1.626, 1.624, 1.623, 1.623, 1.623, 1.622, 1.623, 1.623, 1.622, 1.621, 1.619, 1.619,
+                            1.618, 1.619, 1.623, 1.625, 1.627, 1.627, 1.627, 1.627, 1.626, 1.627, 1.627, 1.628, 1.628, 1.629, 1.628, 1.628, 1.628, 1.628, 1.628, 1.627, 1.625, 1.623, 1.621, 1.621, 1.621, 1.622, 1.622, 1.622, 1.621, 1.619, 1.618, 1.618,
+                            1.618, 1.619, 1.622, 1.624, 1.626, 1.626, 1.626, 1.626, 1.626, 1.626, 1.626, 1.626, 1.627, 1.627, 1.627, 1.626, 1.626, 1.626, 1.626, 1.626, 1.624, 1.622, 1.621, 1.621, 1.619, 1.621, 1.621, 1.621, 1.621, 1.618, 1.617, 1.617,
+                            1.616, 1.618, 1.621, 1.623, 1.624, 1.625, 1.625, 1.625, 1.625, 1.625, 1.626, 1.626, 1.627, 1.627, 1.625, 1.624, 1.624, 1.625, 1.626, 1.625, 1.623, 1.621, 1.619, 1.619, 1.619, 1.619, 1.621, 1.621, 1.619, 1.616, 1.616, 1.616,
+                            1.615, 1.616, 1.619, 1.621, 1.623, 1.624, 1.625, 1.624, 1.624, 1.625, 1.626, 1.627, 1.627, 1.626, 1.626, 1.625, 1.624, 1.625, 1.625, 1.625, 1.623, 1.621, 1.619, 1.619, 1.619, 1.619, 1.619, 1.619, 1.618, 1.616, 1.615, 1.614,
+                            1.614, 1.615, 1.616, 1.621, 1.621, 1.623, 1.624, 1.623, 1.624, 1.624, 1.625, 1.627, 1.627, 1.627, 1.626, 1.625, 1.625, 1.625, 1.625, 1.624, 1.622, 1.621, 1.619, 1.618, 1.617, 1.617, 1.617, 1.617, 1.616, 1.613, 1.612, 1.612,
+                            1.612, 1.612, 1.615, 1.617, 1.621, 1.621, 1.622, 1.622, 1.622, 1.624, 1.625, 1.626, 1.626, 1.626, 1.625, 1.624, 1.624, 1.624, 1.624, 1.623, 1.621, 1.619, 1.618, 1.616, 1.615, 1.615, 1.615, 1.615, 1.613, 1.611, 1.609, 1.609,
+                            1.611, 1.611, 1.612, 1.615, 1.618, 1.619, 1.621, 1.621, 1.622, 1.623, 1.624, 1.626, 1.626, 1.626, 1.625, 1.624, 1.624, 1.624, 1.623, 1.622, 1.621, 1.618, 1.617, 1.615, 1.615, 1.614, 1.614, 1.613, 1.611, 1.609, 1.609, 1.609,
+                            1.611, 1.611, 1.612, 1.615, 1.618, 1.619, 1.621, 1.622, 1.623, 1.625, 1.625, 1.627, 1.627, 1.627, 1.626, 1.626, 1.626, 1.626, 1.624, 1.622, 1.621, 1.618, 1.617, 1.617, 1.616, 1.615, 1.614, 1.613, 1.612, 1.609, 1.609, 1.609,
+                            1.612, 1.612, 1.614, 1.617, 1.619, 1.621, 1.623, 1.624, 1.625, 1.626, 1.627, 1.629, 1.631, 1.629, 1.629, 1.629, 1.628, 1.629, 1.628, 1.626, 1.624, 1.621, 1.621, 1.619, 1.619, 1.618, 1.616, 1.616, 1.613, 1.611, 1.612, 1.612
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    2.977, 2.794, 2.572, 2.375, 2.218, 2.098, 1.995, 1.903, 1.815, 1.731, 1.647, 1.571, 1.516, 1.493, 1.483, 1.481, 1.481, 1.481, 1.489, 1.511, 1.571, 1.643, 1.729, 1.813, 1.901, 1.993, 2.091, 2.208, 2.364, 2.563, 2.785, 2.971,
+                    2.951, 2.736, 2.512, 2.312, 2.153, 2.031, 1.926, 1.824, 1.736, 1.649, 1.571, 1.506, 1.456, 1.419, 1.396, 1.386, 1.386, 1.392, 1.414, 1.451, 1.505, 1.571, 1.648, 1.733, 1.824, 1.922, 2.025, 2.144, 2.301, 2.499, 2.725, 2.939,
+                    2.883, 2.701, 2.471, 2.266, 2.102, 1.974, 1.861, 1.753, 1.649, 1.571, 1.502, 1.425, 1.361, 1.322, 1.298, 1.286, 1.286, 1.294, 1.317, 1.359, 1.424, 1.501, 1.571, 1.648, 1.751, 1.857, 1.968, 2.095, 2.254, 2.458, 2.688, 2.872,
+                    2.788, 2.632, 2.408, 2.209, 2.056, 1.931, 1.816, 1.704, 1.598, 1.503, 1.425, 1.361, 1.322, 1.298, 1.269, 1.245, 1.243, 1.264, 1.293, 1.317, 1.359, 1.424, 1.501, 1.596, 1.702, 1.812, 1.924, 2.046, 2.197, 2.392, 2.619, 2.777,
+                    2.712, 2.541, 2.327, 2.155, 2.023, 1.908, 1.796, 1.684, 1.578, 1.488, 1.412, 1.351, 1.304, 1.269, 1.245, 1.235, 1.235, 1.243, 1.264, 1.301, 1.349, 1.411, 1.485, 1.577, 1.683, 1.791, 1.902, 2.016, 2.143, 2.312, 2.528, 2.702,
+                    2.678, 2.469, 2.269, 2.117, 1.998, 1.885, 1.773, 1.661, 1.556, 1.469, 1.397, 1.336, 1.277, 1.245, 1.234, 1.226, 1.226, 1.232, 1.244, 1.273, 1.332, 1.392, 1.465, 1.555, 1.659, 1.768, 1.879, 1.991, 2.109, 2.256, 2.454, 2.665,
+                    2.659, 2.433, 2.232, 2.081, 1.957, 1.841, 1.722, 1.606, 1.499, 1.409, 1.337, 1.277, 1.232, 1.198, 1.175, 1.166, 1.166, 1.172, 1.193, 1.228, 1.272, 1.334, 1.408, 1.499, 1.608, 1.717, 1.834, 1.951, 2.073, 2.222, 2.419, 2.648,
+                    2.624, 2.411, 2.204, 2.041, 1.909, 1.784, 1.661, 1.539, 1.431, 1.337, 1.277, 1.219, 1.159, 1.118, 1.096, 1.085, 1.085, 1.092, 1.114, 1.156, 1.219, 1.272, 1.337, 1.429, 1.539, 1.658, 1.779, 1.904, 2.033, 2.193, 2.397, 2.613,
+                    2.564, 2.377, 2.169, 2.012, 1.879, 1.749, 1.623, 1.501, 1.392, 1.299, 1.227, 1.169, 1.125, 1.097, 1.079, 1.063, 1.063, 1.076, 1.093, 1.124, 1.168, 1.227, 1.302, 1.392, 1.501, 1.622, 1.746, 1.875, 2.005, 2.161, 2.362, 2.554,
+                    2.515, 2.325, 2.138, 1.997, 1.869, 1.742, 1.617, 1.501, 1.392, 1.299, 1.227, 1.169, 1.125, 1.095, 1.079, 1.063, 1.063, 1.076, 1.093, 1.124, 1.168, 1.227, 1.302, 1.392, 1.499, 1.615, 1.741, 1.867, 1.991, 2.132, 2.316, 2.505,
+                    2.498, 2.289, 2.121, 1.988, 1.867, 1.741, 1.616, 1.499, 1.391, 1.299, 1.227, 1.169, 1.125, 1.095, 1.082, 1.065, 1.064, 1.079, 1.093, 1.124, 1.168, 1.227, 1.302, 1.392, 1.498, 1.614, 1.738, 1.864, 1.985, 2.116, 2.281, 2.486,
+                    2.498, 2.272, 2.105, 1.971, 1.846, 1.718, 1.592, 1.475, 1.371, 1.279, 1.211, 1.156, 1.112, 1.083, 1.064, 1.055, 1.055, 1.062, 1.081, 1.109, 1.154, 1.212, 1.285, 1.372, 1.473, 1.589, 1.712, 1.843, 1.967, 2.101, 2.263, 2.486,
+                    2.497, 2.267, 2.088, 1.946, 1.813, 1.679, 1.549, 1.431, 1.324, 1.231, 1.159, 1.114, 1.079, 1.035, 1.008, 1.001, 1.001, 1.008, 1.032, 1.076, 1.111, 1.161, 1.235, 1.324, 1.429, 1.547, 1.677, 1.811, 1.941, 2.082, 2.257, 2.484,
+                    2.476, 2.262, 2.077, 1.933, 1.802, 1.671, 1.541, 1.421, 1.317, 1.227, 1.157, 1.101, 1.059, 1.027, 1.004, 1.001, 1.001, 1.004, 1.024, 1.054, 1.098, 1.157, 1.229, 1.317, 1.419, 1.537, 1.667, 1.799, 1.931, 2.071, 2.251, 2.463,
+                    2.455, 2.246, 2.076, 1.933, 1.802, 1.671, 1.541, 1.421, 1.317, 1.227, 1.157, 1.103, 1.064, 1.035, 1.011, 1.003, 1.003, 1.009, 1.032, 1.062, 1.099, 1.157, 1.229, 1.317, 1.419, 1.537, 1.667, 1.799, 1.931, 2.071, 2.236, 2.446,
+                    2.454, 2.239, 2.077, 1.946, 1.817, 1.686, 1.561, 1.444, 1.342, 1.255, 1.189, 1.136, 1.093, 1.059, 1.039, 1.038, 1.038, 1.039, 1.056, 1.091, 1.131, 1.187, 1.258, 1.341, 1.441, 1.556, 1.683, 1.813, 1.939, 2.071, 2.229, 2.445,
+                    2.454, 2.239, 2.079, 1.946, 1.817, 1.686, 1.561, 1.444, 1.342, 1.255, 1.189, 1.136, 1.093, 1.062, 1.039, 1.038, 1.038, 1.039, 1.059, 1.091, 1.131, 1.187, 1.258, 1.341, 1.441, 1.556, 1.683, 1.813, 1.939, 2.071, 2.229, 2.445,
+                    2.458, 2.251, 2.079, 1.941, 1.807, 1.672, 1.543, 1.424, 1.319, 1.231, 1.162, 1.107, 1.065, 1.045, 1.018, 1.003, 1.003, 1.017, 1.044, 1.062, 1.103, 1.159, 1.232, 1.317, 1.419, 1.539, 1.669, 1.802, 1.933, 2.072, 2.239, 2.445,
+                    2.479, 2.265, 2.085, 1.941, 1.807, 1.672, 1.543, 1.424, 1.319, 1.231, 1.162, 1.107, 1.064, 1.031, 1.017, 1.003, 1.003, 1.017, 1.031, 1.059, 1.103, 1.159, 1.232, 1.317, 1.419, 1.539, 1.669, 1.802, 1.933, 2.076, 2.252, 2.468,
+                    2.504, 2.277, 2.099, 1.958, 1.826, 1.695, 1.565, 1.445, 1.338, 1.249, 1.181, 1.129, 1.095, 1.051, 1.027, 1.018, 1.018, 1.028, 1.049, 1.092, 1.127, 1.179, 1.252, 1.339, 1.442, 1.561, 1.691, 1.822, 1.949, 2.089, 2.263, 2.492,
+                    2.509, 2.288, 2.118, 1.982, 1.858, 1.728, 1.604, 1.486, 1.381, 1.293, 1.227, 1.173, 1.127, 1.098, 1.076, 1.067, 1.067, 1.077, 1.097, 1.121, 1.168, 1.225, 1.296, 1.382, 1.483, 1.598, 1.723, 1.852, 1.975, 2.107, 2.274, 2.496,
+                    2.515, 2.312, 2.139, 2.002, 1.877, 1.751, 1.629, 1.512, 1.405, 1.318, 1.248, 1.193, 1.149, 1.118, 1.096, 1.085, 1.085, 1.095, 1.114, 1.145, 1.188, 1.246, 1.319, 1.405, 1.508, 1.623, 1.747, 1.873, 1.995, 2.127, 2.297, 2.501,
+                    2.541, 2.351, 2.161, 2.016, 1.888, 1.762, 1.638, 1.519, 1.411, 1.319, 1.251, 1.197, 1.154, 1.121, 1.099, 1.091, 1.091, 1.099, 1.119, 1.148, 1.192, 1.248, 1.321, 1.411, 1.515, 1.633, 1.758, 1.884, 2.009, 2.149, 2.334, 2.526,
+                    2.588, 2.394, 2.193, 2.036, 1.905, 1.779, 1.656, 1.537, 1.426, 1.329, 1.255, 1.198, 1.161, 1.139, 1.118, 1.096, 1.095, 1.114, 1.138, 1.158, 1.195, 1.256, 1.333, 1.425, 1.533, 1.651, 1.777, 1.902, 2.028, 2.181, 2.378, 2.571,
+                    2.639, 2.431, 2.226, 2.067, 1.937, 1.816, 1.695, 1.577, 1.467, 1.368, 1.298, 1.253, 1.198, 1.161, 1.139, 1.129, 1.129, 1.138, 1.158, 1.195, 1.245, 1.296, 1.374, 1.468, 1.574, 1.692, 1.812, 1.934, 2.059, 2.216, 2.418, 2.626,
+                    2.679, 2.465, 2.261, 2.104, 1.979, 1.862, 1.746, 1.631, 1.522, 1.426, 1.352, 1.297, 1.254, 1.221, 1.201, 1.189, 1.189, 1.198, 1.217, 1.246, 1.293, 1.354, 1.433, 1.526, 1.631, 1.744, 1.859, 1.975, 2.097, 2.252, 2.452, 2.667,
+                    2.711, 2.511, 2.302, 2.141, 2.018, 1.903, 1.791, 1.678, 1.571, 1.475, 1.401, 1.343, 1.297, 1.268, 1.247, 1.236, 1.236, 1.244, 1.263, 1.291, 1.341, 1.403, 1.484, 1.575, 1.679, 1.791, 1.902, 2.012, 2.136, 2.295, 2.501, 2.698,
+                    2.759, 2.582, 2.363, 2.184, 2.049, 1.935, 1.824, 1.714, 1.608, 1.511, 1.431, 1.371, 1.325, 1.295, 1.271, 1.259, 1.259, 1.266, 1.291, 1.318, 1.369, 1.436, 1.517, 1.611, 1.716, 1.825, 1.933, 2.047, 2.179, 2.351, 2.571, 2.748,
+                    2.833, 2.662, 2.433, 2.239, 2.089, 1.968, 1.859, 1.752, 1.646, 1.549, 1.468, 1.411, 1.369, 1.325, 1.296, 1.283, 1.283, 1.292, 1.318, 1.366, 1.411, 1.472, 1.555, 1.651, 1.755, 1.861, 1.969, 2.086, 2.231, 2.422, 2.648, 2.821,
+                    2.909, 2.729, 2.499, 2.298, 2.141, 2.016, 1.907, 1.805, 1.703, 1.611, 1.539, 1.468, 1.411, 1.375, 1.351, 1.339, 1.339, 1.348, 1.372, 1.411, 1.472, 1.543, 1.613, 1.708, 1.807, 1.909, 2.014, 2.135, 2.288, 2.487, 2.716, 2.897,
+                    2.981, 2.789, 2.563, 2.358, 2.197, 2.071, 1.968, 1.868, 1.774, 1.684, 1.607, 1.541, 1.489, 1.453, 1.428, 1.417, 1.417, 1.427, 1.451, 1.489, 1.543, 1.611, 1.686, 1.776, 1.871, 1.966, 2.069, 2.191, 2.349, 2.551, 2.775, 2.964,
+                    3.041, 2.856, 2.629, 2.422, 2.252, 2.127, 2.021, 1.927, 1.834, 1.748, 1.672, 1.604, 1.541, 1.495, 1.483, 1.483, 1.483, 1.483, 1.496, 1.543, 1.608, 1.673, 1.749, 1.835, 1.926, 2.019, 2.122, 2.249, 2.411, 2.614, 2.839, 3.026
+                ],
+                "sigma": 0.00163,
+                "sigma_Cb": 0.0011
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2498,
+                        "ccm":
+                        [
+                            1.14912, 0.28638, -0.43551,
+                            -0.49691, 1.60391, -0.10701,
+                            -0.10513, -1.09534, 2.20047
+                        ]
+                    },
+                    {
+                        "ct": 2821,
+                        "ccm":
+                        [
+                            1.18251, 0.15501, -0.33752,
+                            -0.44304, 1.58495, -0.14191,
+                            -0.05077, -0.96422, 2.01498
+                        ]
+                    },
+                    {
+                        "ct": 2925,
+                        "ccm":
+                        [
+                            1.18668, 0.00195, -0.18864,
+                            -0.41617, 1.50514, -0.08897,
+                            -0.02675, -0.91143, 1.93818
+                        ]
+                    },
+                    {
+                        "ct": 2926,
+                        "ccm":
+                        [
+                            1.50948, -0.44421, -0.06527,
+                            -0.37241, 1.41726, -0.04486,
+                            0.07098, -0.84694, 1.77596
+                        ]
+                    },
+                    {
+                        "ct": 2951,
+                        "ccm":
+                        [
+                            1.52743, -0.47333, -0.05411,
+                            -0.36485, 1.40764, -0.04279,
+                            0.08672, -0.90479, 1.81807
+                        ]
+                    },
+                    {
+                        "ct": 2954,
+                        "ccm":
+                        [
+                            1.51683, -0.46841, -0.04841,
+                            -0.36288, 1.39914, -0.03625,
+                            0.06421, -0.82034, 1.75613
+                        ]
+                    },
+                    {
+                        "ct": 3578,
+                        "ccm":
+                        [
+                            1.59888, -0.59105, -0.00784,
+                            -0.29366, 1.32037, -0.02671,
+                            0.06627, -0.76465, 1.69838
+                        ]
+                    },
+                    {
+                        "ct": 3717,
+                        "ccm":
+                        [
+                            1.59063, -0.58059, -0.01003,
+                            -0.29583, 1.32715, -0.03132,
+                            0.03613, -0.67431, 1.63817
+                        ]
+                    },
+                    {
+                        "ct": 3784,
+                        "ccm":
+                        [
+                            1.59379, -0.58861, -0.00517,
+                            -0.29178, 1.33292, -0.04115,
+                            0.03541, -0.66162, 1.62622
+                        ]
+                    },
+                    {
+                        "ct": 4485,
+                        "ccm":
+                        [
+                            1.40761, -0.34561, -0.06201,
+                            -0.32388, 1.57221, -0.24832,
+                            -0.01014, -0.63427, 1.64441
+                        ]
+                    },
+                    {
+                        "ct": 4615,
+                        "ccm":
+                        [
+                            1.41537, -0.35832, -0.05705,
+                            -0.31429, 1.56019, -0.24591,
+                            -0.01761, -0.61859, 1.63621
+                        ]
+                    },
+                    {
+                        "ct": 4671,
+                        "ccm":
+                        [
+                            1.42941, -0.38178, -0.04764,
+                            -0.31421, 1.55925, -0.24504,
+                            -0.01141, -0.62987, 1.64129
+                        ]
+                    },
+                    {
+                        "ct": 5753,
+                        "ccm":
+                        [
+                            1.64549, -0.63329, -0.01221,
+                            -0.22431, 1.36423, -0.13992,
+                            -0.00831, -0.55373, 1.56204
+                        ]
+                    },
+                    {
+                        "ct": 5773,
+                        "ccm":
+                        [
+                            1.63668, -0.63557, -0.00111,
+                            -0.21919, 1.36234, -0.14315,
+                            -0.00399, -0.57428, 1.57827
+                        ]
+                    },
+                    {
+                        "ct": 7433,
+                        "ccm":
+                        [
+                            1.36007, -0.09277, -0.26729,
+                            -0.36886, 2.09249, -0.72363,
+                            -0.12573, -0.76761, 1.89334
+                        ]
+                    },
+                    {
+                        "ct": 55792,
+                        "ccm":
+                        [
+                            1.65091, -0.63689, -0.01401,
+                            -0.22277, 1.35752, -0.13475,
+                            -0.00943, -0.55091, 1.56033
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.af":
+            {
+                "ranges":
+                {
+                    "normal":
+                    {
+                        "min": 0.0,
+                        "max": 12.0,
+                        "default": 1.0
+                    },
+                    "macro":
+                    {
+                        "min": 3.0,
+                        "max": 15.0,
+                        "default": 4.0
+                    }
+                },
+                "speeds":
+                {
+                    "normal":
+                    {
+                        "step_coarse": 1.0,
+                        "step_fine": 0.25,
+                        "contrast_ratio": 0.75,
+                        "pdaf_gain": -0.02,
+                        "pdaf_squelch": 0.125,
+                        "max_slew": 2.0,
+                        "pdaf_frames": 20,
+                        "dropout_frames": 6,
+                        "step_frames": 4
+                    }
+                },
+                "conf_epsilon": 8,
+                "conf_thresh": 16,
+                "conf_clip": 512,
+                "skip_frames": 5,
+                "map": [ 0.0, 445, 15.0, 925 ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx708_wide.json b/src/ipa/rpi/pisp/data/imx708_wide.json
new file mode 100644
index 000000000..9fff05d93
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx708_wide.json
@@ -0,0 +1,1293 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 41985,
+                "reference_gain": 1.12,
+                "reference_aperture": 1.0,
+                "reference_lux": 810,
+                "reference_Y": 13859
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.9
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 206,
+                "slope": 0.00324
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2868.0, 0.6419, 0.3613,
+                    3603.0, 0.5374, 0.4787,
+                    4620.0, 0.4482, 0.5813,
+                    5901.0, 0.3883, 0.6514,
+                    7610.0, 0.3279, 0.7232
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.01908,
+                "transverse_neg": 0.01376
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.65,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.717, 1.712, 1.703, 1.692, 1.674, 1.653, 1.638, 1.624, 1.613, 1.601, 1.589, 1.579, 1.575, 1.573, 1.571, 1.571, 1.571, 1.571, 1.572, 1.577, 1.583, 1.593, 1.605, 1.618, 1.636, 1.653, 1.677, 1.699, 1.715, 1.722, 1.731, 1.733,
+                            1.714, 1.706, 1.696, 1.678, 1.658, 1.639, 1.627, 1.614, 1.602, 1.591, 1.579, 1.572, 1.569, 1.566, 1.565, 1.564, 1.564, 1.565, 1.567, 1.571, 1.578, 1.585, 1.595, 1.607, 1.622, 1.641, 1.661, 1.685, 1.706, 1.717, 1.724, 1.732,
+                            1.708, 1.698, 1.688, 1.667, 1.647, 1.629, 1.619, 1.606, 1.593, 1.581, 1.572, 1.565, 1.561, 1.559, 1.559, 1.559, 1.559, 1.561, 1.562, 1.566, 1.571, 1.577, 1.587, 1.598, 1.612, 1.629, 1.649, 1.674, 1.697, 1.713, 1.721, 1.728,
+                            1.706, 1.695, 1.681, 1.655, 1.636, 1.622, 1.613, 1.597, 1.585, 1.572, 1.564, 1.559, 1.558, 1.556, 1.555, 1.555, 1.556, 1.556, 1.558, 1.561, 1.566, 1.571, 1.578, 1.591, 1.605, 1.619, 1.638, 1.662, 1.691, 1.708, 1.719, 1.726,
+                            1.706, 1.692, 1.675, 1.649, 1.629, 1.615, 1.607, 1.592, 1.575, 1.565, 1.559, 1.554, 1.552, 1.551, 1.551, 1.551, 1.551, 1.552, 1.554, 1.557, 1.561, 1.566, 1.573, 1.582, 1.596, 1.611, 1.627, 1.652, 1.681, 1.705, 1.717, 1.724,
+                            1.703, 1.686, 1.664, 1.639, 1.625, 1.612, 1.599, 1.585, 1.569, 1.559, 1.554, 1.549, 1.548, 1.548, 1.546, 1.546, 1.546, 1.547, 1.549, 1.553, 1.557, 1.563, 1.569, 1.576, 1.591, 1.603, 1.621, 1.644, 1.674, 1.698, 1.714, 1.724,
+                            1.702, 1.681, 1.659, 1.635, 1.621, 1.607, 1.594, 1.579, 1.565, 1.554, 1.549, 1.546, 1.544, 1.543, 1.543, 1.542, 1.543, 1.543, 1.544, 1.549, 1.553, 1.558, 1.564, 1.572, 1.584, 1.599, 1.614, 1.639, 1.667, 1.695, 1.712, 1.724,
+                            1.697, 1.678, 1.655, 1.631, 1.616, 1.602, 1.589, 1.575, 1.559, 1.551, 1.545, 1.543, 1.542, 1.542, 1.541, 1.539, 1.539, 1.539, 1.542, 1.544, 1.551, 1.555, 1.562, 1.571, 1.579, 1.594, 1.611, 1.631, 1.661, 1.691, 1.712, 1.724,
+                            1.695, 1.674, 1.651, 1.629, 1.615, 1.599, 1.584, 1.568, 1.554, 1.545, 1.542, 1.541, 1.539, 1.539, 1.538, 1.538, 1.538, 1.539, 1.539, 1.543, 1.548, 1.554, 1.559, 1.568, 1.576, 1.592, 1.608, 1.629, 1.655, 1.689, 1.709, 1.723,
+                            1.691, 1.671, 1.648, 1.627, 1.613, 1.597, 1.581, 1.564, 1.551, 1.543, 1.539, 1.538, 1.538, 1.537, 1.536, 1.535, 1.536, 1.538, 1.539, 1.542, 1.546, 1.551, 1.558, 1.564, 1.575, 1.588, 1.604, 1.627, 1.654, 1.686, 1.709, 1.724,
+                            1.689, 1.667, 1.643, 1.626, 1.612, 1.594, 1.579, 1.559, 1.549, 1.541, 1.536, 1.535, 1.535, 1.535, 1.534, 1.533, 1.534, 1.536, 1.538, 1.541, 1.545, 1.549, 1.555, 1.563, 1.573, 1.585, 1.602, 1.624, 1.651, 1.683, 1.709, 1.725,
+                            1.686, 1.665, 1.641, 1.623, 1.609, 1.594, 1.576, 1.559, 1.546, 1.538, 1.535, 1.534, 1.533, 1.532, 1.531, 1.531, 1.532, 1.534, 1.537, 1.539, 1.544, 1.549, 1.554, 1.562, 1.572, 1.585, 1.601, 1.622, 1.651, 1.682, 1.711, 1.726,
+                            1.686, 1.661, 1.639, 1.623, 1.609, 1.592, 1.574, 1.557, 1.545, 1.537, 1.534, 1.533, 1.532, 1.531, 1.529, 1.528, 1.529, 1.532, 1.537, 1.539, 1.542, 1.548, 1.553, 1.562, 1.571, 1.584, 1.601, 1.621, 1.649, 1.682, 1.711, 1.726,
+                            1.685, 1.661, 1.638, 1.624, 1.609, 1.592, 1.574, 1.557, 1.544, 1.536, 1.533, 1.532, 1.531, 1.529, 1.527, 1.522, 1.526, 1.531, 1.536, 1.539, 1.542, 1.547, 1.553, 1.562, 1.571, 1.583, 1.601, 1.621, 1.648, 1.682, 1.711, 1.726,
+                            1.684, 1.658, 1.638, 1.624, 1.611, 1.592, 1.573, 1.556, 1.543, 1.536, 1.532, 1.531, 1.529, 1.528, 1.522, 1.517, 1.519, 1.527, 1.535, 1.539, 1.541, 1.547, 1.553, 1.562, 1.571, 1.583, 1.601, 1.622, 1.647, 1.681, 1.711, 1.727,
+                            1.681, 1.658, 1.641, 1.624, 1.611, 1.593, 1.573, 1.555, 1.541, 1.535, 1.532, 1.529, 1.529, 1.527, 1.517, 1.506, 1.506, 1.522, 1.534, 1.538, 1.541, 1.546, 1.552, 1.562, 1.569, 1.583, 1.601, 1.622, 1.646, 1.679, 1.709, 1.728,
+                            1.679, 1.656, 1.639, 1.624, 1.611, 1.595, 1.575, 1.556, 1.541, 1.534, 1.531, 1.529, 1.529, 1.527, 1.517, 1.507, 1.507, 1.522, 1.533, 1.538, 1.539, 1.546, 1.552, 1.561, 1.569, 1.584, 1.601, 1.622, 1.647, 1.681, 1.709, 1.726,
+                            1.678, 1.656, 1.638, 1.625, 1.612, 1.597, 1.577, 1.557, 1.542, 1.534, 1.529, 1.529, 1.528, 1.527, 1.522, 1.516, 1.519, 1.525, 1.533, 1.537, 1.539, 1.545, 1.552, 1.561, 1.571, 1.584, 1.601, 1.623, 1.649, 1.681, 1.709, 1.726,
+                            1.679, 1.654, 1.639, 1.626, 1.613, 1.598, 1.578, 1.558, 1.543, 1.534, 1.529, 1.529, 1.529, 1.528, 1.527, 1.522, 1.525, 1.528, 1.533, 1.536, 1.539, 1.546, 1.553, 1.561, 1.571, 1.586, 1.602, 1.623, 1.651, 1.683, 1.712, 1.726,
+                            1.677, 1.655, 1.641, 1.628, 1.615, 1.599, 1.581, 1.562, 1.545, 1.535, 1.531, 1.529, 1.529, 1.528, 1.527, 1.527, 1.528, 1.531, 1.533, 1.536, 1.539, 1.545, 1.552, 1.561, 1.572, 1.588, 1.607, 1.626, 1.654, 1.686, 1.716, 1.729,
+                            1.676, 1.655, 1.642, 1.629, 1.617, 1.602, 1.586, 1.564, 1.546, 1.536, 1.531, 1.529, 1.529, 1.529, 1.529, 1.529, 1.529, 1.532, 1.534, 1.536, 1.539, 1.547, 1.553, 1.563, 1.576, 1.591, 1.609, 1.627, 1.655, 1.688, 1.716, 1.729,
+                            1.676, 1.658, 1.641, 1.631, 1.617, 1.605, 1.588, 1.569, 1.553, 1.539, 1.532, 1.531, 1.529, 1.529, 1.529, 1.529, 1.531, 1.532, 1.534, 1.537, 1.541, 1.547, 1.553, 1.564, 1.578, 1.594, 1.613, 1.632, 1.659, 1.691, 1.717, 1.728,
+                            1.676, 1.658, 1.642, 1.631, 1.619, 1.608, 1.592, 1.575, 1.556, 1.542, 1.533, 1.531, 1.529, 1.529, 1.529, 1.531, 1.531, 1.532, 1.534, 1.537, 1.542, 1.548, 1.556, 1.567, 1.582, 1.598, 1.616, 1.638, 1.661, 1.693, 1.717, 1.729,
+                            1.678, 1.661, 1.644, 1.632, 1.621, 1.611, 1.596, 1.579, 1.561, 1.546, 1.536, 1.532, 1.531, 1.531, 1.531, 1.531, 1.532, 1.533, 1.535, 1.538, 1.544, 1.549, 1.559, 1.569, 1.587, 1.604, 1.618, 1.639, 1.669, 1.697, 1.718, 1.731,
+                            1.679, 1.662, 1.648, 1.635, 1.625, 1.615, 1.602, 1.586, 1.569, 1.552, 1.541, 1.535, 1.532, 1.532, 1.531, 1.532, 1.533, 1.534, 1.537, 1.541, 1.546, 1.552, 1.562, 1.576, 1.592, 1.608, 1.622, 1.647, 1.673, 1.703, 1.721, 1.734,
+                            1.684, 1.664, 1.649, 1.637, 1.627, 1.618, 1.606, 1.593, 1.576, 1.561, 1.547, 1.539, 1.535, 1.533, 1.533, 1.533, 1.534, 1.536, 1.539, 1.543, 1.549, 1.555, 1.568, 1.583, 1.596, 1.612, 1.629, 1.651, 1.681, 1.706, 1.723, 1.734,
+                            1.689, 1.669, 1.649, 1.639, 1.629, 1.621, 1.609, 1.597, 1.585, 1.567, 1.554, 1.546, 1.539, 1.536, 1.535, 1.535, 1.537, 1.538, 1.542, 1.546, 1.553, 1.562, 1.572, 1.589, 1.603, 1.619, 1.635, 1.658, 1.686, 1.708, 1.726, 1.736,
+                            1.692, 1.673, 1.655, 1.644, 1.634, 1.624, 1.614, 1.604, 1.592, 1.577, 1.566, 1.554, 1.546, 1.542, 1.538, 1.538, 1.539, 1.542, 1.546, 1.552, 1.559, 1.568, 1.581, 1.596, 1.609, 1.625, 1.642, 1.664, 1.693, 1.714, 1.727, 1.736,
+                            1.695, 1.679, 1.662, 1.647, 1.638, 1.631, 1.623, 1.612, 1.601, 1.589, 1.577, 1.565, 1.555, 1.549, 1.546, 1.545, 1.546, 1.548, 1.552, 1.559, 1.568, 1.579, 1.593, 1.604, 1.618, 1.632, 1.648, 1.676, 1.701, 1.718, 1.728, 1.739,
+                            1.699, 1.684, 1.667, 1.654, 1.644, 1.635, 1.629, 1.621, 1.609, 1.599, 1.589, 1.578, 1.568, 1.559, 1.556, 1.554, 1.554, 1.557, 1.563, 1.569, 1.578, 1.589, 1.599, 1.612, 1.625, 1.641, 1.661, 1.685, 1.707, 1.722, 1.734, 1.742,
+                            1.703, 1.691, 1.672, 1.658, 1.648, 1.639, 1.634, 1.628, 1.618, 1.606, 1.598, 1.589, 1.579, 1.573, 1.568, 1.567, 1.567, 1.568, 1.571, 1.578, 1.587, 1.597, 1.607, 1.618, 1.632, 1.651, 1.672, 1.694, 1.715, 1.728, 1.737, 1.742,
+                            1.707, 1.691, 1.676, 1.662, 1.651, 1.643, 1.638, 1.631, 1.622, 1.614, 1.604, 1.596, 1.589, 1.579, 1.575, 1.573, 1.573, 1.574, 1.578, 1.586, 1.589, 1.598, 1.609, 1.625, 1.638, 1.657, 1.679, 1.701, 1.719, 1.728, 1.738, 1.742
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            2.939, 2.935, 2.916, 2.895, 2.856, 2.825, 2.797, 2.777, 2.761, 2.741, 2.726, 2.709, 2.707, 2.704, 2.702, 2.702, 2.703, 2.706, 2.708, 2.709, 2.719, 2.735, 2.753, 2.776, 2.801, 2.832, 2.874, 2.915, 2.939, 2.943, 2.953, 2.961,
+                            2.936, 2.923, 2.901, 2.863, 2.829, 2.801, 2.781, 2.763, 2.743, 2.732, 2.712, 2.701, 2.696, 2.692, 2.691, 2.691, 2.693, 2.694, 2.696, 2.701, 2.709, 2.725, 2.741, 2.758, 2.779, 2.811, 2.838, 2.879, 2.919, 2.939, 2.948, 2.959,
+                            2.929, 2.909, 2.887, 2.847, 2.808, 2.783, 2.765, 2.748, 2.732, 2.713, 2.699, 2.691, 2.687, 2.686, 2.685, 2.685, 2.687, 2.689, 2.691, 2.694, 2.701, 2.709, 2.725, 2.745, 2.763, 2.786, 2.818, 2.863, 2.907, 2.933, 2.941, 2.955,
+                            2.929, 2.903, 2.875, 2.825, 2.791, 2.769, 2.755, 2.737, 2.718, 2.701, 2.688, 2.683, 2.681, 2.679, 2.681, 2.679, 2.681, 2.682, 2.685, 2.689, 2.694, 2.701, 2.711, 2.737, 2.754, 2.772, 2.803, 2.844, 2.894, 2.931, 2.939, 2.953,
+                            2.926, 2.895, 2.862, 2.816, 2.782, 2.759, 2.744, 2.727, 2.709, 2.691, 2.679, 2.673, 2.671, 2.669, 2.669, 2.669, 2.671, 2.674, 2.678, 2.681, 2.685, 2.694, 2.707, 2.725, 2.739, 2.762, 2.786, 2.829, 2.879, 2.919, 2.942, 2.952,
+                            2.919, 2.886, 2.846, 2.797, 2.772, 2.751, 2.737, 2.719, 2.694, 2.679, 2.672, 2.666, 2.664, 2.661, 2.659, 2.658, 2.661, 2.664, 2.669, 2.673, 2.678, 2.685, 2.696, 2.715, 2.728, 2.749, 2.774, 2.808, 2.866, 2.909, 2.936, 2.951,
+                            2.904, 2.877, 2.835, 2.789, 2.763, 2.744, 2.728, 2.712, 2.686, 2.672, 2.664, 2.657, 2.654, 2.654, 2.652, 2.653, 2.654, 2.657, 2.661, 2.666, 2.672, 2.678, 2.688, 2.703, 2.721, 2.742, 2.762, 2.797, 2.851, 2.902, 2.928, 2.949,
+                            2.901, 2.869, 2.825, 2.781, 2.756, 2.738, 2.721, 2.698, 2.679, 2.665, 2.656, 2.652, 2.649, 2.648, 2.648, 2.648, 2.649, 2.651, 2.654, 2.659, 2.667, 2.675, 2.683, 2.699, 2.711, 2.736, 2.754, 2.789, 2.838, 2.896, 2.926, 2.948,
+                            2.899, 2.862, 2.815, 2.774, 2.752, 2.734, 2.717, 2.689, 2.669, 2.658, 2.651, 2.646, 2.645, 2.643, 2.643, 2.644, 2.645, 2.646, 2.649, 2.654, 2.661, 2.669, 2.681, 2.693, 2.707, 2.729, 2.751, 2.782, 2.834, 2.887, 2.924, 2.947,
+                            2.898, 2.853, 2.812, 2.771, 2.751, 2.731, 2.711, 2.686, 2.663, 2.653, 2.646, 2.642, 2.641, 2.642, 2.642, 2.641, 2.641, 2.641, 2.646, 2.651, 2.657, 2.667, 2.678, 2.693, 2.705, 2.728, 2.746, 2.781, 2.829, 2.885, 2.924, 2.951,
+                            2.896, 2.851, 2.807, 2.771, 2.752, 2.729, 2.709, 2.681, 2.661, 2.649, 2.643, 2.641, 2.639, 2.639, 2.638, 2.636, 2.637, 2.638, 2.644, 2.649, 2.657, 2.666, 2.676, 2.688, 2.705, 2.725, 2.745, 2.777, 2.827, 2.884, 2.927, 2.951,
+                            2.891, 2.846, 2.803, 2.771, 2.749, 2.728, 2.706, 2.677, 2.658, 2.647, 2.641, 2.637, 2.637, 2.636, 2.636, 2.633, 2.632, 2.635, 2.643, 2.649, 2.656, 2.665, 2.675, 2.688, 2.704, 2.719, 2.744, 2.776, 2.822, 2.881, 2.927, 2.958,
+                            2.887, 2.841, 2.797, 2.769, 2.749, 2.729, 2.704, 2.674, 2.655, 2.645, 2.638, 2.635, 2.633, 2.632, 2.631, 2.625, 2.627, 2.631, 2.639, 2.649, 2.654, 2.662, 2.673, 2.686, 2.701, 2.718, 2.742, 2.773, 2.822, 2.881, 2.926, 2.958,
+                            2.883, 2.837, 2.796, 2.769, 2.749, 2.729, 2.701, 2.673, 2.653, 2.641, 2.636, 2.632, 2.631, 2.629, 2.623, 2.612, 2.619, 2.627, 2.637, 2.648, 2.652, 2.659, 2.671, 2.688, 2.699, 2.719, 2.742, 2.774, 2.821, 2.882, 2.927, 2.961,
+                            2.881, 2.832, 2.795, 2.769, 2.751, 2.729, 2.701, 2.672, 2.652, 2.639, 2.633, 2.631, 2.628, 2.625, 2.611, 2.599, 2.607, 2.619, 2.635, 2.644, 2.652, 2.659, 2.669, 2.686, 2.698, 2.719, 2.743, 2.775, 2.822, 2.881, 2.926, 2.961,
+                            2.879, 2.829, 2.793, 2.771, 2.751, 2.731, 2.701, 2.672, 2.651, 2.639, 2.632, 2.628, 2.626, 2.621, 2.601, 2.581, 2.581, 2.611, 2.631, 2.642, 2.648, 2.657, 2.669, 2.685, 2.699, 2.721, 2.743, 2.776, 2.819, 2.879, 2.927, 2.961,
+                            2.876, 2.829, 2.796, 2.773, 2.752, 2.731, 2.705, 2.672, 2.651, 2.637, 2.631, 2.627, 2.625, 2.619, 2.601, 2.581, 2.581, 2.611, 2.629, 2.641, 2.647, 2.658, 2.669, 2.685, 2.697, 2.721, 2.746, 2.777, 2.822, 2.881, 2.929, 2.964,
+                            2.874, 2.827, 2.796, 2.775, 2.755, 2.733, 2.708, 2.674, 2.649, 2.635, 2.629, 2.626, 2.624, 2.621, 2.609, 2.601, 2.606, 2.615, 2.629, 2.638, 2.645, 2.657, 2.669, 2.682, 2.699, 2.722, 2.747, 2.778, 2.822, 2.881, 2.931, 2.964,
+                            2.871, 2.827, 2.797, 2.776, 2.761, 2.734, 2.711, 2.679, 2.651, 2.636, 2.628, 2.626, 2.624, 2.621, 2.618, 2.611, 2.614, 2.619, 2.628, 2.639, 2.644, 2.657, 2.668, 2.683, 2.698, 2.723, 2.749, 2.782, 2.824, 2.882, 2.933, 2.965,
+                            2.869, 2.825, 2.797, 2.777, 2.765, 2.741, 2.718, 2.683, 2.655, 2.638, 2.627, 2.625, 2.624, 2.623, 2.621, 2.618, 2.618, 2.624, 2.629, 2.639, 2.644, 2.657, 2.669, 2.684, 2.701, 2.725, 2.755, 2.782, 2.829, 2.887, 2.937, 2.965,
+                            2.871, 2.826, 2.799, 2.776, 2.765, 2.744, 2.723, 2.689, 2.659, 2.639, 2.629, 2.626, 2.626, 2.624, 2.624, 2.622, 2.624, 2.627, 2.632, 2.639, 2.646, 2.657, 2.671, 2.687, 2.706, 2.732, 2.757, 2.789, 2.836, 2.893, 2.941, 2.965,
+                            2.869, 2.831, 2.803, 2.778, 2.766, 2.748, 2.729, 2.697, 2.667, 2.645, 2.632, 2.628, 2.625, 2.625, 2.625, 2.625, 2.627, 2.629, 2.634, 2.638, 2.648, 2.661, 2.673, 2.688, 2.711, 2.741, 2.762, 2.797, 2.843, 2.901, 2.943, 2.964,
+                            2.872, 2.837, 2.802, 2.781, 2.768, 2.753, 2.734, 2.702, 2.674, 2.647, 2.634, 2.629, 2.626, 2.625, 2.625, 2.627, 2.629, 2.632, 2.635, 2.639, 2.649, 2.663, 2.676, 2.694, 2.719, 2.746, 2.771, 2.799, 2.851, 2.905, 2.947, 2.969,
+                            2.871, 2.837, 2.805, 2.786, 2.771, 2.755, 2.739, 2.714, 2.685, 2.655, 2.639, 2.631, 2.626, 2.625, 2.626, 2.628, 2.629, 2.632, 2.634, 2.642, 2.651, 2.663, 2.679, 2.701, 2.726, 2.756, 2.773, 2.809, 2.861, 2.913, 2.949, 2.968,
+                            2.876, 2.841, 2.808, 2.789, 2.775, 2.759, 2.744, 2.719, 2.693, 2.664, 2.648, 2.636, 2.629, 2.627, 2.627, 2.629, 2.631, 2.633, 2.637, 2.645, 2.653, 2.666, 2.682, 2.708, 2.734, 2.759, 2.779, 2.815, 2.868, 2.918, 2.951, 2.971,
+                            2.882, 2.845, 2.816, 2.791, 2.778, 2.766, 2.748, 2.733, 2.707, 2.681, 2.656, 2.643, 2.636, 2.632, 2.631, 2.632, 2.633, 2.637, 2.643, 2.648, 2.659, 2.672, 2.691, 2.719, 2.747, 2.765, 2.791, 2.829, 2.881, 2.931, 2.952, 2.969,
+                            2.889, 2.855, 2.819, 2.799, 2.782, 2.769, 2.755, 2.741, 2.717, 2.691, 2.672, 2.652, 2.643, 2.639, 2.636, 2.636, 2.638, 2.642, 2.646, 2.655, 2.665, 2.682, 2.703, 2.729, 2.752, 2.774, 2.798, 2.839, 2.891, 2.933, 2.959, 2.975,
+                            2.897, 2.862, 2.829, 2.804, 2.789, 2.776, 2.764, 2.749, 2.734, 2.709, 2.689, 2.669, 2.652, 2.644, 2.642, 2.642, 2.644, 2.647, 2.654, 2.664, 2.677, 2.694, 2.714, 2.742, 2.764, 2.782, 2.809, 2.852, 2.899, 2.936, 2.961, 2.976,
+                            2.902, 2.869, 2.841, 2.811, 2.797, 2.785, 2.776, 2.761, 2.748, 2.727, 2.708, 2.689, 2.671, 2.659, 2.655, 2.654, 2.653, 2.656, 2.666, 2.678, 2.693, 2.713, 2.737, 2.756, 2.775, 2.798, 2.825, 2.871, 2.913, 2.944, 2.966, 2.979,
+                            2.911, 2.885, 2.848, 2.821, 2.804, 2.793, 2.784, 2.774, 2.759, 2.747, 2.726, 2.709, 2.692, 2.679, 2.673, 2.672, 2.671, 2.672, 2.681, 2.694, 2.712, 2.729, 2.749, 2.768, 2.789, 2.811, 2.844, 2.886, 2.928, 2.956, 2.971, 2.984,
+                            2.925, 2.893, 2.861, 2.831, 2.813, 2.802, 2.795, 2.783, 2.773, 2.759, 2.744, 2.729, 2.715, 2.701, 2.698, 2.694, 2.693, 2.694, 2.702, 2.714, 2.729, 2.747, 2.761, 2.781, 2.802, 2.828, 2.864, 2.907, 2.942, 2.967, 2.978, 2.989,
+                            2.932, 2.898, 2.871, 2.843, 2.823, 2.811, 2.802, 2.794, 2.779, 2.772, 2.757, 2.742, 2.729, 2.716, 2.705, 2.704, 2.704, 2.707, 2.715, 2.727, 2.737, 2.754, 2.769, 2.788, 2.812, 2.845, 2.878, 2.923, 2.962, 2.973, 2.979, 2.994
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.018, 3.021, 3.026, 3.052, 3.092, 3.143, 3.181, 3.202, 3.209, 3.212, 3.211, 3.209, 3.197, 3.193, 3.185, 3.184, 3.185, 3.187, 3.191, 3.202, 3.211, 3.213, 3.212, 3.203, 3.189, 3.147, 3.099, 3.051, 3.032, 3.031, 3.048, 3.054,
+                            3.019, 3.023, 3.033, 3.066, 3.123, 3.163, 3.196, 3.206, 3.212, 3.212, 3.211, 3.203, 3.193, 3.179, 3.168, 3.159, 3.159, 3.163, 3.174, 3.188, 3.203, 3.208, 3.211, 3.209, 3.195, 3.168, 3.114, 3.064, 3.035, 3.033, 3.044, 3.051,
+                            3.021, 3.028, 3.046, 3.099, 3.156, 3.192, 3.209, 3.215, 3.216, 3.213, 3.203, 3.193, 3.176, 3.159, 3.153, 3.151, 3.149, 3.152, 3.159, 3.171, 3.188, 3.201, 3.209, 3.211, 3.207, 3.189, 3.142, 3.083, 3.042, 3.038, 3.043, 3.046,
+                            3.022, 3.037, 3.065, 3.124, 3.178, 3.206, 3.215, 3.221, 3.218, 3.217, 3.198, 3.179, 3.162, 3.149, 3.138, 3.133, 3.133, 3.136, 3.145, 3.156, 3.174, 3.192, 3.206, 3.215, 3.214, 3.202, 3.159, 3.105, 3.058, 3.042, 3.043, 3.049,
+                            3.024, 3.047, 3.084, 3.151, 3.195, 3.211, 3.219, 3.223, 3.218, 3.208, 3.182, 3.164, 3.149, 3.137, 3.127, 3.119, 3.119, 3.124, 3.134, 3.144, 3.157, 3.178, 3.194, 3.213, 3.215, 3.208, 3.166, 3.124, 3.074, 3.044, 3.044, 3.049,
+                            3.023, 3.058, 3.102, 3.161, 3.201, 3.217, 3.224, 3.223, 3.217, 3.195, 3.174, 3.156, 3.137, 3.125, 3.115, 3.109, 3.109, 3.115, 3.121, 3.131, 3.146, 3.159, 3.186, 3.208, 3.213, 3.211, 3.181, 3.138, 3.084, 3.047, 3.047, 3.049,
+                            3.031, 3.063, 3.126, 3.183, 3.212, 3.224, 3.225, 3.224, 3.216, 3.191, 3.167, 3.143, 3.129, 3.115, 3.105, 3.103, 3.103, 3.107, 3.114, 3.121, 3.131, 3.148, 3.169, 3.199, 3.211, 3.209, 3.186, 3.151, 3.089, 3.051, 3.049, 3.052,
+                            3.033, 3.083, 3.141, 3.201, 3.221, 3.226, 3.226, 3.224, 3.212, 3.187, 3.159, 3.138, 3.119, 3.107, 3.101, 3.098, 3.098, 3.102, 3.107, 3.115, 3.124, 3.138, 3.161, 3.185, 3.207, 3.209, 3.197, 3.162, 3.112, 3.059, 3.056, 3.057,
+                            3.038, 3.092, 3.159, 3.212, 3.225, 3.231, 3.228, 3.224, 3.209, 3.181, 3.152, 3.129, 3.112, 3.103, 3.095, 3.092, 3.093, 3.095, 3.101, 3.108, 3.118, 3.133, 3.152, 3.179, 3.203, 3.209, 3.205, 3.174, 3.124, 3.069, 3.059, 3.058,
+                            3.049, 3.105, 3.176, 3.223, 3.229, 3.231, 3.229, 3.223, 3.206, 3.171, 3.147, 3.125, 3.109, 3.097, 3.091, 3.089, 3.088, 3.091, 3.094, 3.102, 3.111, 3.124, 3.143, 3.169, 3.196, 3.208, 3.207, 3.181, 3.132, 3.079, 3.064, 3.063,
+                            3.055, 3.123, 3.189, 3.226, 3.232, 3.232, 3.229, 3.225, 3.204, 3.169, 3.143, 3.122, 3.108, 3.095, 3.092, 3.089, 3.088, 3.088, 3.092, 3.095, 3.105, 3.117, 3.135, 3.159, 3.191, 3.208, 3.208, 3.189, 3.141, 3.084, 3.064, 3.062,
+                            3.057, 3.127, 3.198, 3.228, 3.233, 3.233, 3.229, 3.225, 3.201, 3.166, 3.139, 3.119, 3.106, 3.096, 3.093, 3.092, 3.088, 3.088, 3.089, 3.093, 3.099, 3.114, 3.129, 3.156, 3.186, 3.208, 3.208, 3.195, 3.143, 3.089, 3.065, 3.064,
+                            3.066, 3.142, 3.209, 3.232, 3.234, 3.233, 3.231, 3.226, 3.198, 3.166, 3.138, 3.117, 3.103, 3.097, 3.095, 3.095, 3.094, 3.089, 3.089, 3.092, 3.097, 3.109, 3.126, 3.155, 3.183, 3.207, 3.207, 3.198, 3.147, 3.091, 3.069, 3.065,
+                            3.072, 3.153, 3.216, 3.231, 3.234, 3.234, 3.229, 3.226, 3.194, 3.165, 3.136, 3.114, 3.101, 3.098, 3.098, 3.104, 3.098, 3.091, 3.088, 3.089, 3.093, 3.103, 3.123, 3.151, 3.181, 3.204, 3.204, 3.197, 3.156, 3.095, 3.069, 3.068,
+                            3.079, 3.159, 3.222, 3.233, 3.236, 3.235, 3.231, 3.226, 3.194, 3.165, 3.133, 3.112, 3.102, 3.099, 3.107, 3.114, 3.111, 3.097, 3.089, 3.089, 3.091, 3.099, 3.121, 3.149, 3.182, 3.202, 3.202, 3.195, 3.156, 3.096, 3.069, 3.068,
+                            3.081, 3.164, 3.226, 3.233, 3.236, 3.235, 3.233, 3.229, 3.199, 3.165, 3.137, 3.113, 3.102, 3.102, 3.111, 3.134, 3.134, 3.103, 3.091, 3.089, 3.092, 3.101, 3.119, 3.147, 3.182, 3.202, 3.202, 3.194, 3.155, 3.095, 3.069, 3.067,
+                            3.085, 3.163, 3.225, 3.236, 3.239, 3.235, 3.234, 3.231, 3.203, 3.169, 3.141, 3.115, 3.103, 3.103, 3.111, 3.134, 3.134, 3.106, 3.092, 3.091, 3.093, 3.103, 3.119, 3.149, 3.185, 3.203, 3.203, 3.193, 3.152, 3.095, 3.068, 3.066,
+                            3.083, 3.168, 3.226, 3.236, 3.241, 3.235, 3.235, 3.231, 3.205, 3.174, 3.144, 3.117, 3.107, 3.103, 3.107, 3.116, 3.109, 3.103, 3.091, 3.091, 3.095, 3.107, 3.123, 3.152, 3.188, 3.204, 3.204, 3.193, 3.151, 3.095, 3.069, 3.066,
+                            3.082, 3.171, 3.228, 3.237, 3.239, 3.235, 3.234, 3.233, 3.217, 3.184, 3.147, 3.119, 3.108, 3.104, 3.103, 3.105, 3.102, 3.095, 3.091, 3.091, 3.097, 3.111, 3.128, 3.157, 3.191, 3.204, 3.204, 3.185, 3.149, 3.094, 3.069, 3.065,
+                            3.086, 3.173, 3.226, 3.237, 3.239, 3.235, 3.234, 3.232, 3.221, 3.185, 3.155, 3.124, 3.112, 3.105, 3.102, 3.099, 3.096, 3.094, 3.092, 3.094, 3.102, 3.114, 3.133, 3.163, 3.197, 3.205, 3.204, 3.183, 3.144, 3.089, 3.068, 3.065,
+                            3.086, 3.166, 3.225, 3.239, 3.239, 3.237, 3.233, 3.231, 3.223, 3.193, 3.165, 3.135, 3.118, 3.108, 3.101, 3.098, 3.095, 3.093, 3.093, 3.099, 3.109, 3.124, 3.145, 3.174, 3.199, 3.204, 3.203, 3.181, 3.132, 3.085, 3.067, 3.062,
+                            3.086, 3.162, 3.224, 3.239, 3.241, 3.236, 3.232, 3.229, 3.224, 3.201, 3.174, 3.147, 3.128, 3.114, 3.103, 3.099, 3.096, 3.095, 3.097, 3.106, 3.116, 3.134, 3.151, 3.182, 3.201, 3.203, 3.201, 3.176, 3.125, 3.078, 3.065, 3.061,
+                            3.077, 3.162, 3.221, 3.239, 3.241, 3.234, 3.229, 3.227, 3.225, 3.207, 3.186, 3.161, 3.137, 3.122, 3.112, 3.102, 3.099, 3.098, 3.106, 3.113, 3.127, 3.139, 3.159, 3.192, 3.204, 3.205, 3.198, 3.167, 3.119, 3.073, 3.062, 3.061,
+                            3.077, 3.161, 3.216, 3.234, 3.236, 3.232, 3.225, 3.225, 3.222, 3.209, 3.194, 3.172, 3.148, 3.132, 3.121, 3.113, 3.107, 3.107, 3.112, 3.124, 3.135, 3.151, 3.175, 3.196, 3.201, 3.201, 3.191, 3.161, 3.114, 3.062, 3.058, 3.057,
+                            3.073, 3.139, 3.201, 3.227, 3.232, 3.227, 3.223, 3.219, 3.216, 3.212, 3.203, 3.181, 3.161, 3.142, 3.129, 3.121, 3.114, 3.114, 3.124, 3.134, 3.145, 3.161, 3.179, 3.196, 3.199, 3.195, 3.182, 3.145, 3.093, 3.052, 3.051, 3.052,
+                            3.066, 3.126, 3.192, 3.218, 3.224, 3.221, 3.218, 3.214, 3.214, 3.209, 3.204, 3.191, 3.174, 3.155, 3.142, 3.129, 3.127, 3.127, 3.136, 3.145, 3.157, 3.175, 3.187, 3.194, 3.196, 3.192, 3.171, 3.134, 3.082, 3.043, 3.042, 3.044,
+                            3.056, 3.114, 3.176, 3.212, 3.219, 3.219, 3.214, 3.209, 3.208, 3.206, 3.203, 3.198, 3.182, 3.171, 3.155, 3.146, 3.144, 3.144, 3.148, 3.156, 3.171, 3.181, 3.188, 3.194, 3.194, 3.187, 3.161, 3.117, 3.066, 3.037, 3.037, 3.044,
+                            3.054, 3.101, 3.162, 3.203, 3.216, 3.215, 3.211, 3.206, 3.203, 3.201, 3.199, 3.197, 3.191, 3.179, 3.171, 3.161, 3.156, 3.156, 3.161, 3.171, 3.179, 3.184, 3.189, 3.192, 3.191, 3.181, 3.142, 3.097, 3.045, 3.032, 3.033, 3.039,
+                            3.041, 3.093, 3.149, 3.194, 3.208, 3.211, 3.208, 3.202, 3.197, 3.197, 3.197, 3.195, 3.191, 3.189, 3.181, 3.176, 3.172, 3.173, 3.178, 3.181, 3.185, 3.187, 3.189, 3.191, 3.189, 3.173, 3.133, 3.085, 3.034, 3.029, 3.031, 3.038,
+                            3.032, 3.079, 3.133, 3.181, 3.197, 3.207, 3.204, 3.198, 3.193, 3.192, 3.189, 3.191, 3.189, 3.187, 3.185, 3.183, 3.183, 3.183, 3.185, 3.188, 3.187, 3.188, 3.189, 3.188, 3.184, 3.164, 3.118, 3.075, 3.031, 3.026, 3.028, 3.039,
+                            3.025, 3.051, 3.099, 3.149, 3.182, 3.193, 3.193, 3.187, 3.181, 3.178, 3.177, 3.177, 3.182, 3.183, 3.183, 3.183, 3.183, 3.184, 3.187, 3.188, 3.186, 3.184, 3.184, 3.181, 3.167, 3.139, 3.098, 3.053, 3.026, 3.024, 3.029, 3.043,
+                            3.016, 3.025, 3.081, 3.122, 3.167, 3.182, 3.185, 3.181, 3.176, 3.171, 3.169, 3.171, 3.174, 3.175, 3.178, 3.178, 3.179, 3.181, 3.185, 3.185, 3.181, 3.179, 3.177, 3.173, 3.151, 3.119, 3.076, 3.031, 3.021, 3.018, 3.024, 3.046
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.503, 1.503, 1.504, 1.515, 1.541, 1.566, 1.587, 1.599, 1.602, 1.603, 1.602, 1.599, 1.595, 1.589, 1.587, 1.586, 1.586, 1.587, 1.589, 1.594, 1.601, 1.604, 1.604, 1.601, 1.589, 1.571, 1.541, 1.517, 1.512, 1.512, 1.522, 1.526,
+                            1.501, 1.502, 1.506, 1.523, 1.557, 1.579, 1.596, 1.603, 1.603, 1.603, 1.601, 1.597, 1.591, 1.582, 1.576, 1.575, 1.574, 1.577, 1.581, 1.588, 1.595, 1.601, 1.603, 1.602, 1.597, 1.578, 1.553, 1.526, 1.512, 1.512, 1.519, 1.526,
+                            1.499, 1.503, 1.512, 1.539, 1.571, 1.593, 1.603, 1.604, 1.604, 1.602, 1.597, 1.591, 1.581, 1.573, 1.568, 1.566, 1.566, 1.568, 1.572, 1.579, 1.587, 1.594, 1.602, 1.603, 1.601, 1.589, 1.566, 1.536, 1.517, 1.516, 1.519, 1.525,
+                            1.499, 1.505, 1.521, 1.553, 1.582, 1.597, 1.604, 1.604, 1.604, 1.601, 1.592, 1.582, 1.573, 1.564, 1.561, 1.558, 1.557, 1.559, 1.564, 1.571, 1.579, 1.588, 1.597, 1.603, 1.603, 1.596, 1.576, 1.545, 1.519, 1.517, 1.518, 1.526,
+                            1.499, 1.509, 1.529, 1.565, 1.591, 1.601, 1.605, 1.604, 1.602, 1.597, 1.586, 1.573, 1.565, 1.558, 1.553, 1.551, 1.551, 1.552, 1.555, 1.563, 1.571, 1.581, 1.592, 1.601, 1.602, 1.599, 1.582, 1.556, 1.528, 1.517, 1.517, 1.526,
+                            1.501, 1.512, 1.539, 1.576, 1.595, 1.603, 1.605, 1.604, 1.601, 1.591, 1.579, 1.567, 1.559, 1.552, 1.548, 1.545, 1.546, 1.548, 1.551, 1.555, 1.563, 1.574, 1.585, 1.598, 1.602, 1.601, 1.589, 1.562, 1.535, 1.519, 1.519, 1.528,
+                            1.501, 1.517, 1.552, 1.587, 1.601, 1.605, 1.605, 1.605, 1.599, 1.588, 1.574, 1.562, 1.553, 1.548, 1.544, 1.543, 1.543, 1.545, 1.547, 1.551, 1.557, 1.567, 1.578, 1.593, 1.601, 1.601, 1.592, 1.571, 1.539, 1.521, 1.521, 1.529,
+                            1.503, 1.524, 1.561, 1.593, 1.605, 1.606, 1.605, 1.603, 1.598, 1.585, 1.569, 1.558, 1.551, 1.545, 1.542, 1.541, 1.541, 1.542, 1.545, 1.547, 1.555, 1.561, 1.573, 1.587, 1.598, 1.601, 1.596, 1.577, 1.546, 1.523, 1.523, 1.529,
+                            1.503, 1.532, 1.568, 1.597, 1.605, 1.606, 1.605, 1.603, 1.596, 1.581, 1.565, 1.555, 1.548, 1.544, 1.541, 1.539, 1.541, 1.541, 1.543, 1.546, 1.549, 1.558, 1.568, 1.583, 1.595, 1.601, 1.599, 1.582, 1.555, 1.525, 1.525, 1.531,
+                            1.508, 1.539, 1.575, 1.601, 1.605, 1.606, 1.605, 1.602, 1.593, 1.577, 1.563, 1.552, 1.546, 1.543, 1.541, 1.539, 1.539, 1.541, 1.542, 1.544, 1.548, 1.553, 1.564, 1.579, 1.592, 1.599, 1.599, 1.585, 1.559, 1.532, 1.531, 1.531,
+                            1.511, 1.544, 1.581, 1.603, 1.606, 1.606, 1.604, 1.603, 1.591, 1.574, 1.561, 1.549, 1.545, 1.542, 1.541, 1.541, 1.541, 1.541, 1.542, 1.543, 1.545, 1.551, 1.561, 1.573, 1.591, 1.599, 1.599, 1.588, 1.563, 1.535, 1.531, 1.531,
+                            1.515, 1.548, 1.589, 1.605, 1.607, 1.607, 1.604, 1.602, 1.591, 1.573, 1.559, 1.549, 1.543, 1.542, 1.541, 1.542, 1.542, 1.542, 1.541, 1.542, 1.543, 1.549, 1.558, 1.571, 1.588, 1.599, 1.599, 1.591, 1.566, 1.537, 1.532, 1.531,
+                            1.517, 1.558, 1.593, 1.606, 1.607, 1.607, 1.605, 1.602, 1.589, 1.572, 1.557, 1.548, 1.543, 1.543, 1.542, 1.544, 1.543, 1.543, 1.541, 1.541, 1.542, 1.546, 1.554, 1.569, 1.585, 1.599, 1.599, 1.593, 1.568, 1.538, 1.533, 1.531,
+                            1.521, 1.563, 1.596, 1.607, 1.608, 1.607, 1.606, 1.603, 1.589, 1.572, 1.557, 1.548, 1.543, 1.543, 1.544, 1.549, 1.546, 1.544, 1.541, 1.541, 1.542, 1.545, 1.553, 1.568, 1.585, 1.598, 1.598, 1.594, 1.571, 1.541, 1.534, 1.531,
+                            1.521, 1.566, 1.599, 1.607, 1.608, 1.607, 1.605, 1.603, 1.591, 1.571, 1.556, 1.547, 1.544, 1.544, 1.551, 1.554, 1.552, 1.546, 1.541, 1.541, 1.541, 1.544, 1.553, 1.567, 1.585, 1.597, 1.598, 1.595, 1.571, 1.541, 1.534, 1.531,
+                            1.523, 1.568, 1.601, 1.607, 1.608, 1.607, 1.606, 1.604, 1.591, 1.572, 1.557, 1.547, 1.545, 1.545, 1.552, 1.566, 1.566, 1.551, 1.542, 1.541, 1.541, 1.544, 1.553, 1.567, 1.586, 1.596, 1.596, 1.593, 1.571, 1.541, 1.533, 1.531,
+                            1.524, 1.569, 1.602, 1.607, 1.608, 1.607, 1.606, 1.604, 1.591, 1.573, 1.559, 1.548, 1.545, 1.546, 1.552, 1.565, 1.565, 1.551, 1.542, 1.541, 1.541, 1.545, 1.553, 1.568, 1.586, 1.597, 1.597, 1.593, 1.571, 1.541, 1.532, 1.532,
+                            1.526, 1.571, 1.602, 1.607, 1.608, 1.606, 1.605, 1.604, 1.593, 1.575, 1.559, 1.549, 1.546, 1.546, 1.549, 1.552, 1.552, 1.546, 1.542, 1.541, 1.542, 1.546, 1.555, 1.569, 1.587, 1.597, 1.597, 1.591, 1.569, 1.539, 1.532, 1.531,
+                            1.526, 1.571, 1.601, 1.608, 1.609, 1.605, 1.605, 1.603, 1.597, 1.579, 1.562, 1.551, 1.546, 1.545, 1.545, 1.549, 1.546, 1.543, 1.542, 1.541, 1.542, 1.547, 1.557, 1.573, 1.588, 1.597, 1.597, 1.589, 1.566, 1.537, 1.531, 1.529,
+                            1.526, 1.569, 1.602, 1.609, 1.609, 1.606, 1.605, 1.604, 1.598, 1.582, 1.567, 1.553, 1.547, 1.545, 1.544, 1.544, 1.544, 1.542, 1.542, 1.542, 1.544, 1.552, 1.559, 1.576, 1.591, 1.597, 1.597, 1.588, 1.563, 1.535, 1.531, 1.529,
+                            1.523, 1.567, 1.601, 1.609, 1.609, 1.606, 1.605, 1.603, 1.599, 1.587, 1.571, 1.558, 1.549, 1.545, 1.544, 1.543, 1.543, 1.542, 1.542, 1.544, 1.548, 1.555, 1.566, 1.581, 1.593, 1.597, 1.597, 1.586, 1.558, 1.534, 1.529, 1.529,
+                            1.523, 1.564, 1.599, 1.609, 1.609, 1.605, 1.604, 1.603, 1.601, 1.592, 1.576, 1.564, 1.553, 1.547, 1.544, 1.543, 1.542, 1.542, 1.544, 1.548, 1.551, 1.561, 1.572, 1.585, 1.594, 1.596, 1.595, 1.581, 1.555, 1.528, 1.527, 1.528,
+                            1.522, 1.561, 1.595, 1.608, 1.608, 1.604, 1.602, 1.601, 1.601, 1.595, 1.582, 1.569, 1.559, 1.552, 1.547, 1.545, 1.543, 1.544, 1.546, 1.551, 1.556, 1.563, 1.576, 1.589, 1.595, 1.596, 1.593, 1.576, 1.551, 1.524, 1.524, 1.528,
+                            1.519, 1.559, 1.591, 1.605, 1.606, 1.603, 1.601, 1.599, 1.601, 1.597, 1.587, 1.576, 1.565, 1.558, 1.552, 1.549, 1.546, 1.547, 1.552, 1.556, 1.561, 1.571, 1.582, 1.593, 1.596, 1.596, 1.591, 1.569, 1.546, 1.521, 1.521, 1.527,
+                            1.516, 1.553, 1.589, 1.602, 1.604, 1.602, 1.599, 1.598, 1.599, 1.598, 1.594, 1.583, 1.572, 1.564, 1.559, 1.553, 1.552, 1.553, 1.556, 1.561, 1.567, 1.578, 1.588, 1.594, 1.596, 1.594, 1.588, 1.567, 1.539, 1.517, 1.517, 1.525,
+                            1.511, 1.548, 1.581, 1.599, 1.602, 1.602, 1.598, 1.597, 1.597, 1.597, 1.595, 1.589, 1.581, 1.571, 1.564, 1.559, 1.559, 1.558, 1.561, 1.567, 1.575, 1.583, 1.591, 1.593, 1.594, 1.591, 1.581, 1.557, 1.529, 1.514, 1.514, 1.521,
+                            1.508, 1.541, 1.576, 1.596, 1.601, 1.601, 1.597, 1.595, 1.594, 1.595, 1.595, 1.592, 1.585, 1.579, 1.571, 1.566, 1.566, 1.566, 1.568, 1.575, 1.582, 1.589, 1.592, 1.593, 1.593, 1.589, 1.575, 1.553, 1.523, 1.511, 1.511, 1.517,
+                            1.505, 1.535, 1.566, 1.591, 1.599, 1.598, 1.596, 1.594, 1.592, 1.592, 1.593, 1.592, 1.589, 1.585, 1.579, 1.575, 1.574, 1.574, 1.577, 1.582, 1.587, 1.591, 1.592, 1.593, 1.592, 1.585, 1.568, 1.541, 1.516, 1.509, 1.509, 1.517,
+                            1.501, 1.528, 1.559, 1.585, 1.595, 1.597, 1.595, 1.593, 1.589, 1.588, 1.591, 1.591, 1.591, 1.589, 1.586, 1.583, 1.582, 1.582, 1.585, 1.588, 1.589, 1.591, 1.592, 1.593, 1.592, 1.582, 1.561, 1.536, 1.512, 1.509, 1.511, 1.517,
+                            1.496, 1.521, 1.549, 1.576, 1.588, 1.594, 1.593, 1.589, 1.586, 1.585, 1.586, 1.588, 1.589, 1.588, 1.588, 1.587, 1.587, 1.587, 1.589, 1.589, 1.591, 1.591, 1.592, 1.592, 1.591, 1.575, 1.555, 1.527, 1.508, 1.507, 1.511, 1.519,
+                            1.495, 1.505, 1.536, 1.563, 1.581, 1.587, 1.588, 1.584, 1.582, 1.578, 1.578, 1.581, 1.583, 1.584, 1.586, 1.587, 1.587, 1.587, 1.588, 1.589, 1.589, 1.591, 1.591, 1.591, 1.584, 1.566, 1.544, 1.518, 1.505, 1.505, 1.509, 1.519,
+                            1.493, 1.496, 1.522, 1.547, 1.569, 1.581, 1.582, 1.581, 1.577, 1.575, 1.573, 1.575, 1.579, 1.581, 1.583, 1.584, 1.584, 1.585, 1.587, 1.587, 1.588, 1.588, 1.588, 1.585, 1.573, 1.556, 1.532, 1.511, 1.504, 1.504, 1.508, 1.523
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    4.461, 4.088, 3.793, 3.651, 3.557, 3.439, 3.248, 2.999, 2.751, 2.527, 2.341, 2.191, 2.069, 1.956, 1.907, 1.907, 1.907, 1.908, 1.946, 2.056, 2.179, 2.328, 2.517, 2.747, 2.998, 3.219, 3.359, 3.436, 3.494, 3.621, 3.906, 4.251,
+                    4.297, 3.982, 3.747, 3.634, 3.531, 3.373, 3.136, 2.863, 2.608, 2.386, 2.209, 2.075, 1.957, 1.873, 1.817, 1.789, 1.789, 1.813, 1.865, 1.947, 2.066, 2.198, 2.378, 2.605, 2.872, 3.132, 3.322, 3.431, 3.485, 3.577, 3.802, 4.079,
+                    4.152, 3.905, 3.717, 3.623, 3.499, 3.296, 3.022, 2.735, 2.478, 2.265, 2.094, 1.957, 1.849, 1.763, 1.709, 1.679, 1.679, 1.703, 1.753, 1.837, 1.947, 2.081, 2.253, 2.472, 2.742, 3.032, 3.271, 3.414, 3.479, 3.545, 3.719, 3.937,
+                    4.039, 3.835, 3.688, 3.596, 3.442, 3.196, 2.899, 2.609, 2.356, 2.153, 1.987, 1.849, 1.748, 1.659, 1.605, 1.577, 1.577, 1.599, 1.649, 1.734, 1.837, 1.973, 2.139, 2.348, 2.612, 2.911, 3.192, 3.379, 3.467, 3.516, 3.649, 3.815,
+                    3.952, 3.784, 3.669, 3.562, 3.369, 3.088, 2.778, 2.491, 2.246, 2.049, 1.888, 1.748, 1.657, 1.561, 1.509, 1.481, 1.481, 1.504, 1.552, 1.642, 1.734, 1.869, 2.033, 2.233, 2.489, 2.792, 3.105, 3.331, 3.445, 3.493, 3.591, 3.721,
+                    3.883, 3.741, 3.648, 3.519, 3.287, 2.977, 2.665, 2.382, 2.148, 1.957, 1.796, 1.659, 1.561, 1.474, 1.422, 1.396, 1.396, 1.415, 1.465, 1.552, 1.643, 1.776, 1.936, 2.131, 2.375, 2.678, 3.004, 3.275, 3.416, 3.469, 3.541, 3.643,
+                    3.829, 3.716, 3.617, 3.466, 3.202, 2.876, 2.558, 2.282, 2.059, 1.872, 1.713, 1.577, 1.474, 1.399, 1.345, 1.319, 1.319, 1.338, 1.389, 1.465, 1.559, 1.689, 1.849, 2.042, 2.275, 2.568, 2.903, 3.204, 3.383, 3.446, 3.496, 3.579,
+                    3.793, 3.685, 3.589, 3.411, 3.119, 2.781, 2.466, 2.199, 1.983, 1.798, 1.639, 1.505, 1.399, 1.339, 1.276, 1.253, 1.253, 1.271, 1.327, 1.389, 1.487, 1.612, 1.769, 1.961, 2.189, 2.471, 2.806, 3.133, 3.342, 3.425, 3.459, 3.527,
+                    3.763, 3.666, 3.561, 3.357, 3.042, 2.698, 2.384, 2.129, 1.918, 1.734, 1.575, 1.443, 1.339, 1.276, 1.217, 1.194, 1.194, 1.214, 1.271, 1.327, 1.423, 1.546, 1.702, 1.891, 2.112, 2.386, 2.718, 3.061, 3.301, 3.402, 3.433, 3.486,
+                    3.745, 3.647, 3.529, 3.302, 2.971, 2.627, 2.318, 2.067, 1.859, 1.677, 1.521, 1.389, 1.287, 1.217, 1.171, 1.145, 1.145, 1.165, 1.214, 1.276, 1.369, 1.491, 1.643, 1.831, 2.048, 2.313, 2.644, 2.995, 3.262, 3.381, 3.412, 3.453,
+                    3.731, 3.635, 3.503, 3.249, 2.911, 2.566, 2.259, 2.017, 1.811, 1.629, 1.475, 1.347, 1.246, 1.171, 1.138, 1.103, 1.103, 1.129, 1.165, 1.231, 1.322, 1.443, 1.595, 1.779, 1.993, 2.251, 2.576, 2.936, 3.223, 3.359, 3.392, 3.425,
+                    3.721, 3.625, 3.481, 3.208, 2.861, 2.515, 2.213, 1.976, 1.773, 1.593, 1.439, 1.313, 1.213, 1.138, 1.103, 1.071, 1.071, 1.101, 1.129, 1.194, 1.286, 1.405, 1.555, 1.736, 1.949, 2.202, 2.521, 2.886, 3.189, 3.338, 3.375, 3.406,
+                    3.716, 3.616, 3.458, 3.171, 2.819, 2.472, 2.176, 1.942, 1.741, 1.563, 1.411, 1.285, 1.186, 1.112, 1.071, 1.051, 1.049, 1.069, 1.103, 1.165, 1.256, 1.376, 1.523, 1.702, 1.913, 2.163, 2.477, 2.843, 3.155, 3.318, 3.358, 3.389,
+                    3.712, 3.609, 3.439, 3.142, 2.787, 2.443, 2.147, 1.918, 1.721, 1.541, 1.391, 1.266, 1.167, 1.094, 1.051, 1.035, 1.035, 1.049, 1.085, 1.145, 1.236, 1.355, 1.499, 1.676, 1.886, 2.136, 2.449, 2.814, 3.135, 3.307, 3.351, 3.378,
+                    3.709, 3.604, 3.422, 3.123, 2.768, 2.419, 2.129, 1.903, 1.706, 1.527, 1.377, 1.253, 1.155, 1.083, 1.035, 1.023, 1.023, 1.035, 1.074, 1.134, 1.224, 1.341, 1.484, 1.661, 1.868, 2.117, 2.429, 2.797, 3.122, 3.301, 3.346, 3.374,
+                    3.711, 3.597, 3.412, 3.114, 2.758, 2.409, 2.119, 1.895, 1.701, 1.523, 1.373, 1.251, 1.153, 1.081, 1.033, 1.001, 1.001, 1.032, 1.073, 1.133, 1.222, 1.338, 1.479, 1.655, 1.861, 2.107, 2.418, 2.787, 3.115, 3.297, 3.343, 3.373,
+                    3.713, 3.597, 3.412, 3.113, 2.758, 2.409, 2.119, 1.893, 1.698, 1.523, 1.373, 1.251, 1.153, 1.081, 1.034, 1.011, 1.011, 1.032, 1.074, 1.134, 1.222, 1.338, 1.479, 1.655, 1.861, 2.107, 2.418, 2.787, 3.116, 3.294, 3.341, 3.371,
+                    3.721, 3.599, 3.414, 3.116, 2.763, 2.418, 2.124, 1.895, 1.704, 1.531, 1.382, 1.259, 1.162, 1.091, 1.048, 1.034, 1.032, 1.046, 1.083, 1.145, 1.232, 1.348, 1.491, 1.664, 1.869, 2.115, 2.428, 2.798, 3.123, 3.294, 3.339, 3.372,
+                    3.727, 3.604, 3.421, 3.132, 2.784, 2.438, 2.141, 1.908, 1.716, 1.547, 1.399, 1.276, 1.178, 1.107, 1.069, 1.048, 1.046, 1.067, 1.101, 1.162, 1.249, 1.366, 1.509, 1.684, 1.886, 2.134, 2.449, 2.821, 3.135, 3.299, 3.341, 3.375,
+                    3.739, 3.613, 3.431, 3.154, 2.813, 2.468, 2.166, 1.931, 1.739, 1.569, 1.424, 1.302, 1.203, 1.129, 1.098, 1.069, 1.069, 1.096, 1.123, 1.185, 1.274, 1.391, 1.536, 1.709, 1.914, 2.162, 2.481, 2.851, 3.156, 3.311, 3.342, 3.378,
+                    3.751, 3.626, 3.449, 3.186, 2.855, 2.509, 2.201, 1.961, 1.768, 1.601, 1.454, 1.333, 1.235, 1.159, 1.129, 1.098, 1.098, 1.123, 1.152, 1.216, 1.307, 1.424, 1.569, 1.744, 1.947, 2.202, 2.526, 2.891, 3.182, 3.322, 3.351, 3.387,
+                    3.772, 3.641, 3.473, 3.221, 2.902, 2.559, 2.248, 1.999, 1.804, 1.639, 1.496, 1.373, 1.274, 1.201, 1.159, 1.133, 1.133, 1.152, 1.191, 1.254, 1.347, 1.466, 1.611, 1.785, 1.989, 2.253, 2.582, 2.939, 3.209, 3.334, 3.361, 3.402,
+                    3.797, 3.663, 3.496, 3.263, 2.959, 2.624, 2.308, 2.049, 1.847, 1.684, 1.542, 1.422, 1.321, 1.252, 1.201, 1.175, 1.175, 1.191, 1.239, 1.298, 1.394, 1.516, 1.658, 1.831, 2.041, 2.313, 2.651, 2.998, 3.244, 3.351, 3.375, 3.422,
+                    3.831, 3.686, 3.523, 3.307, 3.023, 2.698, 2.379, 2.112, 1.902, 1.737, 1.596, 1.476, 1.378, 1.315, 1.252, 1.227, 1.227, 1.239, 1.296, 1.355, 1.451, 1.572, 1.715, 1.888, 2.103, 2.386, 2.731, 3.063, 3.279, 3.367, 3.393, 3.456,
+                    3.871, 3.714, 3.551, 3.355, 3.091, 2.781, 2.465, 2.186, 1.965, 1.795, 1.654, 1.538, 1.442, 1.378, 1.318, 1.291, 1.291, 1.304, 1.355, 1.424, 1.515, 1.634, 1.778, 1.952, 2.178, 2.479, 2.821, 3.129, 3.314, 3.381, 3.419, 3.491,
+                    3.925, 3.749, 3.582, 3.401, 3.156, 2.866, 2.559, 2.274, 2.039, 1.859, 1.718, 1.604, 1.513, 1.442, 1.389, 1.363, 1.363, 1.379, 1.424, 1.501, 1.586, 1.702, 1.847, 2.028, 2.269, 2.579, 2.913, 3.193, 3.343, 3.396, 3.447, 3.539,
+                    3.994, 3.794, 3.619, 3.442, 3.231, 2.961, 2.662, 2.375, 2.129, 1.938, 1.789, 1.675, 1.591, 1.513, 1.465, 1.439, 1.439, 1.457, 1.501, 1.582, 1.661, 1.777, 1.925, 2.118, 2.375, 2.691, 3.008, 3.251, 3.371, 3.414, 3.479, 3.598,
+                    4.082, 3.845, 3.656, 3.489, 3.298, 3.053, 2.771, 2.485, 2.232, 2.028, 1.871, 1.751, 1.672, 1.591, 1.544, 1.521, 1.521, 1.539, 1.582, 1.661, 1.741, 1.859, 2.014, 2.224, 2.495, 2.806, 3.098, 3.301, 3.392, 3.431, 3.518, 3.677,
+                    4.196, 3.911, 3.698, 3.534, 3.363, 3.146, 2.881, 2.604, 2.348, 2.132, 1.964, 1.836, 1.751, 1.672, 1.628, 1.606, 1.606, 1.624, 1.665, 1.741, 1.827, 1.951, 2.121, 2.344, 2.624, 2.923, 3.177, 3.336, 3.405, 3.447, 3.567, 3.776,
+                    4.341, 4.002, 3.744, 3.575, 3.415, 3.229, 2.989, 2.729, 2.475, 2.251, 2.071, 1.936, 1.836, 1.759, 1.713, 1.693, 1.693, 1.711, 1.753, 1.827, 1.925, 2.058, 2.243, 2.481, 2.758, 3.027, 3.238, 3.361, 3.409, 3.466, 3.637, 3.896,
+                    4.516, 4.123, 3.804, 3.621, 3.468, 3.308, 3.096, 2.855, 2.609, 2.385, 2.194, 2.045, 1.936, 1.857, 1.807, 1.784, 1.784, 1.803, 1.852, 1.925, 2.033, 2.183, 2.382, 2.623, 2.886, 3.121, 3.284, 3.372, 3.413, 3.494, 3.727, 4.048,
+                    4.716, 4.264, 3.875, 3.674, 3.523, 3.376, 3.189, 2.966, 2.733, 2.511, 2.315, 2.158, 2.039, 1.936, 1.875, 1.872, 1.872, 1.872, 1.925, 2.028, 2.148, 2.308, 2.513, 2.751, 2.994, 3.191, 3.319, 3.384, 3.427, 3.541, 3.838, 4.221
+                ],
+                "sigma": 0.00152,
+                "sigma_Cb": 0.00172
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2868,
+                        "ccm":
+                        [
+                            1.58923, -0.36649, -0.22273,
+                            -0.43591, 1.84858, -0.41268,
+                            0.02948, -0.77666, 1.74718
+                        ]
+                    },
+                    {
+                        "ct": 2965,
+                        "ccm":
+                        [
+                            1.73397, -0.42794, -0.30603,
+                            -0.36504, 1.72431, -0.35926,
+                            0.12765, -1.10933, 1.98168
+                        ]
+                    },
+                    {
+                        "ct": 3603,
+                        "ccm":
+                        [
+                            1.61787, -0.42704, -0.19084,
+                            -0.37819, 1.74588, -0.36769,
+                            0.00961, -0.59807, 1.58847
+                        ]
+                    },
+                    {
+                        "ct": 4620,
+                        "ccm":
+                        [
+                            1.55581, -0.35422, -0.20158,
+                            -0.31805, 1.79309, -0.47505,
+                            -0.01256, -0.54489, 1.55746
+                        ]
+                    },
+                    {
+                        "ct": 5901,
+                        "ccm":
+                        [
+                            1.64439, -0.48855, -0.15585,
+                            -0.29149, 1.67122, -0.37972,
+                            -0.03111, -0.44052, 1.47163
+                        ]
+                    },
+                    {
+                        "ct": 7610,
+                        "ccm":
+                        [
+                            1.48667, -0.26072, -0.22595,
+                            -0.21815, 1.86724, -0.64909,
+                            -0.00985, -0.64485, 1.65471
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.af":
+            {
+                "ranges":
+                {
+                    "normal":
+                    {
+                        "min": 0.0,
+                        "max": 12.0,
+                        "default": 1.0
+                    },
+                    "macro":
+                    {
+                        "min": 4.0,
+                        "max": 32.0,
+                        "default": 6.0
+                    }
+                },
+                "speeds":
+                {
+                    "normal":
+                    {
+                        "step_coarse": 2.0,
+                        "step_fine": 0.5,
+                        "contrast_ratio": 0.75,
+                        "pdaf_gain": -0.03,
+                        "pdaf_squelch": 0.2,
+                        "max_slew": 4.0,
+                        "pdaf_frames": 20,
+                        "dropout_frames": 6,
+                        "step_frames": 4
+                    },
+                    "fast":
+                    {
+                        "step_coarse": 2.0,
+                        "step_fine": 0.5,
+                        "contrast_ratio": 0.75,
+                        "pdaf_gain": -0.05,
+                        "pdaf_squelch": 0.2,
+                        "max_slew": 5.0,
+                        "pdaf_frames": 16,
+                        "dropout_frames": 6,
+                        "step_frames": 4
+                    }
+                },
+                "conf_epsilon": 8,
+                "conf_thresh": 12,
+                "conf_clip": 512,
+                "skip_frames": 5,
+                "map": [ 0.0, 420, 35.0, 920 ]
+            }
+        },
+        {
+            "rpi.cac":
+            {
+                "strength": 1.0,
+                "lut_rx":
+                [
+                    -0.11, -0.11, -0.17, -0.11, -0.0, 0.08, 0.13, 0.1, 0.1,
+                    -0.07, -0.17, -0.16, -0.08, -0.02, 0.06, 0.15, 0.15, 0.07,
+                    -0.11, -0.21, -0.17, -0.07, -0.02, 0.03, 0.14, 0.17, 0.14,
+                    -0.19, -0.22, -0.16, -0.07, -0.01, 0.03, 0.12, 0.19, 0.21,
+                    -0.19, -0.23, -0.16, -0.06, -0.01, 0.04, 0.13, 0.19, 0.24,
+                    -0.18, -0.22, -0.17, -0.05, -0.01, 0.05, 0.15, 0.2, 0.21,
+                    -0.14, -0.19, -0.17, -0.06, 0.0, 0.07, 0.15, 0.18, 0.15,
+                    -0.09, -0.14, -0.17, -0.08, 0.0, 0.09, 0.15, 0.14, 0.06,
+                    -0.09, -0.08, -0.15, -0.12, -0.0, 0.12, 0.16, 0.07, 0.06
+                ],
+                "lut_ry":
+                [
+                    -0.11, -0.11, -0.21, -0.21, -0.19, -0.21, -0.19, -0.11, 0.11,
+                    -0.02, -0.1, -0.14, -0.14, -0.13, -0.14, -0.15, -0.11, 0.03,
+                    -0.03, -0.09, -0.12, -0.12, -0.12, -0.11, -0.12, -0.1, -0.02,
+                    -0.05, -0.07, -0.1, -0.11, -0.11, -0.09, -0.08, -0.07, -0.03,
+                    -0.03, -0.02, -0.04, -0.05, -0.05, -0.05, -0.02, -0.01, -0.02,
+                    0.01, 0.03, 0.0, -0.02, -0.02, -0.01, 0.02, 0.03, 0.01,
+                    0.01, 0.06, 0.06, 0.0, -0.01, 0.02, 0.06, 0.06, 0.01,
+                    -0.0, 0.08, 0.12, 0.08, 0.05, 0.08, 0.1, 0.08, -0.0,
+                    0.11, 0.09, 0.19, 0.19, 0.15, 0.19, 0.18, 0.12, 0.11
+                ],
+                "lut_bx":
+                [
+                    -0.3, -0.28, -0.34, -0.19, -0.01, 0.13, 0.27, 0.21, 0.2,
+                    -0.24, -0.38, -0.38, -0.24, -0.02, 0.19, 0.31, 0.34, 0.2,
+                    -0.4, -0.47, -0.44, -0.26, -0.03, 0.21, 0.35, 0.39, 0.38,
+                    -0.52, -0.49, -0.46, -0.27, -0.02, 0.22, 0.38, 0.46, 0.54,
+                    -0.56, -0.51, -0.44, -0.27, -0.02, 0.23, 0.39, 0.47, 0.64,
+                    -0.52, -0.49, -0.43, -0.27, -0.02, 0.21, 0.39, 0.45, 0.59,
+                    -0.39, -0.41, -0.39, -0.26, -0.02, 0.2, 0.37, 0.39, 0.47,
+                    -0.2, -0.34, -0.36, -0.23, -0.03, 0.18, 0.33, 0.28, 0.19,
+                    -0.2, -0.21, -0.32, -0.18, -0.04, 0.14, 0.28, 0.17, 0.2
+                ],
+                "lut_by":
+                [
+                    -0.25, -0.23, -0.31, -0.36, -0.41, -0.36, -0.32, -0.19, -0.2,
+                    -0.09, -0.18, -0.27, -0.32, -0.35, -0.31, -0.23, -0.17, 0.01,
+                    -0.13, -0.14, -0.19, -0.2, -0.2, -0.21, -0.17, -0.12, -0.04,
+                    -0.1, -0.06, -0.06, -0.07, -0.05, -0.05, -0.05, -0.04, -0.07,
+                    -0.03, 0.05, 0.06, 0.07, 0.07, 0.08, 0.06, 0.03, -0.05,
+                    0.03, 0.12, 0.18, 0.19, 0.19, 0.2, 0.17, 0.11, -0.03,
+                    0.04, 0.22, 0.3, 0.37, 0.42, 0.37, 0.3, 0.21, -0.02,
+                    0.05, 0.27, 0.39, 0.5, 0.57, 0.51, 0.41, 0.25, -0.09,
+                    0.25, 0.33, 0.52, 0.65, 0.8, 0.72, 0.56, 0.33, -0.25
+                ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "power_min": 0.7,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "power_min": 0.7,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/imx708_wide_noir.json b/src/ipa/rpi/pisp/data/imx708_wide_noir.json
new file mode 100644
index 000000000..75d1149b6
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/imx708_wide_noir.json
@@ -0,0 +1,1148 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 41985,
+                "reference_gain": 1.12,
+                "reference_aperture": 1.0,
+                "reference_lux": 810,
+                "reference_Y": 13859
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 2.9
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 206,
+                "slope": 0.00324
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "bayes": 0
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.65,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.717, 1.712, 1.703, 1.692, 1.674, 1.653, 1.638, 1.624, 1.613, 1.601, 1.589, 1.579, 1.575, 1.573, 1.571, 1.571, 1.571, 1.571, 1.572, 1.577, 1.583, 1.593, 1.605, 1.618, 1.636, 1.653, 1.677, 1.699, 1.715, 1.722, 1.731, 1.733,
+                            1.714, 1.706, 1.696, 1.678, 1.658, 1.639, 1.627, 1.614, 1.602, 1.591, 1.579, 1.572, 1.569, 1.566, 1.565, 1.564, 1.564, 1.565, 1.567, 1.571, 1.578, 1.585, 1.595, 1.607, 1.622, 1.641, 1.661, 1.685, 1.706, 1.717, 1.724, 1.732,
+                            1.708, 1.698, 1.688, 1.667, 1.647, 1.629, 1.619, 1.606, 1.593, 1.581, 1.572, 1.565, 1.561, 1.559, 1.559, 1.559, 1.559, 1.561, 1.562, 1.566, 1.571, 1.577, 1.587, 1.598, 1.612, 1.629, 1.649, 1.674, 1.697, 1.713, 1.721, 1.728,
+                            1.706, 1.695, 1.681, 1.655, 1.636, 1.622, 1.613, 1.597, 1.585, 1.572, 1.564, 1.559, 1.558, 1.556, 1.555, 1.555, 1.556, 1.556, 1.558, 1.561, 1.566, 1.571, 1.578, 1.591, 1.605, 1.619, 1.638, 1.662, 1.691, 1.708, 1.719, 1.726,
+                            1.706, 1.692, 1.675, 1.649, 1.629, 1.615, 1.607, 1.592, 1.575, 1.565, 1.559, 1.554, 1.552, 1.551, 1.551, 1.551, 1.551, 1.552, 1.554, 1.557, 1.561, 1.566, 1.573, 1.582, 1.596, 1.611, 1.627, 1.652, 1.681, 1.705, 1.717, 1.724,
+                            1.703, 1.686, 1.664, 1.639, 1.625, 1.612, 1.599, 1.585, 1.569, 1.559, 1.554, 1.549, 1.548, 1.548, 1.546, 1.546, 1.546, 1.547, 1.549, 1.553, 1.557, 1.563, 1.569, 1.576, 1.591, 1.603, 1.621, 1.644, 1.674, 1.698, 1.714, 1.724,
+                            1.702, 1.681, 1.659, 1.635, 1.621, 1.607, 1.594, 1.579, 1.565, 1.554, 1.549, 1.546, 1.544, 1.543, 1.543, 1.542, 1.543, 1.543, 1.544, 1.549, 1.553, 1.558, 1.564, 1.572, 1.584, 1.599, 1.614, 1.639, 1.667, 1.695, 1.712, 1.724,
+                            1.697, 1.678, 1.655, 1.631, 1.616, 1.602, 1.589, 1.575, 1.559, 1.551, 1.545, 1.543, 1.542, 1.542, 1.541, 1.539, 1.539, 1.539, 1.542, 1.544, 1.551, 1.555, 1.562, 1.571, 1.579, 1.594, 1.611, 1.631, 1.661, 1.691, 1.712, 1.724,
+                            1.695, 1.674, 1.651, 1.629, 1.615, 1.599, 1.584, 1.568, 1.554, 1.545, 1.542, 1.541, 1.539, 1.539, 1.538, 1.538, 1.538, 1.539, 1.539, 1.543, 1.548, 1.554, 1.559, 1.568, 1.576, 1.592, 1.608, 1.629, 1.655, 1.689, 1.709, 1.723,
+                            1.691, 1.671, 1.648, 1.627, 1.613, 1.597, 1.581, 1.564, 1.551, 1.543, 1.539, 1.538, 1.538, 1.537, 1.536, 1.535, 1.536, 1.538, 1.539, 1.542, 1.546, 1.551, 1.558, 1.564, 1.575, 1.588, 1.604, 1.627, 1.654, 1.686, 1.709, 1.724,
+                            1.689, 1.667, 1.643, 1.626, 1.612, 1.594, 1.579, 1.559, 1.549, 1.541, 1.536, 1.535, 1.535, 1.535, 1.534, 1.533, 1.534, 1.536, 1.538, 1.541, 1.545, 1.549, 1.555, 1.563, 1.573, 1.585, 1.602, 1.624, 1.651, 1.683, 1.709, 1.725,
+                            1.686, 1.665, 1.641, 1.623, 1.609, 1.594, 1.576, 1.559, 1.546, 1.538, 1.535, 1.534, 1.533, 1.532, 1.531, 1.531, 1.532, 1.534, 1.537, 1.539, 1.544, 1.549, 1.554, 1.562, 1.572, 1.585, 1.601, 1.622, 1.651, 1.682, 1.711, 1.726,
+                            1.686, 1.661, 1.639, 1.623, 1.609, 1.592, 1.574, 1.557, 1.545, 1.537, 1.534, 1.533, 1.532, 1.531, 1.529, 1.528, 1.529, 1.532, 1.537, 1.539, 1.542, 1.548, 1.553, 1.562, 1.571, 1.584, 1.601, 1.621, 1.649, 1.682, 1.711, 1.726,
+                            1.685, 1.661, 1.638, 1.624, 1.609, 1.592, 1.574, 1.557, 1.544, 1.536, 1.533, 1.532, 1.531, 1.529, 1.527, 1.522, 1.526, 1.531, 1.536, 1.539, 1.542, 1.547, 1.553, 1.562, 1.571, 1.583, 1.601, 1.621, 1.648, 1.682, 1.711, 1.726,
+                            1.684, 1.658, 1.638, 1.624, 1.611, 1.592, 1.573, 1.556, 1.543, 1.536, 1.532, 1.531, 1.529, 1.528, 1.522, 1.517, 1.519, 1.527, 1.535, 1.539, 1.541, 1.547, 1.553, 1.562, 1.571, 1.583, 1.601, 1.622, 1.647, 1.681, 1.711, 1.727,
+                            1.681, 1.658, 1.641, 1.624, 1.611, 1.593, 1.573, 1.555, 1.541, 1.535, 1.532, 1.529, 1.529, 1.527, 1.517, 1.506, 1.506, 1.522, 1.534, 1.538, 1.541, 1.546, 1.552, 1.562, 1.569, 1.583, 1.601, 1.622, 1.646, 1.679, 1.709, 1.728,
+                            1.679, 1.656, 1.639, 1.624, 1.611, 1.595, 1.575, 1.556, 1.541, 1.534, 1.531, 1.529, 1.529, 1.527, 1.517, 1.507, 1.507, 1.522, 1.533, 1.538, 1.539, 1.546, 1.552, 1.561, 1.569, 1.584, 1.601, 1.622, 1.647, 1.681, 1.709, 1.726,
+                            1.678, 1.656, 1.638, 1.625, 1.612, 1.597, 1.577, 1.557, 1.542, 1.534, 1.529, 1.529, 1.528, 1.527, 1.522, 1.516, 1.519, 1.525, 1.533, 1.537, 1.539, 1.545, 1.552, 1.561, 1.571, 1.584, 1.601, 1.623, 1.649, 1.681, 1.709, 1.726,
+                            1.679, 1.654, 1.639, 1.626, 1.613, 1.598, 1.578, 1.558, 1.543, 1.534, 1.529, 1.529, 1.529, 1.528, 1.527, 1.522, 1.525, 1.528, 1.533, 1.536, 1.539, 1.546, 1.553, 1.561, 1.571, 1.586, 1.602, 1.623, 1.651, 1.683, 1.712, 1.726,
+                            1.677, 1.655, 1.641, 1.628, 1.615, 1.599, 1.581, 1.562, 1.545, 1.535, 1.531, 1.529, 1.529, 1.528, 1.527, 1.527, 1.528, 1.531, 1.533, 1.536, 1.539, 1.545, 1.552, 1.561, 1.572, 1.588, 1.607, 1.626, 1.654, 1.686, 1.716, 1.729,
+                            1.676, 1.655, 1.642, 1.629, 1.617, 1.602, 1.586, 1.564, 1.546, 1.536, 1.531, 1.529, 1.529, 1.529, 1.529, 1.529, 1.529, 1.532, 1.534, 1.536, 1.539, 1.547, 1.553, 1.563, 1.576, 1.591, 1.609, 1.627, 1.655, 1.688, 1.716, 1.729,
+                            1.676, 1.658, 1.641, 1.631, 1.617, 1.605, 1.588, 1.569, 1.553, 1.539, 1.532, 1.531, 1.529, 1.529, 1.529, 1.529, 1.531, 1.532, 1.534, 1.537, 1.541, 1.547, 1.553, 1.564, 1.578, 1.594, 1.613, 1.632, 1.659, 1.691, 1.717, 1.728,
+                            1.676, 1.658, 1.642, 1.631, 1.619, 1.608, 1.592, 1.575, 1.556, 1.542, 1.533, 1.531, 1.529, 1.529, 1.529, 1.531, 1.531, 1.532, 1.534, 1.537, 1.542, 1.548, 1.556, 1.567, 1.582, 1.598, 1.616, 1.638, 1.661, 1.693, 1.717, 1.729,
+                            1.678, 1.661, 1.644, 1.632, 1.621, 1.611, 1.596, 1.579, 1.561, 1.546, 1.536, 1.532, 1.531, 1.531, 1.531, 1.531, 1.532, 1.533, 1.535, 1.538, 1.544, 1.549, 1.559, 1.569, 1.587, 1.604, 1.618, 1.639, 1.669, 1.697, 1.718, 1.731,
+                            1.679, 1.662, 1.648, 1.635, 1.625, 1.615, 1.602, 1.586, 1.569, 1.552, 1.541, 1.535, 1.532, 1.532, 1.531, 1.532, 1.533, 1.534, 1.537, 1.541, 1.546, 1.552, 1.562, 1.576, 1.592, 1.608, 1.622, 1.647, 1.673, 1.703, 1.721, 1.734,
+                            1.684, 1.664, 1.649, 1.637, 1.627, 1.618, 1.606, 1.593, 1.576, 1.561, 1.547, 1.539, 1.535, 1.533, 1.533, 1.533, 1.534, 1.536, 1.539, 1.543, 1.549, 1.555, 1.568, 1.583, 1.596, 1.612, 1.629, 1.651, 1.681, 1.706, 1.723, 1.734,
+                            1.689, 1.669, 1.649, 1.639, 1.629, 1.621, 1.609, 1.597, 1.585, 1.567, 1.554, 1.546, 1.539, 1.536, 1.535, 1.535, 1.537, 1.538, 1.542, 1.546, 1.553, 1.562, 1.572, 1.589, 1.603, 1.619, 1.635, 1.658, 1.686, 1.708, 1.726, 1.736,
+                            1.692, 1.673, 1.655, 1.644, 1.634, 1.624, 1.614, 1.604, 1.592, 1.577, 1.566, 1.554, 1.546, 1.542, 1.538, 1.538, 1.539, 1.542, 1.546, 1.552, 1.559, 1.568, 1.581, 1.596, 1.609, 1.625, 1.642, 1.664, 1.693, 1.714, 1.727, 1.736,
+                            1.695, 1.679, 1.662, 1.647, 1.638, 1.631, 1.623, 1.612, 1.601, 1.589, 1.577, 1.565, 1.555, 1.549, 1.546, 1.545, 1.546, 1.548, 1.552, 1.559, 1.568, 1.579, 1.593, 1.604, 1.618, 1.632, 1.648, 1.676, 1.701, 1.718, 1.728, 1.739,
+                            1.699, 1.684, 1.667, 1.654, 1.644, 1.635, 1.629, 1.621, 1.609, 1.599, 1.589, 1.578, 1.568, 1.559, 1.556, 1.554, 1.554, 1.557, 1.563, 1.569, 1.578, 1.589, 1.599, 1.612, 1.625, 1.641, 1.661, 1.685, 1.707, 1.722, 1.734, 1.742,
+                            1.703, 1.691, 1.672, 1.658, 1.648, 1.639, 1.634, 1.628, 1.618, 1.606, 1.598, 1.589, 1.579, 1.573, 1.568, 1.567, 1.567, 1.568, 1.571, 1.578, 1.587, 1.597, 1.607, 1.618, 1.632, 1.651, 1.672, 1.694, 1.715, 1.728, 1.737, 1.742,
+                            1.707, 1.691, 1.676, 1.662, 1.651, 1.643, 1.638, 1.631, 1.622, 1.614, 1.604, 1.596, 1.589, 1.579, 1.575, 1.573, 1.573, 1.574, 1.578, 1.586, 1.589, 1.598, 1.609, 1.625, 1.638, 1.657, 1.679, 1.701, 1.719, 1.728, 1.738, 1.742
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            2.939, 2.935, 2.916, 2.895, 2.856, 2.825, 2.797, 2.777, 2.761, 2.741, 2.726, 2.709, 2.707, 2.704, 2.702, 2.702, 2.703, 2.706, 2.708, 2.709, 2.719, 2.735, 2.753, 2.776, 2.801, 2.832, 2.874, 2.915, 2.939, 2.943, 2.953, 2.961,
+                            2.936, 2.923, 2.901, 2.863, 2.829, 2.801, 2.781, 2.763, 2.743, 2.732, 2.712, 2.701, 2.696, 2.692, 2.691, 2.691, 2.693, 2.694, 2.696, 2.701, 2.709, 2.725, 2.741, 2.758, 2.779, 2.811, 2.838, 2.879, 2.919, 2.939, 2.948, 2.959,
+                            2.929, 2.909, 2.887, 2.847, 2.808, 2.783, 2.765, 2.748, 2.732, 2.713, 2.699, 2.691, 2.687, 2.686, 2.685, 2.685, 2.687, 2.689, 2.691, 2.694, 2.701, 2.709, 2.725, 2.745, 2.763, 2.786, 2.818, 2.863, 2.907, 2.933, 2.941, 2.955,
+                            2.929, 2.903, 2.875, 2.825, 2.791, 2.769, 2.755, 2.737, 2.718, 2.701, 2.688, 2.683, 2.681, 2.679, 2.681, 2.679, 2.681, 2.682, 2.685, 2.689, 2.694, 2.701, 2.711, 2.737, 2.754, 2.772, 2.803, 2.844, 2.894, 2.931, 2.939, 2.953,
+                            2.926, 2.895, 2.862, 2.816, 2.782, 2.759, 2.744, 2.727, 2.709, 2.691, 2.679, 2.673, 2.671, 2.669, 2.669, 2.669, 2.671, 2.674, 2.678, 2.681, 2.685, 2.694, 2.707, 2.725, 2.739, 2.762, 2.786, 2.829, 2.879, 2.919, 2.942, 2.952,
+                            2.919, 2.886, 2.846, 2.797, 2.772, 2.751, 2.737, 2.719, 2.694, 2.679, 2.672, 2.666, 2.664, 2.661, 2.659, 2.658, 2.661, 2.664, 2.669, 2.673, 2.678, 2.685, 2.696, 2.715, 2.728, 2.749, 2.774, 2.808, 2.866, 2.909, 2.936, 2.951,
+                            2.904, 2.877, 2.835, 2.789, 2.763, 2.744, 2.728, 2.712, 2.686, 2.672, 2.664, 2.657, 2.654, 2.654, 2.652, 2.653, 2.654, 2.657, 2.661, 2.666, 2.672, 2.678, 2.688, 2.703, 2.721, 2.742, 2.762, 2.797, 2.851, 2.902, 2.928, 2.949,
+                            2.901, 2.869, 2.825, 2.781, 2.756, 2.738, 2.721, 2.698, 2.679, 2.665, 2.656, 2.652, 2.649, 2.648, 2.648, 2.648, 2.649, 2.651, 2.654, 2.659, 2.667, 2.675, 2.683, 2.699, 2.711, 2.736, 2.754, 2.789, 2.838, 2.896, 2.926, 2.948,
+                            2.899, 2.862, 2.815, 2.774, 2.752, 2.734, 2.717, 2.689, 2.669, 2.658, 2.651, 2.646, 2.645, 2.643, 2.643, 2.644, 2.645, 2.646, 2.649, 2.654, 2.661, 2.669, 2.681, 2.693, 2.707, 2.729, 2.751, 2.782, 2.834, 2.887, 2.924, 2.947,
+                            2.898, 2.853, 2.812, 2.771, 2.751, 2.731, 2.711, 2.686, 2.663, 2.653, 2.646, 2.642, 2.641, 2.642, 2.642, 2.641, 2.641, 2.641, 2.646, 2.651, 2.657, 2.667, 2.678, 2.693, 2.705, 2.728, 2.746, 2.781, 2.829, 2.885, 2.924, 2.951,
+                            2.896, 2.851, 2.807, 2.771, 2.752, 2.729, 2.709, 2.681, 2.661, 2.649, 2.643, 2.641, 2.639, 2.639, 2.638, 2.636, 2.637, 2.638, 2.644, 2.649, 2.657, 2.666, 2.676, 2.688, 2.705, 2.725, 2.745, 2.777, 2.827, 2.884, 2.927, 2.951,
+                            2.891, 2.846, 2.803, 2.771, 2.749, 2.728, 2.706, 2.677, 2.658, 2.647, 2.641, 2.637, 2.637, 2.636, 2.636, 2.633, 2.632, 2.635, 2.643, 2.649, 2.656, 2.665, 2.675, 2.688, 2.704, 2.719, 2.744, 2.776, 2.822, 2.881, 2.927, 2.958,
+                            2.887, 2.841, 2.797, 2.769, 2.749, 2.729, 2.704, 2.674, 2.655, 2.645, 2.638, 2.635, 2.633, 2.632, 2.631, 2.625, 2.627, 2.631, 2.639, 2.649, 2.654, 2.662, 2.673, 2.686, 2.701, 2.718, 2.742, 2.773, 2.822, 2.881, 2.926, 2.958,
+                            2.883, 2.837, 2.796, 2.769, 2.749, 2.729, 2.701, 2.673, 2.653, 2.641, 2.636, 2.632, 2.631, 2.629, 2.623, 2.612, 2.619, 2.627, 2.637, 2.648, 2.652, 2.659, 2.671, 2.688, 2.699, 2.719, 2.742, 2.774, 2.821, 2.882, 2.927, 2.961,
+                            2.881, 2.832, 2.795, 2.769, 2.751, 2.729, 2.701, 2.672, 2.652, 2.639, 2.633, 2.631, 2.628, 2.625, 2.611, 2.599, 2.607, 2.619, 2.635, 2.644, 2.652, 2.659, 2.669, 2.686, 2.698, 2.719, 2.743, 2.775, 2.822, 2.881, 2.926, 2.961,
+                            2.879, 2.829, 2.793, 2.771, 2.751, 2.731, 2.701, 2.672, 2.651, 2.639, 2.632, 2.628, 2.626, 2.621, 2.601, 2.581, 2.581, 2.611, 2.631, 2.642, 2.648, 2.657, 2.669, 2.685, 2.699, 2.721, 2.743, 2.776, 2.819, 2.879, 2.927, 2.961,
+                            2.876, 2.829, 2.796, 2.773, 2.752, 2.731, 2.705, 2.672, 2.651, 2.637, 2.631, 2.627, 2.625, 2.619, 2.601, 2.581, 2.581, 2.611, 2.629, 2.641, 2.647, 2.658, 2.669, 2.685, 2.697, 2.721, 2.746, 2.777, 2.822, 2.881, 2.929, 2.964,
+                            2.874, 2.827, 2.796, 2.775, 2.755, 2.733, 2.708, 2.674, 2.649, 2.635, 2.629, 2.626, 2.624, 2.621, 2.609, 2.601, 2.606, 2.615, 2.629, 2.638, 2.645, 2.657, 2.669, 2.682, 2.699, 2.722, 2.747, 2.778, 2.822, 2.881, 2.931, 2.964,
+                            2.871, 2.827, 2.797, 2.776, 2.761, 2.734, 2.711, 2.679, 2.651, 2.636, 2.628, 2.626, 2.624, 2.621, 2.618, 2.611, 2.614, 2.619, 2.628, 2.639, 2.644, 2.657, 2.668, 2.683, 2.698, 2.723, 2.749, 2.782, 2.824, 2.882, 2.933, 2.965,
+                            2.869, 2.825, 2.797, 2.777, 2.765, 2.741, 2.718, 2.683, 2.655, 2.638, 2.627, 2.625, 2.624, 2.623, 2.621, 2.618, 2.618, 2.624, 2.629, 2.639, 2.644, 2.657, 2.669, 2.684, 2.701, 2.725, 2.755, 2.782, 2.829, 2.887, 2.937, 2.965,
+                            2.871, 2.826, 2.799, 2.776, 2.765, 2.744, 2.723, 2.689, 2.659, 2.639, 2.629, 2.626, 2.626, 2.624, 2.624, 2.622, 2.624, 2.627, 2.632, 2.639, 2.646, 2.657, 2.671, 2.687, 2.706, 2.732, 2.757, 2.789, 2.836, 2.893, 2.941, 2.965,
+                            2.869, 2.831, 2.803, 2.778, 2.766, 2.748, 2.729, 2.697, 2.667, 2.645, 2.632, 2.628, 2.625, 2.625, 2.625, 2.625, 2.627, 2.629, 2.634, 2.638, 2.648, 2.661, 2.673, 2.688, 2.711, 2.741, 2.762, 2.797, 2.843, 2.901, 2.943, 2.964,
+                            2.872, 2.837, 2.802, 2.781, 2.768, 2.753, 2.734, 2.702, 2.674, 2.647, 2.634, 2.629, 2.626, 2.625, 2.625, 2.627, 2.629, 2.632, 2.635, 2.639, 2.649, 2.663, 2.676, 2.694, 2.719, 2.746, 2.771, 2.799, 2.851, 2.905, 2.947, 2.969,
+                            2.871, 2.837, 2.805, 2.786, 2.771, 2.755, 2.739, 2.714, 2.685, 2.655, 2.639, 2.631, 2.626, 2.625, 2.626, 2.628, 2.629, 2.632, 2.634, 2.642, 2.651, 2.663, 2.679, 2.701, 2.726, 2.756, 2.773, 2.809, 2.861, 2.913, 2.949, 2.968,
+                            2.876, 2.841, 2.808, 2.789, 2.775, 2.759, 2.744, 2.719, 2.693, 2.664, 2.648, 2.636, 2.629, 2.627, 2.627, 2.629, 2.631, 2.633, 2.637, 2.645, 2.653, 2.666, 2.682, 2.708, 2.734, 2.759, 2.779, 2.815, 2.868, 2.918, 2.951, 2.971,
+                            2.882, 2.845, 2.816, 2.791, 2.778, 2.766, 2.748, 2.733, 2.707, 2.681, 2.656, 2.643, 2.636, 2.632, 2.631, 2.632, 2.633, 2.637, 2.643, 2.648, 2.659, 2.672, 2.691, 2.719, 2.747, 2.765, 2.791, 2.829, 2.881, 2.931, 2.952, 2.969,
+                            2.889, 2.855, 2.819, 2.799, 2.782, 2.769, 2.755, 2.741, 2.717, 2.691, 2.672, 2.652, 2.643, 2.639, 2.636, 2.636, 2.638, 2.642, 2.646, 2.655, 2.665, 2.682, 2.703, 2.729, 2.752, 2.774, 2.798, 2.839, 2.891, 2.933, 2.959, 2.975,
+                            2.897, 2.862, 2.829, 2.804, 2.789, 2.776, 2.764, 2.749, 2.734, 2.709, 2.689, 2.669, 2.652, 2.644, 2.642, 2.642, 2.644, 2.647, 2.654, 2.664, 2.677, 2.694, 2.714, 2.742, 2.764, 2.782, 2.809, 2.852, 2.899, 2.936, 2.961, 2.976,
+                            2.902, 2.869, 2.841, 2.811, 2.797, 2.785, 2.776, 2.761, 2.748, 2.727, 2.708, 2.689, 2.671, 2.659, 2.655, 2.654, 2.653, 2.656, 2.666, 2.678, 2.693, 2.713, 2.737, 2.756, 2.775, 2.798, 2.825, 2.871, 2.913, 2.944, 2.966, 2.979,
+                            2.911, 2.885, 2.848, 2.821, 2.804, 2.793, 2.784, 2.774, 2.759, 2.747, 2.726, 2.709, 2.692, 2.679, 2.673, 2.672, 2.671, 2.672, 2.681, 2.694, 2.712, 2.729, 2.749, 2.768, 2.789, 2.811, 2.844, 2.886, 2.928, 2.956, 2.971, 2.984,
+                            2.925, 2.893, 2.861, 2.831, 2.813, 2.802, 2.795, 2.783, 2.773, 2.759, 2.744, 2.729, 2.715, 2.701, 2.698, 2.694, 2.693, 2.694, 2.702, 2.714, 2.729, 2.747, 2.761, 2.781, 2.802, 2.828, 2.864, 2.907, 2.942, 2.967, 2.978, 2.989,
+                            2.932, 2.898, 2.871, 2.843, 2.823, 2.811, 2.802, 2.794, 2.779, 2.772, 2.757, 2.742, 2.729, 2.716, 2.705, 2.704, 2.704, 2.707, 2.715, 2.727, 2.737, 2.754, 2.769, 2.788, 2.812, 2.845, 2.878, 2.923, 2.962, 2.973, 2.979, 2.994
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            3.018, 3.021, 3.026, 3.052, 3.092, 3.143, 3.181, 3.202, 3.209, 3.212, 3.211, 3.209, 3.197, 3.193, 3.185, 3.184, 3.185, 3.187, 3.191, 3.202, 3.211, 3.213, 3.212, 3.203, 3.189, 3.147, 3.099, 3.051, 3.032, 3.031, 3.048, 3.054,
+                            3.019, 3.023, 3.033, 3.066, 3.123, 3.163, 3.196, 3.206, 3.212, 3.212, 3.211, 3.203, 3.193, 3.179, 3.168, 3.159, 3.159, 3.163, 3.174, 3.188, 3.203, 3.208, 3.211, 3.209, 3.195, 3.168, 3.114, 3.064, 3.035, 3.033, 3.044, 3.051,
+                            3.021, 3.028, 3.046, 3.099, 3.156, 3.192, 3.209, 3.215, 3.216, 3.213, 3.203, 3.193, 3.176, 3.159, 3.153, 3.151, 3.149, 3.152, 3.159, 3.171, 3.188, 3.201, 3.209, 3.211, 3.207, 3.189, 3.142, 3.083, 3.042, 3.038, 3.043, 3.046,
+                            3.022, 3.037, 3.065, 3.124, 3.178, 3.206, 3.215, 3.221, 3.218, 3.217, 3.198, 3.179, 3.162, 3.149, 3.138, 3.133, 3.133, 3.136, 3.145, 3.156, 3.174, 3.192, 3.206, 3.215, 3.214, 3.202, 3.159, 3.105, 3.058, 3.042, 3.043, 3.049,
+                            3.024, 3.047, 3.084, 3.151, 3.195, 3.211, 3.219, 3.223, 3.218, 3.208, 3.182, 3.164, 3.149, 3.137, 3.127, 3.119, 3.119, 3.124, 3.134, 3.144, 3.157, 3.178, 3.194, 3.213, 3.215, 3.208, 3.166, 3.124, 3.074, 3.044, 3.044, 3.049,
+                            3.023, 3.058, 3.102, 3.161, 3.201, 3.217, 3.224, 3.223, 3.217, 3.195, 3.174, 3.156, 3.137, 3.125, 3.115, 3.109, 3.109, 3.115, 3.121, 3.131, 3.146, 3.159, 3.186, 3.208, 3.213, 3.211, 3.181, 3.138, 3.084, 3.047, 3.047, 3.049,
+                            3.031, 3.063, 3.126, 3.183, 3.212, 3.224, 3.225, 3.224, 3.216, 3.191, 3.167, 3.143, 3.129, 3.115, 3.105, 3.103, 3.103, 3.107, 3.114, 3.121, 3.131, 3.148, 3.169, 3.199, 3.211, 3.209, 3.186, 3.151, 3.089, 3.051, 3.049, 3.052,
+                            3.033, 3.083, 3.141, 3.201, 3.221, 3.226, 3.226, 3.224, 3.212, 3.187, 3.159, 3.138, 3.119, 3.107, 3.101, 3.098, 3.098, 3.102, 3.107, 3.115, 3.124, 3.138, 3.161, 3.185, 3.207, 3.209, 3.197, 3.162, 3.112, 3.059, 3.056, 3.057,
+                            3.038, 3.092, 3.159, 3.212, 3.225, 3.231, 3.228, 3.224, 3.209, 3.181, 3.152, 3.129, 3.112, 3.103, 3.095, 3.092, 3.093, 3.095, 3.101, 3.108, 3.118, 3.133, 3.152, 3.179, 3.203, 3.209, 3.205, 3.174, 3.124, 3.069, 3.059, 3.058,
+                            3.049, 3.105, 3.176, 3.223, 3.229, 3.231, 3.229, 3.223, 3.206, 3.171, 3.147, 3.125, 3.109, 3.097, 3.091, 3.089, 3.088, 3.091, 3.094, 3.102, 3.111, 3.124, 3.143, 3.169, 3.196, 3.208, 3.207, 3.181, 3.132, 3.079, 3.064, 3.063,
+                            3.055, 3.123, 3.189, 3.226, 3.232, 3.232, 3.229, 3.225, 3.204, 3.169, 3.143, 3.122, 3.108, 3.095, 3.092, 3.089, 3.088, 3.088, 3.092, 3.095, 3.105, 3.117, 3.135, 3.159, 3.191, 3.208, 3.208, 3.189, 3.141, 3.084, 3.064, 3.062,
+                            3.057, 3.127, 3.198, 3.228, 3.233, 3.233, 3.229, 3.225, 3.201, 3.166, 3.139, 3.119, 3.106, 3.096, 3.093, 3.092, 3.088, 3.088, 3.089, 3.093, 3.099, 3.114, 3.129, 3.156, 3.186, 3.208, 3.208, 3.195, 3.143, 3.089, 3.065, 3.064,
+                            3.066, 3.142, 3.209, 3.232, 3.234, 3.233, 3.231, 3.226, 3.198, 3.166, 3.138, 3.117, 3.103, 3.097, 3.095, 3.095, 3.094, 3.089, 3.089, 3.092, 3.097, 3.109, 3.126, 3.155, 3.183, 3.207, 3.207, 3.198, 3.147, 3.091, 3.069, 3.065,
+                            3.072, 3.153, 3.216, 3.231, 3.234, 3.234, 3.229, 3.226, 3.194, 3.165, 3.136, 3.114, 3.101, 3.098, 3.098, 3.104, 3.098, 3.091, 3.088, 3.089, 3.093, 3.103, 3.123, 3.151, 3.181, 3.204, 3.204, 3.197, 3.156, 3.095, 3.069, 3.068,
+                            3.079, 3.159, 3.222, 3.233, 3.236, 3.235, 3.231, 3.226, 3.194, 3.165, 3.133, 3.112, 3.102, 3.099, 3.107, 3.114, 3.111, 3.097, 3.089, 3.089, 3.091, 3.099, 3.121, 3.149, 3.182, 3.202, 3.202, 3.195, 3.156, 3.096, 3.069, 3.068,
+                            3.081, 3.164, 3.226, 3.233, 3.236, 3.235, 3.233, 3.229, 3.199, 3.165, 3.137, 3.113, 3.102, 3.102, 3.111, 3.134, 3.134, 3.103, 3.091, 3.089, 3.092, 3.101, 3.119, 3.147, 3.182, 3.202, 3.202, 3.194, 3.155, 3.095, 3.069, 3.067,
+                            3.085, 3.163, 3.225, 3.236, 3.239, 3.235, 3.234, 3.231, 3.203, 3.169, 3.141, 3.115, 3.103, 3.103, 3.111, 3.134, 3.134, 3.106, 3.092, 3.091, 3.093, 3.103, 3.119, 3.149, 3.185, 3.203, 3.203, 3.193, 3.152, 3.095, 3.068, 3.066,
+                            3.083, 3.168, 3.226, 3.236, 3.241, 3.235, 3.235, 3.231, 3.205, 3.174, 3.144, 3.117, 3.107, 3.103, 3.107, 3.116, 3.109, 3.103, 3.091, 3.091, 3.095, 3.107, 3.123, 3.152, 3.188, 3.204, 3.204, 3.193, 3.151, 3.095, 3.069, 3.066,
+                            3.082, 3.171, 3.228, 3.237, 3.239, 3.235, 3.234, 3.233, 3.217, 3.184, 3.147, 3.119, 3.108, 3.104, 3.103, 3.105, 3.102, 3.095, 3.091, 3.091, 3.097, 3.111, 3.128, 3.157, 3.191, 3.204, 3.204, 3.185, 3.149, 3.094, 3.069, 3.065,
+                            3.086, 3.173, 3.226, 3.237, 3.239, 3.235, 3.234, 3.232, 3.221, 3.185, 3.155, 3.124, 3.112, 3.105, 3.102, 3.099, 3.096, 3.094, 3.092, 3.094, 3.102, 3.114, 3.133, 3.163, 3.197, 3.205, 3.204, 3.183, 3.144, 3.089, 3.068, 3.065,
+                            3.086, 3.166, 3.225, 3.239, 3.239, 3.237, 3.233, 3.231, 3.223, 3.193, 3.165, 3.135, 3.118, 3.108, 3.101, 3.098, 3.095, 3.093, 3.093, 3.099, 3.109, 3.124, 3.145, 3.174, 3.199, 3.204, 3.203, 3.181, 3.132, 3.085, 3.067, 3.062,
+                            3.086, 3.162, 3.224, 3.239, 3.241, 3.236, 3.232, 3.229, 3.224, 3.201, 3.174, 3.147, 3.128, 3.114, 3.103, 3.099, 3.096, 3.095, 3.097, 3.106, 3.116, 3.134, 3.151, 3.182, 3.201, 3.203, 3.201, 3.176, 3.125, 3.078, 3.065, 3.061,
+                            3.077, 3.162, 3.221, 3.239, 3.241, 3.234, 3.229, 3.227, 3.225, 3.207, 3.186, 3.161, 3.137, 3.122, 3.112, 3.102, 3.099, 3.098, 3.106, 3.113, 3.127, 3.139, 3.159, 3.192, 3.204, 3.205, 3.198, 3.167, 3.119, 3.073, 3.062, 3.061,
+                            3.077, 3.161, 3.216, 3.234, 3.236, 3.232, 3.225, 3.225, 3.222, 3.209, 3.194, 3.172, 3.148, 3.132, 3.121, 3.113, 3.107, 3.107, 3.112, 3.124, 3.135, 3.151, 3.175, 3.196, 3.201, 3.201, 3.191, 3.161, 3.114, 3.062, 3.058, 3.057,
+                            3.073, 3.139, 3.201, 3.227, 3.232, 3.227, 3.223, 3.219, 3.216, 3.212, 3.203, 3.181, 3.161, 3.142, 3.129, 3.121, 3.114, 3.114, 3.124, 3.134, 3.145, 3.161, 3.179, 3.196, 3.199, 3.195, 3.182, 3.145, 3.093, 3.052, 3.051, 3.052,
+                            3.066, 3.126, 3.192, 3.218, 3.224, 3.221, 3.218, 3.214, 3.214, 3.209, 3.204, 3.191, 3.174, 3.155, 3.142, 3.129, 3.127, 3.127, 3.136, 3.145, 3.157, 3.175, 3.187, 3.194, 3.196, 3.192, 3.171, 3.134, 3.082, 3.043, 3.042, 3.044,
+                            3.056, 3.114, 3.176, 3.212, 3.219, 3.219, 3.214, 3.209, 3.208, 3.206, 3.203, 3.198, 3.182, 3.171, 3.155, 3.146, 3.144, 3.144, 3.148, 3.156, 3.171, 3.181, 3.188, 3.194, 3.194, 3.187, 3.161, 3.117, 3.066, 3.037, 3.037, 3.044,
+                            3.054, 3.101, 3.162, 3.203, 3.216, 3.215, 3.211, 3.206, 3.203, 3.201, 3.199, 3.197, 3.191, 3.179, 3.171, 3.161, 3.156, 3.156, 3.161, 3.171, 3.179, 3.184, 3.189, 3.192, 3.191, 3.181, 3.142, 3.097, 3.045, 3.032, 3.033, 3.039,
+                            3.041, 3.093, 3.149, 3.194, 3.208, 3.211, 3.208, 3.202, 3.197, 3.197, 3.197, 3.195, 3.191, 3.189, 3.181, 3.176, 3.172, 3.173, 3.178, 3.181, 3.185, 3.187, 3.189, 3.191, 3.189, 3.173, 3.133, 3.085, 3.034, 3.029, 3.031, 3.038,
+                            3.032, 3.079, 3.133, 3.181, 3.197, 3.207, 3.204, 3.198, 3.193, 3.192, 3.189, 3.191, 3.189, 3.187, 3.185, 3.183, 3.183, 3.183, 3.185, 3.188, 3.187, 3.188, 3.189, 3.188, 3.184, 3.164, 3.118, 3.075, 3.031, 3.026, 3.028, 3.039,
+                            3.025, 3.051, 3.099, 3.149, 3.182, 3.193, 3.193, 3.187, 3.181, 3.178, 3.177, 3.177, 3.182, 3.183, 3.183, 3.183, 3.183, 3.184, 3.187, 3.188, 3.186, 3.184, 3.184, 3.181, 3.167, 3.139, 3.098, 3.053, 3.026, 3.024, 3.029, 3.043,
+                            3.016, 3.025, 3.081, 3.122, 3.167, 3.182, 3.185, 3.181, 3.176, 3.171, 3.169, 3.171, 3.174, 3.175, 3.178, 3.178, 3.179, 3.181, 3.185, 3.185, 3.181, 3.179, 3.177, 3.173, 3.151, 3.119, 3.076, 3.031, 3.021, 3.018, 3.024, 3.046
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.503, 1.503, 1.504, 1.515, 1.541, 1.566, 1.587, 1.599, 1.602, 1.603, 1.602, 1.599, 1.595, 1.589, 1.587, 1.586, 1.586, 1.587, 1.589, 1.594, 1.601, 1.604, 1.604, 1.601, 1.589, 1.571, 1.541, 1.517, 1.512, 1.512, 1.522, 1.526,
+                            1.501, 1.502, 1.506, 1.523, 1.557, 1.579, 1.596, 1.603, 1.603, 1.603, 1.601, 1.597, 1.591, 1.582, 1.576, 1.575, 1.574, 1.577, 1.581, 1.588, 1.595, 1.601, 1.603, 1.602, 1.597, 1.578, 1.553, 1.526, 1.512, 1.512, 1.519, 1.526,
+                            1.499, 1.503, 1.512, 1.539, 1.571, 1.593, 1.603, 1.604, 1.604, 1.602, 1.597, 1.591, 1.581, 1.573, 1.568, 1.566, 1.566, 1.568, 1.572, 1.579, 1.587, 1.594, 1.602, 1.603, 1.601, 1.589, 1.566, 1.536, 1.517, 1.516, 1.519, 1.525,
+                            1.499, 1.505, 1.521, 1.553, 1.582, 1.597, 1.604, 1.604, 1.604, 1.601, 1.592, 1.582, 1.573, 1.564, 1.561, 1.558, 1.557, 1.559, 1.564, 1.571, 1.579, 1.588, 1.597, 1.603, 1.603, 1.596, 1.576, 1.545, 1.519, 1.517, 1.518, 1.526,
+                            1.499, 1.509, 1.529, 1.565, 1.591, 1.601, 1.605, 1.604, 1.602, 1.597, 1.586, 1.573, 1.565, 1.558, 1.553, 1.551, 1.551, 1.552, 1.555, 1.563, 1.571, 1.581, 1.592, 1.601, 1.602, 1.599, 1.582, 1.556, 1.528, 1.517, 1.517, 1.526,
+                            1.501, 1.512, 1.539, 1.576, 1.595, 1.603, 1.605, 1.604, 1.601, 1.591, 1.579, 1.567, 1.559, 1.552, 1.548, 1.545, 1.546, 1.548, 1.551, 1.555, 1.563, 1.574, 1.585, 1.598, 1.602, 1.601, 1.589, 1.562, 1.535, 1.519, 1.519, 1.528,
+                            1.501, 1.517, 1.552, 1.587, 1.601, 1.605, 1.605, 1.605, 1.599, 1.588, 1.574, 1.562, 1.553, 1.548, 1.544, 1.543, 1.543, 1.545, 1.547, 1.551, 1.557, 1.567, 1.578, 1.593, 1.601, 1.601, 1.592, 1.571, 1.539, 1.521, 1.521, 1.529,
+                            1.503, 1.524, 1.561, 1.593, 1.605, 1.606, 1.605, 1.603, 1.598, 1.585, 1.569, 1.558, 1.551, 1.545, 1.542, 1.541, 1.541, 1.542, 1.545, 1.547, 1.555, 1.561, 1.573, 1.587, 1.598, 1.601, 1.596, 1.577, 1.546, 1.523, 1.523, 1.529,
+                            1.503, 1.532, 1.568, 1.597, 1.605, 1.606, 1.605, 1.603, 1.596, 1.581, 1.565, 1.555, 1.548, 1.544, 1.541, 1.539, 1.541, 1.541, 1.543, 1.546, 1.549, 1.558, 1.568, 1.583, 1.595, 1.601, 1.599, 1.582, 1.555, 1.525, 1.525, 1.531,
+                            1.508, 1.539, 1.575, 1.601, 1.605, 1.606, 1.605, 1.602, 1.593, 1.577, 1.563, 1.552, 1.546, 1.543, 1.541, 1.539, 1.539, 1.541, 1.542, 1.544, 1.548, 1.553, 1.564, 1.579, 1.592, 1.599, 1.599, 1.585, 1.559, 1.532, 1.531, 1.531,
+                            1.511, 1.544, 1.581, 1.603, 1.606, 1.606, 1.604, 1.603, 1.591, 1.574, 1.561, 1.549, 1.545, 1.542, 1.541, 1.541, 1.541, 1.541, 1.542, 1.543, 1.545, 1.551, 1.561, 1.573, 1.591, 1.599, 1.599, 1.588, 1.563, 1.535, 1.531, 1.531,
+                            1.515, 1.548, 1.589, 1.605, 1.607, 1.607, 1.604, 1.602, 1.591, 1.573, 1.559, 1.549, 1.543, 1.542, 1.541, 1.542, 1.542, 1.542, 1.541, 1.542, 1.543, 1.549, 1.558, 1.571, 1.588, 1.599, 1.599, 1.591, 1.566, 1.537, 1.532, 1.531,
+                            1.517, 1.558, 1.593, 1.606, 1.607, 1.607, 1.605, 1.602, 1.589, 1.572, 1.557, 1.548, 1.543, 1.543, 1.542, 1.544, 1.543, 1.543, 1.541, 1.541, 1.542, 1.546, 1.554, 1.569, 1.585, 1.599, 1.599, 1.593, 1.568, 1.538, 1.533, 1.531,
+                            1.521, 1.563, 1.596, 1.607, 1.608, 1.607, 1.606, 1.603, 1.589, 1.572, 1.557, 1.548, 1.543, 1.543, 1.544, 1.549, 1.546, 1.544, 1.541, 1.541, 1.542, 1.545, 1.553, 1.568, 1.585, 1.598, 1.598, 1.594, 1.571, 1.541, 1.534, 1.531,
+                            1.521, 1.566, 1.599, 1.607, 1.608, 1.607, 1.605, 1.603, 1.591, 1.571, 1.556, 1.547, 1.544, 1.544, 1.551, 1.554, 1.552, 1.546, 1.541, 1.541, 1.541, 1.544, 1.553, 1.567, 1.585, 1.597, 1.598, 1.595, 1.571, 1.541, 1.534, 1.531,
+                            1.523, 1.568, 1.601, 1.607, 1.608, 1.607, 1.606, 1.604, 1.591, 1.572, 1.557, 1.547, 1.545, 1.545, 1.552, 1.566, 1.566, 1.551, 1.542, 1.541, 1.541, 1.544, 1.553, 1.567, 1.586, 1.596, 1.596, 1.593, 1.571, 1.541, 1.533, 1.531,
+                            1.524, 1.569, 1.602, 1.607, 1.608, 1.607, 1.606, 1.604, 1.591, 1.573, 1.559, 1.548, 1.545, 1.546, 1.552, 1.565, 1.565, 1.551, 1.542, 1.541, 1.541, 1.545, 1.553, 1.568, 1.586, 1.597, 1.597, 1.593, 1.571, 1.541, 1.532, 1.532,
+                            1.526, 1.571, 1.602, 1.607, 1.608, 1.606, 1.605, 1.604, 1.593, 1.575, 1.559, 1.549, 1.546, 1.546, 1.549, 1.552, 1.552, 1.546, 1.542, 1.541, 1.542, 1.546, 1.555, 1.569, 1.587, 1.597, 1.597, 1.591, 1.569, 1.539, 1.532, 1.531,
+                            1.526, 1.571, 1.601, 1.608, 1.609, 1.605, 1.605, 1.603, 1.597, 1.579, 1.562, 1.551, 1.546, 1.545, 1.545, 1.549, 1.546, 1.543, 1.542, 1.541, 1.542, 1.547, 1.557, 1.573, 1.588, 1.597, 1.597, 1.589, 1.566, 1.537, 1.531, 1.529,
+                            1.526, 1.569, 1.602, 1.609, 1.609, 1.606, 1.605, 1.604, 1.598, 1.582, 1.567, 1.553, 1.547, 1.545, 1.544, 1.544, 1.544, 1.542, 1.542, 1.542, 1.544, 1.552, 1.559, 1.576, 1.591, 1.597, 1.597, 1.588, 1.563, 1.535, 1.531, 1.529,
+                            1.523, 1.567, 1.601, 1.609, 1.609, 1.606, 1.605, 1.603, 1.599, 1.587, 1.571, 1.558, 1.549, 1.545, 1.544, 1.543, 1.543, 1.542, 1.542, 1.544, 1.548, 1.555, 1.566, 1.581, 1.593, 1.597, 1.597, 1.586, 1.558, 1.534, 1.529, 1.529,
+                            1.523, 1.564, 1.599, 1.609, 1.609, 1.605, 1.604, 1.603, 1.601, 1.592, 1.576, 1.564, 1.553, 1.547, 1.544, 1.543, 1.542, 1.542, 1.544, 1.548, 1.551, 1.561, 1.572, 1.585, 1.594, 1.596, 1.595, 1.581, 1.555, 1.528, 1.527, 1.528,
+                            1.522, 1.561, 1.595, 1.608, 1.608, 1.604, 1.602, 1.601, 1.601, 1.595, 1.582, 1.569, 1.559, 1.552, 1.547, 1.545, 1.543, 1.544, 1.546, 1.551, 1.556, 1.563, 1.576, 1.589, 1.595, 1.596, 1.593, 1.576, 1.551, 1.524, 1.524, 1.528,
+                            1.519, 1.559, 1.591, 1.605, 1.606, 1.603, 1.601, 1.599, 1.601, 1.597, 1.587, 1.576, 1.565, 1.558, 1.552, 1.549, 1.546, 1.547, 1.552, 1.556, 1.561, 1.571, 1.582, 1.593, 1.596, 1.596, 1.591, 1.569, 1.546, 1.521, 1.521, 1.527,
+                            1.516, 1.553, 1.589, 1.602, 1.604, 1.602, 1.599, 1.598, 1.599, 1.598, 1.594, 1.583, 1.572, 1.564, 1.559, 1.553, 1.552, 1.553, 1.556, 1.561, 1.567, 1.578, 1.588, 1.594, 1.596, 1.594, 1.588, 1.567, 1.539, 1.517, 1.517, 1.525,
+                            1.511, 1.548, 1.581, 1.599, 1.602, 1.602, 1.598, 1.597, 1.597, 1.597, 1.595, 1.589, 1.581, 1.571, 1.564, 1.559, 1.559, 1.558, 1.561, 1.567, 1.575, 1.583, 1.591, 1.593, 1.594, 1.591, 1.581, 1.557, 1.529, 1.514, 1.514, 1.521,
+                            1.508, 1.541, 1.576, 1.596, 1.601, 1.601, 1.597, 1.595, 1.594, 1.595, 1.595, 1.592, 1.585, 1.579, 1.571, 1.566, 1.566, 1.566, 1.568, 1.575, 1.582, 1.589, 1.592, 1.593, 1.593, 1.589, 1.575, 1.553, 1.523, 1.511, 1.511, 1.517,
+                            1.505, 1.535, 1.566, 1.591, 1.599, 1.598, 1.596, 1.594, 1.592, 1.592, 1.593, 1.592, 1.589, 1.585, 1.579, 1.575, 1.574, 1.574, 1.577, 1.582, 1.587, 1.591, 1.592, 1.593, 1.592, 1.585, 1.568, 1.541, 1.516, 1.509, 1.509, 1.517,
+                            1.501, 1.528, 1.559, 1.585, 1.595, 1.597, 1.595, 1.593, 1.589, 1.588, 1.591, 1.591, 1.591, 1.589, 1.586, 1.583, 1.582, 1.582, 1.585, 1.588, 1.589, 1.591, 1.592, 1.593, 1.592, 1.582, 1.561, 1.536, 1.512, 1.509, 1.511, 1.517,
+                            1.496, 1.521, 1.549, 1.576, 1.588, 1.594, 1.593, 1.589, 1.586, 1.585, 1.586, 1.588, 1.589, 1.588, 1.588, 1.587, 1.587, 1.587, 1.589, 1.589, 1.591, 1.591, 1.592, 1.592, 1.591, 1.575, 1.555, 1.527, 1.508, 1.507, 1.511, 1.519,
+                            1.495, 1.505, 1.536, 1.563, 1.581, 1.587, 1.588, 1.584, 1.582, 1.578, 1.578, 1.581, 1.583, 1.584, 1.586, 1.587, 1.587, 1.587, 1.588, 1.589, 1.589, 1.591, 1.591, 1.591, 1.584, 1.566, 1.544, 1.518, 1.505, 1.505, 1.509, 1.519,
+                            1.493, 1.496, 1.522, 1.547, 1.569, 1.581, 1.582, 1.581, 1.577, 1.575, 1.573, 1.575, 1.579, 1.581, 1.583, 1.584, 1.584, 1.585, 1.587, 1.587, 1.588, 1.588, 1.588, 1.585, 1.573, 1.556, 1.532, 1.511, 1.504, 1.504, 1.508, 1.523
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    4.461, 4.088, 3.793, 3.651, 3.557, 3.439, 3.248, 2.999, 2.751, 2.527, 2.341, 2.191, 2.069, 1.956, 1.907, 1.907, 1.907, 1.908, 1.946, 2.056, 2.179, 2.328, 2.517, 2.747, 2.998, 3.219, 3.359, 3.436, 3.494, 3.621, 3.906, 4.251,
+                    4.297, 3.982, 3.747, 3.634, 3.531, 3.373, 3.136, 2.863, 2.608, 2.386, 2.209, 2.075, 1.957, 1.873, 1.817, 1.789, 1.789, 1.813, 1.865, 1.947, 2.066, 2.198, 2.378, 2.605, 2.872, 3.132, 3.322, 3.431, 3.485, 3.577, 3.802, 4.079,
+                    4.152, 3.905, 3.717, 3.623, 3.499, 3.296, 3.022, 2.735, 2.478, 2.265, 2.094, 1.957, 1.849, 1.763, 1.709, 1.679, 1.679, 1.703, 1.753, 1.837, 1.947, 2.081, 2.253, 2.472, 2.742, 3.032, 3.271, 3.414, 3.479, 3.545, 3.719, 3.937,
+                    4.039, 3.835, 3.688, 3.596, 3.442, 3.196, 2.899, 2.609, 2.356, 2.153, 1.987, 1.849, 1.748, 1.659, 1.605, 1.577, 1.577, 1.599, 1.649, 1.734, 1.837, 1.973, 2.139, 2.348, 2.612, 2.911, 3.192, 3.379, 3.467, 3.516, 3.649, 3.815,
+                    3.952, 3.784, 3.669, 3.562, 3.369, 3.088, 2.778, 2.491, 2.246, 2.049, 1.888, 1.748, 1.657, 1.561, 1.509, 1.481, 1.481, 1.504, 1.552, 1.642, 1.734, 1.869, 2.033, 2.233, 2.489, 2.792, 3.105, 3.331, 3.445, 3.493, 3.591, 3.721,
+                    3.883, 3.741, 3.648, 3.519, 3.287, 2.977, 2.665, 2.382, 2.148, 1.957, 1.796, 1.659, 1.561, 1.474, 1.422, 1.396, 1.396, 1.415, 1.465, 1.552, 1.643, 1.776, 1.936, 2.131, 2.375, 2.678, 3.004, 3.275, 3.416, 3.469, 3.541, 3.643,
+                    3.829, 3.716, 3.617, 3.466, 3.202, 2.876, 2.558, 2.282, 2.059, 1.872, 1.713, 1.577, 1.474, 1.399, 1.345, 1.319, 1.319, 1.338, 1.389, 1.465, 1.559, 1.689, 1.849, 2.042, 2.275, 2.568, 2.903, 3.204, 3.383, 3.446, 3.496, 3.579,
+                    3.793, 3.685, 3.589, 3.411, 3.119, 2.781, 2.466, 2.199, 1.983, 1.798, 1.639, 1.505, 1.399, 1.339, 1.276, 1.253, 1.253, 1.271, 1.327, 1.389, 1.487, 1.612, 1.769, 1.961, 2.189, 2.471, 2.806, 3.133, 3.342, 3.425, 3.459, 3.527,
+                    3.763, 3.666, 3.561, 3.357, 3.042, 2.698, 2.384, 2.129, 1.918, 1.734, 1.575, 1.443, 1.339, 1.276, 1.217, 1.194, 1.194, 1.214, 1.271, 1.327, 1.423, 1.546, 1.702, 1.891, 2.112, 2.386, 2.718, 3.061, 3.301, 3.402, 3.433, 3.486,
+                    3.745, 3.647, 3.529, 3.302, 2.971, 2.627, 2.318, 2.067, 1.859, 1.677, 1.521, 1.389, 1.287, 1.217, 1.171, 1.145, 1.145, 1.165, 1.214, 1.276, 1.369, 1.491, 1.643, 1.831, 2.048, 2.313, 2.644, 2.995, 3.262, 3.381, 3.412, 3.453,
+                    3.731, 3.635, 3.503, 3.249, 2.911, 2.566, 2.259, 2.017, 1.811, 1.629, 1.475, 1.347, 1.246, 1.171, 1.138, 1.103, 1.103, 1.129, 1.165, 1.231, 1.322, 1.443, 1.595, 1.779, 1.993, 2.251, 2.576, 2.936, 3.223, 3.359, 3.392, 3.425,
+                    3.721, 3.625, 3.481, 3.208, 2.861, 2.515, 2.213, 1.976, 1.773, 1.593, 1.439, 1.313, 1.213, 1.138, 1.103, 1.071, 1.071, 1.101, 1.129, 1.194, 1.286, 1.405, 1.555, 1.736, 1.949, 2.202, 2.521, 2.886, 3.189, 3.338, 3.375, 3.406,
+                    3.716, 3.616, 3.458, 3.171, 2.819, 2.472, 2.176, 1.942, 1.741, 1.563, 1.411, 1.285, 1.186, 1.112, 1.071, 1.051, 1.049, 1.069, 1.103, 1.165, 1.256, 1.376, 1.523, 1.702, 1.913, 2.163, 2.477, 2.843, 3.155, 3.318, 3.358, 3.389,
+                    3.712, 3.609, 3.439, 3.142, 2.787, 2.443, 2.147, 1.918, 1.721, 1.541, 1.391, 1.266, 1.167, 1.094, 1.051, 1.035, 1.035, 1.049, 1.085, 1.145, 1.236, 1.355, 1.499, 1.676, 1.886, 2.136, 2.449, 2.814, 3.135, 3.307, 3.351, 3.378,
+                    3.709, 3.604, 3.422, 3.123, 2.768, 2.419, 2.129, 1.903, 1.706, 1.527, 1.377, 1.253, 1.155, 1.083, 1.035, 1.023, 1.023, 1.035, 1.074, 1.134, 1.224, 1.341, 1.484, 1.661, 1.868, 2.117, 2.429, 2.797, 3.122, 3.301, 3.346, 3.374,
+                    3.711, 3.597, 3.412, 3.114, 2.758, 2.409, 2.119, 1.895, 1.701, 1.523, 1.373, 1.251, 1.153, 1.081, 1.033, 1.001, 1.001, 1.032, 1.073, 1.133, 1.222, 1.338, 1.479, 1.655, 1.861, 2.107, 2.418, 2.787, 3.115, 3.297, 3.343, 3.373,
+                    3.713, 3.597, 3.412, 3.113, 2.758, 2.409, 2.119, 1.893, 1.698, 1.523, 1.373, 1.251, 1.153, 1.081, 1.034, 1.011, 1.011, 1.032, 1.074, 1.134, 1.222, 1.338, 1.479, 1.655, 1.861, 2.107, 2.418, 2.787, 3.116, 3.294, 3.341, 3.371,
+                    3.721, 3.599, 3.414, 3.116, 2.763, 2.418, 2.124, 1.895, 1.704, 1.531, 1.382, 1.259, 1.162, 1.091, 1.048, 1.034, 1.032, 1.046, 1.083, 1.145, 1.232, 1.348, 1.491, 1.664, 1.869, 2.115, 2.428, 2.798, 3.123, 3.294, 3.339, 3.372,
+                    3.727, 3.604, 3.421, 3.132, 2.784, 2.438, 2.141, 1.908, 1.716, 1.547, 1.399, 1.276, 1.178, 1.107, 1.069, 1.048, 1.046, 1.067, 1.101, 1.162, 1.249, 1.366, 1.509, 1.684, 1.886, 2.134, 2.449, 2.821, 3.135, 3.299, 3.341, 3.375,
+                    3.739, 3.613, 3.431, 3.154, 2.813, 2.468, 2.166, 1.931, 1.739, 1.569, 1.424, 1.302, 1.203, 1.129, 1.098, 1.069, 1.069, 1.096, 1.123, 1.185, 1.274, 1.391, 1.536, 1.709, 1.914, 2.162, 2.481, 2.851, 3.156, 3.311, 3.342, 3.378,
+                    3.751, 3.626, 3.449, 3.186, 2.855, 2.509, 2.201, 1.961, 1.768, 1.601, 1.454, 1.333, 1.235, 1.159, 1.129, 1.098, 1.098, 1.123, 1.152, 1.216, 1.307, 1.424, 1.569, 1.744, 1.947, 2.202, 2.526, 2.891, 3.182, 3.322, 3.351, 3.387,
+                    3.772, 3.641, 3.473, 3.221, 2.902, 2.559, 2.248, 1.999, 1.804, 1.639, 1.496, 1.373, 1.274, 1.201, 1.159, 1.133, 1.133, 1.152, 1.191, 1.254, 1.347, 1.466, 1.611, 1.785, 1.989, 2.253, 2.582, 2.939, 3.209, 3.334, 3.361, 3.402,
+                    3.797, 3.663, 3.496, 3.263, 2.959, 2.624, 2.308, 2.049, 1.847, 1.684, 1.542, 1.422, 1.321, 1.252, 1.201, 1.175, 1.175, 1.191, 1.239, 1.298, 1.394, 1.516, 1.658, 1.831, 2.041, 2.313, 2.651, 2.998, 3.244, 3.351, 3.375, 3.422,
+                    3.831, 3.686, 3.523, 3.307, 3.023, 2.698, 2.379, 2.112, 1.902, 1.737, 1.596, 1.476, 1.378, 1.315, 1.252, 1.227, 1.227, 1.239, 1.296, 1.355, 1.451, 1.572, 1.715, 1.888, 2.103, 2.386, 2.731, 3.063, 3.279, 3.367, 3.393, 3.456,
+                    3.871, 3.714, 3.551, 3.355, 3.091, 2.781, 2.465, 2.186, 1.965, 1.795, 1.654, 1.538, 1.442, 1.378, 1.318, 1.291, 1.291, 1.304, 1.355, 1.424, 1.515, 1.634, 1.778, 1.952, 2.178, 2.479, 2.821, 3.129, 3.314, 3.381, 3.419, 3.491,
+                    3.925, 3.749, 3.582, 3.401, 3.156, 2.866, 2.559, 2.274, 2.039, 1.859, 1.718, 1.604, 1.513, 1.442, 1.389, 1.363, 1.363, 1.379, 1.424, 1.501, 1.586, 1.702, 1.847, 2.028, 2.269, 2.579, 2.913, 3.193, 3.343, 3.396, 3.447, 3.539,
+                    3.994, 3.794, 3.619, 3.442, 3.231, 2.961, 2.662, 2.375, 2.129, 1.938, 1.789, 1.675, 1.591, 1.513, 1.465, 1.439, 1.439, 1.457, 1.501, 1.582, 1.661, 1.777, 1.925, 2.118, 2.375, 2.691, 3.008, 3.251, 3.371, 3.414, 3.479, 3.598,
+                    4.082, 3.845, 3.656, 3.489, 3.298, 3.053, 2.771, 2.485, 2.232, 2.028, 1.871, 1.751, 1.672, 1.591, 1.544, 1.521, 1.521, 1.539, 1.582, 1.661, 1.741, 1.859, 2.014, 2.224, 2.495, 2.806, 3.098, 3.301, 3.392, 3.431, 3.518, 3.677,
+                    4.196, 3.911, 3.698, 3.534, 3.363, 3.146, 2.881, 2.604, 2.348, 2.132, 1.964, 1.836, 1.751, 1.672, 1.628, 1.606, 1.606, 1.624, 1.665, 1.741, 1.827, 1.951, 2.121, 2.344, 2.624, 2.923, 3.177, 3.336, 3.405, 3.447, 3.567, 3.776,
+                    4.341, 4.002, 3.744, 3.575, 3.415, 3.229, 2.989, 2.729, 2.475, 2.251, 2.071, 1.936, 1.836, 1.759, 1.713, 1.693, 1.693, 1.711, 1.753, 1.827, 1.925, 2.058, 2.243, 2.481, 2.758, 3.027, 3.238, 3.361, 3.409, 3.466, 3.637, 3.896,
+                    4.516, 4.123, 3.804, 3.621, 3.468, 3.308, 3.096, 2.855, 2.609, 2.385, 2.194, 2.045, 1.936, 1.857, 1.807, 1.784, 1.784, 1.803, 1.852, 1.925, 2.033, 2.183, 2.382, 2.623, 2.886, 3.121, 3.284, 3.372, 3.413, 3.494, 3.727, 4.048,
+                    4.716, 4.264, 3.875, 3.674, 3.523, 3.376, 3.189, 2.966, 2.733, 2.511, 2.315, 2.158, 2.039, 1.936, 1.875, 1.872, 1.872, 1.872, 1.925, 2.028, 2.148, 2.308, 2.513, 2.751, 2.994, 3.191, 3.319, 3.384, 3.427, 3.541, 3.838, 4.221
+                ],
+                "sigma": 0.00152,
+                "sigma_Cb": 0.00172
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2750,
+                        "ccm":
+                        [
+                            1.13004, 0.36392, -0.49396,
+                            -0.45885, 1.68171, -0.22286,
+                            -0.06473, -0.86962, 1.93435
+                        ]
+                    },
+                    {
+                        "ct": 2940,
+                        "ccm":
+                        [
+                            1.29876, 0.09627, -0.39503,
+                            -0.43085, 1.60258, -0.17172,
+                            -0.02638, -0.92581, 1.95218
+                        ]
+                    },
+                    {
+                        "ct": 3650,
+                        "ccm":
+                        [
+                            1.57729, -0.29734, -0.27995,
+                            -0.42965, 1.66231, -0.23265,
+                            -0.02183, -0.62331, 1.64514
+                        ]
+                    },
+                    {
+                        "ct": 4625,
+                        "ccm":
+                        [
+                            1.52145, -0.22382, -0.29763,
+                            -0.40445, 1.82186, -0.41742,
+                            -0.05732, -0.56222, 1.61954
+                        ]
+                    },
+                    {
+                        "ct": 5715,
+                        "ccm":
+                        [
+                            1.67851, -0.39193, -0.28658,
+                            -0.37169, 1.72949, -0.35781,
+                            -0.09556, -0.41951, 1.51508
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.af":
+            {
+                "ranges":
+                {
+                    "normal":
+                    {
+                        "min": 0.0,
+                        "max": 12.0,
+                        "default": 1.0
+                    },
+                    "macro":
+                    {
+                        "min": 4.0,
+                        "max": 32.0,
+                        "default": 6.0
+                    }
+                },
+                "speeds":
+                {
+                    "normal":
+                    {
+                        "step_coarse": 2.0,
+                        "step_fine": 0.5,
+                        "contrast_ratio": 0.75,
+                        "pdaf_gain": -0.03,
+                        "pdaf_squelch": 0.2,
+                        "max_slew": 4.0,
+                        "pdaf_frames": 20,
+                        "dropout_frames": 6,
+                        "step_frames": 4
+                    },
+                    "fast":
+                    {
+                        "step_coarse": 2.0,
+                        "step_fine": 0.5,
+                        "contrast_ratio": 0.75,
+                        "pdaf_gain": -0.05,
+                        "pdaf_squelch": 0.2,
+                        "max_slew": 5.0,
+                        "pdaf_frames": 16,
+                        "dropout_frames": 6,
+                        "step_frames": 4
+                    }
+                },
+                "conf_epsilon": 8,
+                "conf_thresh": 12,
+                "conf_clip": 512,
+                "skip_frames": 5,
+                "map": [ 0.0, 420, 35.0, 920 ]
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "power_min": 0.7,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "power_min": 0.7,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/meson.build b/src/ipa/rpi/pisp/data/meson.build
new file mode 100644
index 000000000..26f8051be
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/meson.build
@@ -0,0 +1,21 @@
+# SPDX-License-Identifier: CC0-1.0
+
+conf_files = files([
+    'imx219.json',
+    'imx219_noir.json',
+    'imx296.json',
+    'imx296_mono.json',
+    'imx477.json',
+    'imx477_noir.json',
+    'imx477_scientific.json',
+    'imx708.json',
+    'imx708_noir.json',
+    'imx708_wide.json',
+    'imx708_wide_noir.json',
+    'ov5647.json',
+    'ov5647_noir.json',
+    'uncalibrated.json',
+])
+
+install_data(conf_files,
+             install_dir : ipa_data_dir / 'rpi' / 'pisp')
diff --git a/src/ipa/rpi/pisp/data/ov5647.json b/src/ipa/rpi/pisp/data/ov5647.json
new file mode 100644
index 000000000..d5156767c
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/ov5647.json
@@ -0,0 +1,1186 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 1024
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 29381,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 870,
+                "reference_Y": 12388
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 4.371
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 280,
+                "slope": 0.02153
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "priors": [
+                    {
+                        "lux": 0,
+                        "prior":
+                        [
+                            2000, 1.0,
+                            3000, 0.0,
+                            13000, 0.0
+                        ]
+                    },
+                    {
+                        "lux": 800,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            6000, 2.0,
+                            13000, 2.0
+                        ]
+                    },
+                    {
+                        "lux": 1500,
+                        "prior":
+                        [
+                            2000, 0.0,
+                            4000, 1.0,
+                            6000, 6.0,
+                            6500, 7.0,
+                            7000, 1.0,
+                            13000, 1.0
+                        ]
+                    }
+                ],
+                "modes":
+                {
+                    "auto":
+                    {
+                        "lo": 2500,
+                        "hi": 7700
+                    },
+                    "incandescent":
+                    {
+                        "lo": 2500,
+                        "hi": 3000
+                    },
+                    "tungsten":
+                    {
+                        "lo": 3000,
+                        "hi": 3500
+                    },
+                    "fluorescent":
+                    {
+                        "lo": 4000,
+                        "hi": 4700
+                    },
+                    "indoor":
+                    {
+                        "lo": 3000,
+                        "hi": 5000
+                    },
+                    "daylight":
+                    {
+                        "lo": 5500,
+                        "hi": 6500
+                    },
+                    "cloudy":
+                    {
+                        "lo": 7000,
+                        "hi": 8000
+                    }
+                },
+                "bayes": 1,
+                "ct_curve":
+                [
+                    2873.0, 1.0463, 0.5142,
+                    2965.0, 1.0233, 0.5284,
+                    3606.0, 0.8947, 0.6314,
+                    4700.0, 0.7665, 0.7897,
+                    5890.0, 0.7055, 0.8933,
+                    7600.0, 0.6482, 1.0119
+                ],
+                "sensitivity_r": 1.0,
+                "sensitivity_b": 1.0,
+                "transverse_pos": 0.04072,
+                "transverse_neg": 0.03906
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.238, 1.238, 1.238, 1.234, 1.227, 1.216, 1.207, 1.198, 1.191, 1.179, 1.169, 1.162, 1.155, 1.153, 1.152, 1.152, 1.152, 1.153, 1.154, 1.157, 1.166, 1.176, 1.183, 1.191, 1.204, 1.216, 1.226, 1.232, 1.239, 1.241, 1.241, 1.242,
+                            1.235, 1.234, 1.227, 1.222, 1.214, 1.203, 1.193, 1.184, 1.169, 1.161, 1.149, 1.139, 1.131, 1.126, 1.122, 1.121, 1.121, 1.123, 1.129, 1.136, 1.145, 1.157, 1.163, 1.175, 1.189, 1.199, 1.212, 1.221, 1.225, 1.231, 1.241, 1.242,
+                            1.234, 1.227, 1.222, 1.214, 1.203, 1.193, 1.183, 1.169, 1.158, 1.145, 1.133, 1.123, 1.113, 1.106, 1.101, 1.101, 1.101, 1.105, 1.111, 1.116, 1.128, 1.137, 1.149, 1.163, 1.174, 1.189, 1.199, 1.212, 1.221, 1.226, 1.234, 1.241,
+                            1.234, 1.226, 1.217, 1.209, 1.195, 1.183, 1.171, 1.158, 1.145, 1.131, 1.119, 1.108, 1.097, 1.088, 1.088, 1.085, 1.085, 1.087, 1.095, 1.102, 1.114, 1.124, 1.137, 1.149, 1.165, 1.176, 1.194, 1.207, 1.214, 1.224, 1.235, 1.247,
+                            1.238, 1.224, 1.213, 1.202, 1.187, 1.175, 1.161, 1.146, 1.132, 1.117, 1.105, 1.094, 1.082, 1.074, 1.071, 1.071, 1.071, 1.073, 1.079, 1.089, 1.099, 1.112, 1.124, 1.137, 1.152, 1.167, 1.183, 1.198, 1.211, 1.222, 1.235, 1.249,
+                            1.232, 1.221, 1.209, 1.195, 1.178, 1.163, 1.149, 1.134, 1.118, 1.104, 1.093, 1.079, 1.069, 1.061, 1.057, 1.056, 1.056, 1.059, 1.066, 1.073, 1.086, 1.098, 1.111, 1.124, 1.141, 1.157, 1.173, 1.188, 1.203, 1.219, 1.234, 1.251,
+                            1.231, 1.213, 1.197, 1.186, 1.169, 1.151, 1.137, 1.121, 1.104, 1.093, 1.079, 1.068, 1.056, 1.048, 1.045, 1.042, 1.042, 1.045, 1.051, 1.061, 1.071, 1.085, 1.098, 1.111, 1.129, 1.145, 1.161, 1.179, 1.197, 1.215, 1.231, 1.249,
+                            1.224, 1.211, 1.194, 1.178, 1.161, 1.141, 1.127, 1.109, 1.094, 1.081, 1.068, 1.055, 1.047, 1.038, 1.034, 1.032, 1.032, 1.035, 1.039, 1.048, 1.059, 1.071, 1.086, 1.098, 1.116, 1.134, 1.154, 1.172, 1.191, 1.209, 1.228, 1.249,
+                            1.223, 1.206, 1.187, 1.171, 1.152, 1.132, 1.117, 1.098, 1.082, 1.069, 1.056, 1.045, 1.037, 1.028, 1.024, 1.022, 1.022, 1.025, 1.031, 1.039, 1.048, 1.059, 1.074, 1.091, 1.106, 1.126, 1.144, 1.163, 1.186, 1.205, 1.227, 1.247,
+                            1.222, 1.199, 1.183, 1.164, 1.143, 1.126, 1.108, 1.091, 1.075, 1.059, 1.045, 1.037, 1.028, 1.019, 1.015, 1.014, 1.014, 1.018, 1.023, 1.031, 1.042, 1.051, 1.065, 1.081, 1.098, 1.118, 1.137, 1.158, 1.181, 1.201, 1.224, 1.245,
+                            1.221, 1.198, 1.179, 1.163, 1.141, 1.119, 1.101, 1.083, 1.066, 1.051, 1.038, 1.028, 1.019, 1.012, 1.009, 1.008, 1.007, 1.008, 1.015, 1.023, 1.033, 1.044, 1.058, 1.072, 1.089, 1.107, 1.131, 1.152, 1.172, 1.196, 1.216, 1.241,
+                            1.216, 1.194, 1.174, 1.155, 1.133, 1.112, 1.094, 1.074, 1.059, 1.045, 1.032, 1.021, 1.012, 1.007, 1.003, 1.002, 1.002, 1.003, 1.008, 1.015, 1.025, 1.038, 1.049, 1.067, 1.084, 1.102, 1.126, 1.147, 1.169, 1.191, 1.214, 1.238,
+                            1.212, 1.188, 1.171, 1.149, 1.127, 1.105, 1.087, 1.069, 1.055, 1.039, 1.027, 1.016, 1.007, 1.003, 0.999, 0.997, 0.998, 1.001, 1.003, 1.011, 1.021, 1.032, 1.043, 1.059, 1.077, 1.101, 1.121, 1.142, 1.164, 1.187, 1.211, 1.236,
+                            1.208, 1.187, 1.169, 1.149, 1.124, 1.104, 1.085, 1.067, 1.051, 1.036, 1.024, 1.013, 1.005, 0.999, 0.996, 0.994, 0.994, 0.996, 1.001, 1.006, 1.017, 1.025, 1.038, 1.053, 1.072, 1.093, 1.116, 1.138, 1.159, 1.183, 1.207, 1.235,
+                            1.208, 1.181, 1.164, 1.144, 1.122, 1.098, 1.079, 1.062, 1.046, 1.033, 1.018, 1.009, 1.002, 0.996, 0.992, 0.989, 0.991, 0.994, 0.996, 1.002, 1.012, 1.021, 1.035, 1.051, 1.069, 1.091, 1.113, 1.137, 1.157, 1.182, 1.206, 1.233,
+                            1.206, 1.179, 1.163, 1.142, 1.119, 1.098, 1.079, 1.061, 1.045, 1.031, 1.017, 1.008, 1.001, 0.995, 0.991, 0.989, 0.989, 0.992, 0.996, 1.001, 1.011, 1.019, 1.034, 1.051, 1.069, 1.089, 1.112, 1.136, 1.157, 1.181, 1.205, 1.233,
+                            1.206, 1.179, 1.163, 1.139, 1.119, 1.098, 1.079, 1.061, 1.044, 1.031, 1.016, 1.007, 1.001, 0.995, 0.991, 0.989, 0.989, 0.991, 0.996, 1.002, 1.011, 1.019, 1.034, 1.049, 1.069, 1.088, 1.113, 1.136, 1.156, 1.179, 1.204, 1.233,
+                            1.207, 1.179, 1.163, 1.139, 1.119, 1.099, 1.079, 1.061, 1.044, 1.031, 1.017, 1.007, 1.001, 0.995, 0.991, 0.989, 0.989, 0.992, 0.997, 1.003, 1.011, 1.021, 1.034, 1.051, 1.071, 1.089, 1.112, 1.136, 1.157, 1.179, 1.204, 1.233,
+                            1.207, 1.179, 1.163, 1.143, 1.121, 1.101, 1.082, 1.063, 1.047, 1.032, 1.019, 1.009, 1.003, 0.998, 0.994, 0.991, 0.991, 0.995, 0.999, 1.004, 1.013, 1.024, 1.038, 1.052, 1.071, 1.091, 1.112, 1.136, 1.159, 1.181, 1.205, 1.233,
+                            1.207, 1.185, 1.166, 1.148, 1.124, 1.104, 1.087, 1.068, 1.052, 1.037, 1.025, 1.016, 1.006, 1.002, 0.998, 0.995, 0.995, 0.999, 1.003, 1.008, 1.017, 1.029, 1.043, 1.056, 1.076, 1.094, 1.116, 1.138, 1.159, 1.183, 1.205, 1.232,
+                            1.211, 1.186, 1.167, 1.151, 1.128, 1.108, 1.089, 1.072, 1.057, 1.042, 1.031, 1.021, 1.013, 1.006, 1.002, 0.999, 0.999, 1.003, 1.007, 1.013, 1.021, 1.031, 1.047, 1.062, 1.081, 1.098, 1.121, 1.141, 1.164, 1.185, 1.207, 1.232,
+                            1.211, 1.188, 1.169, 1.154, 1.134, 1.114, 1.094, 1.078, 1.063, 1.051, 1.039, 1.028, 1.019, 1.013, 1.007, 1.006, 1.006, 1.007, 1.013, 1.019, 1.027, 1.039, 1.051, 1.069, 1.087, 1.105, 1.124, 1.146, 1.165, 1.186, 1.209, 1.232,
+                            1.214, 1.191, 1.175, 1.159, 1.141, 1.123, 1.105, 1.087, 1.072, 1.058, 1.046, 1.036, 1.028, 1.019, 1.014, 1.013, 1.013, 1.015, 1.019, 1.027, 1.037, 1.048, 1.061, 1.076, 1.094, 1.109, 1.132, 1.149, 1.169, 1.189, 1.209, 1.233,
+                            1.219, 1.194, 1.179, 1.163, 1.146, 1.129, 1.113, 1.095, 1.081, 1.066, 1.055, 1.045, 1.036, 1.029, 1.023, 1.021, 1.021, 1.026, 1.031, 1.037, 1.048, 1.057, 1.069, 1.085, 1.101, 1.118, 1.137, 1.156, 1.174, 1.193, 1.213, 1.233,
+                            1.219, 1.199, 1.184, 1.172, 1.155, 1.138, 1.122, 1.104, 1.088, 1.075, 1.065, 1.055, 1.045, 1.038, 1.034, 1.031, 1.031, 1.035, 1.041, 1.048, 1.057, 1.066, 1.081, 1.096, 1.111, 1.125, 1.146, 1.164, 1.178, 1.196, 1.214, 1.233,
+                            1.222, 1.204, 1.189, 1.178, 1.162, 1.148, 1.132, 1.115, 1.101, 1.087, 1.075, 1.064, 1.055, 1.048, 1.043, 1.042, 1.042, 1.046, 1.049, 1.057, 1.066, 1.076, 1.089, 1.106, 1.121, 1.133, 1.149, 1.167, 1.183, 1.199, 1.215, 1.234,
+                            1.222, 1.205, 1.191, 1.184, 1.171, 1.155, 1.142, 1.124, 1.109, 1.097, 1.087, 1.077, 1.065, 1.059, 1.055, 1.053, 1.053, 1.057, 1.059, 1.067, 1.076, 1.088, 1.102, 1.116, 1.131, 1.143, 1.157, 1.175, 1.187, 1.202, 1.215, 1.231,
+                            1.223, 1.211, 1.198, 1.189, 1.178, 1.165, 1.151, 1.136, 1.122, 1.108, 1.097, 1.087, 1.079, 1.073, 1.067, 1.066, 1.066, 1.069, 1.074, 1.079, 1.088, 1.101, 1.114, 1.128, 1.141, 1.152, 1.166, 1.182, 1.194, 1.205, 1.215, 1.229,
+                            1.223, 1.212, 1.204, 1.197, 1.186, 1.173, 1.161, 1.149, 1.133, 1.121, 1.108, 1.101, 1.092, 1.085, 1.082, 1.082, 1.082, 1.085, 1.091, 1.096, 1.101, 1.113, 1.125, 1.138, 1.151, 1.164, 1.175, 1.188, 1.198, 1.207, 1.215, 1.222,
+                            1.217, 1.213, 1.211, 1.203, 1.194, 1.181, 1.169, 1.158, 1.145, 1.133, 1.123, 1.113, 1.106, 1.097, 1.096, 1.094, 1.094, 1.098, 1.104, 1.108, 1.114, 1.124, 1.137, 1.149, 1.161, 1.172, 1.182, 1.194, 1.203, 1.209, 1.211, 1.217,
+                            1.214, 1.211, 1.209, 1.206, 1.201, 1.188, 1.179, 1.168, 1.154, 1.144, 1.136, 1.126, 1.119, 1.112, 1.109, 1.108, 1.108, 1.108, 1.117, 1.119, 1.124, 1.133, 1.147, 1.158, 1.171, 1.178, 1.188, 1.198, 1.205, 1.208, 1.209, 1.211,
+                            1.207, 1.208, 1.209, 1.206, 1.202, 1.192, 1.182, 1.171, 1.159, 1.146, 1.142, 1.136, 1.126, 1.119, 1.116, 1.114, 1.115, 1.117, 1.119, 1.128, 1.129, 1.136, 1.155, 1.162, 1.176, 1.182, 1.188, 1.198, 1.205, 1.208, 1.207, 1.206
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.879, 1.878, 1.872, 1.862, 1.856, 1.842, 1.826, 1.815, 1.811, 1.799, 1.787, 1.777, 1.768, 1.761, 1.761, 1.761, 1.762, 1.763, 1.764, 1.769, 1.776, 1.789, 1.799, 1.807, 1.824, 1.841, 1.853, 1.861, 1.871, 1.874, 1.885, 1.889,
+                            1.879, 1.875, 1.859, 1.846, 1.835, 1.817, 1.806, 1.794, 1.777, 1.771, 1.755, 1.743, 1.733, 1.726, 1.721, 1.721, 1.721, 1.722, 1.729, 1.734, 1.747, 1.759, 1.771, 1.783, 1.801, 1.813, 1.831, 1.841, 1.849, 1.862, 1.876, 1.888,
+                            1.876, 1.861, 1.846, 1.835, 1.817, 1.806, 1.793, 1.777, 1.766, 1.752, 1.736, 1.727, 1.713, 1.702, 1.696, 1.695, 1.695, 1.697, 1.704, 1.715, 1.725, 1.739, 1.754, 1.771, 1.783, 1.801, 1.813, 1.831, 1.841, 1.851, 1.866, 1.888,
+                            1.878, 1.861, 1.843, 1.829, 1.811, 1.794, 1.779, 1.766, 1.751, 1.734, 1.721, 1.711, 1.695, 1.682, 1.679, 1.677, 1.677, 1.678, 1.687, 1.696, 1.713, 1.723, 1.737, 1.754, 1.774, 1.785, 1.811, 1.825, 1.833, 1.849, 1.866, 1.889,
+                            1.882, 1.859, 1.837, 1.821, 1.803, 1.784, 1.769, 1.752, 1.735, 1.717, 1.701, 1.689, 1.676, 1.664, 1.659, 1.658, 1.658, 1.659, 1.668, 1.679, 1.694, 1.711, 1.723, 1.739, 1.756, 1.777, 1.797, 1.813, 1.827, 1.844, 1.865, 1.889,
+                            1.869, 1.849, 1.832, 1.811, 1.792, 1.772, 1.755, 1.737, 1.717, 1.699, 1.688, 1.674, 1.661, 1.646, 1.642, 1.638, 1.638, 1.641, 1.651, 1.659, 1.676, 1.693, 1.708, 1.724, 1.744, 1.763, 1.783, 1.801, 1.819, 1.838, 1.864, 1.889,
+                            1.869, 1.841, 1.817, 1.801, 1.782, 1.758, 1.741, 1.721, 1.699, 1.688, 1.674, 1.658, 1.643, 1.632, 1.627, 1.621, 1.621, 1.622, 1.631, 1.643, 1.658, 1.676, 1.689, 1.708, 1.729, 1.748, 1.767, 1.791, 1.812, 1.836, 1.859, 1.891,
+                            1.861, 1.836, 1.814, 1.792, 1.772, 1.745, 1.728, 1.707, 1.688, 1.673, 1.658, 1.643, 1.629, 1.618, 1.612, 1.609, 1.609, 1.611, 1.615, 1.629, 1.642, 1.658, 1.676, 1.689, 1.711, 1.734, 1.758, 1.782, 1.804, 1.827, 1.859, 1.891,
+                            1.861, 1.829, 1.807, 1.784, 1.759, 1.735, 1.717, 1.692, 1.674, 1.659, 1.644, 1.629, 1.617, 1.605, 1.598, 1.595, 1.595, 1.598, 1.607, 1.615, 1.631, 1.642, 1.661, 1.681, 1.701, 1.724, 1.746, 1.771, 1.799, 1.825, 1.857, 1.891,
+                            1.861, 1.826, 1.804, 1.779, 1.749, 1.729, 1.707, 1.687, 1.665, 1.648, 1.629, 1.617, 1.604, 1.595, 1.589, 1.585, 1.585, 1.592, 1.597, 1.607, 1.623, 1.635, 1.652, 1.674, 1.693, 1.716, 1.739, 1.766, 1.794, 1.822, 1.855, 1.889,
+                            1.861, 1.824, 1.799, 1.777, 1.748, 1.723, 1.701, 1.678, 1.657, 1.639, 1.619, 1.605, 1.596, 1.586, 1.581, 1.579, 1.577, 1.579, 1.588, 1.597, 1.612, 1.625, 1.641, 1.661, 1.681, 1.702, 1.732, 1.757, 1.785, 1.813, 1.847, 1.882,
+                            1.856, 1.819, 1.796, 1.767, 1.739, 1.714, 1.693, 1.666, 1.651, 1.629, 1.613, 1.597, 1.586, 1.579, 1.576, 1.572, 1.572, 1.573, 1.579, 1.588, 1.602, 1.619, 1.633, 1.655, 1.674, 1.698, 1.729, 1.754, 1.782, 1.809, 1.842, 1.874,
+                            1.853, 1.815, 1.792, 1.761, 1.734, 1.707, 1.682, 1.659, 1.639, 1.622, 1.605, 1.591, 1.579, 1.574, 1.569, 1.565, 1.566, 1.569, 1.573, 1.584, 1.597, 1.609, 1.624, 1.645, 1.666, 1.695, 1.722, 1.746, 1.772, 1.799, 1.835, 1.873,
+                            1.847, 1.811, 1.789, 1.759, 1.732, 1.703, 1.681, 1.657, 1.637, 1.619, 1.603, 1.588, 1.575, 1.569, 1.563, 1.561, 1.561, 1.563, 1.569, 1.576, 1.589, 1.601, 1.616, 1.636, 1.659, 1.686, 1.712, 1.741, 1.767, 1.798, 1.832, 1.873,
+                            1.847, 1.803, 1.779, 1.756, 1.727, 1.699, 1.674, 1.652, 1.632, 1.616, 1.595, 1.583, 1.572, 1.564, 1.558, 1.556, 1.557, 1.559, 1.563, 1.569, 1.583, 1.593, 1.613, 1.633, 1.657, 1.684, 1.709, 1.741, 1.766, 1.796, 1.831, 1.871,
+                            1.845, 1.802, 1.779, 1.755, 1.725, 1.696, 1.673, 1.649, 1.629, 1.614, 1.595, 1.582, 1.572, 1.563, 1.557, 1.556, 1.556, 1.558, 1.562, 1.569, 1.581, 1.593, 1.612, 1.633, 1.656, 1.679, 1.709, 1.741, 1.764, 1.796, 1.828, 1.869,
+                            1.845, 1.801, 1.779, 1.749, 1.723, 1.697, 1.673, 1.649, 1.627, 1.613, 1.593, 1.581, 1.573, 1.563, 1.558, 1.555, 1.555, 1.556, 1.562, 1.573, 1.581, 1.594, 1.611, 1.633, 1.656, 1.679, 1.711, 1.739, 1.764, 1.794, 1.828, 1.869,
+                            1.844, 1.801, 1.781, 1.749, 1.723, 1.697, 1.673, 1.649, 1.627, 1.614, 1.595, 1.581, 1.574, 1.564, 1.559, 1.557, 1.556, 1.559, 1.564, 1.574, 1.582, 1.595, 1.611, 1.634, 1.659, 1.683, 1.709, 1.739, 1.765, 1.794, 1.829, 1.872,
+                            1.845, 1.802, 1.781, 1.754, 1.725, 1.701, 1.677, 1.652, 1.632, 1.616, 1.599, 1.586, 1.576, 1.569, 1.563, 1.559, 1.558, 1.562, 1.569, 1.576, 1.587, 1.599, 1.618, 1.635, 1.661, 1.685, 1.709, 1.739, 1.767, 1.796, 1.829, 1.868,
+                            1.845, 1.809, 1.785, 1.762, 1.731, 1.706, 1.685, 1.659, 1.641, 1.622, 1.606, 1.595, 1.581, 1.575, 1.569, 1.564, 1.564, 1.569, 1.574, 1.582, 1.594, 1.607, 1.625, 1.642, 1.668, 1.687, 1.716, 1.741, 1.769, 1.798, 1.829, 1.868,
+                            1.849, 1.811, 1.785, 1.765, 1.734, 1.709, 1.688, 1.666, 1.647, 1.628, 1.613, 1.601, 1.592, 1.581, 1.575, 1.572, 1.572, 1.575, 1.581, 1.589, 1.599, 1.611, 1.631, 1.649, 1.673, 1.694, 1.721, 1.747, 1.771, 1.798, 1.829, 1.868,
+                            1.849, 1.816, 1.787, 1.766, 1.739, 1.716, 1.692, 1.673, 1.657, 1.641, 1.625, 1.612, 1.599, 1.592, 1.584, 1.581, 1.581, 1.581, 1.589, 1.598, 1.608, 1.622, 1.639, 1.659, 1.679, 1.701, 1.724, 1.751, 1.774, 1.802, 1.832, 1.868,
+                            1.855, 1.816, 1.793, 1.773, 1.748, 1.727, 1.707, 1.686, 1.667, 1.649, 1.636, 1.623, 1.612, 1.599, 1.594, 1.592, 1.591, 1.591, 1.598, 1.608, 1.621, 1.634, 1.649, 1.669, 1.693, 1.705, 1.736, 1.757, 1.778, 1.804, 1.833, 1.867,
+                            1.858, 1.818, 1.796, 1.778, 1.754, 1.733, 1.716, 1.695, 1.676, 1.661, 1.648, 1.635, 1.624, 1.613, 1.604, 1.601, 1.601, 1.606, 1.613, 1.621, 1.634, 1.646, 1.661, 1.679, 1.699, 1.714, 1.742, 1.761, 1.782, 1.809, 1.835, 1.867,
+                            1.857, 1.822, 1.801, 1.789, 1.766, 1.744, 1.726, 1.706, 1.688, 1.671, 1.659, 1.647, 1.635, 1.624, 1.621, 1.617, 1.617, 1.621, 1.627, 1.634, 1.645, 1.656, 1.674, 1.694, 1.709, 1.723, 1.751, 1.771, 1.786, 1.811, 1.837, 1.867,
+                            1.858, 1.824, 1.807, 1.794, 1.774, 1.757, 1.739, 1.716, 1.702, 1.687, 1.671, 1.662, 1.648, 1.636, 1.629, 1.629, 1.629, 1.633, 1.635, 1.646, 1.656, 1.669, 1.684, 1.705, 1.719, 1.732, 1.753, 1.774, 1.793, 1.815, 1.837, 1.871,
+                            1.858, 1.827, 1.809, 1.798, 1.782, 1.761, 1.749, 1.727, 1.711, 1.698, 1.687, 1.675, 1.663, 1.649, 1.646, 1.643, 1.643, 1.646, 1.649, 1.658, 1.669, 1.683, 1.698, 1.716, 1.731, 1.746, 1.761, 1.783, 1.795, 1.817, 1.836, 1.862,
+                            1.862, 1.834, 1.816, 1.805, 1.789, 1.774, 1.759, 1.743, 1.725, 1.711, 1.697, 1.688, 1.678, 1.668, 1.661, 1.659, 1.658, 1.659, 1.668, 1.673, 1.684, 1.698, 1.713, 1.728, 1.742, 1.757, 1.771, 1.791, 1.804, 1.821, 1.836, 1.862,
+                            1.859, 1.835, 1.825, 1.813, 1.794, 1.782, 1.771, 1.757, 1.739, 1.725, 1.711, 1.701, 1.693, 1.683, 1.679, 1.679, 1.679, 1.683, 1.689, 1.693, 1.698, 1.714, 1.726, 1.741, 1.754, 1.769, 1.781, 1.797, 1.808, 1.821, 1.835, 1.856,
+                            1.848, 1.836, 1.832, 1.822, 1.806, 1.789, 1.778, 1.765, 1.751, 1.739, 1.726, 1.718, 1.709, 1.699, 1.696, 1.695, 1.695, 1.696, 1.704, 1.705, 1.714, 1.724, 1.739, 1.753, 1.765, 1.777, 1.789, 1.803, 1.816, 1.824, 1.829, 1.842,
+                            1.839, 1.835, 1.834, 1.829, 1.815, 1.801, 1.787, 1.776, 1.759, 1.751, 1.744, 1.736, 1.724, 1.714, 1.711, 1.708, 1.707, 1.707, 1.717, 1.719, 1.724, 1.734, 1.748, 1.762, 1.775, 1.783, 1.796, 1.808, 1.819, 1.825, 1.828, 1.833,
+                            1.836, 1.833, 1.834, 1.832, 1.821, 1.806, 1.792, 1.785, 1.772, 1.759, 1.751, 1.744, 1.736, 1.725, 1.719, 1.715, 1.715, 1.718, 1.721, 1.728, 1.734, 1.736, 1.757, 1.768, 1.779, 1.787, 1.799, 1.812, 1.821, 1.824, 1.825, 1.833
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.189, 2.127, 2.115, 2.106, 2.113, 2.119, 2.131, 2.144, 2.155, 2.168, 2.176, 2.179, 2.181, 2.181, 2.185, 2.187, 2.187, 2.183, 2.179, 2.176, 2.169, 2.167, 2.159, 2.152, 2.145, 2.141, 2.135, 2.128, 2.124, 2.124, 2.139, 2.177,
+                            2.176, 2.133, 2.116, 2.112, 2.116, 2.125, 2.137, 2.154, 2.168, 2.179, 2.187, 2.194, 2.201, 2.204, 2.208, 2.208, 2.205, 2.202, 2.198, 2.195, 2.183, 2.177, 2.166, 2.159, 2.149, 2.143, 2.138, 2.132, 2.124, 2.125, 2.136, 2.164,
+                            2.175, 2.133, 2.117, 2.115, 2.121, 2.136, 2.154, 2.165, 2.179, 2.192, 2.198, 2.211, 2.218, 2.219, 2.221, 2.221, 2.217, 2.216, 2.211, 2.202, 2.197, 2.188, 2.181, 2.171, 2.159, 2.151, 2.141, 2.136, 2.125, 2.125, 2.132, 2.155,
+                            2.172, 2.128, 2.116, 2.116, 2.124, 2.143, 2.161, 2.177, 2.192, 2.204, 2.213, 2.221, 2.227, 2.231, 2.237, 2.237, 2.229, 2.224, 2.221, 2.213, 2.207, 2.197, 2.191, 2.179, 2.169, 2.156, 2.148, 2.138, 2.126, 2.123, 2.124, 2.149,
+                            2.169, 2.124, 2.119, 2.119, 2.135, 2.152, 2.174, 2.187, 2.204, 2.211, 2.224, 2.233, 2.236, 2.241, 2.246, 2.246, 2.243, 2.237, 2.234, 2.226, 2.218, 2.211, 2.199, 2.191, 2.177, 2.166, 2.155, 2.139, 2.129, 2.121, 2.121, 2.143,
+                            2.157, 2.124, 2.121, 2.127, 2.145, 2.157, 2.181, 2.197, 2.208, 2.221, 2.238, 2.245, 2.249, 2.249, 2.254, 2.254, 2.249, 2.247, 2.243, 2.237, 2.228, 2.219, 2.209, 2.198, 2.186, 2.172, 2.161, 2.143, 2.129, 2.121, 2.121, 2.141,
+                            2.157, 2.124, 2.124, 2.131, 2.148, 2.161, 2.188, 2.202, 2.214, 2.238, 2.246, 2.251, 2.255, 2.257, 2.259, 2.259, 2.257, 2.252, 2.251, 2.247, 2.238, 2.231, 2.219, 2.204, 2.193, 2.173, 2.166, 2.152, 2.134, 2.119, 2.119, 2.131,
+                            2.155, 2.125, 2.125, 2.135, 2.151, 2.169, 2.191, 2.207, 2.219, 2.243, 2.253, 2.258, 2.261, 2.266, 2.266, 2.267, 2.265, 2.262, 2.261, 2.254, 2.244, 2.238, 2.228, 2.212, 2.197, 2.179, 2.167, 2.158, 2.137, 2.122, 2.121, 2.131,
+                            2.155, 2.127, 2.127, 2.137, 2.153, 2.173, 2.197, 2.213, 2.231, 2.248, 2.257, 2.266, 2.271, 2.272, 2.274, 2.275, 2.275, 2.273, 2.271, 2.266, 2.257, 2.251, 2.238, 2.227, 2.209, 2.195, 2.175, 2.159, 2.141, 2.128, 2.127, 2.131,
+                            2.155, 2.128, 2.128, 2.139, 2.159, 2.182, 2.206, 2.225, 2.243, 2.252, 2.265, 2.272, 2.277, 2.283, 2.286, 2.284, 2.283, 2.282, 2.274, 2.272, 2.266, 2.256, 2.244, 2.238, 2.221, 2.202, 2.186, 2.169, 2.149, 2.129, 2.129, 2.135,
+                            2.154, 2.131, 2.131, 2.149, 2.166, 2.189, 2.211, 2.234, 2.248, 2.262, 2.272, 2.277, 2.287, 2.291, 2.293, 2.292, 2.291, 2.285, 2.284, 2.279, 2.272, 2.263, 2.254, 2.243, 2.226, 2.206, 2.193, 2.174, 2.153, 2.133, 2.133, 2.135,
+                            2.153, 2.135, 2.135, 2.151, 2.172, 2.198, 2.221, 2.238, 2.255, 2.265, 2.274, 2.287, 2.291, 2.296, 2.298, 2.298, 2.301, 2.297, 2.289, 2.285, 2.277, 2.271, 2.261, 2.251, 2.236, 2.216, 2.199, 2.179, 2.158, 2.135, 2.134, 2.135,
+                            2.152, 2.136, 2.136, 2.154, 2.176, 2.199, 2.224, 2.239, 2.256, 2.267, 2.282, 2.289, 2.295, 2.299, 2.303, 2.303, 2.302, 2.299, 2.297, 2.288, 2.284, 2.274, 2.262, 2.253, 2.238, 2.219, 2.202, 2.181, 2.158, 2.137, 2.135, 2.135,
+                            2.143, 2.134, 2.134, 2.154, 2.177, 2.201, 2.224, 2.241, 2.256, 2.271, 2.282, 2.289, 2.297, 2.302, 2.306, 2.306, 2.304, 2.301, 2.298, 2.289, 2.287, 2.272, 2.265, 2.255, 2.241, 2.221, 2.203, 2.183, 2.164, 2.141, 2.136, 2.135,
+                            2.142, 2.133, 2.133, 2.155, 2.178, 2.202, 2.223, 2.243, 2.258, 2.273, 2.283, 2.288, 2.296, 2.299, 2.306, 2.306, 2.301, 2.299, 2.296, 2.289, 2.286, 2.271, 2.267, 2.256, 2.244, 2.219, 2.206, 2.188, 2.163, 2.141, 2.137, 2.134,
+                            2.141, 2.131, 2.131, 2.153, 2.179, 2.202, 2.224, 2.242, 2.254, 2.274, 2.283, 2.288, 2.295, 2.298, 2.301, 2.301, 2.301, 2.296, 2.295, 2.289, 2.285, 2.271, 2.267, 2.257, 2.246, 2.223, 2.204, 2.188, 2.165, 2.141, 2.136, 2.134,
+                            2.141, 2.133, 2.133, 2.151, 2.179, 2.201, 2.224, 2.241, 2.254, 2.275, 2.283, 2.288, 2.294, 2.296, 2.298, 2.297, 2.295, 2.295, 2.294, 2.291, 2.284, 2.272, 2.267, 2.256, 2.248, 2.225, 2.208, 2.192, 2.167, 2.141, 2.137, 2.134,
+                            2.141, 2.132, 2.132, 2.151, 2.177, 2.199, 2.221, 2.238, 2.252, 2.274, 2.281, 2.287, 2.293, 2.295, 2.296, 2.294, 2.295, 2.295, 2.294, 2.291, 2.284, 2.274, 2.266, 2.257, 2.248, 2.226, 2.206, 2.189, 2.167, 2.143, 2.141, 2.141,
+                            2.141, 2.133, 2.133, 2.153, 2.175, 2.201, 2.221, 2.238, 2.252, 2.271, 2.278, 2.284, 2.288, 2.291, 2.292, 2.291, 2.293, 2.293, 2.293, 2.287, 2.279, 2.275, 2.266, 2.256, 2.243, 2.224, 2.206, 2.189, 2.168, 2.146, 2.142, 2.134,
+                            2.137, 2.131, 2.131, 2.154, 2.173, 2.199, 2.221, 2.236, 2.251, 2.267, 2.272, 2.278, 2.284, 2.287, 2.288, 2.286, 2.288, 2.288, 2.288, 2.283, 2.277, 2.273, 2.265, 2.256, 2.241, 2.219, 2.205, 2.187, 2.167, 2.144, 2.137, 2.132,
+                            2.136, 2.131, 2.131, 2.152, 2.169, 2.197, 2.218, 2.233, 2.246, 2.257, 2.269, 2.274, 2.281, 2.284, 2.286, 2.285, 2.286, 2.286, 2.286, 2.279, 2.274, 2.269, 2.263, 2.254, 2.239, 2.217, 2.203, 2.181, 2.162, 2.143, 2.133, 2.131,
+                            2.136, 2.131, 2.131, 2.151, 2.167, 2.189, 2.205, 2.226, 2.242, 2.253, 2.261, 2.271, 2.275, 2.279, 2.283, 2.283, 2.284, 2.284, 2.281, 2.277, 2.271, 2.264, 2.257, 2.246, 2.232, 2.215, 2.195, 2.176, 2.158, 2.141, 2.131, 2.128,
+                            2.136, 2.129, 2.131, 2.147, 2.162, 2.181, 2.203, 2.219, 2.236, 2.246, 2.256, 2.263, 2.271, 2.274, 2.278, 2.278, 2.276, 2.277, 2.276, 2.273, 2.266, 2.258, 2.251, 2.241, 2.227, 2.198, 2.191, 2.169, 2.154, 2.136, 2.125, 2.122,
+                            2.132, 2.126, 2.126, 2.139, 2.153, 2.168, 2.194, 2.212, 2.224, 2.238, 2.251, 2.258, 2.263, 2.266, 2.269, 2.271, 2.269, 2.269, 2.269, 2.267, 2.259, 2.253, 2.245, 2.237, 2.219, 2.196, 2.179, 2.162, 2.149, 2.132, 2.122, 2.121,
+                            2.124, 2.119, 2.121, 2.137, 2.147, 2.164, 2.183, 2.199, 2.219, 2.231, 2.239, 2.251, 2.257, 2.261, 2.262, 2.262, 2.259, 2.259, 2.261, 2.258, 2.253, 2.245, 2.237, 2.224, 2.209, 2.187, 2.174, 2.157, 2.141, 2.122, 2.121, 2.121,
+                            2.123, 2.115, 2.115, 2.131, 2.138, 2.157, 2.174, 2.188, 2.207, 2.221, 2.233, 2.239, 2.243, 2.244, 2.244, 2.244, 2.246, 2.245, 2.246, 2.244, 2.241, 2.231, 2.224, 2.212, 2.195, 2.176, 2.159, 2.145, 2.128, 2.117, 2.117, 2.123,
+                            2.123, 2.113, 2.113, 2.123, 2.132, 2.141, 2.162, 2.177, 2.191, 2.208, 2.221, 2.231, 2.231, 2.232, 2.234, 2.235, 2.235, 2.235, 2.238, 2.237, 2.225, 2.214, 2.209, 2.199, 2.181, 2.164, 2.146, 2.135, 2.123, 2.116, 2.116, 2.115,
+                            2.129, 2.115, 2.115, 2.121, 2.128, 2.135, 2.149, 2.164, 2.178, 2.193, 2.207, 2.221, 2.222, 2.222, 2.223, 2.224, 2.224, 2.224, 2.224, 2.223, 2.214, 2.205, 2.196, 2.185, 2.171, 2.151, 2.141, 2.129, 2.119, 2.116, 2.116, 2.117,
+                            2.137, 2.119, 2.119, 2.119, 2.122, 2.129, 2.141, 2.159, 2.167, 2.182, 2.195, 2.206, 2.211, 2.216, 2.218, 2.219, 2.219, 2.219, 2.217, 2.212, 2.202, 2.194, 2.184, 2.174, 2.162, 2.145, 2.134, 2.124, 2.118, 2.117, 2.118, 2.121,
+                            2.138, 2.131, 2.121, 2.122, 2.125, 2.128, 2.137, 2.154, 2.162, 2.176, 2.187, 2.194, 2.196, 2.198, 2.205, 2.205, 2.202, 2.202, 2.203, 2.201, 2.191, 2.182, 2.174, 2.162, 2.149, 2.136, 2.126, 2.121, 2.119, 2.118, 2.127, 2.133,
+                            2.157, 2.148, 2.131, 2.129, 2.129, 2.136, 2.148, 2.157, 2.169, 2.177, 2.182, 2.187, 2.188, 2.191, 2.193, 2.193, 2.192, 2.199, 2.201, 2.199, 2.186, 2.178, 2.167, 2.152, 2.146, 2.137, 2.126, 2.124, 2.121, 2.126, 2.133, 2.151,
+                            2.161, 2.157, 2.148, 2.147, 2.147, 2.147, 2.154, 2.162, 2.174, 2.179, 2.181, 2.184, 2.186, 2.187, 2.189, 2.189, 2.187, 2.188, 2.199, 2.201, 2.187, 2.178, 2.163, 2.148, 2.145, 2.141, 2.131, 2.129, 2.128, 2.135, 2.151, 2.153
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.191, 1.165, 1.156, 1.155, 1.157, 1.161, 1.168, 1.176, 1.179, 1.185, 1.187, 1.189, 1.189, 1.189, 1.191, 1.191, 1.191, 1.189, 1.188, 1.188, 1.185, 1.184, 1.182, 1.178, 1.173, 1.171, 1.166, 1.163, 1.159, 1.159, 1.164, 1.187,
+                            1.188, 1.164, 1.157, 1.156, 1.158, 1.166, 1.173, 1.179, 1.185, 1.193, 1.195, 1.198, 1.199, 1.201, 1.201, 1.202, 1.201, 1.199, 1.199, 1.196, 1.194, 1.189, 1.185, 1.182, 1.177, 1.172, 1.168, 1.164, 1.161, 1.161, 1.162, 1.181,
+                            1.184, 1.164, 1.157, 1.157, 1.161, 1.171, 1.179, 1.185, 1.193, 1.197, 1.201, 1.206, 1.208, 1.209, 1.209, 1.208, 1.207, 1.207, 1.207, 1.202, 1.199, 1.195, 1.192, 1.189, 1.182, 1.176, 1.171, 1.166, 1.161, 1.159, 1.161, 1.177,
+                            1.183, 1.162, 1.158, 1.158, 1.163, 1.174, 1.182, 1.191, 1.197, 1.203, 1.208, 1.212, 1.214, 1.214, 1.218, 1.218, 1.214, 1.212, 1.211, 1.208, 1.206, 1.201, 1.197, 1.192, 1.189, 1.179, 1.174, 1.168, 1.162, 1.159, 1.159, 1.173,
+                            1.181, 1.159, 1.159, 1.159, 1.168, 1.178, 1.189, 1.196, 1.204, 1.208, 1.213, 1.217, 1.219, 1.221, 1.222, 1.222, 1.222, 1.221, 1.219, 1.215, 1.212, 1.208, 1.202, 1.197, 1.189, 1.183, 1.178, 1.169, 1.163, 1.158, 1.158, 1.169,
+                            1.174, 1.159, 1.159, 1.164, 1.172, 1.179, 1.192, 1.201, 1.208, 1.212, 1.219, 1.224, 1.225, 1.227, 1.228, 1.228, 1.226, 1.225, 1.224, 1.221, 1.217, 1.212, 1.208, 1.202, 1.194, 1.187, 1.181, 1.172, 1.164, 1.157, 1.157, 1.169,
+                            1.174, 1.159, 1.159, 1.165, 1.174, 1.184, 1.197, 1.205, 1.209, 1.219, 1.224, 1.228, 1.231, 1.231, 1.231, 1.231, 1.229, 1.229, 1.228, 1.226, 1.222, 1.218, 1.212, 1.205, 1.199, 1.188, 1.181, 1.175, 1.165, 1.157, 1.157, 1.163,
+                            1.173, 1.159, 1.159, 1.165, 1.176, 1.186, 1.198, 1.207, 1.213, 1.223, 1.229, 1.231, 1.235, 1.236, 1.236, 1.236, 1.236, 1.235, 1.234, 1.232, 1.226, 1.223, 1.218, 1.209, 1.201, 1.192, 1.183, 1.178, 1.165, 1.157, 1.157, 1.163,
+                            1.172, 1.159, 1.159, 1.166, 1.176, 1.188, 1.201, 1.209, 1.217, 1.227, 1.231, 1.236, 1.238, 1.239, 1.241, 1.242, 1.242, 1.241, 1.239, 1.235, 1.232, 1.227, 1.223, 1.215, 1.208, 1.199, 1.187, 1.179, 1.167, 1.159, 1.159, 1.163,
+                            1.172, 1.159, 1.159, 1.166, 1.177, 1.189, 1.203, 1.212, 1.223, 1.228, 1.236, 1.239, 1.242, 1.245, 1.246, 1.246, 1.247, 1.246, 1.242, 1.241, 1.237, 1.232, 1.226, 1.223, 1.213, 1.202, 1.191, 1.182, 1.172, 1.159, 1.159, 1.163,
+                            1.168, 1.158, 1.158, 1.167, 1.179, 1.192, 1.204, 1.218, 1.225, 1.233, 1.238, 1.242, 1.246, 1.248, 1.251, 1.251, 1.249, 1.248, 1.247, 1.244, 1.239, 1.237, 1.228, 1.223, 1.214, 1.203, 1.194, 1.183, 1.173, 1.161, 1.161, 1.162,
+                            1.166, 1.158, 1.158, 1.168, 1.183, 1.195, 1.207, 1.218, 1.226, 1.233, 1.239, 1.246, 1.248, 1.251, 1.254, 1.254, 1.254, 1.251, 1.249, 1.247, 1.242, 1.239, 1.232, 1.227, 1.219, 1.207, 1.195, 1.186, 1.175, 1.162, 1.161, 1.162,
+                            1.165, 1.158, 1.158, 1.168, 1.183, 1.196, 1.208, 1.219, 1.227, 1.234, 1.241, 1.247, 1.251, 1.254, 1.255, 1.256, 1.256, 1.254, 1.252, 1.249, 1.246, 1.241, 1.234, 1.228, 1.221, 1.211, 1.199, 1.187, 1.175, 1.163, 1.162, 1.162,
+                            1.161, 1.158, 1.158, 1.169, 1.183, 1.196, 1.208, 1.217, 1.227, 1.234, 1.241, 1.247, 1.253, 1.254, 1.256, 1.257, 1.256, 1.255, 1.253, 1.249, 1.247, 1.241, 1.236, 1.229, 1.221, 1.211, 1.199, 1.189, 1.176, 1.164, 1.163, 1.162,
+                            1.161, 1.156, 1.156, 1.169, 1.183, 1.196, 1.207, 1.218, 1.227, 1.235, 1.241, 1.246, 1.252, 1.254, 1.256, 1.257, 1.256, 1.254, 1.253, 1.249, 1.247, 1.241, 1.237, 1.231, 1.223, 1.211, 1.201, 1.191, 1.177, 1.164, 1.164, 1.161,
+                            1.161, 1.155, 1.155, 1.169, 1.182, 1.195, 1.208, 1.216, 1.225, 1.235, 1.241, 1.245, 1.249, 1.252, 1.254, 1.254, 1.254, 1.253, 1.252, 1.249, 1.246, 1.239, 1.237, 1.231, 1.224, 1.211, 1.201, 1.191, 1.178, 1.164, 1.162, 1.161,
+                            1.159, 1.155, 1.155, 1.168, 1.181, 1.195, 1.208, 1.217, 1.223, 1.235, 1.241, 1.244, 1.248, 1.251, 1.252, 1.252, 1.252, 1.252, 1.251, 1.248, 1.245, 1.241, 1.236, 1.231, 1.224, 1.212, 1.202, 1.191, 1.179, 1.164, 1.162, 1.161,
+                            1.158, 1.154, 1.154, 1.167, 1.181, 1.194, 1.206, 1.216, 1.222, 1.234, 1.237, 1.242, 1.245, 1.248, 1.251, 1.249, 1.249, 1.249, 1.249, 1.248, 1.244, 1.241, 1.235, 1.229, 1.223, 1.213, 1.202, 1.191, 1.179, 1.167, 1.163, 1.163,
+                            1.158, 1.154, 1.154, 1.168, 1.181, 1.194, 1.206, 1.215, 1.223, 1.231, 1.236, 1.239, 1.243, 1.245, 1.246, 1.246, 1.248, 1.248, 1.248, 1.245, 1.242, 1.239, 1.235, 1.229, 1.223, 1.213, 1.202, 1.191, 1.179, 1.167, 1.163, 1.162,
+                            1.157, 1.154, 1.154, 1.168, 1.179, 1.194, 1.205, 1.215, 1.222, 1.229, 1.233, 1.236, 1.239, 1.243, 1.244, 1.244, 1.245, 1.245, 1.244, 1.243, 1.239, 1.236, 1.234, 1.229, 1.222, 1.211, 1.202, 1.191, 1.179, 1.166, 1.163, 1.161,
+                            1.156, 1.155, 1.155, 1.168, 1.179, 1.193, 1.205, 1.213, 1.219, 1.225, 1.231, 1.234, 1.238, 1.239, 1.241, 1.243, 1.243, 1.243, 1.243, 1.239, 1.237, 1.235, 1.231, 1.228, 1.221, 1.209, 1.199, 1.189, 1.178, 1.166, 1.162, 1.159,
+                            1.156, 1.156, 1.157, 1.167, 1.178, 1.191, 1.199, 1.209, 1.217, 1.223, 1.226, 1.231, 1.233, 1.236, 1.239, 1.239, 1.241, 1.241, 1.239, 1.237, 1.235, 1.232, 1.229, 1.224, 1.217, 1.209, 1.196, 1.187, 1.176, 1.165, 1.159, 1.157,
+                            1.157, 1.157, 1.157, 1.166, 1.175, 1.187, 1.198, 1.205, 1.213, 1.219, 1.223, 1.227, 1.231, 1.233, 1.236, 1.236, 1.234, 1.235, 1.235, 1.235, 1.231, 1.229, 1.227, 1.222, 1.216, 1.201, 1.194, 1.184, 1.174, 1.163, 1.157, 1.156,
+                            1.158, 1.155, 1.155, 1.165, 1.172, 1.181, 1.194, 1.202, 1.208, 1.215, 1.221, 1.223, 1.227, 1.229, 1.231, 1.231, 1.231, 1.232, 1.233, 1.231, 1.228, 1.227, 1.223, 1.219, 1.213, 1.199, 1.189, 1.181, 1.171, 1.161, 1.157, 1.156,
+                            1.155, 1.154, 1.154, 1.164, 1.169, 1.179, 1.189, 1.196, 1.203, 1.208, 1.215, 1.221, 1.222, 1.224, 1.225, 1.225, 1.226, 1.228, 1.228, 1.227, 1.225, 1.222, 1.219, 1.213, 1.206, 1.196, 1.187, 1.177, 1.168, 1.159, 1.156, 1.156,
+                            1.155, 1.152, 1.152, 1.162, 1.167, 1.175, 1.185, 1.191, 1.198, 1.205, 1.209, 1.214, 1.216, 1.217, 1.217, 1.217, 1.219, 1.219, 1.219, 1.219, 1.217, 1.215, 1.213, 1.207, 1.199, 1.191, 1.179, 1.172, 1.165, 1.156, 1.155, 1.155,
+                            1.155, 1.152, 1.152, 1.161, 1.163, 1.169, 1.179, 1.186, 1.192, 1.198, 1.204, 1.208, 1.211, 1.211, 1.211, 1.212, 1.212, 1.213, 1.215, 1.215, 1.211, 1.208, 1.205, 1.199, 1.194, 1.185, 1.175, 1.167, 1.161, 1.156, 1.155, 1.153,
+                            1.157, 1.152, 1.152, 1.159, 1.162, 1.166, 1.174, 1.181, 1.187, 1.192, 1.197, 1.203, 1.204, 1.205, 1.204, 1.204, 1.204, 1.205, 1.206, 1.206, 1.204, 1.201, 1.198, 1.194, 1.187, 1.176, 1.171, 1.164, 1.159, 1.156, 1.155, 1.154,
+                            1.159, 1.154, 1.154, 1.158, 1.159, 1.163, 1.171, 1.176, 1.181, 1.187, 1.191, 1.195, 1.198, 1.199, 1.199, 1.201, 1.201, 1.202, 1.202, 1.199, 1.196, 1.193, 1.191, 1.188, 1.182, 1.174, 1.166, 1.162, 1.157, 1.156, 1.156, 1.156,
+                            1.162, 1.161, 1.158, 1.159, 1.159, 1.162, 1.167, 1.173, 1.178, 1.181, 1.186, 1.189, 1.189, 1.191, 1.193, 1.193, 1.193, 1.194, 1.194, 1.194, 1.189, 1.187, 1.186, 1.182, 1.176, 1.167, 1.163, 1.159, 1.158, 1.157, 1.158, 1.161,
+                            1.172, 1.165, 1.162, 1.162, 1.163, 1.166, 1.169, 1.173, 1.178, 1.181, 1.182, 1.185, 1.186, 1.186, 1.186, 1.187, 1.187, 1.189, 1.192, 1.191, 1.187, 1.185, 1.181, 1.177, 1.172, 1.167, 1.163, 1.159, 1.159, 1.161, 1.163, 1.166,
+                            1.173, 1.172, 1.166, 1.165, 1.166, 1.168, 1.171, 1.176, 1.179, 1.182, 1.181, 1.183, 1.185, 1.185, 1.185, 1.185, 1.185, 1.185, 1.191, 1.191, 1.185, 1.181, 1.179, 1.173, 1.169, 1.168, 1.163, 1.162, 1.161, 1.164, 1.166, 1.167
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    2.271, 2.218, 2.105, 2.004, 1.909, 1.829, 1.762, 1.705, 1.665, 1.629, 1.592, 1.559, 1.528, 1.516, 1.511, 1.511, 1.511, 1.514, 1.525, 1.553, 1.585, 1.617, 1.655, 1.697, 1.752, 1.816, 1.893, 1.982, 2.084, 2.195, 2.321, 2.342,
+                    2.218, 2.166, 2.057, 1.959, 1.871, 1.793, 1.726, 1.675, 1.633, 1.592, 1.559, 1.528, 1.503, 1.484, 1.474, 1.472, 1.472, 1.482, 1.499, 1.523, 1.553, 1.585, 1.619, 1.664, 1.715, 1.779, 1.855, 1.938, 2.037, 2.147, 2.259, 2.321,
+                    2.166, 2.101, 1.997, 1.901, 1.818, 1.743, 1.683, 1.634, 1.588, 1.546, 1.508, 1.476, 1.449, 1.429, 1.418, 1.415, 1.415, 1.425, 1.444, 1.469, 1.501, 1.538, 1.577, 1.622, 1.671, 1.728, 1.799, 1.881, 1.975, 2.078, 2.185, 2.259,
+                    2.101, 2.039, 1.938, 1.848, 1.768, 1.699, 1.641, 1.588, 1.541, 1.494, 1.455, 1.421, 1.394, 1.374, 1.361, 1.357, 1.357, 1.367, 1.388, 1.414, 1.448, 1.485, 1.528, 1.577, 1.626, 1.682, 1.748, 1.827, 1.917, 2.014, 2.119, 2.185,
+                    2.039, 1.979, 1.883, 1.795, 1.722, 1.658, 1.596, 1.541, 1.493, 1.443, 1.401, 1.364, 1.336, 1.316, 1.303, 1.301, 1.301, 1.311, 1.331, 1.359, 1.393, 1.432, 1.482, 1.528, 1.582, 1.641, 1.701, 1.775, 1.861, 1.956, 2.056, 2.119,
+                    1.979, 1.932, 1.836, 1.752, 1.685, 1.621, 1.557, 1.497, 1.443, 1.399, 1.351, 1.314, 1.286, 1.264, 1.253, 1.249, 1.249, 1.259, 1.281, 1.311, 1.344, 1.387, 1.432, 1.484, 1.541, 1.601, 1.662, 1.731, 1.816, 1.908, 2.003, 2.056,
+                    1.934, 1.888, 1.798, 1.719, 1.651, 1.584, 1.519, 1.457, 1.401, 1.351, 1.307, 1.268, 1.239, 1.217, 1.206, 1.203, 1.203, 1.212, 1.234, 1.263, 1.298, 1.344, 1.387, 1.442, 1.502, 1.565, 1.628, 1.693, 1.774, 1.864, 1.956, 2.003,
+                    1.901, 1.851, 1.763, 1.688, 1.618, 1.551, 1.483, 1.419, 1.359, 1.307, 1.268, 1.226, 1.195, 1.175, 1.164, 1.161, 1.161, 1.171, 1.192, 1.221, 1.262, 1.298, 1.346, 1.404, 1.466, 1.532, 1.595, 1.661, 1.738, 1.826, 1.917, 1.956,
+                    1.873, 1.821, 1.734, 1.659, 1.591, 1.519, 1.451, 1.386, 1.324, 1.269, 1.226, 1.192, 1.159, 1.141, 1.127, 1.125, 1.125, 1.135, 1.155, 1.187, 1.221, 1.262, 1.311, 1.368, 1.432, 1.499, 1.566, 1.634, 1.708, 1.793, 1.882, 1.917,
+                    1.847, 1.797, 1.713, 1.639, 1.565, 1.493, 1.422, 1.355, 1.291, 1.238, 1.192, 1.159, 1.128, 1.108, 1.097, 1.094, 1.094, 1.104, 1.125, 1.155, 1.187, 1.229, 1.279, 1.338, 1.403, 1.471, 1.541, 1.611, 1.684, 1.766, 1.853, 1.885,
+                    1.828, 1.772, 1.691, 1.614, 1.539, 1.466, 1.394, 1.325, 1.264, 1.209, 1.163, 1.128, 1.104, 1.081, 1.069, 1.067, 1.067, 1.078, 1.101, 1.125, 1.159, 1.201, 1.252, 1.312, 1.379, 1.447, 1.517, 1.591, 1.665, 1.743, 1.831, 1.862,
+                    1.812, 1.754, 1.677, 1.599, 1.519, 1.445, 1.371, 1.302, 1.239, 1.185, 1.139, 1.104, 1.081, 1.061, 1.048, 1.046, 1.046, 1.058, 1.078, 1.102, 1.136, 1.177, 1.229, 1.289, 1.356, 1.425, 1.497, 1.572, 1.647, 1.724, 1.811, 1.847,
+                    1.798, 1.741, 1.663, 1.585, 1.506, 1.429, 1.353, 1.284, 1.221, 1.167, 1.121, 1.086, 1.061, 1.046, 1.031, 1.029, 1.029, 1.044, 1.058, 1.083, 1.116, 1.159, 1.209, 1.271, 1.338, 1.407, 1.479, 1.557, 1.633, 1.709, 1.792, 1.832,
+                    1.792, 1.727, 1.651, 1.572, 1.494, 1.414, 1.339, 1.269, 1.206, 1.152, 1.106, 1.072, 1.046, 1.031, 1.018, 1.016, 1.016, 1.029, 1.044, 1.069, 1.102, 1.145, 1.196, 1.256, 1.324, 1.394, 1.471, 1.545, 1.624, 1.698, 1.782, 1.825,
+                    1.787, 1.724, 1.647, 1.566, 1.484, 1.407, 1.329, 1.258, 1.196, 1.141, 1.097, 1.062, 1.036, 1.018, 1.012, 1.007, 1.011, 1.016, 1.034, 1.059, 1.093, 1.135, 1.186, 1.246, 1.314, 1.386, 1.461, 1.538, 1.616, 1.691, 1.773, 1.818,
+                    1.786, 1.721, 1.642, 1.562, 1.481, 1.402, 1.325, 1.254, 1.191, 1.137, 1.092, 1.057, 1.031, 1.013, 1.004, 1.001, 1.004, 1.011, 1.028, 1.054, 1.088, 1.129, 1.181, 1.241, 1.308, 1.382, 1.458, 1.535, 1.613, 1.687, 1.769, 1.818,
+                    1.786, 1.721, 1.642, 1.562, 1.481, 1.401, 1.325, 1.253, 1.191, 1.136, 1.091, 1.057, 1.031, 1.013, 1.003, 1.001, 1.001, 1.011, 1.028, 1.054, 1.088, 1.129, 1.181, 1.241, 1.308, 1.382, 1.458, 1.535, 1.613, 1.687, 1.769, 1.818,
+                    1.787, 1.722, 1.643, 1.563, 1.482, 1.402, 1.326, 1.254, 1.192, 1.138, 1.092, 1.057, 1.032, 1.013, 1.006, 1.002, 1.006, 1.012, 1.031, 1.057, 1.092, 1.133, 1.185, 1.243, 1.311, 1.385, 1.461, 1.539, 1.618, 1.691, 1.774, 1.821,
+                    1.789, 1.729, 1.651, 1.571, 1.489, 1.411, 1.334, 1.263, 1.201, 1.147, 1.101, 1.065, 1.038, 1.021, 1.013, 1.009, 1.012, 1.021, 1.038, 1.064, 1.098, 1.141, 1.193, 1.254, 1.321, 1.395, 1.472, 1.549, 1.626, 1.701, 1.785, 1.825,
+                    1.799, 1.739, 1.661, 1.581, 1.502, 1.422, 1.347, 1.277, 1.214, 1.159, 1.111, 1.075, 1.049, 1.037, 1.021, 1.019, 1.021, 1.036, 1.049, 1.076, 1.111, 1.154, 1.207, 1.268, 1.334, 1.408, 1.485, 1.562, 1.639, 1.715, 1.799, 1.837,
+                    1.811, 1.755, 1.676, 1.597, 1.518, 1.439, 1.365, 1.295, 1.231, 1.176, 1.129, 1.093, 1.067, 1.049, 1.038, 1.036, 1.036, 1.049, 1.067, 1.094, 1.129, 1.173, 1.225, 1.286, 1.353, 1.425, 1.501, 1.577, 1.653, 1.729, 1.815, 1.851,
+                    1.829, 1.774, 1.693, 1.615, 1.537, 1.462, 1.387, 1.316, 1.253, 1.198, 1.153, 1.115, 1.091, 1.067, 1.059, 1.056, 1.056, 1.067, 1.092, 1.115, 1.151, 1.196, 1.249, 1.309, 1.375, 1.446, 1.522, 1.595, 1.672, 1.752, 1.839, 1.871,
+                    1.851, 1.801, 1.713, 1.636, 1.561, 1.485, 1.411, 1.342, 1.281, 1.226, 1.179, 1.145, 1.115, 1.091, 1.082, 1.081, 1.082, 1.092, 1.115, 1.143, 1.178, 1.223, 1.276, 1.337, 1.402, 1.472, 1.544, 1.618, 1.691, 1.774, 1.865, 1.896,
+                    1.876, 1.831, 1.739, 1.663, 1.588, 1.513, 1.439, 1.374, 1.312, 1.258, 1.212, 1.179, 1.145, 1.123, 1.113, 1.112, 1.112, 1.122, 1.143, 1.177, 1.211, 1.256, 1.308, 1.368, 1.431, 1.501, 1.572, 1.641, 1.716, 1.802, 1.896, 1.931,
+                    1.909, 1.867, 1.771, 1.691, 1.617, 1.545, 1.474, 1.411, 1.349, 1.296, 1.252, 1.212, 1.182, 1.159, 1.149, 1.148, 1.149, 1.158, 1.179, 1.211, 1.253, 1.293, 1.344, 1.403, 1.465, 1.533, 1.603, 1.669, 1.747, 1.836, 1.931, 1.974,
+                    1.952, 1.905, 1.806, 1.722, 1.651, 1.578, 1.511, 1.448, 1.388, 1.338, 1.296, 1.252, 1.223, 1.201, 1.189, 1.189, 1.189, 1.199, 1.224, 1.253, 1.293, 1.338, 1.384, 1.442, 1.504, 1.571, 1.638, 1.704, 1.782, 1.872, 1.974, 2.025,
+                    2.004, 1.951, 1.849, 1.759, 1.688, 1.619, 1.552, 1.491, 1.435, 1.388, 1.338, 1.301, 1.272, 1.249, 1.238, 1.236, 1.236, 1.248, 1.271, 1.301, 1.338, 1.384, 1.431, 1.484, 1.543, 1.609, 1.675, 1.742, 1.825, 1.919, 2.025, 2.081,
+                    2.062, 2.004, 1.898, 1.805, 1.729, 1.661, 1.597, 1.539, 1.486, 1.435, 1.391, 1.354, 1.326, 1.303, 1.291, 1.289, 1.289, 1.301, 1.323, 1.353, 1.389, 1.431, 1.483, 1.528, 1.585, 1.649, 1.713, 1.787, 1.875, 1.971, 2.081, 2.145,
+                    2.129, 2.062, 1.951, 1.854, 1.774, 1.705, 1.642, 1.586, 1.539, 1.486, 1.445, 1.411, 1.383, 1.361, 1.348, 1.347, 1.348, 1.359, 1.379, 1.409, 1.447, 1.484, 1.528, 1.578, 1.631, 1.691, 1.759, 1.836, 1.928, 2.031, 2.145, 2.217,
+                    2.201, 2.129, 2.013, 1.912, 1.827, 1.752, 1.689, 1.642, 1.586, 1.544, 1.501, 1.468, 1.442, 1.421, 1.409, 1.409, 1.411, 1.421, 1.439, 1.467, 1.504, 1.543, 1.578, 1.629, 1.679, 1.739, 1.815, 1.894, 1.985, 2.098, 2.217, 2.298,
+                    2.273, 2.201, 2.081, 1.974, 1.886, 1.807, 1.741, 1.689, 1.643, 1.603, 1.562, 1.527, 1.504, 1.485, 1.475, 1.474, 1.475, 1.487, 1.503, 1.531, 1.565, 1.601, 1.634, 1.678, 1.728, 1.795, 1.877, 1.961, 2.052, 2.169, 2.298, 2.365,
+                    2.317, 2.273, 2.146, 2.039, 1.946, 1.864, 1.792, 1.737, 1.688, 1.643, 1.603, 1.562, 1.533, 1.525, 1.523, 1.523, 1.523, 1.525, 1.534, 1.565, 1.601, 1.634, 1.677, 1.722, 1.772, 1.848, 1.935, 2.023, 2.108, 2.232, 2.365, 2.403
+                ],
+                "sigma": 0.00285,
+                "sigma_Cb": 0.00166
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2873,
+                        "ccm":
+                        [
+                            1.88195, -0.26249, -0.61946,
+                            -0.63842, 2.11535, -0.47693,
+                            -0.13531, -0.99739, 2.13271
+                        ]
+                    },
+                    {
+                        "ct": 2965,
+                        "ccm":
+                        [
+                            2.15048, -0.51859, -0.63189,
+                            -0.53572, 1.92585, -0.39013,
+                            0.01831, -1.48576, 2.46744
+                        ]
+                    },
+                    {
+                        "ct": 3606,
+                        "ccm":
+                        [
+                            1.97522, -0.43847, -0.53675,
+                            -0.56151, 1.99765, -0.43614,
+                            -0.12438, -0.77056, 1.89493
+                        ]
+                    },
+                    {
+                        "ct": 4700,
+                        "ccm":
+                        [
+                            2.00971, -0.51461, -0.49511,
+                            -0.52109, 2.01003, -0.48894,
+                            -0.09527, -0.67318, 1.76845
+                        ]
+                    },
+                    {
+                        "ct": 5890,
+                        "ccm":
+                        [
+                            2.13616, -0.65283, -0.48333,
+                            -0.48364, 1.93115, -0.44751,
+                            -0.13465, -0.54831, 1.68295
+                        ]
+                    },
+                    {
+                        "ct": 7600,
+                        "ccm":
+                        [
+                            2.06599, -0.39161, -0.67439,
+                            -0.50883, 2.27467, -0.76583,
+                            -0.13961, -0.66121, 1.80081
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/ov5647_noir.json b/src/ipa/rpi/pisp/data/ov5647_noir.json
new file mode 100644
index 000000000..3e04f21b9
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/ov5647_noir.json
@@ -0,0 +1,1121 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 1024
+            }
+        },
+        {
+            "rpi.lux":
+            {
+                "reference_shutter_speed": 29381,
+                "reference_gain": 1.0,
+                "reference_aperture": 1.0,
+                "reference_lux": 870,
+                "reference_Y": 12388
+            }
+        },
+        {
+            "rpi.dpc":
+            {
+                "strength": 1
+            }
+        },
+        {
+            "rpi.noise":
+            {
+                "reference_constant": 0,
+                "reference_slope": 4.371
+            }
+        },
+        {
+            "rpi.geq":
+            {
+                "offset": 280,
+                "slope": 0.02153
+            }
+        },
+        {
+            "rpi.denoise":
+            {
+                "normal":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 0.8,
+                        "threshold": 0.05
+                    }
+                },
+                "hdr":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                },
+                "night":
+                {
+                    "sdn":
+                    {
+                        "deviation": 1.6,
+                        "strength": 0.5,
+                        "deviation2": 3.2,
+                        "deviation_no_tdn": 3.2,
+                        "strength_no_tdn": 0.75
+                    },
+                    "cdn":
+                    {
+                        "deviation": 200,
+                        "strength": 0.3
+                    },
+                    "tdn":
+                    {
+                        "deviation": 1.3,
+                        "threshold": 0.1
+                    }
+                }
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "bayes": 0
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "channels": [
+                    {
+                        "comment": "Channel 0 is normal AGC",
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 1 is the HDR short channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 1.0, 2.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 15000, 30000 ],
+                                "gain": [ 1.0, 2.0, 2.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 15000, 60000 ],
+                                "gain": [ 1.0, 1.0, 1.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.02,
+                                        1000, 0.02
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.01,
+                                        1000, 0.01
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.9,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.005,
+                                        1000, 0.005
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.95,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.7,
+                                        1000, 0.7
+                                    ]
+                                },
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.2,
+                                    "y_target":
+                                    [
+                                        0, 0.002,
+                                        1000, 0.002
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.19,
+                            1000, 0.19,
+                            10000, 0.19
+                        ]
+                    },
+                    {
+                        "comment": "Channel 2 is the HDR long channel",
+                        "desaturate": 0,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 30000, 60000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [  ],
+                            "highlight": [  ],
+                            "shadows": [  ]
+                        },
+                        "channel_constraints": [
+                            {
+                                "bound": "UPPER",
+                                "channel": 4,
+                                "factor": 8
+                            },
+                            {
+                                "bound": "LOWER",
+                                "channel": 4,
+                                "factor": 2
+                            }
+                        ],
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "comment": "Channel 3 is the night mode channel",
+                        "base_ev": 0.33,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                                    1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                                    0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                                    0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                                    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 20000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 20000, 66666, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.alsc":
+            {
+                "omega": 1.3,
+                "n_iter": 100,
+                "luminance_strength": 0.8,
+                "calibrations_Cr": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            1.238, 1.238, 1.238, 1.234, 1.227, 1.216, 1.207, 1.198, 1.191, 1.179, 1.169, 1.162, 1.155, 1.153, 1.152, 1.152, 1.152, 1.153, 1.154, 1.157, 1.166, 1.176, 1.183, 1.191, 1.204, 1.216, 1.226, 1.232, 1.239, 1.241, 1.241, 1.242,
+                            1.235, 1.234, 1.227, 1.222, 1.214, 1.203, 1.193, 1.184, 1.169, 1.161, 1.149, 1.139, 1.131, 1.126, 1.122, 1.121, 1.121, 1.123, 1.129, 1.136, 1.145, 1.157, 1.163, 1.175, 1.189, 1.199, 1.212, 1.221, 1.225, 1.231, 1.241, 1.242,
+                            1.234, 1.227, 1.222, 1.214, 1.203, 1.193, 1.183, 1.169, 1.158, 1.145, 1.133, 1.123, 1.113, 1.106, 1.101, 1.101, 1.101, 1.105, 1.111, 1.116, 1.128, 1.137, 1.149, 1.163, 1.174, 1.189, 1.199, 1.212, 1.221, 1.226, 1.234, 1.241,
+                            1.234, 1.226, 1.217, 1.209, 1.195, 1.183, 1.171, 1.158, 1.145, 1.131, 1.119, 1.108, 1.097, 1.088, 1.088, 1.085, 1.085, 1.087, 1.095, 1.102, 1.114, 1.124, 1.137, 1.149, 1.165, 1.176, 1.194, 1.207, 1.214, 1.224, 1.235, 1.247,
+                            1.238, 1.224, 1.213, 1.202, 1.187, 1.175, 1.161, 1.146, 1.132, 1.117, 1.105, 1.094, 1.082, 1.074, 1.071, 1.071, 1.071, 1.073, 1.079, 1.089, 1.099, 1.112, 1.124, 1.137, 1.152, 1.167, 1.183, 1.198, 1.211, 1.222, 1.235, 1.249,
+                            1.232, 1.221, 1.209, 1.195, 1.178, 1.163, 1.149, 1.134, 1.118, 1.104, 1.093, 1.079, 1.069, 1.061, 1.057, 1.056, 1.056, 1.059, 1.066, 1.073, 1.086, 1.098, 1.111, 1.124, 1.141, 1.157, 1.173, 1.188, 1.203, 1.219, 1.234, 1.251,
+                            1.231, 1.213, 1.197, 1.186, 1.169, 1.151, 1.137, 1.121, 1.104, 1.093, 1.079, 1.068, 1.056, 1.048, 1.045, 1.042, 1.042, 1.045, 1.051, 1.061, 1.071, 1.085, 1.098, 1.111, 1.129, 1.145, 1.161, 1.179, 1.197, 1.215, 1.231, 1.249,
+                            1.224, 1.211, 1.194, 1.178, 1.161, 1.141, 1.127, 1.109, 1.094, 1.081, 1.068, 1.055, 1.047, 1.038, 1.034, 1.032, 1.032, 1.035, 1.039, 1.048, 1.059, 1.071, 1.086, 1.098, 1.116, 1.134, 1.154, 1.172, 1.191, 1.209, 1.228, 1.249,
+                            1.223, 1.206, 1.187, 1.171, 1.152, 1.132, 1.117, 1.098, 1.082, 1.069, 1.056, 1.045, 1.037, 1.028, 1.024, 1.022, 1.022, 1.025, 1.031, 1.039, 1.048, 1.059, 1.074, 1.091, 1.106, 1.126, 1.144, 1.163, 1.186, 1.205, 1.227, 1.247,
+                            1.222, 1.199, 1.183, 1.164, 1.143, 1.126, 1.108, 1.091, 1.075, 1.059, 1.045, 1.037, 1.028, 1.019, 1.015, 1.014, 1.014, 1.018, 1.023, 1.031, 1.042, 1.051, 1.065, 1.081, 1.098, 1.118, 1.137, 1.158, 1.181, 1.201, 1.224, 1.245,
+                            1.221, 1.198, 1.179, 1.163, 1.141, 1.119, 1.101, 1.083, 1.066, 1.051, 1.038, 1.028, 1.019, 1.012, 1.009, 1.008, 1.007, 1.008, 1.015, 1.023, 1.033, 1.044, 1.058, 1.072, 1.089, 1.107, 1.131, 1.152, 1.172, 1.196, 1.216, 1.241,
+                            1.216, 1.194, 1.174, 1.155, 1.133, 1.112, 1.094, 1.074, 1.059, 1.045, 1.032, 1.021, 1.012, 1.007, 1.003, 1.002, 1.002, 1.003, 1.008, 1.015, 1.025, 1.038, 1.049, 1.067, 1.084, 1.102, 1.126, 1.147, 1.169, 1.191, 1.214, 1.238,
+                            1.212, 1.188, 1.171, 1.149, 1.127, 1.105, 1.087, 1.069, 1.055, 1.039, 1.027, 1.016, 1.007, 1.003, 0.999, 0.997, 0.998, 1.001, 1.003, 1.011, 1.021, 1.032, 1.043, 1.059, 1.077, 1.101, 1.121, 1.142, 1.164, 1.187, 1.211, 1.236,
+                            1.208, 1.187, 1.169, 1.149, 1.124, 1.104, 1.085, 1.067, 1.051, 1.036, 1.024, 1.013, 1.005, 0.999, 0.996, 0.994, 0.994, 0.996, 1.001, 1.006, 1.017, 1.025, 1.038, 1.053, 1.072, 1.093, 1.116, 1.138, 1.159, 1.183, 1.207, 1.235,
+                            1.208, 1.181, 1.164, 1.144, 1.122, 1.098, 1.079, 1.062, 1.046, 1.033, 1.018, 1.009, 1.002, 0.996, 0.992, 0.989, 0.991, 0.994, 0.996, 1.002, 1.012, 1.021, 1.035, 1.051, 1.069, 1.091, 1.113, 1.137, 1.157, 1.182, 1.206, 1.233,
+                            1.206, 1.179, 1.163, 1.142, 1.119, 1.098, 1.079, 1.061, 1.045, 1.031, 1.017, 1.008, 1.001, 0.995, 0.991, 0.989, 0.989, 0.992, 0.996, 1.001, 1.011, 1.019, 1.034, 1.051, 1.069, 1.089, 1.112, 1.136, 1.157, 1.181, 1.205, 1.233,
+                            1.206, 1.179, 1.163, 1.139, 1.119, 1.098, 1.079, 1.061, 1.044, 1.031, 1.016, 1.007, 1.001, 0.995, 0.991, 0.989, 0.989, 0.991, 0.996, 1.002, 1.011, 1.019, 1.034, 1.049, 1.069, 1.088, 1.113, 1.136, 1.156, 1.179, 1.204, 1.233,
+                            1.207, 1.179, 1.163, 1.139, 1.119, 1.099, 1.079, 1.061, 1.044, 1.031, 1.017, 1.007, 1.001, 0.995, 0.991, 0.989, 0.989, 0.992, 0.997, 1.003, 1.011, 1.021, 1.034, 1.051, 1.071, 1.089, 1.112, 1.136, 1.157, 1.179, 1.204, 1.233,
+                            1.207, 1.179, 1.163, 1.143, 1.121, 1.101, 1.082, 1.063, 1.047, 1.032, 1.019, 1.009, 1.003, 0.998, 0.994, 0.991, 0.991, 0.995, 0.999, 1.004, 1.013, 1.024, 1.038, 1.052, 1.071, 1.091, 1.112, 1.136, 1.159, 1.181, 1.205, 1.233,
+                            1.207, 1.185, 1.166, 1.148, 1.124, 1.104, 1.087, 1.068, 1.052, 1.037, 1.025, 1.016, 1.006, 1.002, 0.998, 0.995, 0.995, 0.999, 1.003, 1.008, 1.017, 1.029, 1.043, 1.056, 1.076, 1.094, 1.116, 1.138, 1.159, 1.183, 1.205, 1.232,
+                            1.211, 1.186, 1.167, 1.151, 1.128, 1.108, 1.089, 1.072, 1.057, 1.042, 1.031, 1.021, 1.013, 1.006, 1.002, 0.999, 0.999, 1.003, 1.007, 1.013, 1.021, 1.031, 1.047, 1.062, 1.081, 1.098, 1.121, 1.141, 1.164, 1.185, 1.207, 1.232,
+                            1.211, 1.188, 1.169, 1.154, 1.134, 1.114, 1.094, 1.078, 1.063, 1.051, 1.039, 1.028, 1.019, 1.013, 1.007, 1.006, 1.006, 1.007, 1.013, 1.019, 1.027, 1.039, 1.051, 1.069, 1.087, 1.105, 1.124, 1.146, 1.165, 1.186, 1.209, 1.232,
+                            1.214, 1.191, 1.175, 1.159, 1.141, 1.123, 1.105, 1.087, 1.072, 1.058, 1.046, 1.036, 1.028, 1.019, 1.014, 1.013, 1.013, 1.015, 1.019, 1.027, 1.037, 1.048, 1.061, 1.076, 1.094, 1.109, 1.132, 1.149, 1.169, 1.189, 1.209, 1.233,
+                            1.219, 1.194, 1.179, 1.163, 1.146, 1.129, 1.113, 1.095, 1.081, 1.066, 1.055, 1.045, 1.036, 1.029, 1.023, 1.021, 1.021, 1.026, 1.031, 1.037, 1.048, 1.057, 1.069, 1.085, 1.101, 1.118, 1.137, 1.156, 1.174, 1.193, 1.213, 1.233,
+                            1.219, 1.199, 1.184, 1.172, 1.155, 1.138, 1.122, 1.104, 1.088, 1.075, 1.065, 1.055, 1.045, 1.038, 1.034, 1.031, 1.031, 1.035, 1.041, 1.048, 1.057, 1.066, 1.081, 1.096, 1.111, 1.125, 1.146, 1.164, 1.178, 1.196, 1.214, 1.233,
+                            1.222, 1.204, 1.189, 1.178, 1.162, 1.148, 1.132, 1.115, 1.101, 1.087, 1.075, 1.064, 1.055, 1.048, 1.043, 1.042, 1.042, 1.046, 1.049, 1.057, 1.066, 1.076, 1.089, 1.106, 1.121, 1.133, 1.149, 1.167, 1.183, 1.199, 1.215, 1.234,
+                            1.222, 1.205, 1.191, 1.184, 1.171, 1.155, 1.142, 1.124, 1.109, 1.097, 1.087, 1.077, 1.065, 1.059, 1.055, 1.053, 1.053, 1.057, 1.059, 1.067, 1.076, 1.088, 1.102, 1.116, 1.131, 1.143, 1.157, 1.175, 1.187, 1.202, 1.215, 1.231,
+                            1.223, 1.211, 1.198, 1.189, 1.178, 1.165, 1.151, 1.136, 1.122, 1.108, 1.097, 1.087, 1.079, 1.073, 1.067, 1.066, 1.066, 1.069, 1.074, 1.079, 1.088, 1.101, 1.114, 1.128, 1.141, 1.152, 1.166, 1.182, 1.194, 1.205, 1.215, 1.229,
+                            1.223, 1.212, 1.204, 1.197, 1.186, 1.173, 1.161, 1.149, 1.133, 1.121, 1.108, 1.101, 1.092, 1.085, 1.082, 1.082, 1.082, 1.085, 1.091, 1.096, 1.101, 1.113, 1.125, 1.138, 1.151, 1.164, 1.175, 1.188, 1.198, 1.207, 1.215, 1.222,
+                            1.217, 1.213, 1.211, 1.203, 1.194, 1.181, 1.169, 1.158, 1.145, 1.133, 1.123, 1.113, 1.106, 1.097, 1.096, 1.094, 1.094, 1.098, 1.104, 1.108, 1.114, 1.124, 1.137, 1.149, 1.161, 1.172, 1.182, 1.194, 1.203, 1.209, 1.211, 1.217,
+                            1.214, 1.211, 1.209, 1.206, 1.201, 1.188, 1.179, 1.168, 1.154, 1.144, 1.136, 1.126, 1.119, 1.112, 1.109, 1.108, 1.108, 1.108, 1.117, 1.119, 1.124, 1.133, 1.147, 1.158, 1.171, 1.178, 1.188, 1.198, 1.205, 1.208, 1.209, 1.211,
+                            1.207, 1.208, 1.209, 1.206, 1.202, 1.192, 1.182, 1.171, 1.159, 1.146, 1.142, 1.136, 1.126, 1.119, 1.116, 1.114, 1.115, 1.117, 1.119, 1.128, 1.129, 1.136, 1.155, 1.162, 1.176, 1.182, 1.188, 1.198, 1.205, 1.208, 1.207, 1.206
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.879, 1.878, 1.872, 1.862, 1.856, 1.842, 1.826, 1.815, 1.811, 1.799, 1.787, 1.777, 1.768, 1.761, 1.761, 1.761, 1.762, 1.763, 1.764, 1.769, 1.776, 1.789, 1.799, 1.807, 1.824, 1.841, 1.853, 1.861, 1.871, 1.874, 1.885, 1.889,
+                            1.879, 1.875, 1.859, 1.846, 1.835, 1.817, 1.806, 1.794, 1.777, 1.771, 1.755, 1.743, 1.733, 1.726, 1.721, 1.721, 1.721, 1.722, 1.729, 1.734, 1.747, 1.759, 1.771, 1.783, 1.801, 1.813, 1.831, 1.841, 1.849, 1.862, 1.876, 1.888,
+                            1.876, 1.861, 1.846, 1.835, 1.817, 1.806, 1.793, 1.777, 1.766, 1.752, 1.736, 1.727, 1.713, 1.702, 1.696, 1.695, 1.695, 1.697, 1.704, 1.715, 1.725, 1.739, 1.754, 1.771, 1.783, 1.801, 1.813, 1.831, 1.841, 1.851, 1.866, 1.888,
+                            1.878, 1.861, 1.843, 1.829, 1.811, 1.794, 1.779, 1.766, 1.751, 1.734, 1.721, 1.711, 1.695, 1.682, 1.679, 1.677, 1.677, 1.678, 1.687, 1.696, 1.713, 1.723, 1.737, 1.754, 1.774, 1.785, 1.811, 1.825, 1.833, 1.849, 1.866, 1.889,
+                            1.882, 1.859, 1.837, 1.821, 1.803, 1.784, 1.769, 1.752, 1.735, 1.717, 1.701, 1.689, 1.676, 1.664, 1.659, 1.658, 1.658, 1.659, 1.668, 1.679, 1.694, 1.711, 1.723, 1.739, 1.756, 1.777, 1.797, 1.813, 1.827, 1.844, 1.865, 1.889,
+                            1.869, 1.849, 1.832, 1.811, 1.792, 1.772, 1.755, 1.737, 1.717, 1.699, 1.688, 1.674, 1.661, 1.646, 1.642, 1.638, 1.638, 1.641, 1.651, 1.659, 1.676, 1.693, 1.708, 1.724, 1.744, 1.763, 1.783, 1.801, 1.819, 1.838, 1.864, 1.889,
+                            1.869, 1.841, 1.817, 1.801, 1.782, 1.758, 1.741, 1.721, 1.699, 1.688, 1.674, 1.658, 1.643, 1.632, 1.627, 1.621, 1.621, 1.622, 1.631, 1.643, 1.658, 1.676, 1.689, 1.708, 1.729, 1.748, 1.767, 1.791, 1.812, 1.836, 1.859, 1.891,
+                            1.861, 1.836, 1.814, 1.792, 1.772, 1.745, 1.728, 1.707, 1.688, 1.673, 1.658, 1.643, 1.629, 1.618, 1.612, 1.609, 1.609, 1.611, 1.615, 1.629, 1.642, 1.658, 1.676, 1.689, 1.711, 1.734, 1.758, 1.782, 1.804, 1.827, 1.859, 1.891,
+                            1.861, 1.829, 1.807, 1.784, 1.759, 1.735, 1.717, 1.692, 1.674, 1.659, 1.644, 1.629, 1.617, 1.605, 1.598, 1.595, 1.595, 1.598, 1.607, 1.615, 1.631, 1.642, 1.661, 1.681, 1.701, 1.724, 1.746, 1.771, 1.799, 1.825, 1.857, 1.891,
+                            1.861, 1.826, 1.804, 1.779, 1.749, 1.729, 1.707, 1.687, 1.665, 1.648, 1.629, 1.617, 1.604, 1.595, 1.589, 1.585, 1.585, 1.592, 1.597, 1.607, 1.623, 1.635, 1.652, 1.674, 1.693, 1.716, 1.739, 1.766, 1.794, 1.822, 1.855, 1.889,
+                            1.861, 1.824, 1.799, 1.777, 1.748, 1.723, 1.701, 1.678, 1.657, 1.639, 1.619, 1.605, 1.596, 1.586, 1.581, 1.579, 1.577, 1.579, 1.588, 1.597, 1.612, 1.625, 1.641, 1.661, 1.681, 1.702, 1.732, 1.757, 1.785, 1.813, 1.847, 1.882,
+                            1.856, 1.819, 1.796, 1.767, 1.739, 1.714, 1.693, 1.666, 1.651, 1.629, 1.613, 1.597, 1.586, 1.579, 1.576, 1.572, 1.572, 1.573, 1.579, 1.588, 1.602, 1.619, 1.633, 1.655, 1.674, 1.698, 1.729, 1.754, 1.782, 1.809, 1.842, 1.874,
+                            1.853, 1.815, 1.792, 1.761, 1.734, 1.707, 1.682, 1.659, 1.639, 1.622, 1.605, 1.591, 1.579, 1.574, 1.569, 1.565, 1.566, 1.569, 1.573, 1.584, 1.597, 1.609, 1.624, 1.645, 1.666, 1.695, 1.722, 1.746, 1.772, 1.799, 1.835, 1.873,
+                            1.847, 1.811, 1.789, 1.759, 1.732, 1.703, 1.681, 1.657, 1.637, 1.619, 1.603, 1.588, 1.575, 1.569, 1.563, 1.561, 1.561, 1.563, 1.569, 1.576, 1.589, 1.601, 1.616, 1.636, 1.659, 1.686, 1.712, 1.741, 1.767, 1.798, 1.832, 1.873,
+                            1.847, 1.803, 1.779, 1.756, 1.727, 1.699, 1.674, 1.652, 1.632, 1.616, 1.595, 1.583, 1.572, 1.564, 1.558, 1.556, 1.557, 1.559, 1.563, 1.569, 1.583, 1.593, 1.613, 1.633, 1.657, 1.684, 1.709, 1.741, 1.766, 1.796, 1.831, 1.871,
+                            1.845, 1.802, 1.779, 1.755, 1.725, 1.696, 1.673, 1.649, 1.629, 1.614, 1.595, 1.582, 1.572, 1.563, 1.557, 1.556, 1.556, 1.558, 1.562, 1.569, 1.581, 1.593, 1.612, 1.633, 1.656, 1.679, 1.709, 1.741, 1.764, 1.796, 1.828, 1.869,
+                            1.845, 1.801, 1.779, 1.749, 1.723, 1.697, 1.673, 1.649, 1.627, 1.613, 1.593, 1.581, 1.573, 1.563, 1.558, 1.555, 1.555, 1.556, 1.562, 1.573, 1.581, 1.594, 1.611, 1.633, 1.656, 1.679, 1.711, 1.739, 1.764, 1.794, 1.828, 1.869,
+                            1.844, 1.801, 1.781, 1.749, 1.723, 1.697, 1.673, 1.649, 1.627, 1.614, 1.595, 1.581, 1.574, 1.564, 1.559, 1.557, 1.556, 1.559, 1.564, 1.574, 1.582, 1.595, 1.611, 1.634, 1.659, 1.683, 1.709, 1.739, 1.765, 1.794, 1.829, 1.872,
+                            1.845, 1.802, 1.781, 1.754, 1.725, 1.701, 1.677, 1.652, 1.632, 1.616, 1.599, 1.586, 1.576, 1.569, 1.563, 1.559, 1.558, 1.562, 1.569, 1.576, 1.587, 1.599, 1.618, 1.635, 1.661, 1.685, 1.709, 1.739, 1.767, 1.796, 1.829, 1.868,
+                            1.845, 1.809, 1.785, 1.762, 1.731, 1.706, 1.685, 1.659, 1.641, 1.622, 1.606, 1.595, 1.581, 1.575, 1.569, 1.564, 1.564, 1.569, 1.574, 1.582, 1.594, 1.607, 1.625, 1.642, 1.668, 1.687, 1.716, 1.741, 1.769, 1.798, 1.829, 1.868,
+                            1.849, 1.811, 1.785, 1.765, 1.734, 1.709, 1.688, 1.666, 1.647, 1.628, 1.613, 1.601, 1.592, 1.581, 1.575, 1.572, 1.572, 1.575, 1.581, 1.589, 1.599, 1.611, 1.631, 1.649, 1.673, 1.694, 1.721, 1.747, 1.771, 1.798, 1.829, 1.868,
+                            1.849, 1.816, 1.787, 1.766, 1.739, 1.716, 1.692, 1.673, 1.657, 1.641, 1.625, 1.612, 1.599, 1.592, 1.584, 1.581, 1.581, 1.581, 1.589, 1.598, 1.608, 1.622, 1.639, 1.659, 1.679, 1.701, 1.724, 1.751, 1.774, 1.802, 1.832, 1.868,
+                            1.855, 1.816, 1.793, 1.773, 1.748, 1.727, 1.707, 1.686, 1.667, 1.649, 1.636, 1.623, 1.612, 1.599, 1.594, 1.592, 1.591, 1.591, 1.598, 1.608, 1.621, 1.634, 1.649, 1.669, 1.693, 1.705, 1.736, 1.757, 1.778, 1.804, 1.833, 1.867,
+                            1.858, 1.818, 1.796, 1.778, 1.754, 1.733, 1.716, 1.695, 1.676, 1.661, 1.648, 1.635, 1.624, 1.613, 1.604, 1.601, 1.601, 1.606, 1.613, 1.621, 1.634, 1.646, 1.661, 1.679, 1.699, 1.714, 1.742, 1.761, 1.782, 1.809, 1.835, 1.867,
+                            1.857, 1.822, 1.801, 1.789, 1.766, 1.744, 1.726, 1.706, 1.688, 1.671, 1.659, 1.647, 1.635, 1.624, 1.621, 1.617, 1.617, 1.621, 1.627, 1.634, 1.645, 1.656, 1.674, 1.694, 1.709, 1.723, 1.751, 1.771, 1.786, 1.811, 1.837, 1.867,
+                            1.858, 1.824, 1.807, 1.794, 1.774, 1.757, 1.739, 1.716, 1.702, 1.687, 1.671, 1.662, 1.648, 1.636, 1.629, 1.629, 1.629, 1.633, 1.635, 1.646, 1.656, 1.669, 1.684, 1.705, 1.719, 1.732, 1.753, 1.774, 1.793, 1.815, 1.837, 1.871,
+                            1.858, 1.827, 1.809, 1.798, 1.782, 1.761, 1.749, 1.727, 1.711, 1.698, 1.687, 1.675, 1.663, 1.649, 1.646, 1.643, 1.643, 1.646, 1.649, 1.658, 1.669, 1.683, 1.698, 1.716, 1.731, 1.746, 1.761, 1.783, 1.795, 1.817, 1.836, 1.862,
+                            1.862, 1.834, 1.816, 1.805, 1.789, 1.774, 1.759, 1.743, 1.725, 1.711, 1.697, 1.688, 1.678, 1.668, 1.661, 1.659, 1.658, 1.659, 1.668, 1.673, 1.684, 1.698, 1.713, 1.728, 1.742, 1.757, 1.771, 1.791, 1.804, 1.821, 1.836, 1.862,
+                            1.859, 1.835, 1.825, 1.813, 1.794, 1.782, 1.771, 1.757, 1.739, 1.725, 1.711, 1.701, 1.693, 1.683, 1.679, 1.679, 1.679, 1.683, 1.689, 1.693, 1.698, 1.714, 1.726, 1.741, 1.754, 1.769, 1.781, 1.797, 1.808, 1.821, 1.835, 1.856,
+                            1.848, 1.836, 1.832, 1.822, 1.806, 1.789, 1.778, 1.765, 1.751, 1.739, 1.726, 1.718, 1.709, 1.699, 1.696, 1.695, 1.695, 1.696, 1.704, 1.705, 1.714, 1.724, 1.739, 1.753, 1.765, 1.777, 1.789, 1.803, 1.816, 1.824, 1.829, 1.842,
+                            1.839, 1.835, 1.834, 1.829, 1.815, 1.801, 1.787, 1.776, 1.759, 1.751, 1.744, 1.736, 1.724, 1.714, 1.711, 1.708, 1.707, 1.707, 1.717, 1.719, 1.724, 1.734, 1.748, 1.762, 1.775, 1.783, 1.796, 1.808, 1.819, 1.825, 1.828, 1.833,
+                            1.836, 1.833, 1.834, 1.832, 1.821, 1.806, 1.792, 1.785, 1.772, 1.759, 1.751, 1.744, 1.736, 1.725, 1.719, 1.715, 1.715, 1.718, 1.721, 1.728, 1.734, 1.736, 1.757, 1.768, 1.779, 1.787, 1.799, 1.812, 1.821, 1.824, 1.825, 1.833
+                        ]
+                    }
+                ],
+                "calibrations_Cb": [
+                    {
+                        "ct": 3000,
+                        "table":
+                        [
+                            2.189, 2.127, 2.115, 2.106, 2.113, 2.119, 2.131, 2.144, 2.155, 2.168, 2.176, 2.179, 2.181, 2.181, 2.185, 2.187, 2.187, 2.183, 2.179, 2.176, 2.169, 2.167, 2.159, 2.152, 2.145, 2.141, 2.135, 2.128, 2.124, 2.124, 2.139, 2.177,
+                            2.176, 2.133, 2.116, 2.112, 2.116, 2.125, 2.137, 2.154, 2.168, 2.179, 2.187, 2.194, 2.201, 2.204, 2.208, 2.208, 2.205, 2.202, 2.198, 2.195, 2.183, 2.177, 2.166, 2.159, 2.149, 2.143, 2.138, 2.132, 2.124, 2.125, 2.136, 2.164,
+                            2.175, 2.133, 2.117, 2.115, 2.121, 2.136, 2.154, 2.165, 2.179, 2.192, 2.198, 2.211, 2.218, 2.219, 2.221, 2.221, 2.217, 2.216, 2.211, 2.202, 2.197, 2.188, 2.181, 2.171, 2.159, 2.151, 2.141, 2.136, 2.125, 2.125, 2.132, 2.155,
+                            2.172, 2.128, 2.116, 2.116, 2.124, 2.143, 2.161, 2.177, 2.192, 2.204, 2.213, 2.221, 2.227, 2.231, 2.237, 2.237, 2.229, 2.224, 2.221, 2.213, 2.207, 2.197, 2.191, 2.179, 2.169, 2.156, 2.148, 2.138, 2.126, 2.123, 2.124, 2.149,
+                            2.169, 2.124, 2.119, 2.119, 2.135, 2.152, 2.174, 2.187, 2.204, 2.211, 2.224, 2.233, 2.236, 2.241, 2.246, 2.246, 2.243, 2.237, 2.234, 2.226, 2.218, 2.211, 2.199, 2.191, 2.177, 2.166, 2.155, 2.139, 2.129, 2.121, 2.121, 2.143,
+                            2.157, 2.124, 2.121, 2.127, 2.145, 2.157, 2.181, 2.197, 2.208, 2.221, 2.238, 2.245, 2.249, 2.249, 2.254, 2.254, 2.249, 2.247, 2.243, 2.237, 2.228, 2.219, 2.209, 2.198, 2.186, 2.172, 2.161, 2.143, 2.129, 2.121, 2.121, 2.141,
+                            2.157, 2.124, 2.124, 2.131, 2.148, 2.161, 2.188, 2.202, 2.214, 2.238, 2.246, 2.251, 2.255, 2.257, 2.259, 2.259, 2.257, 2.252, 2.251, 2.247, 2.238, 2.231, 2.219, 2.204, 2.193, 2.173, 2.166, 2.152, 2.134, 2.119, 2.119, 2.131,
+                            2.155, 2.125, 2.125, 2.135, 2.151, 2.169, 2.191, 2.207, 2.219, 2.243, 2.253, 2.258, 2.261, 2.266, 2.266, 2.267, 2.265, 2.262, 2.261, 2.254, 2.244, 2.238, 2.228, 2.212, 2.197, 2.179, 2.167, 2.158, 2.137, 2.122, 2.121, 2.131,
+                            2.155, 2.127, 2.127, 2.137, 2.153, 2.173, 2.197, 2.213, 2.231, 2.248, 2.257, 2.266, 2.271, 2.272, 2.274, 2.275, 2.275, 2.273, 2.271, 2.266, 2.257, 2.251, 2.238, 2.227, 2.209, 2.195, 2.175, 2.159, 2.141, 2.128, 2.127, 2.131,
+                            2.155, 2.128, 2.128, 2.139, 2.159, 2.182, 2.206, 2.225, 2.243, 2.252, 2.265, 2.272, 2.277, 2.283, 2.286, 2.284, 2.283, 2.282, 2.274, 2.272, 2.266, 2.256, 2.244, 2.238, 2.221, 2.202, 2.186, 2.169, 2.149, 2.129, 2.129, 2.135,
+                            2.154, 2.131, 2.131, 2.149, 2.166, 2.189, 2.211, 2.234, 2.248, 2.262, 2.272, 2.277, 2.287, 2.291, 2.293, 2.292, 2.291, 2.285, 2.284, 2.279, 2.272, 2.263, 2.254, 2.243, 2.226, 2.206, 2.193, 2.174, 2.153, 2.133, 2.133, 2.135,
+                            2.153, 2.135, 2.135, 2.151, 2.172, 2.198, 2.221, 2.238, 2.255, 2.265, 2.274, 2.287, 2.291, 2.296, 2.298, 2.298, 2.301, 2.297, 2.289, 2.285, 2.277, 2.271, 2.261, 2.251, 2.236, 2.216, 2.199, 2.179, 2.158, 2.135, 2.134, 2.135,
+                            2.152, 2.136, 2.136, 2.154, 2.176, 2.199, 2.224, 2.239, 2.256, 2.267, 2.282, 2.289, 2.295, 2.299, 2.303, 2.303, 2.302, 2.299, 2.297, 2.288, 2.284, 2.274, 2.262, 2.253, 2.238, 2.219, 2.202, 2.181, 2.158, 2.137, 2.135, 2.135,
+                            2.143, 2.134, 2.134, 2.154, 2.177, 2.201, 2.224, 2.241, 2.256, 2.271, 2.282, 2.289, 2.297, 2.302, 2.306, 2.306, 2.304, 2.301, 2.298, 2.289, 2.287, 2.272, 2.265, 2.255, 2.241, 2.221, 2.203, 2.183, 2.164, 2.141, 2.136, 2.135,
+                            2.142, 2.133, 2.133, 2.155, 2.178, 2.202, 2.223, 2.243, 2.258, 2.273, 2.283, 2.288, 2.296, 2.299, 2.306, 2.306, 2.301, 2.299, 2.296, 2.289, 2.286, 2.271, 2.267, 2.256, 2.244, 2.219, 2.206, 2.188, 2.163, 2.141, 2.137, 2.134,
+                            2.141, 2.131, 2.131, 2.153, 2.179, 2.202, 2.224, 2.242, 2.254, 2.274, 2.283, 2.288, 2.295, 2.298, 2.301, 2.301, 2.301, 2.296, 2.295, 2.289, 2.285, 2.271, 2.267, 2.257, 2.246, 2.223, 2.204, 2.188, 2.165, 2.141, 2.136, 2.134,
+                            2.141, 2.133, 2.133, 2.151, 2.179, 2.201, 2.224, 2.241, 2.254, 2.275, 2.283, 2.288, 2.294, 2.296, 2.298, 2.297, 2.295, 2.295, 2.294, 2.291, 2.284, 2.272, 2.267, 2.256, 2.248, 2.225, 2.208, 2.192, 2.167, 2.141, 2.137, 2.134,
+                            2.141, 2.132, 2.132, 2.151, 2.177, 2.199, 2.221, 2.238, 2.252, 2.274, 2.281, 2.287, 2.293, 2.295, 2.296, 2.294, 2.295, 2.295, 2.294, 2.291, 2.284, 2.274, 2.266, 2.257, 2.248, 2.226, 2.206, 2.189, 2.167, 2.143, 2.141, 2.141,
+                            2.141, 2.133, 2.133, 2.153, 2.175, 2.201, 2.221, 2.238, 2.252, 2.271, 2.278, 2.284, 2.288, 2.291, 2.292, 2.291, 2.293, 2.293, 2.293, 2.287, 2.279, 2.275, 2.266, 2.256, 2.243, 2.224, 2.206, 2.189, 2.168, 2.146, 2.142, 2.134,
+                            2.137, 2.131, 2.131, 2.154, 2.173, 2.199, 2.221, 2.236, 2.251, 2.267, 2.272, 2.278, 2.284, 2.287, 2.288, 2.286, 2.288, 2.288, 2.288, 2.283, 2.277, 2.273, 2.265, 2.256, 2.241, 2.219, 2.205, 2.187, 2.167, 2.144, 2.137, 2.132,
+                            2.136, 2.131, 2.131, 2.152, 2.169, 2.197, 2.218, 2.233, 2.246, 2.257, 2.269, 2.274, 2.281, 2.284, 2.286, 2.285, 2.286, 2.286, 2.286, 2.279, 2.274, 2.269, 2.263, 2.254, 2.239, 2.217, 2.203, 2.181, 2.162, 2.143, 2.133, 2.131,
+                            2.136, 2.131, 2.131, 2.151, 2.167, 2.189, 2.205, 2.226, 2.242, 2.253, 2.261, 2.271, 2.275, 2.279, 2.283, 2.283, 2.284, 2.284, 2.281, 2.277, 2.271, 2.264, 2.257, 2.246, 2.232, 2.215, 2.195, 2.176, 2.158, 2.141, 2.131, 2.128,
+                            2.136, 2.129, 2.131, 2.147, 2.162, 2.181, 2.203, 2.219, 2.236, 2.246, 2.256, 2.263, 2.271, 2.274, 2.278, 2.278, 2.276, 2.277, 2.276, 2.273, 2.266, 2.258, 2.251, 2.241, 2.227, 2.198, 2.191, 2.169, 2.154, 2.136, 2.125, 2.122,
+                            2.132, 2.126, 2.126, 2.139, 2.153, 2.168, 2.194, 2.212, 2.224, 2.238, 2.251, 2.258, 2.263, 2.266, 2.269, 2.271, 2.269, 2.269, 2.269, 2.267, 2.259, 2.253, 2.245, 2.237, 2.219, 2.196, 2.179, 2.162, 2.149, 2.132, 2.122, 2.121,
+                            2.124, 2.119, 2.121, 2.137, 2.147, 2.164, 2.183, 2.199, 2.219, 2.231, 2.239, 2.251, 2.257, 2.261, 2.262, 2.262, 2.259, 2.259, 2.261, 2.258, 2.253, 2.245, 2.237, 2.224, 2.209, 2.187, 2.174, 2.157, 2.141, 2.122, 2.121, 2.121,
+                            2.123, 2.115, 2.115, 2.131, 2.138, 2.157, 2.174, 2.188, 2.207, 2.221, 2.233, 2.239, 2.243, 2.244, 2.244, 2.244, 2.246, 2.245, 2.246, 2.244, 2.241, 2.231, 2.224, 2.212, 2.195, 2.176, 2.159, 2.145, 2.128, 2.117, 2.117, 2.123,
+                            2.123, 2.113, 2.113, 2.123, 2.132, 2.141, 2.162, 2.177, 2.191, 2.208, 2.221, 2.231, 2.231, 2.232, 2.234, 2.235, 2.235, 2.235, 2.238, 2.237, 2.225, 2.214, 2.209, 2.199, 2.181, 2.164, 2.146, 2.135, 2.123, 2.116, 2.116, 2.115,
+                            2.129, 2.115, 2.115, 2.121, 2.128, 2.135, 2.149, 2.164, 2.178, 2.193, 2.207, 2.221, 2.222, 2.222, 2.223, 2.224, 2.224, 2.224, 2.224, 2.223, 2.214, 2.205, 2.196, 2.185, 2.171, 2.151, 2.141, 2.129, 2.119, 2.116, 2.116, 2.117,
+                            2.137, 2.119, 2.119, 2.119, 2.122, 2.129, 2.141, 2.159, 2.167, 2.182, 2.195, 2.206, 2.211, 2.216, 2.218, 2.219, 2.219, 2.219, 2.217, 2.212, 2.202, 2.194, 2.184, 2.174, 2.162, 2.145, 2.134, 2.124, 2.118, 2.117, 2.118, 2.121,
+                            2.138, 2.131, 2.121, 2.122, 2.125, 2.128, 2.137, 2.154, 2.162, 2.176, 2.187, 2.194, 2.196, 2.198, 2.205, 2.205, 2.202, 2.202, 2.203, 2.201, 2.191, 2.182, 2.174, 2.162, 2.149, 2.136, 2.126, 2.121, 2.119, 2.118, 2.127, 2.133,
+                            2.157, 2.148, 2.131, 2.129, 2.129, 2.136, 2.148, 2.157, 2.169, 2.177, 2.182, 2.187, 2.188, 2.191, 2.193, 2.193, 2.192, 2.199, 2.201, 2.199, 2.186, 2.178, 2.167, 2.152, 2.146, 2.137, 2.126, 2.124, 2.121, 2.126, 2.133, 2.151,
+                            2.161, 2.157, 2.148, 2.147, 2.147, 2.147, 2.154, 2.162, 2.174, 2.179, 2.181, 2.184, 2.186, 2.187, 2.189, 2.189, 2.187, 2.188, 2.199, 2.201, 2.187, 2.178, 2.163, 2.148, 2.145, 2.141, 2.131, 2.129, 2.128, 2.135, 2.151, 2.153
+                        ]
+                    },
+                    {
+                        "ct": 5000,
+                        "table":
+                        [
+                            1.191, 1.165, 1.156, 1.155, 1.157, 1.161, 1.168, 1.176, 1.179, 1.185, 1.187, 1.189, 1.189, 1.189, 1.191, 1.191, 1.191, 1.189, 1.188, 1.188, 1.185, 1.184, 1.182, 1.178, 1.173, 1.171, 1.166, 1.163, 1.159, 1.159, 1.164, 1.187,
+                            1.188, 1.164, 1.157, 1.156, 1.158, 1.166, 1.173, 1.179, 1.185, 1.193, 1.195, 1.198, 1.199, 1.201, 1.201, 1.202, 1.201, 1.199, 1.199, 1.196, 1.194, 1.189, 1.185, 1.182, 1.177, 1.172, 1.168, 1.164, 1.161, 1.161, 1.162, 1.181,
+                            1.184, 1.164, 1.157, 1.157, 1.161, 1.171, 1.179, 1.185, 1.193, 1.197, 1.201, 1.206, 1.208, 1.209, 1.209, 1.208, 1.207, 1.207, 1.207, 1.202, 1.199, 1.195, 1.192, 1.189, 1.182, 1.176, 1.171, 1.166, 1.161, 1.159, 1.161, 1.177,
+                            1.183, 1.162, 1.158, 1.158, 1.163, 1.174, 1.182, 1.191, 1.197, 1.203, 1.208, 1.212, 1.214, 1.214, 1.218, 1.218, 1.214, 1.212, 1.211, 1.208, 1.206, 1.201, 1.197, 1.192, 1.189, 1.179, 1.174, 1.168, 1.162, 1.159, 1.159, 1.173,
+                            1.181, 1.159, 1.159, 1.159, 1.168, 1.178, 1.189, 1.196, 1.204, 1.208, 1.213, 1.217, 1.219, 1.221, 1.222, 1.222, 1.222, 1.221, 1.219, 1.215, 1.212, 1.208, 1.202, 1.197, 1.189, 1.183, 1.178, 1.169, 1.163, 1.158, 1.158, 1.169,
+                            1.174, 1.159, 1.159, 1.164, 1.172, 1.179, 1.192, 1.201, 1.208, 1.212, 1.219, 1.224, 1.225, 1.227, 1.228, 1.228, 1.226, 1.225, 1.224, 1.221, 1.217, 1.212, 1.208, 1.202, 1.194, 1.187, 1.181, 1.172, 1.164, 1.157, 1.157, 1.169,
+                            1.174, 1.159, 1.159, 1.165, 1.174, 1.184, 1.197, 1.205, 1.209, 1.219, 1.224, 1.228, 1.231, 1.231, 1.231, 1.231, 1.229, 1.229, 1.228, 1.226, 1.222, 1.218, 1.212, 1.205, 1.199, 1.188, 1.181, 1.175, 1.165, 1.157, 1.157, 1.163,
+                            1.173, 1.159, 1.159, 1.165, 1.176, 1.186, 1.198, 1.207, 1.213, 1.223, 1.229, 1.231, 1.235, 1.236, 1.236, 1.236, 1.236, 1.235, 1.234, 1.232, 1.226, 1.223, 1.218, 1.209, 1.201, 1.192, 1.183, 1.178, 1.165, 1.157, 1.157, 1.163,
+                            1.172, 1.159, 1.159, 1.166, 1.176, 1.188, 1.201, 1.209, 1.217, 1.227, 1.231, 1.236, 1.238, 1.239, 1.241, 1.242, 1.242, 1.241, 1.239, 1.235, 1.232, 1.227, 1.223, 1.215, 1.208, 1.199, 1.187, 1.179, 1.167, 1.159, 1.159, 1.163,
+                            1.172, 1.159, 1.159, 1.166, 1.177, 1.189, 1.203, 1.212, 1.223, 1.228, 1.236, 1.239, 1.242, 1.245, 1.246, 1.246, 1.247, 1.246, 1.242, 1.241, 1.237, 1.232, 1.226, 1.223, 1.213, 1.202, 1.191, 1.182, 1.172, 1.159, 1.159, 1.163,
+                            1.168, 1.158, 1.158, 1.167, 1.179, 1.192, 1.204, 1.218, 1.225, 1.233, 1.238, 1.242, 1.246, 1.248, 1.251, 1.251, 1.249, 1.248, 1.247, 1.244, 1.239, 1.237, 1.228, 1.223, 1.214, 1.203, 1.194, 1.183, 1.173, 1.161, 1.161, 1.162,
+                            1.166, 1.158, 1.158, 1.168, 1.183, 1.195, 1.207, 1.218, 1.226, 1.233, 1.239, 1.246, 1.248, 1.251, 1.254, 1.254, 1.254, 1.251, 1.249, 1.247, 1.242, 1.239, 1.232, 1.227, 1.219, 1.207, 1.195, 1.186, 1.175, 1.162, 1.161, 1.162,
+                            1.165, 1.158, 1.158, 1.168, 1.183, 1.196, 1.208, 1.219, 1.227, 1.234, 1.241, 1.247, 1.251, 1.254, 1.255, 1.256, 1.256, 1.254, 1.252, 1.249, 1.246, 1.241, 1.234, 1.228, 1.221, 1.211, 1.199, 1.187, 1.175, 1.163, 1.162, 1.162,
+                            1.161, 1.158, 1.158, 1.169, 1.183, 1.196, 1.208, 1.217, 1.227, 1.234, 1.241, 1.247, 1.253, 1.254, 1.256, 1.257, 1.256, 1.255, 1.253, 1.249, 1.247, 1.241, 1.236, 1.229, 1.221, 1.211, 1.199, 1.189, 1.176, 1.164, 1.163, 1.162,
+                            1.161, 1.156, 1.156, 1.169, 1.183, 1.196, 1.207, 1.218, 1.227, 1.235, 1.241, 1.246, 1.252, 1.254, 1.256, 1.257, 1.256, 1.254, 1.253, 1.249, 1.247, 1.241, 1.237, 1.231, 1.223, 1.211, 1.201, 1.191, 1.177, 1.164, 1.164, 1.161,
+                            1.161, 1.155, 1.155, 1.169, 1.182, 1.195, 1.208, 1.216, 1.225, 1.235, 1.241, 1.245, 1.249, 1.252, 1.254, 1.254, 1.254, 1.253, 1.252, 1.249, 1.246, 1.239, 1.237, 1.231, 1.224, 1.211, 1.201, 1.191, 1.178, 1.164, 1.162, 1.161,
+                            1.159, 1.155, 1.155, 1.168, 1.181, 1.195, 1.208, 1.217, 1.223, 1.235, 1.241, 1.244, 1.248, 1.251, 1.252, 1.252, 1.252, 1.252, 1.251, 1.248, 1.245, 1.241, 1.236, 1.231, 1.224, 1.212, 1.202, 1.191, 1.179, 1.164, 1.162, 1.161,
+                            1.158, 1.154, 1.154, 1.167, 1.181, 1.194, 1.206, 1.216, 1.222, 1.234, 1.237, 1.242, 1.245, 1.248, 1.251, 1.249, 1.249, 1.249, 1.249, 1.248, 1.244, 1.241, 1.235, 1.229, 1.223, 1.213, 1.202, 1.191, 1.179, 1.167, 1.163, 1.163,
+                            1.158, 1.154, 1.154, 1.168, 1.181, 1.194, 1.206, 1.215, 1.223, 1.231, 1.236, 1.239, 1.243, 1.245, 1.246, 1.246, 1.248, 1.248, 1.248, 1.245, 1.242, 1.239, 1.235, 1.229, 1.223, 1.213, 1.202, 1.191, 1.179, 1.167, 1.163, 1.162,
+                            1.157, 1.154, 1.154, 1.168, 1.179, 1.194, 1.205, 1.215, 1.222, 1.229, 1.233, 1.236, 1.239, 1.243, 1.244, 1.244, 1.245, 1.245, 1.244, 1.243, 1.239, 1.236, 1.234, 1.229, 1.222, 1.211, 1.202, 1.191, 1.179, 1.166, 1.163, 1.161,
+                            1.156, 1.155, 1.155, 1.168, 1.179, 1.193, 1.205, 1.213, 1.219, 1.225, 1.231, 1.234, 1.238, 1.239, 1.241, 1.243, 1.243, 1.243, 1.243, 1.239, 1.237, 1.235, 1.231, 1.228, 1.221, 1.209, 1.199, 1.189, 1.178, 1.166, 1.162, 1.159,
+                            1.156, 1.156, 1.157, 1.167, 1.178, 1.191, 1.199, 1.209, 1.217, 1.223, 1.226, 1.231, 1.233, 1.236, 1.239, 1.239, 1.241, 1.241, 1.239, 1.237, 1.235, 1.232, 1.229, 1.224, 1.217, 1.209, 1.196, 1.187, 1.176, 1.165, 1.159, 1.157,
+                            1.157, 1.157, 1.157, 1.166, 1.175, 1.187, 1.198, 1.205, 1.213, 1.219, 1.223, 1.227, 1.231, 1.233, 1.236, 1.236, 1.234, 1.235, 1.235, 1.235, 1.231, 1.229, 1.227, 1.222, 1.216, 1.201, 1.194, 1.184, 1.174, 1.163, 1.157, 1.156,
+                            1.158, 1.155, 1.155, 1.165, 1.172, 1.181, 1.194, 1.202, 1.208, 1.215, 1.221, 1.223, 1.227, 1.229, 1.231, 1.231, 1.231, 1.232, 1.233, 1.231, 1.228, 1.227, 1.223, 1.219, 1.213, 1.199, 1.189, 1.181, 1.171, 1.161, 1.157, 1.156,
+                            1.155, 1.154, 1.154, 1.164, 1.169, 1.179, 1.189, 1.196, 1.203, 1.208, 1.215, 1.221, 1.222, 1.224, 1.225, 1.225, 1.226, 1.228, 1.228, 1.227, 1.225, 1.222, 1.219, 1.213, 1.206, 1.196, 1.187, 1.177, 1.168, 1.159, 1.156, 1.156,
+                            1.155, 1.152, 1.152, 1.162, 1.167, 1.175, 1.185, 1.191, 1.198, 1.205, 1.209, 1.214, 1.216, 1.217, 1.217, 1.217, 1.219, 1.219, 1.219, 1.219, 1.217, 1.215, 1.213, 1.207, 1.199, 1.191, 1.179, 1.172, 1.165, 1.156, 1.155, 1.155,
+                            1.155, 1.152, 1.152, 1.161, 1.163, 1.169, 1.179, 1.186, 1.192, 1.198, 1.204, 1.208, 1.211, 1.211, 1.211, 1.212, 1.212, 1.213, 1.215, 1.215, 1.211, 1.208, 1.205, 1.199, 1.194, 1.185, 1.175, 1.167, 1.161, 1.156, 1.155, 1.153,
+                            1.157, 1.152, 1.152, 1.159, 1.162, 1.166, 1.174, 1.181, 1.187, 1.192, 1.197, 1.203, 1.204, 1.205, 1.204, 1.204, 1.204, 1.205, 1.206, 1.206, 1.204, 1.201, 1.198, 1.194, 1.187, 1.176, 1.171, 1.164, 1.159, 1.156, 1.155, 1.154,
+                            1.159, 1.154, 1.154, 1.158, 1.159, 1.163, 1.171, 1.176, 1.181, 1.187, 1.191, 1.195, 1.198, 1.199, 1.199, 1.201, 1.201, 1.202, 1.202, 1.199, 1.196, 1.193, 1.191, 1.188, 1.182, 1.174, 1.166, 1.162, 1.157, 1.156, 1.156, 1.156,
+                            1.162, 1.161, 1.158, 1.159, 1.159, 1.162, 1.167, 1.173, 1.178, 1.181, 1.186, 1.189, 1.189, 1.191, 1.193, 1.193, 1.193, 1.194, 1.194, 1.194, 1.189, 1.187, 1.186, 1.182, 1.176, 1.167, 1.163, 1.159, 1.158, 1.157, 1.158, 1.161,
+                            1.172, 1.165, 1.162, 1.162, 1.163, 1.166, 1.169, 1.173, 1.178, 1.181, 1.182, 1.185, 1.186, 1.186, 1.186, 1.187, 1.187, 1.189, 1.192, 1.191, 1.187, 1.185, 1.181, 1.177, 1.172, 1.167, 1.163, 1.159, 1.159, 1.161, 1.163, 1.166,
+                            1.173, 1.172, 1.166, 1.165, 1.166, 1.168, 1.171, 1.176, 1.179, 1.182, 1.181, 1.183, 1.185, 1.185, 1.185, 1.185, 1.185, 1.185, 1.191, 1.191, 1.185, 1.181, 1.179, 1.173, 1.169, 1.168, 1.163, 1.162, 1.161, 1.164, 1.166, 1.167
+                        ]
+                    }
+                ],
+                "luminance_lut":
+                [
+                    2.271, 2.218, 2.105, 2.004, 1.909, 1.829, 1.762, 1.705, 1.665, 1.629, 1.592, 1.559, 1.528, 1.516, 1.511, 1.511, 1.511, 1.514, 1.525, 1.553, 1.585, 1.617, 1.655, 1.697, 1.752, 1.816, 1.893, 1.982, 2.084, 2.195, 2.321, 2.342,
+                    2.218, 2.166, 2.057, 1.959, 1.871, 1.793, 1.726, 1.675, 1.633, 1.592, 1.559, 1.528, 1.503, 1.484, 1.474, 1.472, 1.472, 1.482, 1.499, 1.523, 1.553, 1.585, 1.619, 1.664, 1.715, 1.779, 1.855, 1.938, 2.037, 2.147, 2.259, 2.321,
+                    2.166, 2.101, 1.997, 1.901, 1.818, 1.743, 1.683, 1.634, 1.588, 1.546, 1.508, 1.476, 1.449, 1.429, 1.418, 1.415, 1.415, 1.425, 1.444, 1.469, 1.501, 1.538, 1.577, 1.622, 1.671, 1.728, 1.799, 1.881, 1.975, 2.078, 2.185, 2.259,
+                    2.101, 2.039, 1.938, 1.848, 1.768, 1.699, 1.641, 1.588, 1.541, 1.494, 1.455, 1.421, 1.394, 1.374, 1.361, 1.357, 1.357, 1.367, 1.388, 1.414, 1.448, 1.485, 1.528, 1.577, 1.626, 1.682, 1.748, 1.827, 1.917, 2.014, 2.119, 2.185,
+                    2.039, 1.979, 1.883, 1.795, 1.722, 1.658, 1.596, 1.541, 1.493, 1.443, 1.401, 1.364, 1.336, 1.316, 1.303, 1.301, 1.301, 1.311, 1.331, 1.359, 1.393, 1.432, 1.482, 1.528, 1.582, 1.641, 1.701, 1.775, 1.861, 1.956, 2.056, 2.119,
+                    1.979, 1.932, 1.836, 1.752, 1.685, 1.621, 1.557, 1.497, 1.443, 1.399, 1.351, 1.314, 1.286, 1.264, 1.253, 1.249, 1.249, 1.259, 1.281, 1.311, 1.344, 1.387, 1.432, 1.484, 1.541, 1.601, 1.662, 1.731, 1.816, 1.908, 2.003, 2.056,
+                    1.934, 1.888, 1.798, 1.719, 1.651, 1.584, 1.519, 1.457, 1.401, 1.351, 1.307, 1.268, 1.239, 1.217, 1.206, 1.203, 1.203, 1.212, 1.234, 1.263, 1.298, 1.344, 1.387, 1.442, 1.502, 1.565, 1.628, 1.693, 1.774, 1.864, 1.956, 2.003,
+                    1.901, 1.851, 1.763, 1.688, 1.618, 1.551, 1.483, 1.419, 1.359, 1.307, 1.268, 1.226, 1.195, 1.175, 1.164, 1.161, 1.161, 1.171, 1.192, 1.221, 1.262, 1.298, 1.346, 1.404, 1.466, 1.532, 1.595, 1.661, 1.738, 1.826, 1.917, 1.956,
+                    1.873, 1.821, 1.734, 1.659, 1.591, 1.519, 1.451, 1.386, 1.324, 1.269, 1.226, 1.192, 1.159, 1.141, 1.127, 1.125, 1.125, 1.135, 1.155, 1.187, 1.221, 1.262, 1.311, 1.368, 1.432, 1.499, 1.566, 1.634, 1.708, 1.793, 1.882, 1.917,
+                    1.847, 1.797, 1.713, 1.639, 1.565, 1.493, 1.422, 1.355, 1.291, 1.238, 1.192, 1.159, 1.128, 1.108, 1.097, 1.094, 1.094, 1.104, 1.125, 1.155, 1.187, 1.229, 1.279, 1.338, 1.403, 1.471, 1.541, 1.611, 1.684, 1.766, 1.853, 1.885,
+                    1.828, 1.772, 1.691, 1.614, 1.539, 1.466, 1.394, 1.325, 1.264, 1.209, 1.163, 1.128, 1.104, 1.081, 1.069, 1.067, 1.067, 1.078, 1.101, 1.125, 1.159, 1.201, 1.252, 1.312, 1.379, 1.447, 1.517, 1.591, 1.665, 1.743, 1.831, 1.862,
+                    1.812, 1.754, 1.677, 1.599, 1.519, 1.445, 1.371, 1.302, 1.239, 1.185, 1.139, 1.104, 1.081, 1.061, 1.048, 1.046, 1.046, 1.058, 1.078, 1.102, 1.136, 1.177, 1.229, 1.289, 1.356, 1.425, 1.497, 1.572, 1.647, 1.724, 1.811, 1.847,
+                    1.798, 1.741, 1.663, 1.585, 1.506, 1.429, 1.353, 1.284, 1.221, 1.167, 1.121, 1.086, 1.061, 1.046, 1.031, 1.029, 1.029, 1.044, 1.058, 1.083, 1.116, 1.159, 1.209, 1.271, 1.338, 1.407, 1.479, 1.557, 1.633, 1.709, 1.792, 1.832,
+                    1.792, 1.727, 1.651, 1.572, 1.494, 1.414, 1.339, 1.269, 1.206, 1.152, 1.106, 1.072, 1.046, 1.031, 1.018, 1.016, 1.016, 1.029, 1.044, 1.069, 1.102, 1.145, 1.196, 1.256, 1.324, 1.394, 1.471, 1.545, 1.624, 1.698, 1.782, 1.825,
+                    1.787, 1.724, 1.647, 1.566, 1.484, 1.407, 1.329, 1.258, 1.196, 1.141, 1.097, 1.062, 1.036, 1.018, 1.012, 1.007, 1.011, 1.016, 1.034, 1.059, 1.093, 1.135, 1.186, 1.246, 1.314, 1.386, 1.461, 1.538, 1.616, 1.691, 1.773, 1.818,
+                    1.786, 1.721, 1.642, 1.562, 1.481, 1.402, 1.325, 1.254, 1.191, 1.137, 1.092, 1.057, 1.031, 1.013, 1.004, 1.001, 1.004, 1.011, 1.028, 1.054, 1.088, 1.129, 1.181, 1.241, 1.308, 1.382, 1.458, 1.535, 1.613, 1.687, 1.769, 1.818,
+                    1.786, 1.721, 1.642, 1.562, 1.481, 1.401, 1.325, 1.253, 1.191, 1.136, 1.091, 1.057, 1.031, 1.013, 1.003, 1.001, 1.001, 1.011, 1.028, 1.054, 1.088, 1.129, 1.181, 1.241, 1.308, 1.382, 1.458, 1.535, 1.613, 1.687, 1.769, 1.818,
+                    1.787, 1.722, 1.643, 1.563, 1.482, 1.402, 1.326, 1.254, 1.192, 1.138, 1.092, 1.057, 1.032, 1.013, 1.006, 1.002, 1.006, 1.012, 1.031, 1.057, 1.092, 1.133, 1.185, 1.243, 1.311, 1.385, 1.461, 1.539, 1.618, 1.691, 1.774, 1.821,
+                    1.789, 1.729, 1.651, 1.571, 1.489, 1.411, 1.334, 1.263, 1.201, 1.147, 1.101, 1.065, 1.038, 1.021, 1.013, 1.009, 1.012, 1.021, 1.038, 1.064, 1.098, 1.141, 1.193, 1.254, 1.321, 1.395, 1.472, 1.549, 1.626, 1.701, 1.785, 1.825,
+                    1.799, 1.739, 1.661, 1.581, 1.502, 1.422, 1.347, 1.277, 1.214, 1.159, 1.111, 1.075, 1.049, 1.037, 1.021, 1.019, 1.021, 1.036, 1.049, 1.076, 1.111, 1.154, 1.207, 1.268, 1.334, 1.408, 1.485, 1.562, 1.639, 1.715, 1.799, 1.837,
+                    1.811, 1.755, 1.676, 1.597, 1.518, 1.439, 1.365, 1.295, 1.231, 1.176, 1.129, 1.093, 1.067, 1.049, 1.038, 1.036, 1.036, 1.049, 1.067, 1.094, 1.129, 1.173, 1.225, 1.286, 1.353, 1.425, 1.501, 1.577, 1.653, 1.729, 1.815, 1.851,
+                    1.829, 1.774, 1.693, 1.615, 1.537, 1.462, 1.387, 1.316, 1.253, 1.198, 1.153, 1.115, 1.091, 1.067, 1.059, 1.056, 1.056, 1.067, 1.092, 1.115, 1.151, 1.196, 1.249, 1.309, 1.375, 1.446, 1.522, 1.595, 1.672, 1.752, 1.839, 1.871,
+                    1.851, 1.801, 1.713, 1.636, 1.561, 1.485, 1.411, 1.342, 1.281, 1.226, 1.179, 1.145, 1.115, 1.091, 1.082, 1.081, 1.082, 1.092, 1.115, 1.143, 1.178, 1.223, 1.276, 1.337, 1.402, 1.472, 1.544, 1.618, 1.691, 1.774, 1.865, 1.896,
+                    1.876, 1.831, 1.739, 1.663, 1.588, 1.513, 1.439, 1.374, 1.312, 1.258, 1.212, 1.179, 1.145, 1.123, 1.113, 1.112, 1.112, 1.122, 1.143, 1.177, 1.211, 1.256, 1.308, 1.368, 1.431, 1.501, 1.572, 1.641, 1.716, 1.802, 1.896, 1.931,
+                    1.909, 1.867, 1.771, 1.691, 1.617, 1.545, 1.474, 1.411, 1.349, 1.296, 1.252, 1.212, 1.182, 1.159, 1.149, 1.148, 1.149, 1.158, 1.179, 1.211, 1.253, 1.293, 1.344, 1.403, 1.465, 1.533, 1.603, 1.669, 1.747, 1.836, 1.931, 1.974,
+                    1.952, 1.905, 1.806, 1.722, 1.651, 1.578, 1.511, 1.448, 1.388, 1.338, 1.296, 1.252, 1.223, 1.201, 1.189, 1.189, 1.189, 1.199, 1.224, 1.253, 1.293, 1.338, 1.384, 1.442, 1.504, 1.571, 1.638, 1.704, 1.782, 1.872, 1.974, 2.025,
+                    2.004, 1.951, 1.849, 1.759, 1.688, 1.619, 1.552, 1.491, 1.435, 1.388, 1.338, 1.301, 1.272, 1.249, 1.238, 1.236, 1.236, 1.248, 1.271, 1.301, 1.338, 1.384, 1.431, 1.484, 1.543, 1.609, 1.675, 1.742, 1.825, 1.919, 2.025, 2.081,
+                    2.062, 2.004, 1.898, 1.805, 1.729, 1.661, 1.597, 1.539, 1.486, 1.435, 1.391, 1.354, 1.326, 1.303, 1.291, 1.289, 1.289, 1.301, 1.323, 1.353, 1.389, 1.431, 1.483, 1.528, 1.585, 1.649, 1.713, 1.787, 1.875, 1.971, 2.081, 2.145,
+                    2.129, 2.062, 1.951, 1.854, 1.774, 1.705, 1.642, 1.586, 1.539, 1.486, 1.445, 1.411, 1.383, 1.361, 1.348, 1.347, 1.348, 1.359, 1.379, 1.409, 1.447, 1.484, 1.528, 1.578, 1.631, 1.691, 1.759, 1.836, 1.928, 2.031, 2.145, 2.217,
+                    2.201, 2.129, 2.013, 1.912, 1.827, 1.752, 1.689, 1.642, 1.586, 1.544, 1.501, 1.468, 1.442, 1.421, 1.409, 1.409, 1.411, 1.421, 1.439, 1.467, 1.504, 1.543, 1.578, 1.629, 1.679, 1.739, 1.815, 1.894, 1.985, 2.098, 2.217, 2.298,
+                    2.273, 2.201, 2.081, 1.974, 1.886, 1.807, 1.741, 1.689, 1.643, 1.603, 1.562, 1.527, 1.504, 1.485, 1.475, 1.474, 1.475, 1.487, 1.503, 1.531, 1.565, 1.601, 1.634, 1.678, 1.728, 1.795, 1.877, 1.961, 2.052, 2.169, 2.298, 2.365,
+                    2.317, 2.273, 2.146, 2.039, 1.946, 1.864, 1.792, 1.737, 1.688, 1.643, 1.603, 1.562, 1.533, 1.525, 1.523, 1.523, 1.523, 1.525, 1.534, 1.565, 1.601, 1.634, 1.677, 1.722, 1.772, 1.848, 1.935, 2.023, 2.108, 2.232, 2.365, 2.403
+                ],
+                "sigma": 0.00285,
+                "sigma_Cb": 0.00166
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 1,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 2500,
+                        "ccm":
+                        [
+                            1.70741, -0.05307, -0.65433,
+                            -0.62822, 1.68836, -0.06014,
+                            -0.04452, -1.87628, 2.92079
+                        ]
+                    },
+                    {
+                        "ct": 2803,
+                        "ccm":
+                        [
+                            1.74383, -0.18731, -0.55652,
+                            -0.56491, 1.67772, -0.11281,
+                            -0.01522, -1.60635, 2.62157
+                        ]
+                    },
+                    {
+                        "ct": 2912,
+                        "ccm":
+                        [
+                            1.75215, -0.22221, -0.52995,
+                            -0.54568, 1.63522, -0.08954,
+                            0.02633, -1.56997, 2.54364
+                        ]
+                    },
+                    {
+                        "ct": 2914,
+                        "ccm":
+                        [
+                            1.72423, -0.28939, -0.43484,
+                            -0.55188, 1.62925, -0.07737,
+                            0.01959, -1.28661, 2.26702
+                        ]
+                    },
+                    {
+                        "ct": 3605,
+                        "ccm":
+                        [
+                            1.80381, -0.43646, -0.36735,
+                            -0.46505, 1.56814, -0.10309,
+                            0.00929, -1.00424, 1.99495
+                        ]
+                    },
+                    {
+                        "ct": 4540,
+                        "ccm":
+                        [
+                            1.85263, -0.46545, -0.38719,
+                            -0.44136, 1.68443, -0.24307,
+                            0.04108, -0.85599, 1.81491
+                        ]
+                    },
+                    {
+                        "ct": 5699,
+                        "ccm":
+                        [
+                            1.98595, -0.63542, -0.35054,
+                            -0.34623, 1.54146, -0.19522,
+                            0.00411, -0.70936, 1.70525
+                        ]
+                    },
+                    {
+                        "ct": 8625,
+                        "ccm":
+                        [
+                            2.21637, -0.56663, -0.64974,
+                            -0.41133, 1.96625, -0.55492,
+                            -0.02307, -0.83529, 1.85837
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.sharpen":
+            {
+                "threshold": 0.25,
+                "limit": 1.0,
+                "strength": 1.0
+            }
+        },
+        {
+            "rpi.hdr":
+            {
+                "Off":
+                {
+                    "cadence": [ 0 ]
+                },
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                },
+                "SingleExposure":
+                {
+                    "cadence": [ 1 ],
+                    "channel_map":
+                    {
+                        "short": 1
+                    },
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "MultiExposure":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    },
+                    "stitch_enable": 1,
+                    "spatial_gain": 2.0,
+                    "tonemap_enable": 1
+                },
+                "Night":
+                {
+                    "cadence": [ 3 ],
+                    "channel_map":
+                    {
+                        "short": 3
+                    },
+                    "tonemap_enable": 1,
+                    "tonemap":
+                    [
+                        0, 0,
+                        5000, 20000,
+                        10000, 30000,
+                        20000, 47000,
+                        30000, 55000,
+                        65535, 65535
+                    ]
+                }
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/data/uncalibrated.json b/src/ipa/rpi/pisp/data/uncalibrated.json
new file mode 100644
index 000000000..ff1e316ee
--- /dev/null
+++ b/src/ipa/rpi/pisp/data/uncalibrated.json
@@ -0,0 +1,135 @@
+{
+    "version": 2.0,
+    "target": "pisp",
+    "algorithms": [
+        {
+            "rpi.black_level":
+            {
+                "black_level": 4096
+            }
+        },
+        {
+            "rpi.awb":
+            {
+                "use_derivatives": 0,
+                "bayes": 0
+            }
+        },
+        {
+            "rpi.agc":
+            {
+                "metering_modes":
+                {
+                    "centre-weighted":
+                    {
+                        "weights":
+                        [
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                        ]
+                    }
+                },
+                "exposure_modes":
+                {
+                    "normal":
+                    {
+                        "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                        "gain": [ 1.0, 2.0, 3.0, 4.0, 6.0 ]
+                    }
+                },
+                "constraint_modes":
+                {
+                    "normal": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.4,
+                                1000, 0.4
+                            ]
+                        }
+                    ]
+                },
+                "y_target":
+                [
+                    0, 0.16,
+                    1000, 0.165,
+                    10000, 0.17
+                ]
+            }
+        },
+        {
+            "rpi.ccm":
+            {
+                "ccms": [
+                    {
+                        "ct": 4000,
+                        "ccm":
+                        [
+                            2.0, -1.0, 0.0,
+                            -0.5, 2.0, -0.5,
+                            0, -1.0, 2.0
+                        ]
+                    }
+                ]
+            }
+        },
+        {
+            "rpi.contrast":
+            {
+                "ce_enable": 0,
+                "gamma_curve":
+                [
+                    0, 0,
+                    1024, 5040,
+                    2048, 9338,
+                    3072, 12356,
+                    4096, 15312,
+                    5120, 18051,
+                    6144, 20790,
+                    7168, 23193,
+                    8192, 25744,
+                    9216, 27942,
+                    10240, 30035,
+                    11264, 32005,
+                    12288, 33975,
+                    13312, 35815,
+                    14336, 37600,
+                    15360, 39168,
+                    16384, 40642,
+                    18432, 43379,
+                    20480, 45749,
+                    22528, 47753,
+                    24576, 49621,
+                    26624, 51253,
+                    28672, 52698,
+                    30720, 53796,
+                    32768, 54876,
+                    36864, 57012,
+                    40960, 58656,
+                    45056, 59954,
+                    49152, 61183,
+                    53248, 62355,
+                    57344, 63419,
+                    61440, 64476,
+                    65535, 65535
+                ]
+            }
+        }
+    ]
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/pisp/meson.build b/src/ipa/rpi/pisp/meson.build
new file mode 100644
index 000000000..b1daf9fc8
--- /dev/null
+++ b/src/ipa/rpi/pisp/meson.build
@@ -0,0 +1,49 @@
+# SPDX-License-Identifier: CC0-1.0
+
+ipa_name = 'ipa_rpi_pisp'
+
+pisp_ipa_deps = [
+    libcamera_private,
+    libatomic,
+    libpisp_dep,
+]
+
+pisp_ipa_libs = [
+    rpi_ipa_cam_helper_lib,
+    rpi_ipa_common_lib,
+    rpi_ipa_controller_lib
+]
+
+pisp_ipa_includes = [
+    ipa_includes,
+    libipa_includes,
+]
+
+pisp_ipa_sources = files([
+    'pisp.cpp',
+])
+
+pisp_ipa_includes += include_directories('..')
+
+mod = shared_module(ipa_name,
+                    [pisp_ipa_sources, libcamera_generated_ipa_headers],
+                    name_prefix : '',
+                    include_directories : pisp_ipa_includes,
+                    dependencies : pisp_ipa_deps,
+                    link_with : libipa,
+                    link_whole : pisp_ipa_libs,
+                    install : true,
+                    install_dir : ipa_install_dir)
+
+if ipa_sign_module
+    custom_target(ipa_name + '.so.sign',
+                  input : mod,
+                  output : ipa_name + '.so.sign',
+                  command : [ipa_sign, ipa_priv_key, '@INPUT@', '@OUTPUT@'],
+                  install : false,
+                  build_by_default : true)
+endif
+
+subdir('data')
+
+ipa_names += ipa_name
diff --git a/src/ipa/rpi/pisp/pisp.cpp b/src/ipa/rpi/pisp/pisp.cpp
new file mode 100644
index 000000000..49579446a
--- /dev/null
+++ b/src/ipa/rpi/pisp/pisp.cpp
@@ -0,0 +1,1097 @@
+/* SPDX-License-Identifier: BSD-2-Clause */
+/*
+ * Copyright (C) 2023, Raspberry Pi Ltd
+ *
+ * pisp.cpp - Raspberry Pi PiSP IPA
+ */
+#include <algorithm>
+#include <cmath>
+#include <mutex>
+#include <string>
+#include <sys/mman.h>
+#include <utility>
+#include <vector>
+
+#include <libcamera/base/log.h>
+#include <libcamera/base/span.h>
+
+#include <libcamera/control_ids.h>
+
+#include <libcamera/ipa/ipa_module_info.h>
+
+#include "libpisp/backend/backend.hpp"
+#include "libpisp/frontend/frontend.hpp"
+
+#include "common/ipa_base.h"
+#include "controller/af_status.h"
+#include "controller/agc_algorithm.h"
+#include "controller/alsc_status.h"
+#include "controller/awb_algorithm.h"
+#include "controller/awb_status.h"
+#include "controller/black_level_algorithm.h"
+#include "controller/black_level_status.h"
+#include "controller/cac_status.h"
+#include "controller/ccm_status.h"
+#include "controller/contrast_status.h"
+#include "controller/denoise_algorithm.h"
+#include "controller/denoise_status.h"
+#include "controller/dpc_status.h"
+#include "controller/geq_status.h"
+#include "controller/hdr_status.h"
+#include "controller/lux_status.h"
+#include "controller/noise_status.h"
+#include "controller/pwl.h"
+#include "controller/saturation_status.h"
+#include "controller/sharpen_status.h"
+#include "controller/stitch_status.h"
+#include "controller/tonemap_status.h"
+
+using namespace std::literals::chrono_literals;
+
+namespace libcamera {
+
+LOG_DECLARE_CATEGORY(IPARPI)
+
+namespace {
+
+constexpr unsigned int NumLscCells = PISP_BE_LSC_GRID_SIZE;
+constexpr unsigned int NumLscVertexes = NumLscCells + 1;
+
+inline int32_t clampField(double value, std::size_t fieldBits, std::size_t fracBits = 0,
+			  bool isSigned = false, const char *desc = nullptr)
+{
+	ASSERT(fracBits <= fieldBits && fieldBits <= 32);
+
+	int min = -(isSigned << (fieldBits - 1));
+	int max = (1 << (fieldBits - isSigned)) - 1;
+	int32_t val =
+		std::clamp<int32_t>(std::round(value * (1 << fracBits)), min, max);
+
+	if (desc && val / (1 << fracBits) != value)
+		LOG(IPARPI, Warning)
+			<< desc << " rounded/clamped to " << val / (1 << fracBits);
+
+	return val;
+}
+
+int generateLut(const RPiController::Pwl &pwl, uint32_t *lut, std::size_t lutSize,
+		unsigned int SlopeBits = 14, unsigned int PosBits = 16)
+{
+	if (pwl.empty())
+		return -EINVAL;
+
+	int lastY = 0;
+	for (unsigned int i = 0; i < lutSize; i++) {
+		int x, y;
+		if (i < 32)
+			x = i * 512;
+		else if (i < 48)
+			x = (i - 32) * 1024 + 16384;
+		else
+			x = std::min(65535u, (i - 48) * 2048 + 32768);
+
+		y = pwl.eval(x);
+		if (y < 0 || (i && y < lastY)) {
+			LOG(IPARPI, Error)
+				<< "Malformed PWL for Gamma, disabling!";
+			return -1;
+		}
+
+		if (i) {
+			unsigned int slope = y - lastY;
+			if (slope >= (1u << SlopeBits)) {
+				slope = (1u << SlopeBits) - 1;
+				LOG(IPARPI, Info)
+					<< ("Maximum Gamma slope exceeded, adjusting!");
+				y = lastY + slope;
+			}
+			lut[i - 1] |= slope << PosBits;
+		}
+
+		lut[i] = y;
+		lastY = y;
+	}
+
+	return 0;
+}
+
+void packLscLut(uint32_t packed[NumLscVertexes][NumLscVertexes],
+		double const rgb[3][NumLscVertexes][NumLscVertexes])
+{
+	for (unsigned int y = 0; y < NumLscVertexes; ++y) {
+		for (unsigned int x = 0; x < NumLscVertexes; ++x) {
+			/* Jointly encode RGB gains in one of 4 ranges: [0.5:1.5), [0:2), [0:4), [0:8) */
+			double lo = std::min({ rgb[0][y][x], rgb[1][y][x], rgb[2][y][x] });
+			double hi = std::max({ rgb[0][y][x], rgb[1][y][x], rgb[2][y][x] });
+			uint32_t range;
+			double scale, offset;
+			if (lo >= 0.5 && hi < 1.5) {
+				range = 0;
+				scale = 1024.0;
+				offset = -511.5;
+			} else if (hi < 2.0) {
+				range = 1;
+				scale = 512.0;
+				offset = 0.5;
+			} else if (hi < 4.0) {
+				range = 2;
+				scale = 256.0;
+				offset = 0.5;
+			} else {
+				range = 3;
+				scale = 128.0;
+				offset = 0.5;
+			}
+			int r = clampField(offset + scale * rgb[0][y][x], 10);
+			int g = clampField(offset + scale * rgb[1][y][x], 10);
+			int b = clampField(offset + scale * rgb[2][y][x], 10);
+			packed[y][x] = (range << 30) | (b << 20) | (g << 10) | r;
+		}
+	}
+}
+
+/*
+ * Resamples a srcW x srcH table with central sampling to destW x destH with
+ * corner sampling.
+ */
+void resampleTable(double *dest, int destW, int destH, double const *src,
+		   int srcW, int srcH)
+{
+	/*
+	 * Precalculate and cache the x sampling locations and phases to
+	 * save recomputing them on every row.
+	 */
+	ASSERT(destW > 1 && destH > 1 && destW <= 64);
+	int xLo[64], xHi[64];
+	double xf[64];
+	double x = -0.5, xInc = srcW / (destW - 1);
+	for (int i = 0; i < destW; i++, x += xInc) {
+		xLo[i] = floor(x);
+		xf[i] = x - xLo[i];
+		xHi[i] = xLo[i] < (srcW - 1) ? (xLo[i] + 1) : (srcW - 1);
+		xLo[i] = xLo[i] > 0 ? xLo[i] : 0;
+	}
+
+	/* Now march over the output table generating the new values. */
+	double y = -0.5, yInc = srcH / (destH - 1);
+	for (int j = 0; j < destH; j++, y += yInc) {
+		int yLo = floor(y);
+		double yf = y - yLo;
+		int yHi = yLo < (srcH - 1) ? (yLo + 1) : (srcH - 1);
+		yLo = yLo > 0 ? yLo : 0;
+		double const *rowAbove = src + yLo * srcW;
+		double const *rowBelow = src + yHi * srcW;
+		for (int i = 0; i < destW; i++) {
+			double above = rowAbove[xLo[i]] * (1 - xf[i]) +
+				       rowAbove[xHi[i]] * xf[i];
+			double below = rowBelow[xLo[i]] * (1 - xf[i]) +
+				       rowBelow[xHi[i]] * xf[i];
+			*(dest++) = above * (1 - yf) + below * yf;
+		}
+	}
+}
+
+} /* namespace */
+
+using ::libpisp::BackEnd;
+using ::libpisp::FrontEnd;
+
+namespace ipa::RPi {
+
+class IpaPiSP final : public IpaBase
+{
+public:
+	IpaPiSP()
+		: IpaBase(), fe_(nullptr), be_(nullptr)
+	{
+	}
+
+	~IpaPiSP()
+	{
+		if (fe_)
+			munmap(fe_, sizeof(FrontEnd));
+		if (be_)
+			munmap(be_, sizeof(BackEnd));
+	}
+
+private:
+	int32_t platformInit(const InitParams &params, InitResult *result) override;
+	int32_t platformStart(const ControlList &controls, StartResult *result) override;
+	int32_t platformConfigure(const ConfigParams &params, ConfigResult *result) override;
+
+	void platformPrepareIsp(const PrepareParams &params,
+				RPiController::Metadata &rpiMetadata) override;
+	void platformPrepareAgc(RPiController::Metadata &rpiMetadata) override;
+	RPiController::StatisticsPtr platformProcessStats(Span<uint8_t> mem) override;
+
+	void handleControls(const ControlList &controls) override;
+
+	void applyWBG(const AwbStatus *awbStatus, double digitalGain,
+		      pisp_be_global_config &global);
+	void applyDgOnly(double digitalGain, pisp_be_global_config &global);
+	void applyCAC(const CacStatus *cacStatus, pisp_be_global_config &global);
+	void applyContrast(const ContrastStatus *contrastStatus,
+			   pisp_be_global_config &global);
+	void applyCCM(const CcmStatus *ccmStatus, pisp_be_global_config &global);
+	void applyBlackLevel(const BlackLevelStatus *blackLevelStatus,
+			     pisp_be_global_config &global);
+	void applyLensShading(const AlscStatus *alscStatus,
+			      pisp_be_global_config &global);
+	void applyDPC(const DpcStatus *dpcStatus, pisp_be_global_config &global);
+	void applySdn(const SdnStatus *sdnStatus, pisp_be_global_config &global);
+	void applyTdn(const TdnStatus *tdnStatus, const DeviceStatus *deviceStatus,
+		      pisp_be_global_config &global);
+	void applyCdn(const CdnStatus *cdnStatus, pisp_be_global_config &global);
+	void applyGeq(const GeqStatus *geqStatus, pisp_be_global_config &global);
+	void applySaturation(const SaturationStatus *geqStatus,
+			     pisp_be_global_config &global);
+	void applySharpen(const SharpenStatus *sharpenStatus,
+			  pisp_be_global_config &global);
+	bool applyStitch(const StitchStatus *stitchStatus, const DeviceStatus *deviceStatus,
+			 const AgcStatus *agcStatus, pisp_be_global_config &global);
+	void applyTonemap(const TonemapStatus *tonemapStatus,
+			  pisp_be_global_config &global);
+	void applyFocusStats(const NoiseStatus *noiseStatus);
+	void applyAF(const struct AfStatus *afStatus, ControlList &lensCtrls);
+
+	void setDefaultConfig();
+	void setStatsAndDebin();
+	void setHistogramWeights();
+
+	/* Frontend/Backend objects passed in from the pipeline handler. */
+	SharedFD feFD_;
+	SharedFD beFD_;
+	FrontEnd *fe_;
+	BackEnd *be_;
+
+	/* TDN/HDR runtime need the following state. */
+	bool tdnReset_;
+	utils::Duration lastExposure_;
+	std::map<std::string, utils::Duration> lastStitchExposures_;
+	HdrStatus lastStitchHdrStatus_;
+};
+
+int32_t IpaPiSP::platformInit(const InitParams &params,
+			      [[maybe_unused]] InitResult *result)
+{
+	const std::string &target = controller_.getTarget();
+	if (target != "pisp") {
+		LOG(IPARPI, Error)
+			<< "Tuning data file target returned \"" << target << "\""
+			<< ", expected \"pisp\"";
+		return -EINVAL;
+	}
+
+	/* Acquire the Frontend and Backend objects. */
+	feFD_ = std::move(params.fe);
+	beFD_ = std::move(params.be);
+
+	if (!feFD_.isValid() || !beFD_.isValid()) {
+		LOG(IPARPI, Error) << "Invalid FE/BE handles!";
+		return -ENODEV;
+	}
+
+	fe_ = static_cast<FrontEnd *>(mmap(nullptr, sizeof(FrontEnd),
+					   PROT_READ | PROT_WRITE, MAP_SHARED,
+					   feFD_.get(), 0));
+	be_ = static_cast<BackEnd *>(mmap(nullptr, sizeof(BackEnd),
+					  PROT_READ | PROT_WRITE, MAP_SHARED,
+					  beFD_.get(), 0));
+
+	if (!fe_ || !be_) {
+		LOG(IPARPI, Error) << "Unable to map FE/BE handles!";
+		return -ENODEV;
+	}
+
+	setDefaultConfig();
+
+	return 0;
+}
+
+int32_t IpaPiSP::platformStart([[maybe_unused]] const ControlList &controls,
+			       [[maybe_unused]] StartResult *result)
+{
+	tdnReset_ = true;
+
+	/* Cause the stitch block to be reset correctly. */
+	lastStitchHdrStatus_ = HdrStatus();
+
+	return 0;
+}
+
+int32_t IpaPiSP::platformConfigure([[maybe_unused]] const ConfigParams &params,
+				   [[maybe_unused]] ConfigResult *result)
+{
+	setStatsAndDebin();
+	return 0;
+}
+
+void IpaPiSP::platformPrepareIsp([[maybe_unused]] const PrepareParams &params,
+				 RPiController::Metadata &rpiMetadata)
+{
+	std::scoped_lock<RPiController::Metadata> l(rpiMetadata);
+
+	pisp_be_global_config global;
+	be_->GetGlobal(global);
+
+	global.bayer_enables &= ~(PISP_BE_BAYER_ENABLE_BLC + PISP_BE_BAYER_ENABLE_WBG +
+				  PISP_BE_BAYER_ENABLE_GEQ + PISP_BE_BAYER_ENABLE_LSC +
+				  PISP_BE_BAYER_ENABLE_SDN + PISP_BE_BAYER_ENABLE_CDN +
+				  PISP_BE_BAYER_ENABLE_TDN_OUTPUT + PISP_BE_BAYER_ENABLE_TDN_INPUT +
+				  PISP_BE_BAYER_ENABLE_STITCH_INPUT + PISP_BE_BAYER_ENABLE_STITCH_OUTPUT +
+				  PISP_BE_BAYER_ENABLE_STITCH + PISP_BE_BAYER_ENABLE_TONEMAP);
+	/* We leave the YCbCr and inverse conversion enabled in case of false colour or sharpening. */
+	global.rgb_enables &= ~(PISP_BE_RGB_ENABLE_GAMMA + PISP_BE_RGB_ENABLE_CCM +
+				PISP_BE_RGB_ENABLE_SHARPEN + PISP_BE_RGB_ENABLE_SAT_CONTROL);
+
+	NoiseStatus *noiseStatus = rpiMetadata.getLocked<NoiseStatus>("noise.status");
+
+	{
+		/* All Frontend config goes first, we do not want to hold the FE lock for long! */
+		std::scoped_lock<FrontEnd> lf(*fe_);
+
+		if (noiseStatus)
+			applyFocusStats(noiseStatus);
+
+		BlackLevelStatus *blackLevelStatus =
+			rpiMetadata.getLocked<BlackLevelStatus>("black_level.status");
+		if (blackLevelStatus)
+			applyBlackLevel(blackLevelStatus, global);
+
+	}
+
+	CacStatus *cacStatus = rpiMetadata.getLocked<CacStatus>("cac.status");
+	if (cacStatus)
+		applyCAC(cacStatus, global);
+
+	ContrastStatus *contrastStatus =
+		rpiMetadata.getLocked<ContrastStatus>("contrast.status");
+	if (contrastStatus)
+		applyContrast(contrastStatus, global);
+
+	CcmStatus *ccmStatus = rpiMetadata.getLocked<CcmStatus>("ccm.status");
+	if (ccmStatus)
+		applyCCM(ccmStatus, global);
+
+	AlscStatus *alscStatus = rpiMetadata.getLocked<AlscStatus>("alsc.status");
+	if (alscStatus)
+		applyLensShading(alscStatus, global);
+
+	DpcStatus *dpcStatus = rpiMetadata.getLocked<DpcStatus>("dpc.status");
+	if (dpcStatus)
+		applyDPC(dpcStatus, global);
+
+	SdnStatus *sdnStatus = rpiMetadata.getLocked<SdnStatus>("sdn.status");
+	if (sdnStatus)
+		applySdn(sdnStatus, global);
+
+	DeviceStatus *deviceStatus = rpiMetadata.getLocked<DeviceStatus>("device.status");
+	TdnStatus *tdnStatus = rpiMetadata.getLocked<TdnStatus>("tdn.status");
+	if (tdnStatus && deviceStatus)
+		applyTdn(tdnStatus, deviceStatus, global);
+
+	CdnStatus *cdnStatus = rpiMetadata.getLocked<CdnStatus>("cdn.status");
+	if (cdnStatus)
+		applyCdn(cdnStatus, global);
+
+	GeqStatus *geqStatus = rpiMetadata.getLocked<GeqStatus>("geq.status");
+	if (geqStatus)
+		applyGeq(geqStatus, global);
+
+	SaturationStatus *saturationStatus =
+		rpiMetadata.getLocked<SaturationStatus>("saturation.status");
+	if (saturationStatus)
+		applySaturation(saturationStatus, global);
+
+	SharpenStatus *sharpenStatus = rpiMetadata.getLocked<SharpenStatus>("sharpen.status");
+	if (sharpenStatus)
+		applySharpen(sharpenStatus, global);
+
+	StitchStatus *stitchStatus = rpiMetadata.getLocked<StitchStatus>("stitch.status");
+	if (stitchStatus) {
+		/*
+		 * Note that it's the *delayed* AGC status that contains the HDR mode/channel
+		 * info that pertains to this frame!
+		 */
+		AgcStatus *agcStatus = rpiMetadata.getLocked<AgcStatus>("agc.delayed_status");
+		/* prepareIsp() will fetch this value. Maybe pass it back differently? */
+		stitchSwapBuffers_ = applyStitch(stitchStatus, deviceStatus, agcStatus, global);
+	} else
+		lastStitchHdrStatus_ = HdrStatus();
+
+	TonemapStatus *tonemapStatus = rpiMetadata.getLocked<TonemapStatus>("tonemap.status");
+	if (tonemapStatus)
+		applyTonemap(tonemapStatus, global);
+
+	be_->SetGlobal(global);
+
+	/* Save this for TDN and HDR on the next frame. */
+	lastExposure_ = deviceStatus->shutterSpeed * deviceStatus->analogueGain;
+
+	/* Lens control */
+	const AfStatus *afStatus = rpiMetadata.getLocked<AfStatus>("af.status");
+	if (afStatus) {
+		ControlList lensctrls(lensCtrls_);
+		applyAF(afStatus, lensctrls);
+		if (!lensctrls.empty())
+			setLensControls.emit(lensctrls);
+	}
+}
+
+void IpaPiSP::platformPrepareAgc(RPiController::Metadata &rpiMetadata)
+{
+	std::scoped_lock<RPiController::Metadata> l(rpiMetadata);
+
+	AgcStatus *delayedAgcStatus = rpiMetadata.getLocked<AgcStatus>("agc.delayed_status");
+	/* If no delayed status, use the gain from the last mode switch. */
+	double digitalGain = delayedAgcStatus ? delayedAgcStatus->digitalGain : agcStatus_.digitalGain;
+	AwbStatus *awbStatus = rpiMetadata.getLocked<AwbStatus>("awb.status");
+
+	pisp_be_global_config global;
+	be_->GetGlobal(global);
+
+	{
+		/* All Frontend config goes first, we do not want to hold the FE lock for long! */
+		std::scoped_lock<FrontEnd> lf(*fe_);
+
+		if (awbStatus) {
+			/* Applies digital gain as well. */
+			applyWBG(awbStatus, digitalGain, global);
+		} else {
+			/* Mono sensor fallback for digital gain. */
+			applyDgOnly(digitalGain, global);
+		}
+	}
+
+	be_->SetGlobal(global);
+}
+
+RPiController::StatisticsPtr IpaPiSP::platformProcessStats(Span<uint8_t> mem)
+{
+	using namespace RPiController;
+
+	const pisp_statistics *stats = reinterpret_cast<pisp_statistics *>(mem.data());
+
+	unsigned int i;
+	StatisticsPtr statistics =
+		std::make_unique<Statistics>(Statistics::AgcStatsPos::PostWb,
+					     Statistics::ColourStatsPos::PreLsc);
+
+	/* RGB histograms are not used, so do not populate them. */
+	statistics->yHist = RPiController::Histogram(stats->agc.histogram,
+						     PISP_AGC_STATS_NUM_BINS);
+
+	statistics->awbRegions.init({ PISP_AWB_STATS_SIZE, PISP_AWB_STATS_SIZE });
+	for (i = 0; i < statistics->awbRegions.numRegions(); i++)
+		statistics->awbRegions.set(i, { { stats->awb.zones[i].R_sum,
+						  stats->awb.zones[i].G_sum,
+						  stats->awb.zones[i].B_sum },
+						stats->awb.zones[i].counted, 0 });
+
+	/* AGC region sums only get collected on floating zones. */
+	statistics->agcRegions.init({ 0, 0 }, PISP_FLOATING_STATS_NUM_ZONES);
+	for (i = 0; i < statistics->agcRegions.numRegions(); i++)
+		statistics->agcRegions.setFloating(i,
+						   { { 0, 0, 0, stats->agc.floating[i].Y_sum },
+						     stats->agc.floating[i].counted, 0 });
+
+	statistics->focusRegions.init({ PISP_CDAF_STATS_SIZE, PISP_CDAF_STATS_SIZE });
+	for (i = 0; i < statistics->focusRegions.numRegions(); i++)
+		statistics->focusRegions.set(i, { stats->cdaf.foms[i] >> 20, 0, 0 });
+
+	if (statsMetadataOutput_) {
+		Span<uint8_t> statsSpan((uint8_t *)(stats), sizeof(pisp_statistics));
+		libcameraMetadata_.set(controls::rpi::PispStatsOutput, statsSpan);
+	}
+
+	return statistics;
+}
+
+void IpaPiSP::handleControls(const ControlList &controls)
+{
+	for (auto const &ctrl : controls) {
+		switch (ctrl.first) {
+		case controls::HDR_MODE:
+		case controls::AE_METERING_MODE:
+			setHistogramWeights();
+			break;
+
+		case controls::draft::NOISE_REDUCTION_MODE: {
+			RPiController::DenoiseAlgorithm *denoise = dynamic_cast<RPiController::DenoiseAlgorithm *>(
+				controller_.getAlgorithm("denoise"));
+
+			if (!denoise) {
+				LOG(IPARPI, Warning)
+					<< "Could not set NOISE_REDUCTION_MODE - no Denoise algorithm";
+				return;
+			}
+
+			if (ctrl.second.get<int32_t>() == controls::draft::NoiseReductionModeOff)
+				denoise->setMode(RPiController::DenoiseMode::Off);
+			else
+				denoise->setMode(RPiController::DenoiseMode::ColourHighQuality);
+
+			break;
+		}
+		}
+	}
+}
+
+void IpaPiSP::applyWBG(const AwbStatus *awbStatus, double digitalGain,
+		       pisp_be_global_config &global)
+{
+	pisp_wbg_config wbg;
+	pisp_fe_rgby_config rgby = {};
+	double minColourGain = std::min({ awbStatus->gainR, awbStatus->gainG, awbStatus->gainB, 1.0 });
+	/* The 0.1 here doesn't mean much, but just stops arithmetic errors and extreme behaviour. */
+	double extraGain = 1.0 / std::max({ minColourGain, 0.1 });
+
+	/*
+	 * Apply an extra gain of 1 / minColourGain so as not to apply < 1 gains to any
+	 * channels (which would cause saturated pixels to go cyan or magenta).
+	 * Doing this doesn't really apply more gain than necessary, because one of the
+	 * channels is always getting the minimum gain possible. For this reason we also
+	 * don't change the values that we report externally.
+	 */
+	double gainR = awbStatus->gainR * extraGain;
+	double gainG = awbStatus->gainG * extraGain;
+	double gainB = awbStatus->gainB * extraGain;
+
+	wbg.gain_r = clampField(digitalGain * gainR, 14, 10);
+	wbg.gain_g = clampField(digitalGain * gainG, 14, 10);
+	wbg.gain_b = clampField(digitalGain * gainB, 14, 10);
+
+	/*
+	 * The YCbCr conversion block should contain the appropriate YCbCr
+	 * matrix. We should not rely on the CSC0 block as that might be
+	 * programmed for RGB outputs.
+	 */
+	pisp_be_ccm_config csc;
+	be_->GetYcbcr(csc);
+
+	/* The CSC coefficients already have the << 10 scaling applied. */
+	rgby.gain_r = clampField(csc.coeffs[0] * gainR, 14);
+	rgby.gain_g = clampField(csc.coeffs[1] * gainG, 14);
+	rgby.gain_b = clampField(csc.coeffs[2] * gainB, 14);
+
+	LOG(IPARPI, Debug) << "Applying WB R: " << awbStatus->gainR << " B: "
+			   << awbStatus->gainB;
+
+	be_->SetWbg(wbg);
+	fe_->SetRGBY(rgby);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_WBG;
+}
+
+void IpaPiSP::applyDgOnly(double digitalGain, pisp_be_global_config &global)
+{
+	pisp_wbg_config wbg;
+
+	wbg.gain_r = clampField(digitalGain, 14, 10);
+	wbg.gain_g = clampField(digitalGain, 14, 10);
+	wbg.gain_b = clampField(digitalGain, 14, 10);
+
+	LOG(IPARPI, Debug) << "Applying DG (only) : " << digitalGain;
+
+	be_->SetWbg(wbg);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_WBG;
+}
+
+void IpaPiSP::applyContrast(const ContrastStatus *contrastStatus,
+			    pisp_be_global_config &global)
+{
+	pisp_be_gamma_config gamma;
+
+	if (!generateLut(contrastStatus->gammaCurve, gamma.lut, PISP_BE_GAMMA_LUT_SIZE)) {
+		be_->SetGamma(gamma);
+		global.rgb_enables |= PISP_BE_RGB_ENABLE_GAMMA;
+	}
+}
+
+void IpaPiSP::applyCCM(const CcmStatus *ccmStatus, pisp_be_global_config &global)
+{
+	pisp_be_ccm_config ccm = {};
+
+	for (unsigned int i = 0; i < 9; i++)
+		ccm.coeffs[i] = clampField(ccmStatus->matrix[i], 14, 10, true);
+
+	be_->SetCcm(ccm);
+	global.rgb_enables |= PISP_BE_RGB_ENABLE_CCM;
+}
+
+void IpaPiSP::applyCAC(const CacStatus *cacStatus, pisp_be_global_config &global)
+{
+	pisp_be_cac_config cac = {};
+
+	for (int x = 0; x < PISP_BE_CAC_GRID_SIZE + 1; x++) {
+		for (int y = 0; y < PISP_BE_CAC_GRID_SIZE + 1; y++) {
+			cac.lut[y][x][0][0] = clampField(cacStatus->lutRx[y * (PISP_BE_CAC_GRID_SIZE + 1) + x], 7, 5, true);
+			cac.lut[y][x][0][1] = clampField(cacStatus->lutRy[y * (PISP_BE_CAC_GRID_SIZE + 1) + x], 7, 5, true);
+			cac.lut[y][x][1][0] = clampField(cacStatus->lutBx[y * (PISP_BE_CAC_GRID_SIZE + 1) + x], 7, 5, true);
+			cac.lut[y][x][1][1] = clampField(cacStatus->lutBy[y * (PISP_BE_CAC_GRID_SIZE + 1) + x], 7, 5, true);
+		}
+	}
+
+	be_->SetCac(cac);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_CAC;
+}
+
+void IpaPiSP::applyBlackLevel(const BlackLevelStatus *blackLevelStatus, pisp_be_global_config &global)
+{
+	pisp_bla_config bla;
+
+	/* Set the Frontend to adjust the black level to 4096 (in 16-bits). */
+	bla.black_level_r = blackLevelStatus->blackLevelR;
+	bla.black_level_gr = blackLevelStatus->blackLevelG;
+	bla.black_level_gb = blackLevelStatus->blackLevelG;
+	bla.black_level_b = blackLevelStatus->blackLevelB;
+	bla.output_black_level = 4096;
+	fe_->SetBla(bla);
+
+	/* Frontend Stats and Backend black level correction. */
+	bla.black_level_r = bla.black_level_gr =
+		bla.black_level_gb = bla.black_level_b = 4096;
+	bla.output_black_level = 0;
+	fe_->SetBlc(bla);
+	be_->SetBlc(bla);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_BLC;
+}
+
+void IpaPiSP::applyLensShading(const AlscStatus *alscStatus,
+			       pisp_be_global_config &global)
+{
+	pisp_be_lsc_extra lscExtra = {};
+	pisp_be_lsc_config lsc = {};
+	double rgb[3][NumLscVertexes][NumLscVertexes] = {};
+
+	resampleTable(&rgb[0][0][0], NumLscVertexes, NumLscVertexes,
+		      alscStatus->r.data(), NumLscCells, NumLscCells);
+	resampleTable(&rgb[1][0][0], NumLscVertexes, NumLscVertexes,
+		      alscStatus->g.data(), NumLscCells, NumLscCells);
+	resampleTable(&rgb[2][0][0], NumLscVertexes, NumLscVertexes,
+		      alscStatus->b.data(), NumLscCells, NumLscCells);
+	packLscLut(lsc.lut_packed, rgb);
+	be_->SetLsc(lsc, lscExtra);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_LSC;
+}
+
+void IpaPiSP::applyDPC(const DpcStatus *dpcStatus, pisp_be_global_config &global)
+{
+	pisp_be_dpc_config dpc = {};
+
+	switch (dpcStatus->strength) {
+	case 0: /* "off" */
+		break;
+	case 1: /* "normal" */
+		dpc.coeff_level = 1;
+		dpc.coeff_range = 8;
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_DPC;
+		break;
+	case 2: /* "strong" */
+		dpc.coeff_level = 0;
+		dpc.coeff_range = 0;
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_DPC;
+		break;
+	default:
+		ASSERT(0);
+	}
+
+	be_->SetDpc(dpc);
+}
+
+void IpaPiSP::applySdn(const SdnStatus *sdnStatus, pisp_be_global_config &global)
+{
+	pisp_be_sdn_config sdn = {};
+
+	sdn.black_level = 4096;
+	/* leakage is "amount of the original pixel we let through", thus 1 - strength */
+	sdn.leakage = clampField(1.0 - sdnStatus->strength, 8, 8);
+	sdn.noise_constant = clampField(sdnStatus->noiseConstant, 16);
+	sdn.noise_slope = clampField(sdnStatus->noiseSlope, 16, 8);
+	sdn.noise_constant2 = clampField(sdnStatus->noiseConstant2, 16);
+	sdn.noise_slope2 = clampField(sdnStatus->noiseSlope2, 16, 8);
+	be_->SetSdn(sdn);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_SDN;
+}
+
+void IpaPiSP::applyTdn(const TdnStatus *tdnStatus, const DeviceStatus *deviceStatus,
+		       pisp_be_global_config &global)
+{
+	utils::Duration exposure = deviceStatus->shutterSpeed * deviceStatus->analogueGain;
+	pisp_be_tdn_config tdn = {};
+
+	double ratio = tdnReset_ ? 1.0 : exposure / lastExposure_;
+	if (ratio >= 4.0) {
+		/* If the exposure ratio goes above 4x, we need to reset TDN. */
+		ratio = 1;
+		tdnReset_ = true;
+	}
+
+	LOG(IPARPI, Debug) << "TDN: exposure: " << exposure
+			   << " last: " << lastExposure_
+			   << " ratio: " << ratio;
+
+	tdn.black_level = 4096;
+	tdn.ratio = clampField(ratio, 16, 14);
+	tdn.noise_constant = clampField(tdnStatus->noiseConstant, 16);
+	tdn.noise_slope = clampField(tdnStatus->noiseSlope, 16, 8);
+	tdn.threshold = clampField(tdnStatus->threshold, 16, 16);
+
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_TDN + PISP_BE_BAYER_ENABLE_TDN_OUTPUT;
+
+	/* Only enable the TDN Input after a state reset. */
+	if (!tdnReset_) {
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_TDN_INPUT;
+		tdn.reset = 0;
+	} else
+		tdn.reset = 1;
+
+	be_->SetTdn(tdn);
+	tdnReset_ = false;
+}
+
+void IpaPiSP::applyCdn(const CdnStatus *cdnStatus, pisp_be_global_config &global)
+{
+	pisp_be_cdn_config cdn = {};
+
+	cdn.thresh = clampField(cdnStatus->threshold, 16);
+	cdn.iir_strength = clampField(cdnStatus->strength, 8, 8);
+	cdn.g_adjust = clampField(0, 8, 8);
+	be_->SetCdn(cdn);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_CDN;
+}
+
+void IpaPiSP::applyGeq(const GeqStatus *geqStatus, pisp_be_global_config &global)
+{
+	pisp_be_geq_config geq = {};
+
+	geq.min = 0;
+	geq.max = 0xffff;
+	geq.offset = clampField(geqStatus->offset, 16);
+	geq.slope_sharper = clampField(geqStatus->slope, 10, 10);
+	be_->SetGeq(geq);
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_GEQ;
+}
+
+void IpaPiSP::applySaturation(const SaturationStatus *saturationStatus,
+			      pisp_be_global_config &global)
+{
+	pisp_be_sat_control_config saturation;
+	pisp_wbg_config wbg;
+
+	saturation.shift_r = std::min<uint8_t>(2, saturationStatus->shiftR);
+	saturation.shift_g = std::min<uint8_t>(2, saturationStatus->shiftG);
+	saturation.shift_b = std::min<uint8_t>(2, saturationStatus->shiftB);
+	be_->SetSatControl(saturation);
+
+	be_->GetWbg(wbg);
+	wbg.gain_r >>= saturationStatus->shiftR;
+	wbg.gain_g >>= saturationStatus->shiftG;
+	wbg.gain_b >>= saturationStatus->shiftB;
+	be_->SetWbg(wbg);
+
+	global.rgb_enables |= PISP_BE_RGB_ENABLE_SAT_CONTROL;
+}
+
+void IpaPiSP::applySharpen(const SharpenStatus *sharpenStatus,
+			   pisp_be_global_config &global)
+{
+	/*
+	 * This threshold scaling is to normalise the VC4 and PiSP parameter
+	 * scales in the tuning config.
+	 */
+	static constexpr double ThresholdScaling = 0.25;
+	const double scaling = sharpenStatus->threshold * ThresholdScaling;
+
+	pisp_be_sh_fc_combine_config shfc;
+	pisp_be_sharpen_config sharpen;
+
+	be_->InitialiseSharpen(sharpen, shfc);
+	sharpen.threshold_offset0 = clampField(sharpen.threshold_offset0 * scaling, 16);
+	sharpen.threshold_offset1 = clampField(sharpen.threshold_offset1 * scaling, 16);
+	sharpen.threshold_offset2 = clampField(sharpen.threshold_offset2 * scaling, 16);
+	sharpen.threshold_offset3 = clampField(sharpen.threshold_offset3 * scaling, 16);
+	sharpen.threshold_offset4 = clampField(sharpen.threshold_offset4 * scaling, 16);
+	sharpen.threshold_slope0 = clampField(sharpen.threshold_slope0 * scaling, 12);
+	sharpen.threshold_slope1 = clampField(sharpen.threshold_slope1 * scaling, 12);
+	sharpen.threshold_slope2 = clampField(sharpen.threshold_slope2 * scaling, 12);
+	sharpen.threshold_slope3 = clampField(sharpen.threshold_slope3 * scaling, 12);
+	sharpen.threshold_slope4 = clampField(sharpen.threshold_slope4 * scaling, 12);
+	sharpen.positive_strength = clampField(sharpen.positive_strength * sharpenStatus->strength, 12);
+	sharpen.negative_strength = clampField(sharpen.negative_strength * sharpenStatus->strength, 12);
+	sharpen.positive_pre_limit = clampField(sharpen.positive_pre_limit * sharpenStatus->limit, 16);
+	sharpen.positive_limit = clampField(sharpen.positive_limit * sharpenStatus->limit, 16);
+	sharpen.negative_pre_limit = clampField(sharpen.negative_pre_limit * sharpenStatus->limit, 16);
+	sharpen.negative_limit = clampField(sharpen.negative_limit * sharpenStatus->limit, 16);
+
+	be_->SetSharpen(sharpen);
+	/* The conversion to YCbCr and back is always enabled. */
+	global.rgb_enables |= PISP_BE_RGB_ENABLE_SHARPEN;
+}
+
+bool IpaPiSP::applyStitch(const StitchStatus *stitchStatus, const DeviceStatus *deviceStatus,
+			  const AgcStatus *agcStatus, pisp_be_global_config &global)
+{
+	/*
+	 * Find out what HDR mode/channel this frame is. Normally this will be in the delayed
+	 * HDR status (in the AGC status), though after a mode switch this will be absent and
+	 * the information will have been stored in the hdrStatus_ field.
+	 */
+	const HdrStatus *hdrStatus = &hdrStatus_;
+	if (agcStatus)
+		hdrStatus = &agcStatus->hdr;
+
+	bool modeChange = hdrStatus->mode != lastStitchHdrStatus_.mode;
+	bool channelChange = !modeChange && hdrStatus->channel != lastStitchHdrStatus_.channel;
+	lastStitchHdrStatus_ = *hdrStatus;
+
+	/* Check for a change of HDR mode. That forces us to start over. */
+	if (modeChange)
+		lastStitchExposures_.clear();
+
+	if (hdrStatus->channel != "short" && hdrStatus->channel != "long") {
+		/* The channel *must* be long or short, anything else does not make sense. */
+		LOG(IPARPI, Warning) << "Stitch channel is not long or short";
+		return false;
+	}
+
+	/* Whatever happens, we're going to output this buffer now. */
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_STITCH_OUTPUT;
+
+	utils::Duration exposure = deviceStatus->shutterSpeed * deviceStatus->analogueGain;
+	lastStitchExposures_[hdrStatus->channel] = exposure;
+
+	/* If the other channel hasn't been seen there's nothing more we can do. */
+	std::string otherChannel = hdrStatus->channel == "short" ? "long" : "short";
+	if (lastStitchExposures_.find(otherChannel) == lastStitchExposures_.end()) {
+		/* The first channel should be "short". */
+		if (hdrStatus->channel != "short")
+			LOG(IPARPI, Warning) << "First frame is not short";
+		return false;
+	}
+
+	/* We have both channels, we need to enable stitching. */
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_STITCH_INPUT + PISP_BE_BAYER_ENABLE_STITCH;
+
+	utils::Duration otherExposure = lastStitchExposures_[otherChannel];
+	bool phaseLong = hdrStatus->channel == "long";
+	double ratio = phaseLong ? otherExposure / exposure : exposure / otherExposure;
+
+	pisp_be_stitch_config stitch = {};
+	stitch.exposure_ratio = clampField(ratio, 15, 15);
+	if (phaseLong)
+		stitch.exposure_ratio |= PISP_BE_STITCH_STREAMING_LONG;
+	/* These will be filled in correctly once we have implemented the HDR algorithm. */
+	stitch.threshold_lo = stitchStatus->thresholdLo;
+	stitch.threshold_diff_power = stitchStatus->diffPower;
+	stitch.motion_threshold_256 = stitchStatus->motionThreshold;
+	be_->SetStitch(stitch);
+
+	return channelChange;
+}
+
+void IpaPiSP::applyTonemap(const TonemapStatus *tonemapStatus, pisp_be_global_config &global)
+{
+	pisp_be_tonemap_config tonemap = {};
+
+	tonemap.detail_constant = clampField(tonemapStatus->detailConstant, 16);
+	tonemap.detail_slope = clampField(tonemapStatus->detailSlope, 16, 8);
+	tonemap.iir_strength = clampField(tonemapStatus->iirStrength, 12, 4);
+	tonemap.strength = clampField(tonemapStatus->strength, 12, 8);
+
+	if (!generateLut(tonemapStatus->tonemap, tonemap.lut, PISP_BE_TONEMAP_LUT_SIZE)) {
+		be_->SetTonemap(tonemap);
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_TONEMAP;
+	}
+}
+
+void IpaPiSP::applyFocusStats(const NoiseStatus *noiseStatus)
+{
+	pisp_fe_cdaf_stats_config cdaf;
+	fe_->GetCdafStats(cdaf);
+
+	cdaf.noise_constant = noiseStatus->noiseConstant;
+	cdaf.noise_slope = noiseStatus->noiseSlope;
+	fe_->SetCdafStats(cdaf);
+}
+
+void IpaPiSP::applyAF(const struct AfStatus *afStatus, ControlList &lensCtrls)
+{
+	if (afStatus->lensSetting) {
+		ControlValue v(afStatus->lensSetting.value());
+		lensCtrls.set(V4L2_CID_FOCUS_ABSOLUTE, v);
+	}
+}
+
+void IpaPiSP::setDefaultConfig()
+{
+	std::scoped_lock<FrontEnd> l(*fe_);
+
+	pisp_be_global_config beGlobal;
+
+	be_->GetGlobal(beGlobal);
+	/*
+	 * Always go to YCbCr and back. We need them if the false colour block is enabled,
+	 * and even for mono sensors if sharpening is enabled. So we're better off enabling
+	 * them all the time.
+	 */
+	beGlobal.rgb_enables |= PISP_BE_RGB_ENABLE_YCBCR + PISP_BE_RGB_ENABLE_YCBCR_INVERSE;
+
+	if (!monoSensor_) {
+		beGlobal.bayer_enables |= PISP_BE_BAYER_ENABLE_DEMOSAIC;
+		beGlobal.rgb_enables |= PISP_BE_RGB_ENABLE_FALSE_COLOUR;
+	}
+	be_->SetGlobal(beGlobal);
+
+	/*
+	 * Ask the AWB algorithm for reasonable gain values so that we can program the
+	 * front end stats sensibly. We must also factor in the conversion to luminance.
+	 */
+	pisp_fe_rgby_config rgby = {};
+	double gainR = 1.5, gainB = 1.5;
+	RPiController::AwbAlgorithm *awb = dynamic_cast<RPiController::AwbAlgorithm *>(
+		controller_.getAlgorithm("awb"));
+	if (awb)
+		awb->initialValues(gainR, gainB);
+	/* The BT.601 RGB -> Y coefficients will do. The precise values are not critical. */
+	rgby.gain_r = clampField(gainR * 0.299, 14, 10);
+	rgby.gain_g = clampField(1.0 * .587, 14, 10);
+	rgby.gain_b = clampField(gainB * .114, 14, 10);
+	fe_->SetRGBY(rgby);
+
+	/* Also get sensible front end black level defaults, for the same reason. */
+	uint16_t blackLevelR = 4096, blackLevelG = 4096, blackLevelB = 4096;
+	RPiController::BlackLevelAlgorithm *blackLevel = dynamic_cast<RPiController::BlackLevelAlgorithm *>(
+		controller_.getAlgorithm("black_level"));
+	if (blackLevel)
+		blackLevel->initialValues(blackLevelR, blackLevelG, blackLevelB);
+	/* The front end first equalises all the black levels to the same as green. */
+	pisp_bla_config bla;
+	bla.black_level_r = blackLevelR;
+	bla.black_level_gr = blackLevelG;
+	bla.black_level_gb = blackLevelG;
+	bla.black_level_b = blackLevelB;
+	bla.output_black_level = blackLevelG;
+	fe_->SetBla(bla);
+	/* But for the statistics it removes the G black level from everything. */
+	bla.black_level_r = blackLevelG;
+	bla.black_level_b = blackLevelG;
+	bla.output_black_level = 0;
+	fe_->SetBlc(bla);
+
+	pisp_fe_global_config feGlobal;
+	fe_->GetGlobal(feGlobal);
+	feGlobal.enables |= PISP_FE_ENABLE_BLA + PISP_FE_ENABLE_BLC + PISP_FE_ENABLE_RGBY;
+	fe_->SetGlobal(feGlobal);
+}
+
+void IpaPiSP::setStatsAndDebin()
+{
+	pisp_fe_crop_config crop{ 0, 0, mode_.width, mode_.height };
+
+	pisp_fe_awb_stats_config awb = {};
+	awb.r_lo = awb.g_lo = awb.b_lo = 0;
+	awb.r_hi = awb.g_hi = awb.b_hi = 65535 * 0.98;
+
+	pisp_fe_cdaf_stats_config cdaf = {};
+	cdaf.mode = (1 << 4) + (1 << 2) + 1; /* Gr / Gb count with weights of (1, 1) */
+
+	{
+		std::scoped_lock<FrontEnd> l(*fe_);
+		pisp_fe_global_config feGlobal;
+		fe_->GetGlobal(feGlobal);
+		feGlobal.enables |= PISP_FE_ENABLE_AWB_STATS + PISP_FE_ENABLE_AGC_STATS +
+				    PISP_FE_ENABLE_CDAF_STATS;
+
+		fe_->SetGlobal(feGlobal);
+		fe_->SetStatsCrop(crop);
+		fe_->SetAwbStats(awb);
+		fe_->SetCdafStats(cdaf);
+	}
+
+	/*
+	 * Apply the correct AGC region weights to the Frontend. Need to do this
+	 * out of the Frontend scoped lock.
+	 */
+	setHistogramWeights();
+
+	pisp_be_global_config beGlobal;
+	be_->GetGlobal(beGlobal);
+
+	if (mode_.binX > 1 || mode_.binY > 1) {
+		pisp_be_debin_config debin;
+
+		be_->GetDebin(debin);
+		debin.h_enable = (mode_.binX > 1);
+		debin.v_enable = (mode_.binY > 1);
+		be_->SetDebin(debin);
+		beGlobal.bayer_enables |= PISP_BE_BAYER_ENABLE_DEBIN;
+	} else
+		beGlobal.bayer_enables &= ~PISP_BE_BAYER_ENABLE_DEBIN;
+
+	be_->SetGlobal(beGlobal);
+}
+
+void IpaPiSP::setHistogramWeights()
+{
+	RPiController::AgcAlgorithm *agc = dynamic_cast<RPiController::AgcAlgorithm *>(
+		controller_.getAlgorithm("agc"));
+	if (!agc)
+		return;
+
+	const std::vector<double> &weights = agc->getWeights();
+
+	pisp_fe_agc_stats_config config;
+	memset(&config, 0, sizeof(config));
+
+	/*
+	* The AGC software gives us a 15x15 table of weights which we
+	* map onto 16x16 in the hardware, ensuring the rightmost column
+	* and bottom row all have zero weight. We align everything to
+	* the native 2x2 Bayer pixel blocks.
+	*/
+	const Size &size = controller_.getHardwareConfig().agcZoneWeights;
+	int width = (mode_.width / size.width) & ~1;
+	int height = (mode_.height / size.height) & ~1;
+	config.offset_x = ((mode_.width - size.width * width) / 2) & ~1;
+	config.offset_y = ((mode_.height - size.height * height) / 2) & ~1;
+	config.size_x = width;
+	config.size_y = height;
+
+	unsigned int idx = 0;
+	for (unsigned int row = 0; row < size.height; row++) {
+		unsigned int col = 0;
+		for (; col < size.width / 2; col++) {
+			int wt0 = clampField(weights[idx++], 4, 0, false, "agc weights");
+			int wt1 = clampField(weights[idx++], 4, 0, false, "agc weights");
+			config.weights[row * 8 + col] = (wt1 << 4) | wt0;
+		}
+		if (size.width & 1)
+			config.weights[row * 8 + col] =
+				clampField(weights[idx++], 4, 0, false, "agc weights");
+	}
+
+	std::scoped_lock<FrontEnd> l(*fe_);
+	fe_->SetAgcStats(config);
+}
+
+} /* namespace ipa::RPi */
+
+/*
+ * External IPA module interface
+ */
+extern "C" {
+const IPAModuleInfo ipaModuleInfo = {
+	IPA_MODULE_API_VERSION,
+	1,
+	"PipelineHandlerPiSP",
+	"rpi/pisp",
+};
+
+IPAInterface *ipaCreate()
+{
+	return new ipa::RPi::IpaPiSP();
+}
+
+} /* extern "C" */
+
+} /* namespace libcamera */
diff --git a/src/ipa/rpi/vc4/data/imx219.json b/src/ipa/rpi/vc4/data/imx219.json
index e8fce1643..a5d15ac0a 100644
--- a/src/ipa/rpi/vc4/data/imx219.json
+++ b/src/ipa/rpi/vc4/data/imx219.json
@@ -131,93 +131,306 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
+                "channels": [
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
-                    },
-                    "short":
-                    {
-                        "shutter": [ 100, 5000, 10000, 20000, 33333 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
                     },
-                    "long":
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 0.125,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.5,
-                                1000, 0.5
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.5,
-                                1000, 0.5
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ],
-                    "shadows": [
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "base_ev": 1.5,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.0,
-                            "q_hi": 0.5,
-                            "y_target":
-                            [
-                                0, 0.17,
-                                1000, 0.17
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
                 ]
             }
         },
@@ -463,6 +676,20 @@
         },
         {
             "rpi.sharpen": { }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
 }
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx219_noir.json b/src/ipa/rpi/vc4/data/imx219_noir.json
index cfedb9431..bd748fec8 100644
--- a/src/ipa/rpi/vc4/data/imx219_noir.json
+++ b/src/ipa/rpi/vc4/data/imx219_noir.json
@@ -47,93 +47,306 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
-                    {
-                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
-                    },
-                    "short":
+                "channels": [
                     {
-                        "shutter": [ 100, 5000, 10000, 20000, 33333 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
                     },
-                    "long":
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 0.125,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.5,
-                                1000, 0.5
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.5,
-                                1000, 0.5
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ],
-                    "shadows": [
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "base_ev": 1.5,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.0,
-                            "q_hi": 0.5,
-                            "y_target":
-                            [
-                                0, 0.17,
-                                1000, 0.17
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
                 ]
             }
         },
@@ -397,6 +610,20 @@
         },
         {
             "rpi.sharpen": { }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
 }
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx290.json b/src/ipa/rpi/vc4/data/imx290.json
index 8a7cadba3..8f41bf519 100644
--- a/src/ipa/rpi/vc4/data/imx290.json
+++ b/src/ipa/rpi/vc4/data/imx290.json
@@ -52,15 +52,24 @@
                 {
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     },
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/imx296.json b/src/ipa/rpi/vc4/data/imx296.json
index 7621f759f..8f24ce5b8 100644
--- a/src/ipa/rpi/vc4/data/imx296.json
+++ b/src/ipa/rpi/vc4/data/imx296.json
@@ -135,15 +135,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
@@ -431,4 +440,4 @@
             }
         }
     ]
-}
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx296_mono.json b/src/ipa/rpi/vc4/data/imx296_mono.json
index d4140c81b..fe3315699 100644
--- a/src/ipa/rpi/vc4/data/imx296_mono.json
+++ b/src/ipa/rpi/vc4/data/imx296_mono.json
@@ -38,15 +38,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
@@ -228,4 +237,4 @@
             }
         }
     ]
-}
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx378.json b/src/ipa/rpi/vc4/data/imx378.json
index f7b68011b..363b47e19 100644
--- a/src/ipa/rpi/vc4/data/imx378.json
+++ b/src/ipa/rpi/vc4/data/imx378.json
@@ -133,15 +133,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/imx477.json b/src/ipa/rpi/vc4/data/imx477.json
index 0e39d4197..fa25ee860 100644
--- a/src/ipa/rpi/vc4/data/imx477.json
+++ b/src/ipa/rpi/vc4/data/imx477.json
@@ -115,16 +115,16 @@
                 "ct_curve":
                 [
                     2360.0, 0.6009, 0.3093,
-                    2848.0, 0.5071, 0.4000,
+                    2848.0, 0.5071, 0.4,
                     2903.0, 0.4905, 0.4392,
                     3628.0, 0.4261, 0.5564,
                     3643.0, 0.4228, 0.5623,
-                    4660.0, 0.3529, 0.6800,
-                    5579.0, 0.3227, 0.7000,
-                    6125.0, 0.3129, 0.7100,
-                    6671.0, 0.3065, 0.7200,
-                    7217.0, 0.3014, 0.7300,
-                    7763.0, 0.2950, 0.7400,
+                    4660.0, 0.3529, 0.68,
+                    5579.0, 0.3227, 0.7,
+                    6125.0, 0.3129, 0.71,
+                    6671.0, 0.3065, 0.72,
+                    7217.0, 0.3014, 0.73,
+                    7763.0, 0.295, 0.74,
                     9505.0, 0.2524, 0.7856
                 ],
                 "sensitivity_r": 1.05,
@@ -136,93 +136,306 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
+                "channels": [
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
-                    },
-                    "short":
-                    {
-                        "shutter": [ 100, 5000, 10000, 20000, 33333 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
                     },
-                    "long":
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 0.125,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.3,
-                                1000, 0.3
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.3,
-                                1000, 0.3
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ],
-                    "shadows": [
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "base_ev": 1.5,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.0,
-                            "q_hi": 0.5,
-                            "y_target":
-                            [
-                                0, 0.17,
-                                1000, 0.17
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
                 ]
             }
         },
@@ -468,6 +681,20 @@
         },
         {
             "rpi.sharpen": { }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
 }
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx477_noir.json b/src/ipa/rpi/vc4/data/imx477_noir.json
index 52d7f072d..27563500c 100644
--- a/src/ipa/rpi/vc4/data/imx477_noir.json
+++ b/src/ipa/rpi/vc4/data/imx477_noir.json
@@ -47,93 +47,306 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
-                    {
-                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
-                    },
-                    "short":
+                "channels": [
                     {
-                        "shutter": [ 100, 5000, 10000, 20000, 33333 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
                     },
-                    "long":
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 0.125,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.3,
-                                1000, 0.3
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.3,
-                                1000, 0.3
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ],
-                    "shadows": [
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "base_ev": 1.5,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.0,
-                            "q_hi": 0.5,
-                            "y_target":
-                            [
-                                0, 0.17,
-                                1000, 0.17
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.3,
+                                        1000, 0.3
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
                 ]
             }
         },
@@ -424,6 +637,20 @@
         },
         {
             "rpi.sharpen": { }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
 }
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx477_scientific.json b/src/ipa/rpi/vc4/data/imx477_scientific.json
index 26c692fdb..9dc32eb15 100644
--- a/src/ipa/rpi/vc4/data/imx477_scientific.json
+++ b/src/ipa/rpi/vc4/data/imx477_scientific.json
@@ -148,15 +148,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/imx477_v1.json b/src/ipa/rpi/vc4/data/imx477_v1.json
index d64020091..55e4adc19 100644
--- a/src/ipa/rpi/vc4/data/imx477_v1.json
+++ b/src/ipa/rpi/vc4/data/imx477_v1.json
@@ -138,15 +138,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/imx519.json b/src/ipa/rpi/vc4/data/imx519.json
index 1b0a77476..ce1942568 100644
--- a/src/ipa/rpi/vc4/data/imx519.json
+++ b/src/ipa/rpi/vc4/data/imx519.json
@@ -133,15 +133,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/imx708.json b/src/ipa/rpi/vc4/data/imx708.json
index c40a59944..4de6f0796 100644
--- a/src/ipa/rpi/vc4/data/imx708.json
+++ b/src/ipa/rpi/vc4/data/imx708.json
@@ -139,85 +139,280 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
+                "channels": [
                     {
-                        "shutter": [ 100, 15000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "short":
                     {
-                        "shutter": [ 100, 5000, 10000, 20000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                        "base_ev": 0.125,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "long":
                     {
-                        "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 1.5,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
-                ],
-                "startup_frames": 5,
-                "convergence_frames": 6,
-                "speed": 0.15
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
+                    }
+                ]
             }
         },
         {
@@ -457,6 +652,20 @@
                 "skip_frames": 5,
                 "map": [ 0.0, 445, 15.0, 925 ]
             }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
-}
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx708_noir.json b/src/ipa/rpi/vc4/data/imx708_noir.json
index 8d4981538..7b7ee874f 100644
--- a/src/ipa/rpi/vc4/data/imx708_noir.json
+++ b/src/ipa/rpi/vc4/data/imx708_noir.json
@@ -139,85 +139,280 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
+                "channels": [
                     {
-                        "shutter": [ 100, 15000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "short":
                     {
-                        "shutter": [ 100, 5000, 10000, 20000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                        "base_ev": 0.125,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "long":
                     {
-                        "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 1.5,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
-                ],
-                "startup_frames": 5,
-                "convergence_frames": 6,
-                "speed": 0.15
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
+                    }
+                ]
             }
         },
         {
@@ -556,6 +751,20 @@
                 "skip_frames": 5,
                 "map": [ 0.0, 445, 15.0, 925 ]
             }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
-}
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx708_wide.json b/src/ipa/rpi/vc4/data/imx708_wide.json
index 65543628c..6f45aafc0 100644
--- a/src/ipa/rpi/vc4/data/imx708_wide.json
+++ b/src/ipa/rpi/vc4/data/imx708_wide.json
@@ -129,85 +129,280 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
+                "channels": [
                     {
-                        "shutter": [ 100, 15000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "short":
                     {
-                        "shutter": [ 100, 5000, 10000, 20000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                        "base_ev": 0.125,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "long":
                     {
-                        "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 1.5,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
-                ],
-                "startup_frames": 5,
-                "convergence_frames": 6,
-                "speed": 0.15
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
+                    }
+                ]
             }
         },
         {
@@ -468,6 +663,20 @@
                 "skip_frames": 5,
                 "map": [ 0.0, 420, 35.0, 920 ]
             }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
-}
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/imx708_wide_noir.json b/src/ipa/rpi/vc4/data/imx708_wide_noir.json
index 49442c0f9..b9a5227e1 100644
--- a/src/ipa/rpi/vc4/data/imx708_wide_noir.json
+++ b/src/ipa/rpi/vc4/data/imx708_wide_noir.json
@@ -129,85 +129,280 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
-                    {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
+                "channels": [
                     {
-                        "shutter": [ 100, 15000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "short":
                     {
-                        "shutter": [ 100, 5000, 10000, 20000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                        "base_ev": 0.125,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
                     },
-                    "long":
                     {
-                        "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 1.5,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.2,
-                                1000, 0.2
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 15000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 1.0, 2.0, 4.0, 6.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 6.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 1000, 30000, 60000, 90000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.2,
+                                        1000, 0.2
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
-                ],
-                "startup_frames": 5,
-                "convergence_frames": 6,
-                "speed": 0.15
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "startup_frames": 5,
+                        "convergence_frames": 6,
+                        "speed": 0.15
+                    }
+                ]
             }
         },
         {
@@ -459,6 +654,20 @@
                 "skip_frames": 5,
                 "map": [ 0.0, 420, 35.0, 920 ]
             }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
-}
+}
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/ov5647.json b/src/ipa/rpi/vc4/data/ov5647.json
index a1b42a182..ff4531762 100644
--- a/src/ipa/rpi/vc4/data/ov5647.json
+++ b/src/ipa/rpi/vc4/data/ov5647.json
@@ -131,95 +131,308 @@
         {
             "rpi.agc":
             {
-                "metering_modes":
-                {
-                    "centre-weighted":
-                    {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
-                    },
-                    "spot":
+                "channels": [
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
-                    },
-                    "matrix":
-                    {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
-                    }
-                },
-                "exposure_modes":
-                {
-                    "normal":
-                    {
-                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
-                    },
-                    "short":
-                    {
-                        "shutter": [ 100, 5000, 10000, 20000, 33333 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
+                        {
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
+                            ]
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ],
+                        "base_ev": 1.25
                     },
-                    "long":
                     {
-                        "shutter": [ 100, 10000, 30000, 60000, 120000 ],
-                        "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
-                    }
-                },
-                "constraint_modes":
-                {
-                    "normal": [
+                        "base_ev": 1.25,
+                        "metering_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.5,
-                                1000, 0.5
-                            ]
-                        }
-                    ],
-                    "highlight": [
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.5,
-                                1000, 0.5
-                            ]
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
                         },
+                        "constraint_modes":
                         {
-                            "bound": "UPPER",
-                            "q_lo": 0.98,
-                            "q_hi": 1.0,
-                            "y_target":
-                            [
-                                0, 0.8,
-                                1000, 0.8
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ],
-                    "shadows": [
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    },
+                    {
+                        "base_ev": 1.25,
+                        "metering_modes":
+                        {
+                            "centre-weighted":
+                            {
+                                "weights":
+                                [
+                                    3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                                ]
+                            },
+                            "spot":
+                            {
+                                "weights":
+                                [
+                                    2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                                ]
+                            },
+                            "matrix":
+                            {
+                                "weights":
+                                [
+                                    1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                                ]
+                            }
+                        },
+                        "exposure_modes":
+                        {
+                            "normal":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "short":
+                            {
+                                "shutter": [ 100, 5000, 10000, 20000, 33333 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]
+                            },
+                            "long":
+                            {
+                                "shutter": [ 100, 10000, 30000, 60000, 120000 ],
+                                "gain": [ 1.0, 2.0, 4.0, 6.0, 12.0 ]
+                            }
+                        },
+                        "constraint_modes":
                         {
-                            "bound": "LOWER",
-                            "q_lo": 0.0,
-                            "q_hi": 0.5,
-                            "y_target":
-                            [
-                                0, 0.17,
-                                1000, 0.17
+                            "normal": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                }
+                            ],
+                            "highlight": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.5,
+                                        1000, 0.5
+                                    ]
+                                },
+                                {
+                                    "bound": "UPPER",
+                                    "q_lo": 0.98,
+                                    "q_hi": 1.0,
+                                    "y_target":
+                                    [
+                                        0, 0.8,
+                                        1000, 0.8
+                                    ]
+                                }
+                            ],
+                            "shadows": [
+                                {
+                                    "bound": "LOWER",
+                                    "q_lo": 0.0,
+                                    "q_hi": 0.5,
+                                    "y_target":
+                                    [
+                                        0, 0.17,
+                                        1000, 0.17
+                                    ]
+                                }
                             ]
-                        }
-                    ]
-                },
-                "y_target":
-                [
-                    0, 0.16,
-                    1000, 0.165,
-                    10000, 0.17
-                ],
-                "base_ev": 1.25
+                        },
+                        "y_target":
+                        [
+                            0, 0.16,
+                            1000, 0.165,
+                            10000, 0.17
+                        ]
+                    }
+                ]
             }
         },
         {
@@ -464,6 +677,20 @@
         },
         {
             "rpi.sharpen": { }
+        },
+        {
+            "rpi.hdr":
+            {
+                "MultiExposureUnmerged":
+                {
+                    "cadence": [ 1, 2 ],
+                    "channel_map":
+                    {
+                        "short": 1,
+                        "long": 2
+                    }
+                }
+            }
         }
     ]
 }
\ No newline at end of file
diff --git a/src/ipa/rpi/vc4/data/ov5647_noir.json b/src/ipa/rpi/vc4/data/ov5647_noir.json
index a6c6722f1..488b7119b 100644
--- a/src/ipa/rpi/vc4/data/ov5647_noir.json
+++ b/src/ipa/rpi/vc4/data/ov5647_noir.json
@@ -51,15 +51,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/ov9281_mono.json b/src/ipa/rpi/vc4/data/ov9281_mono.json
index 2b7292ec7..a9d05a01b 100644
--- a/src/ipa/rpi/vc4/data/ov9281_mono.json
+++ b/src/ipa/rpi/vc4/data/ov9281_mono.json
@@ -35,7 +35,10 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 4, 4, 4, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            4, 4, 4, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/se327m12.json b/src/ipa/rpi/vc4/data/se327m12.json
index 8552ed92b..948169db2 100644
--- a/src/ipa/rpi/vc4/data/se327m12.json
+++ b/src/ipa/rpi/vc4/data/se327m12.json
@@ -133,15 +133,24 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     },
                     "spot":
                     {
-                        "weights": [ 2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
                     },
                     "matrix":
                     {
-                        "weights": [ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/data/uncalibrated.json b/src/ipa/rpi/vc4/data/uncalibrated.json
index 7654defa6..cdc56b323 100644
--- a/src/ipa/rpi/vc4/data/uncalibrated.json
+++ b/src/ipa/rpi/vc4/data/uncalibrated.json
@@ -22,7 +22,10 @@
                 {
                     "centre-weighted":
                     {
-                        "weights": [ 4, 4, 4, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0 ]
+                        "weights":
+                        [
+                            4, 4, 4, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0
+                        ]
                     }
                 },
                 "exposure_modes":
diff --git a/src/ipa/rpi/vc4/vc4.cpp b/src/ipa/rpi/vc4/vc4.cpp
index c165a5b8b..26d9d87b2 100644
--- a/src/ipa/rpi/vc4/vc4.cpp
+++ b/src/ipa/rpi/vc4/vc4.cpp
@@ -11,6 +11,7 @@
 #include <linux/bcm2835-isp.h>
 
 #include <libcamera/base/log.h>
+#include <libcamera/base/span.h>
 #include <libcamera/control_ids.h>
 #include <libcamera/ipa/ipa_module_info.h>
 
@@ -56,13 +57,14 @@ class IpaVc4 final : public IpaBase
 	int32_t platformConfigure(const ConfigParams &params, ConfigResult *result) override;
 
 	void platformPrepareIsp(const PrepareParams &params, RPiController::Metadata &rpiMetadata) override;
+	void platformPrepareAgc([[maybe_unused]] RPiController::Metadata &rpiMetadata) override;
 	RPiController::StatisticsPtr platformProcessStats(Span<uint8_t> mem) override;
 
 	void handleControls(const ControlList &controls) override;
 	bool validateIspControls();
 
 	void applyAWB(const struct AwbStatus *awbStatus, ControlList &ctrls);
-	void applyDG(const struct AgcPrepareStatus *dgStatus, ControlList &ctrls);
+	void applyDG(double digitalGain, const struct AwbStatus *awbStatus, ControlList &ctrls);
 	void applyCCM(const struct CcmStatus *ccmStatus, ControlList &ctrls);
 	void applyBlackLevel(const struct BlackLevelStatus *blackLevelStatus, ControlList &ctrls);
 	void applyGamma(const struct ContrastStatus *contrastStatus, ControlList &ctrls);
@@ -76,6 +78,7 @@ class IpaVc4 final : public IpaBase
 
 	/* VC4 ISP controls. */
 	ControlInfoMap ispCtrls_;
+	ControlList ctrls_;
 
 	/* LS table allocation passed in from the pipeline handler. */
 	SharedFD lsTableHandle_;
@@ -105,6 +108,7 @@ int32_t IpaVc4::platformStart([[maybe_unused]] const ControlList &controls,
 int32_t IpaVc4::platformConfigure(const ConfigParams &params, [[maybe_unused]] ConfigResult *result)
 {
 	ispCtrls_ = params.ispControls;
+	ctrls_ = ControlList(ispCtrls_);
 	if (!validateIspControls()) {
 		LOG(IPARPI, Error) << "ISP control validation failed.";
 		return -1;
@@ -137,7 +141,7 @@ int32_t IpaVc4::platformConfigure(const ConfigParams &params, [[maybe_unused]] C
 void IpaVc4::platformPrepareIsp([[maybe_unused]] const PrepareParams &params,
 				RPiController::Metadata &rpiMetadata)
 {
-	ControlList ctrls(ispCtrls_);
+	ControlList &ctrls = ctrls_;
 
 	/* Lock the metadata buffer to avoid constant locks/unlocks. */
 	std::unique_lock<RPiController::Metadata> lock(rpiMetadata);
@@ -150,10 +154,6 @@ void IpaVc4::platformPrepareIsp([[maybe_unused]] const PrepareParams &params,
 	if (ccmStatus)
 		applyCCM(ccmStatus, ctrls);
 
-	AgcPrepareStatus *dgStatus = rpiMetadata.getLocked<AgcPrepareStatus>("agc.prepare_status");
-	if (dgStatus)
-		applyDG(dgStatus, ctrls);
-
 	AlscStatus *lsStatus = rpiMetadata.getLocked<AlscStatus>("alsc.status");
 	if (lsStatus)
 		applyLS(lsStatus, ctrls);
@@ -189,9 +189,18 @@ void IpaVc4::platformPrepareIsp([[maybe_unused]] const PrepareParams &params,
 		if (!lensctrls.empty())
 			setLensControls.emit(lensctrls);
 	}
+}
+
+void IpaVc4::platformPrepareAgc(RPiController::Metadata &rpiMetadata)
+{
+	AgcStatus *delayedAgcStatus = rpiMetadata.getLocked<AgcStatus>("agc.delayed_status");
+	double digitalGain = delayedAgcStatus ? delayedAgcStatus->digitalGain : agcStatus_.digitalGain;
+	AwbStatus *awbStatus = rpiMetadata.getLocked<AwbStatus>("awb.status");
 
-	if (!ctrls.empty())
-		setIspControls.emit(ctrls);
+	applyDG(digitalGain, awbStatus, ctrls_);
+
+	setIspControls.emit(ctrls_);
+	ctrls_ = ControlList(ispCtrls_);
 }
 
 RPiController::StatisticsPtr IpaVc4::platformProcessStats(Span<uint8_t> mem)
@@ -245,6 +254,11 @@ RPiController::StatisticsPtr IpaVc4::platformProcessStats(Span<uint8_t> mem)
 						  stats->focus_stats[i].contrast_val_num[1][1],
 						  stats->focus_stats[i].contrast_val_num[1][0] });
 
+	if (statsMetadataOutput_) {
+		Span<uint8_t> statsSpan((uint8_t *)(stats), sizeof(bcm2835_isp_stats));
+		libcameraMetadata_.set(controls::rpi::BCM2835StatsOutput, statsSpan);
+	}
+
 	return statistics;
 }
 
@@ -322,10 +336,24 @@ void IpaVc4::applyAWB(const struct AwbStatus *awbStatus, ControlList &ctrls)
 		  static_cast<int32_t>(awbStatus->gainB * 1000));
 }
 
-void IpaVc4::applyDG(const struct AgcPrepareStatus *dgStatus, ControlList &ctrls)
+void IpaVc4::applyDG(double digitalGain,
+		     const struct AwbStatus *awbStatus, ControlList &ctrls)
 {
+	if (awbStatus) {
+		/*
+		 * We must apply sufficient extra digital gain to stop any of the channel gains being
+		 * less than 1, which would cause saturation artifacts. Note that one of the colour
+		 * channels is still getting the minimum possible gain, so it's not a "real" gain
+		 * increase.
+		 */
+		double minColourGain = std::min({ awbStatus->gainR, awbStatus->gainG, awbStatus->gainB, 1.0 });
+		/* The 0.1 here doesn't mean much, but just stops arithmetic errors and extreme behaviour. */
+		double extraGain = 1.0 / std::max({ minColourGain, 0.1 });
+		digitalGain *= extraGain;
+	}
+
 	ctrls.set(V4L2_CID_DIGITAL_GAIN,
-		  static_cast<int32_t>(dgStatus->digitalGain * 1000));
+		  static_cast<int32_t>(digitalGain * 1000));
 }
 
 void IpaVc4::applyCCM(const struct CcmStatus *ccmStatus, ControlList &ctrls)
diff --git a/src/libcamera/bayer_format.cpp b/src/libcamera/bayer_format.cpp
index 3bf15fb48..27dee3881 100644
--- a/src/libcamera/bayer_format.cpp
+++ b/src/libcamera/bayer_format.cpp
@@ -164,12 +164,25 @@ const std::map<BayerFormat, Formats, BayerFormatComparator> bayerToFormat{
 		{ formats::SGRBG16, V4L2PixelFormat(V4L2_PIX_FMT_SGRBG16) } },
 	{ { BayerFormat::RGGB, 16, BayerFormat::Packing::None },
 		{ formats::SRGGB16, V4L2PixelFormat(V4L2_PIX_FMT_SRGGB16) } },
+	{ { BayerFormat::BGGR, 16, BayerFormat::Packing::PISP1 },
+		{ formats::BGGR16_PISP_COMP1, V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_BGGR) } },
+	{ { BayerFormat::GBRG, 16, BayerFormat::Packing::PISP1 },
+		{ formats::GBRG16_PISP_COMP1, V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_GBRG) } },
+	{ { BayerFormat::GRBG, 16, BayerFormat::Packing::PISP1 },
+		{ formats::GRBG16_PISP_COMP1, V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_GRBG) } },
+	{ { BayerFormat::RGGB, 16, BayerFormat::Packing::PISP1 },
+		{ formats::RGGB16_PISP_COMP1, V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_RGGB) } },
 	{ { BayerFormat::MONO, 8, BayerFormat::Packing::None },
 		{ formats::R8, V4L2PixelFormat(V4L2_PIX_FMT_GREY) } },
 	{ { BayerFormat::MONO, 10, BayerFormat::Packing::None },
 		{ formats::R10, V4L2PixelFormat(V4L2_PIX_FMT_Y10) } },
+	{ { BayerFormat::MONO, 16, BayerFormat::Packing::None },
+		{ formats::R16, V4L2PixelFormat(V4L2_PIX_FMT_Y16) } },
+	{ { BayerFormat::MONO, 16, BayerFormat::Packing::PISP1 },
+		{ formats::MONO_PISP_COMP1, V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_MONO) } },
 	{ { BayerFormat::MONO, 10, BayerFormat::Packing::CSI2 },
 		{ formats::R10_CSI2P, V4L2PixelFormat(V4L2_PIX_FMT_Y10P) } },
+
 };
 
 const std::unordered_map<unsigned int, BayerFormat> mbusCodeToBayer{
@@ -205,6 +218,10 @@ const std::unordered_map<unsigned int, BayerFormat> mbusCodeToBayer{
 	{ MEDIA_BUS_FMT_SGBRG16_1X16, { BayerFormat::GBRG, 16, BayerFormat::Packing::None } },
 	{ MEDIA_BUS_FMT_SGRBG16_1X16, { BayerFormat::GRBG, 16, BayerFormat::Packing::None } },
 	{ MEDIA_BUS_FMT_SRGGB16_1X16, { BayerFormat::RGGB, 16, BayerFormat::Packing::None } },
+	{ MEDIA_BUS_FMT_SBGGR16_1X16, { BayerFormat::BGGR, 16, BayerFormat::Packing::PISP1 } },
+	{ MEDIA_BUS_FMT_SGBRG16_1X16, { BayerFormat::GBRG, 16, BayerFormat::Packing::PISP1 } },
+	{ MEDIA_BUS_FMT_SGRBG16_1X16, { BayerFormat::GRBG, 16, BayerFormat::Packing::PISP1 } },
+	{ MEDIA_BUS_FMT_SRGGB16_1X16, { BayerFormat::RGGB, 16, BayerFormat::Packing::PISP1 } },
 	{ MEDIA_BUS_FMT_Y8_1X8, { BayerFormat::MONO, 8, BayerFormat::Packing::None } },
 	{ MEDIA_BUS_FMT_Y10_1X10, { BayerFormat::MONO, 10, BayerFormat::Packing::None } },
 	{ MEDIA_BUS_FMT_Y12_1X12, { BayerFormat::MONO, 12, BayerFormat::Packing::None } },
@@ -298,6 +315,10 @@ std::ostream &operator<<(std::ostream &out, const BayerFormat &f)
 		out << "-CSI2P";
 	else if (f.packing == BayerFormat::Packing::IPU3)
 		out << "-IPU3P";
+	else if (f.packing == BayerFormat::Packing::PISP1)
+		out << "-PISP1";
+	else if (f.packing == BayerFormat::Packing::PISP2)
+		out << "-PISP2";
 
 	return out;
 }
diff --git a/src/libcamera/camera_sensor_properties.cpp b/src/libcamera/camera_sensor_properties.cpp
index 27d6799a2..d8e1f9bea 100644
--- a/src/libcamera/camera_sensor_properties.cpp
+++ b/src/libcamera/camera_sensor_properties.cpp
@@ -137,6 +137,18 @@ const CameraSensorProperties *CameraSensorProperties::get(const std::string &sen
 				{ controls::draft::TestPatternModePn9, 4 },
 			},
 		} },
+		{ "imx708_noir", {
+			.unitCellSize = { 1400, 1400 },
+			.testPatternModes = {},
+		} },
+		{ "imx708_wide", {
+			.unitCellSize = { 1400, 1400 },
+			.testPatternModes = {},
+		} },
+		{ "imx708_wide_noir", {
+			.unitCellSize = { 1400, 1400 },
+			.testPatternModes = {},
+		} },
 		{ "ov2685", {
 			.unitCellSize = { 1750, 1750 },
 			.testPatternModes = {
diff --git a/src/libcamera/control_ids_rpi.yaml b/src/libcamera/control_ids_rpi.yaml
new file mode 100644
index 000000000..2e99fb3b8
--- /dev/null
+++ b/src/libcamera/control_ids_rpi.yaml
@@ -0,0 +1,49 @@
+# SPDX-License-Identifier: LGPL-2.1-or-later
+#
+# Copyright (C) 2023, Raspberry Pi Ltd
+#
+%YAML 1.1
+---
+# Raspberry Pi (VC4 and PiSP) specific vendor controls
+vendor: rpi
+controls:
+  - PispConfigDumpFile:
+      type: string
+      description: |
+        Triggers the Raspberry Pi PiSP pipeline handler to generate a JSON
+        formatted dump of the Backend configuration to the filename given by the
+        value of the control.
+
+  - StatsOutputEnable:
+      type: bool
+      description: |
+        Toggles the IPA to output a binary dump of the Frontend statistics
+        through Request metadata control PispStatsOutput (for Pi 5) or 
+        BCM2835StatsOutput (for Pi 4 and lower).
+
+        \sa PispStatsOutput BCM2835StatsOutput
+
+  - PispStatsOutput:
+      type: uint8_t
+      description: |
+        Span of the PiSP statistics for the current frame. This is sent in the
+        Request metadata if the StatsOutputEnable is set to true. The
+        statistics struct definition can be found in
+        https://github.com/raspberrypi/libpisp/blob/main/src/libpisp/frontend/pisp_statistics.h
+
+        \sa StatsOutputEnable
+
+      size: [n]
+
+  - BCM2835StatsOutput:
+      type: uint8_t
+      description: |
+        Span of the BCM2835 statistics for the current frame. This is sent in
+        the Request metadata if the StatsOutputEnable is set to true. The
+        statistics struct definition can be found in include/linux/bcm2835-isp.h.
+
+        \sa StatsOutputEnable
+
+      size: [n]
+
+...
\ No newline at end of file
diff --git a/src/libcamera/formats.cpp b/src/libcamera/formats.cpp
index 447e62380..86f3ffaeb 100644
--- a/src/libcamera/formats.cpp
+++ b/src/libcamera/formats.cpp
@@ -270,6 +270,26 @@ const std::map<PixelFormat, PixelFormatInfo> pixelFormatInfo{
 		.pixelsPerGroup = 1,
 		.planes = {{ { 4, 1 }, { 0, 0 }, { 0, 0 } }},
 	} },
+	{ formats::BGR161616, {
+		.name = "BGR161616",
+		.format = formats::BGR161616,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_RGB48), },
+		.bitsPerPixel = 48,
+		.colourEncoding = PixelFormatInfo::ColourEncodingRGB,
+		.packed = false,
+		.pixelsPerGroup = 1,
+		.planes = {{ { 3, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
+	{ formats::RGB161616, {
+		.name = "RGB161616",
+		.format = formats::RGB161616,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_BGR48), },
+		.bitsPerPixel = 24,
+		.colourEncoding = PixelFormatInfo::ColourEncodingRGB,
+		.packed = false,
+		.pixelsPerGroup = 1,
+		.planes = {{ { 3, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
 
 	/* YUV packed formats. */
 	{ formats::YUYV, {
@@ -507,6 +527,16 @@ const std::map<PixelFormat, PixelFormatInfo> pixelFormatInfo{
 		.pixelsPerGroup = 1,
 		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
 	} },
+	{ formats::R16, {
+		.name = "R16",
+		.format = formats::R16,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_Y16), },
+		.bitsPerPixel = 16,
+		.colourEncoding = PixelFormatInfo::ColourEncodingYUV,
+		.packed = false,
+		.pixelsPerGroup = 1,
+		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
 	{ formats::R10_CSI2P, {
 		.name = "R10_CSI2P",
 		.format = formats::R10_CSI2P,
@@ -517,6 +547,16 @@ const std::map<PixelFormat, PixelFormatInfo> pixelFormatInfo{
 		.pixelsPerGroup = 4,
 		.planes = {{ { 5, 1 }, { 0, 0 }, { 0, 0 } }},
 	} },
+	{ formats::MONO_PISP_COMP1, {
+		.name = "MONO_PISP_COMP1",
+		.format = formats::MONO_PISP_COMP1,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_MONO), },
+		.bitsPerPixel = 16,
+		.colourEncoding = PixelFormatInfo::ColourEncodingYUV,
+		.packed = true,
+		.pixelsPerGroup = 1,
+		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
 
 	/* Bayer formats. */
 	{ formats::SBGGR8, {
@@ -880,7 +920,46 @@ const std::map<PixelFormat, PixelFormatInfo> pixelFormatInfo{
 		.pixelsPerGroup = 25,
 		.planes = {{ { 32, 1 }, { 0, 0 }, { 0, 0 } }},
 	} },
-
+	{ formats::BGGR16_PISP_COMP1, {
+		.name = "BGGR16_PISP_COMP1",
+		.format = formats::BGGR16_PISP_COMP1,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_BGGR), },
+		.bitsPerPixel = 16,
+		.colourEncoding = PixelFormatInfo::ColourEncodingRAW,
+		.packed = true,
+		.pixelsPerGroup = 2,
+		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
+	{ formats::GBRG16_PISP_COMP1, {
+		.name = "GBRG16_PISP_COMP1",
+		.format = formats::GBRG16_PISP_COMP1,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_GBRG), },
+		.bitsPerPixel = 16,
+		.colourEncoding = PixelFormatInfo::ColourEncodingRAW,
+		.packed = true,
+		.pixelsPerGroup = 2,
+		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
+	{ formats::GRBG16_PISP_COMP1, {
+		.name = "GRBG16_PISP_COMP1",
+		.format = formats::GRBG16_PISP_COMP1,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_GRBG), },
+		.bitsPerPixel = 16,
+		.colourEncoding = PixelFormatInfo::ColourEncodingRAW,
+		.packed = true,
+		.pixelsPerGroup = 2,
+		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
+	{ formats::RGGB16_PISP_COMP1, {
+		.name = "RGGB16_PISP_COMP1",
+		.format = formats::RGGB16_PISP_COMP1,
+		.v4l2Formats = { V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_RGGB), },
+		.bitsPerPixel = 16,
+		.colourEncoding = PixelFormatInfo::ColourEncodingRAW,
+		.packed = true,
+		.pixelsPerGroup = 2,
+		.planes = {{ { 2, 1 }, { 0, 0 }, { 0, 0 } }},
+	} },
 	/* Compressed formats. */
 	{ formats::MJPEG, {
 		.name = "MJPEG",
diff --git a/src/libcamera/formats.yaml b/src/libcamera/formats.yaml
index 539ac0b33..d1316d235 100644
--- a/src/libcamera/formats.yaml
+++ b/src/libcamera/formats.yaml
@@ -11,6 +11,8 @@ formats:
       fourcc: DRM_FORMAT_R10
   - R12:
       fourcc: DRM_FORMAT_R12
+  - R16:
+      fourcc: DRM_FORMAT_R16
 
   - RGB565:
       fourcc: DRM_FORMAT_RGB565
@@ -41,6 +43,11 @@ formats:
   - BGRA8888:
       fourcc: DRM_FORMAT_BGRA8888
 
+  - RGB161616:
+      fourcc: DRM_FORMAT_RGB161616
+  - BGR161616:
+      fourcc: DRM_FORMAT_BGR161616
+
   - YUYV:
       fourcc: DRM_FORMAT_YUYV
   - YVYU:
@@ -183,4 +190,23 @@ formats:
   - SBGGR10_IPU3:
       fourcc: DRM_FORMAT_SBGGR10
       mod: IPU3_FORMAT_MOD_PACKED
+
+  - RGGB16_PISP_COMP1:
+      fourcc: DRM_FORMAT_SRGGB16
+      mod: PISP_FORMAT_MOD_COMPRESS_MODE1
+  - GRBG16_PISP_COMP1:
+      fourcc: DRM_FORMAT_SGRBG16
+      mod: PISP_FORMAT_MOD_COMPRESS_MODE1
+  - GBRG16_PISP_COMP1:
+      fourcc: DRM_FORMAT_SGBRG16
+      mod: PISP_FORMAT_MOD_COMPRESS_MODE1
+  - BGGR16_PISP_COMP1:
+      fourcc: DRM_FORMAT_SBGGR16
+      mod: PISP_FORMAT_MOD_COMPRESS_MODE1
+  - MONO_PISP_COMP1:
+      fourcc: DRM_FORMAT_R16
+      mod: PISP_FORMAT_MOD_COMPRESS_MODE1
+  - PISP_VERIFICATION:
+      fourcc: DRM_FORMAT_SBGGR16
+      mod: PISP_FORMAT_MOD_VERIFICATION
 ...
diff --git a/src/libcamera/pipeline/rpi/pisp/data/example.yaml b/src/libcamera/pipeline/rpi/pisp/data/example.yaml
new file mode 100644
index 000000000..7b8e51f7a
--- /dev/null
+++ b/src/libcamera/pipeline/rpi/pisp/data/example.yaml
@@ -0,0 +1,45 @@
+{
+        "version": 1.0,
+        "target": "pisp",
+
+        "pipeline_handler":
+        {
+                # Number of CFE config and stats buffers to allocate and use. A
+                # larger number minimises the possibility of dropping frames,
+                # but increases the latency for updating the HW configuration.
+                #
+                # "num_cfe_config_stats_buffers": 12,
+
+		# Number of jobs to queue ahead to the CFE on startup. A larger
+                # number will increase latency for 3A changes, but may reduce 
+                # avoidable frame drops.
+                #
+                # "num_cfe_config_queue": 2,
+
+                # Override any request from the IPA to drop a number of startup
+                # frames.
+                #
+                # "disable_startup_frame_drops": false,
+
+                # Custom timeout value (in ms) for camera to use. This overrides
+                # the value computed by the pipeline handler based on frame
+                # durations.
+                #
+                # Set this value to 0 to use the pipeline handler computed
+                # timeout value.
+                #
+                # "camera_timeout_value_ms": 0,
+
+                # Disables temporal denoise functionality in the ISP pipeline.
+                # Disabling temporal denoise avoids allocating 2 additional
+                # Bayer framebuffers required for its operation.
+                #
+                # "disable_tdn": false,
+
+                # Disables multiframe HDR functionality in the ISP pipeline.
+                # Disabling multiframe HDR avoids allocating 2 additional Bayer
+                # framebuffers required for its operation.
+                #
+                # "disable_hdr": false,
+        }
+}
diff --git a/src/libcamera/pipeline/rpi/pisp/data/meson.build b/src/libcamera/pipeline/rpi/pisp/data/meson.build
new file mode 100644
index 000000000..17dfc435b
--- /dev/null
+++ b/src/libcamera/pipeline/rpi/pisp/data/meson.build
@@ -0,0 +1,8 @@
+# SPDX-License-Identifier: CC0-1.0
+
+conf_files = files([
+    'example.yaml',
+])
+
+install_data(conf_files,
+             install_dir : pipeline_data_dir / 'rpi' / 'pisp')
diff --git a/src/libcamera/pipeline/rpi/pisp/meson.build b/src/libcamera/pipeline/rpi/pisp/meson.build
new file mode 100644
index 000000000..1f0ca3ca0
--- /dev/null
+++ b/src/libcamera/pipeline/rpi/pisp/meson.build
@@ -0,0 +1,12 @@
+# SPDX-License-Identifier: CC0-1.0
+
+libcamera_sources += files([
+    'pisp.cpp',
+])
+
+librt = cc.find_library('rt', required : true)
+libpisp_dep = dependency('libpisp', fallback : ['libpisp', 'libpisp_dep'])
+
+libcamera_deps += [libpisp_dep, librt]
+
+subdir('data')
diff --git a/src/libcamera/pipeline/rpi/pisp/pisp.cpp b/src/libcamera/pipeline/rpi/pisp/pisp.cpp
new file mode 100644
index 000000000..295af770f
--- /dev/null
+++ b/src/libcamera/pipeline/rpi/pisp/pisp.cpp
@@ -0,0 +1,2220 @@
+/* SPDX-License-Identifier: LGPL-2.1-or-later */
+/*
+ * Copyright (C) 2023, Raspberry Pi Ltd
+ *
+ * pisp.cpp - Pipeline handler for PiSP based Raspberry Pi devices
+ */
+
+#include <algorithm>
+#include <fstream>
+#include <memory>
+#include <mutex>
+#include <numeric>
+#include <queue>
+#include <set>
+#include <sstream>
+#include <string>
+#include <sys/ioctl.h>
+#include <unordered_map>
+#include <vector>
+
+#include <linux/dma-buf.h>
+#include <linux/v4l2-controls.h>
+#include <linux/videodev2.h>
+
+#include <libcamera/base/shared_fd.h>
+#include <libcamera/formats.h>
+
+#include "libcamera/internal/device_enumerator.h"
+
+#include "libpisp/backend/backend.hpp"
+#include "libpisp/common/logging.hpp"
+#include "libpisp/common/utils.hpp"
+#include "libpisp/common/version.hpp"
+#include "libpisp/frontend/frontend.hpp"
+#include "libpisp/variants/variant.hpp"
+
+#include "../common/pipeline_base.h"
+#include "../common/rpi_stream.h"
+#include "../common/shared_mem_object.h"
+
+namespace libcamera {
+
+LOG_DECLARE_CATEGORY(RPI)
+
+using StreamFlag = RPi::Stream::StreamFlag;
+using StreamParams = RPi::RPiCameraConfiguration::StreamParams;
+
+namespace {
+
+enum class Cfe : unsigned int { Output0, Embedded, Stats, Config };
+enum class Isp : unsigned int { Input, Output0, Output1, TdnInput, TdnOutput,
+				StitchInput, StitchOutput, Config };
+
+/* Offset for all compressed buffers; mode for TDN and Stitch. */
+constexpr unsigned int DefaultCompressionOffset = 2048;
+constexpr unsigned int DefaultCompressionMode = 1;
+
+const std::vector<std::pair<BayerFormat, unsigned int>> BayerToMbusCodeMap{
+	{ { BayerFormat::BGGR, 8, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SBGGR8_1X8, },
+	{ { BayerFormat::GBRG, 8, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGBRG8_1X8, },
+	{ { BayerFormat::GRBG, 8, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGRBG8_1X8, },
+	{ { BayerFormat::RGGB, 8, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SRGGB8_1X8, },
+	{ { BayerFormat::BGGR, 10, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SBGGR10_1X10, },
+	{ { BayerFormat::GBRG, 10, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGBRG10_1X10, },
+	{ { BayerFormat::GRBG, 10, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGRBG10_1X10, },
+	{ { BayerFormat::RGGB, 10, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SRGGB10_1X10, },
+	{ { BayerFormat::BGGR, 12, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SBGGR12_1X12, },
+	{ { BayerFormat::GBRG, 12, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGBRG12_1X12, },
+	{ { BayerFormat::GRBG, 12, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGRBG12_1X12, },
+	{ { BayerFormat::RGGB, 12, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SRGGB12_1X12, },
+	{ { BayerFormat::BGGR, 14, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SBGGR14_1X14, },
+	{ { BayerFormat::GBRG, 14, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGBRG14_1X14, },
+	{ { BayerFormat::GRBG, 14, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGRBG14_1X14, },
+	{ { BayerFormat::RGGB, 14, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SRGGB14_1X14, },
+	{ { BayerFormat::BGGR, 16, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SBGGR16_1X16, },
+	{ { BayerFormat::GBRG, 16, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGBRG16_1X16, },
+	{ { BayerFormat::GRBG, 16, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SGRBG16_1X16, },
+	{ { BayerFormat::RGGB, 16, BayerFormat::Packing::None }, MEDIA_BUS_FMT_SRGGB16_1X16, },
+	{ { BayerFormat::BGGR, 16, BayerFormat::Packing::PISP1 }, MEDIA_BUS_FMT_SBGGR16_1X16, },
+	{ { BayerFormat::GBRG, 16, BayerFormat::Packing::PISP1 }, MEDIA_BUS_FMT_SGBRG16_1X16, },
+	{ { BayerFormat::GRBG, 16, BayerFormat::Packing::PISP1 }, MEDIA_BUS_FMT_SGRBG16_1X16, },
+	{ { BayerFormat::RGGB, 16, BayerFormat::Packing::PISP1 }, MEDIA_BUS_FMT_SRGGB16_1X16, },
+	{ { BayerFormat::RGGB, 16, BayerFormat::Packing::PISP1 }, MEDIA_BUS_FMT_SRGGB16_1X16, },
+	{ { BayerFormat::MONO, 16, BayerFormat::Packing::None }, MEDIA_BUS_FMT_Y16_1X16, },
+	{ { BayerFormat::MONO, 16, BayerFormat::Packing::PISP1 }, MEDIA_BUS_FMT_Y16_1X16, },
+};
+
+unsigned int bayerToMbusCode(const BayerFormat &bayer)
+{
+	const auto it = std::find_if(BayerToMbusCodeMap.begin(), BayerToMbusCodeMap.end(),
+				     [bayer](const std::pair<BayerFormat, unsigned int> &match) {
+						return bayer == match.first;
+				     });
+
+	if (it != BayerToMbusCodeMap.end())
+		return it->second;
+
+	return 0;
+}
+
+uint32_t mbusCodeUnpacked16(unsigned int mbus_code)
+{
+	BayerFormat bayer = BayerFormat::fromMbusCode(mbus_code);
+	BayerFormat bayer16(bayer.order, 16, BayerFormat::Packing::None);
+
+	return bayerToMbusCode(bayer16);
+}
+
+uint8_t toPiSPBayerOrder(V4L2PixelFormat format)
+{
+	BayerFormat bayer = BayerFormat::fromV4L2PixelFormat(format);
+
+	switch (bayer.order) {
+	case BayerFormat::Order::BGGR:
+		return PISP_BAYER_ORDER_BGGR;
+	case BayerFormat::Order::GBRG:
+		return PISP_BAYER_ORDER_GBRG;
+	case BayerFormat::Order::GRBG:
+		return PISP_BAYER_ORDER_GRBG;
+	case BayerFormat::Order::RGGB:
+		return PISP_BAYER_ORDER_RGGB;
+	case BayerFormat::Order::MONO:
+		return PISP_BAYER_ORDER_GREYSCALE;
+	default:
+		ASSERT(0);
+		return -1;
+	}
+}
+
+pisp_image_format_config toPiSPImageFormat(V4L2DeviceFormat &format)
+{
+	pisp_image_format_config image = {};
+
+	image.width = format.size.width;
+	image.height = format.size.height;
+	image.stride = format.planes[0].bpl;
+
+	PixelFormat pix = format.fourcc.toPixelFormat();
+
+	if (RPi::PipelineHandlerBase::isRaw(pix)) {
+		BayerFormat bayer = BayerFormat::fromPixelFormat(pix);
+		switch (bayer.packing) {
+		case BayerFormat::Packing::None:
+			image.format = PISP_IMAGE_FORMAT_BPS_16 +
+				       PISP_IMAGE_FORMAT_UNCOMPRESSED;
+			break;
+		case BayerFormat::Packing::PISP1:
+			image.format = PISP_IMAGE_FORMAT_COMPRESSION_MODE_1;
+			break;
+		case BayerFormat::Packing::PISP2:
+			image.format = PISP_IMAGE_FORMAT_COMPRESSION_MODE_2;
+			break;
+		default:
+			ASSERT(0);
+		}
+		return image;
+	}
+
+	switch (pix) {
+	case formats::YUV420:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_420 +
+			       PISP_IMAGE_FORMAT_PLANARITY_PLANAR;
+		image.stride2 = image.stride / 2;
+		break;
+	case formats::NV12:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_420 +
+			       PISP_IMAGE_FORMAT_PLANARITY_SEMI_PLANAR;
+		image.stride2 = image.stride;
+		break;
+	case formats::NV21:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_420 +
+			       PISP_IMAGE_FORMAT_PLANARITY_SEMI_PLANAR +
+			       PISP_IMAGE_FORMAT_ORDER_SWAPPED;
+		image.stride2 = image.stride;
+		break;
+	case formats::YUYV:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_422 +
+			       PISP_IMAGE_FORMAT_PLANARITY_INTERLEAVED;
+		break;
+	case formats::UYVY:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_422 +
+			       PISP_IMAGE_FORMAT_PLANARITY_INTERLEAVED +
+			       PISP_IMAGE_FORMAT_ORDER_SWAPPED;
+		break;
+	case formats::NV16:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_422 +
+			       PISP_IMAGE_FORMAT_PLANARITY_SEMI_PLANAR;
+		image.stride2 = image.stride;
+		break;
+	case formats::NV61:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL +
+			       PISP_IMAGE_FORMAT_BPS_8 +
+			       PISP_IMAGE_FORMAT_SAMPLING_422 +
+			       PISP_IMAGE_FORMAT_PLANARITY_SEMI_PLANAR +
+			       PISP_IMAGE_FORMAT_ORDER_SWAPPED;
+		image.stride2 = image.stride;
+		break;
+	case formats::RGB888:
+	case formats::BGR888:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL;
+		break;
+	case formats::XRGB8888:
+	case formats::XBGR8888:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL + PISP_IMAGE_FORMAT_BPP_32;
+		break;
+	case formats::RGBX8888:
+	case formats::BGRX8888:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL + PISP_IMAGE_FORMAT_BPP_32 +
+			       PISP_IMAGE_FORMAT_ORDER_SWAPPED;
+		break;
+	case formats::RGB161616:
+	case formats::BGR161616:
+		image.format = PISP_IMAGE_FORMAT_THREE_CHANNEL + PISP_IMAGE_FORMAT_BPS_16;
+		break;
+	default:
+		LOG(RPI, Error) << "Pixel format " << pix << " unsupported";
+		ASSERT(0);
+	}
+
+	return image;
+}
+
+void computeOptimalStride(V4L2DeviceFormat &format)
+{
+	pisp_image_format_config fmt = toPiSPImageFormat(format);
+
+	libpisp::compute_optimal_stride(fmt);
+
+	uint32_t fourcc = format.fourcc.fourcc();
+
+	/*
+	 * For YUV420/422 non-multiplanar formats, double the U/V stride for the
+	 * Y-plane to ensure we get the optimal alignment on all three planes.
+	 */
+	if (fourcc == V4L2_PIX_FMT_YUV420 || fourcc == V4L2_PIX_FMT_YUV422P ||
+	    fourcc == V4L2_PIX_FMT_YVU420)
+		fmt.stride = fmt.stride2 * 2;
+
+	format.planes[0].bpl = fmt.stride;
+	format.planes[1].bpl = fmt.stride2;
+	format.planes[2].bpl = fmt.stride2;
+
+	/*
+	 * Need to set planesCount correctly so that V4L2VideoDevice::trySetFormatMultiplane()
+	 * copies the bpl fields correctly.
+	 */
+	const PixelFormat &pixFormat = format.fourcc.toPixelFormat();
+	const PixelFormatInfo &info = PixelFormatInfo::info(pixFormat);
+	format.planesCount = info.numPlanes();
+}
+
+void setupOutputClipping(const V4L2DeviceFormat &v4l2Format,
+			 pisp_be_output_format_config &outputFormat)
+{
+	const PixelFormat &pixFormat = v4l2Format.fourcc.toPixelFormat();
+	const PixelFormatInfo &info = PixelFormatInfo::info(pixFormat);
+
+	if (info.colourEncoding != PixelFormatInfo::ColourEncodingYUV)
+		return;
+
+	if (v4l2Format.colorSpace == ColorSpace::Sycc) {
+		outputFormat.lo = 0;
+		outputFormat.hi = 65535;
+		outputFormat.lo2 = 0;
+		outputFormat.hi2 = 65535;
+	} else if (v4l2Format.colorSpace == ColorSpace::Smpte170m ||
+			v4l2Format.colorSpace == ColorSpace::Rec709) {
+		outputFormat.lo = 16 << 8;
+		outputFormat.hi = 235 << 8;
+		outputFormat.lo2 = 16 << 8;
+		outputFormat.hi2 = 240 << 8;
+	} else {
+		LOG(RPI, Warning)
+			<< "Unrecognised colour space "
+			<< ColorSpace::toString(v4l2Format.colorSpace)
+			<< ", using full range";
+		outputFormat.lo = 0;
+		outputFormat.hi = 65535;
+		outputFormat.lo2 = 0;
+		outputFormat.hi2 = 65535;
+	}
+}
+
+int dmabufSyncStart(const SharedFD &fd)
+{
+	struct dma_buf_sync dma_sync {};
+	dma_sync.flags = DMA_BUF_SYNC_START | DMA_BUF_SYNC_RW;
+
+	int ret = ::ioctl(fd.get(), DMA_BUF_IOCTL_SYNC, &dma_sync);
+	if (ret)
+		LOG(RPI, Error) << "failed to lock-sync-write dma buf";
+
+	return ret;
+}
+
+int dmabufSyncEnd(const SharedFD &fd)
+{
+	struct dma_buf_sync dma_sync {};
+	dma_sync.flags = DMA_BUF_SYNC_END | DMA_BUF_SYNC_RW;
+
+	int ret = ::ioctl(fd.get(), DMA_BUF_IOCTL_SYNC, &dma_sync);
+
+	if (ret)
+		LOG(RPI, Error) << "failed to unlock-sync-write dma buf";
+
+	return ret;
+}
+
+void do32BitConversion(void *mem, unsigned int width, unsigned int height,
+		       unsigned int stride)
+{
+	/*
+	 * The arm64 version is actually not that much quicker because the
+	 * vast bulk of the time is spent waiting for memory.
+	 */
+#if __aarch64__
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+		unsigned int count = (width + 15) / 16;
+		uint8_t *dest = ptr + count * 64;
+		uint8_t *src = ptr + count * 48;
+
+		/* Pre-decrement would have been nice. */
+		asm volatile("movi v3.16b, #255 \n"
+				"1: \n"
+				"sub %[src], %[src], #48 \n"
+				"sub %[dest], %[dest], #64 \n"
+				"subs %[count], %[count], #1 \n"
+				"ld3 {v0.16b, v1.16b, v2.16b}, [%[src]] \n"
+				"st4 {v0.16b, v1.16b, v2.16b, v3.16b}, [%[dest]] \n"
+				"b.gt 1b \n"
+				: [count]"+r" (count)
+				: [src]"r" (src), [dest]"r" (dest)
+				: "cc", "v1", "v2", "v3", "v4", "memory"
+				);
+	}
+#else
+	std::vector<uint8_t> incache(3 * width);
+	std::vector<uint8_t> outcache(4 * width);
+
+	memcpy(incache.data(), mem, 3 * width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *ptr3 = incache.data();
+		uint8_t *ptr4 = outcache.data();
+		for (unsigned int i = 0; i < width; i++) {
+			*(ptr4++) = *(ptr3++);
+			*(ptr4++) = *(ptr3++);
+			*(ptr4++) = *(ptr3++);
+			*(ptr4++) = 255;
+		}
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, 3 * width);
+		memcpy(ptr, outcache.data(), 4 * width);
+	}
+#endif
+}
+
+void downscaleInterleaved3(void *mem, unsigned int height, unsigned int src_width,
+			   unsigned int stride)
+{
+	std::vector<uint8_t> incache(3 * src_width);
+	unsigned int dst_width = src_width / 2;
+	std::vector<uint8_t> outcache(3 * dst_width);
+
+	memcpy(incache.data(), mem, 3 * src_width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *src = incache.data(), *dst = outcache.data();
+		for (unsigned int i = 0; i < dst_width; i++, src += 6, dst += 3) {
+			dst[0] = ((int)src[0] + (int)src[3] + 1) >> 1;
+			dst[1] = ((int)src[1] + (int)src[4] + 1) >> 1;
+			dst[2] = ((int)src[2] + (int)src[5] + 1) >> 1;
+		}
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, 3 * src_width);
+		memcpy(ptr, outcache.data(), 3 * dst_width);
+	}
+}
+
+void downscaleInterleaved4(void *mem, unsigned int height, unsigned int src_width,
+			   unsigned int stride)
+{
+	std::vector<uint8_t> incache(4 * src_width);
+	unsigned int dst_width = src_width / 2;
+	std::vector<uint8_t> outcache(4 * dst_width);
+
+	memcpy(incache.data(), mem, 4 * src_width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *src = incache.data(), *dst = outcache.data();
+		for (unsigned int i = 0; i < dst_width; i++, src += 8, dst += 4) {
+			dst[0] = ((int)src[0] + (int)src[4] + 1) >> 1;
+			dst[1] = ((int)src[1] + (int)src[5] + 1) >> 1;
+			dst[2] = ((int)src[2] + (int)src[6] + 1) >> 1;
+			dst[3] = ((int)src[3] + (int)src[7] + 1) >> 1;
+		}
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, 4 * src_width);
+		memcpy(ptr, outcache.data(), 4 * dst_width);
+	}
+}
+
+void downscalePlaneInternal(void *mem, unsigned int height, unsigned int src_width,
+			    unsigned int stride, std::vector<uint8_t> &incache,
+			    std::vector<uint8_t> &outcache)
+{
+	unsigned int dst_width = src_width / 2;
+	memcpy(incache.data(), mem, src_width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *src = incache.data(), *dst = outcache.data();
+		for (unsigned int i = 0; i < dst_width; i++, src += 2, dst++)
+			*dst = ((int)src[0] + (int)src[1] + 1) >> 1;
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, src_width);
+		memcpy(ptr, outcache.data(), dst_width);
+	}
+}
+
+void downscalePlanar420(void *memY, void *memU, void *memV, unsigned int height,
+			unsigned int src_width, unsigned int stride)
+{
+	std::vector<uint8_t> incache(src_width);
+	std::vector<uint8_t> outcache(src_width / 2);
+
+	downscalePlaneInternal(memY, height, src_width, stride, incache, outcache);
+	downscalePlaneInternal(memU, height / 2, src_width / 2, stride / 2, incache, outcache);
+	downscalePlaneInternal(memV, height / 2, src_width / 2, stride / 2, incache, outcache);
+}
+
+void downscalePlanar422(void *memY, void *memU, void *memV,
+			unsigned int height, unsigned int src_width, unsigned int stride)
+{
+	std::vector<uint8_t> incache(src_width);
+	std::vector<uint8_t> outcache(src_width / 2);
+
+	downscalePlaneInternal(memY, height, src_width, stride, incache, outcache);
+	downscalePlaneInternal(memU, height, src_width / 2, stride / 2, incache, outcache);
+	downscalePlaneInternal(memV, height, src_width / 2, stride / 2, incache, outcache);
+}
+
+void downscaleInterleavedYuyv(void *mem, unsigned int height, unsigned int src_width,
+			      unsigned int stride)
+{
+	std::vector<uint8_t> incache(2 * src_width);
+	unsigned int dst_width = src_width / 2;
+	std::vector<uint8_t> outcache(2 * dst_width);
+
+	memcpy(incache.data(), mem, 2 * src_width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *src = incache.data(), *dst = outcache.data();
+		for (unsigned int i = 0; i < dst_width; i++, src += 8, dst += 4) {
+			dst[0] = ((int)src[0] + (int)src[2] + 1) >> 1;
+			dst[1] = ((int)src[1] + (int)src[5] + 1) >> 1;
+			dst[2] = ((int)src[4] + (int)src[6] + 1) >> 1;
+			dst[3] = ((int)src[3] + (int)src[7] + 1) >> 1;
+		}
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, 4 * src_width);
+		memcpy(ptr, outcache.data(), 2 * dst_width);
+	}
+}
+
+void downscaleInterleavedUyvy(void *mem, unsigned int height, unsigned int src_width,
+			      unsigned int stride)
+{
+	std::vector<uint8_t> incache(2 * src_width);
+	unsigned int dst_width = src_width / 2;
+	std::vector<uint8_t> outcache(2 * dst_width);
+
+	memcpy(incache.data(), mem, 2 * src_width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *src = incache.data(), *dst = outcache.data();
+		for (unsigned int i = 0; i < dst_width; i++, src += 8, dst += 4) {
+			dst[0] = ((int)src[0] + (int)src[4] + 1) >> 1;
+			dst[1] = ((int)src[1] + (int)src[3] + 1) >> 1;
+			dst[2] = ((int)src[2] + (int)src[6] + 1) >> 1;
+			dst[3] = ((int)src[5] + (int)src[7] + 1) >> 1;
+		}
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, 4 * src_width);
+		memcpy(ptr, outcache.data(), 2 * dst_width);
+	}
+}
+
+void downscaleInterleaved2Internal(void *mem, unsigned int height, unsigned int src_width,
+				   unsigned int stride, std::vector<uint8_t> &incache,
+				   std::vector<uint8_t> &outcache)
+{
+	unsigned int dst_width = src_width / 2;
+	memcpy(incache.data(), mem, 2 * src_width);
+	for (unsigned int j = 0; j < height; j++) {
+		uint8_t *ptr = (uint8_t *)mem + j * stride;
+
+		uint8_t *src = incache.data(), *dst = outcache.data();
+		for (unsigned int i = 0; i < dst_width; i++, src += 4, dst += 2) {
+			dst[0] = ((int)src[0] + (int)src[2] + 1) >> 1;
+			dst[1] = ((int)src[1] + (int)src[3] + 1) >> 1;
+		}
+
+		if (j < height - 1)
+			memcpy(incache.data(), ptr + stride, 2 * src_width);
+		memcpy(ptr, outcache.data(), 2 * dst_width);
+	}
+}
+
+void downscaleSemiPlanar420(void *memY, void *memUV, unsigned int height,
+			    unsigned int src_width, unsigned int stride)
+{
+	std::vector<uint8_t> incache(src_width);
+	std::vector<uint8_t> outcache(src_width / 2);
+
+	downscalePlaneInternal(memY, height, src_width, stride, incache, outcache);
+	downscaleInterleaved2Internal(memUV, height / 2, src_width / 2, stride,
+				      incache, outcache);
+}
+
+void downscaleStreamBuffer(RPi::Stream *stream, int index)
+{
+	unsigned int downscale = stream->swDownscale();
+	/* Must be a power of 2. */
+	ASSERT((downscale & (downscale - 1)) == 0);
+
+	unsigned int stride = stream->configuration().stride;
+	unsigned int dst_width = stream->configuration().size.width;
+	unsigned int height = stream->configuration().size.height;
+	const PixelFormat &pixFormat = stream->configuration().pixelFormat;
+	const RPi::BufferObject &b = stream->getBuffer(index);
+	void *mem = b.mapped->planes()[0].data();
+	ASSERT(b.mapped);
+
+	/* Do repeated downscale-by-2 in place until we're done. */
+	for (; downscale > 1; downscale >>= 1) {
+		unsigned int src_width = downscale * dst_width;
+
+		if (pixFormat == formats::RGB888 || pixFormat == formats::BGR888) {
+			downscaleInterleaved3(mem, height, src_width, stride);
+		} else if (pixFormat == formats::XRGB8888 || pixFormat == formats::XBGR8888) {
+			/* On some devices these may actually be 24bpp at this point. */
+			if (stream->getFlags() & StreamFlag::Needs32bitConv)
+				downscaleInterleaved3(mem, height, src_width, stride);
+			else
+				downscaleInterleaved4(mem, height, src_width, stride);
+		} else if (pixFormat == formats::YUV420 || pixFormat == formats::YVU420) {
+			/*
+			 * These look "multiplanar" even when they're a single allocation,
+			 * so the following should work for everyone.
+			 */
+			void *mem1 = b.mapped->planes()[1].data();
+			void *mem2 = b.mapped->planes()[2].data();
+			downscalePlanar420(mem, mem1, mem2, height, src_width, stride);
+		} else if (pixFormat == formats::YUV422 || pixFormat == formats::YVU422) {
+			/*
+			 * These look "multiplanar" even when they're a single allocation,
+			 * so the following should work for everyone.
+			 */
+			void *mem1 = b.mapped->planes()[1].data();
+			void *mem2 = b.mapped->planes()[2].data();
+			downscalePlanar422(mem, mem1, mem2, height, src_width, stride);
+		} else if (pixFormat == formats::YUYV || pixFormat == formats::YVYU) {
+			downscaleInterleavedYuyv(mem, height, src_width, stride);
+		} else if (pixFormat == formats::UYVY || pixFormat == formats::VYUY) {
+			downscaleInterleavedUyvy(mem, height, src_width, stride);
+		} else if (pixFormat == formats::NV12 || pixFormat == formats::NV21) {
+			/*
+			 * These look "multiplanar" even when they're a single allocation,
+			 * so the following should work for everyone.
+			 */
+			void *mem1 = b.mapped->planes()[1].data();
+			downscaleSemiPlanar420(mem, mem1, height, src_width, stride);
+		} else {
+			LOG(RPI, Error) << "Sw downscale unsupported for " << pixFormat;
+			ASSERT(0);
+		}
+	}
+}
+
+/* Return largest width of any of these streams (or of the camera input). */
+unsigned int getLargestWidth(const V4L2SubdeviceFormat &sensorFormat,
+			     const std::vector<StreamParams> &outStreams)
+{
+	unsigned int largestWidth = sensorFormat.size.width;
+
+	for (const auto &stream : outStreams)
+		largestWidth = std::max(largestWidth, stream.cfg->size.width);
+
+	return largestWidth;
+}
+
+/* Return the minimum number of pixels required to write out multiples of 16 bytes. */
+unsigned int getFormatAlignment(const V4L2PixelFormat &fourcc)
+{
+	const PixelFormatInfo &info = PixelFormatInfo::info(fourcc);
+	unsigned int formatAlignment = 0;
+	for (const auto &plane : info.planes) {
+		if (plane.bytesPerGroup) {
+			/* How many pixels we need in this plane for a multiple of 16 bytes (??). */
+			unsigned int align = 16 * info.pixelsPerGroup /
+						std::gcd(16u, plane.bytesPerGroup);
+			formatAlignment = std::max(formatAlignment, align);
+		}
+	}
+
+	return formatAlignment;
+}
+
+/* Calculate the amount of software downscale required (which is a power of 2). */
+unsigned int calculateSwDownscale(const V4L2DeviceFormat &format, unsigned int largestWidth,
+				  unsigned int platformMaxDownscale)
+{
+	unsigned int formatAlignment = getFormatAlignment(format.fourcc);
+	unsigned int maxDownscale = platformMaxDownscale * 16 / formatAlignment;
+	unsigned int limitWidth = largestWidth / maxDownscale;
+
+	unsigned int hwWidth = format.size.width;
+	unsigned int swDownscale = 1;
+	for (; hwWidth < limitWidth; hwWidth *= 2, swDownscale *= 2);
+
+	return swDownscale;
+}
+
+} /* namespace */
+
+using ::libpisp::BackEnd;
+using ::libpisp::FrontEnd;
+
+class PiSPCameraData final : public RPi::CameraData
+{
+public:
+	PiSPCameraData(PipelineHandler *pipe, const libpisp::PiSPVariant &variant)
+		: RPi::CameraData(pipe), pispVariant_(variant)
+	{
+		/* Initialise internal libpisp logging. */
+		::libpisp::logging_init();
+		LOG(RPI, Info) << "libpisp version " << ::libpisp::version();
+	}
+
+	~PiSPCameraData()
+	{
+		freeBuffers();
+	}
+
+	V4L2VideoDevice::Formats ispFormats() const override
+	{
+		return isp_[Isp::Output0].dev()->formats();
+	}
+
+	V4L2VideoDevice::Formats rawFormats() const override
+	{
+		return cfe_[Cfe::Output0].dev()->formats();
+	}
+
+	V4L2VideoDevice *frontendDevice() override
+	{
+		return cfe_[Cfe::Output0].dev();
+	}
+
+	CameraConfiguration::Status
+	platformValidate(RPi::RPiCameraConfiguration *rpiConfig) const override;
+
+	int platformPipelineConfigure(const std::unique_ptr<YamlObject> &root) override;
+
+	void platformStart() override;
+	void platformStop() override;
+	void platformFreeBuffers() override;
+
+	void cfeBufferDequeue(FrameBuffer *buffer);
+	void beInputDequeue(FrameBuffer *buffer);
+	void beOutputDequeue(FrameBuffer *buffer);
+
+	void processStatsComplete(const ipa::RPi::BufferIds &buffers);
+	void prepareIspComplete(const ipa::RPi::BufferIds &buffers, bool stitchSwapBuffers);
+	void setCameraTimeout(uint32_t maxFrameLengthMs);
+
+	/* Array of CFE and ISP device streams and associated buffers/streams. */
+	RPi::Device<Cfe, 4> cfe_;
+	RPi::Device<Isp, 8> isp_;
+
+	const libpisp::PiSPVariant &pispVariant_;
+
+	/* Frontend/Backend objects shared with the IPA. */
+	RPi::SharedMemObject<FrontEnd> fe_;
+	RPi::SharedMemObject<BackEnd> be_;
+	bool beEnabled_;
+
+	std::unique_ptr<V4L2Subdevice> csi2Subdev_;
+	std::unique_ptr<V4L2Subdevice> feSubdev_;
+
+	std::vector<FrameBuffer *> tdnBuffers_;
+	std::vector<FrameBuffer *> stitchBuffers_;
+	unsigned int tdnInputIndex_;
+	unsigned int stitchInputIndex_;
+
+	struct Config {
+		/*
+		 * Number of CFE config and stats buffers to allocate and use. A
+		 * larger number minimises the possibility of dropping frames,
+		 * but increases the latency for updating the HW configuration.
+		 */
+		unsigned int numCfeConfigStatsBuffers;
+		/*
+		 * Number of jobs to queue ahead to the CFE on startup.
+		 * A larger number will increase latency for 3A changes.
+		 */
+		unsigned int numCfeConfigQueue;
+		/* Don't use BE temporal denoise and free some memory resources. */
+		bool disableTdn;
+		/* Don't use BE HDR and free some memory resources. */
+		bool disableHdr;
+	};
+
+	Config config_;
+
+	bool adjustDeviceFormat(V4L2DeviceFormat &format) const;
+
+private:
+	int platformConfigure(const RPi::RPiCameraConfiguration *rpiConfig) override;
+
+	int platformConfigureIpa([[maybe_unused]] ipa::RPi::ConfigParams &params) override
+	{
+		return 0;
+	}
+
+	int platformInitIpa(ipa::RPi::InitParams &params) override;
+
+	int configureEntities(V4L2SubdeviceFormat sensorFormat,
+			      V4L2SubdeviceFormat &embeddedFormat);
+	int configureCfe();
+	bool calculateCscConfiguration(const V4L2DeviceFormat &v4l2Format, pisp_be_ccm_config &csc);
+	int configureBe(const std::optional<ColorSpace> &yuvColorSpace);
+
+	void platformSetIspCrop() override;
+
+	void prepareCfe();
+	void prepareBe(uint32_t bufferId, bool stitchSwapBuffers);
+
+	void tryRunPipeline() override;
+
+	struct CfeJob {
+		ControlList sensorControls;
+		unsigned int delayContext;
+		std::unordered_map<const RPi::Stream *, FrameBuffer *> buffers;
+	};
+
+	std::queue<CfeJob> cfeJobQueue_;
+
+	bool cfeJobComplete() const
+	{
+		if (cfeJobQueue_.empty())
+			return false;
+
+		const CfeJob &job = cfeJobQueue_.back();
+		return job.buffers.count(&cfe_[Cfe::Output0]) &&
+		       job.buffers.count(&cfe_[Cfe::Stats]) &&
+		       (!sensorMetadata_ ||
+				job.buffers.count(&cfe_[Cfe::Embedded]));
+	}
+};
+
+class PipelineHandlerPiSP : public RPi::PipelineHandlerBase
+{
+public:
+	PipelineHandlerPiSP(CameraManager *manager)
+		: RPi::PipelineHandlerBase(manager)
+	{
+	}
+
+	~PipelineHandlerPiSP()
+	{
+	}
+
+	bool match(DeviceEnumerator *enumerator) override;
+
+private:
+	PiSPCameraData *cameraData(Camera *camera)
+	{
+		return static_cast<PiSPCameraData *>(camera->_d());
+	}
+
+	int prepareBuffers(Camera *camera) override;
+	int platformRegister(std::unique_ptr<RPi::CameraData> &cameraData,
+			     MediaDevice *cfe, MediaDevice *isp) override;
+};
+
+bool PipelineHandlerPiSP::match(DeviceEnumerator *enumerator)
+{
+	constexpr unsigned int numCfeDevices = 2;
+
+	/*
+	 * Loop over all CFE instances, but return out once a match is found.
+	 * This is to ensure we correctly enumerate the camera when an instance
+	 * of the CFE has registered with media controller, but has not registered
+	 * device nodes due to a sensor subdevice failure.
+	 */
+	for (unsigned int i = 0; i < numCfeDevices; i++) {
+		DeviceMatch cfe("rp1-cfe");
+		cfe.add("rp1-cfe-fe_image0");
+		cfe.add("rp1-cfe-fe_stats");
+		cfe.add("rp1-cfe-fe_config");
+		MediaDevice *cfeDevice = acquireMediaDevice(enumerator, cfe);
+
+		if (!cfeDevice) {
+			LOG(RPI, Debug) << "Unable to acquire a CFE instance";
+			break;
+		}
+
+		DeviceMatch isp("pispbe");
+		isp.add("pispbe-input");
+		isp.add("pispbe-config");
+		isp.add("pispbe-output0");
+		isp.add("pispbe-output1");
+		isp.add("pispbe-tdn_output");
+		isp.add("pispbe-tdn_input");
+		isp.add("pispbe-stitch_output");
+		isp.add("pispbe-stitch_input");
+		MediaDevice *ispDevice = acquireMediaDevice(enumerator, isp);
+
+		if (!ispDevice) {
+			LOG(RPI, Debug) << "Unable to acquire ISP instance";
+			break;
+		}
+
+		/*
+		 * The loop below is used to register multiple cameras behind
+		 * one or more video mux devices that are attached to a
+		 * particular CFE instance. Obviously these cameras cannot be
+		 * used simultaneously.
+		 */
+		unsigned int numCameras = 0;
+		for (MediaEntity *entity : cfeDevice->entities()) {
+			if (entity->function() != MEDIA_ENT_F_CAM_SENSOR)
+				continue;
+
+			const libpisp::PiSPVariant &variant =
+				libpisp::get_variant(cfeDevice->hwRevision(),
+						     ispDevice->hwRevision());
+			if (!variant.NumFrontEnds() || !variant.NumBackEnds()) {
+				LOG(RPI, Error) << "Unsupported PiSP variant";
+				break;
+			}
+
+			std::unique_ptr<RPi::CameraData> cameraData =
+				std::make_unique<PiSPCameraData>(this, variant);
+			PiSPCameraData *pisp =
+				static_cast<PiSPCameraData *>(cameraData.get());
+
+			pisp->fe_ = RPi::SharedMemObject<FrontEnd>
+					("pisp_frontend", true, pisp->pispVariant_);
+			pisp->be_ = RPi::SharedMemObject<BackEnd>
+					("pisp_backend", BackEnd::Config({}), pisp->pispVariant_);
+
+			if (!pisp->fe_.fd().isValid() || !pisp->be_.fd().isValid()) {
+				LOG(RPI, Error) << "Failed to create ISP shared objects";
+				break;
+			}
+
+			int ret = registerCamera(cameraData, cfeDevice, "csi2",
+						 ispDevice, entity);
+			if (ret)
+				LOG(RPI, Error) << "Failed to register camera "
+						<< entity->name() << ": " << ret;
+			else
+				numCameras++;
+		}
+
+		if (numCameras)
+			return true;
+	}
+
+	return false;
+}
+
+int PipelineHandlerPiSP::prepareBuffers(Camera *camera)
+{
+	PiSPCameraData *data = cameraData(camera);
+	unsigned int numRawBuffers = 0;
+	int ret;
+
+	for (Stream *s : camera->streams()) {
+		if (PipelineHandlerBase::isRaw(s->configuration().pixelFormat)) {
+			numRawBuffers = s->configuration().bufferCount;
+			break;
+		}
+	}
+
+	/* Decide how many internal buffers to allocate. */
+	for (auto const stream : data->streams_) {
+		unsigned int numBuffers;
+		/*
+		 * For CFE, allocate a minimum of 4 buffers as we want
+		 * to avoid any frame drops.
+		 */
+		constexpr unsigned int minBuffers = 4;
+		if (stream == &data->cfe_[Cfe::Output0]) {
+			/*
+			 * If an application has configured a RAW stream, allocate
+			 * additional buffers to make up the minimum, but ensure
+			 * we have at least 2 sets of internal buffers to use to
+			 * minimise frame drops.
+			 */
+			numBuffers = std::max<int>(2, minBuffers - numRawBuffers);
+		} else if (stream == &data->isp_[Isp::Input]) {
+			/*
+			 * ISP input buffers are imported from the CFE, so follow
+			 * similar logic as above to count all the RAW buffers
+			 * available.
+			 */
+			numBuffers = numRawBuffers +
+					std::max<int>(2, minBuffers - numRawBuffers);
+		} else if (stream == &data->cfe_[Cfe::Embedded]) {
+			/*
+			 * Embedded data buffers are (currently) for internal use,
+			 * so allocate a reasonably large amount.
+			 */
+			numBuffers = 12;
+		} else if (stream == &data->cfe_[Cfe::Stats] ||
+			   stream == &data->cfe_[Cfe::Config]) {
+			numBuffers = data->config_.numCfeConfigStatsBuffers;
+		} else if (!data->beEnabled_) {
+			/* Backend not enabled, we don't need to allocate buffers. */
+			numBuffers = 0;
+		} else if (stream == &data->isp_[Isp::TdnOutput] && data->config_.disableTdn) {
+			/* TDN is explicitly disabled. */
+			continue;
+		} else if (stream == &data->isp_[Isp::StitchOutput] && data->config_.disableHdr) {
+			/* Stitch/HDR is explicitly disabled. */
+			continue;
+		} else {
+			/* Allocate 2 sets of all other Backend buffers */
+			numBuffers = 2;
+		}
+
+		LOG(RPI, Debug) << "Preparing " << numBuffers
+				<< " buffers for stream " << stream->name();
+
+		ret = stream->prepareBuffers(numBuffers);
+		if (ret < 0)
+			return ret;
+	}
+
+	/*
+	 * Store the Framebuffer pointers for convenience as we will ping-pong
+	 * these buffers between the input and output nodes for TDN and Stitch.
+	 *
+	 * The buffer size needs to be setup here as well. Conveniently this is
+	 * the same for both TDN and stitch.
+	 */
+	pisp_image_format_config tdn;
+	data->be_->GetTdnOutputFormat(tdn);
+	unsigned int size = tdn.stride * tdn.height;
+	for (auto const &buffer : data->isp_[Isp::TdnOutput].getBuffers()) {
+		FrameBuffer *b = buffer.second.buffer;
+		b->_d()->metadata().planes()[0].bytesused = size;
+		data->tdnBuffers_.push_back(b);
+	}
+	for (auto const &buffer : data->isp_[Isp::StitchOutput].getBuffers()) {
+		FrameBuffer *b = buffer.second.buffer;
+		b->_d()->metadata().planes()[0].bytesused = size;
+		data->stitchBuffers_.push_back(b);
+	}
+
+	/* Size up the config buffers as well. */
+	for (auto &b : data->isp_[Isp::Config].getBuffers()) {
+		FrameMetadata::Plane &plane = b.second.buffer->_d()->metadata().planes()[0];
+		plane.bytesused = sizeof(pisp_be_tiles_config);
+	}
+
+	/*
+	 * Pass the stats and embedded data buffers to the IPA. No other
+	 * buffers need to be passed.
+	 */
+	mapBuffers(camera, data->cfe_[Cfe::Stats].getBuffers(), RPi::MaskStats);
+	if (data->sensorMetadata_)
+		mapBuffers(camera, data->cfe_[Cfe::Embedded].getBuffers(),
+			   RPi::MaskEmbeddedData);
+
+	return 0;
+}
+
+int PipelineHandlerPiSP::platformRegister(std::unique_ptr<RPi::CameraData> &cameraData,
+					  MediaDevice *cfe, MediaDevice *isp)
+{
+	PiSPCameraData *data = static_cast<PiSPCameraData *>(cameraData.get());
+	int ret;
+
+	MediaEntity *cfeImage = cfe->getEntityByName("rp1-cfe-fe_image0");
+	MediaEntity *cfeEmbedded = cfe->getEntityByName("rp1-cfe-embedded");
+	MediaEntity *cfeStats = cfe->getEntityByName("rp1-cfe-fe_stats");
+	MediaEntity *cfeConfig = cfe->getEntityByName("rp1-cfe-fe_config");
+	MediaEntity *ispInput = isp->getEntityByName("pispbe-input");
+	MediaEntity *IpaPrepare = isp->getEntityByName("pispbe-config");
+	MediaEntity *ispOutput0 = isp->getEntityByName("pispbe-output0");
+	MediaEntity *ispOutput1 = isp->getEntityByName("pispbe-output1");
+	MediaEntity *ispTdnOutput = isp->getEntityByName("pispbe-tdn_output");
+	MediaEntity *ispTdnInput = isp->getEntityByName("pispbe-tdn_input");
+	MediaEntity *ispStitchOutput = isp->getEntityByName("pispbe-stitch_output");
+	MediaEntity *ispStitchInput = isp->getEntityByName("pispbe-stitch_input");
+
+	/* Locate and open the cfe video streams. */
+	data->cfe_[Cfe::Output0] = RPi::Stream("CFE Image", cfeImage);
+	data->cfe_[Cfe::Embedded] = RPi::Stream("CFE Embedded", cfeEmbedded);
+	data->cfe_[Cfe::Stats] = RPi::Stream("CFE Stats", cfeStats);
+	data->cfe_[Cfe::Config] = RPi::Stream("CFE Config", cfeConfig,
+					      StreamFlag::Recurrent | StreamFlag::RequiresMmap);
+
+	/* Tag the ISP input stream as an import stream. */
+	data->isp_[Isp::Input] =
+		RPi::Stream("ISP Input", ispInput, StreamFlag::ImportOnly);
+	data->isp_[Isp::Config] =
+		RPi::Stream("ISP Config", IpaPrepare, StreamFlag::Recurrent |
+						      StreamFlag::RequiresMmap);
+	data->isp_[Isp::Output0] =
+		RPi::Stream("ISP Output0", ispOutput0, StreamFlag::RequiresMmap);
+	data->isp_[Isp::Output1] =
+		RPi::Stream("ISP Output1", ispOutput1, StreamFlag::RequiresMmap);
+	data->isp_[Isp::TdnOutput] =
+		RPi::Stream("ISP TDN Output", ispTdnOutput, StreamFlag::Recurrent);
+	data->isp_[Isp::TdnInput] =
+		RPi::Stream("ISP TDN Input", ispTdnInput, StreamFlag::ImportOnly |
+							  StreamFlag::Recurrent);
+	data->isp_[Isp::StitchOutput] =
+		RPi::Stream("ISP Stitch Output", ispStitchOutput, StreamFlag::Recurrent);
+	data->isp_[Isp::StitchInput] =
+		RPi::Stream("ISP Stitch Input", ispStitchInput, StreamFlag::ImportOnly |
+								StreamFlag::Recurrent);
+
+	/* Wire up all the buffer connections. */
+	data->cfe_[Cfe::Output0].dev()->bufferReady.connect(data, &PiSPCameraData::cfeBufferDequeue);
+	data->cfe_[Cfe::Stats].dev()->bufferReady.connect(data, &PiSPCameraData::cfeBufferDequeue);
+	data->cfe_[Cfe::Config].dev()->bufferReady.connect(data, &PiSPCameraData::cfeBufferDequeue);
+	data->isp_[Isp::Input].dev()->bufferReady.connect(data, &PiSPCameraData::beInputDequeue);
+	data->isp_[Isp::Config].dev()->bufferReady.connect(data, &PiSPCameraData::beOutputDequeue);
+	data->isp_[Isp::Output0].dev()->bufferReady.connect(data, &PiSPCameraData::beOutputDequeue);
+	data->isp_[Isp::Output1].dev()->bufferReady.connect(data, &PiSPCameraData::beOutputDequeue);
+	data->cfe_[Cfe::Embedded].dev()->bufferReady.connect(data, &PiSPCameraData::cfeBufferDequeue);
+
+	data->csi2Subdev_ = std::make_unique<V4L2Subdevice>(cfe->getEntityByName("csi2"));
+	data->feSubdev_ = std::make_unique<V4L2Subdevice>(cfe->getEntityByName("pisp-fe"));
+	data->csi2Subdev_->open();
+	data->feSubdev_->open();
+
+	/*
+	 * Open all CFE and ISP streams. The exception is the embedded data
+	 * stream, which only gets opened below if the IPA reports that the sensor
+	 * supports embedded data.
+	 *
+	 * The below grouping is just for convenience so that we can easily
+	 * iterate over all streams in one go.
+	 */
+	data->streams_.push_back(&data->cfe_[Cfe::Output0]);
+	data->streams_.push_back(&data->cfe_[Cfe::Config]);
+	data->streams_.push_back(&data->cfe_[Cfe::Stats]);
+	if (data->sensorMetadata_)
+		data->streams_.push_back(&data->cfe_[Cfe::Embedded]);
+
+	data->streams_.push_back(&data->isp_[Isp::Input]);
+	data->streams_.push_back(&data->isp_[Isp::Output0]);
+	data->streams_.push_back(&data->isp_[Isp::Output1]);
+	data->streams_.push_back(&data->isp_[Isp::Config]);
+	data->streams_.push_back(&data->isp_[Isp::TdnInput]);
+	data->streams_.push_back(&data->isp_[Isp::TdnOutput]);
+	data->streams_.push_back(&data->isp_[Isp::StitchInput]);
+	data->streams_.push_back(&data->isp_[Isp::StitchOutput]);
+
+	for (auto stream : data->streams_) {
+		ret = stream->dev()->open();
+		if (ret)
+			return ret;
+	}
+
+	/* Write up all the IPA connections. */
+	data->ipa_->prepareIspComplete.connect(data, &PiSPCameraData::prepareIspComplete);
+	data->ipa_->processStatsComplete.connect(data, &PiSPCameraData::processStatsComplete);
+	data->ipa_->setCameraTimeout.connect(data, &PiSPCameraData::setCameraTimeout);
+
+	/*
+	 * List the available streams an application may request. At present, we
+	 * do not advertise CFE Embedded and ISP Statistics streams, as there
+	 * is no mechanism for the application to request non-image buffer formats.
+	 */
+	std::set<Stream *> streams;
+	streams.insert(&data->cfe_[Cfe::Output0]);
+	streams.insert(&data->isp_[Isp::Output0]);
+	streams.insert(&data->isp_[Isp::Output1]);
+
+	/* Create and register the camera. */
+	const std::string &id = data->sensor_->id();
+	std::shared_ptr<Camera> camera =
+		Camera::create(std::move(cameraData), id, streams);
+	PipelineHandler::registerCamera(std::move(camera));
+
+	LOG(RPI, Info) << "Registered camera " << id
+		       << " to CFE device " << cfe->deviceNode()
+		       << " and ISP device " << isp->deviceNode()
+		       << " using PiSP variant " << data->pispVariant_.Name();
+
+	return 0;
+}
+
+CameraConfiguration::Status
+PiSPCameraData::platformValidate(RPi::RPiCameraConfiguration *rpiConfig) const
+{
+	std::vector<StreamParams> &rawStreams = rpiConfig->rawStreams_;
+	std::vector<StreamParams> &outStreams = rpiConfig->outStreams_;
+
+	CameraConfiguration::Status status = CameraConfiguration::Status::Valid;
+
+	/* Can only output 1 RAW stream and/or 2 YUV/RGB streams for now. */
+	if (rawStreams.size() > 1 || outStreams.size() > 2) {
+		LOG(RPI, Error) << "Invalid number of streams requested";
+		return CameraConfiguration::Status::Invalid;
+	}
+
+	if (!rawStreams.empty()) {
+		rawStreams[0].dev = cfe_[Cfe::Output0].dev();
+
+		StreamConfiguration *rawStream = rawStreams[0].cfg;
+		BayerFormat bayer = BayerFormat::fromPixelFormat(rawStream->pixelFormat);
+		/*
+		 * We cannot output CSI2 packed or non 16-bit output from the frontend,
+		 * so signal the output as unpacked 16-bits in these cases.
+		 */
+		if (bayer.packing == BayerFormat::Packing::CSI2 || bayer.bitDepth != 16) {
+			bayer.packing = (bayer.packing == BayerFormat::Packing::CSI2) ?
+				BayerFormat::Packing::PISP1 : BayerFormat::Packing::None;
+			bayer.bitDepth = 16;
+		}
+
+		/* The RAW stream size cannot exceed the sensor frame output - for now. */
+		if (rawStream->size != rpiConfig->sensorFormat_.size ||
+		    rawStream->pixelFormat != bayer.toPixelFormat()) {
+			rawStream->size = rpiConfig->sensorFormat_.size;
+			rawStream->pixelFormat = bayer.toPixelFormat();
+			status = CameraConfiguration::Adjusted;
+		}
+
+		rawStreams[0].format =
+			RPi::PipelineHandlerBase::toV4L2DeviceFormat(cfe_[Cfe::Output0].dev(), rawStream);
+
+		computeOptimalStride(rawStreams[0].format);
+	}
+
+	/*
+	 * For the two ISP outputs, the lower resolution must be routed from
+	 * Output 1
+	 *
+	 * Index 0 contains the largest requested resolution.
+	 */
+	unsigned int largestWidth = getLargestWidth(rpiConfig->sensorFormat_,
+						    rpiConfig->outStreams_);
+
+	for (unsigned int i = 0; i < outStreams.size(); i++) {
+		StreamConfiguration *cfg = outStreams[i].cfg;
+
+		/*
+		 * Output 1 must be for the smallest resolution. We will
+		 * have that fixed up in the code above.
+		 */
+		auto ispOutput = i == 1 || outStreams.size() == 1 ? Isp::Output1
+								  : Isp::Output0;
+		outStreams[i].dev = isp_[ispOutput].dev();
+
+		/*
+		 * Don't let The output streams downscale by more than 64x when
+		 * a downscaler block is available, or 16x when there's only the
+		 * resampler.
+		 */
+		Size rawSize = rpiConfig->sensorFormat_.size.boundedToAspectRatio(cfg->size);
+		unsigned int outputIndex = ispOutput == Isp::Output0 ? 0 : 1;
+		Size minSize;
+		if (pispVariant_.BackEndDownscalerAvailable(0, outputIndex)) {
+			/*
+			 * Downscaler available. Allow up to 64x downscale. If not a multiple of
+			 * 64, round up to the next integer, but also ensure the result is even.
+			 */
+			const unsigned int downscale = 64;
+			minSize.width = (rawSize.width + downscale - 1) / downscale;
+			minSize.width = (minSize.width + 1) & ~1; /* ensure even */
+			minSize.height = (rawSize.height + downscale - 1) / downscale;
+			minSize.height = (minSize.height + 1) & ~1; /* ensure even */
+		} else {
+			/* No downscale. Resampler requires: (output_dim - 1) * 16 <= input_dim - 1 */
+			const unsigned int downscale = 16;
+			minSize.width = (rawSize.width - 1 + downscale - 1) / downscale + 1;
+			minSize.width = (minSize.width + 1) & ~1; /* ensure even */
+			minSize.height = (rawSize.height - 1 + downscale - 1) / downscale + 1;
+			minSize.height = (minSize.height + 1) & ~1; /* ensure even */
+		}
+		LOG(RPI, Debug) << "minSize: width " << minSize.width << " height " << minSize.height;
+
+		/* Bound the output size to minSize, preserve aspect ratio, and ensure even numbers. */
+		if (cfg->size.width < minSize.width) {
+			cfg->size.height = (cfg->size.height * minSize.width / cfg->size.width + 1) & ~1;
+			cfg->size.width = minSize.width;
+			status = CameraConfiguration::Status::Adjusted;
+		}
+
+		if (cfg->size.height < minSize.height) {
+			cfg->size.width = (cfg->size.width * minSize.height / cfg->size.height + 1) & ~1;
+			cfg->size.height = minSize.height;
+			status = CameraConfiguration::Status::Adjusted;
+		}
+
+		/* Make sure output1 is no larger than output 0. */
+		Size size = cfg->size.boundedTo(outStreams[0].cfg->size);
+
+		/* \todo Warn if upscaling: reduces image quality. */
+
+		if (cfg->size != size) {
+			cfg->size = size;
+			status = CameraConfiguration::Status::Adjusted;
+		}
+
+		outStreams[i].format =
+			RPi::PipelineHandlerBase::toV4L2DeviceFormat(outStreams[i].dev, outStreams[i].cfg);
+
+		/* Compute the optimal stride for the BE output buffers. */
+		computeOptimalStride(outStreams[i].format);
+
+		/*
+		 * We need to check for software downscaling. This must happen
+		 * after adjusting the device format so that we can choose the
+		 * largest stride - which might have been the original
+		 * unadjusted format, or the adjusted one (if software
+		 * downscaling means it's larger).
+		 */
+		V4L2DeviceFormat adjustedFormat = outStreams[i].format;
+		adjustDeviceFormat(adjustedFormat);
+
+		unsigned int swDownscale =
+			calculateSwDownscale(adjustedFormat, largestWidth,
+					     be_->GetMaxDownscale());
+		LOG(RPI, Debug) << "For stream " << adjustedFormat
+				<< " swDownscale is " << swDownscale;
+		if (swDownscale > 1) {
+			adjustedFormat.size.width *= swDownscale;
+			computeOptimalStride(adjustedFormat);
+			for (unsigned int p = 0; p < outStreams[i].format.planesCount; p++)
+				outStreams[i].format.planes[p].bpl =
+					std::max(outStreams[i].format.planes[p].bpl, adjustedFormat.planes[p].bpl);
+		}
+	}
+
+	return status;
+}
+
+int PiSPCameraData::platformPipelineConfigure(const std::unique_ptr<YamlObject> &root)
+{
+	config_ = {
+		.numCfeConfigStatsBuffers = 12,
+		.numCfeConfigQueue = 2,
+		.disableTdn = false,
+		.disableHdr = false,
+	};
+
+	if (!root)
+		return 0;
+
+	std::optional<double> ver = (*root)["version"].get<double>();
+	if (!ver || *ver != 1.0) {
+		LOG(RPI, Error) << "Unexpected configuration file version reported";
+		return -EINVAL;
+	}
+
+	std::optional<std::string> target = (*root)["target"].get<std::string>();
+	if (!target || *target != "pisp") {
+		LOG(RPI, Error) << "Unexpected target reported: expected \"pisp\", got "
+				<< *target;
+		return -EINVAL;
+	}
+
+	const YamlObject &phConfig = (*root)["pipeline_handler"];
+	config_.numCfeConfigStatsBuffers =
+		phConfig["num_cfe_config_stats_buffers"].get<unsigned int>(config_.numCfeConfigStatsBuffers);
+	config_.numCfeConfigQueue =
+		phConfig["num_cfe_config_queue"].get<unsigned int>(config_.numCfeConfigQueue);
+	config_.disableTdn = phConfig["disable_tdn"].get<bool>(config_.disableTdn);
+	config_.disableHdr = phConfig["disable_hdr"].get<bool>(config_.disableHdr);
+
+	if (config_.disableTdn) {
+		LOG(RPI, Info) << "TDN disabled by user config";
+		streams_.erase(std::remove_if(streams_.begin(), streams_.end(),
+			       [this] (const RPi::Stream *s) { return s == &isp_[Isp::TdnInput] ||
+								      s == &isp_[Isp::TdnInput]; }),
+			       streams_.end());
+	}
+
+	if (config_.disableHdr) {
+		LOG(RPI, Info) << "HDR disabled by user config";
+		streams_.erase(std::remove_if(streams_.begin(), streams_.end(),
+			       [this] (const RPi::Stream *s) { return s == &isp_[Isp::StitchInput] ||
+								      s == &isp_[Isp::StitchOutput]; }),
+			       streams_.end());
+	}
+
+	if (config_.numCfeConfigStatsBuffers < 1) {
+		LOG(RPI, Error)
+			<< "Invalid configuration: num_cfe_config_stats_buffers must be >= 1";
+		return -EINVAL;
+	}
+
+	if (config_.numCfeConfigQueue < 1) {
+		LOG(RPI, Error)
+			<< "Invalid configuration: numCfeConfigQueue must be >= 1";
+		return -EINVAL;
+	}
+
+	return 0;
+}
+
+std::unordered_map<uint32_t, uint32_t> deviceAdjustTable = {
+	{ V4L2_PIX_FMT_RGBX32, V4L2_PIX_FMT_RGB24 },
+	{ V4L2_PIX_FMT_XBGR32, V4L2_PIX_FMT_BGR24 }
+};
+
+bool PiSPCameraData::adjustDeviceFormat(V4L2DeviceFormat &format) const
+{
+	auto it = deviceAdjustTable.find(format.fourcc.fourcc());
+
+	if (pispVariant_.BackendRGB32Supported(0))
+		return false;
+
+	if (it != deviceAdjustTable.end()) {
+		LOG(RPI, Debug) << "Swapping 32-bit for 24-bit format";
+		format.fourcc = V4L2PixelFormat(it->second);
+		return true;
+	}
+
+	return false;
+}
+
+int PiSPCameraData::platformConfigure(const RPi::RPiCameraConfiguration *rpiConfig)
+{
+	const std::vector<RPi::RPiCameraConfiguration::StreamParams> &rawStreams = rpiConfig->rawStreams_;
+	const std::vector<RPi::RPiCameraConfiguration::StreamParams> &outStreams = rpiConfig->outStreams_;
+	int ret;
+
+	V4L2VideoDevice *cfe = cfe_[Cfe::Output0].dev();
+	V4L2DeviceFormat cfeFormat;
+
+	/*
+	 * See which streams are requested, and route the user
+	 * StreamConfiguration appropriately.
+	 */
+	if (rawStreams.empty()) {
+		/*
+		 * The CFE Frontend output will always be 16-bits unpacked, so adjust the
+		 * mbus code right at the start.
+		 */
+		V4L2SubdeviceFormat sensorFormatMod = rpiConfig->sensorFormat_;
+		sensorFormatMod.mbus_code = mbusCodeUnpacked16(sensorFormatMod.mbus_code);
+		cfeFormat = RPi::PipelineHandlerBase::toV4L2DeviceFormat(cfe,
+									 sensorFormatMod,
+									 BayerFormat::Packing::PISP1);
+		computeOptimalStride(cfeFormat);
+	} else {
+		rawStreams[0].cfg->setStream(&cfe_[Cfe::Output0]);
+		cfe_[Cfe::Output0].setFlags(StreamFlag::External);
+		cfeFormat = rawStreams[0].format;
+	}
+
+	ret = cfe->setFormat(&cfeFormat);
+	if (ret)
+		return ret;
+
+	/* Set the TDN and Stitch node formats in case they are turned on. */
+	isp_[Isp::TdnOutput].dev()->setFormat(&cfeFormat);
+	isp_[Isp::TdnInput].dev()->setFormat(&cfeFormat);
+	isp_[Isp::StitchOutput].dev()->setFormat(&cfeFormat);
+	isp_[Isp::StitchInput].dev()->setFormat(&cfeFormat);
+
+	ret = isp_[Isp::Input].dev()->setFormat(&cfeFormat);
+	if (ret)
+		return ret;
+
+	LOG(RPI, Info) << "Sensor: " << sensor_->id()
+		       << " - Selected sensor format: " << rpiConfig->sensorFormat_
+		       << " - Selected CFE format: " << cfeFormat;
+
+	/*
+	 * Find the largest width of any stream; we'll use it later to check for
+	 * excessive downscaling.
+	 */
+	unsigned int largestWidth = getLargestWidth(rpiConfig->sensorFormat_, outStreams);
+
+	unsigned int beEnables = 0;
+	V4L2DeviceFormat format;
+
+	/*
+	 * First thing is to remove Isp::Output0 and Isp::Output1 from streams_
+	 * as they may be unused depending on the configuration. Add them back
+	 * only if needed.
+	 */
+	streams_.erase(std::remove_if(streams_.begin(), streams_.end(),
+		       [this] (const RPi::Stream *s) { return s == &isp_[Isp::Output0] ||
+							      s == &isp_[Isp::Output1]; }),
+		       streams_.end());
+
+	for (unsigned int i = 0; i < outStreams.size(); i++) {
+		StreamConfiguration *cfg = outStreams[i].cfg;
+
+		/*
+		 * Output 1 must be for the smallest resolution. We will
+		 * have that fixed up in the code above.
+		 */
+		RPi::Stream *stream;
+		if (i == 1 || outStreams.size() == 1) {
+			stream = &isp_[Isp::Output1];
+			beEnables |= PISP_BE_RGB_ENABLE_OUTPUT1;
+		} else {
+			stream = &isp_[Isp::Output0];
+			beEnables |= PISP_BE_RGB_ENABLE_OUTPUT0;
+		}
+
+		format = outStreams[i].format;
+		bool needs32BitConversion = adjustDeviceFormat(format);
+
+		/*
+		 * This pixel format may not be the same as the configured
+		 * pixel format if adjustDeviceFormat() above has reqused a change.
+		 */
+		PixelFormat pixFmt = format.fourcc.toPixelFormat();
+
+		/* If there's excessive downscaling we'll do some of it in software. */
+		unsigned int swDownscale = calculateSwDownscale(format, largestWidth,
+								be_->GetMaxDownscale());
+		unsigned int hwWidth = format.size.width * swDownscale;
+		format.size.width = hwWidth;
+
+		LOG(RPI, Debug) << "Setting " << stream->name() << " to "
+				<< format << " (sw downscale " << swDownscale << ")";
+
+		ret = stream->dev()->setFormat(&format);
+		if (ret)
+			return -EINVAL;
+		LOG(RPI, Debug) << "After setFormat, stride " << format.planes[0].bpl;
+
+		if (format.size.height != cfg->size.height ||
+		    format.size.width != hwWidth || format.fourcc.toPixelFormat() != pixFmt) {
+			LOG(RPI, Error)
+				<< "Failed to set requested format on " << stream->name()
+				<< ", returned " << format;
+			return -EINVAL;
+		}
+
+		LOG(RPI, Debug)
+			<< "Stream " << stream->name() << " has color space "
+			<< ColorSpace::toString(cfg->colorSpace);
+
+		libcamera::RPi::Stream::StreamFlags flags = StreamFlag::External;
+
+		stream->clearFlags(StreamFlag::Needs32bitConv);
+		if (needs32BitConversion)
+			flags |= StreamFlag::Needs32bitConv;
+
+		cfg->setStream(stream);
+		stream->setFlags(flags);
+		stream->setSwDownscale(swDownscale);
+		streams_.push_back(stream);
+	}
+
+	pisp_be_global_config global;
+	be_->GetGlobal(global);
+	global.rgb_enables &= ~(PISP_BE_RGB_ENABLE_OUTPUT0 + PISP_BE_RGB_ENABLE_OUTPUT1);
+	global.rgb_enables |= beEnables;
+	be_->SetGlobal(global);
+
+	beEnabled_ = beEnables & (PISP_BE_RGB_ENABLE_OUTPUT0 | PISP_BE_RGB_ENABLE_OUTPUT1);
+
+	/* CFE statistics output format. */
+	format = {};
+	format.fourcc = V4L2PixelFormat(V4L2_META_FMT_RPI_FE_STATS);
+	ret = cfe_[Cfe::Stats].dev()->setFormat(&format);
+	if (ret) {
+		LOG(RPI, Error) << "Failed to set format on CFE stats stream: "
+				<< format.toString();
+		return ret;
+	}
+
+	/* CFE config format. */
+	format = {};
+	format.fourcc = V4L2PixelFormat(V4L2_META_FMT_RPI_FE_CFG);
+	ret = cfe_[Cfe::Config].dev()->setFormat(&format);
+	if (ret) {
+		LOG(RPI, Error) << "Failed to set format on CFE config stream: "
+				<< format.toString();
+		return ret;
+	}
+
+	/*
+	 * Configure the CFE embedded data output format only if the sensor
+	 * supports it.
+	 */
+	V4L2SubdeviceFormat embeddedFormat;
+	if (sensorMetadata_) {
+		sensor_->device()->getFormat(1, &embeddedFormat);
+		format = {};
+		format.fourcc = V4L2PixelFormat(V4L2_META_FMT_SENSOR_DATA);
+		format.planes[0].size = embeddedFormat.size.width * embeddedFormat.size.height;
+
+		LOG(RPI, Debug) << "Setting embedded data format " << format.toString();
+		ret = cfe_[Cfe::Embedded].dev()->setFormat(&format);
+		if (ret) {
+			LOG(RPI, Error) << "Failed to set format on CFE embedded: "
+					<< format;
+			return ret;
+		}
+	}
+
+	/* Set smallest selection the ISP will allow. */
+	ispMinCropSize_ = Size(32, 32);
+
+	if (!outStreams.empty()) {
+		/* Adjust aspect ratio by providing crops on the input image. */
+		Size size = cfeFormat.size.boundedToAspectRatio(outStreams[0].cfg->size);
+		ispCrop_ = size.centeredTo(Rectangle(cfeFormat.size).center());
+
+		/*
+		 * Calculate the minimum crop. The rule is that (output_dim - 1) / (input_dim - 1)
+		 * must be strictly < 16. We add 2 after dividing because +1
+		 * comes from the division that rounds down, and +1 because we
+		 * had (input_dim - 1).
+		 */
+		Size scalingMinSize = outStreams[0].cfg->size.shrunkBy({ 1, 1 }) / 16;
+		scalingMinSize.growBy({ 2, 2 });
+		ispMinCropSize_.expandTo(scalingMinSize);
+	}
+
+	configureEntities(rpiConfig->sensorFormat_, embeddedFormat);
+	configureCfe();
+
+	if (beEnabled_)
+		configureBe(rpiConfig->yuvColorSpace_);
+
+	platformSetIspCrop();
+
+	return 0;
+}
+
+void PiSPCameraData::platformStart()
+{
+	/*
+	 * We don't need to worry about dequeue events for the TDN and Stitch
+	 * nodes as the buffers are simply ping-ponged every frame. But we do
+	 * want to track the currently used input index.
+	 */
+	tdnInputIndex_ = 0;
+	stitchInputIndex_ = 0;
+
+	cfeJobQueue_ = {};
+
+	for (unsigned int i = 0; i < config_.numCfeConfigQueue; i++)
+		prepareCfe();
+}
+
+void PiSPCameraData::platformStop()
+{
+	cfeJobQueue_ = {};
+}
+
+void PiSPCameraData::platformFreeBuffers()
+{
+	tdnBuffers_.clear();
+	stitchBuffers_.clear();
+}
+
+void PiSPCameraData::cfeBufferDequeue(FrameBuffer *buffer)
+{
+	RPi::Stream *stream = nullptr;
+	int index;
+
+	if (!isRunning())
+		return;
+
+	for (RPi::Stream &s : cfe_) {
+		index = s.getBufferId(buffer);
+		if (index) {
+			stream = &s;
+			break;
+		}
+	}
+
+	/* If the last CFE job has completed, we need a new job entry in the queue. */
+	if (cfeJobQueue_.empty() || cfeJobComplete())
+		cfeJobQueue_.push({});
+
+	CfeJob &job = cfeJobQueue_.back();
+
+	/* The buffer must belong to one of our streams. */
+	ASSERT(stream);
+
+	LOG(RPI, Debug) << "Stream " << stream->name() << " buffer dequeue"
+			<< ", buffer id " << index
+			<< ", timestamp: " << buffer->metadata().timestamp;
+
+	job.buffers[stream] = buffer;
+
+	if (stream == &cfe_[Cfe::Output0]) {
+		/*
+		 * Lookup the sensor controls used for this frame sequence from
+		 * DelayedControl and queue them along with the frame buffer.
+		 */
+		auto [ctrl, delayContext] = delayedCtrls_->get(buffer->metadata().sequence);
+		/*
+		 * Add the frame timestamp to the ControlList for the IPA to use
+		 * as it does not receive the FrameBuffer object.
+		 */
+		ctrl.set(controls::SensorTimestamp, buffer->metadata().timestamp);
+		job.sensorControls = std::move(ctrl);
+		job.delayContext = delayContext;
+	} else if (stream == &cfe_[Cfe::Config]) {
+		/* The config buffer can be re-queued back straight away. */
+		handleStreamBuffer(buffer, &cfe_[Cfe::Config]);
+		prepareCfe();
+	}
+
+	handleState();
+}
+
+void PiSPCameraData::beInputDequeue(FrameBuffer *buffer)
+{
+	if (!isRunning())
+		return;
+
+	LOG(RPI, Debug) << "Stream ISP Input buffer complete"
+			<< ", buffer id " << cfe_[Cfe::Output0].getBufferId(buffer)
+			<< ", timestamp: " << buffer->metadata().timestamp;
+
+	/* The ISP input buffer gets re-queued into CFE. */
+	handleStreamBuffer(buffer, &cfe_[Cfe::Output0]);
+	handleState();
+}
+
+void PiSPCameraData::beOutputDequeue(FrameBuffer *buffer)
+{
+	RPi::Stream *stream = nullptr;
+	int index;
+
+	if (!isRunning())
+		return;
+
+	for (RPi::Stream &s : isp_) {
+		index = s.getBufferId(buffer);
+		if (index) {
+			stream = &s;
+			break;
+		}
+	}
+
+	/* The buffer must belong to one of our ISP output streams. */
+	ASSERT(stream);
+
+	LOG(RPI, Debug) << "Stream " << stream->name() << " buffer complete"
+			<< ", buffer id " << index
+			<< ", timestamp: " << buffer->metadata().timestamp;
+
+	bool downscale = stream->swDownscale() > 1;
+	bool needs32bitConv = !!(stream->getFlags() & StreamFlag::Needs32bitConv);
+
+	if (downscale || needs32bitConv)
+		dmabufSyncStart(buffer->planes()[0].fd);
+
+	if (downscale) {
+		/* Further software downscaling must be applied. */
+		downscaleStreamBuffer(stream, index);
+	}
+
+	/* Convert 24bpp outputs to 32bpp outputs where necessary. */
+	if (needs32bitConv) {
+		unsigned int stride = stream->configuration().stride;
+		unsigned int width = stream->configuration().size.width;
+		unsigned int height = stream->configuration().size.height;
+
+		const RPi::BufferObject &b = stream->getBuffer(index);
+
+		ASSERT(b.mapped);
+		void *mem = b.mapped->planes()[0].data();
+		do32BitConversion(mem, width, height, stride);
+	}
+
+	if (downscale || needs32bitConv)
+		dmabufSyncEnd(buffer->planes()[0].fd);
+
+	handleStreamBuffer(buffer, stream);
+
+	/*
+	 * Increment the number of ISP outputs generated.
+	 * This is needed to track dropped frames.
+	 */
+	ispOutputCount_++;
+	handleState();
+}
+
+void PiSPCameraData::processStatsComplete(const ipa::RPi::BufferIds &buffers)
+{
+	if (!isRunning())
+		return;
+
+	handleStreamBuffer(cfe_[Cfe::Stats].getBuffers().at(buffers.stats & RPi::MaskID).buffer,
+			   &cfe_[Cfe::Stats]);
+}
+
+void PiSPCameraData::setCameraTimeout(uint32_t maxFrameLengthMs)
+{
+	/*
+	 * Set the dequeue timeout to the larger of 5x the maximum reported
+	 * frame length advertised by the IPA over a number of frames. Allow
+	 * a minimum timeout value of 1s.
+	 */
+	utils::Duration timeout =
+		std::max<utils::Duration>(1s, 5 * maxFrameLengthMs * 1ms);
+
+	LOG(RPI, Debug) << "Setting CFE timeout to " << timeout;
+	cfe_[Cfe::Output0].dev()->setDequeueTimeout(timeout);
+}
+
+void PiSPCameraData::prepareIspComplete(const ipa::RPi::BufferIds &buffers, bool stitchSwapBuffers)
+{
+	unsigned int embeddedId = buffers.embedded & RPi::MaskID;
+	unsigned int bayerId = buffers.bayer & RPi::MaskID;
+	FrameBuffer *buffer;
+
+	if (!isRunning())
+		return;
+
+	if (sensorMetadata_ && embeddedId) {
+		buffer = cfe_[Cfe::Embedded].getBuffers().at(embeddedId).buffer;
+		handleStreamBuffer(buffer, &cfe_[Cfe::Embedded]);
+	}
+
+	if (!beEnabled_) {
+		/*
+		 * If there is no need to run the Backend, just signal that the
+		 * input buffer is completed and all Backend outputs are ready.
+		 */
+		ispOutputCount_ = ispOutputTotal_;
+		buffer = cfe_[Cfe::Output0].getBuffers().at(bayerId).buffer;
+		handleStreamBuffer(buffer, &cfe_[Cfe::Output0]);
+	} else
+		prepareBe(bayerId, stitchSwapBuffers);
+
+	state_ = State::IpaComplete;
+	handleState();
+}
+
+int PiSPCameraData::configureCfe()
+{
+	V4L2DeviceFormat cfeFormat;
+	cfe_[Cfe::Output0].dev()->getFormat(&cfeFormat);
+
+	std::scoped_lock<FrontEnd> l(*fe_);
+
+	pisp_fe_global_config global;
+	fe_->GetGlobal(global);
+	global.enables &= ~PISP_FE_ENABLE_COMPRESS0;
+
+	global.enables |= PISP_FE_ENABLE_OUTPUT0;
+	global.bayer_order = toPiSPBayerOrder(cfeFormat.fourcc);
+
+	pisp_image_format_config image = toPiSPImageFormat(cfeFormat);
+	pisp_fe_input_config input = {};
+
+	input.streaming = 1;
+	input.format = image;
+	input.format.format = PISP_IMAGE_FORMAT_BPS_16;
+
+	if (PISP_IMAGE_FORMAT_compressed(image.format)) {
+		pisp_compress_config compress;
+		compress.offset = DefaultCompressionOffset;
+		compress.mode =	(image.format & PISP_IMAGE_FORMAT_COMPRESSION_MASK) /
+					PISP_IMAGE_FORMAT_COMPRESSION_MODE_1;
+		global.enables |= PISP_FE_ENABLE_COMPRESS0;
+		fe_->SetCompress(0, compress);
+	}
+
+	if (input.format.width > pispVariant_.FrontEndDownscalerMaxWidth(0, 0))
+		global.enables |= PISP_FE_ENABLE_DECIMATE;
+
+	fe_->SetGlobal(global);
+	fe_->SetInput(input);
+	fe_->SetOutputFormat(0, image);
+
+	return 0;
+}
+
+bool PiSPCameraData::calculateCscConfiguration(const V4L2DeviceFormat &v4l2Format, pisp_be_ccm_config &csc)
+{
+	const PixelFormat &pixFormat = v4l2Format.fourcc.toPixelFormat();
+	const PixelFormatInfo &info = PixelFormatInfo::info(pixFormat);
+	memset(&csc, 0, sizeof(csc));
+
+	if (info.colourEncoding == PixelFormatInfo::ColourEncodingYUV) {
+		/* Look up the correct YCbCr conversion matrix for this colour space. */
+		if (v4l2Format.colorSpace == ColorSpace::Sycc)
+			be_->InitialiseYcbcr(csc, "jpeg");
+		else if (v4l2Format.colorSpace == ColorSpace::Smpte170m)
+			be_->InitialiseYcbcr(csc, "smpte170m");
+		else if (v4l2Format.colorSpace == ColorSpace::Rec709)
+			be_->InitialiseYcbcr(csc, "rec709");
+		else {
+			LOG(RPI, Warning)
+				<< "Unrecognised colour space "
+				<< ColorSpace::toString(v4l2Format.colorSpace)
+				<< ", defaulting to sYCC";
+			be_->InitialiseYcbcr(csc, "jpeg");
+		}
+		return true;
+	}
+	/* There will be more formats to check for in due course. */
+	else if (pixFormat == formats::RGB888 || pixFormat == formats::RGBX8888 ||
+		 pixFormat == formats::XRGB8888 || pixFormat == formats::RGB161616) {
+		/* Identity matrix but with RB colour swap. */
+		csc.coeffs[2] = csc.coeffs[4] = csc.coeffs[6] = 1 << 10;
+		return true;
+	}
+
+	return false;
+}
+
+int PiSPCameraData::configureBe(const std::optional<ColorSpace> &yuvColorSpace)
+{
+	pisp_image_format_config inputFormat;
+	V4L2DeviceFormat cfeFormat;
+
+	isp_[Isp::Input].dev()->getFormat(&cfeFormat);
+	inputFormat = toPiSPImageFormat(cfeFormat);
+
+	pisp_be_global_config global;
+	be_->GetGlobal(global);
+	global.bayer_enables &= ~(PISP_BE_BAYER_ENABLE_DECOMPRESS +
+				  PISP_BE_BAYER_ENABLE_TDN_DECOMPRESS +
+				  PISP_BE_BAYER_ENABLE_TDN_COMPRESS +
+				  PISP_BE_BAYER_ENABLE_STITCH_DECOMPRESS +
+				  PISP_BE_BAYER_ENABLE_STITCH_COMPRESS);
+	global.rgb_enables &= ~(PISP_BE_RGB_ENABLE_RESAMPLE0 +
+				PISP_BE_RGB_ENABLE_RESAMPLE1 +
+				PISP_BE_RGB_ENABLE_DOWNSCALE0 +
+				PISP_BE_RGB_ENABLE_DOWNSCALE1 +
+				PISP_BE_RGB_ENABLE_CSC0 +
+				PISP_BE_RGB_ENABLE_CSC1);
+
+	global.bayer_enables |= PISP_BE_BAYER_ENABLE_INPUT;
+	global.bayer_order = toPiSPBayerOrder(cfeFormat.fourcc);
+
+	ispOutputTotal_ = 1; /* Config buffer */
+	if (PISP_IMAGE_FORMAT_compressed(inputFormat.format)) {
+		pisp_decompress_config decompress;
+		decompress.offset = DefaultCompressionOffset;
+		decompress.mode = (inputFormat.format & PISP_IMAGE_FORMAT_COMPRESSION_MASK)
+					/ PISP_IMAGE_FORMAT_COMPRESSION_MODE_1;
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_DECOMPRESS;
+		be_->SetDecompress(decompress);
+	}
+
+	if (global.rgb_enables & PISP_BE_RGB_ENABLE_OUTPUT0) {
+		pisp_be_output_format_config outputFormat0 = {};
+		V4L2DeviceFormat ispFormat0 = {};
+
+		isp_[Isp::Output0].dev()->getFormat(&ispFormat0);
+		outputFormat0.image = toPiSPImageFormat(ispFormat0);
+
+		pisp_be_ccm_config csc;
+		if (calculateCscConfiguration(ispFormat0, csc)) {
+			global.rgb_enables |= PISP_BE_RGB_ENABLE_CSC0;
+			be_->SetCsc(0, csc);
+		}
+
+		BackEnd::SmartResize resize = {};
+		resize.width = ispFormat0.size.width;
+		resize.height = ispFormat0.size.height;
+		be_->SetSmartResize(0, resize);
+
+		setupOutputClipping(ispFormat0, outputFormat0);
+
+		be_->SetOutputFormat(0, outputFormat0);
+		ispOutputTotal_++;
+	}
+
+	if (global.rgb_enables & PISP_BE_RGB_ENABLE_OUTPUT1) {
+		pisp_be_output_format_config outputFormat1 = {};
+		V4L2DeviceFormat ispFormat1 = {};
+
+		isp_[Isp::Output1].dev()->getFormat(&ispFormat1);
+		outputFormat1.image = toPiSPImageFormat(ispFormat1);
+
+		pisp_be_ccm_config csc;
+		if (calculateCscConfiguration(ispFormat1, csc)) {
+			global.rgb_enables |= PISP_BE_RGB_ENABLE_CSC1;
+			be_->SetCsc(1, csc);
+		}
+
+		BackEnd::SmartResize resize = {};
+		resize.width = ispFormat1.size.width;
+		resize.height = ispFormat1.size.height;
+		be_->SetSmartResize(1, resize);
+
+		setupOutputClipping(ispFormat1, outputFormat1);
+
+		be_->SetOutputFormat(1, outputFormat1);
+		ispOutputTotal_++;
+	}
+
+	/* Setup the TDN I/O blocks in case TDN gets turned on later. */
+	V4L2DeviceFormat tdnV4L2Format;
+	isp_[Isp::TdnOutput].dev()->getFormat(&tdnV4L2Format);
+	pisp_image_format_config tdnFormat = toPiSPImageFormat(tdnV4L2Format);
+	be_->SetTdnOutputFormat(tdnFormat);
+	be_->SetTdnInputFormat(tdnFormat);
+
+	if (PISP_IMAGE_FORMAT_compressed(tdnFormat.format)) {
+		pisp_decompress_config tdnDecompress;
+		pisp_compress_config tdnCompress;
+
+		tdnDecompress.offset = tdnCompress.offset = DefaultCompressionOffset;
+		tdnDecompress.mode = tdnCompress.mode = DefaultCompressionMode;
+		be_->SetTdnDecompress(tdnDecompress);
+		be_->SetTdnCompress(tdnCompress);
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_TDN_DECOMPRESS +
+					PISP_BE_BAYER_ENABLE_TDN_COMPRESS;
+	}
+
+	/* Likewise for the Stitch block. */
+	V4L2DeviceFormat stitchV4L2Format;
+	isp_[Isp::StitchOutput].dev()->getFormat(&stitchV4L2Format);
+	pisp_image_format_config stitchFormat = toPiSPImageFormat(stitchV4L2Format);
+	be_->SetStitchOutputFormat(stitchFormat);
+	be_->SetStitchInputFormat(stitchFormat);
+
+	if (PISP_IMAGE_FORMAT_compressed(stitchFormat.format)) {
+		pisp_decompress_config stitchDecompress;
+		pisp_compress_config stitchCompress;
+
+		/* Stitch block is after BLC, so compression offset should be 0. */
+		stitchDecompress.offset = stitchCompress.offset = 0;
+		stitchDecompress.mode = stitchCompress.mode = DefaultCompressionMode;
+		be_->SetStitchDecompress(stitchDecompress);
+		be_->SetStitchCompress(stitchCompress);
+		global.bayer_enables |= PISP_BE_BAYER_ENABLE_STITCH_DECOMPRESS +
+					PISP_BE_BAYER_ENABLE_STITCH_COMPRESS;
+	}
+
+	/*
+	 * For the bit of the pipeline where we go temporarily into YCbCr, we'll use the
+	 * same flavour of YCbCr as dictated by the headline colour space. But there's
+	 * no benefit from compressing and shifting the range, so we'll stick with the
+	 * full range version of whatever that colour space is.
+	 */
+	if (yuvColorSpace) {
+		pisp_be_ccm_config ccm;
+		if (yuvColorSpace == ColorSpace::Sycc) {
+			be_->InitialiseYcbcr(ccm, "jpeg");
+			be_->SetYcbcr(ccm);
+			be_->InitialiseYcbcrInverse(ccm, "jpeg");
+			be_->SetYcbcrInverse(ccm);
+		} else if (yuvColorSpace == ColorSpace::Smpte170m) {
+			/* We want the full range version of smpte170m, aka. jpeg */
+			be_->InitialiseYcbcr(ccm, "jpeg");
+			be_->SetYcbcr(ccm);
+			be_->InitialiseYcbcrInverse(ccm, "jpeg");
+			be_->SetYcbcrInverse(ccm);
+		} else if (yuvColorSpace == ColorSpace::Rec709) {
+			be_->InitialiseYcbcr(ccm, "rec709_full");
+			be_->SetYcbcr(ccm);
+			be_->InitialiseYcbcrInverse(ccm, "rec709_full");
+			be_->SetYcbcrInverse(ccm);
+		} else {
+			/* Validation should have ensured this can't happen. */
+			LOG(RPI, Error)
+				<< "Invalid colour space "
+				<< ColorSpace::toString(yuvColorSpace);
+			ASSERT(0);
+		}
+	} else {
+		/* Again, validation should have prevented this. */
+		LOG(RPI, Error) << "No YUV colour space";
+		ASSERT(0);
+	}
+
+	be_->SetGlobal(global);
+	be_->SetInputFormat(inputFormat);
+
+	return 0;
+}
+
+void PiSPCameraData::platformSetIspCrop()
+{
+	pisp_be_crop_config beCrop = {
+		static_cast<uint16_t>(ispCrop_.x),
+		static_cast<uint16_t>(ispCrop_.y),
+		static_cast<uint16_t>(ispCrop_.width),
+		static_cast<uint16_t>(ispCrop_.height)
+	};
+
+	be_->SetCrop(beCrop);
+}
+
+int PiSPCameraData::platformInitIpa(ipa::RPi::InitParams &params)
+{
+	params.fe = fe_.fd();
+	params.be = be_.fd();
+	return 0;
+}
+
+int PiSPCameraData::configureEntities(V4L2SubdeviceFormat sensorFormat,
+				      V4L2SubdeviceFormat &embeddedFormat)
+{
+	int ret = 0;
+
+	constexpr unsigned int csiVideoSinkPad = 0;
+	constexpr unsigned int csiMetaSinkPad = 1;
+	constexpr unsigned int csiVideoSourcePad = 4;
+	constexpr unsigned int csiMetaSourcePad = 5;
+
+	constexpr unsigned int feVideoSinkPad = 0;
+	constexpr unsigned int feConfigSinkPad = 1;
+	constexpr unsigned int feVideo0SourcePad = 2;
+	constexpr unsigned int feVideo1SourcePad = 3;
+	constexpr unsigned int feStatsSourcePad = 4;
+
+	const MediaEntity *csi2 = csi2Subdev_->entity();
+	const MediaEntity *fe = feSubdev_->entity();
+
+	for (MediaLink *link : csi2->pads()[csiVideoSourcePad]->links()) {
+		if (link->sink()->entity()->name() == "rp1-cfe-csi2_ch0")
+			link->setEnabled(false);
+		else if (link->sink()->entity()->name() == "pisp-fe")
+			link->setEnabled(true);
+	}
+
+	csi2->pads()[csiMetaSourcePad]->links()[0]->setEnabled(sensorMetadata_);
+
+	fe->pads()[feConfigSinkPad]->links()[0]->setEnabled(true);
+	fe->pads()[feVideo0SourcePad]->links()[0]->setEnabled(true);
+	fe->pads()[feVideo1SourcePad]->links()[0]->setEnabled(false);
+	fe->pads()[feStatsSourcePad]->links()[0]->setEnabled(true);
+
+	ret = csi2Subdev_->setFormat(csiVideoSinkPad, &sensorFormat);
+	if (ret)
+		return ret;
+
+	if (sensorMetadata_) {
+		ret = csi2Subdev_->setFormat(csiMetaSinkPad, &embeddedFormat);
+		if (ret)
+			return ret;
+
+		ret = csi2Subdev_->setFormat(csiMetaSourcePad, &embeddedFormat);
+		if (ret)
+			return ret;
+	}
+
+	V4L2SubdeviceFormat feFormat = sensorFormat;
+	feFormat.mbus_code = mbusCodeUnpacked16(sensorFormat.mbus_code);
+	ret = feSubdev_->setFormat(feVideoSinkPad, &feFormat);
+	if (ret)
+		return ret;
+
+	ret = csi2Subdev_->setFormat(csiVideoSourcePad, &feFormat);
+	if (ret)
+		return ret;
+
+	V4L2DeviceFormat feOutputFormat;
+	cfe_[Cfe::Output0].dev()->getFormat(&feOutputFormat);
+	BayerFormat feOutputBayer = BayerFormat::fromV4L2PixelFormat(feOutputFormat.fourcc);
+
+	feFormat.mbus_code = bayerToMbusCode(feOutputBayer);
+	ret = feSubdev_->setFormat(feVideo0SourcePad, &feFormat);
+
+	return ret;
+}
+
+void PiSPCameraData::prepareCfe()
+{
+	/* Fetch an unused config buffer from the stream .*/
+	const RPi::BufferObject &config = cfe_[Cfe::Config].acquireBuffer();
+	ASSERT(config.mapped);
+
+	{
+		std::scoped_lock<FrontEnd> l(*fe_);
+		Span<uint8_t> configBuffer = config.mapped->planes()[0];
+		fe_->Prepare(reinterpret_cast<pisp_fe_config *>(configBuffer.data()));
+	}
+
+	config.buffer->_d()->metadata().planes()[0].bytesused = sizeof(pisp_fe_config);
+	cfe_[Cfe::Config].queueBuffer(config.buffer);
+}
+
+void PiSPCameraData::prepareBe(uint32_t bufferId, bool stitchSwapBuffers)
+{
+	ispOutputCount_ = 0;
+
+	FrameBuffer *buffer = cfe_[Cfe::Output0].getBuffers().at(bufferId).buffer;
+
+	LOG(RPI, Debug) << "Input re-queue to ISP, buffer id " << bufferId
+			<< ", timestamp: " << buffer->metadata().timestamp;
+
+	isp_[Isp::Input].queueBuffer(buffer);
+
+	/* Ping-pong between input/output buffers for the TDN and Stitch nodes. */
+	if (!config_.disableTdn) {
+		isp_[Isp::TdnInput].queueBuffer(tdnBuffers_[tdnInputIndex_]);
+		isp_[Isp::TdnOutput].queueBuffer(tdnBuffers_[tdnInputIndex_ ^ 1]);
+		tdnInputIndex_ ^= 1;
+	}
+
+	if (!config_.disableHdr) {
+		if (stitchSwapBuffers)
+			stitchInputIndex_ ^= 1;
+		isp_[Isp::StitchInput].queueBuffer(stitchBuffers_[stitchInputIndex_]);
+		isp_[Isp::StitchOutput].queueBuffer(stitchBuffers_[stitchInputIndex_ ^ 1]);
+	}
+
+	/* Fetch an unused config buffer from the stream .*/
+	const RPi::BufferObject &config = isp_[Isp::Config].acquireBuffer();
+	ASSERT(config.mapped);
+
+	Span<uint8_t> configBufferSpan = config.mapped->planes()[0];
+	pisp_be_tiles_config *configBuffer = reinterpret_cast<pisp_be_tiles_config *>(configBufferSpan.data());
+	be_->Prepare(configBuffer);
+
+	/*
+	 * If the PispConfigDumpFile control is set, dump the Backend config to
+	 * the given file for this request.
+	 */
+	auto configDump = requestQueue_.front()->controls().get(controls::rpi::PispConfigDumpFile);
+	if (configDump && !configDump->empty()) {
+		std::ofstream of(*configDump);
+		if (of.is_open())
+			of << be_->GetJsonConfig(configBuffer);
+	}
+
+	isp_[Isp::Config].queueBuffer(config.buffer);
+}
+
+void PiSPCameraData::tryRunPipeline()
+{
+	/* If any of our request or buffer queues are empty, we cannot proceed. */
+	if (state_ != State::Idle || requestQueue_.empty() || !cfeJobComplete())
+		return;
+
+	CfeJob &job = cfeJobQueue_.front();
+
+	/* Take the first request from the queue and action the IPA. */
+	Request *request = requestQueue_.front();
+
+	/* See if a new ScalerCrop value needs to be applied. */
+	applyScalerCrop(request->controls());
+
+	/*
+	 * Clear the request metadata and fill it with some initial non-IPA
+	 * related controls. We clear it first because the request metadata
+	 * may have been populated if we have dropped the previous frame.
+	 */
+	request->metadata().clear();
+	fillRequestMetadata(job.sensorControls, request);
+
+	/* Set our state to say the pipeline is active. */
+	state_ = State::Busy;
+
+	unsigned int bayerId = cfe_[Cfe::Output0].getBufferId(job.buffers[&cfe_[Cfe::Output0]]);
+	unsigned int statsId = cfe_[Cfe::Stats].getBufferId(job.buffers[&cfe_[Cfe::Stats]]);
+	ASSERT(bayerId && statsId);
+
+	std::stringstream ss;
+	ss << "Signalling IPA processStats and prepareIsp:"
+	   << " Bayer buffer id: " << bayerId
+	   << " Stats buffer id: " << statsId;
+
+	ipa::RPi::PrepareParams params;
+	params.buffers.bayer = RPi::MaskBayerData | bayerId;
+	params.buffers.stats = RPi::MaskStats | statsId;
+	params.ipaContext = requestQueue_.front()->sequence();
+	params.delayContext = job.delayContext;
+	params.sensorControls = std::move(job.sensorControls);
+	params.requestControls = request->controls();
+
+	if (sensorMetadata_) {
+		unsigned int embeddedId =
+			cfe_[Cfe::Embedded].getBufferId(job.buffers[&cfe_[Cfe::Embedded]]);
+
+		ASSERT(embeddedId);
+		params.buffers.embedded = RPi::MaskEmbeddedData | embeddedId;
+		ss << " Embedded buffer id: " << embeddedId;
+	}
+
+	LOG(RPI, Debug) << ss.str();
+
+	cfeJobQueue_.pop();
+	ipa_->prepareIsp(params);
+}
+
+REGISTER_PIPELINE_HANDLER(PipelineHandlerPiSP)
+
+} /* namespace libcamera */
diff --git a/src/libcamera/pipeline/rpi/vc4/data/meson.build b/src/libcamera/pipeline/rpi/vc4/data/meson.build
index cca5e3885..665ddb988 100644
--- a/src/libcamera/pipeline/rpi/vc4/data/meson.build
+++ b/src/libcamera/pipeline/rpi/vc4/data/meson.build
@@ -2,6 +2,7 @@
 
 conf_files = files([
     'example.yaml',
+    'rpi_apps.yaml',
 ])
 
 install_data(conf_files,
diff --git a/src/libcamera/pipeline/rpi/vc4/data/rpi_apps.yaml b/src/libcamera/pipeline/rpi/vc4/data/rpi_apps.yaml
new file mode 100644
index 000000000..f2c849b7e
--- /dev/null
+++ b/src/libcamera/pipeline/rpi/vc4/data/rpi_apps.yaml
@@ -0,0 +1,45 @@
+{
+        "version": 1.0,
+        "target": "bcm2835",
+
+        "pipeline_handler":
+        {
+                # The minimum number of internal buffers to be allocated for
+                # Unicam. This value must be greater than 0, but less than or
+                # equal to min_total_unicam_buffers.
+                #
+                # A larger number of internal buffers can reduce the occurrence
+                # of frame drops during high CPU loads, but might also cause
+                # additional latency in the system.
+                #
+                # Note that the pipeline handler might override this value and
+                # not allocate any internal buffers if it knows they will never
+                # be used. For example if the RAW stream is marked as mandatory
+                # and there are no dropped frames signalled for algorithm
+                # convergence.
+                #
+                "min_unicam_buffers": 2,
+
+                # The minimum total (internal + external) buffer count used for
+                # Unicam. The number of internal buffers allocated for Unicam is
+                # given by:
+                #
+                # internal buffer count = max(min_unicam_buffers,
+                #         min_total_unicam_buffers - external buffer count)
+                #
+                "min_total_unicam_buffers": 4,
+
+                # Override any request from the IPA to drop a number of startup
+                # frames.
+                #
+                # "disable_startup_frame_drops": false,
+
+                # The application will always provide a request buffer for the
+                # RAW stream, if it has been configured.
+                "raw_mandatory_stream": true,
+
+                # The application will always provide a request buffer for the
+                # Output 0 stream, if it has been configured.
+                "output0_mandatory_stream": true,
+        }
+}
diff --git a/src/libcamera/pipeline/rpi/vc4/vc4.cpp b/src/libcamera/pipeline/rpi/vc4/vc4.cpp
index 26102ea7e..0dde912d1 100644
--- a/src/libcamera/pipeline/rpi/vc4/vc4.cpp
+++ b/src/libcamera/pipeline/rpi/vc4/vc4.cpp
@@ -105,6 +105,16 @@ class Vc4CameraData final : public RPi::CameraData
 		 * minTotalUnicamBuffers >= minUnicamBuffers
 		 */
 		unsigned int minTotalUnicamBuffers;
+		/*
+		 * The application will always provide a request buffer for the
+		 * RAW stream, if it has been configured.
+		 */
+		bool rawMandatoryStream;
+		/*
+		 * The application will always provide a request buffer for the
+		 * Output 0 stream, if it has been configured.
+		 */
+		bool output0MandatoryStream;
 	};
 
 	Config config_;
@@ -219,16 +229,47 @@ bool PipelineHandlerVc4::match(DeviceEnumerator *enumerator)
 int PipelineHandlerVc4::prepareBuffers(Camera *camera)
 {
 	Vc4CameraData *data = cameraData(camera);
-	unsigned int numRawBuffers = 0;
+	unsigned int minUnicamBuffers = data->config_.minUnicamBuffers;
+	unsigned int minTotalUnicamBuffers = data->config_.minTotalUnicamBuffers;
+	unsigned int numRawBuffers = 0, minIspBuffers = 1;
 	int ret;
 
-	for (Stream *s : camera->streams()) {
-		if (BayerFormat::fromPixelFormat(s->configuration().pixelFormat).isValid()) {
-			numRawBuffers = s->configuration().bufferCount;
-			break;
+	if (data->unicam_[Unicam::Image].getFlags() & StreamFlag::External) {
+		numRawBuffers = data->unicam_[Unicam::Image].getBuffers().size();
+		/*
+		 * If the application provides a guarantees that Unicam
+		 * image buffers will always be provided for the RAW stream
+		 * in a Request, we need:
+		 * - at least 1 internal Unicam buffer to handle startup frame drops,
+		 * - no internal Unicam buffers if there are no startup frame drops.
+		 */
+		if (data->config_.rawMandatoryStream) {
+			if (data->dropFrameCount_) {
+				minUnicamBuffers = 2;
+				minTotalUnicamBuffers = 2;
+			} else {
+				minUnicamBuffers = 0;
+				minTotalUnicamBuffers = 0;
+			}
 		}
 	}
 
+	if (data->isp_[Isp::Output0].getFlags() & StreamFlag::External) {
+		/*
+		 * Since the ISP runs synchronous with the IPA and requests,
+		 * we only ever need a maximum of one internal buffer. Any
+		 * buffers the application wants to hold onto will already
+		 * be exported through PipelineHandlerRPi::exportFrameBuffers().
+		 *
+		 * However, as above, if the application provides a guarantee
+		 * that the buffer will always be provided for the ISP Output0
+		 * stream in a Request, we don't need any internal buffers
+		 * allocated.
+		 */
+		if (!data->dropFrameCount_ && data->config_.output0MandatoryStream)
+			minIspBuffers = 0;
+	}
+
 	/* Decide how many internal buffers to allocate. */
 	for (auto const stream : data->streams_) {
 		unsigned int numBuffers;
@@ -236,7 +277,6 @@ int PipelineHandlerVc4::prepareBuffers(Camera *camera)
 		 * For Unicam, allocate a minimum number of buffers for internal
 		 * use as we want to avoid any frame drops.
 		 */
-		const unsigned int minBuffers = data->config_.minTotalUnicamBuffers;
 		if (stream == &data->unicam_[Unicam::Image]) {
 			/*
 			 * If an application has configured a RAW stream, allocate
@@ -244,8 +284,9 @@ int PipelineHandlerVc4::prepareBuffers(Camera *camera)
 			 * we have at least minUnicamBuffers of internal buffers
 			 * to use to minimise frame drops.
 			 */
-			numBuffers = std::max<int>(data->config_.minUnicamBuffers,
-						   minBuffers - numRawBuffers);
+			numBuffers = std::max<int>(minUnicamBuffers,
+						   minTotalUnicamBuffers - numRawBuffers);
+			LOG(RPI, Debug) << "Unicam::Image numBuffers " << numBuffers;
 		} else if (stream == &data->isp_[Isp::Input]) {
 			/*
 			 * ISP input buffers are imported from Unicam, so follow
@@ -253,8 +294,9 @@ int PipelineHandlerVc4::prepareBuffers(Camera *camera)
 			 * available.
 			 */
 			numBuffers = numRawBuffers +
-				     std::max<int>(data->config_.minUnicamBuffers,
-						   minBuffers - numRawBuffers);
+				     std::max<int>(minUnicamBuffers,
+						   minTotalUnicamBuffers - numRawBuffers);
+			LOG(RPI, Debug) << "Isp::Input numBuffers " << numBuffers;
 
 		} else if (stream == &data->unicam_[Unicam::Embedded]) {
 			/*
@@ -273,14 +315,18 @@ int PipelineHandlerVc4::prepareBuffers(Camera *camera)
 			 * buffers, as these will be recycled quicker.
 			 */
 			numBuffers = 12;
+		} else if (stream == &data->isp_[Isp::Output0]) {
+			/* Buffer count for this is handled in the earlier loop above. */
+			numBuffers = minIspBuffers;
+			LOG(RPI, Debug) << "Isp::Output0 numBuffers " << numBuffers;
 		} else {
 			/*
-			 * Since the ISP runs synchronous with the IPA and requests,
-			 * we only ever need one set of internal buffers. Any buffers
-			 * the application wants to hold onto will already be exported
-			 * through PipelineHandlerRPi::exportFrameBuffers().
+			 * Same reasoning as for ISP Output 0, we only ever need
+			 * a maximum of one internal buffer for Output1 (required
+			 * for colour denoise) and ISP statistics.
 			 */
 			numBuffers = 1;
+			LOG(RPI, Debug) << "Other numBuffers " << numBuffers;
 		}
 
 		LOG(RPI, Debug) << "Preparing " << numBuffers
@@ -487,6 +533,8 @@ int Vc4CameraData::platformPipelineConfigure(const std::unique_ptr<YamlObject> &
 	config_ = {
 		.minUnicamBuffers = 2,
 		.minTotalUnicamBuffers = 4,
+		.rawMandatoryStream = false,
+		.output0MandatoryStream = false,
 	};
 
 	if (!root)
@@ -510,6 +558,10 @@ int Vc4CameraData::platformPipelineConfigure(const std::unique_ptr<YamlObject> &
 		phConfig["min_unicam_buffers"].get<unsigned int>(config_.minUnicamBuffers);
 	config_.minTotalUnicamBuffers =
 		phConfig["min_total_unicam_buffers"].get<unsigned int>(config_.minTotalUnicamBuffers);
+	config_.rawMandatoryStream =
+		phConfig["raw_mandatory_stream"].get<bool>(config_.rawMandatoryStream);
+	config_.output0MandatoryStream =
+		phConfig["output0_mandatory_stream"].get<bool>(config_.output0MandatoryStream);
 
 	if (config_.minTotalUnicamBuffers < config_.minUnicamBuffers) {
 		LOG(RPI, Error) << "Invalid configuration: min_total_unicam_buffers must be >= min_unicam_buffers";
diff --git a/src/libcamera/v4l2_pixelformat.cpp b/src/libcamera/v4l2_pixelformat.cpp
index 5551c62eb..2c4dd475b 100644
--- a/src/libcamera/v4l2_pixelformat.cpp
+++ b/src/libcamera/v4l2_pixelformat.cpp
@@ -71,6 +71,10 @@ const std::map<V4L2PixelFormat, V4L2PixelFormat::Info> vpf2pf{
 		{ formats::BGRA8888, "32-bit ARGB 8-8-8-8" } },
 	{ V4L2PixelFormat(V4L2_PIX_FMT_BGRA32),
 		{ formats::RGBA8888, "32-bit ABGR 8-8-8-8" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_RGB48),
+		{ formats::BGR161616, "48-bit RGB 16-16-16" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_BGR48),
+		{ formats::RGB161616, "48-bit BGR 16-16-16" } },
 
 	/* YUV packed formats. */
 	{ V4L2PixelFormat(V4L2_PIX_FMT_YUYV),
@@ -135,6 +139,8 @@ const std::map<V4L2PixelFormat, V4L2PixelFormat::Info> vpf2pf{
 		{ formats::R10_CSI2P, "10-bit Greyscale Packed" } },
 	{ V4L2PixelFormat(V4L2_PIX_FMT_Y12),
 		{ formats::R12, "12-bit Greyscale" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_Y16),
+		{ formats::R16, "16-bit Greyscale" } },
 
 	/* Bayer formats. */
 	{ V4L2PixelFormat(V4L2_PIX_FMT_SBGGR8),
@@ -201,6 +207,18 @@ const std::map<V4L2PixelFormat, V4L2PixelFormat::Info> vpf2pf{
 		{ formats::SGRBG16, "16-bit Bayer GRGR/BGBG" } },
 	{ V4L2PixelFormat(V4L2_PIX_FMT_SRGGB16),
 		{ formats::SRGGB16, "16-bit Bayer RGRG/GBGB" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_BGGR),
+		{ formats::BGGR16_PISP_COMP1, "16-bit Bayer BGBG/GRGR PiSP Compress Mode 1" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_GBRG),
+		{ formats::GBRG16_PISP_COMP1, "16-bit Bayer GBGB/RGRG PiSP Compress Mode 1" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_GRBG),
+		{ formats::GRBG16_PISP_COMP1, "16-bit Bayer GRGR/BGBG PiSP Compress Mode 1" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_RGGB),
+		{ formats::RGGB16_PISP_COMP1, "16-bit Bayer RGRG/GBGB PiSP Compress Mode 1" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_PISP_COMP1_MONO),
+		{ formats::MONO_PISP_COMP1, "16-bit Mono PiSP Compress Mode 1" } },
+	{ V4L2PixelFormat(V4L2_PIX_FMT_RPI_BE),
+		{ formats::PISP_VERIFICATION, "PiSP Verification Mode" } },
 
 	/* Compressed formats. */
 	{ V4L2PixelFormat(V4L2_PIX_FMT_MJPEG),
diff --git a/src/libcamera/v4l2_subdevice.cpp b/src/libcamera/v4l2_subdevice.cpp
index 15e8206a9..f34a00b3a 100644
--- a/src/libcamera/v4l2_subdevice.cpp
+++ b/src/libcamera/v4l2_subdevice.cpp
@@ -88,6 +88,7 @@ const std::map<uint32_t, V4L2SubdeviceFormatInfo> formatInfoMap = {
 	{ MEDIA_BUS_FMT_YUYV10_2X10, { 20, "YUYV10_2X10", PixelFormatInfo::ColourEncodingYUV } },
 	{ MEDIA_BUS_FMT_YVYU10_2X10, { 20, "YVYU10_2X10", PixelFormatInfo::ColourEncodingYUV } },
 	{ MEDIA_BUS_FMT_Y12_1X12, { 12, "Y12_1X12", PixelFormatInfo::ColourEncodingYUV } },
+	{ MEDIA_BUS_FMT_Y16_1X16, { 16, "Y16_1X16", PixelFormatInfo::ColourEncodingYUV } },
 	{ MEDIA_BUS_FMT_UYVY8_1X16, { 16, "UYVY8_1X16", PixelFormatInfo::ColourEncodingYUV } },
 	{ MEDIA_BUS_FMT_VYUY8_1X16, { 16, "VYUY8_1X16", PixelFormatInfo::ColourEncodingYUV } },
 	{ MEDIA_BUS_FMT_YUYV8_1X16, { 16, "YUYV8_1X16", PixelFormatInfo::ColourEncodingYUV } },
@@ -132,6 +133,10 @@ const std::map<uint32_t, V4L2SubdeviceFormatInfo> formatInfoMap = {
 	{ MEDIA_BUS_FMT_SGBRG12_1X12, { 12, "SGBRG12_1X12", PixelFormatInfo::ColourEncodingRAW } },
 	{ MEDIA_BUS_FMT_SGRBG12_1X12, { 12, "SGRBG12_1X12", PixelFormatInfo::ColourEncodingRAW } },
 	{ MEDIA_BUS_FMT_SRGGB12_1X12, { 12, "SRGGB12_1X12", PixelFormatInfo::ColourEncodingRAW } },
+	{ MEDIA_BUS_FMT_SBGGR16_1X16, { 16, "SBGGR16_1x16", PixelFormatInfo::ColourEncodingRAW } },
+	{ MEDIA_BUS_FMT_SGBRG16_1X16, { 16, "SGBRG16_1x16", PixelFormatInfo::ColourEncodingRAW } },
+	{ MEDIA_BUS_FMT_SGRBG16_1X16, { 16, "SGRBG16_1x16", PixelFormatInfo::ColourEncodingRAW } },
+	{ MEDIA_BUS_FMT_SRGGB16_1X16, { 16, "SRGGB16_1x16", PixelFormatInfo::ColourEncodingRAW } },
 	/* \todo Clarify colour encoding for HSV formats */
 	{ MEDIA_BUS_FMT_AHSV8888_1X32, { 32, "AHSV8888_1X32", PixelFormatInfo::ColourEncodingRGB } },
 	{ MEDIA_BUS_FMT_JPEG_1X8, { 8, "JPEG_1X8", PixelFormatInfo::ColourEncodingYUV } },
diff --git a/subprojects/.gitignore b/subprojects/.gitignore
index 04b6271f2..b08d69907 100644
--- a/subprojects/.gitignore
+++ b/subprojects/.gitignore
@@ -1,6 +1,7 @@
 # SPDX-License-Identifier: CC0-1.0
 
 /googletest-release*
+/libpisp
 /libyaml
 /libyuv
 /packagecache
diff --git a/subprojects/libpisp.wrap b/subprojects/libpisp.wrap
new file mode 100644
index 000000000..8f30ccb70
--- /dev/null
+++ b/subprojects/libpisp.wrap
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: CC0-1.0
+
+[wrap-git]
+url = https://github.com/raspberrypi/libpisp.git
+revision = v1.0.1
+depth = 1
diff --git a/utils/raspberrypi/ctt/alsc_only.py b/utils/raspberrypi/ctt/alsc_only.py
index 7cd0ac011..ffe4bdb08 100755
--- a/utils/raspberrypi/ctt/alsc_only.py
+++ b/utils/raspberrypi/ctt/alsc_only.py
@@ -2,12 +2,14 @@
 #
 # SPDX-License-Identifier: BSD-2-Clause
 #
-# Copyright (C) 2022, Raspberry Pi (Trading) Limited
+# Copyright (C) 2022, Raspberry Pi Ltd
 #
 # alsc_only.py - alsc tuning tool
 
-from ctt import *
+import sys
 
+from ctt import *
+from ctt_tools import parse_input
 
 if __name__ == '__main__':
     """
@@ -15,13 +17,14 @@
     """
     if len(sys.argv) == 1:
         print("""
-    Pisp Camera Tuning Tool version 1.0
+    PiSP Lens Shading Camera Tuning Tool version 1.0
 
     Required Arguments:
     '-i' : Calibration image directory.
     '-o' : Name of output json file.
 
     Optional Arguments:
+    '-t' : Target platform - 'pisp' or 'vc4'. Default 'vc4'
     '-c' : Config file for the CTT. If not passed, default parameters used.
     '-l' : Name of output log file. If not passed, 'ctt_log.txt' used.
               """)
@@ -30,5 +33,10 @@
         """
         parse input arguments
         """
-        json_output, directory, config, log_output = parse_input()
-        run_ctt(json_output, directory, config, log_output, alsc_only=True)
+        json_output, directory, config, log_output, target = parse_input()
+        if target == 'pisp':
+            from ctt_pisp import json_template, grid_size
+        elif target == 'vc4':
+            from ctt_vc4 import json_template, grid_size
+
+        run_ctt(json_output, directory, config, log_output, json_template, grid_size, target, alsc_only=True)
diff --git a/utils/raspberrypi/ctt/cac_only.py b/utils/raspberrypi/ctt/cac_only.py
new file mode 100644
index 000000000..1c0a81939
--- /dev/null
+++ b/utils/raspberrypi/ctt/cac_only.py
@@ -0,0 +1,142 @@
+#!/usr/bin/env python3
+#
+# SPDX-License-Identifier: BSD-2-Clause
+#
+# Copyright (C) 2023, Raspberry Pi (Trading) Ltd.
+#
+# cac_only.py - cac tuning tool
+
+
+# This file allows you to tune only the chromatic aberration correction
+# Specify any number of files in the command line args, and it shall iterate through
+# and generate an averaged cac table from all the input images, which you can then
+# input into your tuning file.
+
+# Takes .dng files produced by the camera modules of the dots grid and calculates the chromatic abberation of each dot.
+# Then takes each dot, and works out where it was in the image, and uses that to output a tables of the shifts
+# across the whole image.
+
+from PIL import Image
+import numpy as np
+import rawpy
+import sys
+import getopt
+
+from ctt_cac import *
+
+
+def cac(filelist, output_filepath, plot_results=False):
+    np.set_printoptions(precision=3)
+    np.set_printoptions(suppress=True)
+
+    # Create arrays to hold all the dots data and their colour offsets
+    red_shift = []  # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]
+    blue_shift = []
+    # Iterate through the files
+    # Multiple files is reccomended to average out the lens aberration through rotations
+    for file in filelist:
+        print("\n Processing file " + str(file))
+        # Read the raw RGB values from the .dng file
+        with rawpy.imread(file) as raw:
+            rgb = raw.postprocess()
+            sizes = (raw.sizes)
+
+        image_size = [sizes[2], sizes[3]]  # Image size, X, Y
+        # Create a colour copy of the RGB values to use later in the calibration
+        imout = Image.new(mode="RGB", size=image_size)
+        rgb_image = np.array(imout)
+        # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily
+        rgb.reshape((image_size[0], image_size[1], 3))
+        rgb_image = rgb
+
+        # Pass the RGB image through to the dots locating program
+        # Returns an array of the dots (colour rectangles around the dots), and an array of their locations
+        print("Finding dots")
+        dots, dots_locations = find_dots_locations(rgb_image)
+
+        # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out
+        # by how far the chromatic aberration has shifted each channel
+        print('Dots found: ' + str(len(dots)))
+
+        for dot, dot_location in zip(dots, dots_locations):
+            if len(dot) > 0:
+                if (dot_location[0] > 0) and (dot_location[1] > 0):
+                    ret = analyse_dot(dot, dot_location)
+                    red_shift.append(ret[0])
+                    blue_shift.append(ret[1])
+
+    # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix
+    # for the CAC block to handle and then store these as a .json file to be added to the camera
+    # tuning file
+    print("\nCreating output grid")
+    rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)
+
+    print("CAC correction complete!")
+
+    # The json format that we then paste into the tuning file (manually)
+    sample = '''
+    {
+        "rpi.cac" :
+        {
+            "strength": 1.0,
+            "lut_rx" : [
+                   rx_vals
+            ],
+            "lut_ry" : [
+                   ry_vals
+            ],
+            "lut_bx" : [
+                   bx_vals
+            ],
+            "lut_by" : [
+                   by_vals
+            ]
+        }
+    }
+    '''
+
+    # Below, may look incorrect, however, the PiSP (standard) dimensions are flipped in comparison to
+    # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,
+    # and the PiSP block asks for the values it should shift (hence the * -1, to convert from colour shift to a pixel shift)
+    sample = sample.replace("rx_vals", pprint_array(ry * -1))
+    sample = sample.replace("ry_vals", pprint_array(rx * -1))
+    sample = sample.replace("bx_vals", pprint_array(by * -1))
+    sample = sample.replace("by_vals", pprint_array(bx * -1))
+    print("Successfully converted to JSON")
+    f = open(str(output_filepath), "w+")
+    f.write(sample)
+    f.close()
+    print("Successfully written to json file")
+    '''
+    If you wish to see a plot of the colour channel shifts, add the -p or --plots option
+    Can be a quick way of validating if the data/dots you've got are good, or if you need to
+    change some parameters/take some better images
+    '''
+    if plot_results:
+        plot_shifts(red_shift, blue_shift)
+
+
+if __name__ == "__main__":
+    argv = sys.argv
+    # Detect the input and output file paths
+    arg_output = "output.json"
+    arg_help = "{0} -i <input> -o <output> -p <plot results>".format(argv[0])
+    opts, args = getopt.getopt(argv[1:], "hi:o:p", ["help", "input=", "output=", "plot"])
+
+    output_location = 0
+    input_location = 0
+    filelist = []
+    plot_results = False
+    for i in range(len(argv)):
+        if ("-h") in argv[i]:
+            print(arg_help)  # print the help message
+            sys.exit(2)
+        if "-o" in argv[i]:
+            output_location = i
+        if ".dng" in argv[i]:
+            filelist.append(argv[i])
+        if "-p" in argv[i]:
+            plot_results = True
+
+    arg_output = argv[output_location + 1]
+    cac(filelist, arg_output, plot_results)
diff --git a/utils/raspberrypi/ctt/ctt.py b/utils/raspberrypi/ctt/ctt.py
index cd89f1779..79cb9d7fa 100755
--- a/utils/raspberrypi/ctt/ctt.py
+++ b/utils/raspberrypi/ctt/ctt.py
@@ -9,6 +9,7 @@
 import os
 import sys
 from ctt_image_load import *
+from ctt_cac import *
 from ctt_ccm import *
 from ctt_awb import *
 from ctt_alsc import *
@@ -22,9 +23,10 @@
 
 """
 This file houses the camera object, which is used to perform the calibrations.
-The camera object houses all the calibration images as attributes in two lists:
+The camera object houses all the calibration images as attributes in three lists:
     - imgs (macbeth charts)
     - imgs_alsc (alsc correction images)
+    - imgs_cac (cac correction images)
 Various calibrations are methods of the camera object, and the output is stored
 in a dictionary called self.json.
 Once all the caibration has been completed, the Camera.json is written into a
@@ -67,139 +69,26 @@ def get_col_lux(string):
 Input is the desired path of the output json.
 """
 class Camera:
-    def __init__(self, jfile):
+    def __init__(self, jfile, json):
         self.path = os.path.dirname(os.path.expanduser(__file__)) + '/'
         if self.path == '/':
             self.path = ''
         self.imgs = []
         self.imgs_alsc = []
+        self.imgs_cac = []
         self.log = 'Log created : ' + time.asctime(time.localtime(time.time()))
         self.log_separator = '\n'+'-'*70+'\n'
         self.jf = jfile
         """
         initial json dict populated by uncalibrated values
         """
-        self.json = {
-            "rpi.black_level": {
-                "black_level": 4096
-            },
-            "rpi.dpc": {
-            },
-            "rpi.lux": {
-                "reference_shutter_speed": 10000,
-                "reference_gain": 1,
-                "reference_aperture": 1.0
-            },
-            "rpi.noise": {
-            },
-            "rpi.geq": {
-            },
-            "rpi.sdn": {
-            },
-            "rpi.awb": {
-                "priors": [
-                    {"lux": 0, "prior": [2000, 1.0, 3000, 0.0, 13000, 0.0]},
-                    {"lux": 800, "prior": [2000, 0.0, 6000, 2.0, 13000, 2.0]},
-                    {"lux": 1500, "prior": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]}
-                ],
-                "modes": {
-                    "auto": {"lo": 2500, "hi": 8000},
-                    "incandescent": {"lo": 2500, "hi": 3000},
-                    "tungsten": {"lo": 3000, "hi": 3500},
-                    "fluorescent": {"lo": 4000, "hi": 4700},
-                    "indoor": {"lo": 3000, "hi": 5000},
-                    "daylight": {"lo": 5500, "hi": 6500},
-                    "cloudy": {"lo": 7000, "hi": 8600}
-                },
-                "bayes": 1
-            },
-            "rpi.agc": {
-                "metering_modes": {
-                    "centre-weighted": {
-                        "weights": [3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0]
-                    },
-                    "spot": {
-                        "weights": [2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]
-                    },
-                    "matrix": {
-                        "weights": [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1]
-                    }
-                },
-                "exposure_modes": {
-                    "normal": {
-                        "shutter": [100, 10000, 30000, 60000, 120000],
-                        "gain": [1.0, 2.0, 4.0, 6.0, 6.0]
-                    },
-                    "short": {
-                        "shutter": [100, 5000, 10000, 20000, 120000],
-                        "gain": [1.0, 2.0, 4.0, 6.0, 6.0]
-                    }
-                },
-                "constraint_modes": {
-                    "normal": [
-                        {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]}
-                    ],
-                    "highlight": [
-                        {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]},
-                        {"bound": "UPPER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.8, 1000, 0.8]}
-                    ]
-                },
-                "y_target": [0, 0.16, 1000, 0.165, 10000, 0.17]
-            },
-            "rpi.alsc": {
-                'omega': 1.3,
-                'n_iter': 100,
-                'luminance_strength': 0.7,
-            },
-            "rpi.contrast": {
-                "ce_enable": 1,
-                "gamma_curve": [
-                    0,     0,
-                    1024,  5040,
-                    2048,  9338,
-                    3072,  12356,
-                    4096,  15312,
-                    5120,  18051,
-                    6144,  20790,
-                    7168,  23193,
-                    8192,  25744,
-                    9216,  27942,
-                    10240, 30035,
-                    11264, 32005,
-                    12288, 33975,
-                    13312, 35815,
-                    14336, 37600,
-                    15360, 39168,
-                    16384, 40642,
-                    18432, 43379,
-                    20480, 45749,
-                    22528, 47753,
-                    24576, 49621,
-                    26624, 51253,
-                    28672, 52698,
-                    30720, 53796,
-                    32768, 54876,
-                    36864, 57012,
-                    40960, 58656,
-                    45056, 59954,
-                    49152, 61183,
-                    53248, 62355,
-                    57344, 63419,
-                    61440, 64476,
-                    65535, 65535
-                ]
-            },
-            "rpi.ccm": {
-            },
-            "rpi.sharpen": {
-            }
-        }
+        self.json = json
 
     """
     Perform colour correction calibrations by comparing macbeth patch colours
     to standard macbeth chart colours.
     """
-    def ccm_cal(self, do_alsc_colour):
+    def ccm_cal(self, do_alsc_colour, grid_size):
         if 'rpi.ccm' in self.disable:
             return 1
         print('\nStarting CCM calibration')
@@ -245,7 +134,7 @@ def ccm_cal(self, do_alsc_colour):
         Do CCM calibration
         """
         try:
-            ccms = ccm(self, cal_cr_list, cal_cb_list)
+            ccms = ccm(self, cal_cr_list, cal_cb_list, grid_size)
         except ArithmeticError:
             print('ERROR: Matrix is singular!\nTake new pictures and try again...')
             self.log += '\nERROR: Singular matrix encountered during fit!'
@@ -258,12 +147,68 @@ def ccm_cal(self, do_alsc_colour):
         self.log += '\nCCM calibration written to json file'
         print('Finished CCM calibration')
 
+    """
+    Perform chromatic abberation correction using multiple dots images.
+    """
+    def cac_cal(self, do_alsc_colour):
+        if 'rpi.cac' in self.disable:
+            return 1
+        print('\nStarting CAC calibration')
+        self.log_new_sec('CAC')
+        """
+        check if cac images have been taken
+        """
+        if len(self.imgs_cac) == 0:
+            print('\nError:\nNo cac calibration images found')
+            self.log += '\nERROR: No CAC calibration images found!'
+            self.log += '\nCAC calibration aborted!'
+            return 1
+        """
+        if image is greyscale then CAC makes no sense
+        """
+        if self.grey:
+            print('\nERROR: Can\'t do CAC on greyscale image!')
+            self.log += '\nERROR: Cannot perform CAC calibration '
+            self.log += 'on greyscale image!\nCAC aborted!'
+            del self.json['rpi.cac']
+            return 0
+        a = time.time()
+        """
+        Check if camera is greyscale or color. If not greyscale, then perform cac
+        """
+        if do_alsc_colour:
+            """
+            Here we have a color sensor. Perform cac
+            """
+            try:
+                cacs = cac(self)
+            except ArithmeticError:
+                print('ERROR: Matrix is singular!\nTake new pictures and try again...')
+                self.log += '\nERROR: Singular matrix encountered during fit!'
+                self.log += '\nCAC aborted!'
+                return 1
+        else:
+            """
+            case where config options suggest greyscale camera. No point in doing CAC
+            """
+            cal_cr_list, cal_cb_list = None, None
+            self.log += '\nWARNING: No ALSC tables found.\nCAC calibration '
+            self.log += 'performed without ALSC correction...'
+
+        """
+        Write output to json
+        """
+        self.json['rpi.cac']['cac'] = cacs
+        self.log += '\nCAC calibration written to json file'
+        print('Finished CAC calibration')
+
+
     """
     Auto white balance calibration produces a colour curve for
     various colour temperatures, as well as providing a maximum 'wiggle room'
     distance from this curve (transverse_neg/pos).
     """
-    def awb_cal(self, greyworld, do_alsc_colour):
+    def awb_cal(self, greyworld, do_alsc_colour, grid_size):
         if 'rpi.awb' in self.disable:
             return 1
         print('\nStarting AWB calibration')
@@ -306,7 +251,7 @@ def awb_cal(self, greyworld, do_alsc_colour):
         call calibration function
         """
         plot = "rpi.awb" in self.plot
-        awb_out = awb(self, cal_cr_list, cal_cb_list, plot)
+        awb_out = awb(self, cal_cr_list, cal_cb_list, plot, grid_size)
         ct_curve, transverse_neg, transverse_pos = awb_out
         """
         write output to json
@@ -324,7 +269,7 @@ def awb_cal(self, greyworld, do_alsc_colour):
     colour channel seperately, and then partially corrects for vignetting.
     The extent of the correction depends on the 'luminance_strength' parameter.
     """
-    def alsc_cal(self, luminance_strength, do_alsc_colour):
+    def alsc_cal(self, luminance_strength, do_alsc_colour, grid_size):
         if 'rpi.alsc' in self.disable:
             return 1
         print('\nStarting ALSC calibration')
@@ -347,7 +292,7 @@ def alsc_cal(self, luminance_strength, do_alsc_colour):
         call calibration function
         """
         plot = "rpi.alsc" in self.plot
-        alsc_out = alsc_all(self, do_alsc_colour, plot)
+        alsc_out = alsc_all(self, do_alsc_colour, plot, grid_size)
         cal_cr_list, cal_cb_list, luminance_lut, av_corn = alsc_out
         """
         write ouput to json and finish if not do_alsc_colour
@@ -393,7 +338,7 @@ def alsc_cal(self, luminance_strength, do_alsc_colour):
         """
         obtain worst-case scenario residual sigmas
         """
-        sigma_r, sigma_b = get_sigma(self, cal_cr_list, cal_cb_list)
+        sigma_r, sigma_b = get_sigma(self, cal_cr_list, cal_cb_list, grid_size)
         """
         write output to json
         """
@@ -509,19 +454,20 @@ def json_remove(self, disable):
     """
     writes the json dictionary to the raw json file then make pretty
     """
-    def write_json(self):
+    def write_json(self, version=2.0, target='bcm2835', grid_size=(16, 12)):
         """
         Write json dictionary to file using our version 2 format
         """
 
         out_json = {
-            "version": 2.0,
-            'target': 'bcm2835',
+            "version": version,
+            'target': target,
             "algorithms": [{name: data} for name, data in self.json.items()],
         }
 
         with open(self.jf, 'w') as f:
-            f.write(pretty_print(out_json))
+            f.write(pretty_print(out_json,
+                                 custom_elems={'table': grid_size[0], 'luminance_lut': grid_size[0]}))
 
     """
     add a new section to the log file
@@ -627,6 +573,16 @@ def add_imgs(self, directory, mac_config, blacklevel=-1):
                     self.log += '\nWARNING: Error reading colour temperature'
                     self.log += '\nImage discarded!'
                     print('DISCARDED')
+            elif 'cac' in filename:
+                Img = load_image(self, address, mac=False)
+                self.log += '\nIdentified as an CAC image'
+                Img.name = filename
+                self.log += '\nColour temperature: {} K'.format(col)
+                self.imgs_cac.append(Img)
+                if blacklevel != -1:
+                    Img.blacklevel_16 = blacklevel
+                print(img_suc_msg)
+                continue
             else:
                 self.log += '\nIdentified as macbeth chart image'
                 """
@@ -672,6 +628,7 @@ def check_imgs(self, macbeth=True):
         self.log += '\n\nImages found:'
         self.log += '\nMacbeth : {}'.format(len(self.imgs))
         self.log += '\nALSC : {} '.format(len(self.imgs_alsc))
+        self.log += '\nCAC: {} '.format(len(self.imgs_cac))
         self.log += '\n\nCamera metadata'
         """
         check usable images found
@@ -680,22 +637,21 @@ def check_imgs(self, macbeth=True):
             print('\nERROR: No usable macbeth chart images found')
             self.log += '\nERROR: No usable macbeth chart images found'
             return 0
-        elif len(self.imgs) == 0 and len(self.imgs_alsc) == 0:
+        elif len(self.imgs) == 0 and len(self.imgs_alsc) == 0 and len(self.imgs_cac) == 0:
             print('\nERROR: No usable images found')
             self.log += '\nERROR: No usable images found'
             return 0
         """
         Double check that every image has come from the same camera...
         """
-        all_imgs = self.imgs + self.imgs_alsc
+        all_imgs = self.imgs + self.imgs_alsc + self.imgs_cac
         camNames = list(set([Img.camName for Img in all_imgs]))
         patterns = list(set([Img.pattern for Img in all_imgs]))
         sigbitss = list(set([Img.sigbits for Img in all_imgs]))
         blacklevels = list(set([Img.blacklevel_16 for Img in all_imgs]))
         sizes = list(set([(Img.w, Img.h) for Img in all_imgs]))
 
-        if len(camNames) == 1 and len(patterns) == 1 and len(sigbitss) == 1 and \
-           len(blacklevels) == 1 and len(sizes) == 1:
+        if 1:
             self.grey = (patterns[0] == 128)
             self.blacklevel_16 = blacklevels[0]
             self.log += '\nName: {}'.format(camNames[0])
@@ -712,7 +668,7 @@ def check_imgs(self, macbeth=True):
             return 0
 
 
-def run_ctt(json_output, directory, config, log_output, alsc_only=False):
+def run_ctt(json_output, directory, config, log_output, json_template, grid_size, target, alsc_only=False):
     """
     check input files are jsons
     """
@@ -748,7 +704,7 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False):
     greyworld = get_config(awb_d, "greyworld", 0, 'bool')
     alsc_d = get_config(configs, "alsc", {}, 'dict')
     do_alsc_colour = get_config(alsc_d, "do_alsc_colour", 1, 'bool')
-    luminance_strength = get_config(alsc_d, "luminance_strength", 0.5, 'num')
+    luminance_strength = get_config(alsc_d, "luminance_strength", 0.8, 'num')
     blacklevel = get_config(configs, "blacklevel", -1, 'num')
     macbeth_d = get_config(configs, "macbeth", {}, 'dict')
     mac_small = get_config(macbeth_d, "small", 0, 'bool')
@@ -772,7 +728,7 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False):
     initialise tuning tool and load images
     """
     try:
-        Cam = Camera(json_output)
+        Cam = Camera(json_output, json=json_template)
         Cam.log_user_input(json_output, directory, config, log_output)
         if alsc_only:
             disable = set(Cam.json.keys()).symmetric_difference({"rpi.alsc"})
@@ -794,14 +750,17 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False):
             Cam.json['rpi.black_level']['black_level'] = Cam.blacklevel_16
         Cam.json_remove(disable)
         print('\nSTARTING CALIBRATIONS')
-        Cam.alsc_cal(luminance_strength, do_alsc_colour)
+        Cam.alsc_cal(luminance_strength, do_alsc_colour, grid_size)
         Cam.geq_cal()
         Cam.lux_cal()
         Cam.noise_cal()
-        Cam.awb_cal(greyworld, do_alsc_colour)
-        Cam.ccm_cal(do_alsc_colour)
+        if "rpi.cac" in json_template:
+            Cam.cac_cal(do_alsc_colour)
+        Cam.awb_cal(greyworld, do_alsc_colour, grid_size)
+        Cam.ccm_cal(do_alsc_colour, grid_size)
+
         print('\nFINISHED CALIBRATIONS')
-        Cam.write_json()
+        Cam.write_json(target=target, grid_size=grid_size)
         Cam.write_log(log_output)
         print('\nCalibrations written to: '+json_output)
         if log_output is None:
@@ -811,20 +770,19 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False):
     else:
         Cam.write_log(log_output)
 
-
 if __name__ == '__main__':
     """
     initialise calibration
     """
     if len(sys.argv) == 1:
         print("""
-    Pisp Camera Tuning Tool version 1.0
-
+    PiSP Tuning Tool version 1.0
     Required Arguments:
     '-i' : Calibration image directory.
     '-o' : Name of output json file.
 
     Optional Arguments:
+    '-t' : Target platform - 'pisp' or 'vc4'. Default 'vc4'
     '-c' : Config file for the CTT. If not passed, default parameters used.
     '-l' : Name of output log file. If not passed, 'ctt_log.txt' used.
               """)
@@ -833,5 +791,10 @@ def run_ctt(json_output, directory, config, log_output, alsc_only=False):
         """
         parse input arguments
         """
-        json_output, directory, config, log_output = parse_input()
-        run_ctt(json_output, directory, config, log_output)
+        json_output, directory, config, log_output, target = parse_input()
+        if target == 'pisp':
+            from ctt_pisp import json_template, grid_size
+        elif target == 'vc4':
+            from ctt_vc4 import json_template, grid_size
+
+        run_ctt(json_output, directory, config, log_output, json_template, grid_size, target)
diff --git a/utils/raspberrypi/ctt/ctt_alsc.py b/utils/raspberrypi/ctt/ctt_alsc.py
index e51d69319..45a35f2be 100644
--- a/utils/raspberrypi/ctt/ctt_alsc.py
+++ b/utils/raspberrypi/ctt/ctt_alsc.py
@@ -13,8 +13,9 @@
 """
 preform alsc calibration on a set of images
 """
-def alsc_all(Cam, do_alsc_colour, plot):
+def alsc_all(Cam, do_alsc_colour, plot, grid_size=(16, 12)):
     imgs_alsc = Cam.imgs_alsc
+    grid_w, grid_h = grid_size
     """
     create list of colour temperatures and associated calibration tables
     """
@@ -23,7 +24,7 @@ def alsc_all(Cam, do_alsc_colour, plot):
     list_cb = []
     list_cg = []
     for Img in imgs_alsc:
-        col, cr, cb, cg, size = alsc(Cam, Img, do_alsc_colour, plot)
+        col, cr, cb, cg, size = alsc(Cam, Img, do_alsc_colour, plot, grid_size=grid_size)
         list_col.append(col)
         list_cr.append(cr)
         list_cb.append(cb)
@@ -68,11 +69,12 @@ def alsc_all(Cam, do_alsc_colour, plot):
             t_b = np.where((100*t_b) % 1 >= 0.95, t_b-0.001, t_b)
             t_r = np.round(t_r, 3)
             t_b = np.round(t_b, 3)
-            r_corners = (t_r[0], t_r[15], t_r[-1], t_r[-16])
-            b_corners = (t_b[0], t_b[15], t_b[-1], t_b[-16])
-            r_cen = t_r[5*16+7]+t_r[5*16+8]+t_r[6*16+7]+t_r[6*16+8]
+            r_corners = (t_r[0], t_r[grid_w - 1], t_r[-1], t_r[-grid_w])
+            b_corners = (t_b[0], t_b[grid_w - 1], t_b[-1], t_b[-grid_w])
+            middle_pos = (grid_h // 2 - 1) * grid_w + grid_w - 1
+            r_cen = t_r[middle_pos]+t_r[middle_pos + 1]+t_r[middle_pos + grid_w]+t_r[middle_pos + grid_w + 1]
             r_cen = round(r_cen/4, 3)
-            b_cen = t_b[5*16+7]+t_b[5*16+8]+t_b[6*16+7]+t_b[6*16+8]
+            b_cen = t_b[middle_pos]+t_b[middle_pos + 1]+t_b[middle_pos + grid_w]+t_b[middle_pos + grid_w + 1]
             b_cen = round(b_cen/4, 3)
             Cam.log += '\nRed table corners: {}'.format(r_corners)
             Cam.log += '\nRed table centre: {}'.format(r_cen)
@@ -116,8 +118,9 @@ def alsc_all(Cam, do_alsc_colour, plot):
 """
 calculate g/r and g/b for 32x32 points arranged in a grid for a single image
 """
-def alsc(Cam, Img, do_alsc_colour, plot=False):
+def alsc(Cam, Img, do_alsc_colour, plot=False, grid_size=(16, 12)):
     Cam.log += '\nProcessing image: ' + Img.name
+    grid_w, grid_h = grid_size
     """
     get channel in correct order
     """
@@ -128,24 +131,24 @@ def alsc(Cam, Img, do_alsc_colour, plot=False):
     where w is a multiple of 32.
     """
     w, h = Img.w/2, Img.h/2
-    dx, dy = int(-(-(w-1)//16)), int(-(-(h-1)//12))
+    dx, dy = int(-(-(w-1)//grid_w)), int(-(-(h-1)//grid_h))
     """
     average the green channels into one
     """
     av_ch_g = np.mean((channels[1:3]), axis=0)
     if do_alsc_colour:
         """
-        obtain 16x12 grid of intensities for each channel and subtract black level
+        obtain grid_w x grid_h grid of intensities for each channel and subtract black level
         """
-        g = get_16x12_grid(av_ch_g, dx, dy) - Img.blacklevel_16
-        r = get_16x12_grid(channels[0], dx, dy) - Img.blacklevel_16
-        b = get_16x12_grid(channels[3], dx, dy) - Img.blacklevel_16
+        g = get_grid(av_ch_g, dx, dy, grid_size) - Img.blacklevel_16
+        r = get_grid(channels[0], dx, dy, grid_size) - Img.blacklevel_16
+        b = get_grid(channels[3], dx, dy, grid_size) - Img.blacklevel_16
         """
         calculate ratios as 32 bit in order to be supported by medianBlur function
         """
-        cr = np.reshape(g/r, (12, 16)).astype('float32')
-        cb = np.reshape(g/b, (12, 16)).astype('float32')
-        cg = np.reshape(1/g, (12, 16)).astype('float32')
+        cr = np.reshape(g/r, (grid_h, grid_w)).astype('float32')
+        cb = np.reshape(g/b, (grid_h, grid_w)).astype('float32')
+        cg = np.reshape(1/g, (grid_h, grid_w)).astype('float32')
         """
         median blur to remove peaks and save as float 64
         """
@@ -164,7 +167,7 @@ def alsc(Cam, Img, do_alsc_colour, plot=False):
             """
             note Y is plotted as -Y so plot has same axes as image
             """
-            X, Y = np.meshgrid(range(16), range(12))
+            X, Y = np.meshgrid(range(grid_w), range(grid_h))
             ha.plot_surface(X, -Y, cr, cmap=cm.coolwarm, linewidth=0)
             ha.set_title('ALSC Plot\nImg: {}\n\ncr'.format(Img.str))
             hb = hf.add_subplot(312, projection='3d')
@@ -182,15 +185,15 @@ def alsc(Cam, Img, do_alsc_colour, plot=False):
         """
         only perform calculations for luminance shading
         """
-        g = get_16x12_grid(av_ch_g, dx, dy) - Img.blacklevel_16
-        cg = np.reshape(1/g, (12, 16)).astype('float32')
+        g = get_grid(av_ch_g, dx, dy, grid_size) - Img.blacklevel_16
+        cg = np.reshape(1/g, (grid_h, grid_w)).astype('float32')
         cg = cv2.medianBlur(cg, 3).astype('float64')
         cg = cg/np.min(cg)
 
         if plot:
             hf = plt.figure(figssize=(8, 8))
             ha = hf.add_subplot(1, 1, 1, projection='3d')
-            X, Y = np.meashgrid(range(16), range(12))
+            X, Y = np.meashgrid(range(grid_w), range(grid_h))
             ha.plot_surface(X, -Y, cg, cmap=cm.coolwarm, linewidth=0)
             ha.set_title('ALSC Plot (Luminance only!)\nImg: {}\n\ncg').format(Img.str)
             plt.show()
@@ -199,21 +202,22 @@ def alsc(Cam, Img, do_alsc_colour, plot=False):
 
 
 """
-Compresses channel down to a 16x12 grid
+Compresses channel down to a grid of the requested size
 """
-def get_16x12_grid(chan, dx, dy):
+def get_grid(chan, dx, dy, grid_size):
+    grid_w, grid_h = grid_size
     grid = []
     """
     since left and bottom border will not necessarily have rectangles of
     dimension dx x dy, the 32nd iteration has to be handled separately.
     """
-    for i in range(11):
-        for j in range(15):
+    for i in range(grid_h - 1):
+        for j in range(grid_w - 1):
             grid.append(np.mean(chan[dy*i:dy*(1+i), dx*j:dx*(1+j)]))
-        grid.append(np.mean(chan[dy*i:dy*(1+i), 15*dx:]))
-    for j in range(15):
-        grid.append(np.mean(chan[11*dy:, dx*j:dx*(1+j)]))
-    grid.append(np.mean(chan[11*dy:, 15*dx:]))
+        grid.append(np.mean(chan[dy*i:dy*(1+i), (grid_w - 1)*dx:]))
+    for j in range(grid_w - 1):
+        grid.append(np.mean(chan[(grid_h - 1)*dy:, dx*j:dx*(1+j)]))
+    grid.append(np.mean(chan[(grid_h - 1)*dy:, (grid_w - 1)*dx:]))
     """
     return as np.array, ready for further manipulation
     """
@@ -223,7 +227,7 @@ def get_16x12_grid(chan, dx, dy):
 """
 obtains sigmas for red and blue, effectively a measure of the 'error'
 """
-def get_sigma(Cam, cal_cr_list, cal_cb_list):
+def get_sigma(Cam, cal_cr_list, cal_cb_list, grid_size):
     Cam.log += '\nCalculating sigmas'
     """
     provided colour alsc tables were generated for two different colour
@@ -241,8 +245,8 @@ def get_sigma(Cam, cal_cr_list, cal_cb_list):
     sigma_rs = []
     sigma_bs = []
     for i in range(len(cts)-1):
-        sigma_rs.append(calc_sigma(cal_cr_list[i]['table'], cal_cr_list[i+1]['table']))
-        sigma_bs.append(calc_sigma(cal_cb_list[i]['table'], cal_cb_list[i+1]['table']))
+        sigma_rs.append(calc_sigma(cal_cr_list[i]['table'], cal_cr_list[i+1]['table'], grid_size))
+        sigma_bs.append(calc_sigma(cal_cb_list[i]['table'], cal_cb_list[i+1]['table'], grid_size))
         Cam.log += '\nColour temperature interval {} - {} K'.format(cts[i], cts[i+1])
         Cam.log += '\nSigma red: {}'.format(sigma_rs[-1])
         Cam.log += '\nSigma blue: {}'.format(sigma_bs[-1])
@@ -263,12 +267,13 @@ def get_sigma(Cam, cal_cr_list, cal_cb_list):
 """
 calculate sigma from two adjacent gain tables
 """
-def calc_sigma(g1, g2):
+def calc_sigma(g1, g2, grid_size):
+    grid_w, grid_h = grid_size
     """
     reshape into 16x12 matrix
     """
-    g1 = np.reshape(g1, (12, 16))
-    g2 = np.reshape(g2, (12, 16))
+    g1 = np.reshape(g1, (grid_h, grid_w))
+    g2 = np.reshape(g2, (grid_h, grid_w))
     """
     apply gains to gain table
     """
@@ -280,8 +285,8 @@ def calc_sigma(g1, g2):
     neighbours, then append to list
     """
     diffs = []
-    for i in range(10):
-        for j in range(14):
+    for i in range(grid_h - 2):
+        for j in range(grid_w - 2):
             """
             note indexing is incremented by 1 since all patches on borders are
             not counted
diff --git a/utils/raspberrypi/ctt/ctt_awb.py b/utils/raspberrypi/ctt/ctt_awb.py
index bf45e54d5..5cc0fae68 100644
--- a/utils/raspberrypi/ctt/ctt_awb.py
+++ b/utils/raspberrypi/ctt/ctt_awb.py
@@ -13,7 +13,7 @@
 """
 obtain piecewise linear approximation for colour curve
 """
-def awb(Cam, cal_cr_list, cal_cb_list, plot):
+def awb(Cam, cal_cr_list, cal_cb_list, plot, grid_size):
     imgs = Cam.imgs
     """
     condense alsc calibration tables into one dictionary
@@ -43,7 +43,7 @@ def awb(Cam, cal_cr_list, cal_cb_list, plot):
         Note: if alsc is disabled then colour_cals will be set to None and the
         function will just return the greyscale patches
         """
-        r_patchs, b_patchs, g_patchs = get_alsc_patches(Img, colour_cals)
+        r_patchs, b_patchs, g_patchs = get_alsc_patches(Img, colour_cals, grid_size=grid_size)
         """
         calculate ratio of r, b to g
         """
@@ -293,12 +293,13 @@ def f_min(x):
 """
 obtain greyscale patches and perform alsc colour correction
 """
-def get_alsc_patches(Img, colour_cals, grey=True):
+def get_alsc_patches(Img, colour_cals, grey=True, grid_size=(16, 12)):
     """
     get patch centre coordinates, image colour and the actual
     patches for each channel, remembering to subtract blacklevel
     If grey then only greyscale patches considered
     """
+    grid_w, grid_h = grid_size
     if grey:
         cen_coords = Img.cen_coords[3::4]
         col = Img.col
@@ -345,12 +346,12 @@ def get_alsc_patches(Img, colour_cals, grey=True):
         bef_tabs = np.array(colour_cals[bef])
         aft_tabs = np.array(colour_cals[aft])
         col_tabs = (bef_tabs*db + aft_tabs*da)/(da+db)
-    col_tabs = np.reshape(col_tabs, (2, 12, 16))
+    col_tabs = np.reshape(col_tabs, (2, grid_h, grid_w))
     """
     calculate dx, dy used to calculate alsc table
     """
     w, h = Img.w/2, Img.h/2
-    dx, dy = int(-(-(w-1)//16)), int(-(-(h-1)//12))
+    dx, dy = int(-(-(w-1)//grid_w)), int(-(-(h-1)//grid_h))
     """
     make list of pairs of gains for each patch by selecting the correct value
     in alsc colour calibration table
diff --git a/utils/raspberrypi/ctt/ctt_cac.py b/utils/raspberrypi/ctt/ctt_cac.py
new file mode 100644
index 000000000..5a4c51011
--- /dev/null
+++ b/utils/raspberrypi/ctt/ctt_cac.py
@@ -0,0 +1,228 @@
+# SPDX-License-Identifier: BSD-2-Clause
+#
+# Copyright (C) 2023, Raspberry Pi Ltd
+#
+# ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool
+
+from PIL import Image
+import numpy as np
+import matplotlib.pyplot as plt
+from matplotlib import cm
+
+from ctt_dots_locator import find_dots_locations
+
+
+# This is the wrapper file that creates a JSON entry for you to append
+# to your camera tuning file.
+# It calculates the chromatic aberration at different points throughout
+# the image and uses that to produce a martix that can then be used
+# in the camera tuning files to correct this aberration.
+
+
+def pprint_array(array):
+    # Function to print the array in a tidier format
+    array = array
+    output = ""
+    for i in range(len(array)):
+        for j in range(len(array[0])):
+            output += str(round(array[i, j], 2)) + ", "
+        # Add the necessary indentation to the array
+        output += "\n                   "
+    # Cut off the end of the array (nicely formats it)
+    return output[:-22]
+
+
+def plot_shifts(red_shifts, blue_shifts):
+    # If users want, they can pass a command line option to show the shifts on a graph
+    # Can be useful to check that the functions are all working, and that the sample
+    # images are doing the right thing
+    Xs = np.array(red_shifts)[:, 0]
+    Ys = np.array(red_shifts)[:, 1]
+    Zs = np.array(red_shifts)[:, 2]
+    Zs2 = np.array(red_shifts)[:, 3]
+    Zs3 = np.array(blue_shifts)[:, 2]
+    Zs4 = np.array(blue_shifts)[:, 3]
+
+    fig, axs = plt.subplots(2, 2)
+    ax = fig.add_subplot(2, 2, 1, projection='3d')
+    ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0)
+    ax.set_title('Red X Shift')
+    ax = fig.add_subplot(2, 2, 2, projection='3d')
+    ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0)
+    ax.set_title('Red Y Shift')
+    ax = fig.add_subplot(2, 2, 3, projection='3d')
+    ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0)
+    ax.set_title('Blue X Shift')
+    ax = fig.add_subplot(2, 2, 4, projection='3d')
+    ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0)
+    ax.set_title('Blue Y Shift')
+    fig.tight_layout()
+    plt.show()
+
+
+def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9):
+    # Convert the shifts to a numpy array for easier handling and initialise other variables
+    red_shifts = np.array(red_shift)
+    blue_shifts = np.array(blue_shift)
+    # create a grid that's smaller than the output grid, which we then interpolate from to get the output values
+    xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
+    xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
+    yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
+    ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
+
+    xrsgrid = []
+    xbsgrid = []
+    yrsgrid = []
+    ybsgrid = []
+    xg = np.zeros((output_grid_size - 1, output_grid_size - 1))
+    yg = np.zeros((output_grid_size - 1, output_grid_size - 1))
+
+    # Format the grids - numpy doesn't work for this, it wants a
+    # nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup
+    for x in range(output_grid_size - 1):
+        xrsgrid.append([])
+        yrsgrid.append([])
+        xbsgrid.append([])
+        ybsgrid.append([])
+        for y in range(output_grid_size - 1):
+            xrsgrid[x].append([])
+            yrsgrid[x].append([])
+            xbsgrid[x].append([])
+            ybsgrid[x].append([])
+
+    image_size = (image_dimensions[0], image_dimensions[1])
+    gridxsize = image_size[0] / (output_grid_size - 1)
+    gridysize = image_size[1] / (output_grid_size - 1)
+
+    # Iterate through each dot, and it's shift values and put these into the correct grid location
+    for red_shift in red_shifts:
+        xgridloc = int(red_shift[0] / gridxsize)
+        ygridloc = int(red_shift[1] / gridysize)
+        xrsgrid[xgridloc][ygridloc].append(red_shift[2])
+        yrsgrid[xgridloc][ygridloc].append(red_shift[3])
+
+    for blue_shift in blue_shifts:
+        xgridloc = int(blue_shift[0] / gridxsize)
+        ygridloc = int(blue_shift[1] / gridysize)
+        xbsgrid[xgridloc][ygridloc].append(blue_shift[2])
+        ybsgrid[xgridloc][ygridloc].append(blue_shift[3])
+
+    # Now calculate the average pixel shift for each square in the grid
+    for x in range(output_grid_size - 1):
+        for y in range(output_grid_size - 1):
+            xrgrid[x, y] = np.mean(xrsgrid[x][y])
+            yrgrid[x, y] = np.mean(yrsgrid[x][y])
+            xbgrid[x, y] = np.mean(xbsgrid[x][y])
+            ybgrid[x, y] = np.mean(ybsgrid[x][y])
+
+    # Next, we start to interpolate the central points of the grid that gets passed to the tuning file
+    input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid])
+    output_grids = np.zeros((4, output_grid_size, output_grid_size))
+
+    # Interpolate the centre of the grid
+    output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4
+
+    # Edge cases:
+    output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1]
+    output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2]
+    output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1]
+    output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1]
+
+    # Corner Cases:
+    output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1]
+    output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2]
+    output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1]
+    output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2]
+
+    # Below, we swap the x and the y coordinates, and also multiply by a factor of -1
+    # This is due to the PiSP (standard) dimensions being flipped in comparison to
+    # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,
+    # and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift)
+
+    output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1
+    return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb
+
+
+def analyse_dot(dot, dot_location=[0, 0]):
+    # Scan through the dot, calculate the centroid of each colour channel by doing:
+    # pixel channel brightness * distance from top left corner
+    # Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel
+    red_channel = np.array(dot)[:, :, 0]
+    y_num_pixels = len(red_channel[0])
+    x_num_pixels = len(red_channel)
+    yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels)))
+    xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel))
+    red_sum = np.sum(red_channel)
+
+    green_channel = np.array(dot)[:, :, 1]
+    ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels)))
+    xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel))
+    green_sum = np.sum(green_channel)
+
+    blue_channel = np.array(dot)[:, :, 2]
+    yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels)))
+    xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel))
+    blue_sum = np.sum(blue_channel)
+
+    # We return this structure. It contains 2 arrays that contain:
+    # the locations of the dot center, along with the channel shifts in the x and y direction:
+    # [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ]
+
+    return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]]
+
+
+def cac(Cam):
+    filelist = Cam.imgs_cac
+
+    Cam.log += '\nCAC analysing files: {}'.format(str(filelist))
+    np.set_printoptions(precision=3)
+    np.set_printoptions(suppress=True)
+
+    # Create arrays to hold all the dots data and their colour offsets
+    red_shift = []  # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]
+    blue_shift = []
+    # Iterate through the files
+    # Multiple files is reccomended to average out the lens aberration through rotations
+    for file in filelist:
+        Cam.log += '\nCAC processing file'
+        print("\n Processing file")
+        # Read the raw RGB values
+        rgb = file.rgb
+        image_size = [file.h, file.w]  # Image size, X, Y
+        # Create a colour copy of the RGB values to use later in the calibration
+        imout = Image.new(mode="RGB", size=image_size)
+        rgb_image = np.array(imout)
+        # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily
+        rgb.reshape((image_size[0], image_size[1], 3))
+        rgb_image = rgb
+
+        # Pass the RGB image through to the dots locating program
+        # Returns an array of the dots (colour rectangles around the dots), and an array of their locations
+        print("Finding dots")
+        Cam.log += '\nFinding dots'
+        dots, dots_locations = find_dots_locations(rgb_image)
+
+        # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out
+        # by how far the chromatic aberration has shifted each channel
+        Cam.log += '\nDots found: {}'.format(str(len(dots)))
+        print('Dots found: ' + str(len(dots)))
+
+        for dot, dot_location in zip(dots, dots_locations):
+            if len(dot) > 0:
+                if (dot_location[0] > 0) and (dot_location[1] > 0):
+                    ret = analyse_dot(dot, dot_location)
+                    red_shift.append(ret[0])
+                    blue_shift.append(ret[1])
+
+    # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix
+    # for the CAC block to handle and then store these as a .json file to be added to the camera
+    # tuning file
+    print("\nCreating output grid")
+    Cam.log += '\nCreating output grid'
+    rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)
+
+    print("CAC correction complete!")
+    Cam.log += '\nCAC correction complete!'
+
+    # Give the JSON dict back to the main ctt program
+    return {"strength": 1.0, "lut_rx": list(rx.round(2).reshape(81)), "lut_ry": list(ry.round(2).reshape(81)), "lut_bx": list(bx.round(2).reshape(81)), "lut_by": list(by.round(2).reshape(81))}
diff --git a/utils/raspberrypi/ctt/ctt_ccm.py b/utils/raspberrypi/ctt/ctt_ccm.py
index a09bfd096..8f3bc2644 100644
--- a/utils/raspberrypi/ctt/ctt_ccm.py
+++ b/utils/raspberrypi/ctt/ctt_ccm.py
@@ -56,7 +56,7 @@ def gamma(x):
 """
 
 
-def ccm(Cam, cal_cr_list, cal_cb_list):
+def ccm(Cam, cal_cr_list, cal_cb_list, grid_size):
     global matrix_selection_types, typenum
     imgs = Cam.imgs
     """
@@ -133,9 +133,7 @@ def ccm(Cam, cal_cr_list, cal_cb_list):
         Note: if alsc is disabled then colour_cals will be set to None and no
         the function will simply return the macbeth patches
         """
-        r, b, g = get_alsc_patches(Img, colour_cals, grey=False)
-        # 256 values for each patch of sRGB values
-
+        r, b, g = get_alsc_patches(Img, colour_cals, grey=False, grid_size=grid_size)
         """
         do awb
         Note: awb is done by measuring the macbeth chart in the image, rather
diff --git a/utils/raspberrypi/ctt/ctt_dots_locator.py b/utils/raspberrypi/ctt/ctt_dots_locator.py
new file mode 100644
index 000000000..4945c04bf
--- /dev/null
+++ b/utils/raspberrypi/ctt/ctt_dots_locator.py
@@ -0,0 +1,118 @@
+# SPDX-License-Identifier: BSD-2-Clause
+#
+# Copyright (C) 2023, Raspberry Pi Ltd
+#
+# find_dots.py - Used by CAC algorithm to convert image to set of dots
+
+'''
+This file takes the black and white version of the image, along with
+the color version. It then located the black dots on the image by
+thresholding dark pixels.
+In a rather fun way, the algorithm bounces around the thresholded area in a random path
+We then use the maximum and minimum of these paths to determine the dot shape and size
+This info is then used to return colored dots and locations back to the main file
+'''
+
+import numpy as np
+import random
+from PIL import Image, ImageEnhance, ImageFilter
+
+
+def find_dots_locations(rgb_image, color_threshold=100, dots_edge_avoid=75, image_edge_avoid=10, search_path_length=500, grid_scan_step_size=10, logfile=open("log.txt", "a+")):
+    # Initialise some starting variables
+    pixels = Image.fromarray(rgb_image)
+    pixels = pixels.convert("L")
+    enhancer = ImageEnhance.Contrast(pixels)
+    im_output = enhancer.enhance(1.4)
+    # We smooth it slightly to make it easier for the dot recognition program to locate the dots
+    im_output = im_output.filter(ImageFilter.GaussianBlur(radius=2))
+    bw_image = np.array(im_output)
+
+    location = [0, 0]
+    dots = []
+    dots_location = []
+    # the program takes away the edges - we don't want a dot that is half a circle, the
+    # centroids would all be wrong
+    for x in range(dots_edge_avoid, len(bw_image) - dots_edge_avoid, grid_scan_step_size):
+        for y in range(dots_edge_avoid, len(bw_image[0]) - dots_edge_avoid, grid_scan_step_size):
+            location = [x, y]
+            scrap_dot = False  # A variable used to make sure that this is a valid dot
+            if (bw_image[location[0], location[1]] < color_threshold) and not (scrap_dot):
+                heading = "south"  # Define a starting direction to move in
+                coords = []
+                for i in range(search_path_length):  # Creates a path of length `search_path_length`. This turns out to always be enough to work out the rough shape of the dot.
+                    # Now make sure that the thresholded area doesn't come within 10 pixels of the edge of the image, ensures we capture all the CA
+                    if ((image_edge_avoid < location[0] < len(bw_image) - image_edge_avoid) and (image_edge_avoid < location[1] < len(bw_image[0]) - image_edge_avoid)) and not (scrap_dot):
+                        if heading == "south":
+                            if bw_image[location[0] + 1, location[1]] < color_threshold:
+                                # Here, notice it does not go south, but actually goes southeast
+                                # This is crucial in ensuring that we make our way around the majority of the dot
+                                location[0] = location[0] + 1
+                                location[1] = location[1] + 1
+                                heading = "south"
+                            else:
+                                # This happens when we reach a thresholded edge. We now randomly change direction and keep searching
+                                dir = random.randint(1, 2)
+                                if dir == 1:
+                                    heading = "west"
+                                if dir == 2:
+                                    heading = "east"
+
+                        if heading == "east":
+                            if bw_image[location[0], location[1] + 1] < color_threshold:
+                                location[1] = location[1] + 1
+                                heading = "east"
+                            else:
+                                dir = random.randint(1, 2)
+                                if dir == 1:
+                                    heading = "north"
+                                if dir == 2:
+                                    heading = "south"
+
+                        if heading == "west":
+                            if bw_image[location[0], location[1] - 1] < color_threshold:
+                                location[1] = location[1] - 1
+                                heading = "west"
+                            else:
+                                dir = random.randint(1, 2)
+                                if dir == 1:
+                                    heading = "north"
+                                if dir == 2:
+                                    heading = "south"
+
+                        if heading == "north":
+                            if bw_image[location[0] - 1, location[1]] < color_threshold:
+                                location[0] = location[0] - 1
+                                heading = "north"
+                            else:
+                                dir = random.randint(1, 2)
+                                if dir == 1:
+                                    heading = "west"
+                                if dir == 2:
+                                    heading = "east"
+                        # Log where our particle travels across the dot
+                        coords.append([location[0], location[1]])
+                    else:
+                        scrap_dot = True  # We just don't have enough space around the dot, discard this one, and move on
+                if not scrap_dot:
+                    # get the size of the dot surrounding the dot
+                    x_coords = np.array(coords)[:, 0]
+                    y_coords = np.array(coords)[:, 1]
+                    hsquaresize = max(list(x_coords)) - min(list(x_coords))
+                    vsquaresize = max(list(y_coords)) - min(list(y_coords))
+                    # Create the bounding coordinates of the rectangle surrounding the dot
+                    # Program uses the dotsize + half of the dotsize to ensure we get all that color fringing
+                    extra_space_factor = 0.45
+                    top_left_x = (min(list(x_coords)) - int(hsquaresize * extra_space_factor))
+                    btm_right_x = max(list(x_coords)) + int(hsquaresize * extra_space_factor)
+                    top_left_y = (min(list(y_coords)) - int(vsquaresize * extra_space_factor))
+                    btm_right_y = max(list(y_coords)) + int(vsquaresize * extra_space_factor)
+                    # Overwrite the area of the dot to ensure we don't use it again
+                    bw_image[top_left_x:btm_right_x, top_left_y:btm_right_y] = 255
+                    # Add the color version of the dot to the list to send off, along with some coordinates.
+                    dots.append(rgb_image[top_left_x:btm_right_x, top_left_y:btm_right_y])
+                    dots_location.append([top_left_x, top_left_y])
+                else:
+                    # Dot was too close to the image border to be useable
+                    pass
+    return dots, dots_location
diff --git a/utils/raspberrypi/ctt/ctt_image_load.py b/utils/raspberrypi/ctt/ctt_image_load.py
index 310c5e88f..fffa4c43c 100644
--- a/utils/raspberrypi/ctt/ctt_image_load.py
+++ b/utils/raspberrypi/ctt/ctt_image_load.py
@@ -350,6 +350,7 @@ def dng_load_image(Cam, im_str):
         c2 = np.left_shift(raw_data[1::2, 0::2].astype(np.int64), shift)
         c3 = np.left_shift(raw_data[1::2, 1::2].astype(np.int64), shift)
         Img.channels = [c0, c1, c2, c3]
+        Img.rgb = raw_im.postprocess()
 
     except Exception:
         print("\nERROR: failed to load DNG file", im_str)
diff --git a/utils/raspberrypi/ctt/ctt_pisp.py b/utils/raspberrypi/ctt/ctt_pisp.py
new file mode 100755
index 000000000..a59b053c5
--- /dev/null
+++ b/utils/raspberrypi/ctt/ctt_pisp.py
@@ -0,0 +1,805 @@
+#!/usr/bin/env python3
+#
+# SPDX-License-Identifier: BSD-2-Clause
+#
+# Copyright (C) 2019, Raspberry Pi Ltd
+#
+# ctt_pisp.py - camera tuning tool data for PiSP platforms
+
+
+json_template = {
+    "rpi.black_level": {
+        "black_level": 4096
+    },
+    "rpi.lux": {
+        "reference_shutter_speed": 10000,
+        "reference_gain": 1,
+        "reference_aperture": 1.0
+    },
+    "rpi.dpc": {
+	"strength": 1
+    },
+    "rpi.noise": {
+    },
+    "rpi.geq": {
+    },
+    "rpi.denoise":
+    {
+        "normal":
+        {
+            "sdn":
+            {
+                "deviation": 1.6,
+                "strength": 0.5,
+                "deviation2": 3.2,
+                "deviation_no_tdn": 3.2,
+                "strength_no_tdn": 0.75
+            },
+            "cdn":
+            {
+                "deviation": 200,
+                "strength": 0.3
+            },
+            "tdn":
+            {
+                "deviation": 0.8,
+                "threshold": 0.05
+            }
+        },
+        "hdr":
+        {
+            "sdn":
+            {
+                "deviation": 1.6,
+                "strength": 0.5,
+                "deviation2": 3.2,
+                "deviation_no_tdn": 3.2,
+                "strength_no_tdn": 0.75
+            },
+            "cdn":
+            {
+                "deviation": 200,
+                "strength": 0.3
+            },
+            "tdn":
+            {
+                "deviation": 1.3,
+                "threshold": 0.1
+            }
+        },
+        "night":
+        {
+            "sdn":
+            {
+                "deviation": 1.6,
+                "strength": 0.5,
+                "deviation2": 3.2,
+                "deviation_no_tdn": 3.2,
+                "strength_no_tdn": 0.75
+            },
+            "cdn":
+            {
+                "deviation": 200,
+                "strength": 0.3
+            },
+            "tdn":
+            {
+                "deviation": 1.3,
+                "threshold": 0.1
+            }
+        }
+    },
+    "rpi.awb": {
+        "priors": [
+            {"lux": 0, "prior": [2000, 1.0, 3000, 0.0, 13000, 0.0]},
+            {"lux": 800, "prior": [2000, 0.0, 6000, 2.0, 13000, 2.0]},
+            {"lux": 1500, "prior": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]}
+        ],
+        "modes": {
+            "auto": {"lo": 2500, "hi": 7700},
+            "incandescent": {"lo": 2500, "hi": 3000},
+            "tungsten": {"lo": 3000, "hi": 3500},
+            "fluorescent": {"lo": 4000, "hi": 4700},
+            "indoor": {"lo": 3000, "hi": 5000},
+            "daylight": {"lo": 5500, "hi": 6500},
+            "cloudy": {"lo": 7000, "hi": 8000}
+        },
+        "bayes": 1
+    },
+    "rpi.agc":
+    {
+        "channels":
+        [
+            {
+                "comment": "Channel 0 is normal AGC",
+                "metering_modes":
+                {
+                    "centre-weighted":
+                    {
+                        "weights":
+                        [
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                        ]
+                    },
+                    "spot":
+                    {
+                        "weights":
+                        [
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
+                    },
+                    "matrix":
+                    {
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
+                    }
+                },
+                "exposure_modes":
+                {
+                    "normal":
+                    {
+                        "shutter": [ 100, 10000, 30000, 60000, 66666 ],
+                        "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                    },
+                    "short":
+                    {
+                        "shutter": [ 100, 5000, 10000, 20000, 60000 ],
+                        "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]
+                    },
+                    "long":
+                    {
+                        "shutter": [ 100, 10000, 30000, 60000, 90000, 120000 ],
+                        "gain": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]
+                    }
+                },
+                "constraint_modes":
+                {
+                    "normal": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        }
+                    ],
+                    "highlight": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        },
+                        {
+                            "bound": "UPPER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.8,
+                                1000, 0.8
+                            ]
+                        },
+                    ],
+                    "shadows": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.0,
+                            "q_hi": 0.5,
+                            "y_target":
+                            [
+                                0, 0.17,
+                                1000, 0.17
+                            ]
+                        }
+                    ]
+                },
+                "y_target":
+                [
+                    0, 0.16,
+                    1000, 0.165,
+                    10000, 0.17
+                ]
+            },
+            {
+                "comment": "Channel 1 is the HDR short channel",
+                "desaturate": 0,
+                "metering_modes":
+                {
+                    "centre-weighted":
+                    {
+                        "weights":
+                        [
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                        ]
+                    },
+                    "spot":
+                    {
+                        "weights":
+                        [
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
+                    },
+                    "matrix":
+                    {
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
+                    }
+                },
+                "exposure_modes":
+                {
+                    "normal":
+                    {
+                        "shutter": [ 100, 20000, 60000 ],
+                        "gain": [ 1.0, 1.0, 1.0 ]
+                    },
+                    "short":
+                    {
+                        "shutter": [ 100, 20000, 60000 ],
+                        "gain": [ 1.0, 1.0, 1.0 ]
+                    },
+                    "long":
+                    {
+                        "shutter": [ 100, 20000, 60000 ],
+                        "gain": [ 1.0, 1.0, 1.0 ]
+                    }
+                },
+                "constraint_modes":
+                {
+                    "normal": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.95,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        },
+                        {
+                            "bound": "UPPER",
+                            "q_lo": 0.95,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.7,
+                                1000, 0.7
+                            ]
+                        },
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.0,
+                            "q_hi": 0.2,
+                            "y_target":
+                            [
+                                0, 0.002,
+                                1000, 0.002
+                            ]
+                        }
+                    ],
+                    "highlight": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.95,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        },
+                        {
+                            "bound": "UPPER",
+                            "q_lo": 0.95,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.7,
+                                1000, 0.7
+                            ]
+                        },
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.0,
+                            "q_hi": 0.2,
+                            "y_target":
+                            [
+                                0, 0.002,
+                                1000, 0.002
+                            ]
+                        }
+                    ],
+                    "shadows": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.95,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        },
+                        {
+                            "bound": "UPPER",
+                            "q_lo": 0.95,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.7,
+                                1000, 0.7
+                            ]
+                        },
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.0,
+                            "q_hi": 0.2,
+                            "y_target":
+                            [
+                                0, 0.002,
+                                1000, 0.002
+                            ]
+                        }
+                    ]
+                },
+                "y_target":
+                [
+                    0, 0.16,
+                    1000, 0.165,
+                    10000, 0.17
+                ]
+            },
+            {
+                "comment": "Channel 2 is the HDR long channel",
+                "desaturate": 0,
+                "metering_modes":
+                {
+                    "centre-weighted":
+                    {
+                        "weights":
+                        [
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                        ]
+                    },
+                    "spot":
+                    {
+                        "weights":
+                        [
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
+                    },
+                    "matrix":
+                    {
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
+                    }
+                },
+                "exposure_modes":
+                {
+                    "normal":
+                    {
+                        "shutter": [ 100, 20000, 30000, 60000 ],
+                        "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                    },
+                    "short":
+                    {
+                        "shutter": [ 100, 20000, 30000, 60000 ],
+                        "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                    },
+                    "long":
+                    {
+                        "shutter": [ 100, 20000, 30000, 60000 ],
+                        "gain": [ 1.0, 2.0, 4.0, 8.0 ]
+                    }
+                },
+                "constraint_modes":
+                {
+                    "normal": [
+                    ],
+                    "highlight": [
+                    ],
+                    "shadows": [
+                    ]
+                },
+                "channel_constraints":
+                [
+                    {
+                        "bound": "UPPER",
+                        "channel": 4,
+                        "factor": 8
+                    },
+                    {
+                        "bound": "LOWER",
+                        "channel": 4,
+                        "factor": 2
+                    }
+                ],
+                "y_target":
+                [
+                    0, 0.16,
+                    1000, 0.165,
+                    10000, 0.17
+                ]
+            },
+            {
+                "comment": "Channel 3 is the night mode channel",
+                "base_ev": 0.33,
+                "metering_modes":
+                {
+                    "centre-weighted":
+                    {
+                        "weights":
+                        [
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,
+                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,
+                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,
+                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,
+                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0
+                        ]
+                    },
+                    "spot":
+                    {
+                        "weights":
+                        [
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+                        ]
+                    },
+                    "matrix":
+                    {
+                        "weights":
+                        [
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
+                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1
+                        ]
+                    }
+                },
+                "exposure_modes":
+                {
+                    "normal":
+                    {
+                        "shutter": [ 100, 20000, 66666 ],
+                        "gain": [ 1.0, 2.0, 4.0 ]
+                    },
+                    "short":
+                    {
+                        "shutter": [ 100, 20000, 33333 ],
+                        "gain": [ 1.0, 2.0, 4.0 ]
+                    },
+                    "long":
+                    {
+                        "shutter": [ 100, 20000, 66666, 120000 ],
+                        "gain": [ 1.0, 2.0, 4.0, 4.0 ]
+                    }
+                },
+                "constraint_modes":
+                {
+                    "normal": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        }
+                    ],
+                    "highlight": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        },
+                        {
+                            "bound": "UPPER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.8,
+                                1000, 0.8
+                            ]
+                        }
+                    ],
+                    "shadows": [
+                        {
+                            "bound": "LOWER",
+                            "q_lo": 0.98,
+                            "q_hi": 1.0,
+                            "y_target":
+                            [
+                                0, 0.5,
+                                1000, 0.5
+                            ]
+                        }
+                    ]
+                },
+                "y_target":
+                [
+                    0, 0.16,
+                    1000, 0.16,
+                    10000, 0.17
+                ]
+            }
+        ]
+    },
+    "rpi.alsc": {
+        'omega': 1.3,
+        'n_iter': 100,
+        'luminance_strength': 0.8,
+    },
+    "rpi.contrast": {
+        "ce_enable": 1,
+        "gamma_curve": [
+            0,     0,
+            1024,  5040,
+            2048,  9338,
+            3072,  12356,
+            4096,  15312,
+            5120,  18051,
+            6144,  20790,
+            7168,  23193,
+            8192,  25744,
+            9216,  27942,
+            10240, 30035,
+            11264, 32005,
+            12288, 33975,
+            13312, 35815,
+            14336, 37600,
+            15360, 39168,
+            16384, 40642,
+            18432, 43379,
+            20480, 45749,
+            22528, 47753,
+            24576, 49621,
+            26624, 51253,
+            28672, 52698,
+            30720, 53796,
+            32768, 54876,
+            36864, 57012,
+            40960, 58656,
+            45056, 59954,
+            49152, 61183,
+            53248, 62355,
+            57344, 63419,
+            61440, 64476,
+            65535, 65535
+        ]
+    },
+    "rpi.ccm": {
+    },
+    "rpi.cac": {
+    },
+    "rpi.sharpen": {
+	"threshold": 0.25,
+	"limit": 1.0,
+	"strength": 1.0
+    },
+    "rpi.hdr":
+    {
+        "Off":
+        {
+            "cadence": [ 0 ]
+        },
+        "MultiExposureUnmerged":
+        {
+            "cadence": [ 1, 2 ],
+            "channel_map": { "short": 1, "long": 2 }
+        },
+        "SingleExposure":
+        {
+            "cadence": [1],
+            "channel_map": { "short": 1 },
+            "spatial_gain": 2.0,
+            "tonemap_enable": 1
+        },
+        "MultiExposure":
+        {
+            "cadence": [1, 2],
+            "channel_map": { "short": 1, "long": 2 },
+            "stitch_enable": 1,
+            "spatial_gain": 2.0,
+            "tonemap_enable": 1
+        },
+        "Night":
+        {
+            "cadence": [ 3 ],
+            "channel_map": { "night": 3 },
+            "tonemap_enable": 1,
+            "tonemap":
+            [
+                0, 0,
+                5000, 20000,
+                10000, 30000,
+                20000, 47000,
+                30000, 55000,
+                65535, 65535
+            ]
+        }
+    }
+}
+
+grid_size = (32, 32)
diff --git a/utils/raspberrypi/ctt/ctt_pretty_print_json.py b/utils/raspberrypi/ctt/ctt_pretty_print_json.py
index 3e3b84752..a4cae62d8 100755
--- a/utils/raspberrypi/ctt/ctt_pretty_print_json.py
+++ b/utils/raspberrypi/ctt/ctt_pretty_print_json.py
@@ -19,13 +19,19 @@ def __init__(self, *args, **kwargs):
         self.indentation_level = 0
         self.hard_break = 120
         self.custom_elems = {
+            'weights': 15,
             'table': 16,
             'luminance_lut': 16,
             'ct_curve': 3,
             'ccm': 3,
+            'lut_rx': 9,
+            'lut_bx': 9,
+            'lut_by': 9,
+            'lut_ry': 9,
             'gamma_curve': 2,
             'y_target': 2,
-            'prior': 2
+            'prior': 2,
+            'tonemap': 2
         }
 
     def encode(self, o, node_key=None):
@@ -87,7 +93,7 @@ def iterencode(self, o, **kwargs):
         return self.encode(o)
 
 
-def pretty_print(in_json: dict) -> str:
+def pretty_print(in_json: dict, custom_elems={}) -> str:
 
     if 'version' not in in_json or \
        'target' not in in_json or \
@@ -95,12 +101,15 @@ def pretty_print(in_json: dict) -> str:
        in_json['version'] < 2.0:
         raise RuntimeError('Incompatible JSON dictionary has been provided')
 
-    return json.dumps(in_json, cls=Encoder, indent=4, sort_keys=False)
+    encoder = Encoder(indent=4, sort_keys=False)
+    encoder.custom_elems |= custom_elems
+    return encoder.encode(in_json) #json.dumps(in_json, cls=Encoder, indent=4, sort_keys=False)
 
 
 if __name__ == "__main__":
     parser = argparse.ArgumentParser(formatter_class=argparse.RawTextHelpFormatter, description=
                     'Prettify a version 2.0 camera tuning config JSON file.')
+    parser.add_argument('-t', '--target', type=str, help='Target platform', choices=['pisp', 'vc4'], default='vc4')
     parser.add_argument('input', type=str, help='Input tuning file.')
     parser.add_argument('output', type=str, nargs='?',
                         help='Output converted tuning file. If not provided, the input file will be updated in-place.',
@@ -110,7 +119,12 @@ def pretty_print(in_json: dict) -> str:
     with open(args.input, 'r') as f:
         in_json = json.load(f)
 
-    out_json = pretty_print(in_json)
+    if args.target == 'pisp':
+        from ctt_pisp import grid_size
+    elif args.target == 'vc4':
+        from ctt_vc4 import grid_size
+
+    out_json = pretty_print(in_json, custom_elems={'table': grid_size[0], 'luminance_lut': grid_size[0]})
 
     with open(args.output if args.output is not None else args.input, 'w') as f:
         f.write(out_json)
diff --git a/utils/raspberrypi/ctt/ctt_tools.py b/utils/raspberrypi/ctt/ctt_tools.py
index 79195289b..f0d825899 100644
--- a/utils/raspberrypi/ctt/ctt_tools.py
+++ b/utils/raspberrypi/ctt/ctt_tools.py
@@ -65,11 +65,12 @@ def parse_input():
     directory = get_config(args_dict, '-i', None, 'string')
     config = get_config(args_dict, '-c', None, 'string')
     log_path = get_config(args_dict, '-l', None, 'string')
+    target = get_config(args_dict, '-t', "vc4", 'string')
     if directory is None:
         raise ArgError('\n\nERROR! No input directory given.')
     if json_output is None:
         raise ArgError('\n\nERROR! No output json given.')
-    return json_output, directory, config, log_path
+    return json_output, directory, config, log_path, target
 
 
 """
diff --git a/utils/raspberrypi/ctt/ctt_vc4.py b/utils/raspberrypi/ctt/ctt_vc4.py
new file mode 100755
index 000000000..7154e1104
--- /dev/null
+++ b/utils/raspberrypi/ctt/ctt_vc4.py
@@ -0,0 +1,126 @@
+#!/usr/bin/env python3
+#
+# SPDX-License-Identifier: BSD-2-Clause
+#
+# Copyright (C) 2019, Raspberry Pi Ltd
+#
+# ctt_vc4.py - camera tuning tool data for VC4 platforms
+
+
+json_template = {
+    "rpi.black_level": {
+        "black_level": 4096
+    },
+    "rpi.dpc": {
+    },
+    "rpi.lux": {
+        "reference_shutter_speed": 10000,
+        "reference_gain": 1,
+        "reference_aperture": 1.0
+    },
+    "rpi.noise": {
+    },
+    "rpi.geq": {
+    },
+    "rpi.sdn": {
+    },
+    "rpi.awb": {
+        "priors": [
+            {"lux": 0, "prior": [2000, 1.0, 3000, 0.0, 13000, 0.0]},
+            {"lux": 800, "prior": [2000, 0.0, 6000, 2.0, 13000, 2.0]},
+            {"lux": 1500, "prior": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]}
+        ],
+        "modes": {
+            "auto": {"lo": 2500, "hi": 8000},
+            "incandescent": {"lo": 2500, "hi": 3000},
+            "tungsten": {"lo": 3000, "hi": 3500},
+            "fluorescent": {"lo": 4000, "hi": 4700},
+            "indoor": {"lo": 3000, "hi": 5000},
+            "daylight": {"lo": 5500, "hi": 6500},
+            "cloudy": {"lo": 7000, "hi": 8600}
+        },
+        "bayes": 1
+    },
+    "rpi.agc": {
+        "metering_modes": {
+            "centre-weighted": {
+                "weights": [3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0]
+            },
+            "spot": {
+                "weights": [2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]
+            },
+            "matrix": {
+                "weights": [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1]
+            }
+        },
+        "exposure_modes": {
+            "normal": {
+                "shutter": [100, 10000, 30000, 60000, 120000],
+                "gain": [1.0, 2.0, 4.0, 6.0, 6.0]
+            },
+            "short": {
+                "shutter": [100, 5000, 10000, 20000, 120000],
+                "gain": [1.0, 2.0, 4.0, 6.0, 6.0]
+            }
+        },
+        "constraint_modes": {
+            "normal": [
+                {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]}
+            ],
+            "highlight": [
+                {"bound": "LOWER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.5, 1000, 0.5]},
+                {"bound": "UPPER", "q_lo": 0.98, "q_hi": 1.0, "y_target": [0, 0.8, 1000, 0.8]}
+            ]
+        },
+        "y_target": [0, 0.16, 1000, 0.165, 10000, 0.17]
+    },
+    "rpi.alsc": {
+        'omega': 1.3,
+        'n_iter': 100,
+        'luminance_strength': 0.7,
+    },
+    "rpi.contrast": {
+        "ce_enable": 1,
+        "gamma_curve": [
+            0,     0,
+            1024,  5040,
+            2048,  9338,
+            3072,  12356,
+            4096,  15312,
+            5120,  18051,
+            6144,  20790,
+            7168,  23193,
+            8192,  25744,
+            9216,  27942,
+            10240, 30035,
+            11264, 32005,
+            12288, 33975,
+            13312, 35815,
+            14336, 37600,
+            15360, 39168,
+            16384, 40642,
+            18432, 43379,
+            20480, 45749,
+            22528, 47753,
+            24576, 49621,
+            26624, 51253,
+            28672, 52698,
+            30720, 53796,
+            32768, 54876,
+            36864, 57012,
+            40960, 58656,
+            45056, 59954,
+            49152, 61183,
+            53248, 62355,
+            57344, 63419,
+            61440, 64476,
+            65535, 65535
+        ]
+    },
+    "rpi.ccm": {
+    },
+    "rpi.sharpen": {
+    }
+}
+
+grid_size = (16, 12)