diff --git a/app.js b/app.js new file mode 100644 index 0000000..07b151d --- /dev/null +++ b/app.js @@ -0,0 +1,29 @@ +const lugar = require('./lugar/lugar'); +const clima = require('./clima/clima'); + +const argv = require('yargs').options({ + direccion: { + alias: 'd', + desc: 'Direccion de la ciudad para obener el clima', + demand: true + } +}).argv; + +//lugar.getLugarLatLng(argv.direccion).then(console.log); +//clima.getClima(40.750000, -74.000000).then(console.log); + +const getInfo = async(direccion) => { + + try { + const coordes = await lugar.getLugarLatLng(direccion); + const temp = await clima.getClima(coordes.lat, coordes.lng); + return `El clima de ${coordes.dir} es de ${temp}` + } catch (e) { + return `No se pudo determinar el clima de ${direccion}` + } + +} + +getInfo(argv.direccion) + .then(console.log) + .catch(console.log); \ No newline at end of file diff --git a/clima/.gitignore b/clima/.gitignore new file mode 100644 index 0000000..40b878d --- /dev/null +++ b/clima/.gitignore @@ -0,0 +1 @@ +node_modules/ \ No newline at end of file diff --git a/clima/README.md b/clima/README.md new file mode 100644 index 0000000..c1f8774 --- /dev/null +++ b/clima/README.md @@ -0,0 +1,6 @@ +##Aplicacion del clima - curso node + +Recuerda ejecutar '''npm install''' para las librerias + + +## Ejemplo : node app -d "New York" \ No newline at end of file diff --git a/clima/clima.js b/clima/clima.js new file mode 100644 index 0000000..14400fc --- /dev/null +++ b/clima/clima.js @@ -0,0 +1,14 @@ +const axios = require('axios'); + +const getClima = async(lat, lng) => { + + const resp = await axios.get(`https://api.openweathermap.org/data/2.5/weather?lat=${ lat }&lon=${ lng }&appid=be4d5e9db9b5918cf282c5a9d1aebd35`) + + return resp.data.main.temp; + +} + + +module.exports = { + getClima +} \ No newline at end of file diff --git a/lugar/lugar.js b/lugar/lugar.js new file mode 100644 index 0000000..bffc197 --- /dev/null +++ b/lugar/lugar.js @@ -0,0 +1,33 @@ +const axios = require('axios'); + +const getLugarLatLng = async(direccion) => { + + const encoudeURL = encodeURI(direccion); + + const instance = axios.create({ + baseURL: 'https://devru-latitude-longitude-find-v1.p.rapidapi.com/latlon.php?location=' + encoudeURL, + headers: { 'X-RapidAPI-Key': '9f7b574f86mshcf6b47f4bde626dp18db4bjsnedb3a25abaaf' } + }); + + const resp = await instance.get(); + + if (resp.data.Results.length === 0) { + throw new Error('No hay resultados para' + direccion); + } + + const data = resp.data.Results[0]; + const dir = data.name; + const lat = data.lat; + const lng = data.lon; + + return { + dir, + lat, + lng + } + +} + +module.exports = { + getLugarLatLng +} \ No newline at end of file diff --git a/node_modules/ansi-regex/index.js b/node_modules/ansi-regex/index.js new file mode 100644 index 0000000..c254480 --- /dev/null +++ b/node_modules/ansi-regex/index.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = options => { + options = Object.assign({ + onlyFirst: false + }, options); + + const pattern = [ + '[\\u001B\\u009B][[\\]()#;?]*(?:(?:(?:[a-zA-Z\\d]*(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]*)*)?\\u0007)', + '(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PR-TZcf-ntqry=><~]))' + ].join('|'); + + return new RegExp(pattern, options.onlyFirst ? undefined : 'g'); +}; diff --git a/node_modules/ansi-regex/license b/node_modules/ansi-regex/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/ansi-regex/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ansi-regex/package.json b/node_modules/ansi-regex/package.json new file mode 100644 index 0000000..b082e71 --- /dev/null +++ b/node_modules/ansi-regex/package.json @@ -0,0 +1,85 @@ +{ + "_from": "ansi-regex@^4.1.0", + "_id": "ansi-regex@4.1.0", + "_inBundle": false, + "_integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "_location": "/ansi-regex", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-regex@^4.1.0", + "name": "ansi-regex", + "escapedName": "ansi-regex", + "rawSpec": "^4.1.0", + "saveSpec": null, + "fetchSpec": "^4.1.0" + }, + "_requiredBy": [ + "/strip-ansi" + ], + "_resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "_shasum": "8b9f8f08cf1acb843756a839ca8c7e3168c51997", + "_spec": "ansi-regex@^4.1.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\strip-ansi", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/ansi-regex/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Regular expression for matching ANSI escape codes", + "devDependencies": { + "ava": "^0.25.0", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/chalk/ansi-regex#readme", + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "text", + "regex", + "regexp", + "re", + "match", + "test", + "find", + "pattern" + ], + "license": "MIT", + "name": "ansi-regex", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/ansi-regex.git" + }, + "scripts": { + "test": "xo && ava", + "view-supported": "node fixtures/view-codes.js" + }, + "version": "4.1.0" +} diff --git a/node_modules/ansi-regex/readme.md b/node_modules/ansi-regex/readme.md new file mode 100644 index 0000000..d19c446 --- /dev/null +++ b/node_modules/ansi-regex/readme.md @@ -0,0 +1,87 @@ +# ansi-regex [![Build Status](https://travis-ci.org/chalk/ansi-regex.svg?branch=master)](https://travis-ci.org/chalk/ansi-regex) + +> Regular expression for matching [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+ +--- + + +## Install + +``` +$ npm install ansi-regex +``` + + +## Usage + +```js +const ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001B[4mcake\u001B[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001B[4mcake\u001B[0m'.match(ansiRegex()); +//=> ['\u001B[4m', '\u001B[0m'] + +'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true})); +//=> ['\u001B[4m'] + +'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex()); +//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007'] +``` + + +## API + +### ansiRegex([options]) + +Returns a regex for matching ANSI escape codes. + +#### options + +##### onlyFirst + +Type: `boolean`
+Default: `false` *(Matches any ANSI escape codes in a string)* + +Match only the first ANSI escape. + + +## FAQ + +### Why do you test for codes not in the ECMA 48 standard? + +Some of the codes we run as a test are codes that we acquired finding various lists of non-standard or manufacturer specific codes. We test for both standard and non-standard codes, as most of them follow the same or similar format and can be safely matched in strings without the risk of removing actual string content. There are a few non-standard control codes that do not follow the traditional format (i.e. they end in numbers) thus forcing us to exclude them from the test because we cannot reliably match them. + +On the historical side, those ECMA standards were established in the early 90's whereas the VT100, for example, was designed in the mid/late 70's. At that point in time, control codes were still pretty ungoverned and engineers used them for a multitude of things, namely to activate hardware ports that may have been proprietary. Somewhere else you see a similar 'anarchy' of codes is in the x86 architecture for processors; there are a ton of "interrupts" that can mean different things on certain brands of processors, most of which have been phased out. + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +## License + +MIT diff --git a/node_modules/ansi-styles/index.js b/node_modules/ansi-styles/index.js new file mode 100644 index 0000000..90a871c --- /dev/null +++ b/node_modules/ansi-styles/index.js @@ -0,0 +1,165 @@ +'use strict'; +const colorConvert = require('color-convert'); + +const wrapAnsi16 = (fn, offset) => function () { + const code = fn.apply(colorConvert, arguments); + return `\u001B[${code + offset}m`; +}; + +const wrapAnsi256 = (fn, offset) => function () { + const code = fn.apply(colorConvert, arguments); + return `\u001B[${38 + offset};5;${code}m`; +}; + +const wrapAnsi16m = (fn, offset) => function () { + const rgb = fn.apply(colorConvert, arguments); + return `\u001B[${38 + offset};2;${rgb[0]};${rgb[1]};${rgb[2]}m`; +}; + +function assembleStyles() { + const codes = new Map(); + const styles = { + modifier: { + reset: [0, 0], + // 21 isn't widely supported and 22 does the same thing + bold: [1, 22], + dim: [2, 22], + italic: [3, 23], + underline: [4, 24], + inverse: [7, 27], + hidden: [8, 28], + strikethrough: [9, 29] + }, + color: { + black: [30, 39], + red: [31, 39], + green: [32, 39], + yellow: [33, 39], + blue: [34, 39], + magenta: [35, 39], + cyan: [36, 39], + white: [37, 39], + gray: [90, 39], + + // Bright color + redBright: [91, 39], + greenBright: [92, 39], + yellowBright: [93, 39], + blueBright: [94, 39], + magentaBright: [95, 39], + cyanBright: [96, 39], + whiteBright: [97, 39] + }, + bgColor: { + bgBlack: [40, 49], + bgRed: [41, 49], + bgGreen: [42, 49], + bgYellow: [43, 49], + bgBlue: [44, 49], + bgMagenta: [45, 49], + bgCyan: [46, 49], + bgWhite: [47, 49], + + // Bright color + bgBlackBright: [100, 49], + bgRedBright: [101, 49], + bgGreenBright: [102, 49], + bgYellowBright: [103, 49], + bgBlueBright: [104, 49], + bgMagentaBright: [105, 49], + bgCyanBright: [106, 49], + bgWhiteBright: [107, 49] + } + }; + + // Fix humans + styles.color.grey = styles.color.gray; + + for (const groupName of Object.keys(styles)) { + const group = styles[groupName]; + + for (const styleName of Object.keys(group)) { + const style = group[styleName]; + + styles[styleName] = { + open: `\u001B[${style[0]}m`, + close: `\u001B[${style[1]}m` + }; + + group[styleName] = styles[styleName]; + + codes.set(style[0], style[1]); + } + + Object.defineProperty(styles, groupName, { + value: group, + enumerable: false + }); + + Object.defineProperty(styles, 'codes', { + value: codes, + enumerable: false + }); + } + + const ansi2ansi = n => n; + const rgb2rgb = (r, g, b) => [r, g, b]; + + styles.color.close = '\u001B[39m'; + styles.bgColor.close = '\u001B[49m'; + + styles.color.ansi = { + ansi: wrapAnsi16(ansi2ansi, 0) + }; + styles.color.ansi256 = { + ansi256: wrapAnsi256(ansi2ansi, 0) + }; + styles.color.ansi16m = { + rgb: wrapAnsi16m(rgb2rgb, 0) + }; + + styles.bgColor.ansi = { + ansi: wrapAnsi16(ansi2ansi, 10) + }; + styles.bgColor.ansi256 = { + ansi256: wrapAnsi256(ansi2ansi, 10) + }; + styles.bgColor.ansi16m = { + rgb: wrapAnsi16m(rgb2rgb, 10) + }; + + for (let key of Object.keys(colorConvert)) { + if (typeof colorConvert[key] !== 'object') { + continue; + } + + const suite = colorConvert[key]; + + if (key === 'ansi16') { + key = 'ansi'; + } + + if ('ansi16' in suite) { + styles.color.ansi[key] = wrapAnsi16(suite.ansi16, 0); + styles.bgColor.ansi[key] = wrapAnsi16(suite.ansi16, 10); + } + + if ('ansi256' in suite) { + styles.color.ansi256[key] = wrapAnsi256(suite.ansi256, 0); + styles.bgColor.ansi256[key] = wrapAnsi256(suite.ansi256, 10); + } + + if ('rgb' in suite) { + styles.color.ansi16m[key] = wrapAnsi16m(suite.rgb, 0); + styles.bgColor.ansi16m[key] = wrapAnsi16m(suite.rgb, 10); + } + } + + return styles; +} + +// Make the export immutable +Object.defineProperty(module, 'exports', { + enumerable: true, + get: assembleStyles +}); diff --git a/node_modules/ansi-styles/license b/node_modules/ansi-styles/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/ansi-styles/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ansi-styles/package.json b/node_modules/ansi-styles/package.json new file mode 100644 index 0000000..652de11 --- /dev/null +++ b/node_modules/ansi-styles/package.json @@ -0,0 +1,88 @@ +{ + "_from": "ansi-styles@^3.2.0", + "_id": "ansi-styles@3.2.1", + "_inBundle": false, + "_integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "_location": "/ansi-styles", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-styles@^3.2.0", + "name": "ansi-styles", + "escapedName": "ansi-styles", + "rawSpec": "^3.2.0", + "saveSpec": null, + "fetchSpec": "^3.2.0" + }, + "_requiredBy": [ + "/wrap-ansi" + ], + "_resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "_shasum": "41fbb20243e50b12be0f04b8dedbf07520ce841d", + "_spec": "ansi-styles@^3.2.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\wrap-ansi", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "ava": { + "require": "babel-polyfill" + }, + "bugs": { + "url": "https://github.com/chalk/ansi-styles/issues" + }, + "bundleDependencies": false, + "dependencies": { + "color-convert": "^1.9.0" + }, + "deprecated": false, + "description": "ANSI escape codes for styling strings in the terminal", + "devDependencies": { + "ava": "*", + "babel-polyfill": "^6.23.0", + "svg-term-cli": "^2.1.1", + "xo": "*" + }, + "engines": { + "node": ">=4" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/chalk/ansi-styles#readme", + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "name": "ansi-styles", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/ansi-styles.git" + }, + "scripts": { + "screenshot": "svg-term --command='node screenshot' --out=screenshot.svg --padding=3 --width=55 --height=3 --at=1000 --no-cursor", + "test": "xo && ava" + }, + "version": "3.2.1" +} diff --git a/node_modules/ansi-styles/readme.md b/node_modules/ansi-styles/readme.md new file mode 100644 index 0000000..3158e2d --- /dev/null +++ b/node_modules/ansi-styles/readme.md @@ -0,0 +1,147 @@ +# ansi-styles [![Build Status](https://travis-ci.org/chalk/ansi-styles.svg?branch=master)](https://travis-ci.org/chalk/ansi-styles) + +> [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) for styling strings in the terminal + +You probably want the higher-level [chalk](https://github.com/chalk/chalk) module for styling your strings. + + + + +## Install + +``` +$ npm install ansi-styles +``` + + +## Usage + +```js +const style = require('ansi-styles'); + +console.log(`${style.green.open}Hello world!${style.green.close}`); + + +// Color conversion between 16/256/truecolor +// NOTE: If conversion goes to 16 colors or 256 colors, the original color +// may be degraded to fit that color palette. This means terminals +// that do not support 16 million colors will best-match the +// original color. +console.log(style.bgColor.ansi.hsl(120, 80, 72) + 'Hello world!' + style.bgColor.close); +console.log(style.color.ansi256.rgb(199, 20, 250) + 'Hello world!' + style.color.close); +console.log(style.color.ansi16m.hex('#ABCDEF') + 'Hello world!' + style.color.close); +``` + +## API + +Each style has an `open` and `close` property. + + +## Styles + +### Modifiers + +- `reset` +- `bold` +- `dim` +- `italic` *(Not widely supported)* +- `underline` +- `inverse` +- `hidden` +- `strikethrough` *(Not widely supported)* + +### Colors + +- `black` +- `red` +- `green` +- `yellow` +- `blue` +- `magenta` +- `cyan` +- `white` +- `gray` ("bright black") +- `redBright` +- `greenBright` +- `yellowBright` +- `blueBright` +- `magentaBright` +- `cyanBright` +- `whiteBright` + +### Background colors + +- `bgBlack` +- `bgRed` +- `bgGreen` +- `bgYellow` +- `bgBlue` +- `bgMagenta` +- `bgCyan` +- `bgWhite` +- `bgBlackBright` +- `bgRedBright` +- `bgGreenBright` +- `bgYellowBright` +- `bgBlueBright` +- `bgMagentaBright` +- `bgCyanBright` +- `bgWhiteBright` + + +## Advanced usage + +By default, you get a map of styles, but the styles are also available as groups. They are non-enumerable so they don't show up unless you access them explicitly. This makes it easier to expose only a subset in a higher-level module. + +- `style.modifier` +- `style.color` +- `style.bgColor` + +###### Example + +```js +console.log(style.color.green.open); +``` + +Raw escape codes (i.e. without the CSI escape prefix `\u001B[` and render mode postfix `m`) are available under `style.codes`, which returns a `Map` with the open codes as keys and close codes as values. + +###### Example + +```js +console.log(style.codes.get(36)); +//=> 39 +``` + + +## [256 / 16 million (TrueColor) support](https://gist.github.com/XVilka/8346728) + +`ansi-styles` uses the [`color-convert`](https://github.com/Qix-/color-convert) package to allow for converting between various colors and ANSI escapes, with support for 256 and 16 million colors. + +To use these, call the associated conversion function with the intended output, for example: + +```js +style.color.ansi.rgb(100, 200, 15); // RGB to 16 color ansi foreground code +style.bgColor.ansi.rgb(100, 200, 15); // RGB to 16 color ansi background code + +style.color.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code +style.bgColor.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code + +style.color.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color foreground code +style.bgColor.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color background code +``` + + +## Related + +- [ansi-escapes](https://github.com/sindresorhus/ansi-escapes) - ANSI escape codes for manipulating the terminal + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +## License + +MIT diff --git a/node_modules/axios/CHANGELOG.md b/node_modules/axios/CHANGELOG.md new file mode 100644 index 0000000..1b3c0df --- /dev/null +++ b/node_modules/axios/CHANGELOG.md @@ -0,0 +1,348 @@ +# Changelog + +### 0.19.0 (May 30, 2019) + +Fixes and Functionality: + +- Unzip response body only for statuses != 204 ([#1129](https://github.com/axios/axios/pull/1129)) - drawski +- Destroy stream on exceeding maxContentLength (fixes [#1098](https://github.com/axios/axios/issue/1098)) ([#1485](https://github.com/axios/axios/pull/1485)) - Gadzhi Gadzhiev +- Makes Axios error generic to use AxiosResponse ([#1738](https://github.com/axios/axios/pull/1738)) - Suman Lama +- Fixing Mocha tests by locking follow-redirects version to 1.5.10 ([#1993](https://github.com/axios/axios/pull/1993)) - grumblerchester +- Allow uppercase methods in typings. ([#1781](https://github.com/axios/axios/pull/1781)) - Ken Powers +- Fixing .eslintrc without extension ([#1789](https://github.com/axios/axios/pull/1789)) - Manoel +- Consistent coding style ([#1787](https://github.com/axios/axios/pull/1787)) - Ali Servet Donmez +- Fixing building url with hash mark ([#1771](https://github.com/axios/axios/pull/1771)) - Anatoly Ryabov +- This commit fix building url with hash map (fragment identifier) when parameters are present: they must not be added after `#`, because client cut everything after `#` +- Preserve HTTP method when following redirect ([#1758](https://github.com/axios/axios/pull/1758)) - Rikki Gibson +- Add `getUri` signature to TypeScript definition. ([#1736](https://github.com/axios/axios/pull/1736)) - Alexander Trauzzi +- Adding isAxiosError flag to errors thrown by axios ([#1419](https://github.com/axios/axios/pull/1419)) - Ayush Gupta +- Fix failing SauceLabs tests by updating configuration - Emily Morehouse + +Documentation: + +- Add information about auth parameter to README ([#2166](https://github.com/axios/axios/pull/2166)) - xlaguna +- Add DELETE to list of methods that allow data as a config option ([#2169](https://github.com/axios/axios/pull/2169)) - Daniela Borges Matos de Carvalho +- Update ECOSYSTEM.md - Add Axios Endpoints ([#2176](https://github.com/axios/axios/pull/2176)) - Renan +- Add r2curl in ECOSYSTEM ([#2141](https://github.com/axios/axios/pull/2141)) - 유용우 / CX +- Update README.md - Add instructions for installing with yarn ([#2036](https://github.com/axios/axios/pull/2036)) - Victor Hermes +- Fixing spacing for README.md ([#2066](https://github.com/axios/axios/pull/2066)) - Josh McCarty +- Update README.md. - Change `.then` to `.finally` in example code ([#2090](https://github.com/axios/axios/pull/2090)) - Omar Cai +- Clarify what values responseType can have in Node ([#2121](https://github.com/axios/axios/pull/2121)) - Tyler Breisacher +- docs(ECOSYSTEM): add axios-api-versioning ([#2020](https://github.com/axios/axios/pull/2020)) - Weffe +- It seems that `responseType: 'blob'` doesn't actually work in Node (when I tried using it, response.data was a string, not a Blob, since Node doesn't have Blobs), so this clarifies that this option should only be used in the browser +- Add issue templates - Emily Morehouse +- Update README.md. - Add Querystring library note ([#1896](https://github.com/axios/axios/pull/1896)) - Dmitriy Eroshenko +- Add react-hooks-axios to Libraries section of ECOSYSTEM.md ([#1925](https://github.com/axios/axios/pull/1925)) - Cody Chan +- Clarify in README that default timeout is 0 (no timeout) ([#1750](https://github.com/axios/axios/pull/1750)) - Ben Standefer + +### 0.19.0-beta.1 (Aug 9, 2018) + +**NOTE:** This is a beta version of this release. There may be functionality that is broken in +certain browsers, though we suspect that builds are hanging and not erroring. See +https://saucelabs.com/u/axios for the most up-to-date information. + +New Functionality: + +- Add getUri method ([#1712](https://github.com/axios/axios/issues/1712)) +- Add support for no_proxy env variable ([#1693](https://github.com/axios/axios/issues/1693)) +- Add toJSON to decorated Axios errors to faciliate serialization ([#1625](https://github.com/axios/axios/issues/1625)) +- Add second then on axios call ([#1623](https://github.com/axios/axios/issues/1623)) +- Typings: allow custom return types +- Add option to specify character set in responses (with http adapter) + +Fixes: + +- Fix Keep defaults local to instance ([#385](https://github.com/axios/axios/issues/385)) +- Correctly catch exception in http test ([#1475](https://github.com/axios/axios/issues/1475)) +- Fix accept header normalization ([#1698](https://github.com/axios/axios/issues/1698)) +- Fix http adapter to allow HTTPS connections via HTTP ([#959](https://github.com/axios/axios/issues/959)) +- Fix Removes usage of deprecated Buffer constructor. ([#1555](https://github.com/axios/axios/issues/1555), [#1622](https://github.com/axios/axios/issues/1622)) +- Fix defaults to use httpAdapter if available ([#1285](https://github.com/axios/axios/issues/1285)) + - Fixing defaults to use httpAdapter if available + - Use a safer, cross-platform method to detect the Node environment +- Fix Reject promise if request is cancelled by the browser ([#537](https://github.com/axios/axios/issues/537)) +- [Typescript] Fix missing type parameters on delete/head methods +- [NS]: Send `false` flag isStandardBrowserEnv for Nativescript +- Fix missing type parameters on delete/head +- Fix Default method for an instance always overwritten by get +- Fix type error when socketPath option in AxiosRequestConfig +- Capture errors on request data streams +- Decorate resolve and reject to clear timeout in all cases + +Huge thanks to everyone who contributed to this release via code (authors listed +below) or via reviews and triaging on GitHub: + +- Andrew Scott +- Anthony Gauthier +- arpit +- ascott18 +- Benedikt Rötsch +- Chance Dickson +- Dave Stewart +- Deric Cain +- Guillaume Briday +- Jacob Wejendorp +- Jim Lynch +- johntron +- Justin Beckwith +- Justin Beckwith +- Khaled Garbaya +- Lim Jing Rong +- Mark van den Broek +- Martti Laine +- mattridley +- mattridley +- Nicolas Del Valle +- Nilegfx +- pbarbiero +- Rikki Gibson +- Sako Hartounian +- Shane Fitzpatrick +- Stephan Schneider +- Steven +- Tim Garthwaite +- Tim Johns +- Yutaro Miyazaki + +### 0.18.0 (Feb 19, 2018) + +- Adding support for UNIX Sockets when running with Node.js ([#1070](https://github.com/axios/axios/pull/1070)) +- Fixing typings ([#1177](https://github.com/axios/axios/pull/1177)): + - AxiosRequestConfig.proxy: allows type false + - AxiosProxyConfig: added auth field +- Adding function signature in AxiosInstance interface so AxiosInstance can be invoked ([#1192](https://github.com/axios/axios/pull/1192), [#1254](https://github.com/axios/axios/pull/1254)) +- Allowing maxContentLength to pass through to redirected calls as maxBodyLength in follow-redirects config ([#1287](https://github.com/axios/axios/pull/1287)) +- Fixing configuration when using an instance - method can now be set ([#1342](https://github.com/axios/axios/pull/1342)) + +### 0.17.1 (Nov 11, 2017) + +- Fixing issue with web workers ([#1160](https://github.com/axios/axios/pull/1160)) +- Allowing overriding transport ([#1080](https://github.com/axios/axios/pull/1080)) +- Updating TypeScript typings ([#1165](https://github.com/axios/axios/pull/1165), [#1125](https://github.com/axios/axios/pull/1125), [#1131](https://github.com/axios/axios/pull/1131)) + +### 0.17.0 (Oct 21, 2017) + +- **BREAKING** Fixing issue with `baseURL` and interceptors ([#950](https://github.com/axios/axios/pull/950)) +- **BREAKING** Improving handing of duplicate headers ([#874](https://github.com/axios/axios/pull/874)) +- Adding support for disabling proxies ([#691](https://github.com/axios/axios/pull/691)) +- Updating TypeScript typings with generic type parameters ([#1061](https://github.com/axios/axios/pull/1061)) + +### 0.16.2 (Jun 3, 2017) + +- Fixing issue with including `buffer` in bundle ([#887](https://github.com/axios/axios/pull/887)) +- Including underlying request in errors ([#830](https://github.com/axios/axios/pull/830)) +- Convert `method` to lowercase ([#930](https://github.com/axios/axios/pull/930)) + +### 0.16.1 (Apr 8, 2017) + +- Improving HTTP adapter to return last request in case of redirects ([#828](https://github.com/axios/axios/pull/828)) +- Updating `follow-redirects` dependency ([#829](https://github.com/axios/axios/pull/829)) +- Adding support for passing `Buffer` in node ([#773](https://github.com/axios/axios/pull/773)) + +### 0.16.0 (Mar 31, 2017) + +- **BREAKING** Removing `Promise` from axios typings in favor of built-in type declarations ([#480](https://github.com/axios/axios/issues/480)) +- Adding `options` shortcut method ([#461](https://github.com/axios/axios/pull/461)) +- Fixing issue with using `responseType: 'json'` in browsers incompatible with XHR Level 2 ([#654](https://github.com/axios/axios/pull/654)) +- Improving React Native detection ([#731](https://github.com/axios/axios/pull/731)) +- Fixing `combineURLs` to support empty `relativeURL` ([#581](https://github.com/axios/axios/pull/581)) +- Removing `PROTECTION_PREFIX` support ([#561](https://github.com/axios/axios/pull/561)) + +### 0.15.3 (Nov 27, 2016) + +- Fixing issue with custom instances and global defaults ([#443](https://github.com/axios/axios/issues/443)) +- Renaming `axios.d.ts` to `index.d.ts` ([#519](https://github.com/axios/axios/issues/519)) +- Adding `get`, `head`, and `delete` to `defaults.headers` ([#509](https://github.com/axios/axios/issues/509)) +- Fixing issue with `btoa` and IE ([#507](https://github.com/axios/axios/issues/507)) +- Adding support for proxy authentication ([#483](https://github.com/axios/axios/pull/483)) +- Improving HTTP adapter to use `http` protocol by default ([#493](https://github.com/axios/axios/pull/493)) +- Fixing proxy issues ([#491](https://github.com/axios/axios/pull/491)) + +### 0.15.2 (Oct 17, 2016) + +- Fixing issue with calling `cancel` after response has been received ([#482](https://github.com/axios/axios/issues/482)) + +### 0.15.1 (Oct 14, 2016) + +- Fixing issue with UMD ([#485](https://github.com/axios/axios/issues/485)) + +### 0.15.0 (Oct 10, 2016) + +- Adding cancellation support ([#452](https://github.com/axios/axios/pull/452)) +- Moving default adapter to global defaults ([#437](https://github.com/axios/axios/pull/437)) +- Fixing issue with `file` URI scheme ([#440](https://github.com/axios/axios/pull/440)) +- Fixing issue with `params` objects that have no prototype ([#445](https://github.com/axios/axios/pull/445)) + +### 0.14.0 (Aug 27, 2016) + +- **BREAKING** Updating TypeScript definitions ([#419](https://github.com/axios/axios/pull/419)) +- **BREAKING** Replacing `agent` option with `httpAgent` and `httpsAgent` ([#387](https://github.com/axios/axios/pull/387)) +- **BREAKING** Splitting `progress` event handlers into `onUploadProgress` and `onDownloadProgress` ([#423](https://github.com/axios/axios/pull/423)) +- Adding support for `http_proxy` and `https_proxy` environment variables ([#366](https://github.com/axios/axios/pull/366)) +- Fixing issue with `auth` config option and `Authorization` header ([#397](https://github.com/axios/axios/pull/397)) +- Don't set XSRF header if `xsrfCookieName` is `null` ([#406](https://github.com/axios/axios/pull/406)) + +### 0.13.1 (Jul 16, 2016) + +- Fixing issue with response data not being transformed on error ([#378](https://github.com/axios/axios/issues/378)) + +### 0.13.0 (Jul 13, 2016) + +- **BREAKING** Improved error handling ([#345](https://github.com/axios/axios/pull/345)) +- **BREAKING** Response transformer now invoked in dispatcher not adapter ([10eb238](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e)) +- **BREAKING** Request adapters now return a `Promise` ([157efd5](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a)) +- Fixing issue with `withCredentials` not being overwritten ([#343](https://github.com/axios/axios/issues/343)) +- Fixing regression with request transformer being called before request interceptor ([#352](https://github.com/axios/axios/issues/352)) +- Fixing custom instance defaults ([#341](https://github.com/axios/axios/issues/341)) +- Fixing instances created from `axios.create` to have same API as default axios ([#217](https://github.com/axios/axios/issues/217)) + +### 0.12.0 (May 31, 2016) + +- Adding support for `URLSearchParams` ([#317](https://github.com/axios/axios/pull/317)) +- Adding `maxRedirects` option ([#307](https://github.com/axios/axios/pull/307)) + +### 0.11.1 (May 17, 2016) + +- Fixing IE CORS support ([#313](https://github.com/axios/axios/pull/313)) +- Fixing detection of `FormData` ([#325](https://github.com/axios/axios/pull/325)) +- Adding `Axios` class to exports ([#321](https://github.com/axios/axios/pull/321)) + +### 0.11.0 (Apr 26, 2016) + +- Adding support for Stream with HTTP adapter ([#296](https://github.com/axios/axios/pull/296)) +- Adding support for custom HTTP status code error ranges ([#308](https://github.com/axios/axios/pull/308)) +- Fixing issue with ArrayBuffer ([#299](https://github.com/axios/axios/pull/299)) + +### 0.10.0 (Apr 20, 2016) + +- Fixing issue with some requests sending `undefined` instead of `null` ([#250](https://github.com/axios/axios/pull/250)) +- Fixing basic auth for HTTP adapter ([#252](https://github.com/axios/axios/pull/252)) +- Fixing request timeout for XHR adapter ([#227](https://github.com/axios/axios/pull/227)) +- Fixing IE8 support by using `onreadystatechange` instead of `onload` ([#249](https://github.com/axios/axios/pull/249)) +- Fixing IE9 cross domain requests ([#251](https://github.com/axios/axios/pull/251)) +- Adding `maxContentLength` option ([#275](https://github.com/axios/axios/pull/275)) +- Fixing XHR support for WebWorker environment ([#279](https://github.com/axios/axios/pull/279)) +- Adding request instance to response ([#200](https://github.com/axios/axios/pull/200)) + +### 0.9.1 (Jan 24, 2016) + +- Improving handling of request timeout in node ([#124](https://github.com/axios/axios/issues/124)) +- Fixing network errors not rejecting ([#205](https://github.com/axios/axios/pull/205)) +- Fixing issue with IE rejecting on HTTP 204 ([#201](https://github.com/axios/axios/issues/201)) +- Fixing host/port when following redirects ([#198](https://github.com/axios/axios/pull/198)) + +### 0.9.0 (Jan 18, 2016) + +- Adding support for custom adapters +- Fixing Content-Type header being removed when data is false ([#195](https://github.com/axios/axios/pull/195)) +- Improving XDomainRequest implementation ([#185](https://github.com/axios/axios/pull/185)) +- Improving config merging and order of precedence ([#183](https://github.com/axios/axios/pull/183)) +- Fixing XDomainRequest support for only <= IE9 ([#182](https://github.com/axios/axios/pull/182)) + +### 0.8.1 (Dec 14, 2015) + +- Adding support for passing XSRF token for cross domain requests when using `withCredentials` ([#168](https://github.com/axios/axios/pull/168)) +- Fixing error with format of basic auth header ([#178](https://github.com/axios/axios/pull/173)) +- Fixing error with JSON payloads throwing `InvalidStateError` in some cases ([#174](https://github.com/axios/axios/pull/174)) + +### 0.8.0 (Dec 11, 2015) + +- Adding support for creating instances of axios ([#123](https://github.com/axios/axios/pull/123)) +- Fixing http adapter to use `Buffer` instead of `String` in case of `responseType === 'arraybuffer'` ([#128](https://github.com/axios/axios/pull/128)) +- Adding support for using custom parameter serializer with `paramsSerializer` option ([#121](https://github.com/axios/axios/pull/121)) +- Fixing issue in IE8 caused by `forEach` on `arguments` ([#127](https://github.com/axios/axios/pull/127)) +- Adding support for following redirects in node ([#146](https://github.com/axios/axios/pull/146)) +- Adding support for transparent decompression if `content-encoding` is set ([#149](https://github.com/axios/axios/pull/149)) +- Adding support for transparent XDomainRequest to handle cross domain requests in IE9 ([#140](https://github.com/axios/axios/pull/140)) +- Adding support for HTTP basic auth via Authorization header ([#167](https://github.com/axios/axios/pull/167)) +- Adding support for baseURL option ([#160](https://github.com/axios/axios/pull/160)) + +### 0.7.0 (Sep 29, 2015) + +- Fixing issue with minified bundle in IE8 ([#87](https://github.com/axios/axios/pull/87)) +- Adding support for passing agent in node ([#102](https://github.com/axios/axios/pull/102)) +- Adding support for returning result from `axios.spread` for chaining ([#106](https://github.com/axios/axios/pull/106)) +- Fixing typescript definition ([#105](https://github.com/axios/axios/pull/105)) +- Fixing default timeout config for node ([#112](https://github.com/axios/axios/pull/112)) +- Adding support for use in web workers, and react-native ([#70](https://github.com/axios/axios/issue/70)), ([#98](https://github.com/axios/axios/pull/98)) +- Adding support for fetch like API `axios(url[, config])` ([#116](https://github.com/axios/axios/issues/116)) + +### 0.6.0 (Sep 21, 2015) + +- Removing deprecated success/error aliases +- Fixing issue with array params not being properly encoded ([#49](https://github.com/axios/axios/pull/49)) +- Fixing issue with User-Agent getting overridden ([#69](https://github.com/axios/axios/issues/69)) +- Adding support for timeout config ([#56](https://github.com/axios/axios/issues/56)) +- Removing es6-promise dependency +- Fixing issue preventing `length` to be used as a parameter ([#91](https://github.com/axios/axios/pull/91)) +- Fixing issue with IE8 ([#85](https://github.com/axios/axios/pull/85)) +- Converting build to UMD + +### 0.5.4 (Apr 08, 2015) + +- Fixing issue with FormData not being sent ([#53](https://github.com/axios/axios/issues/53)) + +### 0.5.3 (Apr 07, 2015) + +- Using JSON.parse unconditionally when transforming response string ([#55](https://github.com/axios/axios/issues/55)) + +### 0.5.2 (Mar 13, 2015) + +- Adding support for `statusText` in response ([#46](https://github.com/axios/axios/issues/46)) + +### 0.5.1 (Mar 10, 2015) + +- Fixing issue using strict mode ([#45](https://github.com/axios/axios/issues/45)) +- Fixing issue with standalone build ([#47](https://github.com/axios/axios/issues/47)) + +### 0.5.0 (Jan 23, 2015) + +- Adding support for intercepetors ([#14](https://github.com/axios/axios/issues/14)) +- Updating es6-promise dependency + +### 0.4.2 (Dec 10, 2014) + +- Fixing issue with `Content-Type` when using `FormData` ([#22](https://github.com/axios/axios/issues/22)) +- Adding support for TypeScript ([#25](https://github.com/axios/axios/issues/25)) +- Fixing issue with standalone build ([#29](https://github.com/axios/axios/issues/29)) +- Fixing issue with verbs needing to be capitalized in some browsers ([#30](https://github.com/axios/axios/issues/30)) + +### 0.4.1 (Oct 15, 2014) + +- Adding error handling to request for node.js ([#18](https://github.com/axios/axios/issues/18)) + +### 0.4.0 (Oct 03, 2014) + +- Adding support for `ArrayBuffer` and `ArrayBufferView` ([#10](https://github.com/axios/axios/issues/10)) +- Adding support for utf-8 for node.js ([#13](https://github.com/axios/axios/issues/13)) +- Adding support for SSL for node.js ([#12](https://github.com/axios/axios/issues/12)) +- Fixing incorrect `Content-Type` header ([#9](https://github.com/axios/axios/issues/9)) +- Adding standalone build without bundled es6-promise ([#11](https://github.com/axios/axios/issues/11)) +- Deprecating `success`/`error` in favor of `then`/`catch` + +### 0.3.1 (Sep 16, 2014) + +- Fixing missing post body when using node.js ([#3](https://github.com/axios/axios/issues/3)) + +### 0.3.0 (Sep 16, 2014) + +- Fixing `success` and `error` to properly receive response data as individual arguments ([#8](https://github.com/axios/axios/issues/8)) +- Updating `then` and `catch` to receive response data as a single object ([#6](https://github.com/axios/axios/issues/6)) +- Fixing issue with `all` not working ([#7](https://github.com/axios/axios/issues/7)) + +### 0.2.2 (Sep 14, 2014) + +- Fixing bundling with browserify ([#4](https://github.com/axios/axios/issues/4)) + +### 0.2.1 (Sep 12, 2014) + +- Fixing build problem causing ridiculous file sizes + +### 0.2.0 (Sep 12, 2014) + +- Adding support for `all` and `spread` +- Adding support for node.js ([#1](https://github.com/axios/axios/issues/1)) + +### 0.1.0 (Aug 29, 2014) + +- Initial release diff --git a/node_modules/axios/LICENSE b/node_modules/axios/LICENSE new file mode 100644 index 0000000..d36c80e --- /dev/null +++ b/node_modules/axios/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2014-present Matt Zabriskie + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/axios/README.md b/node_modules/axios/README.md new file mode 100644 index 0000000..2533e8d --- /dev/null +++ b/node_modules/axios/README.md @@ -0,0 +1,684 @@ +# axios + +[![npm version](https://img.shields.io/npm/v/axios.svg?style=flat-square)](https://www.npmjs.org/package/axios) +[![build status](https://img.shields.io/travis/axios/axios.svg?style=flat-square)](https://travis-ci.org/axios/axios) +[![code coverage](https://img.shields.io/coveralls/mzabriskie/axios.svg?style=flat-square)](https://coveralls.io/r/mzabriskie/axios) +[![install size](https://packagephobia.now.sh/badge?p=axios)](https://packagephobia.now.sh/result?p=axios) +[![npm downloads](https://img.shields.io/npm/dm/axios.svg?style=flat-square)](http://npm-stat.com/charts.html?package=axios) +[![gitter chat](https://img.shields.io/gitter/room/mzabriskie/axios.svg?style=flat-square)](https://gitter.im/mzabriskie/axios) +[![code helpers](https://www.codetriage.com/axios/axios/badges/users.svg)](https://www.codetriage.com/axios/axios) + +Promise based HTTP client for the browser and node.js + +## Features + +- Make [XMLHttpRequests](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest) from the browser +- Make [http](http://nodejs.org/api/http.html) requests from node.js +- Supports the [Promise](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise) API +- Intercept request and response +- Transform request and response data +- Cancel requests +- Automatic transforms for JSON data +- Client side support for protecting against [XSRF](http://en.wikipedia.org/wiki/Cross-site_request_forgery) + +## Browser Support + +![Chrome](https://raw.github.com/alrra/browser-logos/master/src/chrome/chrome_48x48.png) | ![Firefox](https://raw.github.com/alrra/browser-logos/master/src/firefox/firefox_48x48.png) | ![Safari](https://raw.github.com/alrra/browser-logos/master/src/safari/safari_48x48.png) | ![Opera](https://raw.github.com/alrra/browser-logos/master/src/opera/opera_48x48.png) | ![Edge](https://raw.github.com/alrra/browser-logos/master/src/edge/edge_48x48.png) | ![IE](https://raw.github.com/alrra/browser-logos/master/src/archive/internet-explorer_9-11/internet-explorer_9-11_48x48.png) | +--- | --- | --- | --- | --- | --- | +Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | Latest ✔ | 11 ✔ | + +[![Browser Matrix](https://saucelabs.com/open_sauce/build_matrix/axios.svg)](https://saucelabs.com/u/axios) + +## Installing + +Using npm: + +```bash +$ npm install axios +``` + +Using bower: + +```bash +$ bower install axios +``` + +Using yarn: + +```bash +$ yarn add axios +``` + +Using cdn: + +```html + +``` + +## Example + +Performing a `GET` request + +```js +const axios = require('axios'); + +// Make a request for a user with a given ID +axios.get('/user?ID=12345') + .then(function (response) { + // handle success + console.log(response); + }) + .catch(function (error) { + // handle error + console.log(error); + }) + .finally(function () { + // always executed + }); + +// Optionally the request above could also be done as +axios.get('/user', { + params: { + ID: 12345 + } + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }) + .then(function () { + // always executed + }); + +// Want to use async/await? Add the `async` keyword to your outer function/method. +async function getUser() { + try { + const response = await axios.get('/user?ID=12345'); + console.log(response); + } catch (error) { + console.error(error); + } +} +``` + +> **NOTE:** `async/await` is part of ECMAScript 2017 and is not supported in Internet +> Explorer and older browsers, so use with caution. + +Performing a `POST` request + +```js +axios.post('/user', { + firstName: 'Fred', + lastName: 'Flintstone' + }) + .then(function (response) { + console.log(response); + }) + .catch(function (error) { + console.log(error); + }); +``` + +Performing multiple concurrent requests + +```js +function getUserAccount() { + return axios.get('/user/12345'); +} + +function getUserPermissions() { + return axios.get('/user/12345/permissions'); +} + +axios.all([getUserAccount(), getUserPermissions()]) + .then(axios.spread(function (acct, perms) { + // Both requests are now complete + })); +``` + +## axios API + +Requests can be made by passing the relevant config to `axios`. + +##### axios(config) + +```js +// Send a POST request +axios({ + method: 'post', + url: '/user/12345', + data: { + firstName: 'Fred', + lastName: 'Flintstone' + } +}); +``` + +```js +// GET request for remote image +axios({ + method: 'get', + url: 'http://bit.ly/2mTM3nY', + responseType: 'stream' +}) + .then(function (response) { + response.data.pipe(fs.createWriteStream('ada_lovelace.jpg')) + }); +``` + +##### axios(url[, config]) + +```js +// Send a GET request (default method) +axios('/user/12345'); +``` + +### Request method aliases + +For convenience aliases have been provided for all supported request methods. + +##### axios.request(config) +##### axios.get(url[, config]) +##### axios.delete(url[, config]) +##### axios.head(url[, config]) +##### axios.options(url[, config]) +##### axios.post(url[, data[, config]]) +##### axios.put(url[, data[, config]]) +##### axios.patch(url[, data[, config]]) + +###### NOTE +When using the alias methods `url`, `method`, and `data` properties don't need to be specified in config. + +### Concurrency + +Helper functions for dealing with concurrent requests. + +##### axios.all(iterable) +##### axios.spread(callback) + +### Creating an instance + +You can create a new instance of axios with a custom config. + +##### axios.create([config]) + +```js +const instance = axios.create({ + baseURL: 'https://some-domain.com/api/', + timeout: 1000, + headers: {'X-Custom-Header': 'foobar'} +}); +``` + +### Instance methods + +The available instance methods are listed below. The specified config will be merged with the instance config. + +##### axios#request(config) +##### axios#get(url[, config]) +##### axios#delete(url[, config]) +##### axios#head(url[, config]) +##### axios#options(url[, config]) +##### axios#post(url[, data[, config]]) +##### axios#put(url[, data[, config]]) +##### axios#patch(url[, data[, config]]) +##### axios#getUri([config]) + +## Request Config + +These are the available config options for making requests. Only the `url` is required. Requests will default to `GET` if `method` is not specified. + +```js +{ + // `url` is the server URL that will be used for the request + url: '/user', + + // `method` is the request method to be used when making the request + method: 'get', // default + + // `baseURL` will be prepended to `url` unless `url` is absolute. + // It can be convenient to set `baseURL` for an instance of axios to pass relative URLs + // to methods of that instance. + baseURL: 'https://some-domain.com/api/', + + // `transformRequest` allows changes to the request data before it is sent to the server + // This is only applicable for request methods 'PUT', 'POST', 'PATCH' and 'DELETE' + // The last function in the array must return a string or an instance of Buffer, ArrayBuffer, + // FormData or Stream + // You may modify the headers object. + transformRequest: [function (data, headers) { + // Do whatever you want to transform the data + + return data; + }], + + // `transformResponse` allows changes to the response data to be made before + // it is passed to then/catch + transformResponse: [function (data) { + // Do whatever you want to transform the data + + return data; + }], + + // `headers` are custom headers to be sent + headers: {'X-Requested-With': 'XMLHttpRequest'}, + + // `params` are the URL parameters to be sent with the request + // Must be a plain object or a URLSearchParams object + params: { + ID: 12345 + }, + + // `paramsSerializer` is an optional function in charge of serializing `params` + // (e.g. https://www.npmjs.com/package/qs, http://api.jquery.com/jquery.param/) + paramsSerializer: function (params) { + return Qs.stringify(params, {arrayFormat: 'brackets'}) + }, + + // `data` is the data to be sent as the request body + // Only applicable for request methods 'PUT', 'POST', and 'PATCH' + // When no `transformRequest` is set, must be of one of the following types: + // - string, plain object, ArrayBuffer, ArrayBufferView, URLSearchParams + // - Browser only: FormData, File, Blob + // - Node only: Stream, Buffer + data: { + firstName: 'Fred' + }, + + // `timeout` specifies the number of milliseconds before the request times out. + // If the request takes longer than `timeout`, the request will be aborted. + timeout: 1000, // default is `0` (no timeout) + + // `withCredentials` indicates whether or not cross-site Access-Control requests + // should be made using credentials + withCredentials: false, // default + + // `adapter` allows custom handling of requests which makes testing easier. + // Return a promise and supply a valid response (see lib/adapters/README.md). + adapter: function (config) { + /* ... */ + }, + + // `auth` indicates that HTTP Basic auth should be used, and supplies credentials. + // This will set an `Authorization` header, overwriting any existing + // `Authorization` custom headers you have set using `headers`. + // Please note that only HTTP Basic auth is configurable through this parameter. + // For Bearer tokens and such, use `Authorization` custom headers instead. + auth: { + username: 'janedoe', + password: 's00pers3cret' + }, + + // `responseType` indicates the type of data that the server will respond with + // options are: 'arraybuffer', 'document', 'json', 'text', 'stream' + // browser only: 'blob' + responseType: 'json', // default + + // `responseEncoding` indicates encoding to use for decoding responses + // Note: Ignored for `responseType` of 'stream' or client-side requests + responseEncoding: 'utf8', // default + + // `xsrfCookieName` is the name of the cookie to use as a value for xsrf token + xsrfCookieName: 'XSRF-TOKEN', // default + + // `xsrfHeaderName` is the name of the http header that carries the xsrf token value + xsrfHeaderName: 'X-XSRF-TOKEN', // default + + // `onUploadProgress` allows handling of progress events for uploads + onUploadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `onDownloadProgress` allows handling of progress events for downloads + onDownloadProgress: function (progressEvent) { + // Do whatever you want with the native progress event + }, + + // `maxContentLength` defines the max size of the http response content in bytes allowed + maxContentLength: 2000, + + // `validateStatus` defines whether to resolve or reject the promise for a given + // HTTP response status code. If `validateStatus` returns `true` (or is set to `null` + // or `undefined`), the promise will be resolved; otherwise, the promise will be + // rejected. + validateStatus: function (status) { + return status >= 200 && status < 300; // default + }, + + // `maxRedirects` defines the maximum number of redirects to follow in node.js. + // If set to 0, no redirects will be followed. + maxRedirects: 5, // default + + // `socketPath` defines a UNIX Socket to be used in node.js. + // e.g. '/var/run/docker.sock' to send requests to the docker daemon. + // Only either `socketPath` or `proxy` can be specified. + // If both are specified, `socketPath` is used. + socketPath: null, // default + + // `httpAgent` and `httpsAgent` define a custom agent to be used when performing http + // and https requests, respectively, in node.js. This allows options to be added like + // `keepAlive` that are not enabled by default. + httpAgent: new http.Agent({ keepAlive: true }), + httpsAgent: new https.Agent({ keepAlive: true }), + + // 'proxy' defines the hostname and port of the proxy server. + // You can also define your proxy using the conventional `http_proxy` and + // `https_proxy` environment variables. If you are using environment variables + // for your proxy configuration, you can also define a `no_proxy` environment + // variable as a comma-separated list of domains that should not be proxied. + // Use `false` to disable proxies, ignoring environment variables. + // `auth` indicates that HTTP Basic auth should be used to connect to the proxy, and + // supplies credentials. + // This will set an `Proxy-Authorization` header, overwriting any existing + // `Proxy-Authorization` custom headers you have set using `headers`. + proxy: { + host: '127.0.0.1', + port: 9000, + auth: { + username: 'mikeymike', + password: 'rapunz3l' + } + }, + + // `cancelToken` specifies a cancel token that can be used to cancel the request + // (see Cancellation section below for details) + cancelToken: new CancelToken(function (cancel) { + }) +} +``` + +## Response Schema + +The response for a request contains the following information. + +```js +{ + // `data` is the response that was provided by the server + data: {}, + + // `status` is the HTTP status code from the server response + status: 200, + + // `statusText` is the HTTP status message from the server response + statusText: 'OK', + + // `headers` the headers that the server responded with + // All header names are lower cased + headers: {}, + + // `config` is the config that was provided to `axios` for the request + config: {}, + + // `request` is the request that generated this response + // It is the last ClientRequest instance in node.js (in redirects) + // and an XMLHttpRequest instance the browser + request: {} +} +``` + +When using `then`, you will receive the response as follows: + +```js +axios.get('/user/12345') + .then(function (response) { + console.log(response.data); + console.log(response.status); + console.log(response.statusText); + console.log(response.headers); + console.log(response.config); + }); +``` + +When using `catch`, or passing a [rejection callback](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Promise/then) as second parameter of `then`, the response will be available through the `error` object as explained in the [Handling Errors](#handling-errors) section. + +## Config Defaults + +You can specify config defaults that will be applied to every request. + +### Global axios defaults + +```js +axios.defaults.baseURL = 'https://api.example.com'; +axios.defaults.headers.common['Authorization'] = AUTH_TOKEN; +axios.defaults.headers.post['Content-Type'] = 'application/x-www-form-urlencoded'; +``` + +### Custom instance defaults + +```js +// Set config defaults when creating the instance +const instance = axios.create({ + baseURL: 'https://api.example.com' +}); + +// Alter defaults after instance has been created +instance.defaults.headers.common['Authorization'] = AUTH_TOKEN; +``` + +### Config order of precedence + +Config will be merged with an order of precedence. The order is library defaults found in [lib/defaults.js](https://github.com/axios/axios/blob/master/lib/defaults.js#L28), then `defaults` property of the instance, and finally `config` argument for the request. The latter will take precedence over the former. Here's an example. + +```js +// Create an instance using the config defaults provided by the library +// At this point the timeout config value is `0` as is the default for the library +const instance = axios.create(); + +// Override timeout default for the library +// Now all requests using this instance will wait 2.5 seconds before timing out +instance.defaults.timeout = 2500; + +// Override timeout for this request as it's known to take a long time +instance.get('/longRequest', { + timeout: 5000 +}); +``` + +## Interceptors + +You can intercept requests or responses before they are handled by `then` or `catch`. + +```js +// Add a request interceptor +axios.interceptors.request.use(function (config) { + // Do something before request is sent + return config; + }, function (error) { + // Do something with request error + return Promise.reject(error); + }); + +// Add a response interceptor +axios.interceptors.response.use(function (response) { + // Do something with response data + return response; + }, function (error) { + // Do something with response error + return Promise.reject(error); + }); +``` + +If you may need to remove an interceptor later you can. + +```js +const myInterceptor = axios.interceptors.request.use(function () {/*...*/}); +axios.interceptors.request.eject(myInterceptor); +``` + +You can add interceptors to a custom instance of axios. + +```js +const instance = axios.create(); +instance.interceptors.request.use(function () {/*...*/}); +``` + +## Handling Errors + +```js +axios.get('/user/12345') + .catch(function (error) { + if (error.response) { + // The request was made and the server responded with a status code + // that falls out of the range of 2xx + console.log(error.response.data); + console.log(error.response.status); + console.log(error.response.headers); + } else if (error.request) { + // The request was made but no response was received + // `error.request` is an instance of XMLHttpRequest in the browser and an instance of + // http.ClientRequest in node.js + console.log(error.request); + } else { + // Something happened in setting up the request that triggered an Error + console.log('Error', error.message); + } + console.log(error.config); + }); +``` + +You can define a custom HTTP status code error range using the `validateStatus` config option. + +```js +axios.get('/user/12345', { + validateStatus: function (status) { + return status < 500; // Reject only if the status code is greater than or equal to 500 + } +}) +``` + +## Cancellation + +You can cancel a request using a *cancel token*. + +> The axios cancel token API is based on the withdrawn [cancelable promises proposal](https://github.com/tc39/proposal-cancelable-promises). + +You can create a cancel token using the `CancelToken.source` factory as shown below: + +```js +const CancelToken = axios.CancelToken; +const source = CancelToken.source(); + +axios.get('/user/12345', { + cancelToken: source.token +}).catch(function (thrown) { + if (axios.isCancel(thrown)) { + console.log('Request canceled', thrown.message); + } else { + // handle error + } +}); + +axios.post('/user/12345', { + name: 'new name' +}, { + cancelToken: source.token +}) + +// cancel the request (the message parameter is optional) +source.cancel('Operation canceled by the user.'); +``` + +You can also create a cancel token by passing an executor function to the `CancelToken` constructor: + +```js +const CancelToken = axios.CancelToken; +let cancel; + +axios.get('/user/12345', { + cancelToken: new CancelToken(function executor(c) { + // An executor function receives a cancel function as a parameter + cancel = c; + }) +}); + +// cancel the request +cancel(); +``` + +> Note: you can cancel several requests with the same cancel token. + +## Using application/x-www-form-urlencoded format + +By default, axios serializes JavaScript objects to `JSON`. To send data in the `application/x-www-form-urlencoded` format instead, you can use one of the following options. + +### Browser + +In a browser, you can use the [`URLSearchParams`](https://developer.mozilla.org/en-US/docs/Web/API/URLSearchParams) API as follows: + +```js +const params = new URLSearchParams(); +params.append('param1', 'value1'); +params.append('param2', 'value2'); +axios.post('/foo', params); +``` + +> Note that `URLSearchParams` is not supported by all browsers (see [caniuse.com](http://www.caniuse.com/#feat=urlsearchparams)), but there is a [polyfill](https://github.com/WebReflection/url-search-params) available (make sure to polyfill the global environment). + +Alternatively, you can encode data using the [`qs`](https://github.com/ljharb/qs) library: + +```js +const qs = require('qs'); +axios.post('/foo', qs.stringify({ 'bar': 123 })); +``` + +Or in another way (ES6), + +```js +import qs from 'qs'; +const data = { 'bar': 123 }; +const options = { + method: 'POST', + headers: { 'content-type': 'application/x-www-form-urlencoded' }, + data: qs.stringify(data), + url, +}; +axios(options); +``` + +### Node.js + +In node.js, you can use the [`querystring`](https://nodejs.org/api/querystring.html) module as follows: + +```js +const querystring = require('querystring'); +axios.post('http://something.com/', querystring.stringify({ foo: 'bar' })); +``` + +You can also use the [`qs`](https://github.com/ljharb/qs) library. + +###### NOTE +The `qs` library is preferable if you need to stringify nested objects, as the `querystring` method has known issues with that use case (https://github.com/nodejs/node-v0.x-archive/issues/1665). + +## Semver + +Until axios reaches a `1.0` release, breaking changes will be released with a new minor version. For example `0.5.1`, and `0.5.4` will have the same API, but `0.6.0` will have breaking changes. + +## Promises + +axios depends on a native ES6 Promise implementation to be [supported](http://caniuse.com/promises). +If your environment doesn't support ES6 Promises, you can [polyfill](https://github.com/jakearchibald/es6-promise). + +## TypeScript +axios includes [TypeScript](http://typescriptlang.org) definitions. +```typescript +import axios from 'axios'; +axios.get('/user?ID=12345'); +``` + +## Resources + +* [Changelog](https://github.com/axios/axios/blob/master/CHANGELOG.md) +* [Upgrade Guide](https://github.com/axios/axios/blob/master/UPGRADE_GUIDE.md) +* [Ecosystem](https://github.com/axios/axios/blob/master/ECOSYSTEM.md) +* [Contributing Guide](https://github.com/axios/axios/blob/master/CONTRIBUTING.md) +* [Code of Conduct](https://github.com/axios/axios/blob/master/CODE_OF_CONDUCT.md) + +## Credits + +axios is heavily inspired by the [$http service](https://docs.angularjs.org/api/ng/service/$http) provided in [Angular](https://angularjs.org/). Ultimately axios is an effort to provide a standalone `$http`-like service for use outside of Angular. + +## License + +MIT diff --git a/node_modules/axios/UPGRADE_GUIDE.md b/node_modules/axios/UPGRADE_GUIDE.md new file mode 100644 index 0000000..eedb049 --- /dev/null +++ b/node_modules/axios/UPGRADE_GUIDE.md @@ -0,0 +1,162 @@ +# Upgrade Guide + +### 0.15.x -> 0.16.0 + +#### `Promise` Type Declarations + +The `Promise` type declarations have been removed from the axios typings in favor of the built-in type declarations. If you use axios in a TypeScript project that targets `ES5`, please make sure to include the `es2015.promise` lib. Please see [this post](https://blog.mariusschulz.com/2016/11/25/typescript-2-0-built-in-type-declarations) for details. + +### 0.13.x -> 0.14.0 + +#### TypeScript Definitions + +The axios TypeScript definitions have been updated to match the axios API and use the ES2015 module syntax. + +Please use the following `import` statement to import axios in TypeScript: + +```typescript +import axios from 'axios'; + +axios.get('/foo') + .then(response => console.log(response)) + .catch(error => console.log(error)); +``` + +#### `agent` Config Option + +The `agent` config option has been replaced with two new options: `httpAgent` and `httpsAgent`. Please use them instead. + +```js +{ + // Define a custom agent for HTTP + httpAgent: new http.Agent({ keepAlive: true }), + // Define a custom agent for HTTPS + httpsAgent: new https.Agent({ keepAlive: true }) +} +``` + +#### `progress` Config Option + +The `progress` config option has been replaced with the `onUploadProgress` and `onDownloadProgress` options. + +```js +{ + // Define a handler for upload progress events + onUploadProgress: function (progressEvent) { + // ... + }, + + // Define a handler for download progress events + onDownloadProgress: function (progressEvent) { + // ... + } +} +``` + +### 0.12.x -> 0.13.0 + +The `0.13.0` release contains several changes to custom adapters and error handling. + +#### Error Handling + +Previous to this release an error could either be a server response with bad status code or an actual `Error`. With this release Promise will always reject with an `Error`. In the case that a response was received, the `Error` will also include the response. + +```js +axios.get('/user/12345') + .catch((error) => { + console.log(error.message); + console.log(error.code); // Not always specified + console.log(error.config); // The config that was used to make the request + console.log(error.response); // Only available if response was received from the server + }); +``` + +#### Request Adapters + +This release changes a few things about how request adapters work. Please take note if you are using your own custom adapter. + +1. Response transformer is now called outside of adapter. +2. Request adapter returns a `Promise`. + +This means that you no longer need to invoke `transformData` on response data. You will also no longer receive `resolve` and `reject` as arguments in your adapter. + +Previous code: + +```js +function myAdapter(resolve, reject, config) { + var response = { + data: transformData( + responseData, + responseHeaders, + config.transformResponse + ), + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); +} +``` + +New code: + +```js +function myAdapter(config) { + return new Promise(function (resolve, reject) { + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders + }; + settle(resolve, reject, response); + }); +} +``` + +See the related commits for more details: +- [Response transformers](https://github.com/axios/axios/commit/10eb23865101f9347570552c04e9d6211376e25e) +- [Request adapter Promise](https://github.com/axios/axios/commit/157efd5615890301824e3121cc6c9d2f9b21f94a) + +### 0.5.x -> 0.6.0 + +The `0.6.0` release contains mostly bug fixes, but there are a couple things to be aware of when upgrading. + +#### ES6 Promise Polyfill + +Up until the `0.6.0` release ES6 `Promise` was being polyfilled using [es6-promise](https://github.com/jakearchibald/es6-promise). With this release, the polyfill has been removed, and you will need to supply it yourself if your environment needs it. + +```js +require('es6-promise').polyfill(); +var axios = require('axios'); +``` + +This will polyfill the global environment, and only needs to be done once. + +#### `axios.success`/`axios.error` + +The `success`, and `error` aliases were deprectated in [0.4.0](https://github.com/axios/axios/blob/master/CHANGELOG.md#040-oct-03-2014). As of this release they have been removed entirely. Instead please use `axios.then`, and `axios.catch` respectively. + +```js +axios.get('some/url') + .then(function (res) { + /* ... */ + }) + .catch(function (err) { + /* ... */ + }); +``` + +#### UMD + +Previous versions of axios shipped with an AMD, CommonJS, and Global build. This has all been rolled into a single UMD build. + +```js +// AMD +require(['bower_components/axios/dist/axios'], function (axios) { + /* ... */ +}); + +// CommonJS +var axios = require('axios/dist/axios'); +``` diff --git a/node_modules/axios/dist/axios.js b/node_modules/axios/dist/axios.js new file mode 100644 index 0000000..5cef419 --- /dev/null +++ b/node_modules/axios/dist/axios.js @@ -0,0 +1,1668 @@ +/* axios v0.19.0 | (c) 2019 by Matt Zabriskie */ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["axios"] = factory(); + else + root["axios"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; +/******/ +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.loaded = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + module.exports = __webpack_require__(1); + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var bind = __webpack_require__(3); + var Axios = __webpack_require__(5); + var mergeConfig = __webpack_require__(22); + var defaults = __webpack_require__(11); + + /** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ + function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + return instance; + } + + // Create the default instance to be exported + var axios = createInstance(defaults); + + // Expose Axios class to allow class inheritance + axios.Axios = Axios; + + // Factory for creating new instances + axios.create = function create(instanceConfig) { + return createInstance(mergeConfig(axios.defaults, instanceConfig)); + }; + + // Expose Cancel & CancelToken + axios.Cancel = __webpack_require__(23); + axios.CancelToken = __webpack_require__(24); + axios.isCancel = __webpack_require__(10); + + // Expose all/spread + axios.all = function all(promises) { + return Promise.all(promises); + }; + axios.spread = __webpack_require__(25); + + module.exports = axios; + + // Allow use of default import syntax in TypeScript + module.exports.default = axios; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var bind = __webpack_require__(3); + var isBuffer = __webpack_require__(4); + + /*global toString:true*/ + + // utils is a library of generic helper functions non-specific to axios + + var toString = Object.prototype.toString; + + /** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ + function isArray(val) { + return toString.call(val) === '[object Array]'; + } + + /** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ + function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; + } + + /** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ + function isFormData(val) { + return (typeof FormData !== 'undefined') && (val instanceof FormData); + } + + /** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ + function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + } + return result; + } + + /** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ + function isString(val) { + return typeof val === 'string'; + } + + /** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ + function isNumber(val) { + return typeof val === 'number'; + } + + /** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ + function isUndefined(val) { + return typeof val === 'undefined'; + } + + /** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ + function isObject(val) { + return val !== null && typeof val === 'object'; + } + + /** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ + function isDate(val) { + return toString.call(val) === '[object Date]'; + } + + /** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ + function isFile(val) { + return toString.call(val) === '[object File]'; + } + + /** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ + function isBlob(val) { + return toString.call(val) === '[object Blob]'; + } + + /** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ + function isFunction(val) { + return toString.call(val) === '[object Function]'; + } + + /** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ + function isStream(val) { + return isObject(val) && isFunction(val.pipe); + } + + /** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ + function isURLSearchParams(val) { + return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; + } + + /** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ + function trim(str) { + return str.replace(/^\s*/, '').replace(/\s*$/, ''); + } + + /** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + * nativescript + * navigator.product -> 'NativeScript' or 'NS' + */ + function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' || + navigator.product === 'NativeScript' || + navigator.product === 'NS')) { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); + } + + /** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ + function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } + } + + /** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ + function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = merge(result[key], val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; + } + + /** + * Function equal to merge with the difference being that no reference + * to original objects is kept. + * + * @see merge + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ + function deepMerge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = deepMerge(result[key], val); + } else if (typeof val === 'object') { + result[key] = deepMerge({}, val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; + } + + /** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ + function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; + } + + module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + deepMerge: deepMerge, + extend: extend, + trim: trim + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + 'use strict'; + + module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /*! + * Determine if an object is a Buffer + * + * @author Feross Aboukhadijeh + * @license MIT + */ + + module.exports = function isBuffer (obj) { + return obj != null && obj.constructor != null && + typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj) + } + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var buildURL = __webpack_require__(6); + var InterceptorManager = __webpack_require__(7); + var dispatchRequest = __webpack_require__(8); + var mergeConfig = __webpack_require__(22); + + /** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ + function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; + } + + /** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ + Axios.prototype.request = function request(config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof config === 'string') { + config = arguments[1] || {}; + config.url = arguments[0]; + } else { + config = config || {}; + } + + config = mergeConfig(this.defaults, config); + config.method = config.method ? config.method.toLowerCase() : 'get'; + + // Hook up interceptors middleware + var chain = [dispatchRequest, undefined]; + var promise = Promise.resolve(config); + + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + chain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + chain.push(interceptor.fulfilled, interceptor.rejected); + }); + + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; + }; + + Axios.prototype.getUri = function getUri(config) { + config = mergeConfig(this.defaults, config); + return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\?/, ''); + }; + + // Provide aliases for supported request methods + utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url + })); + }; + }); + + utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url, + data: data + })); + }; + }); + + module.exports = Axios; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + function encode(val) { + return encodeURIComponent(val). + replace(/%40/gi, '@'). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); + } + + /** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ + module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + var hashmarkIndex = url.indexOf('#'); + if (hashmarkIndex !== -1) { + url = url.slice(0, hashmarkIndex); + } + + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; + }; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + function InterceptorManager() { + this.handlers = []; + } + + /** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ + InterceptorManager.prototype.use = function use(fulfilled, rejected) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected + }); + return this.handlers.length - 1; + }; + + /** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ + InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } + }; + + /** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ + InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); + }; + + module.exports = InterceptorManager; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var transformData = __webpack_require__(9); + var isCancel = __webpack_require__(10); + var defaults = __webpack_require__(11); + var isAbsoluteURL = __webpack_require__(20); + var combineURLs = __webpack_require__(21); + + /** + * Throws a `Cancel` if cancellation has been requested. + */ + function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } + } + + /** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ + module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Support baseURL config + if (config.baseURL && !isAbsoluteURL(config.url)) { + config.url = combineURLs(config.baseURL, config.url); + } + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData( + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers || {} + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData( + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData( + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + /** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ + module.exports = function transformData(data, headers, fns) { + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn(data, headers); + }); + + return data; + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports) { + + 'use strict'; + + module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); + }; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var normalizeHeaderName = __webpack_require__(12); + + var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' + }; + + function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } + } + + function getDefaultAdapter() { + var adapter; + // Only Node.JS has a process variable that is of [[Class]] process + if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { + // For node use HTTP adapter + adapter = __webpack_require__(13); + } else if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = __webpack_require__(13); + } + return adapter; + } + + var defaults = { + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Accept'); + normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data)) { + setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); + return JSON.stringify(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + /*eslint no-param-reassign:0*/ + if (typeof data === 'string') { + try { + data = JSON.parse(data); + } catch (e) { /* Ignore */ } + } + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + } + }; + + defaults.headers = { + common: { + 'Accept': 'application/json, text/plain, */*' + } + }; + + utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; + }); + + utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); + }); + + module.exports = defaults; + + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); + }; + + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + var settle = __webpack_require__(14); + var buildURL = __webpack_require__(6); + var parseHeaders = __webpack_require__(17); + var isURLSameOrigin = __webpack_require__(18); + var createError = __webpack_require__(15); + + module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + // Listen for ready state + request.onreadystatechange = function handleLoad() { + if (!request || request.readyState !== 4) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // Clean up request + request = null; + }; + + // Handle browser request cancellation (as opposed to a manual cancellation) + request.onabort = function handleAbort() { + if (!request) { + return; + } + + reject(createError('Request aborted', config, 'ECONNABORTED', request)); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + var cookies = __webpack_require__(19); + + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (config.withCredentials) { + request.withCredentials = true; + } + + // Add responseType to request if needed + if (config.responseType) { + try { + request.responseType = config.responseType; + } catch (e) { + // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. + // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. + if (config.responseType !== 'json') { + throw e; + } + } + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (!request) { + return; + } + + request.abort(); + reject(cancel); + // Clean up request + request = null; + }); + } + + if (requestData === undefined) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); + }; + + +/***/ }), +/* 14 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var createError = __webpack_require__(15); + + /** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ + module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + if (!validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } + }; + + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var enhanceError = __webpack_require__(16); + + /** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ + module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); + }; + + +/***/ }), +/* 16 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ + module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + + error.request = request; + error.response = response; + error.isAxiosError = true; + + error.toJSON = function() { + return { + // Standard + message: this.message, + name: this.name, + // Microsoft + description: this.description, + number: this.number, + // Mozilla + fileName: this.fileName, + lineNumber: this.lineNumber, + columnNumber: this.columnNumber, + stack: this.stack, + // Axios + config: this.config, + code: this.code + }; + }; + return error; + }; + + +/***/ }), +/* 17 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + // Headers whose duplicates are ignored by node + // c.f. https://nodejs.org/api/http.html#http_message_headers + var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' + ]; + + /** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ + module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; + }; + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() + ); + + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() + ); + + +/***/ }), +/* 20 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ + module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); + }; + + +/***/ }), +/* 21 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ + module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; + }; + + +/***/ }), +/* 22 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var utils = __webpack_require__(2); + + /** + * Config-specific merge-function which creates a new config-object + * by merging two configuration objects together. + * + * @param {Object} config1 + * @param {Object} config2 + * @returns {Object} New object resulting from merging config2 to config1 + */ + module.exports = function mergeConfig(config1, config2) { + // eslint-disable-next-line no-param-reassign + config2 = config2 || {}; + var config = {}; + + utils.forEach(['url', 'method', 'params', 'data'], function valueFromConfig2(prop) { + if (typeof config2[prop] !== 'undefined') { + config[prop] = config2[prop]; + } + }); + + utils.forEach(['headers', 'auth', 'proxy'], function mergeDeepProperties(prop) { + if (utils.isObject(config2[prop])) { + config[prop] = utils.deepMerge(config1[prop], config2[prop]); + } else if (typeof config2[prop] !== 'undefined') { + config[prop] = config2[prop]; + } else if (utils.isObject(config1[prop])) { + config[prop] = utils.deepMerge(config1[prop]); + } else if (typeof config1[prop] !== 'undefined') { + config[prop] = config1[prop]; + } + }); + + utils.forEach([ + 'baseURL', 'transformRequest', 'transformResponse', 'paramsSerializer', + 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName', + 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', 'maxContentLength', + 'validateStatus', 'maxRedirects', 'httpAgent', 'httpsAgent', 'cancelToken', + 'socketPath' + ], function defaultToConfig2(prop) { + if (typeof config2[prop] !== 'undefined') { + config[prop] = config2[prop]; + } else if (typeof config1[prop] !== 'undefined') { + config[prop] = config1[prop]; + } + }); + + return config; + }; + + +/***/ }), +/* 23 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ + function Cancel(message) { + this.message = message; + } + + Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); + }; + + Cancel.prototype.__CANCEL__ = true; + + module.exports = Cancel; + + +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { + + 'use strict'; + + var Cancel = __webpack_require__(23); + + /** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ + function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); + } + + /** + * Throws a `Cancel` if cancellation has been requested. + */ + CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } + }; + + /** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ + CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; + }; + + module.exports = CancelToken; + + +/***/ }), +/* 25 */ +/***/ (function(module, exports) { + + 'use strict'; + + /** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ + module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; + }; + + +/***/ }) +/******/ ]) +}); +; +//# sourceMappingURL=axios.map \ No newline at end of file diff --git a/node_modules/axios/dist/axios.map b/node_modules/axios/dist/axios.map new file mode 100644 index 0000000..6fff93e --- /dev/null +++ b/node_modules/axios/dist/axios.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///webpack/bootstrap ddfe8a04d3b6bbcd8d1c","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./~/is-buffer/index.js","webpack:///./lib/core/Axios.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/core/mergeConfig.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":[],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD,O;ACVA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,uBAAe;AACf;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;ACtCA,yC;;;;;;ACAA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,aAAY,MAAM;AAClB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;;;;;;ACpDA;;AAEA;AACA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,aAAa;AACxB,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,oCAAmC,OAAO;AAC1C;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,SAAS,GAAG,SAAS;AAC5C,4BAA2B;AAC3B;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA,wCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL,iCAAgC;AAChC,MAAK;AACL;AACA;AACA;;AAEA,wCAAuC,OAAO;AAC9C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;AC7UA;;AAEA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;;;;;;ACVA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;;;;;ACVA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;;AAEH;AACA;AACA,IAAG;;AAEH;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA;AACA,MAAK;AACL;AACA,EAAC;;AAED;;;;;;;ACrFA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,QAAO;AACP;AACA;;AAEA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;ACtEA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB;AACA,aAAY,OAAO;AACnB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;AAEA;;;;;;;ACnDA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gCAA+B;AAC/B,wCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,IAAG;AACH;;;;;;;ACrFA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,cAAc;AACzB,YAAW,MAAM;AACjB,YAAW,eAAe;AAC1B,cAAa,EAAE;AACf;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACnBA;;AAEA;AACA;AACA;;;;;;;ACJA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yEAAwE;AACxE;AACA;AACA;AACA,wDAAuD;AACvD;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA,QAAO,YAAY;AACnB;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,EAAC;;AAED;AACA;AACA,EAAC;;AAED;;;;;;;ACjGA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;;;;;;ACXA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA,6CAA4C;AAC5C;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;;;;;;AC7KA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,SAAS;AACpB,YAAW,SAAS;AACpB,YAAW,OAAO;AAClB;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACxBA;;AAEA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;;;;;;;ACjBA;;AAEA;AACA;AACA;AACA,YAAW,MAAM;AACjB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,MAAM;AACnB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACzCA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA,kBAAiB,eAAe;;AAEhC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;ACpDA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,eAAc,OAAO;AACrB,iBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;;;;;;ACnEA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,2CAA0C;AAC1C,UAAS;;AAET;AACA,6DAA4D,wBAAwB;AACpF;AACA,UAAS;;AAET;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,mCAAkC;AAClC,gCAA+B,aAAa,EAAE;AAC9C;AACA;AACA,MAAK;AACL;;;;;;;ACpDA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,cAAa,QAAQ;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;AACA;;;;;;;ACbA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,OAAO;AAClB,YAAW,OAAO;AAClB,cAAa,OAAO;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;;AAEH;AACA;;;;;;;AClDA;;AAEA;AACA;AACA;AACA;AACA,YAAW,QAAQ;AACnB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;;;;;;;AClBA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,YAAW,SAAS;AACpB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;;;;;;;ACxDA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B;AAC/B;AACA;AACA,YAAW,SAAS;AACpB,cAAa;AACb;AACA;AACA;AACA;AACA;AACA","file":"axios.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap ddfe8a04d3b6bbcd8d1c","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(mergeConfig(axios.defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\nvar isBuffer = require('is-buffer');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Function equal to merge with the difference being that no reference\n * to original objects is kept.\n *\n * @see merge\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction deepMerge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = deepMerge(result[key], val);\n } else if (typeof val === 'object') {\n result[key] = deepMerge({}, val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n deepMerge: deepMerge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh \n * @license MIT\n */\n\nmodule.exports = function isBuffer (obj) {\n return obj != null && obj.constructor != null &&\n typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/is-buffer/index.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = arguments[1] || {};\n config.url = arguments[0];\n } else {\n config = config || {};\n }\n\n config = mergeConfig(this.defaults, config);\n config.method = config.method ? config.method.toLowerCase() : 'get';\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar isAbsoluteURL = require('./../helpers/isAbsoluteURL');\nvar combineURLs = require('./../helpers/combineURLs');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 10\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n // Only Node.JS has a process variable that is of [[Class]] process\n if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n } else if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 14\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 15\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n\n error.request = request;\n error.response = response;\n error.isAxiosError = true;\n\n error.toJSON = function() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code\n };\n };\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 16\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 17\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 19\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 20\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 21\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n utils.forEach(['url', 'method', 'params', 'data'], function valueFromConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n }\n });\n\n utils.forEach(['headers', 'auth', 'proxy'], function mergeDeepProperties(prop) {\n if (utils.isObject(config2[prop])) {\n config[prop] = utils.deepMerge(config1[prop], config2[prop]);\n } else if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (utils.isObject(config1[prop])) {\n config[prop] = utils.deepMerge(config1[prop]);\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n utils.forEach([\n 'baseURL', 'transformRequest', 'transformResponse', 'paramsSerializer',\n 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',\n 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', 'maxContentLength',\n 'validateStatus', 'maxRedirects', 'httpAgent', 'httpsAgent', 'cancelToken',\n 'socketPath'\n ], function defaultToConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n return config;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/mergeConfig.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/node_modules/axios/dist/axios.min.js b/node_modules/axios/dist/axios.min.js new file mode 100644 index 0000000..0f36816 --- /dev/null +++ b/node_modules/axios/dist/axios.min.js @@ -0,0 +1,9 @@ +/* axios v0.19.0 | (c) 2019 by Matt Zabriskie */ +!function(e,t){"object"==typeof exports&&"object"==typeof module?module.exports=t():"function"==typeof define&&define.amd?define([],t):"object"==typeof exports?exports.axios=t():e.axios=t()}(this,function(){return function(e){function t(r){if(n[r])return n[r].exports;var o=n[r]={exports:{},id:r,loaded:!1};return e[r].call(o.exports,o,o.exports,t),o.loaded=!0,o.exports}var n={};return t.m=e,t.c=n,t.p="",t(0)}([function(e,t,n){e.exports=n(1)},function(e,t,n){"use strict";function r(e){var t=new i(e),n=s(i.prototype.request,t);return o.extend(n,i.prototype,t),o.extend(n,t),n}var o=n(2),s=n(3),i=n(5),a=n(22),u=n(11),c=r(u);c.Axios=i,c.create=function(e){return r(a(c.defaults,e))},c.Cancel=n(23),c.CancelToken=n(24),c.isCancel=n(10),c.all=function(e){return Promise.all(e)},c.spread=n(25),e.exports=c,e.exports.default=c},function(e,t,n){"use strict";function r(e){return"[object Array]"===j.call(e)}function o(e){return"[object ArrayBuffer]"===j.call(e)}function s(e){return"undefined"!=typeof FormData&&e instanceof FormData}function i(e){var t;return t="undefined"!=typeof ArrayBuffer&&ArrayBuffer.isView?ArrayBuffer.isView(e):e&&e.buffer&&e.buffer instanceof ArrayBuffer}function a(e){return"string"==typeof e}function u(e){return"number"==typeof e}function c(e){return"undefined"==typeof e}function f(e){return null!==e&&"object"==typeof e}function p(e){return"[object Date]"===j.call(e)}function d(e){return"[object File]"===j.call(e)}function l(e){return"[object Blob]"===j.call(e)}function h(e){return"[object Function]"===j.call(e)}function m(e){return f(e)&&h(e.pipe)}function y(e){return"undefined"!=typeof URLSearchParams&&e instanceof URLSearchParams}function g(e){return e.replace(/^\s*/,"").replace(/\s*$/,"")}function x(){return("undefined"==typeof navigator||"ReactNative"!==navigator.product&&"NativeScript"!==navigator.product&&"NS"!==navigator.product)&&("undefined"!=typeof window&&"undefined"!=typeof document)}function v(e,t){if(null!==e&&"undefined"!=typeof e)if("object"!=typeof e&&(e=[e]),r(e))for(var n=0,o=e.length;n + * @license MIT + */ +e.exports=function(e){return null!=e&&null!=e.constructor&&"function"==typeof e.constructor.isBuffer&&e.constructor.isBuffer(e)}},function(e,t,n){"use strict";function r(e){this.defaults=e,this.interceptors={request:new i,response:new i}}var o=n(2),s=n(6),i=n(7),a=n(8),u=n(22);r.prototype.request=function(e){"string"==typeof e?(e=arguments[1]||{},e.url=arguments[0]):e=e||{},e=u(this.defaults,e),e.method=e.method?e.method.toLowerCase():"get";var t=[a,void 0],n=Promise.resolve(e);for(this.interceptors.request.forEach(function(e){t.unshift(e.fulfilled,e.rejected)}),this.interceptors.response.forEach(function(e){t.push(e.fulfilled,e.rejected)});t.length;)n=n.then(t.shift(),t.shift());return n},r.prototype.getUri=function(e){return e=u(this.defaults,e),s(e.url,e.params,e.paramsSerializer).replace(/^\?/,"")},o.forEach(["delete","get","head","options"],function(e){r.prototype[e]=function(t,n){return this.request(o.merge(n||{},{method:e,url:t}))}}),o.forEach(["post","put","patch"],function(e){r.prototype[e]=function(t,n,r){return this.request(o.merge(r||{},{method:e,url:t,data:n}))}}),e.exports=r},function(e,t,n){"use strict";function r(e){return encodeURIComponent(e).replace(/%40/gi,"@").replace(/%3A/gi,":").replace(/%24/g,"$").replace(/%2C/gi,",").replace(/%20/g,"+").replace(/%5B/gi,"[").replace(/%5D/gi,"]")}var o=n(2);e.exports=function(e,t,n){if(!t)return e;var s;if(n)s=n(t);else if(o.isURLSearchParams(t))s=t.toString();else{var i=[];o.forEach(t,function(e,t){null!==e&&"undefined"!=typeof e&&(o.isArray(e)?t+="[]":e=[e],o.forEach(e,function(e){o.isDate(e)?e=e.toISOString():o.isObject(e)&&(e=JSON.stringify(e)),i.push(r(t)+"="+r(e))}))}),s=i.join("&")}if(s){var a=e.indexOf("#");a!==-1&&(e=e.slice(0,a)),e+=(e.indexOf("?")===-1?"?":"&")+s}return e}},function(e,t,n){"use strict";function r(){this.handlers=[]}var o=n(2);r.prototype.use=function(e,t){return this.handlers.push({fulfilled:e,rejected:t}),this.handlers.length-1},r.prototype.eject=function(e){this.handlers[e]&&(this.handlers[e]=null)},r.prototype.forEach=function(e){o.forEach(this.handlers,function(t){null!==t&&e(t)})},e.exports=r},function(e,t,n){"use strict";function r(e){e.cancelToken&&e.cancelToken.throwIfRequested()}var o=n(2),s=n(9),i=n(10),a=n(11),u=n(20),c=n(21);e.exports=function(e){r(e),e.baseURL&&!u(e.url)&&(e.url=c(e.baseURL,e.url)),e.headers=e.headers||{},e.data=s(e.data,e.headers,e.transformRequest),e.headers=o.merge(e.headers.common||{},e.headers[e.method]||{},e.headers||{}),o.forEach(["delete","get","head","post","put","patch","common"],function(t){delete e.headers[t]});var t=e.adapter||a.adapter;return t(e).then(function(t){return r(e),t.data=s(t.data,t.headers,e.transformResponse),t},function(t){return i(t)||(r(e),t&&t.response&&(t.response.data=s(t.response.data,t.response.headers,e.transformResponse))),Promise.reject(t)})}},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t,n){return r.forEach(n,function(n){e=n(e,t)}),e}},function(e,t){"use strict";e.exports=function(e){return!(!e||!e.__CANCEL__)}},function(e,t,n){"use strict";function r(e,t){!s.isUndefined(e)&&s.isUndefined(e["Content-Type"])&&(e["Content-Type"]=t)}function o(){var e;return"undefined"!=typeof process&&"[object process]"===Object.prototype.toString.call(process)?e=n(13):"undefined"!=typeof XMLHttpRequest&&(e=n(13)),e}var s=n(2),i=n(12),a={"Content-Type":"application/x-www-form-urlencoded"},u={adapter:o(),transformRequest:[function(e,t){return i(t,"Accept"),i(t,"Content-Type"),s.isFormData(e)||s.isArrayBuffer(e)||s.isBuffer(e)||s.isStream(e)||s.isFile(e)||s.isBlob(e)?e:s.isArrayBufferView(e)?e.buffer:s.isURLSearchParams(e)?(r(t,"application/x-www-form-urlencoded;charset=utf-8"),e.toString()):s.isObject(e)?(r(t,"application/json;charset=utf-8"),JSON.stringify(e)):e}],transformResponse:[function(e){if("string"==typeof e)try{e=JSON.parse(e)}catch(e){}return e}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,validateStatus:function(e){return e>=200&&e<300}};u.headers={common:{Accept:"application/json, text/plain, */*"}},s.forEach(["delete","get","head"],function(e){u.headers[e]={}}),s.forEach(["post","put","patch"],function(e){u.headers[e]=s.merge(a)}),e.exports=u},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t){r.forEach(e,function(n,r){r!==t&&r.toUpperCase()===t.toUpperCase()&&(e[t]=n,delete e[r])})}},function(e,t,n){"use strict";var r=n(2),o=n(14),s=n(6),i=n(17),a=n(18),u=n(15);e.exports=function(e){return new Promise(function(t,c){var f=e.data,p=e.headers;r.isFormData(f)&&delete p["Content-Type"];var d=new XMLHttpRequest;if(e.auth){var l=e.auth.username||"",h=e.auth.password||"";p.Authorization="Basic "+btoa(l+":"+h)}if(d.open(e.method.toUpperCase(),s(e.url,e.params,e.paramsSerializer),!0),d.timeout=e.timeout,d.onreadystatechange=function(){if(d&&4===d.readyState&&(0!==d.status||d.responseURL&&0===d.responseURL.indexOf("file:"))){var n="getAllResponseHeaders"in d?i(d.getAllResponseHeaders()):null,r=e.responseType&&"text"!==e.responseType?d.response:d.responseText,s={data:r,status:d.status,statusText:d.statusText,headers:n,config:e,request:d};o(t,c,s),d=null}},d.onabort=function(){d&&(c(u("Request aborted",e,"ECONNABORTED",d)),d=null)},d.onerror=function(){c(u("Network Error",e,null,d)),d=null},d.ontimeout=function(){c(u("timeout of "+e.timeout+"ms exceeded",e,"ECONNABORTED",d)),d=null},r.isStandardBrowserEnv()){var m=n(19),y=(e.withCredentials||a(e.url))&&e.xsrfCookieName?m.read(e.xsrfCookieName):void 0;y&&(p[e.xsrfHeaderName]=y)}if("setRequestHeader"in d&&r.forEach(p,function(e,t){"undefined"==typeof f&&"content-type"===t.toLowerCase()?delete p[t]:d.setRequestHeader(t,e)}),e.withCredentials&&(d.withCredentials=!0),e.responseType)try{d.responseType=e.responseType}catch(t){if("json"!==e.responseType)throw t}"function"==typeof e.onDownloadProgress&&d.addEventListener("progress",e.onDownloadProgress),"function"==typeof e.onUploadProgress&&d.upload&&d.upload.addEventListener("progress",e.onUploadProgress),e.cancelToken&&e.cancelToken.promise.then(function(e){d&&(d.abort(),c(e),d=null)}),void 0===f&&(f=null),d.send(f)})}},function(e,t,n){"use strict";var r=n(15);e.exports=function(e,t,n){var o=n.config.validateStatus;!o||o(n.status)?e(n):t(r("Request failed with status code "+n.status,n.config,null,n.request,n))}},function(e,t,n){"use strict";var r=n(16);e.exports=function(e,t,n,o,s){var i=new Error(e);return r(i,t,n,o,s)}},function(e,t){"use strict";e.exports=function(e,t,n,r,o){return e.config=t,n&&(e.code=n),e.request=r,e.response=o,e.isAxiosError=!0,e.toJSON=function(){return{message:this.message,name:this.name,description:this.description,number:this.number,fileName:this.fileName,lineNumber:this.lineNumber,columnNumber:this.columnNumber,stack:this.stack,config:this.config,code:this.code}},e}},function(e,t,n){"use strict";var r=n(2),o=["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"];e.exports=function(e){var t,n,s,i={};return e?(r.forEach(e.split("\n"),function(e){if(s=e.indexOf(":"),t=r.trim(e.substr(0,s)).toLowerCase(),n=r.trim(e.substr(s+1)),t){if(i[t]&&o.indexOf(t)>=0)return;"set-cookie"===t?i[t]=(i[t]?i[t]:[]).concat([n]):i[t]=i[t]?i[t]+", "+n:n}}),i):i}},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){function e(e){var t=e;return n&&(o.setAttribute("href",t),t=o.href),o.setAttribute("href",t),{href:o.href,protocol:o.protocol?o.protocol.replace(/:$/,""):"",host:o.host,search:o.search?o.search.replace(/^\?/,""):"",hash:o.hash?o.hash.replace(/^#/,""):"",hostname:o.hostname,port:o.port,pathname:"/"===o.pathname.charAt(0)?o.pathname:"/"+o.pathname}}var t,n=/(msie|trident)/i.test(navigator.userAgent),o=document.createElement("a");return t=e(window.location.href),function(n){var o=r.isString(n)?e(n):n;return o.protocol===t.protocol&&o.host===t.host}}():function(){return function(){return!0}}()},function(e,t,n){"use strict";var r=n(2);e.exports=r.isStandardBrowserEnv()?function(){return{write:function(e,t,n,o,s,i){var a=[];a.push(e+"="+encodeURIComponent(t)),r.isNumber(n)&&a.push("expires="+new Date(n).toGMTString()),r.isString(o)&&a.push("path="+o),r.isString(s)&&a.push("domain="+s),i===!0&&a.push("secure"),document.cookie=a.join("; ")},read:function(e){var t=document.cookie.match(new RegExp("(^|;\\s*)("+e+")=([^;]*)"));return t?decodeURIComponent(t[3]):null},remove:function(e){this.write(e,"",Date.now()-864e5)}}}():function(){return{write:function(){},read:function(){return null},remove:function(){}}}()},function(e,t){"use strict";e.exports=function(e){return/^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(e)}},function(e,t){"use strict";e.exports=function(e,t){return t?e.replace(/\/+$/,"")+"/"+t.replace(/^\/+/,""):e}},function(e,t,n){"use strict";var r=n(2);e.exports=function(e,t){t=t||{};var n={};return r.forEach(["url","method","params","data"],function(e){"undefined"!=typeof t[e]&&(n[e]=t[e])}),r.forEach(["headers","auth","proxy"],function(o){r.isObject(t[o])?n[o]=r.deepMerge(e[o],t[o]):"undefined"!=typeof t[o]?n[o]=t[o]:r.isObject(e[o])?n[o]=r.deepMerge(e[o]):"undefined"!=typeof e[o]&&(n[o]=e[o])}),r.forEach(["baseURL","transformRequest","transformResponse","paramsSerializer","timeout","withCredentials","adapter","responseType","xsrfCookieName","xsrfHeaderName","onUploadProgress","onDownloadProgress","maxContentLength","validateStatus","maxRedirects","httpAgent","httpsAgent","cancelToken","socketPath"],function(r){"undefined"!=typeof t[r]?n[r]=t[r]:"undefined"!=typeof e[r]&&(n[r]=e[r])}),n}},function(e,t){"use strict";function n(e){this.message=e}n.prototype.toString=function(){return"Cancel"+(this.message?": "+this.message:"")},n.prototype.__CANCEL__=!0,e.exports=n},function(e,t,n){"use strict";function r(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise(function(e){t=e});var n=this;e(function(e){n.reason||(n.reason=new o(e),t(n.reason))})}var o=n(23);r.prototype.throwIfRequested=function(){if(this.reason)throw this.reason},r.source=function(){var e,t=new r(function(t){e=t});return{token:t,cancel:e}},e.exports=r},function(e,t){"use strict";e.exports=function(e){return function(t){return e.apply(null,t)}}}])}); +//# sourceMappingURL=axios.min.map \ No newline at end of file diff --git a/node_modules/axios/dist/axios.min.map b/node_modules/axios/dist/axios.min.map new file mode 100644 index 0000000..8dcff1c --- /dev/null +++ b/node_modules/axios/dist/axios.min.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///axios.min.js","webpack:///webpack/bootstrap 3e317bb69558239a2225","webpack:///./index.js","webpack:///./lib/axios.js","webpack:///./lib/utils.js","webpack:///./lib/helpers/bind.js","webpack:///./~/is-buffer/index.js","webpack:///./lib/core/Axios.js","webpack:///./lib/helpers/buildURL.js","webpack:///./lib/core/InterceptorManager.js","webpack:///./lib/core/dispatchRequest.js","webpack:///./lib/core/transformData.js","webpack:///./lib/cancel/isCancel.js","webpack:///./lib/defaults.js","webpack:///./lib/helpers/normalizeHeaderName.js","webpack:///./lib/adapters/xhr.js","webpack:///./lib/core/settle.js","webpack:///./lib/core/createError.js","webpack:///./lib/core/enhanceError.js","webpack:///./lib/helpers/parseHeaders.js","webpack:///./lib/helpers/isURLSameOrigin.js","webpack:///./lib/helpers/cookies.js","webpack:///./lib/helpers/isAbsoluteURL.js","webpack:///./lib/helpers/combineURLs.js","webpack:///./lib/core/mergeConfig.js","webpack:///./lib/cancel/Cancel.js","webpack:///./lib/cancel/CancelToken.js","webpack:///./lib/helpers/spread.js"],"names":["root","factory","exports","module","define","amd","this","modules","__webpack_require__","moduleId","installedModules","id","loaded","call","m","c","p","createInstance","defaultConfig","context","Axios","instance","bind","prototype","request","utils","extend","mergeConfig","defaults","axios","create","instanceConfig","Cancel","CancelToken","isCancel","all","promises","Promise","spread","default","isArray","val","toString","isArrayBuffer","isFormData","FormData","isArrayBufferView","result","ArrayBuffer","isView","buffer","isString","isNumber","isUndefined","isObject","isDate","isFile","isBlob","isFunction","isStream","pipe","isURLSearchParams","URLSearchParams","trim","str","replace","isStandardBrowserEnv","navigator","product","window","document","forEach","obj","fn","i","l","length","key","Object","hasOwnProperty","merge","assignValue","arguments","deepMerge","a","b","thisArg","isBuffer","args","Array","apply","constructor","interceptors","InterceptorManager","response","buildURL","dispatchRequest","config","url","method","toLowerCase","chain","undefined","promise","resolve","interceptor","unshift","fulfilled","rejected","push","then","shift","getUri","params","paramsSerializer","data","encode","encodeURIComponent","serializedParams","parts","v","toISOString","JSON","stringify","join","hashmarkIndex","indexOf","slice","handlers","use","eject","h","throwIfCancellationRequested","cancelToken","throwIfRequested","transformData","isAbsoluteURL","combineURLs","baseURL","headers","transformRequest","common","adapter","transformResponse","reason","reject","fns","value","__CANCEL__","setContentTypeIfUnset","getDefaultAdapter","process","XMLHttpRequest","normalizeHeaderName","DEFAULT_CONTENT_TYPE","Content-Type","parse","e","timeout","xsrfCookieName","xsrfHeaderName","maxContentLength","validateStatus","status","Accept","normalizedName","name","toUpperCase","settle","parseHeaders","isURLSameOrigin","createError","requestData","requestHeaders","auth","username","password","Authorization","btoa","open","onreadystatechange","readyState","responseURL","responseHeaders","getAllResponseHeaders","responseData","responseType","responseText","statusText","onabort","onerror","ontimeout","cookies","xsrfValue","withCredentials","read","setRequestHeader","onDownloadProgress","addEventListener","onUploadProgress","upload","cancel","abort","send","enhanceError","message","code","error","Error","isAxiosError","toJSON","description","number","fileName","lineNumber","columnNumber","stack","ignoreDuplicateOf","parsed","split","line","substr","concat","resolveURL","href","msie","urlParsingNode","setAttribute","protocol","host","search","hash","hostname","port","pathname","charAt","originURL","test","userAgent","createElement","location","requestURL","write","expires","path","domain","secure","cookie","Date","toGMTString","match","RegExp","decodeURIComponent","remove","now","relativeURL","config1","config2","prop","executor","TypeError","resolvePromise","token","source","callback","arr"],"mappings":"CAAA,SAAAA,EAAAC,GACA,gBAAAC,UAAA,gBAAAC,QACAA,OAAAD,QAAAD,IACA,kBAAAG,gBAAAC,IACAD,UAAAH,GACA,gBAAAC,SACAA,QAAA,MAAAD,IAEAD,EAAA,MAAAC,KACCK,KAAA,WACD,MCAgB,UAAUC,GCN1B,QAAAC,GAAAC,GAGA,GAAAC,EAAAD,GACA,MAAAC,GAAAD,GAAAP,OAGA,IAAAC,GAAAO,EAAAD,IACAP,WACAS,GAAAF,EACAG,QAAA,EAUA,OANAL,GAAAE,GAAAI,KAAAV,EAAAD,QAAAC,IAAAD,QAAAM,GAGAL,EAAAS,QAAA,EAGAT,EAAAD,QAvBA,GAAAQ,KAqCA,OATAF,GAAAM,EAAAP,EAGAC,EAAAO,EAAAL,EAGAF,EAAAQ,EAAA,GAGAR,EAAA,KDgBM,SAAUL,EAAQD,EAASM,GEtDjCL,EAAAD,QAAAM,EAAA,IF4DM,SAAUL,EAAQD,EAASM,GG5DjC,YAcA,SAAAS,GAAAC,GACA,GAAAC,GAAA,GAAAC,GAAAF,GACAG,EAAAC,EAAAF,EAAAG,UAAAC,QAAAL,EAQA,OALAM,GAAAC,OAAAL,EAAAD,EAAAG,UAAAJ,GAGAM,EAAAC,OAAAL,EAAAF,GAEAE,EAtBA,GAAAI,GAAAjB,EAAA,GACAc,EAAAd,EAAA,GACAY,EAAAZ,EAAA,GACAmB,EAAAnB,EAAA,IACAoB,EAAApB,EAAA,IAsBAqB,EAAAZ,EAAAW,EAGAC,GAAAT,QAGAS,EAAAC,OAAA,SAAAC,GACA,MAAAd,GAAAU,EAAAE,EAAAD,SAAAG,KAIAF,EAAAG,OAAAxB,EAAA,IACAqB,EAAAI,YAAAzB,EAAA,IACAqB,EAAAK,SAAA1B,EAAA,IAGAqB,EAAAM,IAAA,SAAAC,GACA,MAAAC,SAAAF,IAAAC,IAEAP,EAAAS,OAAA9B,EAAA,IAEAL,EAAAD,QAAA2B,EAGA1B,EAAAD,QAAAqC,QAAAV,GHmEM,SAAU1B,EAAQD,EAASM,GIvHjC,YAiBA,SAAAgC,GAAAC,GACA,yBAAAC,EAAA7B,KAAA4B,GASA,QAAAE,GAAAF,GACA,+BAAAC,EAAA7B,KAAA4B,GASA,QAAAG,GAAAH,GACA,yBAAAI,WAAAJ,YAAAI,UASA,QAAAC,GAAAL,GACA,GAAAM,EAMA,OAJAA,GADA,mBAAAC,0BAAA,OACAA,YAAAC,OAAAR,GAEA,GAAAA,EAAA,QAAAA,EAAAS,iBAAAF,aAWA,QAAAG,GAAAV,GACA,sBAAAA,GASA,QAAAW,GAAAX,GACA,sBAAAA,GASA,QAAAY,GAAAZ,GACA,yBAAAA,GASA,QAAAa,GAAAb,GACA,cAAAA,GAAA,gBAAAA,GASA,QAAAc,GAAAd,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAe,GAAAf,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAgB,GAAAhB,GACA,wBAAAC,EAAA7B,KAAA4B,GASA,QAAAiB,GAAAjB,GACA,4BAAAC,EAAA7B,KAAA4B,GASA,QAAAkB,GAAAlB,GACA,MAAAa,GAAAb,IAAAiB,EAAAjB,EAAAmB,MASA,QAAAC,GAAApB,GACA,yBAAAqB,kBAAArB,YAAAqB,iBASA,QAAAC,GAAAC,GACA,MAAAA,GAAAC,QAAA,WAAAA,QAAA,WAkBA,QAAAC,KACA,0BAAAC,YAAA,gBAAAA,UAAAC,SACA,iBAAAD,UAAAC,SACA,OAAAD,UAAAC,WAIA,mBAAAC,SACA,mBAAAC,WAgBA,QAAAC,GAAAC,EAAAC,GAEA,UAAAD,GAAA,mBAAAA,GAUA,GALA,gBAAAA,KAEAA,OAGAhC,EAAAgC,GAEA,OAAAE,GAAA,EAAAC,EAAAH,EAAAI,OAAmCF,EAAAC,EAAOD,IAC1CD,EAAA5D,KAAA,KAAA2D,EAAAE,KAAAF,OAIA,QAAAK,KAAAL,GACAM,OAAAvD,UAAAwD,eAAAlE,KAAA2D,EAAAK,IACAJ,EAAA5D,KAAA,KAAA2D,EAAAK,KAAAL,GAuBA,QAAAQ,KAEA,QAAAC,GAAAxC,EAAAoC,GACA,gBAAA9B,GAAA8B,IAAA,gBAAApC,GACAM,EAAA8B,GAAAG,EAAAjC,EAAA8B,GAAApC,GAEAM,EAAA8B,GAAApC,EAIA,OATAM,MASA2B,EAAA,EAAAC,EAAAO,UAAAN,OAAuCF,EAAAC,EAAOD,IAC9CH,EAAAW,UAAAR,GAAAO,EAEA,OAAAlC,GAWA,QAAAoC,KAEA,QAAAF,GAAAxC,EAAAoC,GACA,gBAAA9B,GAAA8B,IAAA,gBAAApC,GACAM,EAAA8B,GAAAM,EAAApC,EAAA8B,GAAApC,GACK,gBAAAA,GACLM,EAAA8B,GAAAM,KAAgC1C,GAEhCM,EAAA8B,GAAApC,EAIA,OAXAM,MAWA2B,EAAA,EAAAC,EAAAO,UAAAN,OAAuCF,EAAAC,EAAOD,IAC9CH,EAAAW,UAAAR,GAAAO,EAEA,OAAAlC,GAWA,QAAArB,GAAA0D,EAAAC,EAAAC,GAQA,MAPAf,GAAAc,EAAA,SAAA5C,EAAAoC,GACAS,GAAA,kBAAA7C,GACA2C,EAAAP,GAAAvD,EAAAmB,EAAA6C,GAEAF,EAAAP,GAAApC,IAGA2C,EAlTA,GAAA9D,GAAAd,EAAA,GACA+E,EAAA/E,EAAA,GAMAkC,EAAAoC,OAAAvD,UAAAmB,QA8SAvC,GAAAD,SACAsC,UACAG,gBACA4C,WACA3C,aACAE,oBACAK,WACAC,WACAE,WACAD,cACAE,SACAC,SACAC,SACAC,aACAC,WACAE,oBACAK,uBACAK,UACAS,QACAG,YACAzD,SACAqC,SJ+HM,SAAU5D,EAAQD,GK3cxB,YAEAC,GAAAD,QAAA,SAAAuE,EAAAa,GACA,kBAEA,OADAE,GAAA,GAAAC,OAAAP,UAAAN,QACAF,EAAA,EAAmBA,EAAAc,EAAAZ,OAAiBF,IACpCc,EAAAd,GAAAQ,UAAAR,EAEA,OAAAD,GAAAiB,MAAAJ,EAAAE,MLodM,SAAUrF,EAAQD;;;;;;AMrdxBC,EAAAD,QAAA,SAAAsE,GACA,aAAAA,GAAA,MAAAA,EAAAmB,aACA,kBAAAnB,GAAAmB,YAAAJ,UAAAf,EAAAmB,YAAAJ,SAAAf,KNoeM,SAAUrE,EAAQD,EAASM,GO7ejC,YAaA,SAAAY,GAAAW,GACAzB,KAAAsB,SAAAG,EACAzB,KAAAsF,cACApE,QAAA,GAAAqE,GACAC,SAAA,GAAAD,IAfA,GAAApE,GAAAjB,EAAA,GACAuF,EAAAvF,EAAA,GACAqF,EAAArF,EAAA,GACAwF,EAAAxF,EAAA,GACAmB,EAAAnB,EAAA,GAoBAY,GAAAG,UAAAC,QAAA,SAAAyE,GAGA,gBAAAA,IACAA,EAAAf,UAAA,OACAe,EAAAC,IAAAhB,UAAA,IAEAe,QAGAA,EAAAtE,EAAArB,KAAAsB,SAAAqE,GACAA,EAAAE,OAAAF,EAAAE,OAAAF,EAAAE,OAAAC,cAAA,KAGA,IAAAC,IAAAL,EAAAM,QACAC,EAAAlE,QAAAmE,QAAAP,EAUA,KARA3F,KAAAsF,aAAApE,QAAA+C,QAAA,SAAAkC,GACAJ,EAAAK,QAAAD,EAAAE,UAAAF,EAAAG,YAGAtG,KAAAsF,aAAAE,SAAAvB,QAAA,SAAAkC,GACAJ,EAAAQ,KAAAJ,EAAAE,UAAAF,EAAAG,YAGAP,EAAAzB,QACA2B,IAAAO,KAAAT,EAAAU,QAAAV,EAAAU,QAGA,OAAAR,IAGAnF,EAAAG,UAAAyF,OAAA,SAAAf,GAEA,MADAA,GAAAtE,EAAArB,KAAAsB,SAAAqE,GACAF,EAAAE,EAAAC,IAAAD,EAAAgB,OAAAhB,EAAAiB,kBAAAjD,QAAA,WAIAxC,EAAA8C,SAAA,0CAAA4B,GAEA/E,EAAAG,UAAA4E,GAAA,SAAAD,EAAAD,GACA,MAAA3F,MAAAkB,QAAAC,EAAAuD,MAAAiB,OACAE,SACAD,YAKAzE,EAAA8C,SAAA,+BAAA4B,GAEA/E,EAAAG,UAAA4E,GAAA,SAAAD,EAAAiB,EAAAlB,GACA,MAAA3F,MAAAkB,QAAAC,EAAAuD,MAAAiB,OACAE,SACAD,MACAiB,aAKAhH,EAAAD,QAAAkB,GPofM,SAAUjB,EAAQD,EAASM,GQzkBjC,YAIA,SAAA4G,GAAA3E,GACA,MAAA4E,oBAAA5E,GACAwB,QAAA,aACAA,QAAA,aACAA,QAAA,YACAA,QAAA,aACAA,QAAA,YACAA,QAAA,aACAA,QAAA,aAVA,GAAAxC,GAAAjB,EAAA,EAoBAL,GAAAD,QAAA,SAAAgG,EAAAe,EAAAC,GAEA,IAAAD,EACA,MAAAf,EAGA,IAAAoB,EACA,IAAAJ,EACAI,EAAAJ,EAAAD,OACG,IAAAxF,EAAAoC,kBAAAoD,GACHK,EAAAL,EAAAvE,eACG,CACH,GAAA6E,KAEA9F,GAAA8C,QAAA0C,EAAA,SAAAxE,EAAAoC,GACA,OAAApC,GAAA,mBAAAA,KAIAhB,EAAAe,QAAAC,GACAoC,GAAA,KAEApC,MAGAhB,EAAA8C,QAAA9B,EAAA,SAAA+E,GACA/F,EAAA8B,OAAAiE,GACAA,IAAAC,cACShG,EAAA6B,SAAAkE,KACTA,EAAAE,KAAAC,UAAAH,IAEAD,EAAAV,KAAAO,EAAAvC,GAAA,IAAAuC,EAAAI,SAIAF,EAAAC,EAAAK,KAAA,KAGA,GAAAN,EAAA,CACA,GAAAO,GAAA3B,EAAA4B,QAAA,IACAD,MAAA,IACA3B,IAAA6B,MAAA,EAAAF,IAGA3B,MAAA4B,QAAA,mBAAAR,EAGA,MAAApB,KRilBM,SAAU/F,EAAQD,EAASM,GStpBjC,YAIA,SAAAqF,KACAvF,KAAA0H,YAHA,GAAAvG,GAAAjB,EAAA,EAcAqF,GAAAtE,UAAA0G,IAAA,SAAAtB,EAAAC,GAKA,MAJAtG,MAAA0H,SAAAnB,MACAF,YACAC,aAEAtG,KAAA0H,SAAApD,OAAA,GAQAiB,EAAAtE,UAAA2G,MAAA,SAAAvH,GACAL,KAAA0H,SAAArH,KACAL,KAAA0H,SAAArH,GAAA,OAYAkF,EAAAtE,UAAAgD,QAAA,SAAAE,GACAhD,EAAA8C,QAAAjE,KAAA0H,SAAA,SAAAG,GACA,OAAAA,GACA1D,EAAA0D,MAKAhI,EAAAD,QAAA2F,GT6pBM,SAAU1F,EAAQD,EAASM,GUhtBjC,YAYA,SAAA4H,GAAAnC,GACAA,EAAAoC,aACApC,EAAAoC,YAAAC,mBAZA,GAAA7G,GAAAjB,EAAA,GACA+H,EAAA/H,EAAA,GACA0B,EAAA1B,EAAA,IACAoB,EAAApB,EAAA,IACAgI,EAAAhI,EAAA,IACAiI,EAAAjI,EAAA,GAiBAL,GAAAD,QAAA,SAAA+F,GACAmC,EAAAnC,GAGAA,EAAAyC,UAAAF,EAAAvC,EAAAC,OACAD,EAAAC,IAAAuC,EAAAxC,EAAAyC,QAAAzC,EAAAC,MAIAD,EAAA0C,QAAA1C,EAAA0C,YAGA1C,EAAAkB,KAAAoB,EACAtC,EAAAkB,KACAlB,EAAA0C,QACA1C,EAAA2C,kBAIA3C,EAAA0C,QAAAlH,EAAAuD,MACAiB,EAAA0C,QAAAE,WACA5C,EAAA0C,QAAA1C,EAAAE,YACAF,EAAA0C,aAGAlH,EAAA8C,SACA,qDACA,SAAA4B,SACAF,GAAA0C,QAAAxC,IAIA,IAAA2C,GAAA7C,EAAA6C,SAAAlH,EAAAkH,OAEA,OAAAA,GAAA7C,GAAAa,KAAA,SAAAhB,GAUA,MATAsC,GAAAnC,GAGAH,EAAAqB,KAAAoB,EACAzC,EAAAqB,KACArB,EAAA6C,QACA1C,EAAA8C,mBAGAjD,GACG,SAAAkD,GAcH,MAbA9G,GAAA8G,KACAZ,EAAAnC,GAGA+C,KAAAlD,WACAkD,EAAAlD,SAAAqB,KAAAoB,EACAS,EAAAlD,SAAAqB,KACA6B,EAAAlD,SAAA6C,QACA1C,EAAA8C,qBAKA1G,QAAA4G,OAAAD,OVytBM,SAAU7I,EAAQD,EAASM,GW5yBjC,YAEA,IAAAiB,GAAAjB,EAAA,EAUAL,GAAAD,QAAA,SAAAiH,EAAAwB,EAAAO,GAMA,MAJAzH,GAAA8C,QAAA2E,EAAA,SAAAzE,GACA0C,EAAA1C,EAAA0C,EAAAwB,KAGAxB,IXozBM,SAAUhH,EAAQD,GYt0BxB,YAEAC,GAAAD,QAAA,SAAAiJ,GACA,SAAAA,MAAAC,cZ80BM,SAAUjJ,EAAQD,EAASM,Gaj1BjC,YASA,SAAA6I,GAAAV,EAAAQ,IACA1H,EAAA4B,YAAAsF,IAAAlH,EAAA4B,YAAAsF,EAAA,mBACAA,EAAA,gBAAAQ,GAIA,QAAAG,KACA,GAAAR,EASA,OAPA,mBAAAS,UAAA,qBAAAzE,OAAAvD,UAAAmB,SAAA7B,KAAA0I,SAEAT,EAAAtI,EAAA,IACG,mBAAAgJ,kBAEHV,EAAAtI,EAAA,KAEAsI,EAvBA,GAAArH,GAAAjB,EAAA,GACAiJ,EAAAjJ,EAAA,IAEAkJ,GACAC,eAAA,qCAsBA/H,GACAkH,QAAAQ,IAEAV,kBAAA,SAAAzB,EAAAwB,GAGA,MAFAc,GAAAd,EAAA,UACAc,EAAAd,EAAA,gBACAlH,EAAAmB,WAAAuE,IACA1F,EAAAkB,cAAAwE,IACA1F,EAAA8D,SAAA4B,IACA1F,EAAAkC,SAAAwD,IACA1F,EAAA+B,OAAA2D,IACA1F,EAAAgC,OAAA0D,GAEAA,EAEA1F,EAAAqB,kBAAAqE,GACAA,EAAAjE,OAEAzB,EAAAoC,kBAAAsD,IACAkC,EAAAV,EAAA,mDACAxB,EAAAzE,YAEAjB,EAAA6B,SAAA6D,IACAkC,EAAAV,EAAA,kCACAjB,KAAAC,UAAAR,IAEAA,IAGA4B,mBAAA,SAAA5B,GAEA,mBAAAA,GACA,IACAA,EAAAO,KAAAkC,MAAAzC,GACO,MAAA0C,IAEP,MAAA1C,KAOA2C,QAAA,EAEAC,eAAA,aACAC,eAAA,eAEAC,kBAAA,EAEAC,eAAA,SAAAC,GACA,MAAAA,IAAA,KAAAA,EAAA,KAIAvI,GAAA+G,SACAE,QACAuB,OAAA,sCAIA3I,EAAA8C,SAAA,gCAAA4B,GACAvE,EAAA+G,QAAAxC,QAGA1E,EAAA8C,SAAA,+BAAA4B,GACAvE,EAAA+G,QAAAxC,GAAA1E,EAAAuD,MAAA0E,KAGAvJ,EAAAD,QAAA0B,Gbw1BM,SAAUzB,EAAQD,EAASM,Gcz7BjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QAAA,SAAAyI,EAAA0B,GACA5I,EAAA8C,QAAAoE,EAAA,SAAAQ,EAAAmB,GACAA,IAAAD,GAAAC,EAAAC,gBAAAF,EAAAE,gBACA5B,EAAA0B,GAAAlB,QACAR,GAAA2B,Qdm8BM,SAAUnK,EAAQD,EAASM,Ge38BjC,YAEA,IAAAiB,GAAAjB,EAAA,GACAgK,EAAAhK,EAAA,IACAuF,EAAAvF,EAAA,GACAiK,EAAAjK,EAAA,IACAkK,EAAAlK,EAAA,IACAmK,EAAAnK,EAAA,GAEAL,GAAAD,QAAA,SAAA+F,GACA,UAAA5D,SAAA,SAAAmE,EAAAyC,GACA,GAAA2B,GAAA3E,EAAAkB,KACA0D,EAAA5E,EAAA0C,OAEAlH,GAAAmB,WAAAgI,UACAC,GAAA,eAGA,IAAArJ,GAAA,GAAAgI,eAGA,IAAAvD,EAAA6E,KAAA,CACA,GAAAC,GAAA9E,EAAA6E,KAAAC,UAAA,GACAC,EAAA/E,EAAA6E,KAAAE,UAAA,EACAH,GAAAI,cAAA,SAAAC,KAAAH,EAAA,IAAAC,GA0EA,GAvEAxJ,EAAA2J,KAAAlF,EAAAE,OAAAoE,cAAAxE,EAAAE,EAAAC,IAAAD,EAAAgB,OAAAhB,EAAAiB,mBAAA,GAGA1F,EAAAsI,QAAA7D,EAAA6D,QAGAtI,EAAA4J,mBAAA,WACA,GAAA5J,GAAA,IAAAA,EAAA6J,aAQA,IAAA7J,EAAA2I,QAAA3I,EAAA8J,aAAA,IAAA9J,EAAA8J,YAAAxD,QAAA,WAKA,GAAAyD,GAAA,yBAAA/J,GAAAiJ,EAAAjJ,EAAAgK,yBAAA,KACAC,EAAAxF,EAAAyF,cAAA,SAAAzF,EAAAyF,aAAAlK,EAAAsE,SAAAtE,EAAAmK,aACA7F,GACAqB,KAAAsE,EACAtB,OAAA3I,EAAA2I,OACAyB,WAAApK,EAAAoK,WACAjD,QAAA4C,EACAtF,SACAzE,UAGAgJ,GAAAhE,EAAAyC,EAAAnD,GAGAtE,EAAA,OAIAA,EAAAqK,QAAA,WACArK,IAIAyH,EAAA0B,EAAA,kBAAA1E,EAAA,eAAAzE,IAGAA,EAAA,OAIAA,EAAAsK,QAAA,WAGA7C,EAAA0B,EAAA,gBAAA1E,EAAA,KAAAzE,IAGAA,EAAA,MAIAA,EAAAuK,UAAA,WACA9C,EAAA0B,EAAA,cAAA1E,EAAA6D,QAAA,cAAA7D,EAAA,eACAzE,IAGAA,EAAA,MAMAC,EAAAyC,uBAAA,CACA,GAAA8H,GAAAxL,EAAA,IAGAyL,GAAAhG,EAAAiG,iBAAAxB,EAAAzE,EAAAC,OAAAD,EAAA8D,eACAiC,EAAAG,KAAAlG,EAAA8D,gBACAzD,MAEA2F,KACApB,EAAA5E,EAAA+D,gBAAAiC,GAuBA,GAlBA,oBAAAzK,IACAC,EAAA8C,QAAAsG,EAAA,SAAApI,EAAAoC,GACA,mBAAA+F,IAAA,iBAAA/F,EAAAuB,oBAEAyE,GAAAhG,GAGArD,EAAA4K,iBAAAvH,EAAApC,KAMAwD,EAAAiG,kBACA1K,EAAA0K,iBAAA,GAIAjG,EAAAyF,aACA,IACAlK,EAAAkK,aAAAzF,EAAAyF,aACO,MAAA7B,GAGP,YAAA5D,EAAAyF,aACA,KAAA7B,GAMA,kBAAA5D,GAAAoG,oBACA7K,EAAA8K,iBAAA,WAAArG,EAAAoG,oBAIA,kBAAApG,GAAAsG,kBAAA/K,EAAAgL,QACAhL,EAAAgL,OAAAF,iBAAA,WAAArG,EAAAsG,kBAGAtG,EAAAoC,aAEApC,EAAAoC,YAAA9B,QAAAO,KAAA,SAAA2F,GACAjL,IAIAA,EAAAkL,QACAzD,EAAAwD,GAEAjL,EAAA,QAIA8E,SAAAsE,IACAA,EAAA,MAIApJ,EAAAmL,KAAA/B,Ofo9BM,SAAUzK,EAAQD,EAASM,GgB/nCjC,YAEA,IAAAmK,GAAAnK,EAAA,GASAL,GAAAD,QAAA,SAAAsG,EAAAyC,EAAAnD,GACA,GAAAoE,GAAApE,EAAAG,OAAAiE,gBACAA,KAAApE,EAAAqE,QACA3D,EAAAV,GAEAmD,EAAA0B,EACA,mCAAA7E,EAAAqE,OACArE,EAAAG,OACA,KACAH,EAAAtE,QACAsE,MhByoCM,SAAU3F,EAAQD,EAASM,GiB9pCjC,YAEA,IAAAoM,GAAApM,EAAA,GAYAL,GAAAD,QAAA,SAAA2M,EAAA5G,EAAA6G,EAAAtL,EAAAsE,GACA,GAAAiH,GAAA,GAAAC,OAAAH,EACA,OAAAD,GAAAG,EAAA9G,EAAA6G,EAAAtL,EAAAsE,KjBsqCM,SAAU3F,EAAQD,GkBtrCxB,YAYAC,GAAAD,QAAA,SAAA6M,EAAA9G,EAAA6G,EAAAtL,EAAAsE,GA4BA,MA3BAiH,GAAA9G,SACA6G,IACAC,EAAAD,QAGAC,EAAAvL,UACAuL,EAAAjH,WACAiH,EAAAE,cAAA,EAEAF,EAAAG,OAAA,WACA,OAEAL,QAAAvM,KAAAuM,QACAvC,KAAAhK,KAAAgK,KAEA6C,YAAA7M,KAAA6M,YACAC,OAAA9M,KAAA8M,OAEAC,SAAA/M,KAAA+M,SACAC,WAAAhN,KAAAgN,WACAC,aAAAjN,KAAAiN,aACAC,MAAAlN,KAAAkN,MAEAvH,OAAA3F,KAAA2F,OACA6G,KAAAxM,KAAAwM,OAGAC,IlB8rCM,SAAU5M,EAAQD,EAASM,GmBtuCjC,YAEA,IAAAiB,GAAAjB,EAAA,GAIAiN,GACA,6DACA,kEACA,gEACA,qCAgBAtN,GAAAD,QAAA,SAAAyI,GACA,GACA9D,GACApC,EACAiC,EAHAgJ,IAKA,OAAA/E,IAEAlH,EAAA8C,QAAAoE,EAAAgF,MAAA,eAAAC,GAKA,GAJAlJ,EAAAkJ,EAAA9F,QAAA,KACAjD,EAAApD,EAAAsC,KAAA6J,EAAAC,OAAA,EAAAnJ,IAAA0B,cACA3D,EAAAhB,EAAAsC,KAAA6J,EAAAC,OAAAnJ,EAAA,IAEAG,EAAA,CACA,GAAA6I,EAAA7I,IAAA4I,EAAA3F,QAAAjD,IAAA,EACA,MAEA,gBAAAA,EACA6I,EAAA7I,IAAA6I,EAAA7I,GAAA6I,EAAA7I,OAAAiJ,QAAArL,IAEAiL,EAAA7I,GAAA6I,EAAA7I,GAAA6I,EAAA7I,GAAA,KAAApC,OAKAiL,GAnBiBA,InBiwCX,SAAUvN,EAAQD,EAASM,GoBjyCjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QACAuB,EAAAyC,uBAIA,WAWA,QAAA6J,GAAA7H,GACA,GAAA8H,GAAA9H,CAWA,OATA+H,KAEAC,EAAAC,aAAA,OAAAH,GACAA,EAAAE,EAAAF,MAGAE,EAAAC,aAAA,OAAAH,IAIAA,KAAAE,EAAAF,KACAI,SAAAF,EAAAE,SAAAF,EAAAE,SAAAnK,QAAA,YACAoK,KAAAH,EAAAG,KACAC,OAAAJ,EAAAI,OAAAJ,EAAAI,OAAArK,QAAA,aACAsK,KAAAL,EAAAK,KAAAL,EAAAK,KAAAtK,QAAA,YACAuK,SAAAN,EAAAM,SACAC,KAAAP,EAAAO,KACAC,SAAA,MAAAR,EAAAQ,SAAAC,OAAA,GACAT,EAAAQ,SACA,IAAAR,EAAAQ,UAhCA,GAEAE,GAFAX,EAAA,kBAAAY,KAAA1K,UAAA2K,WACAZ,EAAA5J,SAAAyK,cAAA,IA2CA,OARAH,GAAAb,EAAA1J,OAAA2K,SAAAhB,MAQA,SAAAiB,GACA,GAAAvB,GAAAjM,EAAA0B,SAAA8L,GAAAlB,EAAAkB,IACA,OAAAvB,GAAAU,WAAAQ,EAAAR,UACAV,EAAAW,OAAAO,EAAAP,SAKA,WACA,kBACA,cpB2yCM,SAAUlO,EAAQD,EAASM,GqB32CjC,YAEA,IAAAiB,GAAAjB,EAAA,EAEAL,GAAAD,QACAuB,EAAAyC,uBAGA,WACA,OACAgL,MAAA,SAAA5E,EAAAnB,EAAAgG,EAAAC,EAAAC,EAAAC,GACA,GAAAC,KACAA,GAAA1I,KAAAyD,EAAA,IAAAjD,mBAAA8B,IAEA1H,EAAA2B,SAAA+L,IACAI,EAAA1I,KAAA,cAAA2I,MAAAL,GAAAM,eAGAhO,EAAA0B,SAAAiM,IACAG,EAAA1I,KAAA,QAAAuI,GAGA3N,EAAA0B,SAAAkM,IACAE,EAAA1I,KAAA,UAAAwI,GAGAC,KAAA,GACAC,EAAA1I,KAAA,UAGAvC,SAAAiL,SAAA3H,KAAA,OAGAuE,KAAA,SAAA7B,GACA,GAAAoF,GAAApL,SAAAiL,OAAAG,MAAA,GAAAC,QAAA,aAA4DrF,EAAA,aAC5D,OAAAoF,GAAAE,mBAAAF,EAAA,UAGAG,OAAA,SAAAvF,GACAhK,KAAA4O,MAAA5E,EAAA,GAAAkF,KAAAM,MAAA,YAMA,WACA,OACAZ,MAAA,aACA/C,KAAA,WAA+B,aAC/B0D,OAAA,kBrBq3CM,SAAU1P,EAAQD,GsBt6CxB,YAQAC,GAAAD,QAAA,SAAAgG,GAIA,sCAAA2I,KAAA3I,KtB86CM,SAAU/F,EAAQD,GuB17CxB,YASAC,GAAAD,QAAA,SAAAwI,EAAAqH,GACA,MAAAA,GACArH,EAAAzE,QAAA,eAAA8L,EAAA9L,QAAA,WACAyE,IvBk8CM,SAAUvI,EAAQD,EAASM,GwB98CjC,YAEA,IAAAiB,GAAAjB,EAAA,EAUAL,GAAAD,QAAA,SAAA8P,EAAAC,GAEAA,OACA,IAAAhK,KAkCA,OAhCAxE,GAAA8C,SAAA,yCAAA2L,GACA,mBAAAD,GAAAC,KACAjK,EAAAiK,GAAAD,EAAAC,MAIAzO,EAAA8C,SAAA,mCAAA2L,GACAzO,EAAA6B,SAAA2M,EAAAC,IACAjK,EAAAiK,GAAAzO,EAAA0D,UAAA6K,EAAAE,GAAAD,EAAAC,IACK,mBAAAD,GAAAC,GACLjK,EAAAiK,GAAAD,EAAAC,GACKzO,EAAA6B,SAAA0M,EAAAE,IACLjK,EAAAiK,GAAAzO,EAAA0D,UAAA6K,EAAAE,IACK,mBAAAF,GAAAE,KACLjK,EAAAiK,GAAAF,EAAAE,MAIAzO,EAAA8C,SACA,oEACA,sEACA,4EACA,uEACA,cACA,SAAA2L,GACA,mBAAAD,GAAAC,GACAjK,EAAAiK,GAAAD,EAAAC,GACK,mBAAAF,GAAAE,KACLjK,EAAAiK,GAAAF,EAAAE,MAIAjK,IxBs9CM,SAAU9F,EAAQD,GyBvgDxB,YAQA,SAAA8B,GAAA6K,GACAvM,KAAAuM,UAGA7K,EAAAT,UAAAmB,SAAA,WACA,gBAAApC,KAAAuM,QAAA,KAAAvM,KAAAuM,QAAA,KAGA7K,EAAAT,UAAA6H,YAAA,EAEAjJ,EAAAD,QAAA8B,GzB8gDM,SAAU7B,EAAQD,EAASM,G0BhiDjC,YAUA,SAAAyB,GAAAkO,GACA,qBAAAA,GACA,SAAAC,WAAA,+BAGA,IAAAC,EACA/P,MAAAiG,QAAA,GAAAlE,SAAA,SAAAmE,GACA6J,EAAA7J,GAGA,IAAA8J,GAAAhQ,IACA6P,GAAA,SAAAtD,GACAyD,EAAAtH,SAKAsH,EAAAtH,OAAA,GAAAhH,GAAA6K,GACAwD,EAAAC,EAAAtH,WA1BA,GAAAhH,GAAAxB,EAAA,GAiCAyB,GAAAV,UAAA+G,iBAAA,WACA,GAAAhI,KAAA0I,OACA,KAAA1I,MAAA0I,QAQA/G,EAAAsO,OAAA,WACA,GAAA9D,GACA6D,EAAA,GAAArO,GAAA,SAAAlB,GACA0L,EAAA1L,GAEA,QACAuP,QACA7D,WAIAtM,EAAAD,QAAA+B,G1BuiDM,SAAU9B,EAAQD,G2B/lDxB,YAsBAC,GAAAD,QAAA,SAAAsQ,GACA,gBAAAC,GACA,MAAAD,GAAA9K,MAAA,KAAA+K","file":"axios.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition","(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"axios\"] = factory();\n\telse\n\t\troot[\"axios\"] = factory();\n})(this, function() {\nreturn /******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId])\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\texports: {},\n/******/ \t\t\tid: moduleId,\n/******/ \t\t\tloaded: false\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.loaded = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(0);\n/******/ })\n/************************************************************************/\n/******/ ([\n/* 0 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\tmodule.exports = __webpack_require__(1);\n\n/***/ }),\n/* 1 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar bind = __webpack_require__(3);\n\tvar Axios = __webpack_require__(5);\n\tvar mergeConfig = __webpack_require__(22);\n\tvar defaults = __webpack_require__(11);\n\t\n\t/**\n\t * Create an instance of Axios\n\t *\n\t * @param {Object} defaultConfig The default config for the instance\n\t * @return {Axios} A new instance of Axios\n\t */\n\tfunction createInstance(defaultConfig) {\n\t var context = new Axios(defaultConfig);\n\t var instance = bind(Axios.prototype.request, context);\n\t\n\t // Copy axios.prototype to instance\n\t utils.extend(instance, Axios.prototype, context);\n\t\n\t // Copy context to instance\n\t utils.extend(instance, context);\n\t\n\t return instance;\n\t}\n\t\n\t// Create the default instance to be exported\n\tvar axios = createInstance(defaults);\n\t\n\t// Expose Axios class to allow class inheritance\n\taxios.Axios = Axios;\n\t\n\t// Factory for creating new instances\n\taxios.create = function create(instanceConfig) {\n\t return createInstance(mergeConfig(axios.defaults, instanceConfig));\n\t};\n\t\n\t// Expose Cancel & CancelToken\n\taxios.Cancel = __webpack_require__(23);\n\taxios.CancelToken = __webpack_require__(24);\n\taxios.isCancel = __webpack_require__(10);\n\t\n\t// Expose all/spread\n\taxios.all = function all(promises) {\n\t return Promise.all(promises);\n\t};\n\taxios.spread = __webpack_require__(25);\n\t\n\tmodule.exports = axios;\n\t\n\t// Allow use of default import syntax in TypeScript\n\tmodule.exports.default = axios;\n\n\n/***/ }),\n/* 2 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar bind = __webpack_require__(3);\n\tvar isBuffer = __webpack_require__(4);\n\t\n\t/*global toString:true*/\n\t\n\t// utils is a library of generic helper functions non-specific to axios\n\t\n\tvar toString = Object.prototype.toString;\n\t\n\t/**\n\t * Determine if a value is an Array\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an Array, otherwise false\n\t */\n\tfunction isArray(val) {\n\t return toString.call(val) === '[object Array]';\n\t}\n\t\n\t/**\n\t * Determine if a value is an ArrayBuffer\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n\t */\n\tfunction isArrayBuffer(val) {\n\t return toString.call(val) === '[object ArrayBuffer]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a FormData\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an FormData, otherwise false\n\t */\n\tfunction isFormData(val) {\n\t return (typeof FormData !== 'undefined') && (val instanceof FormData);\n\t}\n\t\n\t/**\n\t * Determine if a value is a view on an ArrayBuffer\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n\t */\n\tfunction isArrayBufferView(val) {\n\t var result;\n\t if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n\t result = ArrayBuffer.isView(val);\n\t } else {\n\t result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Determine if a value is a String\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a String, otherwise false\n\t */\n\tfunction isString(val) {\n\t return typeof val === 'string';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Number\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Number, otherwise false\n\t */\n\tfunction isNumber(val) {\n\t return typeof val === 'number';\n\t}\n\t\n\t/**\n\t * Determine if a value is undefined\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if the value is undefined, otherwise false\n\t */\n\tfunction isUndefined(val) {\n\t return typeof val === 'undefined';\n\t}\n\t\n\t/**\n\t * Determine if a value is an Object\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is an Object, otherwise false\n\t */\n\tfunction isObject(val) {\n\t return val !== null && typeof val === 'object';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Date\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Date, otherwise false\n\t */\n\tfunction isDate(val) {\n\t return toString.call(val) === '[object Date]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a File\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a File, otherwise false\n\t */\n\tfunction isFile(val) {\n\t return toString.call(val) === '[object File]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Blob\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Blob, otherwise false\n\t */\n\tfunction isBlob(val) {\n\t return toString.call(val) === '[object Blob]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Function\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Function, otherwise false\n\t */\n\tfunction isFunction(val) {\n\t return toString.call(val) === '[object Function]';\n\t}\n\t\n\t/**\n\t * Determine if a value is a Stream\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a Stream, otherwise false\n\t */\n\tfunction isStream(val) {\n\t return isObject(val) && isFunction(val.pipe);\n\t}\n\t\n\t/**\n\t * Determine if a value is a URLSearchParams object\n\t *\n\t * @param {Object} val The value to test\n\t * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n\t */\n\tfunction isURLSearchParams(val) {\n\t return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n\t}\n\t\n\t/**\n\t * Trim excess whitespace off the beginning and end of a string\n\t *\n\t * @param {String} str The String to trim\n\t * @returns {String} The String freed of excess whitespace\n\t */\n\tfunction trim(str) {\n\t return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n\t}\n\t\n\t/**\n\t * Determine if we're running in a standard browser environment\n\t *\n\t * This allows axios to run in a web worker, and react-native.\n\t * Both environments support XMLHttpRequest, but not fully standard globals.\n\t *\n\t * web workers:\n\t * typeof window -> undefined\n\t * typeof document -> undefined\n\t *\n\t * react-native:\n\t * navigator.product -> 'ReactNative'\n\t * nativescript\n\t * navigator.product -> 'NativeScript' or 'NS'\n\t */\n\tfunction isStandardBrowserEnv() {\n\t if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n\t navigator.product === 'NativeScript' ||\n\t navigator.product === 'NS')) {\n\t return false;\n\t }\n\t return (\n\t typeof window !== 'undefined' &&\n\t typeof document !== 'undefined'\n\t );\n\t}\n\t\n\t/**\n\t * Iterate over an Array or an Object invoking a function for each item.\n\t *\n\t * If `obj` is an Array callback will be called passing\n\t * the value, index, and complete array for each item.\n\t *\n\t * If 'obj' is an Object callback will be called passing\n\t * the value, key, and complete object for each property.\n\t *\n\t * @param {Object|Array} obj The object to iterate\n\t * @param {Function} fn The callback to invoke for each item\n\t */\n\tfunction forEach(obj, fn) {\n\t // Don't bother if no value provided\n\t if (obj === null || typeof obj === 'undefined') {\n\t return;\n\t }\n\t\n\t // Force an array if not already something iterable\n\t if (typeof obj !== 'object') {\n\t /*eslint no-param-reassign:0*/\n\t obj = [obj];\n\t }\n\t\n\t if (isArray(obj)) {\n\t // Iterate over array values\n\t for (var i = 0, l = obj.length; i < l; i++) {\n\t fn.call(null, obj[i], i, obj);\n\t }\n\t } else {\n\t // Iterate over object keys\n\t for (var key in obj) {\n\t if (Object.prototype.hasOwnProperty.call(obj, key)) {\n\t fn.call(null, obj[key], key, obj);\n\t }\n\t }\n\t }\n\t}\n\t\n\t/**\n\t * Accepts varargs expecting each argument to be an object, then\n\t * immutably merges the properties of each object and returns result.\n\t *\n\t * When multiple objects contain the same key the later object in\n\t * the arguments list will take precedence.\n\t *\n\t * Example:\n\t *\n\t * ```js\n\t * var result = merge({foo: 123}, {foo: 456});\n\t * console.log(result.foo); // outputs 456\n\t * ```\n\t *\n\t * @param {Object} obj1 Object to merge\n\t * @returns {Object} Result of all merge properties\n\t */\n\tfunction merge(/* obj1, obj2, obj3, ... */) {\n\t var result = {};\n\t function assignValue(val, key) {\n\t if (typeof result[key] === 'object' && typeof val === 'object') {\n\t result[key] = merge(result[key], val);\n\t } else {\n\t result[key] = val;\n\t }\n\t }\n\t\n\t for (var i = 0, l = arguments.length; i < l; i++) {\n\t forEach(arguments[i], assignValue);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Function equal to merge with the difference being that no reference\n\t * to original objects is kept.\n\t *\n\t * @see merge\n\t * @param {Object} obj1 Object to merge\n\t * @returns {Object} Result of all merge properties\n\t */\n\tfunction deepMerge(/* obj1, obj2, obj3, ... */) {\n\t var result = {};\n\t function assignValue(val, key) {\n\t if (typeof result[key] === 'object' && typeof val === 'object') {\n\t result[key] = deepMerge(result[key], val);\n\t } else if (typeof val === 'object') {\n\t result[key] = deepMerge({}, val);\n\t } else {\n\t result[key] = val;\n\t }\n\t }\n\t\n\t for (var i = 0, l = arguments.length; i < l; i++) {\n\t forEach(arguments[i], assignValue);\n\t }\n\t return result;\n\t}\n\t\n\t/**\n\t * Extends object a by mutably adding to it the properties of object b.\n\t *\n\t * @param {Object} a The object to be extended\n\t * @param {Object} b The object to copy properties from\n\t * @param {Object} thisArg The object to bind function to\n\t * @return {Object} The resulting value of object a\n\t */\n\tfunction extend(a, b, thisArg) {\n\t forEach(b, function assignValue(val, key) {\n\t if (thisArg && typeof val === 'function') {\n\t a[key] = bind(val, thisArg);\n\t } else {\n\t a[key] = val;\n\t }\n\t });\n\t return a;\n\t}\n\t\n\tmodule.exports = {\n\t isArray: isArray,\n\t isArrayBuffer: isArrayBuffer,\n\t isBuffer: isBuffer,\n\t isFormData: isFormData,\n\t isArrayBufferView: isArrayBufferView,\n\t isString: isString,\n\t isNumber: isNumber,\n\t isObject: isObject,\n\t isUndefined: isUndefined,\n\t isDate: isDate,\n\t isFile: isFile,\n\t isBlob: isBlob,\n\t isFunction: isFunction,\n\t isStream: isStream,\n\t isURLSearchParams: isURLSearchParams,\n\t isStandardBrowserEnv: isStandardBrowserEnv,\n\t forEach: forEach,\n\t merge: merge,\n\t deepMerge: deepMerge,\n\t extend: extend,\n\t trim: trim\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function bind(fn, thisArg) {\n\t return function wrap() {\n\t var args = new Array(arguments.length);\n\t for (var i = 0; i < args.length; i++) {\n\t args[i] = arguments[i];\n\t }\n\t return fn.apply(thisArg, args);\n\t };\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports) {\n\n\t/*!\n\t * Determine if an object is a Buffer\n\t *\n\t * @author Feross Aboukhadijeh \n\t * @license MIT\n\t */\n\t\n\tmodule.exports = function isBuffer (obj) {\n\t return obj != null && obj.constructor != null &&\n\t typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n\t}\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar buildURL = __webpack_require__(6);\n\tvar InterceptorManager = __webpack_require__(7);\n\tvar dispatchRequest = __webpack_require__(8);\n\tvar mergeConfig = __webpack_require__(22);\n\t\n\t/**\n\t * Create a new instance of Axios\n\t *\n\t * @param {Object} instanceConfig The default config for the instance\n\t */\n\tfunction Axios(instanceConfig) {\n\t this.defaults = instanceConfig;\n\t this.interceptors = {\n\t request: new InterceptorManager(),\n\t response: new InterceptorManager()\n\t };\n\t}\n\t\n\t/**\n\t * Dispatch a request\n\t *\n\t * @param {Object} config The config specific for this request (merged with this.defaults)\n\t */\n\tAxios.prototype.request = function request(config) {\n\t /*eslint no-param-reassign:0*/\n\t // Allow for axios('example/url'[, config]) a la fetch API\n\t if (typeof config === 'string') {\n\t config = arguments[1] || {};\n\t config.url = arguments[0];\n\t } else {\n\t config = config || {};\n\t }\n\t\n\t config = mergeConfig(this.defaults, config);\n\t config.method = config.method ? config.method.toLowerCase() : 'get';\n\t\n\t // Hook up interceptors middleware\n\t var chain = [dispatchRequest, undefined];\n\t var promise = Promise.resolve(config);\n\t\n\t this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n\t chain.unshift(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n\t chain.push(interceptor.fulfilled, interceptor.rejected);\n\t });\n\t\n\t while (chain.length) {\n\t promise = promise.then(chain.shift(), chain.shift());\n\t }\n\t\n\t return promise;\n\t};\n\t\n\tAxios.prototype.getUri = function getUri(config) {\n\t config = mergeConfig(this.defaults, config);\n\t return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n\t};\n\t\n\t// Provide aliases for supported request methods\n\tutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url\n\t }));\n\t };\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t /*eslint func-names:0*/\n\t Axios.prototype[method] = function(url, data, config) {\n\t return this.request(utils.merge(config || {}, {\n\t method: method,\n\t url: url,\n\t data: data\n\t }));\n\t };\n\t});\n\t\n\tmodule.exports = Axios;\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction encode(val) {\n\t return encodeURIComponent(val).\n\t replace(/%40/gi, '@').\n\t replace(/%3A/gi, ':').\n\t replace(/%24/g, '$').\n\t replace(/%2C/gi, ',').\n\t replace(/%20/g, '+').\n\t replace(/%5B/gi, '[').\n\t replace(/%5D/gi, ']');\n\t}\n\t\n\t/**\n\t * Build a URL by appending params to the end\n\t *\n\t * @param {string} url The base of the url (e.g., http://www.google.com)\n\t * @param {object} [params] The params to be appended\n\t * @returns {string} The formatted url\n\t */\n\tmodule.exports = function buildURL(url, params, paramsSerializer) {\n\t /*eslint no-param-reassign:0*/\n\t if (!params) {\n\t return url;\n\t }\n\t\n\t var serializedParams;\n\t if (paramsSerializer) {\n\t serializedParams = paramsSerializer(params);\n\t } else if (utils.isURLSearchParams(params)) {\n\t serializedParams = params.toString();\n\t } else {\n\t var parts = [];\n\t\n\t utils.forEach(params, function serialize(val, key) {\n\t if (val === null || typeof val === 'undefined') {\n\t return;\n\t }\n\t\n\t if (utils.isArray(val)) {\n\t key = key + '[]';\n\t } else {\n\t val = [val];\n\t }\n\t\n\t utils.forEach(val, function parseValue(v) {\n\t if (utils.isDate(v)) {\n\t v = v.toISOString();\n\t } else if (utils.isObject(v)) {\n\t v = JSON.stringify(v);\n\t }\n\t parts.push(encode(key) + '=' + encode(v));\n\t });\n\t });\n\t\n\t serializedParams = parts.join('&');\n\t }\n\t\n\t if (serializedParams) {\n\t var hashmarkIndex = url.indexOf('#');\n\t if (hashmarkIndex !== -1) {\n\t url = url.slice(0, hashmarkIndex);\n\t }\n\t\n\t url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n\t }\n\t\n\t return url;\n\t};\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tfunction InterceptorManager() {\n\t this.handlers = [];\n\t}\n\t\n\t/**\n\t * Add a new interceptor to the stack\n\t *\n\t * @param {Function} fulfilled The function to handle `then` for a `Promise`\n\t * @param {Function} rejected The function to handle `reject` for a `Promise`\n\t *\n\t * @return {Number} An ID used to remove interceptor later\n\t */\n\tInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n\t this.handlers.push({\n\t fulfilled: fulfilled,\n\t rejected: rejected\n\t });\n\t return this.handlers.length - 1;\n\t};\n\t\n\t/**\n\t * Remove an interceptor from the stack\n\t *\n\t * @param {Number} id The ID that was returned by `use`\n\t */\n\tInterceptorManager.prototype.eject = function eject(id) {\n\t if (this.handlers[id]) {\n\t this.handlers[id] = null;\n\t }\n\t};\n\t\n\t/**\n\t * Iterate over all the registered interceptors\n\t *\n\t * This method is particularly useful for skipping over any\n\t * interceptors that may have become `null` calling `eject`.\n\t *\n\t * @param {Function} fn The function to call for each interceptor\n\t */\n\tInterceptorManager.prototype.forEach = function forEach(fn) {\n\t utils.forEach(this.handlers, function forEachHandler(h) {\n\t if (h !== null) {\n\t fn(h);\n\t }\n\t });\n\t};\n\t\n\tmodule.exports = InterceptorManager;\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar transformData = __webpack_require__(9);\n\tvar isCancel = __webpack_require__(10);\n\tvar defaults = __webpack_require__(11);\n\tvar isAbsoluteURL = __webpack_require__(20);\n\tvar combineURLs = __webpack_require__(21);\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tfunction throwIfCancellationRequested(config) {\n\t if (config.cancelToken) {\n\t config.cancelToken.throwIfRequested();\n\t }\n\t}\n\t\n\t/**\n\t * Dispatch a request to the server using the configured adapter.\n\t *\n\t * @param {object} config The config that is to be used for the request\n\t * @returns {Promise} The Promise to be fulfilled\n\t */\n\tmodule.exports = function dispatchRequest(config) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Support baseURL config\n\t if (config.baseURL && !isAbsoluteURL(config.url)) {\n\t config.url = combineURLs(config.baseURL, config.url);\n\t }\n\t\n\t // Ensure headers exist\n\t config.headers = config.headers || {};\n\t\n\t // Transform request data\n\t config.data = transformData(\n\t config.data,\n\t config.headers,\n\t config.transformRequest\n\t );\n\t\n\t // Flatten headers\n\t config.headers = utils.merge(\n\t config.headers.common || {},\n\t config.headers[config.method] || {},\n\t config.headers || {}\n\t );\n\t\n\t utils.forEach(\n\t ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n\t function cleanHeaderConfig(method) {\n\t delete config.headers[method];\n\t }\n\t );\n\t\n\t var adapter = config.adapter || defaults.adapter;\n\t\n\t return adapter(config).then(function onAdapterResolution(response) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t response.data = transformData(\n\t response.data,\n\t response.headers,\n\t config.transformResponse\n\t );\n\t\n\t return response;\n\t }, function onAdapterRejection(reason) {\n\t if (!isCancel(reason)) {\n\t throwIfCancellationRequested(config);\n\t\n\t // Transform response data\n\t if (reason && reason.response) {\n\t reason.response.data = transformData(\n\t reason.response.data,\n\t reason.response.headers,\n\t config.transformResponse\n\t );\n\t }\n\t }\n\t\n\t return Promise.reject(reason);\n\t });\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t/**\n\t * Transform the data for a request or a response\n\t *\n\t * @param {Object|String} data The data to be transformed\n\t * @param {Array} headers The headers for the request or response\n\t * @param {Array|Function} fns A single function or Array of functions\n\t * @returns {*} The resulting transformed data\n\t */\n\tmodule.exports = function transformData(data, headers, fns) {\n\t /*eslint no-param-reassign:0*/\n\t utils.forEach(fns, function transform(fn) {\n\t data = fn(data, headers);\n\t });\n\t\n\t return data;\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\tmodule.exports = function isCancel(value) {\n\t return !!(value && value.__CANCEL__);\n\t};\n\n\n/***/ }),\n/* 11 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar normalizeHeaderName = __webpack_require__(12);\n\t\n\tvar DEFAULT_CONTENT_TYPE = {\n\t 'Content-Type': 'application/x-www-form-urlencoded'\n\t};\n\t\n\tfunction setContentTypeIfUnset(headers, value) {\n\t if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n\t headers['Content-Type'] = value;\n\t }\n\t}\n\t\n\tfunction getDefaultAdapter() {\n\t var adapter;\n\t // Only Node.JS has a process variable that is of [[Class]] process\n\t if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n\t // For node use HTTP adapter\n\t adapter = __webpack_require__(13);\n\t } else if (typeof XMLHttpRequest !== 'undefined') {\n\t // For browsers use XHR adapter\n\t adapter = __webpack_require__(13);\n\t }\n\t return adapter;\n\t}\n\t\n\tvar defaults = {\n\t adapter: getDefaultAdapter(),\n\t\n\t transformRequest: [function transformRequest(data, headers) {\n\t normalizeHeaderName(headers, 'Accept');\n\t normalizeHeaderName(headers, 'Content-Type');\n\t if (utils.isFormData(data) ||\n\t utils.isArrayBuffer(data) ||\n\t utils.isBuffer(data) ||\n\t utils.isStream(data) ||\n\t utils.isFile(data) ||\n\t utils.isBlob(data)\n\t ) {\n\t return data;\n\t }\n\t if (utils.isArrayBufferView(data)) {\n\t return data.buffer;\n\t }\n\t if (utils.isURLSearchParams(data)) {\n\t setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n\t return data.toString();\n\t }\n\t if (utils.isObject(data)) {\n\t setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n\t return JSON.stringify(data);\n\t }\n\t return data;\n\t }],\n\t\n\t transformResponse: [function transformResponse(data) {\n\t /*eslint no-param-reassign:0*/\n\t if (typeof data === 'string') {\n\t try {\n\t data = JSON.parse(data);\n\t } catch (e) { /* Ignore */ }\n\t }\n\t return data;\n\t }],\n\t\n\t /**\n\t * A timeout in milliseconds to abort a request. If set to 0 (default) a\n\t * timeout is not created.\n\t */\n\t timeout: 0,\n\t\n\t xsrfCookieName: 'XSRF-TOKEN',\n\t xsrfHeaderName: 'X-XSRF-TOKEN',\n\t\n\t maxContentLength: -1,\n\t\n\t validateStatus: function validateStatus(status) {\n\t return status >= 200 && status < 300;\n\t }\n\t};\n\t\n\tdefaults.headers = {\n\t common: {\n\t 'Accept': 'application/json, text/plain, */*'\n\t }\n\t};\n\t\n\tutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n\t defaults.headers[method] = {};\n\t});\n\t\n\tutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n\t defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n\t});\n\t\n\tmodule.exports = defaults;\n\n\n/***/ }),\n/* 12 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n\t utils.forEach(headers, function processHeader(value, name) {\n\t if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n\t headers[normalizedName] = value;\n\t delete headers[name];\n\t }\n\t });\n\t};\n\n\n/***/ }),\n/* 13 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\tvar settle = __webpack_require__(14);\n\tvar buildURL = __webpack_require__(6);\n\tvar parseHeaders = __webpack_require__(17);\n\tvar isURLSameOrigin = __webpack_require__(18);\n\tvar createError = __webpack_require__(15);\n\t\n\tmodule.exports = function xhrAdapter(config) {\n\t return new Promise(function dispatchXhrRequest(resolve, reject) {\n\t var requestData = config.data;\n\t var requestHeaders = config.headers;\n\t\n\t if (utils.isFormData(requestData)) {\n\t delete requestHeaders['Content-Type']; // Let the browser set it\n\t }\n\t\n\t var request = new XMLHttpRequest();\n\t\n\t // HTTP basic authentication\n\t if (config.auth) {\n\t var username = config.auth.username || '';\n\t var password = config.auth.password || '';\n\t requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n\t }\n\t\n\t request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\t\n\t // Set the request timeout in MS\n\t request.timeout = config.timeout;\n\t\n\t // Listen for ready state\n\t request.onreadystatechange = function handleLoad() {\n\t if (!request || request.readyState !== 4) {\n\t return;\n\t }\n\t\n\t // The request errored out and we didn't get a response, this will be\n\t // handled by onerror instead\n\t // With one exception: request that using file: protocol, most browsers\n\t // will return status as 0 even though it's a successful request\n\t if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n\t return;\n\t }\n\t\n\t // Prepare the response\n\t var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n\t var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n\t var response = {\n\t data: responseData,\n\t status: request.status,\n\t statusText: request.statusText,\n\t headers: responseHeaders,\n\t config: config,\n\t request: request\n\t };\n\t\n\t settle(resolve, reject, response);\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle browser request cancellation (as opposed to a manual cancellation)\n\t request.onabort = function handleAbort() {\n\t if (!request) {\n\t return;\n\t }\n\t\n\t reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle low level network errors\n\t request.onerror = function handleError() {\n\t // Real errors are hidden from us by the browser\n\t // onerror should only fire if it's a network error\n\t reject(createError('Network Error', config, null, request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Handle timeout\n\t request.ontimeout = function handleTimeout() {\n\t reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n\t request));\n\t\n\t // Clean up request\n\t request = null;\n\t };\n\t\n\t // Add xsrf header\n\t // This is only done if running in a standard browser environment.\n\t // Specifically not if we're in a web worker, or react-native.\n\t if (utils.isStandardBrowserEnv()) {\n\t var cookies = __webpack_require__(19);\n\t\n\t // Add xsrf header\n\t var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n\t cookies.read(config.xsrfCookieName) :\n\t undefined;\n\t\n\t if (xsrfValue) {\n\t requestHeaders[config.xsrfHeaderName] = xsrfValue;\n\t }\n\t }\n\t\n\t // Add headers to the request\n\t if ('setRequestHeader' in request) {\n\t utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n\t if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n\t // Remove Content-Type if data is undefined\n\t delete requestHeaders[key];\n\t } else {\n\t // Otherwise add header to the request\n\t request.setRequestHeader(key, val);\n\t }\n\t });\n\t }\n\t\n\t // Add withCredentials to request if needed\n\t if (config.withCredentials) {\n\t request.withCredentials = true;\n\t }\n\t\n\t // Add responseType to request if needed\n\t if (config.responseType) {\n\t try {\n\t request.responseType = config.responseType;\n\t } catch (e) {\n\t // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n\t // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n\t if (config.responseType !== 'json') {\n\t throw e;\n\t }\n\t }\n\t }\n\t\n\t // Handle progress if needed\n\t if (typeof config.onDownloadProgress === 'function') {\n\t request.addEventListener('progress', config.onDownloadProgress);\n\t }\n\t\n\t // Not all browsers support upload events\n\t if (typeof config.onUploadProgress === 'function' && request.upload) {\n\t request.upload.addEventListener('progress', config.onUploadProgress);\n\t }\n\t\n\t if (config.cancelToken) {\n\t // Handle cancellation\n\t config.cancelToken.promise.then(function onCanceled(cancel) {\n\t if (!request) {\n\t return;\n\t }\n\t\n\t request.abort();\n\t reject(cancel);\n\t // Clean up request\n\t request = null;\n\t });\n\t }\n\t\n\t if (requestData === undefined) {\n\t requestData = null;\n\t }\n\t\n\t // Send the request\n\t request.send(requestData);\n\t });\n\t};\n\n\n/***/ }),\n/* 14 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar createError = __webpack_require__(15);\n\t\n\t/**\n\t * Resolve or reject a Promise based on response status.\n\t *\n\t * @param {Function} resolve A function that resolves the promise.\n\t * @param {Function} reject A function that rejects the promise.\n\t * @param {object} response The response.\n\t */\n\tmodule.exports = function settle(resolve, reject, response) {\n\t var validateStatus = response.config.validateStatus;\n\t if (!validateStatus || validateStatus(response.status)) {\n\t resolve(response);\n\t } else {\n\t reject(createError(\n\t 'Request failed with status code ' + response.status,\n\t response.config,\n\t null,\n\t response.request,\n\t response\n\t ));\n\t }\n\t};\n\n\n/***/ }),\n/* 15 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar enhanceError = __webpack_require__(16);\n\t\n\t/**\n\t * Create an Error with the specified message, config, error code, request and response.\n\t *\n\t * @param {string} message The error message.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The created error.\n\t */\n\tmodule.exports = function createError(message, config, code, request, response) {\n\t var error = new Error(message);\n\t return enhanceError(error, config, code, request, response);\n\t};\n\n\n/***/ }),\n/* 16 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Update an Error with the specified config, error code, and response.\n\t *\n\t * @param {Error} error The error to update.\n\t * @param {Object} config The config.\n\t * @param {string} [code] The error code (for example, 'ECONNABORTED').\n\t * @param {Object} [request] The request.\n\t * @param {Object} [response] The response.\n\t * @returns {Error} The error.\n\t */\n\tmodule.exports = function enhanceError(error, config, code, request, response) {\n\t error.config = config;\n\t if (code) {\n\t error.code = code;\n\t }\n\t\n\t error.request = request;\n\t error.response = response;\n\t error.isAxiosError = true;\n\t\n\t error.toJSON = function() {\n\t return {\n\t // Standard\n\t message: this.message,\n\t name: this.name,\n\t // Microsoft\n\t description: this.description,\n\t number: this.number,\n\t // Mozilla\n\t fileName: this.fileName,\n\t lineNumber: this.lineNumber,\n\t columnNumber: this.columnNumber,\n\t stack: this.stack,\n\t // Axios\n\t config: this.config,\n\t code: this.code\n\t };\n\t };\n\t return error;\n\t};\n\n\n/***/ }),\n/* 17 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t// Headers whose duplicates are ignored by node\n\t// c.f. https://nodejs.org/api/http.html#http_message_headers\n\tvar ignoreDuplicateOf = [\n\t 'age', 'authorization', 'content-length', 'content-type', 'etag',\n\t 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n\t 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n\t 'referer', 'retry-after', 'user-agent'\n\t];\n\t\n\t/**\n\t * Parse headers into an object\n\t *\n\t * ```\n\t * Date: Wed, 27 Aug 2014 08:58:49 GMT\n\t * Content-Type: application/json\n\t * Connection: keep-alive\n\t * Transfer-Encoding: chunked\n\t * ```\n\t *\n\t * @param {String} headers Headers needing to be parsed\n\t * @returns {Object} Headers parsed into an object\n\t */\n\tmodule.exports = function parseHeaders(headers) {\n\t var parsed = {};\n\t var key;\n\t var val;\n\t var i;\n\t\n\t if (!headers) { return parsed; }\n\t\n\t utils.forEach(headers.split('\\n'), function parser(line) {\n\t i = line.indexOf(':');\n\t key = utils.trim(line.substr(0, i)).toLowerCase();\n\t val = utils.trim(line.substr(i + 1));\n\t\n\t if (key) {\n\t if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n\t return;\n\t }\n\t if (key === 'set-cookie') {\n\t parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n\t } else {\n\t parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n\t }\n\t }\n\t });\n\t\n\t return parsed;\n\t};\n\n\n/***/ }),\n/* 18 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs have full support of the APIs needed to test\n\t // whether the request URL is of the same origin as current location.\n\t (function standardBrowserEnv() {\n\t var msie = /(msie|trident)/i.test(navigator.userAgent);\n\t var urlParsingNode = document.createElement('a');\n\t var originURL;\n\t\n\t /**\n\t * Parse a URL to discover it's components\n\t *\n\t * @param {String} url The URL to be parsed\n\t * @returns {Object}\n\t */\n\t function resolveURL(url) {\n\t var href = url;\n\t\n\t if (msie) {\n\t // IE needs attribute set twice to normalize properties\n\t urlParsingNode.setAttribute('href', href);\n\t href = urlParsingNode.href;\n\t }\n\t\n\t urlParsingNode.setAttribute('href', href);\n\t\n\t // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n\t return {\n\t href: urlParsingNode.href,\n\t protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n\t host: urlParsingNode.host,\n\t search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n\t hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n\t hostname: urlParsingNode.hostname,\n\t port: urlParsingNode.port,\n\t pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n\t urlParsingNode.pathname :\n\t '/' + urlParsingNode.pathname\n\t };\n\t }\n\t\n\t originURL = resolveURL(window.location.href);\n\t\n\t /**\n\t * Determine if a URL shares the same origin as the current location\n\t *\n\t * @param {String} requestURL The URL to test\n\t * @returns {boolean} True if URL shares the same origin, otherwise false\n\t */\n\t return function isURLSameOrigin(requestURL) {\n\t var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n\t return (parsed.protocol === originURL.protocol &&\n\t parsed.host === originURL.host);\n\t };\n\t })() :\n\t\n\t // Non standard browser envs (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return function isURLSameOrigin() {\n\t return true;\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 19 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\tmodule.exports = (\n\t utils.isStandardBrowserEnv() ?\n\t\n\t // Standard browser envs support document.cookie\n\t (function standardBrowserEnv() {\n\t return {\n\t write: function write(name, value, expires, path, domain, secure) {\n\t var cookie = [];\n\t cookie.push(name + '=' + encodeURIComponent(value));\n\t\n\t if (utils.isNumber(expires)) {\n\t cookie.push('expires=' + new Date(expires).toGMTString());\n\t }\n\t\n\t if (utils.isString(path)) {\n\t cookie.push('path=' + path);\n\t }\n\t\n\t if (utils.isString(domain)) {\n\t cookie.push('domain=' + domain);\n\t }\n\t\n\t if (secure === true) {\n\t cookie.push('secure');\n\t }\n\t\n\t document.cookie = cookie.join('; ');\n\t },\n\t\n\t read: function read(name) {\n\t var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n\t return (match ? decodeURIComponent(match[3]) : null);\n\t },\n\t\n\t remove: function remove(name) {\n\t this.write(name, '', Date.now() - 86400000);\n\t }\n\t };\n\t })() :\n\t\n\t // Non standard browser env (web workers, react-native) lack needed support.\n\t (function nonStandardBrowserEnv() {\n\t return {\n\t write: function write() {},\n\t read: function read() { return null; },\n\t remove: function remove() {}\n\t };\n\t })()\n\t);\n\n\n/***/ }),\n/* 20 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Determines whether the specified URL is absolute\n\t *\n\t * @param {string} url The URL to test\n\t * @returns {boolean} True if the specified URL is absolute, otherwise false\n\t */\n\tmodule.exports = function isAbsoluteURL(url) {\n\t // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n\t // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n\t // by any combination of letters, digits, plus, period, or hyphen.\n\t return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n\t};\n\n\n/***/ }),\n/* 21 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Creates a new URL by combining the specified URLs\n\t *\n\t * @param {string} baseURL The base URL\n\t * @param {string} relativeURL The relative URL\n\t * @returns {string} The combined URL\n\t */\n\tmodule.exports = function combineURLs(baseURL, relativeURL) {\n\t return relativeURL\n\t ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n\t : baseURL;\n\t};\n\n\n/***/ }),\n/* 22 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar utils = __webpack_require__(2);\n\t\n\t/**\n\t * Config-specific merge-function which creates a new config-object\n\t * by merging two configuration objects together.\n\t *\n\t * @param {Object} config1\n\t * @param {Object} config2\n\t * @returns {Object} New object resulting from merging config2 to config1\n\t */\n\tmodule.exports = function mergeConfig(config1, config2) {\n\t // eslint-disable-next-line no-param-reassign\n\t config2 = config2 || {};\n\t var config = {};\n\t\n\t utils.forEach(['url', 'method', 'params', 'data'], function valueFromConfig2(prop) {\n\t if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t }\n\t });\n\t\n\t utils.forEach(['headers', 'auth', 'proxy'], function mergeDeepProperties(prop) {\n\t if (utils.isObject(config2[prop])) {\n\t config[prop] = utils.deepMerge(config1[prop], config2[prop]);\n\t } else if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t } else if (utils.isObject(config1[prop])) {\n\t config[prop] = utils.deepMerge(config1[prop]);\n\t } else if (typeof config1[prop] !== 'undefined') {\n\t config[prop] = config1[prop];\n\t }\n\t });\n\t\n\t utils.forEach([\n\t 'baseURL', 'transformRequest', 'transformResponse', 'paramsSerializer',\n\t 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',\n\t 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', 'maxContentLength',\n\t 'validateStatus', 'maxRedirects', 'httpAgent', 'httpsAgent', 'cancelToken',\n\t 'socketPath'\n\t ], function defaultToConfig2(prop) {\n\t if (typeof config2[prop] !== 'undefined') {\n\t config[prop] = config2[prop];\n\t } else if (typeof config1[prop] !== 'undefined') {\n\t config[prop] = config1[prop];\n\t }\n\t });\n\t\n\t return config;\n\t};\n\n\n/***/ }),\n/* 23 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * A `Cancel` is an object that is thrown when an operation is canceled.\n\t *\n\t * @class\n\t * @param {string=} message The message.\n\t */\n\tfunction Cancel(message) {\n\t this.message = message;\n\t}\n\t\n\tCancel.prototype.toString = function toString() {\n\t return 'Cancel' + (this.message ? ': ' + this.message : '');\n\t};\n\t\n\tCancel.prototype.__CANCEL__ = true;\n\t\n\tmodule.exports = Cancel;\n\n\n/***/ }),\n/* 24 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t'use strict';\n\t\n\tvar Cancel = __webpack_require__(23);\n\t\n\t/**\n\t * A `CancelToken` is an object that can be used to request cancellation of an operation.\n\t *\n\t * @class\n\t * @param {Function} executor The executor function.\n\t */\n\tfunction CancelToken(executor) {\n\t if (typeof executor !== 'function') {\n\t throw new TypeError('executor must be a function.');\n\t }\n\t\n\t var resolvePromise;\n\t this.promise = new Promise(function promiseExecutor(resolve) {\n\t resolvePromise = resolve;\n\t });\n\t\n\t var token = this;\n\t executor(function cancel(message) {\n\t if (token.reason) {\n\t // Cancellation has already been requested\n\t return;\n\t }\n\t\n\t token.reason = new Cancel(message);\n\t resolvePromise(token.reason);\n\t });\n\t}\n\t\n\t/**\n\t * Throws a `Cancel` if cancellation has been requested.\n\t */\n\tCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n\t if (this.reason) {\n\t throw this.reason;\n\t }\n\t};\n\t\n\t/**\n\t * Returns an object that contains a new `CancelToken` and a function that, when called,\n\t * cancels the `CancelToken`.\n\t */\n\tCancelToken.source = function source() {\n\t var cancel;\n\t var token = new CancelToken(function executor(c) {\n\t cancel = c;\n\t });\n\t return {\n\t token: token,\n\t cancel: cancel\n\t };\n\t};\n\t\n\tmodule.exports = CancelToken;\n\n\n/***/ }),\n/* 25 */\n/***/ (function(module, exports) {\n\n\t'use strict';\n\t\n\t/**\n\t * Syntactic sugar for invoking a function and expanding an array for arguments.\n\t *\n\t * Common use case would be to use `Function.prototype.apply`.\n\t *\n\t * ```js\n\t * function f(x, y, z) {}\n\t * var args = [1, 2, 3];\n\t * f.apply(null, args);\n\t * ```\n\t *\n\t * With `spread` this example can be re-written.\n\t *\n\t * ```js\n\t * spread(function(x, y, z) {})([1, 2, 3]);\n\t * ```\n\t *\n\t * @param {Function} callback\n\t * @returns {Function}\n\t */\n\tmodule.exports = function spread(callback) {\n\t return function wrap(arr) {\n\t return callback.apply(null, arr);\n\t };\n\t};\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// axios.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 3e317bb69558239a2225","module.exports = require('./lib/axios');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./index.js\n// module id = 0\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar bind = require('./helpers/bind');\nvar Axios = require('./core/Axios');\nvar mergeConfig = require('./core/mergeConfig');\nvar defaults = require('./defaults');\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(mergeConfig(axios.defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = require('./cancel/Cancel');\naxios.CancelToken = require('./cancel/CancelToken');\naxios.isCancel = require('./cancel/isCancel');\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = require('./helpers/spread');\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/axios.js\n// module id = 1\n// module chunks = 0","'use strict';\n\nvar bind = require('./helpers/bind');\nvar isBuffer = require('is-buffer');\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' ||\n navigator.product === 'NativeScript' ||\n navigator.product === 'NS')) {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Function equal to merge with the difference being that no reference\n * to original objects is kept.\n *\n * @see merge\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction deepMerge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = deepMerge(result[key], val);\n } else if (typeof val === 'object') {\n result[key] = deepMerge({}, val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n deepMerge: deepMerge,\n extend: extend,\n trim: trim\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/utils.js\n// module id = 2\n// module chunks = 0","'use strict';\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/bind.js\n// module id = 3\n// module chunks = 0","/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh \n * @license MIT\n */\n\nmodule.exports = function isBuffer (obj) {\n return obj != null && obj.constructor != null &&\n typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./~/is-buffer/index.js\n// module id = 4\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar buildURL = require('../helpers/buildURL');\nvar InterceptorManager = require('./InterceptorManager');\nvar dispatchRequest = require('./dispatchRequest');\nvar mergeConfig = require('./mergeConfig');\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = arguments[1] || {};\n config.url = arguments[0];\n } else {\n config = config || {};\n }\n\n config = mergeConfig(this.defaults, config);\n config.method = config.method ? config.method.toLowerCase() : 'get';\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\nAxios.prototype.getUri = function getUri(config) {\n config = mergeConfig(this.defaults, config);\n return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\\?/, '');\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/Axios.js\n// module id = 5\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n } else {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n var hashmarkIndex = url.indexOf('#');\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/buildURL.js\n// module id = 6\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/InterceptorManager.js\n// module id = 7\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar transformData = require('./transformData');\nvar isCancel = require('../cancel/isCancel');\nvar defaults = require('../defaults');\nvar isAbsoluteURL = require('./../helpers/isAbsoluteURL');\nvar combineURLs = require('./../helpers/combineURLs');\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/dispatchRequest.js\n// module id = 8\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/transformData.js\n// module id = 9\n// module chunks = 0","'use strict';\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/isCancel.js\n// module id = 10\n// module chunks = 0","'use strict';\n\nvar utils = require('./utils');\nvar normalizeHeaderName = require('./helpers/normalizeHeaderName');\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n // Only Node.JS has a process variable that is of [[Class]] process\n if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') {\n // For node use HTTP adapter\n adapter = require('./adapters/http');\n } else if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = require('./adapters/xhr');\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Accept');\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/defaults.js\n// module id = 11\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/normalizeHeaderName.js\n// module id = 12\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\nvar settle = require('./../core/settle');\nvar buildURL = require('./../helpers/buildURL');\nvar parseHeaders = require('./../helpers/parseHeaders');\nvar isURLSameOrigin = require('./../helpers/isURLSameOrigin');\nvar createError = require('../core/createError');\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(createError('Request aborted', config, 'ECONNABORTED', request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = require('./../helpers/cookies');\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/adapters/xhr.js\n// module id = 13\n// module chunks = 0","'use strict';\n\nvar createError = require('./createError');\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n if (!validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/settle.js\n// module id = 14\n// module chunks = 0","'use strict';\n\nvar enhanceError = require('./enhanceError');\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/createError.js\n// module id = 15\n// module chunks = 0","'use strict';\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n\n error.request = request;\n error.response = response;\n error.isAxiosError = true;\n\n error.toJSON = function() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: this.config,\n code: this.code\n };\n };\n return error;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/enhanceError.js\n// module id = 16\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/parseHeaders.js\n// module id = 17\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isURLSameOrigin.js\n// module id = 18\n// module chunks = 0","'use strict';\n\nvar utils = require('./../utils');\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/cookies.js\n// module id = 19\n// module chunks = 0","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/isAbsoluteURL.js\n// module id = 20\n// module chunks = 0","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/combineURLs.js\n// module id = 21\n// module chunks = 0","'use strict';\n\nvar utils = require('../utils');\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n * @returns {Object} New object resulting from merging config2 to config1\n */\nmodule.exports = function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n var config = {};\n\n utils.forEach(['url', 'method', 'params', 'data'], function valueFromConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n }\n });\n\n utils.forEach(['headers', 'auth', 'proxy'], function mergeDeepProperties(prop) {\n if (utils.isObject(config2[prop])) {\n config[prop] = utils.deepMerge(config1[prop], config2[prop]);\n } else if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (utils.isObject(config1[prop])) {\n config[prop] = utils.deepMerge(config1[prop]);\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n utils.forEach([\n 'baseURL', 'transformRequest', 'transformResponse', 'paramsSerializer',\n 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName',\n 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', 'maxContentLength',\n 'validateStatus', 'maxRedirects', 'httpAgent', 'httpsAgent', 'cancelToken',\n 'socketPath'\n ], function defaultToConfig2(prop) {\n if (typeof config2[prop] !== 'undefined') {\n config[prop] = config2[prop];\n } else if (typeof config1[prop] !== 'undefined') {\n config[prop] = config1[prop];\n }\n });\n\n return config;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/core/mergeConfig.js\n// module id = 22\n// module chunks = 0","'use strict';\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/Cancel.js\n// module id = 23\n// module chunks = 0","'use strict';\n\nvar Cancel = require('./Cancel');\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/cancel/CancelToken.js\n// module id = 24\n// module chunks = 0","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/helpers/spread.js\n// module id = 25\n// module chunks = 0"],"sourceRoot":""} \ No newline at end of file diff --git a/node_modules/axios/index.d.ts b/node_modules/axios/index.d.ts new file mode 100644 index 0000000..f934886 --- /dev/null +++ b/node_modules/axios/index.d.ts @@ -0,0 +1,152 @@ +export interface AxiosTransformer { + (data: any, headers?: any): any; +} + +export interface AxiosAdapter { + (config: AxiosRequestConfig): AxiosPromise; +} + +export interface AxiosBasicCredentials { + username: string; + password: string; +} + +export interface AxiosProxyConfig { + host: string; + port: number; + auth?: { + username: string; + password:string; + }; + protocol?: string; +} + +export type Method = + | 'get' | 'GET' + | 'delete' | 'DELETE' + | 'head' | 'HEAD' + | 'options' | 'OPTIONS' + | 'post' | 'POST' + | 'put' | 'PUT' + | 'patch' | 'PATCH' + +export type ResponseType = + | 'arraybuffer' + | 'blob' + | 'document' + | 'json' + | 'text' + | 'stream' + +export interface AxiosRequestConfig { + url?: string; + method?: Method; + baseURL?: string; + transformRequest?: AxiosTransformer | AxiosTransformer[]; + transformResponse?: AxiosTransformer | AxiosTransformer[]; + headers?: any; + params?: any; + paramsSerializer?: (params: any) => string; + data?: any; + timeout?: number; + withCredentials?: boolean; + adapter?: AxiosAdapter; + auth?: AxiosBasicCredentials; + responseType?: ResponseType; + xsrfCookieName?: string; + xsrfHeaderName?: string; + onUploadProgress?: (progressEvent: any) => void; + onDownloadProgress?: (progressEvent: any) => void; + maxContentLength?: number; + validateStatus?: (status: number) => boolean; + maxRedirects?: number; + socketPath?: string | null; + httpAgent?: any; + httpsAgent?: any; + proxy?: AxiosProxyConfig | false; + cancelToken?: CancelToken; +} + +export interface AxiosResponse { + data: T; + status: number; + statusText: string; + headers: any; + config: AxiosRequestConfig; + request?: any; +} + +export interface AxiosError extends Error { + config: AxiosRequestConfig; + code?: string; + request?: any; + response?: AxiosResponse; + isAxiosError: boolean; +} + +export interface AxiosPromise extends Promise> { +} + +export interface CancelStatic { + new (message?: string): Cancel; +} + +export interface Cancel { + message: string; +} + +export interface Canceler { + (message?: string): void; +} + +export interface CancelTokenStatic { + new (executor: (cancel: Canceler) => void): CancelToken; + source(): CancelTokenSource; +} + +export interface CancelToken { + promise: Promise; + reason?: Cancel; + throwIfRequested(): void; +} + +export interface CancelTokenSource { + token: CancelToken; + cancel: Canceler; +} + +export interface AxiosInterceptorManager { + use(onFulfilled?: (value: V) => V | Promise, onRejected?: (error: any) => any): number; + eject(id: number): void; +} + +export interface AxiosInstance { + (config: AxiosRequestConfig): AxiosPromise; + (url: string, config?: AxiosRequestConfig): AxiosPromise; + defaults: AxiosRequestConfig; + interceptors: { + request: AxiosInterceptorManager; + response: AxiosInterceptorManager; + }; + getUri(config?: AxiosRequestConfig): string; + request> (config: AxiosRequestConfig): Promise; + get>(url: string, config?: AxiosRequestConfig): Promise; + delete>(url: string, config?: AxiosRequestConfig): Promise; + head>(url: string, config?: AxiosRequestConfig): Promise; + post>(url: string, data?: any, config?: AxiosRequestConfig): Promise; + put>(url: string, data?: any, config?: AxiosRequestConfig): Promise; + patch>(url: string, data?: any, config?: AxiosRequestConfig): Promise; +} + +export interface AxiosStatic extends AxiosInstance { + create(config?: AxiosRequestConfig): AxiosInstance; + Cancel: CancelStatic; + CancelToken: CancelTokenStatic; + isCancel(value: any): boolean; + all(values: (T | Promise)[]): Promise; + spread(callback: (...args: T[]) => R): (array: T[]) => R; +} + +declare const Axios: AxiosStatic; + +export default Axios; diff --git a/node_modules/axios/index.js b/node_modules/axios/index.js new file mode 100644 index 0000000..79dfd09 --- /dev/null +++ b/node_modules/axios/index.js @@ -0,0 +1 @@ +module.exports = require('./lib/axios'); \ No newline at end of file diff --git a/node_modules/axios/lib/adapters/README.md b/node_modules/axios/lib/adapters/README.md new file mode 100644 index 0000000..68f1118 --- /dev/null +++ b/node_modules/axios/lib/adapters/README.md @@ -0,0 +1,37 @@ +# axios // adapters + +The modules under `adapters/` are modules that handle dispatching a request and settling a returned `Promise` once a response is received. + +## Example + +```js +var settle = require('./../core/settle'); + +module.exports = function myAdapter(config) { + // At this point: + // - config has been merged with defaults + // - request transformers have already run + // - request interceptors have already run + + // Make the request using config provided + // Upon response settle the Promise + + return new Promise(function(resolve, reject) { + + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // From here: + // - response transformers will run + // - response interceptors will run + }); +} +``` diff --git a/node_modules/axios/lib/adapters/http.js b/node_modules/axios/lib/adapters/http.js new file mode 100644 index 0000000..06169ff --- /dev/null +++ b/node_modules/axios/lib/adapters/http.js @@ -0,0 +1,275 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildURL = require('./../helpers/buildURL'); +var http = require('http'); +var https = require('https'); +var httpFollow = require('follow-redirects').http; +var httpsFollow = require('follow-redirects').https; +var url = require('url'); +var zlib = require('zlib'); +var pkg = require('./../../package.json'); +var createError = require('../core/createError'); +var enhanceError = require('../core/enhanceError'); + +var isHttps = /https:?/; + +/*eslint consistent-return:0*/ +module.exports = function httpAdapter(config) { + return new Promise(function dispatchHttpRequest(resolvePromise, rejectPromise) { + var timer; + var resolve = function resolve(value) { + clearTimeout(timer); + resolvePromise(value); + }; + var reject = function reject(value) { + clearTimeout(timer); + rejectPromise(value); + }; + var data = config.data; + var headers = config.headers; + + // Set User-Agent (required by some servers) + // Only set header if it hasn't been set in config + // See https://github.com/axios/axios/issues/69 + if (!headers['User-Agent'] && !headers['user-agent']) { + headers['User-Agent'] = 'axios/' + pkg.version; + } + + if (data && !utils.isStream(data)) { + if (Buffer.isBuffer(data)) { + // Nothing to do... + } else if (utils.isArrayBuffer(data)) { + data = Buffer.from(new Uint8Array(data)); + } else if (utils.isString(data)) { + data = Buffer.from(data, 'utf-8'); + } else { + return reject(createError( + 'Data after transformation must be a string, an ArrayBuffer, a Buffer, or a Stream', + config + )); + } + + // Add Content-Length header if data exists + headers['Content-Length'] = data.length; + } + + // HTTP basic authentication + var auth = undefined; + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + auth = username + ':' + password; + } + + // Parse url + var parsed = url.parse(config.url); + var protocol = parsed.protocol || 'http:'; + + if (!auth && parsed.auth) { + var urlAuth = parsed.auth.split(':'); + var urlUsername = urlAuth[0] || ''; + var urlPassword = urlAuth[1] || ''; + auth = urlUsername + ':' + urlPassword; + } + + if (auth) { + delete headers.Authorization; + } + + var isHttpsRequest = isHttps.test(protocol); + var agent = isHttpsRequest ? config.httpsAgent : config.httpAgent; + + var options = { + path: buildURL(parsed.path, config.params, config.paramsSerializer).replace(/^\?/, ''), + method: config.method.toUpperCase(), + headers: headers, + agent: agent, + auth: auth + }; + + if (config.socketPath) { + options.socketPath = config.socketPath; + } else { + options.hostname = parsed.hostname; + options.port = parsed.port; + } + + var proxy = config.proxy; + if (!proxy && proxy !== false) { + var proxyEnv = protocol.slice(0, -1) + '_proxy'; + var proxyUrl = process.env[proxyEnv] || process.env[proxyEnv.toUpperCase()]; + if (proxyUrl) { + var parsedProxyUrl = url.parse(proxyUrl); + var noProxyEnv = process.env.no_proxy || process.env.NO_PROXY; + var shouldProxy = true; + + if (noProxyEnv) { + var noProxy = noProxyEnv.split(',').map(function trim(s) { + return s.trim(); + }); + + shouldProxy = !noProxy.some(function proxyMatch(proxyElement) { + if (!proxyElement) { + return false; + } + if (proxyElement === '*') { + return true; + } + if (proxyElement[0] === '.' && + parsed.hostname.substr(parsed.hostname.length - proxyElement.length) === proxyElement && + proxyElement.match(/\./g).length === parsed.hostname.match(/\./g).length) { + return true; + } + + return parsed.hostname === proxyElement; + }); + } + + + if (shouldProxy) { + proxy = { + host: parsedProxyUrl.hostname, + port: parsedProxyUrl.port + }; + + if (parsedProxyUrl.auth) { + var proxyUrlAuth = parsedProxyUrl.auth.split(':'); + proxy.auth = { + username: proxyUrlAuth[0], + password: proxyUrlAuth[1] + }; + } + } + } + } + + if (proxy) { + options.hostname = proxy.host; + options.host = proxy.host; + options.headers.host = parsed.hostname + (parsed.port ? ':' + parsed.port : ''); + options.port = proxy.port; + options.path = protocol + '//' + parsed.hostname + (parsed.port ? ':' + parsed.port : '') + options.path; + + // Basic proxy authorization + if (proxy.auth) { + var base64 = Buffer.from(proxy.auth.username + ':' + proxy.auth.password, 'utf8').toString('base64'); + options.headers['Proxy-Authorization'] = 'Basic ' + base64; + } + } + + var transport; + var isHttpsProxy = isHttpsRequest && (proxy ? isHttps.test(proxy.protocol) : true); + if (config.transport) { + transport = config.transport; + } else if (config.maxRedirects === 0) { + transport = isHttpsProxy ? https : http; + } else { + if (config.maxRedirects) { + options.maxRedirects = config.maxRedirects; + } + transport = isHttpsProxy ? httpsFollow : httpFollow; + } + + if (config.maxContentLength && config.maxContentLength > -1) { + options.maxBodyLength = config.maxContentLength; + } + + // Create the request + var req = transport.request(options, function handleResponse(res) { + if (req.aborted) return; + + // uncompress the response body transparently if required + var stream = res; + switch (res.headers['content-encoding']) { + /*eslint default-case:0*/ + case 'gzip': + case 'compress': + case 'deflate': + // add the unzipper to the body stream processing pipeline + stream = (res.statusCode === 204) ? stream : stream.pipe(zlib.createUnzip()); + + // remove the content-encoding in order to not confuse downstream operations + delete res.headers['content-encoding']; + break; + } + + // return the last request in case of redirects + var lastRequest = res.req || req; + + var response = { + status: res.statusCode, + statusText: res.statusMessage, + headers: res.headers, + config: config, + request: lastRequest + }; + + if (config.responseType === 'stream') { + response.data = stream; + settle(resolve, reject, response); + } else { + var responseBuffer = []; + stream.on('data', function handleStreamData(chunk) { + responseBuffer.push(chunk); + + // make sure the content length is not over the maxContentLength if specified + if (config.maxContentLength > -1 && Buffer.concat(responseBuffer).length > config.maxContentLength) { + stream.destroy(); + reject(createError('maxContentLength size of ' + config.maxContentLength + ' exceeded', + config, null, lastRequest)); + } + }); + + stream.on('error', function handleStreamError(err) { + if (req.aborted) return; + reject(enhanceError(err, config, null, lastRequest)); + }); + + stream.on('end', function handleStreamEnd() { + var responseData = Buffer.concat(responseBuffer); + if (config.responseType !== 'arraybuffer') { + responseData = responseData.toString(config.responseEncoding); + } + + response.data = responseData; + settle(resolve, reject, response); + }); + } + }); + + // Handle errors + req.on('error', function handleRequestError(err) { + if (req.aborted) return; + reject(enhanceError(err, config, null, req)); + }); + + // Handle request timeout + if (config.timeout) { + timer = setTimeout(function handleRequestTimeout() { + req.abort(); + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', req)); + }, config.timeout); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (req.aborted) return; + + req.abort(); + reject(cancel); + }); + } + + // Send the request + if (utils.isStream(data)) { + data.on('error', function handleStreamError(err) { + reject(enhanceError(err, config, null, req)); + }).pipe(req); + } else { + req.end(data); + } + }); +}; diff --git a/node_modules/axios/lib/adapters/xhr.js b/node_modules/axios/lib/adapters/xhr.js new file mode 100644 index 0000000..8c98d11 --- /dev/null +++ b/node_modules/axios/lib/adapters/xhr.js @@ -0,0 +1,174 @@ +'use strict'; + +var utils = require('./../utils'); +var settle = require('./../core/settle'); +var buildURL = require('./../helpers/buildURL'); +var parseHeaders = require('./../helpers/parseHeaders'); +var isURLSameOrigin = require('./../helpers/isURLSameOrigin'); +var createError = require('../core/createError'); + +module.exports = function xhrAdapter(config) { + return new Promise(function dispatchXhrRequest(resolve, reject) { + var requestData = config.data; + var requestHeaders = config.headers; + + if (utils.isFormData(requestData)) { + delete requestHeaders['Content-Type']; // Let the browser set it + } + + var request = new XMLHttpRequest(); + + // HTTP basic authentication + if (config.auth) { + var username = config.auth.username || ''; + var password = config.auth.password || ''; + requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password); + } + + request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true); + + // Set the request timeout in MS + request.timeout = config.timeout; + + // Listen for ready state + request.onreadystatechange = function handleLoad() { + if (!request || request.readyState !== 4) { + return; + } + + // The request errored out and we didn't get a response, this will be + // handled by onerror instead + // With one exception: request that using file: protocol, most browsers + // will return status as 0 even though it's a successful request + if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) { + return; + } + + // Prepare the response + var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null; + var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response; + var response = { + data: responseData, + status: request.status, + statusText: request.statusText, + headers: responseHeaders, + config: config, + request: request + }; + + settle(resolve, reject, response); + + // Clean up request + request = null; + }; + + // Handle browser request cancellation (as opposed to a manual cancellation) + request.onabort = function handleAbort() { + if (!request) { + return; + } + + reject(createError('Request aborted', config, 'ECONNABORTED', request)); + + // Clean up request + request = null; + }; + + // Handle low level network errors + request.onerror = function handleError() { + // Real errors are hidden from us by the browser + // onerror should only fire if it's a network error + reject(createError('Network Error', config, null, request)); + + // Clean up request + request = null; + }; + + // Handle timeout + request.ontimeout = function handleTimeout() { + reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED', + request)); + + // Clean up request + request = null; + }; + + // Add xsrf header + // This is only done if running in a standard browser environment. + // Specifically not if we're in a web worker, or react-native. + if (utils.isStandardBrowserEnv()) { + var cookies = require('./../helpers/cookies'); + + // Add xsrf header + var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ? + cookies.read(config.xsrfCookieName) : + undefined; + + if (xsrfValue) { + requestHeaders[config.xsrfHeaderName] = xsrfValue; + } + } + + // Add headers to the request + if ('setRequestHeader' in request) { + utils.forEach(requestHeaders, function setRequestHeader(val, key) { + if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') { + // Remove Content-Type if data is undefined + delete requestHeaders[key]; + } else { + // Otherwise add header to the request + request.setRequestHeader(key, val); + } + }); + } + + // Add withCredentials to request if needed + if (config.withCredentials) { + request.withCredentials = true; + } + + // Add responseType to request if needed + if (config.responseType) { + try { + request.responseType = config.responseType; + } catch (e) { + // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2. + // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function. + if (config.responseType !== 'json') { + throw e; + } + } + } + + // Handle progress if needed + if (typeof config.onDownloadProgress === 'function') { + request.addEventListener('progress', config.onDownloadProgress); + } + + // Not all browsers support upload events + if (typeof config.onUploadProgress === 'function' && request.upload) { + request.upload.addEventListener('progress', config.onUploadProgress); + } + + if (config.cancelToken) { + // Handle cancellation + config.cancelToken.promise.then(function onCanceled(cancel) { + if (!request) { + return; + } + + request.abort(); + reject(cancel); + // Clean up request + request = null; + }); + } + + if (requestData === undefined) { + requestData = null; + } + + // Send the request + request.send(requestData); + }); +}; diff --git a/node_modules/axios/lib/axios.js b/node_modules/axios/lib/axios.js new file mode 100644 index 0000000..8142437 --- /dev/null +++ b/node_modules/axios/lib/axios.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./utils'); +var bind = require('./helpers/bind'); +var Axios = require('./core/Axios'); +var mergeConfig = require('./core/mergeConfig'); +var defaults = require('./defaults'); + +/** + * Create an instance of Axios + * + * @param {Object} defaultConfig The default config for the instance + * @return {Axios} A new instance of Axios + */ +function createInstance(defaultConfig) { + var context = new Axios(defaultConfig); + var instance = bind(Axios.prototype.request, context); + + // Copy axios.prototype to instance + utils.extend(instance, Axios.prototype, context); + + // Copy context to instance + utils.extend(instance, context); + + return instance; +} + +// Create the default instance to be exported +var axios = createInstance(defaults); + +// Expose Axios class to allow class inheritance +axios.Axios = Axios; + +// Factory for creating new instances +axios.create = function create(instanceConfig) { + return createInstance(mergeConfig(axios.defaults, instanceConfig)); +}; + +// Expose Cancel & CancelToken +axios.Cancel = require('./cancel/Cancel'); +axios.CancelToken = require('./cancel/CancelToken'); +axios.isCancel = require('./cancel/isCancel'); + +// Expose all/spread +axios.all = function all(promises) { + return Promise.all(promises); +}; +axios.spread = require('./helpers/spread'); + +module.exports = axios; + +// Allow use of default import syntax in TypeScript +module.exports.default = axios; diff --git a/node_modules/axios/lib/cancel/Cancel.js b/node_modules/axios/lib/cancel/Cancel.js new file mode 100644 index 0000000..e0de400 --- /dev/null +++ b/node_modules/axios/lib/cancel/Cancel.js @@ -0,0 +1,19 @@ +'use strict'; + +/** + * A `Cancel` is an object that is thrown when an operation is canceled. + * + * @class + * @param {string=} message The message. + */ +function Cancel(message) { + this.message = message; +} + +Cancel.prototype.toString = function toString() { + return 'Cancel' + (this.message ? ': ' + this.message : ''); +}; + +Cancel.prototype.__CANCEL__ = true; + +module.exports = Cancel; diff --git a/node_modules/axios/lib/cancel/CancelToken.js b/node_modules/axios/lib/cancel/CancelToken.js new file mode 100644 index 0000000..6b46e66 --- /dev/null +++ b/node_modules/axios/lib/cancel/CancelToken.js @@ -0,0 +1,57 @@ +'use strict'; + +var Cancel = require('./Cancel'); + +/** + * A `CancelToken` is an object that can be used to request cancellation of an operation. + * + * @class + * @param {Function} executor The executor function. + */ +function CancelToken(executor) { + if (typeof executor !== 'function') { + throw new TypeError('executor must be a function.'); + } + + var resolvePromise; + this.promise = new Promise(function promiseExecutor(resolve) { + resolvePromise = resolve; + }); + + var token = this; + executor(function cancel(message) { + if (token.reason) { + // Cancellation has already been requested + return; + } + + token.reason = new Cancel(message); + resolvePromise(token.reason); + }); +} + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +CancelToken.prototype.throwIfRequested = function throwIfRequested() { + if (this.reason) { + throw this.reason; + } +}; + +/** + * Returns an object that contains a new `CancelToken` and a function that, when called, + * cancels the `CancelToken`. + */ +CancelToken.source = function source() { + var cancel; + var token = new CancelToken(function executor(c) { + cancel = c; + }); + return { + token: token, + cancel: cancel + }; +}; + +module.exports = CancelToken; diff --git a/node_modules/axios/lib/cancel/isCancel.js b/node_modules/axios/lib/cancel/isCancel.js new file mode 100644 index 0000000..051f3ae --- /dev/null +++ b/node_modules/axios/lib/cancel/isCancel.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function isCancel(value) { + return !!(value && value.__CANCEL__); +}; diff --git a/node_modules/axios/lib/core/Axios.js b/node_modules/axios/lib/core/Axios.js new file mode 100644 index 0000000..811cb36 --- /dev/null +++ b/node_modules/axios/lib/core/Axios.js @@ -0,0 +1,86 @@ +'use strict'; + +var utils = require('./../utils'); +var buildURL = require('../helpers/buildURL'); +var InterceptorManager = require('./InterceptorManager'); +var dispatchRequest = require('./dispatchRequest'); +var mergeConfig = require('./mergeConfig'); + +/** + * Create a new instance of Axios + * + * @param {Object} instanceConfig The default config for the instance + */ +function Axios(instanceConfig) { + this.defaults = instanceConfig; + this.interceptors = { + request: new InterceptorManager(), + response: new InterceptorManager() + }; +} + +/** + * Dispatch a request + * + * @param {Object} config The config specific for this request (merged with this.defaults) + */ +Axios.prototype.request = function request(config) { + /*eslint no-param-reassign:0*/ + // Allow for axios('example/url'[, config]) a la fetch API + if (typeof config === 'string') { + config = arguments[1] || {}; + config.url = arguments[0]; + } else { + config = config || {}; + } + + config = mergeConfig(this.defaults, config); + config.method = config.method ? config.method.toLowerCase() : 'get'; + + // Hook up interceptors middleware + var chain = [dispatchRequest, undefined]; + var promise = Promise.resolve(config); + + this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) { + chain.unshift(interceptor.fulfilled, interceptor.rejected); + }); + + this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) { + chain.push(interceptor.fulfilled, interceptor.rejected); + }); + + while (chain.length) { + promise = promise.then(chain.shift(), chain.shift()); + } + + return promise; +}; + +Axios.prototype.getUri = function getUri(config) { + config = mergeConfig(this.defaults, config); + return buildURL(config.url, config.params, config.paramsSerializer).replace(/^\?/, ''); +}; + +// Provide aliases for supported request methods +utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url + })); + }; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + /*eslint func-names:0*/ + Axios.prototype[method] = function(url, data, config) { + return this.request(utils.merge(config || {}, { + method: method, + url: url, + data: data + })); + }; +}); + +module.exports = Axios; diff --git a/node_modules/axios/lib/core/InterceptorManager.js b/node_modules/axios/lib/core/InterceptorManager.js new file mode 100644 index 0000000..50d667b --- /dev/null +++ b/node_modules/axios/lib/core/InterceptorManager.js @@ -0,0 +1,52 @@ +'use strict'; + +var utils = require('./../utils'); + +function InterceptorManager() { + this.handlers = []; +} + +/** + * Add a new interceptor to the stack + * + * @param {Function} fulfilled The function to handle `then` for a `Promise` + * @param {Function} rejected The function to handle `reject` for a `Promise` + * + * @return {Number} An ID used to remove interceptor later + */ +InterceptorManager.prototype.use = function use(fulfilled, rejected) { + this.handlers.push({ + fulfilled: fulfilled, + rejected: rejected + }); + return this.handlers.length - 1; +}; + +/** + * Remove an interceptor from the stack + * + * @param {Number} id The ID that was returned by `use` + */ +InterceptorManager.prototype.eject = function eject(id) { + if (this.handlers[id]) { + this.handlers[id] = null; + } +}; + +/** + * Iterate over all the registered interceptors + * + * This method is particularly useful for skipping over any + * interceptors that may have become `null` calling `eject`. + * + * @param {Function} fn The function to call for each interceptor + */ +InterceptorManager.prototype.forEach = function forEach(fn) { + utils.forEach(this.handlers, function forEachHandler(h) { + if (h !== null) { + fn(h); + } + }); +}; + +module.exports = InterceptorManager; diff --git a/node_modules/axios/lib/core/README.md b/node_modules/axios/lib/core/README.md new file mode 100644 index 0000000..253bc48 --- /dev/null +++ b/node_modules/axios/lib/core/README.md @@ -0,0 +1,7 @@ +# axios // core + +The modules found in `core/` should be modules that are specific to the domain logic of axios. These modules would most likely not make sense to be consumed outside of the axios module, as their logic is too specific. Some examples of core modules are: + +- Dispatching requests +- Managing interceptors +- Handling config diff --git a/node_modules/axios/lib/core/createError.js b/node_modules/axios/lib/core/createError.js new file mode 100644 index 0000000..933680f --- /dev/null +++ b/node_modules/axios/lib/core/createError.js @@ -0,0 +1,18 @@ +'use strict'; + +var enhanceError = require('./enhanceError'); + +/** + * Create an Error with the specified message, config, error code, request and response. + * + * @param {string} message The error message. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The created error. + */ +module.exports = function createError(message, config, code, request, response) { + var error = new Error(message); + return enhanceError(error, config, code, request, response); +}; diff --git a/node_modules/axios/lib/core/dispatchRequest.js b/node_modules/axios/lib/core/dispatchRequest.js new file mode 100644 index 0000000..9ea70f2 --- /dev/null +++ b/node_modules/axios/lib/core/dispatchRequest.js @@ -0,0 +1,86 @@ +'use strict'; + +var utils = require('./../utils'); +var transformData = require('./transformData'); +var isCancel = require('../cancel/isCancel'); +var defaults = require('../defaults'); +var isAbsoluteURL = require('./../helpers/isAbsoluteURL'); +var combineURLs = require('./../helpers/combineURLs'); + +/** + * Throws a `Cancel` if cancellation has been requested. + */ +function throwIfCancellationRequested(config) { + if (config.cancelToken) { + config.cancelToken.throwIfRequested(); + } +} + +/** + * Dispatch a request to the server using the configured adapter. + * + * @param {object} config The config that is to be used for the request + * @returns {Promise} The Promise to be fulfilled + */ +module.exports = function dispatchRequest(config) { + throwIfCancellationRequested(config); + + // Support baseURL config + if (config.baseURL && !isAbsoluteURL(config.url)) { + config.url = combineURLs(config.baseURL, config.url); + } + + // Ensure headers exist + config.headers = config.headers || {}; + + // Transform request data + config.data = transformData( + config.data, + config.headers, + config.transformRequest + ); + + // Flatten headers + config.headers = utils.merge( + config.headers.common || {}, + config.headers[config.method] || {}, + config.headers || {} + ); + + utils.forEach( + ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'], + function cleanHeaderConfig(method) { + delete config.headers[method]; + } + ); + + var adapter = config.adapter || defaults.adapter; + + return adapter(config).then(function onAdapterResolution(response) { + throwIfCancellationRequested(config); + + // Transform response data + response.data = transformData( + response.data, + response.headers, + config.transformResponse + ); + + return response; + }, function onAdapterRejection(reason) { + if (!isCancel(reason)) { + throwIfCancellationRequested(config); + + // Transform response data + if (reason && reason.response) { + reason.response.data = transformData( + reason.response.data, + reason.response.headers, + config.transformResponse + ); + } + } + + return Promise.reject(reason); + }); +}; diff --git a/node_modules/axios/lib/core/enhanceError.js b/node_modules/axios/lib/core/enhanceError.js new file mode 100644 index 0000000..02fbbd6 --- /dev/null +++ b/node_modules/axios/lib/core/enhanceError.js @@ -0,0 +1,42 @@ +'use strict'; + +/** + * Update an Error with the specified config, error code, and response. + * + * @param {Error} error The error to update. + * @param {Object} config The config. + * @param {string} [code] The error code (for example, 'ECONNABORTED'). + * @param {Object} [request] The request. + * @param {Object} [response] The response. + * @returns {Error} The error. + */ +module.exports = function enhanceError(error, config, code, request, response) { + error.config = config; + if (code) { + error.code = code; + } + + error.request = request; + error.response = response; + error.isAxiosError = true; + + error.toJSON = function() { + return { + // Standard + message: this.message, + name: this.name, + // Microsoft + description: this.description, + number: this.number, + // Mozilla + fileName: this.fileName, + lineNumber: this.lineNumber, + columnNumber: this.columnNumber, + stack: this.stack, + // Axios + config: this.config, + code: this.code + }; + }; + return error; +}; diff --git a/node_modules/axios/lib/core/mergeConfig.js b/node_modules/axios/lib/core/mergeConfig.js new file mode 100644 index 0000000..6097a3e --- /dev/null +++ b/node_modules/axios/lib/core/mergeConfig.js @@ -0,0 +1,51 @@ +'use strict'; + +var utils = require('../utils'); + +/** + * Config-specific merge-function which creates a new config-object + * by merging two configuration objects together. + * + * @param {Object} config1 + * @param {Object} config2 + * @returns {Object} New object resulting from merging config2 to config1 + */ +module.exports = function mergeConfig(config1, config2) { + // eslint-disable-next-line no-param-reassign + config2 = config2 || {}; + var config = {}; + + utils.forEach(['url', 'method', 'params', 'data'], function valueFromConfig2(prop) { + if (typeof config2[prop] !== 'undefined') { + config[prop] = config2[prop]; + } + }); + + utils.forEach(['headers', 'auth', 'proxy'], function mergeDeepProperties(prop) { + if (utils.isObject(config2[prop])) { + config[prop] = utils.deepMerge(config1[prop], config2[prop]); + } else if (typeof config2[prop] !== 'undefined') { + config[prop] = config2[prop]; + } else if (utils.isObject(config1[prop])) { + config[prop] = utils.deepMerge(config1[prop]); + } else if (typeof config1[prop] !== 'undefined') { + config[prop] = config1[prop]; + } + }); + + utils.forEach([ + 'baseURL', 'transformRequest', 'transformResponse', 'paramsSerializer', + 'timeout', 'withCredentials', 'adapter', 'responseType', 'xsrfCookieName', + 'xsrfHeaderName', 'onUploadProgress', 'onDownloadProgress', 'maxContentLength', + 'validateStatus', 'maxRedirects', 'httpAgent', 'httpsAgent', 'cancelToken', + 'socketPath' + ], function defaultToConfig2(prop) { + if (typeof config2[prop] !== 'undefined') { + config[prop] = config2[prop]; + } else if (typeof config1[prop] !== 'undefined') { + config[prop] = config1[prop]; + } + }); + + return config; +}; diff --git a/node_modules/axios/lib/core/settle.js b/node_modules/axios/lib/core/settle.js new file mode 100644 index 0000000..071d9e3 --- /dev/null +++ b/node_modules/axios/lib/core/settle.js @@ -0,0 +1,25 @@ +'use strict'; + +var createError = require('./createError'); + +/** + * Resolve or reject a Promise based on response status. + * + * @param {Function} resolve A function that resolves the promise. + * @param {Function} reject A function that rejects the promise. + * @param {object} response The response. + */ +module.exports = function settle(resolve, reject, response) { + var validateStatus = response.config.validateStatus; + if (!validateStatus || validateStatus(response.status)) { + resolve(response); + } else { + reject(createError( + 'Request failed with status code ' + response.status, + response.config, + null, + response.request, + response + )); + } +}; diff --git a/node_modules/axios/lib/core/transformData.js b/node_modules/axios/lib/core/transformData.js new file mode 100644 index 0000000..e065362 --- /dev/null +++ b/node_modules/axios/lib/core/transformData.js @@ -0,0 +1,20 @@ +'use strict'; + +var utils = require('./../utils'); + +/** + * Transform the data for a request or a response + * + * @param {Object|String} data The data to be transformed + * @param {Array} headers The headers for the request or response + * @param {Array|Function} fns A single function or Array of functions + * @returns {*} The resulting transformed data + */ +module.exports = function transformData(data, headers, fns) { + /*eslint no-param-reassign:0*/ + utils.forEach(fns, function transform(fn) { + data = fn(data, headers); + }); + + return data; +}; diff --git a/node_modules/axios/lib/defaults.js b/node_modules/axios/lib/defaults.js new file mode 100644 index 0000000..7cb8a25 --- /dev/null +++ b/node_modules/axios/lib/defaults.js @@ -0,0 +1,98 @@ +'use strict'; + +var utils = require('./utils'); +var normalizeHeaderName = require('./helpers/normalizeHeaderName'); + +var DEFAULT_CONTENT_TYPE = { + 'Content-Type': 'application/x-www-form-urlencoded' +}; + +function setContentTypeIfUnset(headers, value) { + if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) { + headers['Content-Type'] = value; + } +} + +function getDefaultAdapter() { + var adapter; + // Only Node.JS has a process variable that is of [[Class]] process + if (typeof process !== 'undefined' && Object.prototype.toString.call(process) === '[object process]') { + // For node use HTTP adapter + adapter = require('./adapters/http'); + } else if (typeof XMLHttpRequest !== 'undefined') { + // For browsers use XHR adapter + adapter = require('./adapters/xhr'); + } + return adapter; +} + +var defaults = { + adapter: getDefaultAdapter(), + + transformRequest: [function transformRequest(data, headers) { + normalizeHeaderName(headers, 'Accept'); + normalizeHeaderName(headers, 'Content-Type'); + if (utils.isFormData(data) || + utils.isArrayBuffer(data) || + utils.isBuffer(data) || + utils.isStream(data) || + utils.isFile(data) || + utils.isBlob(data) + ) { + return data; + } + if (utils.isArrayBufferView(data)) { + return data.buffer; + } + if (utils.isURLSearchParams(data)) { + setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8'); + return data.toString(); + } + if (utils.isObject(data)) { + setContentTypeIfUnset(headers, 'application/json;charset=utf-8'); + return JSON.stringify(data); + } + return data; + }], + + transformResponse: [function transformResponse(data) { + /*eslint no-param-reassign:0*/ + if (typeof data === 'string') { + try { + data = JSON.parse(data); + } catch (e) { /* Ignore */ } + } + return data; + }], + + /** + * A timeout in milliseconds to abort a request. If set to 0 (default) a + * timeout is not created. + */ + timeout: 0, + + xsrfCookieName: 'XSRF-TOKEN', + xsrfHeaderName: 'X-XSRF-TOKEN', + + maxContentLength: -1, + + validateStatus: function validateStatus(status) { + return status >= 200 && status < 300; + } +}; + +defaults.headers = { + common: { + 'Accept': 'application/json, text/plain, */*' + } +}; + +utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) { + defaults.headers[method] = {}; +}); + +utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) { + defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE); +}); + +module.exports = defaults; diff --git a/node_modules/axios/lib/helpers/README.md b/node_modules/axios/lib/helpers/README.md new file mode 100644 index 0000000..4ae3419 --- /dev/null +++ b/node_modules/axios/lib/helpers/README.md @@ -0,0 +1,7 @@ +# axios // helpers + +The modules found in `helpers/` should be generic modules that are _not_ specific to the domain logic of axios. These modules could theoretically be published to npm on their own and consumed by other modules or apps. Some examples of generic modules are things like: + +- Browser polyfills +- Managing cookies +- Parsing HTTP headers diff --git a/node_modules/axios/lib/helpers/bind.js b/node_modules/axios/lib/helpers/bind.js new file mode 100644 index 0000000..6147c60 --- /dev/null +++ b/node_modules/axios/lib/helpers/bind.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function bind(fn, thisArg) { + return function wrap() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + return fn.apply(thisArg, args); + }; +}; diff --git a/node_modules/axios/lib/helpers/buildURL.js b/node_modules/axios/lib/helpers/buildURL.js new file mode 100644 index 0000000..8c40e40 --- /dev/null +++ b/node_modules/axios/lib/helpers/buildURL.js @@ -0,0 +1,71 @@ +'use strict'; + +var utils = require('./../utils'); + +function encode(val) { + return encodeURIComponent(val). + replace(/%40/gi, '@'). + replace(/%3A/gi, ':'). + replace(/%24/g, '$'). + replace(/%2C/gi, ','). + replace(/%20/g, '+'). + replace(/%5B/gi, '['). + replace(/%5D/gi, ']'); +} + +/** + * Build a URL by appending params to the end + * + * @param {string} url The base of the url (e.g., http://www.google.com) + * @param {object} [params] The params to be appended + * @returns {string} The formatted url + */ +module.exports = function buildURL(url, params, paramsSerializer) { + /*eslint no-param-reassign:0*/ + if (!params) { + return url; + } + + var serializedParams; + if (paramsSerializer) { + serializedParams = paramsSerializer(params); + } else if (utils.isURLSearchParams(params)) { + serializedParams = params.toString(); + } else { + var parts = []; + + utils.forEach(params, function serialize(val, key) { + if (val === null || typeof val === 'undefined') { + return; + } + + if (utils.isArray(val)) { + key = key + '[]'; + } else { + val = [val]; + } + + utils.forEach(val, function parseValue(v) { + if (utils.isDate(v)) { + v = v.toISOString(); + } else if (utils.isObject(v)) { + v = JSON.stringify(v); + } + parts.push(encode(key) + '=' + encode(v)); + }); + }); + + serializedParams = parts.join('&'); + } + + if (serializedParams) { + var hashmarkIndex = url.indexOf('#'); + if (hashmarkIndex !== -1) { + url = url.slice(0, hashmarkIndex); + } + + url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams; + } + + return url; +}; diff --git a/node_modules/axios/lib/helpers/combineURLs.js b/node_modules/axios/lib/helpers/combineURLs.js new file mode 100644 index 0000000..f1b58a5 --- /dev/null +++ b/node_modules/axios/lib/helpers/combineURLs.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Creates a new URL by combining the specified URLs + * + * @param {string} baseURL The base URL + * @param {string} relativeURL The relative URL + * @returns {string} The combined URL + */ +module.exports = function combineURLs(baseURL, relativeURL) { + return relativeURL + ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '') + : baseURL; +}; diff --git a/node_modules/axios/lib/helpers/cookies.js b/node_modules/axios/lib/helpers/cookies.js new file mode 100644 index 0000000..5a8a666 --- /dev/null +++ b/node_modules/axios/lib/helpers/cookies.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs support document.cookie + (function standardBrowserEnv() { + return { + write: function write(name, value, expires, path, domain, secure) { + var cookie = []; + cookie.push(name + '=' + encodeURIComponent(value)); + + if (utils.isNumber(expires)) { + cookie.push('expires=' + new Date(expires).toGMTString()); + } + + if (utils.isString(path)) { + cookie.push('path=' + path); + } + + if (utils.isString(domain)) { + cookie.push('domain=' + domain); + } + + if (secure === true) { + cookie.push('secure'); + } + + document.cookie = cookie.join('; '); + }, + + read: function read(name) { + var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)')); + return (match ? decodeURIComponent(match[3]) : null); + }, + + remove: function remove(name) { + this.write(name, '', Date.now() - 86400000); + } + }; + })() : + + // Non standard browser env (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return { + write: function write() {}, + read: function read() { return null; }, + remove: function remove() {} + }; + })() +); diff --git a/node_modules/axios/lib/helpers/deprecatedMethod.js b/node_modules/axios/lib/helpers/deprecatedMethod.js new file mode 100644 index 0000000..ed40965 --- /dev/null +++ b/node_modules/axios/lib/helpers/deprecatedMethod.js @@ -0,0 +1,24 @@ +'use strict'; + +/*eslint no-console:0*/ + +/** + * Supply a warning to the developer that a method they are using + * has been deprecated. + * + * @param {string} method The name of the deprecated method + * @param {string} [instead] The alternate method to use if applicable + * @param {string} [docs] The documentation URL to get further details + */ +module.exports = function deprecatedMethod(method, instead, docs) { + try { + console.warn( + 'DEPRECATED method `' + method + '`.' + + (instead ? ' Use `' + instead + '` instead.' : '') + + ' This method will be removed in a future release.'); + + if (docs) { + console.warn('For more information about usage see ' + docs); + } + } catch (e) { /* Ignore */ } +}; diff --git a/node_modules/axios/lib/helpers/isAbsoluteURL.js b/node_modules/axios/lib/helpers/isAbsoluteURL.js new file mode 100644 index 0000000..d33e992 --- /dev/null +++ b/node_modules/axios/lib/helpers/isAbsoluteURL.js @@ -0,0 +1,14 @@ +'use strict'; + +/** + * Determines whether the specified URL is absolute + * + * @param {string} url The URL to test + * @returns {boolean} True if the specified URL is absolute, otherwise false + */ +module.exports = function isAbsoluteURL(url) { + // A URL is considered absolute if it begins with "://" or "//" (protocol-relative URL). + // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed + // by any combination of letters, digits, plus, period, or hyphen. + return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url); +}; diff --git a/node_modules/axios/lib/helpers/isURLSameOrigin.js b/node_modules/axios/lib/helpers/isURLSameOrigin.js new file mode 100644 index 0000000..f1d89ad --- /dev/null +++ b/node_modules/axios/lib/helpers/isURLSameOrigin.js @@ -0,0 +1,68 @@ +'use strict'; + +var utils = require('./../utils'); + +module.exports = ( + utils.isStandardBrowserEnv() ? + + // Standard browser envs have full support of the APIs needed to test + // whether the request URL is of the same origin as current location. + (function standardBrowserEnv() { + var msie = /(msie|trident)/i.test(navigator.userAgent); + var urlParsingNode = document.createElement('a'); + var originURL; + + /** + * Parse a URL to discover it's components + * + * @param {String} url The URL to be parsed + * @returns {Object} + */ + function resolveURL(url) { + var href = url; + + if (msie) { + // IE needs attribute set twice to normalize properties + urlParsingNode.setAttribute('href', href); + href = urlParsingNode.href; + } + + urlParsingNode.setAttribute('href', href); + + // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils + return { + href: urlParsingNode.href, + protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '', + host: urlParsingNode.host, + search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '', + hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '', + hostname: urlParsingNode.hostname, + port: urlParsingNode.port, + pathname: (urlParsingNode.pathname.charAt(0) === '/') ? + urlParsingNode.pathname : + '/' + urlParsingNode.pathname + }; + } + + originURL = resolveURL(window.location.href); + + /** + * Determine if a URL shares the same origin as the current location + * + * @param {String} requestURL The URL to test + * @returns {boolean} True if URL shares the same origin, otherwise false + */ + return function isURLSameOrigin(requestURL) { + var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL; + return (parsed.protocol === originURL.protocol && + parsed.host === originURL.host); + }; + })() : + + // Non standard browser envs (web workers, react-native) lack needed support. + (function nonStandardBrowserEnv() { + return function isURLSameOrigin() { + return true; + }; + })() +); diff --git a/node_modules/axios/lib/helpers/normalizeHeaderName.js b/node_modules/axios/lib/helpers/normalizeHeaderName.js new file mode 100644 index 0000000..738c9fe --- /dev/null +++ b/node_modules/axios/lib/helpers/normalizeHeaderName.js @@ -0,0 +1,12 @@ +'use strict'; + +var utils = require('../utils'); + +module.exports = function normalizeHeaderName(headers, normalizedName) { + utils.forEach(headers, function processHeader(value, name) { + if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) { + headers[normalizedName] = value; + delete headers[name]; + } + }); +}; diff --git a/node_modules/axios/lib/helpers/parseHeaders.js b/node_modules/axios/lib/helpers/parseHeaders.js new file mode 100644 index 0000000..8af2cc7 --- /dev/null +++ b/node_modules/axios/lib/helpers/parseHeaders.js @@ -0,0 +1,53 @@ +'use strict'; + +var utils = require('./../utils'); + +// Headers whose duplicates are ignored by node +// c.f. https://nodejs.org/api/http.html#http_message_headers +var ignoreDuplicateOf = [ + 'age', 'authorization', 'content-length', 'content-type', 'etag', + 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since', + 'last-modified', 'location', 'max-forwards', 'proxy-authorization', + 'referer', 'retry-after', 'user-agent' +]; + +/** + * Parse headers into an object + * + * ``` + * Date: Wed, 27 Aug 2014 08:58:49 GMT + * Content-Type: application/json + * Connection: keep-alive + * Transfer-Encoding: chunked + * ``` + * + * @param {String} headers Headers needing to be parsed + * @returns {Object} Headers parsed into an object + */ +module.exports = function parseHeaders(headers) { + var parsed = {}; + var key; + var val; + var i; + + if (!headers) { return parsed; } + + utils.forEach(headers.split('\n'), function parser(line) { + i = line.indexOf(':'); + key = utils.trim(line.substr(0, i)).toLowerCase(); + val = utils.trim(line.substr(i + 1)); + + if (key) { + if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) { + return; + } + if (key === 'set-cookie') { + parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]); + } else { + parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val; + } + } + }); + + return parsed; +}; diff --git a/node_modules/axios/lib/helpers/spread.js b/node_modules/axios/lib/helpers/spread.js new file mode 100644 index 0000000..25e3cdd --- /dev/null +++ b/node_modules/axios/lib/helpers/spread.js @@ -0,0 +1,27 @@ +'use strict'; + +/** + * Syntactic sugar for invoking a function and expanding an array for arguments. + * + * Common use case would be to use `Function.prototype.apply`. + * + * ```js + * function f(x, y, z) {} + * var args = [1, 2, 3]; + * f.apply(null, args); + * ``` + * + * With `spread` this example can be re-written. + * + * ```js + * spread(function(x, y, z) {})([1, 2, 3]); + * ``` + * + * @param {Function} callback + * @returns {Function} + */ +module.exports = function spread(callback) { + return function wrap(arr) { + return callback.apply(null, arr); + }; +}; diff --git a/node_modules/axios/lib/utils.js b/node_modules/axios/lib/utils.js new file mode 100644 index 0000000..8946055 --- /dev/null +++ b/node_modules/axios/lib/utils.js @@ -0,0 +1,334 @@ +'use strict'; + +var bind = require('./helpers/bind'); +var isBuffer = require('is-buffer'); + +/*global toString:true*/ + +// utils is a library of generic helper functions non-specific to axios + +var toString = Object.prototype.toString; + +/** + * Determine if a value is an Array + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Array, otherwise false + */ +function isArray(val) { + return toString.call(val) === '[object Array]'; +} + +/** + * Determine if a value is an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an ArrayBuffer, otherwise false + */ +function isArrayBuffer(val) { + return toString.call(val) === '[object ArrayBuffer]'; +} + +/** + * Determine if a value is a FormData + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an FormData, otherwise false + */ +function isFormData(val) { + return (typeof FormData !== 'undefined') && (val instanceof FormData); +} + +/** + * Determine if a value is a view on an ArrayBuffer + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false + */ +function isArrayBufferView(val) { + var result; + if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) { + result = ArrayBuffer.isView(val); + } else { + result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer); + } + return result; +} + +/** + * Determine if a value is a String + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a String, otherwise false + */ +function isString(val) { + return typeof val === 'string'; +} + +/** + * Determine if a value is a Number + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Number, otherwise false + */ +function isNumber(val) { + return typeof val === 'number'; +} + +/** + * Determine if a value is undefined + * + * @param {Object} val The value to test + * @returns {boolean} True if the value is undefined, otherwise false + */ +function isUndefined(val) { + return typeof val === 'undefined'; +} + +/** + * Determine if a value is an Object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is an Object, otherwise false + */ +function isObject(val) { + return val !== null && typeof val === 'object'; +} + +/** + * Determine if a value is a Date + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Date, otherwise false + */ +function isDate(val) { + return toString.call(val) === '[object Date]'; +} + +/** + * Determine if a value is a File + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a File, otherwise false + */ +function isFile(val) { + return toString.call(val) === '[object File]'; +} + +/** + * Determine if a value is a Blob + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Blob, otherwise false + */ +function isBlob(val) { + return toString.call(val) === '[object Blob]'; +} + +/** + * Determine if a value is a Function + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Function, otherwise false + */ +function isFunction(val) { + return toString.call(val) === '[object Function]'; +} + +/** + * Determine if a value is a Stream + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a Stream, otherwise false + */ +function isStream(val) { + return isObject(val) && isFunction(val.pipe); +} + +/** + * Determine if a value is a URLSearchParams object + * + * @param {Object} val The value to test + * @returns {boolean} True if value is a URLSearchParams object, otherwise false + */ +function isURLSearchParams(val) { + return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams; +} + +/** + * Trim excess whitespace off the beginning and end of a string + * + * @param {String} str The String to trim + * @returns {String} The String freed of excess whitespace + */ +function trim(str) { + return str.replace(/^\s*/, '').replace(/\s*$/, ''); +} + +/** + * Determine if we're running in a standard browser environment + * + * This allows axios to run in a web worker, and react-native. + * Both environments support XMLHttpRequest, but not fully standard globals. + * + * web workers: + * typeof window -> undefined + * typeof document -> undefined + * + * react-native: + * navigator.product -> 'ReactNative' + * nativescript + * navigator.product -> 'NativeScript' or 'NS' + */ +function isStandardBrowserEnv() { + if (typeof navigator !== 'undefined' && (navigator.product === 'ReactNative' || + navigator.product === 'NativeScript' || + navigator.product === 'NS')) { + return false; + } + return ( + typeof window !== 'undefined' && + typeof document !== 'undefined' + ); +} + +/** + * Iterate over an Array or an Object invoking a function for each item. + * + * If `obj` is an Array callback will be called passing + * the value, index, and complete array for each item. + * + * If 'obj' is an Object callback will be called passing + * the value, key, and complete object for each property. + * + * @param {Object|Array} obj The object to iterate + * @param {Function} fn The callback to invoke for each item + */ +function forEach(obj, fn) { + // Don't bother if no value provided + if (obj === null || typeof obj === 'undefined') { + return; + } + + // Force an array if not already something iterable + if (typeof obj !== 'object') { + /*eslint no-param-reassign:0*/ + obj = [obj]; + } + + if (isArray(obj)) { + // Iterate over array values + for (var i = 0, l = obj.length; i < l; i++) { + fn.call(null, obj[i], i, obj); + } + } else { + // Iterate over object keys + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) { + fn.call(null, obj[key], key, obj); + } + } + } +} + +/** + * Accepts varargs expecting each argument to be an object, then + * immutably merges the properties of each object and returns result. + * + * When multiple objects contain the same key the later object in + * the arguments list will take precedence. + * + * Example: + * + * ```js + * var result = merge({foo: 123}, {foo: 456}); + * console.log(result.foo); // outputs 456 + * ``` + * + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function merge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = merge(result[key], val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Function equal to merge with the difference being that no reference + * to original objects is kept. + * + * @see merge + * @param {Object} obj1 Object to merge + * @returns {Object} Result of all merge properties + */ +function deepMerge(/* obj1, obj2, obj3, ... */) { + var result = {}; + function assignValue(val, key) { + if (typeof result[key] === 'object' && typeof val === 'object') { + result[key] = deepMerge(result[key], val); + } else if (typeof val === 'object') { + result[key] = deepMerge({}, val); + } else { + result[key] = val; + } + } + + for (var i = 0, l = arguments.length; i < l; i++) { + forEach(arguments[i], assignValue); + } + return result; +} + +/** + * Extends object a by mutably adding to it the properties of object b. + * + * @param {Object} a The object to be extended + * @param {Object} b The object to copy properties from + * @param {Object} thisArg The object to bind function to + * @return {Object} The resulting value of object a + */ +function extend(a, b, thisArg) { + forEach(b, function assignValue(val, key) { + if (thisArg && typeof val === 'function') { + a[key] = bind(val, thisArg); + } else { + a[key] = val; + } + }); + return a; +} + +module.exports = { + isArray: isArray, + isArrayBuffer: isArrayBuffer, + isBuffer: isBuffer, + isFormData: isFormData, + isArrayBufferView: isArrayBufferView, + isString: isString, + isNumber: isNumber, + isObject: isObject, + isUndefined: isUndefined, + isDate: isDate, + isFile: isFile, + isBlob: isBlob, + isFunction: isFunction, + isStream: isStream, + isURLSearchParams: isURLSearchParams, + isStandardBrowserEnv: isStandardBrowserEnv, + forEach: forEach, + merge: merge, + deepMerge: deepMerge, + extend: extend, + trim: trim +}; diff --git a/node_modules/axios/package.json b/node_modules/axios/package.json new file mode 100644 index 0000000..3090a32 --- /dev/null +++ b/node_modules/axios/package.json @@ -0,0 +1,113 @@ +{ + "_from": "axios@^0.19.0", + "_id": "axios@0.19.0", + "_inBundle": false, + "_integrity": "sha512-1uvKqKQta3KBxIz14F2v06AEHZ/dIoeKfbTRkK1E5oqjDnuEerLmYTgJB5AiQZHJcljpg1TuRzdjDR06qNk0DQ==", + "_location": "/axios", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "axios@^0.19.0", + "name": "axios", + "escapedName": "axios", + "rawSpec": "^0.19.0", + "saveSpec": null, + "fetchSpec": "^0.19.0" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/axios/-/axios-0.19.0.tgz", + "_shasum": "8e09bff3d9122e133f7b8101c8fbdd00ed3d2ab8", + "_spec": "axios@^0.19.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima", + "author": { + "name": "Matt Zabriskie" + }, + "browser": { + "./lib/adapters/http.js": "./lib/adapters/xhr.js" + }, + "bugs": { + "url": "https://github.com/axios/axios/issues" + }, + "bundleDependencies": false, + "bundlesize": [ + { + "path": "./dist/axios.min.js", + "threshold": "5kB" + } + ], + "dependencies": { + "follow-redirects": "1.5.10", + "is-buffer": "^2.0.2" + }, + "deprecated": false, + "description": "Promise based HTTP client for the browser and node.js", + "devDependencies": { + "bundlesize": "^0.17.0", + "coveralls": "^3.0.0", + "es6-promise": "^4.2.4", + "grunt": "^1.0.2", + "grunt-banner": "^0.6.0", + "grunt-cli": "^1.2.0", + "grunt-contrib-clean": "^1.1.0", + "grunt-contrib-watch": "^1.0.0", + "grunt-eslint": "^20.1.0", + "grunt-karma": "^2.0.0", + "grunt-mocha-test": "^0.13.3", + "grunt-ts": "^6.0.0-beta.19", + "grunt-webpack": "^1.0.18", + "istanbul-instrumenter-loader": "^1.0.0", + "jasmine-core": "^2.4.1", + "karma": "^1.3.0", + "karma-chrome-launcher": "^2.2.0", + "karma-coverage": "^1.1.1", + "karma-firefox-launcher": "^1.1.0", + "karma-jasmine": "^1.1.1", + "karma-jasmine-ajax": "^0.1.13", + "karma-opera-launcher": "^1.0.0", + "karma-safari-launcher": "^1.0.0", + "karma-sauce-launcher": "^1.2.0", + "karma-sinon": "^1.0.5", + "karma-sourcemap-loader": "^0.3.7", + "karma-webpack": "^1.7.0", + "load-grunt-tasks": "^3.5.2", + "minimist": "^1.2.0", + "mocha": "^5.2.0", + "sinon": "^4.5.0", + "typescript": "^2.8.1", + "url-search-params": "^0.10.0", + "webpack": "^1.13.1", + "webpack-dev-server": "^1.14.1" + }, + "homepage": "https://github.com/axios/axios", + "keywords": [ + "xhr", + "http", + "ajax", + "promise", + "node" + ], + "license": "MIT", + "main": "index.js", + "name": "axios", + "repository": { + "type": "git", + "url": "git+https://github.com/axios/axios.git" + }, + "scripts": { + "build": "NODE_ENV=production grunt build", + "coveralls": "cat coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js", + "examples": "node ./examples/server.js", + "fix": "eslint --fix lib/**/*.js", + "postversion": "git push && git push --tags", + "preversion": "npm test", + "start": "node ./sandbox/server.js", + "test": "grunt test && bundlesize", + "version": "npm run build && grunt version && git add -A dist && git add CHANGELOG.md bower.json package.json" + }, + "typings": "./index.d.ts", + "version": "0.19.0" +} diff --git a/node_modules/camelcase/index.d.ts b/node_modules/camelcase/index.d.ts new file mode 100644 index 0000000..58f2069 --- /dev/null +++ b/node_modules/camelcase/index.d.ts @@ -0,0 +1,63 @@ +declare namespace camelcase { + interface Options { + /** + Uppercase the first character: `foo-bar` → `FooBar`. + + @default false + */ + readonly pascalCase?: boolean; + } +} + +declare const camelcase: { + /** + Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar`. + + @param input - String to convert to camel case. + + @example + ``` + import camelCase = require('camelcase'); + + camelCase('foo-bar'); + //=> 'fooBar' + + camelCase('foo_bar'); + //=> 'fooBar' + + camelCase('Foo-Bar'); + //=> 'fooBar' + + camelCase('Foo-Bar', {pascalCase: true}); + //=> 'FooBar' + + camelCase('--foo.bar', {pascalCase: false}); + //=> 'fooBar' + + camelCase('foo bar'); + //=> 'fooBar' + + console.log(process.argv[3]); + //=> '--foo-bar' + camelCase(process.argv[3]); + //=> 'fooBar' + + camelCase(['foo', 'bar']); + //=> 'fooBar' + + camelCase(['__foo__', '--bar'], {pascalCase: true}); + //=> 'FooBar' + ``` + */ + (input: string | ReadonlyArray, options?: camelcase.Options): string; + + // TODO: Remove this for the next major release, refactor the whole definition to: + // declare function camelcase( + // input: string | ReadonlyArray, + // options?: camelcase.Options + // ): string; + // export = camelcase; + default: typeof camelcase; +}; + +export = camelcase; diff --git a/node_modules/camelcase/index.js b/node_modules/camelcase/index.js new file mode 100644 index 0000000..579f99b --- /dev/null +++ b/node_modules/camelcase/index.js @@ -0,0 +1,76 @@ +'use strict'; + +const preserveCamelCase = string => { + let isLastCharLower = false; + let isLastCharUpper = false; + let isLastLastCharUpper = false; + + for (let i = 0; i < string.length; i++) { + const character = string[i]; + + if (isLastCharLower && /[a-zA-Z]/.test(character) && character.toUpperCase() === character) { + string = string.slice(0, i) + '-' + string.slice(i); + isLastCharLower = false; + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = true; + i++; + } else if (isLastCharUpper && isLastLastCharUpper && /[a-zA-Z]/.test(character) && character.toLowerCase() === character) { + string = string.slice(0, i - 1) + '-' + string.slice(i - 1); + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = false; + isLastCharLower = true; + } else { + isLastCharLower = character.toLowerCase() === character && character.toUpperCase() !== character; + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = character.toUpperCase() === character && character.toLowerCase() !== character; + } + } + + return string; +}; + +const camelCase = (input, options) => { + if (!(typeof input === 'string' || Array.isArray(input))) { + throw new TypeError('Expected the input to be `string | string[]`'); + } + + options = Object.assign({ + pascalCase: false + }, options); + + const postProcess = x => options.pascalCase ? x.charAt(0).toUpperCase() + x.slice(1) : x; + + if (Array.isArray(input)) { + input = input.map(x => x.trim()) + .filter(x => x.length) + .join('-'); + } else { + input = input.trim(); + } + + if (input.length === 0) { + return ''; + } + + if (input.length === 1) { + return options.pascalCase ? input.toUpperCase() : input.toLowerCase(); + } + + const hasUpperCase = input !== input.toLowerCase(); + + if (hasUpperCase) { + input = preserveCamelCase(input); + } + + input = input + .replace(/^[_.\- ]+/, '') + .toLowerCase() + .replace(/[_.\- ]+(\w|$)/g, (_, p1) => p1.toUpperCase()) + .replace(/\d+(\w|$)/g, m => m.toUpperCase()); + + return postProcess(input); +}; + +module.exports = camelCase; +// TODO: Remove this for the next major release +module.exports.default = camelCase; diff --git a/node_modules/camelcase/license b/node_modules/camelcase/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/camelcase/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/camelcase/package.json b/node_modules/camelcase/package.json new file mode 100644 index 0000000..05eb45f --- /dev/null +++ b/node_modules/camelcase/package.json @@ -0,0 +1,75 @@ +{ + "_from": "camelcase@^5.0.0", + "_id": "camelcase@5.3.1", + "_inBundle": false, + "_integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "_location": "/camelcase", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "camelcase@^5.0.0", + "name": "camelcase", + "escapedName": "camelcase", + "rawSpec": "^5.0.0", + "saveSpec": null, + "fetchSpec": "^5.0.0" + }, + "_requiredBy": [ + "/yargs-parser" + ], + "_resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "_shasum": "e3c9b31569e106811df242f715725a1f4c494320", + "_spec": "camelcase@^5.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs-parser", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/camelcase/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar`", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.1", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/camelcase#readme", + "keywords": [ + "camelcase", + "camel-case", + "camel", + "case", + "dash", + "hyphen", + "dot", + "underscore", + "separator", + "string", + "text", + "convert", + "pascalcase", + "pascal-case" + ], + "license": "MIT", + "name": "camelcase", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/camelcase.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "5.3.1" +} diff --git a/node_modules/camelcase/readme.md b/node_modules/camelcase/readme.md new file mode 100644 index 0000000..fde2726 --- /dev/null +++ b/node_modules/camelcase/readme.md @@ -0,0 +1,99 @@ +# camelcase [![Build Status](https://travis-ci.org/sindresorhus/camelcase.svg?branch=master)](https://travis-ci.org/sindresorhus/camelcase) + +> Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar` + +--- + +
+ + Get professional support for 'camelcase' with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+ +--- + +## Install + +``` +$ npm install camelcase +``` + + +## Usage + +```js +const camelCase = require('camelcase'); + +camelCase('foo-bar'); +//=> 'fooBar' + +camelCase('foo_bar'); +//=> 'fooBar' + +camelCase('Foo-Bar'); +//=> 'fooBar' + +camelCase('Foo-Bar', {pascalCase: true}); +//=> 'FooBar' + +camelCase('--foo.bar', {pascalCase: false}); +//=> 'fooBar' + +camelCase('foo bar'); +//=> 'fooBar' + +console.log(process.argv[3]); +//=> '--foo-bar' +camelCase(process.argv[3]); +//=> 'fooBar' + +camelCase(['foo', 'bar']); +//=> 'fooBar' + +camelCase(['__foo__', '--bar'], {pascalCase: true}); +//=> 'FooBar' +``` + + +## API + +### camelCase(input, [options]) + +#### input + +Type: `string` `string[]` + +String to convert to camel case. + +#### options + +Type: `Object` + +##### pascalCase + +Type: `boolean`
+Default: `false` + +Uppercase the first character: `foo-bar` → `FooBar` + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## Related + +- [decamelize](https://github.com/sindresorhus/decamelize) - The inverse of this module +- [uppercamelcase](https://github.com/SamVerschueren/uppercamelcase) - Like this module, but to PascalCase instead of camelCase +- [titleize](https://github.com/sindresorhus/titleize) - Capitalize every word in string +- [humanize-string](https://github.com/sindresorhus/humanize-string) - Convert a camelized/dasherized/underscored string into a humanized one + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/cliui/CHANGELOG.md b/node_modules/cliui/CHANGELOG.md new file mode 100644 index 0000000..37f259a --- /dev/null +++ b/node_modules/cliui/CHANGELOG.md @@ -0,0 +1,65 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +# [5.0.0](https://github.com/yargs/cliui/compare/v4.1.0...v5.0.0) (2019-04-10) + + +### Bug Fixes + +* Update wrap-ansi to fix compatibility with latest versions of chalk. ([#60](https://github.com/yargs/cliui/issues/60)) ([7bf79ae](https://github.com/yargs/cliui/commit/7bf79ae)) + + +### BREAKING CHANGES + +* Drop support for node < 6. + + + + +# [4.1.0](https://github.com/yargs/cliui/compare/v4.0.0...v4.1.0) (2018-04-23) + + +### Features + +* add resetOutput method ([#57](https://github.com/yargs/cliui/issues/57)) ([7246902](https://github.com/yargs/cliui/commit/7246902)) + + + + +# [4.0.0](https://github.com/yargs/cliui/compare/v3.2.0...v4.0.0) (2017-12-18) + + +### Bug Fixes + +* downgrades strip-ansi to version 3.0.1 ([#54](https://github.com/yargs/cliui/issues/54)) ([5764c46](https://github.com/yargs/cliui/commit/5764c46)) +* set env variable FORCE_COLOR. ([#56](https://github.com/yargs/cliui/issues/56)) ([7350e36](https://github.com/yargs/cliui/commit/7350e36)) + + +### Chores + +* drop support for node < 4 ([#53](https://github.com/yargs/cliui/issues/53)) ([b105376](https://github.com/yargs/cliui/commit/b105376)) + + +### Features + +* add fallback for window width ([#45](https://github.com/yargs/cliui/issues/45)) ([d064922](https://github.com/yargs/cliui/commit/d064922)) + + +### BREAKING CHANGES + +* officially drop support for Node < 4 + + + + +# [3.2.0](https://github.com/yargs/cliui/compare/v3.1.2...v3.2.0) (2016-04-11) + + +### Bug Fixes + +* reduces tarball size ([acc6c33](https://github.com/yargs/cliui/commit/acc6c33)) + +### Features + +* adds standard-version for release management ([ff84e32](https://github.com/yargs/cliui/commit/ff84e32)) diff --git a/node_modules/cliui/LICENSE.txt b/node_modules/cliui/LICENSE.txt new file mode 100644 index 0000000..c7e2747 --- /dev/null +++ b/node_modules/cliui/LICENSE.txt @@ -0,0 +1,14 @@ +Copyright (c) 2015, Contributors + +Permission to use, copy, modify, and/or distribute this software +for any purpose with or without fee is hereby granted, provided +that the above copyright notice and this permission notice +appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE +LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES +OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/cliui/README.md b/node_modules/cliui/README.md new file mode 100644 index 0000000..deacfa0 --- /dev/null +++ b/node_modules/cliui/README.md @@ -0,0 +1,115 @@ +# cliui + +[![Build Status](https://travis-ci.org/yargs/cliui.svg)](https://travis-ci.org/yargs/cliui) +[![Coverage Status](https://coveralls.io/repos/yargs/cliui/badge.svg?branch=)](https://coveralls.io/r/yargs/cliui?branch=) +[![NPM version](https://img.shields.io/npm/v/cliui.svg)](https://www.npmjs.com/package/cliui) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) + +easily create complex multi-column command-line-interfaces. + +## Example + +```js +var ui = require('cliui')() + +ui.div('Usage: $0 [command] [options]') + +ui.div({ + text: 'Options:', + padding: [2, 0, 2, 0] +}) + +ui.div( + { + text: "-f, --file", + width: 20, + padding: [0, 4, 0, 4] + }, + { + text: "the file to load." + + chalk.green("(if this description is long it wraps).") + , + width: 20 + }, + { + text: chalk.red("[required]"), + align: 'right' + } +) + +console.log(ui.toString()) +``` + + + +## Layout DSL + +cliui exposes a simple layout DSL: + +If you create a single `ui.div`, passing a string rather than an +object: + +* `\n`: characters will be interpreted as new rows. +* `\t`: characters will be interpreted as new columns. +* `\s`: characters will be interpreted as padding. + +**as an example...** + +```js +var ui = require('./')({ + width: 60 +}) + +ui.div( + 'Usage: node ./bin/foo.js\n' + + ' \t provide a regex\n' + + ' \t provide a glob\t [required]' +) + +console.log(ui.toString()) +``` + +**will output:** + +```shell +Usage: node ./bin/foo.js + provide a regex + provide a glob [required] +``` + +## Methods + +```js +cliui = require('cliui') +``` + +### cliui({width: integer}) + +Specify the maximum width of the UI being generated. +If no width is provided, cliui will try to get the current window's width and use it, and if that doesn't work, width will be set to `80`. + +### cliui({wrap: boolean}) + +Enable or disable the wrapping of text in a column. + +### cliui.div(column, column, column) + +Create a row with any number of columns, a column +can either be a string, or an object with the following +options: + +* **text:** some text to place in the column. +* **width:** the width of a column. +* **align:** alignment, `right` or `center`. +* **padding:** `[top, right, bottom, left]`. +* **border:** should a border be placed around the div? + +### cliui.span(column, column, column) + +Similar to `div`, except the next row will be appended without +a new line being created. + +### cliui.resetOutput() + +Resets the UI elements of the current cliui instance, maintaining the values +set for `width` and `wrap`. diff --git a/node_modules/cliui/index.js b/node_modules/cliui/index.js new file mode 100644 index 0000000..b42d982 --- /dev/null +++ b/node_modules/cliui/index.js @@ -0,0 +1,324 @@ +var stringWidth = require('string-width') +var stripAnsi = require('strip-ansi') +var wrap = require('wrap-ansi') +var align = { + right: alignRight, + center: alignCenter +} +var top = 0 +var right = 1 +var bottom = 2 +var left = 3 + +function UI (opts) { + this.width = opts.width + this.wrap = opts.wrap + this.rows = [] +} + +UI.prototype.span = function () { + var cols = this.div.apply(this, arguments) + cols.span = true +} + +UI.prototype.resetOutput = function () { + this.rows = [] +} + +UI.prototype.div = function () { + if (arguments.length === 0) this.div('') + if (this.wrap && this._shouldApplyLayoutDSL.apply(this, arguments)) { + return this._applyLayoutDSL(arguments[0]) + } + + var cols = [] + + for (var i = 0, arg; (arg = arguments[i]) !== undefined; i++) { + if (typeof arg === 'string') cols.push(this._colFromString(arg)) + else cols.push(arg) + } + + this.rows.push(cols) + return cols +} + +UI.prototype._shouldApplyLayoutDSL = function () { + return arguments.length === 1 && typeof arguments[0] === 'string' && + /[\t\n]/.test(arguments[0]) +} + +UI.prototype._applyLayoutDSL = function (str) { + var _this = this + var rows = str.split('\n') + var leftColumnWidth = 0 + + // simple heuristic for layout, make sure the + // second column lines up along the left-hand. + // don't allow the first column to take up more + // than 50% of the screen. + rows.forEach(function (row) { + var columns = row.split('\t') + if (columns.length > 1 && stringWidth(columns[0]) > leftColumnWidth) { + leftColumnWidth = Math.min( + Math.floor(_this.width * 0.5), + stringWidth(columns[0]) + ) + } + }) + + // generate a table: + // replacing ' ' with padding calculations. + // using the algorithmically generated width. + rows.forEach(function (row) { + var columns = row.split('\t') + _this.div.apply(_this, columns.map(function (r, i) { + return { + text: r.trim(), + padding: _this._measurePadding(r), + width: (i === 0 && columns.length > 1) ? leftColumnWidth : undefined + } + })) + }) + + return this.rows[this.rows.length - 1] +} + +UI.prototype._colFromString = function (str) { + return { + text: str, + padding: this._measurePadding(str) + } +} + +UI.prototype._measurePadding = function (str) { + // measure padding without ansi escape codes + var noAnsi = stripAnsi(str) + return [0, noAnsi.match(/\s*$/)[0].length, 0, noAnsi.match(/^\s*/)[0].length] +} + +UI.prototype.toString = function () { + var _this = this + var lines = [] + + _this.rows.forEach(function (row, i) { + _this.rowToString(row, lines) + }) + + // don't display any lines with the + // hidden flag set. + lines = lines.filter(function (line) { + return !line.hidden + }) + + return lines.map(function (line) { + return line.text + }).join('\n') +} + +UI.prototype.rowToString = function (row, lines) { + var _this = this + var padding + var rrows = this._rasterize(row) + var str = '' + var ts + var width + var wrapWidth + + rrows.forEach(function (rrow, r) { + str = '' + rrow.forEach(function (col, c) { + ts = '' // temporary string used during alignment/padding. + width = row[c].width // the width with padding. + wrapWidth = _this._negatePadding(row[c]) // the width without padding. + + ts += col + + for (var i = 0; i < wrapWidth - stringWidth(col); i++) { + ts += ' ' + } + + // align the string within its column. + if (row[c].align && row[c].align !== 'left' && _this.wrap) { + ts = align[row[c].align](ts, wrapWidth) + if (stringWidth(ts) < wrapWidth) ts += new Array(width - stringWidth(ts)).join(' ') + } + + // apply border and padding to string. + padding = row[c].padding || [0, 0, 0, 0] + if (padding[left]) str += new Array(padding[left] + 1).join(' ') + str += addBorder(row[c], ts, '| ') + str += ts + str += addBorder(row[c], ts, ' |') + if (padding[right]) str += new Array(padding[right] + 1).join(' ') + + // if prior row is span, try to render the + // current row on the prior line. + if (r === 0 && lines.length > 0) { + str = _this._renderInline(str, lines[lines.length - 1]) + } + }) + + // remove trailing whitespace. + lines.push({ + text: str.replace(/ +$/, ''), + span: row.span + }) + }) + + return lines +} + +function addBorder (col, ts, style) { + if (col.border) { + if (/[.']-+[.']/.test(ts)) return '' + else if (ts.trim().length) return style + else return ' ' + } + return '' +} + +// if the full 'source' can render in +// the target line, do so. +UI.prototype._renderInline = function (source, previousLine) { + var leadingWhitespace = source.match(/^ */)[0].length + var target = previousLine.text + var targetTextWidth = stringWidth(target.trimRight()) + + if (!previousLine.span) return source + + // if we're not applying wrapping logic, + // just always append to the span. + if (!this.wrap) { + previousLine.hidden = true + return target + source + } + + if (leadingWhitespace < targetTextWidth) return source + + previousLine.hidden = true + + return target.trimRight() + new Array(leadingWhitespace - targetTextWidth + 1).join(' ') + source.trimLeft() +} + +UI.prototype._rasterize = function (row) { + var _this = this + var i + var rrow + var rrows = [] + var widths = this._columnWidths(row) + var wrapped + + // word wrap all columns, and create + // a data-structure that is easy to rasterize. + row.forEach(function (col, c) { + // leave room for left and right padding. + col.width = widths[c] + if (_this.wrap) wrapped = wrap(col.text, _this._negatePadding(col), { hard: true }).split('\n') + else wrapped = col.text.split('\n') + + if (col.border) { + wrapped.unshift('.' + new Array(_this._negatePadding(col) + 3).join('-') + '.') + wrapped.push("'" + new Array(_this._negatePadding(col) + 3).join('-') + "'") + } + + // add top and bottom padding. + if (col.padding) { + for (i = 0; i < (col.padding[top] || 0); i++) wrapped.unshift('') + for (i = 0; i < (col.padding[bottom] || 0); i++) wrapped.push('') + } + + wrapped.forEach(function (str, r) { + if (!rrows[r]) rrows.push([]) + + rrow = rrows[r] + + for (var i = 0; i < c; i++) { + if (rrow[i] === undefined) rrow.push('') + } + rrow.push(str) + }) + }) + + return rrows +} + +UI.prototype._negatePadding = function (col) { + var wrapWidth = col.width + if (col.padding) wrapWidth -= (col.padding[left] || 0) + (col.padding[right] || 0) + if (col.border) wrapWidth -= 4 + return wrapWidth +} + +UI.prototype._columnWidths = function (row) { + var _this = this + var widths = [] + var unset = row.length + var unsetWidth + var remainingWidth = this.width + + // column widths can be set in config. + row.forEach(function (col, i) { + if (col.width) { + unset-- + widths[i] = col.width + remainingWidth -= col.width + } else { + widths[i] = undefined + } + }) + + // any unset widths should be calculated. + if (unset) unsetWidth = Math.floor(remainingWidth / unset) + widths.forEach(function (w, i) { + if (!_this.wrap) widths[i] = row[i].width || stringWidth(row[i].text) + else if (w === undefined) widths[i] = Math.max(unsetWidth, _minWidth(row[i])) + }) + + return widths +} + +// calculates the minimum width of +// a column, based on padding preferences. +function _minWidth (col) { + var padding = col.padding || [] + var minWidth = 1 + (padding[left] || 0) + (padding[right] || 0) + if (col.border) minWidth += 4 + return minWidth +} + +function getWindowWidth () { + if (typeof process === 'object' && process.stdout && process.stdout.columns) return process.stdout.columns +} + +function alignRight (str, width) { + str = str.trim() + var padding = '' + var strWidth = stringWidth(str) + + if (strWidth < width) { + padding = new Array(width - strWidth + 1).join(' ') + } + + return padding + str +} + +function alignCenter (str, width) { + str = str.trim() + var padding = '' + var strWidth = stringWidth(str.trim()) + + if (strWidth < width) { + padding = new Array(parseInt((width - strWidth) / 2, 10) + 1).join(' ') + } + + return padding + str +} + +module.exports = function (opts) { + opts = opts || {} + + return new UI({ + width: (opts || {}).width || getWindowWidth() || 80, + wrap: typeof opts.wrap === 'boolean' ? opts.wrap : true + }) +} diff --git a/node_modules/cliui/package.json b/node_modules/cliui/package.json new file mode 100644 index 0000000..c8a8347 --- /dev/null +++ b/node_modules/cliui/package.json @@ -0,0 +1,99 @@ +{ + "_from": "cliui@^5.0.0", + "_id": "cliui@5.0.0", + "_inBundle": false, + "_integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==", + "_location": "/cliui", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "cliui@^5.0.0", + "name": "cliui", + "escapedName": "cliui", + "rawSpec": "^5.0.0", + "saveSpec": null, + "fetchSpec": "^5.0.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", + "_shasum": "deefcfdb2e800784aa34f46fa08e06851c7bbbc5", + "_spec": "cliui@^5.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Ben Coe", + "email": "ben@npmjs.com" + }, + "bugs": { + "url": "https://github.com/yargs/cliui/issues" + }, + "bundleDependencies": false, + "config": { + "blanket": { + "pattern": [ + "index.js" + ], + "data-cover-never": [ + "node_modules", + "test" + ], + "output-reporter": "spec" + } + }, + "dependencies": { + "string-width": "^3.1.0", + "strip-ansi": "^5.2.0", + "wrap-ansi": "^5.1.0" + }, + "deprecated": false, + "description": "easily create complex multi-column command-line-interfaces", + "devDependencies": { + "chai": "^4.2.0", + "chalk": "^2.4.2", + "coveralls": "^3.0.3", + "mocha": "^6.0.2", + "nyc": "^13.3.0", + "standard": "^12.0.1", + "standard-version": "^5.0.2" + }, + "engine": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/yargs/cliui#readme", + "keywords": [ + "cli", + "command-line", + "layout", + "design", + "console", + "wrap", + "table" + ], + "license": "ISC", + "main": "index.js", + "name": "cliui", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/yargs/cliui.git" + }, + "scripts": { + "coverage": "nyc --reporter=text-lcov mocha | coveralls", + "pretest": "standard", + "release": "standard-version", + "test": "nyc mocha" + }, + "standard": { + "ignore": [ + "**/example/**" + ], + "globals": [ + "it" + ] + }, + "version": "5.0.0" +} diff --git a/node_modules/color-convert/CHANGELOG.md b/node_modules/color-convert/CHANGELOG.md new file mode 100644 index 0000000..0a7bce4 --- /dev/null +++ b/node_modules/color-convert/CHANGELOG.md @@ -0,0 +1,54 @@ +# 1.0.0 - 2016-01-07 + +- Removed: unused speed test +- Added: Automatic routing between previously unsupported conversions +([#27](https://github.com/Qix-/color-convert/pull/27)) +- Removed: `xxx2xxx()` and `xxx2xxxRaw()` functions +([#27](https://github.com/Qix-/color-convert/pull/27)) +- Removed: `convert()` class +([#27](https://github.com/Qix-/color-convert/pull/27)) +- Changed: all functions to lookup dictionary +([#27](https://github.com/Qix-/color-convert/pull/27)) +- Changed: `ansi` to `ansi256` +([#27](https://github.com/Qix-/color-convert/pull/27)) +- Fixed: argument grouping for functions requiring only one argument +([#27](https://github.com/Qix-/color-convert/pull/27)) + +# 0.6.0 - 2015-07-23 + +- Added: methods to handle +[ANSI](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors) 16/256 colors: + - rgb2ansi16 + - rgb2ansi + - hsl2ansi16 + - hsl2ansi + - hsv2ansi16 + - hsv2ansi + - hwb2ansi16 + - hwb2ansi + - cmyk2ansi16 + - cmyk2ansi + - keyword2ansi16 + - keyword2ansi + - ansi162rgb + - ansi162hsl + - ansi162hsv + - ansi162hwb + - ansi162cmyk + - ansi162keyword + - ansi2rgb + - ansi2hsl + - ansi2hsv + - ansi2hwb + - ansi2cmyk + - ansi2keyword +([#18](https://github.com/harthur/color-convert/pull/18)) + +# 0.5.3 - 2015-06-02 + +- Fixed: hsl2hsv does not return `NaN` anymore when using `[0,0,0]` +([#15](https://github.com/harthur/color-convert/issues/15)) + +--- + +Check out commit logs for older releases diff --git a/node_modules/color-convert/LICENSE b/node_modules/color-convert/LICENSE new file mode 100644 index 0000000..5b4c386 --- /dev/null +++ b/node_modules/color-convert/LICENSE @@ -0,0 +1,21 @@ +Copyright (c) 2011-2016 Heather Arthur + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/color-convert/README.md b/node_modules/color-convert/README.md new file mode 100644 index 0000000..d4b08fc --- /dev/null +++ b/node_modules/color-convert/README.md @@ -0,0 +1,68 @@ +# color-convert + +[![Build Status](https://travis-ci.org/Qix-/color-convert.svg?branch=master)](https://travis-ci.org/Qix-/color-convert) + +Color-convert is a color conversion library for JavaScript and node. +It converts all ways between `rgb`, `hsl`, `hsv`, `hwb`, `cmyk`, `ansi`, `ansi16`, `hex` strings, and CSS `keyword`s (will round to closest): + +```js +var convert = require('color-convert'); + +convert.rgb.hsl(140, 200, 100); // [96, 48, 59] +convert.keyword.rgb('blue'); // [0, 0, 255] + +var rgbChannels = convert.rgb.channels; // 3 +var cmykChannels = convert.cmyk.channels; // 4 +var ansiChannels = convert.ansi16.channels; // 1 +``` + +# Install + +```console +$ npm install color-convert +``` + +# API + +Simply get the property of the _from_ and _to_ conversion that you're looking for. + +All functions have a rounded and unrounded variant. By default, return values are rounded. To get the unrounded (raw) results, simply tack on `.raw` to the function. + +All 'from' functions have a hidden property called `.channels` that indicates the number of channels the function expects (not including alpha). + +```js +var convert = require('color-convert'); + +// Hex to LAB +convert.hex.lab('DEADBF'); // [ 76, 21, -2 ] +convert.hex.lab.raw('DEADBF'); // [ 75.56213190997677, 20.653827952644754, -2.290532499330533 ] + +// RGB to CMYK +convert.rgb.cmyk(167, 255, 4); // [ 35, 0, 98, 0 ] +convert.rgb.cmyk.raw(167, 255, 4); // [ 34.509803921568626, 0, 98.43137254901961, 0 ] +``` + +### Arrays +All functions that accept multiple arguments also support passing an array. + +Note that this does **not** apply to functions that convert from a color that only requires one value (e.g. `keyword`, `ansi256`, `hex`, etc.) + +```js +var convert = require('color-convert'); + +convert.rgb.hex(123, 45, 67); // '7B2D43' +convert.rgb.hex([123, 45, 67]); // '7B2D43' +``` + +## Routing + +Conversions that don't have an _explicitly_ defined conversion (in [conversions.js](conversions.js)), but can be converted by means of sub-conversions (e.g. XYZ -> **RGB** -> CMYK), are automatically routed together. This allows just about any color model supported by `color-convert` to be converted to any other model, so long as a sub-conversion path exists. This is also true for conversions requiring more than one step in between (e.g. LCH -> **LAB** -> **XYZ** -> **RGB** -> Hex). + +Keep in mind that extensive conversions _may_ result in a loss of precision, and exist only to be complete. For a list of "direct" (single-step) conversions, see [conversions.js](conversions.js). + +# Contribute + +If there is a new model you would like to support, or want to add a direct conversion between two existing models, please send us a pull request. + +# License +Copyright © 2011-2016, Heather Arthur and Josh Junon. Licensed under the [MIT License](LICENSE). diff --git a/node_modules/color-convert/conversions.js b/node_modules/color-convert/conversions.js new file mode 100644 index 0000000..3217200 --- /dev/null +++ b/node_modules/color-convert/conversions.js @@ -0,0 +1,868 @@ +/* MIT license */ +var cssKeywords = require('color-name'); + +// NOTE: conversions should only return primitive values (i.e. arrays, or +// values that give correct `typeof` results). +// do not use box values types (i.e. Number(), String(), etc.) + +var reverseKeywords = {}; +for (var key in cssKeywords) { + if (cssKeywords.hasOwnProperty(key)) { + reverseKeywords[cssKeywords[key]] = key; + } +} + +var convert = module.exports = { + rgb: {channels: 3, labels: 'rgb'}, + hsl: {channels: 3, labels: 'hsl'}, + hsv: {channels: 3, labels: 'hsv'}, + hwb: {channels: 3, labels: 'hwb'}, + cmyk: {channels: 4, labels: 'cmyk'}, + xyz: {channels: 3, labels: 'xyz'}, + lab: {channels: 3, labels: 'lab'}, + lch: {channels: 3, labels: 'lch'}, + hex: {channels: 1, labels: ['hex']}, + keyword: {channels: 1, labels: ['keyword']}, + ansi16: {channels: 1, labels: ['ansi16']}, + ansi256: {channels: 1, labels: ['ansi256']}, + hcg: {channels: 3, labels: ['h', 'c', 'g']}, + apple: {channels: 3, labels: ['r16', 'g16', 'b16']}, + gray: {channels: 1, labels: ['gray']} +}; + +// hide .channels and .labels properties +for (var model in convert) { + if (convert.hasOwnProperty(model)) { + if (!('channels' in convert[model])) { + throw new Error('missing channels property: ' + model); + } + + if (!('labels' in convert[model])) { + throw new Error('missing channel labels property: ' + model); + } + + if (convert[model].labels.length !== convert[model].channels) { + throw new Error('channel and label counts mismatch: ' + model); + } + + var channels = convert[model].channels; + var labels = convert[model].labels; + delete convert[model].channels; + delete convert[model].labels; + Object.defineProperty(convert[model], 'channels', {value: channels}); + Object.defineProperty(convert[model], 'labels', {value: labels}); + } +} + +convert.rgb.hsl = function (rgb) { + var r = rgb[0] / 255; + var g = rgb[1] / 255; + var b = rgb[2] / 255; + var min = Math.min(r, g, b); + var max = Math.max(r, g, b); + var delta = max - min; + var h; + var s; + var l; + + if (max === min) { + h = 0; + } else if (r === max) { + h = (g - b) / delta; + } else if (g === max) { + h = 2 + (b - r) / delta; + } else if (b === max) { + h = 4 + (r - g) / delta; + } + + h = Math.min(h * 60, 360); + + if (h < 0) { + h += 360; + } + + l = (min + max) / 2; + + if (max === min) { + s = 0; + } else if (l <= 0.5) { + s = delta / (max + min); + } else { + s = delta / (2 - max - min); + } + + return [h, s * 100, l * 100]; +}; + +convert.rgb.hsv = function (rgb) { + var rdif; + var gdif; + var bdif; + var h; + var s; + + var r = rgb[0] / 255; + var g = rgb[1] / 255; + var b = rgb[2] / 255; + var v = Math.max(r, g, b); + var diff = v - Math.min(r, g, b); + var diffc = function (c) { + return (v - c) / 6 / diff + 1 / 2; + }; + + if (diff === 0) { + h = s = 0; + } else { + s = diff / v; + rdif = diffc(r); + gdif = diffc(g); + bdif = diffc(b); + + if (r === v) { + h = bdif - gdif; + } else if (g === v) { + h = (1 / 3) + rdif - bdif; + } else if (b === v) { + h = (2 / 3) + gdif - rdif; + } + if (h < 0) { + h += 1; + } else if (h > 1) { + h -= 1; + } + } + + return [ + h * 360, + s * 100, + v * 100 + ]; +}; + +convert.rgb.hwb = function (rgb) { + var r = rgb[0]; + var g = rgb[1]; + var b = rgb[2]; + var h = convert.rgb.hsl(rgb)[0]; + var w = 1 / 255 * Math.min(r, Math.min(g, b)); + + b = 1 - 1 / 255 * Math.max(r, Math.max(g, b)); + + return [h, w * 100, b * 100]; +}; + +convert.rgb.cmyk = function (rgb) { + var r = rgb[0] / 255; + var g = rgb[1] / 255; + var b = rgb[2] / 255; + var c; + var m; + var y; + var k; + + k = Math.min(1 - r, 1 - g, 1 - b); + c = (1 - r - k) / (1 - k) || 0; + m = (1 - g - k) / (1 - k) || 0; + y = (1 - b - k) / (1 - k) || 0; + + return [c * 100, m * 100, y * 100, k * 100]; +}; + +/** + * See https://en.m.wikipedia.org/wiki/Euclidean_distance#Squared_Euclidean_distance + * */ +function comparativeDistance(x, y) { + return ( + Math.pow(x[0] - y[0], 2) + + Math.pow(x[1] - y[1], 2) + + Math.pow(x[2] - y[2], 2) + ); +} + +convert.rgb.keyword = function (rgb) { + var reversed = reverseKeywords[rgb]; + if (reversed) { + return reversed; + } + + var currentClosestDistance = Infinity; + var currentClosestKeyword; + + for (var keyword in cssKeywords) { + if (cssKeywords.hasOwnProperty(keyword)) { + var value = cssKeywords[keyword]; + + // Compute comparative distance + var distance = comparativeDistance(rgb, value); + + // Check if its less, if so set as closest + if (distance < currentClosestDistance) { + currentClosestDistance = distance; + currentClosestKeyword = keyword; + } + } + } + + return currentClosestKeyword; +}; + +convert.keyword.rgb = function (keyword) { + return cssKeywords[keyword]; +}; + +convert.rgb.xyz = function (rgb) { + var r = rgb[0] / 255; + var g = rgb[1] / 255; + var b = rgb[2] / 255; + + // assume sRGB + r = r > 0.04045 ? Math.pow(((r + 0.055) / 1.055), 2.4) : (r / 12.92); + g = g > 0.04045 ? Math.pow(((g + 0.055) / 1.055), 2.4) : (g / 12.92); + b = b > 0.04045 ? Math.pow(((b + 0.055) / 1.055), 2.4) : (b / 12.92); + + var x = (r * 0.4124) + (g * 0.3576) + (b * 0.1805); + var y = (r * 0.2126) + (g * 0.7152) + (b * 0.0722); + var z = (r * 0.0193) + (g * 0.1192) + (b * 0.9505); + + return [x * 100, y * 100, z * 100]; +}; + +convert.rgb.lab = function (rgb) { + var xyz = convert.rgb.xyz(rgb); + var x = xyz[0]; + var y = xyz[1]; + var z = xyz[2]; + var l; + var a; + var b; + + x /= 95.047; + y /= 100; + z /= 108.883; + + x = x > 0.008856 ? Math.pow(x, 1 / 3) : (7.787 * x) + (16 / 116); + y = y > 0.008856 ? Math.pow(y, 1 / 3) : (7.787 * y) + (16 / 116); + z = z > 0.008856 ? Math.pow(z, 1 / 3) : (7.787 * z) + (16 / 116); + + l = (116 * y) - 16; + a = 500 * (x - y); + b = 200 * (y - z); + + return [l, a, b]; +}; + +convert.hsl.rgb = function (hsl) { + var h = hsl[0] / 360; + var s = hsl[1] / 100; + var l = hsl[2] / 100; + var t1; + var t2; + var t3; + var rgb; + var val; + + if (s === 0) { + val = l * 255; + return [val, val, val]; + } + + if (l < 0.5) { + t2 = l * (1 + s); + } else { + t2 = l + s - l * s; + } + + t1 = 2 * l - t2; + + rgb = [0, 0, 0]; + for (var i = 0; i < 3; i++) { + t3 = h + 1 / 3 * -(i - 1); + if (t3 < 0) { + t3++; + } + if (t3 > 1) { + t3--; + } + + if (6 * t3 < 1) { + val = t1 + (t2 - t1) * 6 * t3; + } else if (2 * t3 < 1) { + val = t2; + } else if (3 * t3 < 2) { + val = t1 + (t2 - t1) * (2 / 3 - t3) * 6; + } else { + val = t1; + } + + rgb[i] = val * 255; + } + + return rgb; +}; + +convert.hsl.hsv = function (hsl) { + var h = hsl[0]; + var s = hsl[1] / 100; + var l = hsl[2] / 100; + var smin = s; + var lmin = Math.max(l, 0.01); + var sv; + var v; + + l *= 2; + s *= (l <= 1) ? l : 2 - l; + smin *= lmin <= 1 ? lmin : 2 - lmin; + v = (l + s) / 2; + sv = l === 0 ? (2 * smin) / (lmin + smin) : (2 * s) / (l + s); + + return [h, sv * 100, v * 100]; +}; + +convert.hsv.rgb = function (hsv) { + var h = hsv[0] / 60; + var s = hsv[1] / 100; + var v = hsv[2] / 100; + var hi = Math.floor(h) % 6; + + var f = h - Math.floor(h); + var p = 255 * v * (1 - s); + var q = 255 * v * (1 - (s * f)); + var t = 255 * v * (1 - (s * (1 - f))); + v *= 255; + + switch (hi) { + case 0: + return [v, t, p]; + case 1: + return [q, v, p]; + case 2: + return [p, v, t]; + case 3: + return [p, q, v]; + case 4: + return [t, p, v]; + case 5: + return [v, p, q]; + } +}; + +convert.hsv.hsl = function (hsv) { + var h = hsv[0]; + var s = hsv[1] / 100; + var v = hsv[2] / 100; + var vmin = Math.max(v, 0.01); + var lmin; + var sl; + var l; + + l = (2 - s) * v; + lmin = (2 - s) * vmin; + sl = s * vmin; + sl /= (lmin <= 1) ? lmin : 2 - lmin; + sl = sl || 0; + l /= 2; + + return [h, sl * 100, l * 100]; +}; + +// http://dev.w3.org/csswg/css-color/#hwb-to-rgb +convert.hwb.rgb = function (hwb) { + var h = hwb[0] / 360; + var wh = hwb[1] / 100; + var bl = hwb[2] / 100; + var ratio = wh + bl; + var i; + var v; + var f; + var n; + + // wh + bl cant be > 1 + if (ratio > 1) { + wh /= ratio; + bl /= ratio; + } + + i = Math.floor(6 * h); + v = 1 - bl; + f = 6 * h - i; + + if ((i & 0x01) !== 0) { + f = 1 - f; + } + + n = wh + f * (v - wh); // linear interpolation + + var r; + var g; + var b; + switch (i) { + default: + case 6: + case 0: r = v; g = n; b = wh; break; + case 1: r = n; g = v; b = wh; break; + case 2: r = wh; g = v; b = n; break; + case 3: r = wh; g = n; b = v; break; + case 4: r = n; g = wh; b = v; break; + case 5: r = v; g = wh; b = n; break; + } + + return [r * 255, g * 255, b * 255]; +}; + +convert.cmyk.rgb = function (cmyk) { + var c = cmyk[0] / 100; + var m = cmyk[1] / 100; + var y = cmyk[2] / 100; + var k = cmyk[3] / 100; + var r; + var g; + var b; + + r = 1 - Math.min(1, c * (1 - k) + k); + g = 1 - Math.min(1, m * (1 - k) + k); + b = 1 - Math.min(1, y * (1 - k) + k); + + return [r * 255, g * 255, b * 255]; +}; + +convert.xyz.rgb = function (xyz) { + var x = xyz[0] / 100; + var y = xyz[1] / 100; + var z = xyz[2] / 100; + var r; + var g; + var b; + + r = (x * 3.2406) + (y * -1.5372) + (z * -0.4986); + g = (x * -0.9689) + (y * 1.8758) + (z * 0.0415); + b = (x * 0.0557) + (y * -0.2040) + (z * 1.0570); + + // assume sRGB + r = r > 0.0031308 + ? ((1.055 * Math.pow(r, 1.0 / 2.4)) - 0.055) + : r * 12.92; + + g = g > 0.0031308 + ? ((1.055 * Math.pow(g, 1.0 / 2.4)) - 0.055) + : g * 12.92; + + b = b > 0.0031308 + ? ((1.055 * Math.pow(b, 1.0 / 2.4)) - 0.055) + : b * 12.92; + + r = Math.min(Math.max(0, r), 1); + g = Math.min(Math.max(0, g), 1); + b = Math.min(Math.max(0, b), 1); + + return [r * 255, g * 255, b * 255]; +}; + +convert.xyz.lab = function (xyz) { + var x = xyz[0]; + var y = xyz[1]; + var z = xyz[2]; + var l; + var a; + var b; + + x /= 95.047; + y /= 100; + z /= 108.883; + + x = x > 0.008856 ? Math.pow(x, 1 / 3) : (7.787 * x) + (16 / 116); + y = y > 0.008856 ? Math.pow(y, 1 / 3) : (7.787 * y) + (16 / 116); + z = z > 0.008856 ? Math.pow(z, 1 / 3) : (7.787 * z) + (16 / 116); + + l = (116 * y) - 16; + a = 500 * (x - y); + b = 200 * (y - z); + + return [l, a, b]; +}; + +convert.lab.xyz = function (lab) { + var l = lab[0]; + var a = lab[1]; + var b = lab[2]; + var x; + var y; + var z; + + y = (l + 16) / 116; + x = a / 500 + y; + z = y - b / 200; + + var y2 = Math.pow(y, 3); + var x2 = Math.pow(x, 3); + var z2 = Math.pow(z, 3); + y = y2 > 0.008856 ? y2 : (y - 16 / 116) / 7.787; + x = x2 > 0.008856 ? x2 : (x - 16 / 116) / 7.787; + z = z2 > 0.008856 ? z2 : (z - 16 / 116) / 7.787; + + x *= 95.047; + y *= 100; + z *= 108.883; + + return [x, y, z]; +}; + +convert.lab.lch = function (lab) { + var l = lab[0]; + var a = lab[1]; + var b = lab[2]; + var hr; + var h; + var c; + + hr = Math.atan2(b, a); + h = hr * 360 / 2 / Math.PI; + + if (h < 0) { + h += 360; + } + + c = Math.sqrt(a * a + b * b); + + return [l, c, h]; +}; + +convert.lch.lab = function (lch) { + var l = lch[0]; + var c = lch[1]; + var h = lch[2]; + var a; + var b; + var hr; + + hr = h / 360 * 2 * Math.PI; + a = c * Math.cos(hr); + b = c * Math.sin(hr); + + return [l, a, b]; +}; + +convert.rgb.ansi16 = function (args) { + var r = args[0]; + var g = args[1]; + var b = args[2]; + var value = 1 in arguments ? arguments[1] : convert.rgb.hsv(args)[2]; // hsv -> ansi16 optimization + + value = Math.round(value / 50); + + if (value === 0) { + return 30; + } + + var ansi = 30 + + ((Math.round(b / 255) << 2) + | (Math.round(g / 255) << 1) + | Math.round(r / 255)); + + if (value === 2) { + ansi += 60; + } + + return ansi; +}; + +convert.hsv.ansi16 = function (args) { + // optimization here; we already know the value and don't need to get + // it converted for us. + return convert.rgb.ansi16(convert.hsv.rgb(args), args[2]); +}; + +convert.rgb.ansi256 = function (args) { + var r = args[0]; + var g = args[1]; + var b = args[2]; + + // we use the extended greyscale palette here, with the exception of + // black and white. normal palette only has 4 greyscale shades. + if (r === g && g === b) { + if (r < 8) { + return 16; + } + + if (r > 248) { + return 231; + } + + return Math.round(((r - 8) / 247) * 24) + 232; + } + + var ansi = 16 + + (36 * Math.round(r / 255 * 5)) + + (6 * Math.round(g / 255 * 5)) + + Math.round(b / 255 * 5); + + return ansi; +}; + +convert.ansi16.rgb = function (args) { + var color = args % 10; + + // handle greyscale + if (color === 0 || color === 7) { + if (args > 50) { + color += 3.5; + } + + color = color / 10.5 * 255; + + return [color, color, color]; + } + + var mult = (~~(args > 50) + 1) * 0.5; + var r = ((color & 1) * mult) * 255; + var g = (((color >> 1) & 1) * mult) * 255; + var b = (((color >> 2) & 1) * mult) * 255; + + return [r, g, b]; +}; + +convert.ansi256.rgb = function (args) { + // handle greyscale + if (args >= 232) { + var c = (args - 232) * 10 + 8; + return [c, c, c]; + } + + args -= 16; + + var rem; + var r = Math.floor(args / 36) / 5 * 255; + var g = Math.floor((rem = args % 36) / 6) / 5 * 255; + var b = (rem % 6) / 5 * 255; + + return [r, g, b]; +}; + +convert.rgb.hex = function (args) { + var integer = ((Math.round(args[0]) & 0xFF) << 16) + + ((Math.round(args[1]) & 0xFF) << 8) + + (Math.round(args[2]) & 0xFF); + + var string = integer.toString(16).toUpperCase(); + return '000000'.substring(string.length) + string; +}; + +convert.hex.rgb = function (args) { + var match = args.toString(16).match(/[a-f0-9]{6}|[a-f0-9]{3}/i); + if (!match) { + return [0, 0, 0]; + } + + var colorString = match[0]; + + if (match[0].length === 3) { + colorString = colorString.split('').map(function (char) { + return char + char; + }).join(''); + } + + var integer = parseInt(colorString, 16); + var r = (integer >> 16) & 0xFF; + var g = (integer >> 8) & 0xFF; + var b = integer & 0xFF; + + return [r, g, b]; +}; + +convert.rgb.hcg = function (rgb) { + var r = rgb[0] / 255; + var g = rgb[1] / 255; + var b = rgb[2] / 255; + var max = Math.max(Math.max(r, g), b); + var min = Math.min(Math.min(r, g), b); + var chroma = (max - min); + var grayscale; + var hue; + + if (chroma < 1) { + grayscale = min / (1 - chroma); + } else { + grayscale = 0; + } + + if (chroma <= 0) { + hue = 0; + } else + if (max === r) { + hue = ((g - b) / chroma) % 6; + } else + if (max === g) { + hue = 2 + (b - r) / chroma; + } else { + hue = 4 + (r - g) / chroma + 4; + } + + hue /= 6; + hue %= 1; + + return [hue * 360, chroma * 100, grayscale * 100]; +}; + +convert.hsl.hcg = function (hsl) { + var s = hsl[1] / 100; + var l = hsl[2] / 100; + var c = 1; + var f = 0; + + if (l < 0.5) { + c = 2.0 * s * l; + } else { + c = 2.0 * s * (1.0 - l); + } + + if (c < 1.0) { + f = (l - 0.5 * c) / (1.0 - c); + } + + return [hsl[0], c * 100, f * 100]; +}; + +convert.hsv.hcg = function (hsv) { + var s = hsv[1] / 100; + var v = hsv[2] / 100; + + var c = s * v; + var f = 0; + + if (c < 1.0) { + f = (v - c) / (1 - c); + } + + return [hsv[0], c * 100, f * 100]; +}; + +convert.hcg.rgb = function (hcg) { + var h = hcg[0] / 360; + var c = hcg[1] / 100; + var g = hcg[2] / 100; + + if (c === 0.0) { + return [g * 255, g * 255, g * 255]; + } + + var pure = [0, 0, 0]; + var hi = (h % 1) * 6; + var v = hi % 1; + var w = 1 - v; + var mg = 0; + + switch (Math.floor(hi)) { + case 0: + pure[0] = 1; pure[1] = v; pure[2] = 0; break; + case 1: + pure[0] = w; pure[1] = 1; pure[2] = 0; break; + case 2: + pure[0] = 0; pure[1] = 1; pure[2] = v; break; + case 3: + pure[0] = 0; pure[1] = w; pure[2] = 1; break; + case 4: + pure[0] = v; pure[1] = 0; pure[2] = 1; break; + default: + pure[0] = 1; pure[1] = 0; pure[2] = w; + } + + mg = (1.0 - c) * g; + + return [ + (c * pure[0] + mg) * 255, + (c * pure[1] + mg) * 255, + (c * pure[2] + mg) * 255 + ]; +}; + +convert.hcg.hsv = function (hcg) { + var c = hcg[1] / 100; + var g = hcg[2] / 100; + + var v = c + g * (1.0 - c); + var f = 0; + + if (v > 0.0) { + f = c / v; + } + + return [hcg[0], f * 100, v * 100]; +}; + +convert.hcg.hsl = function (hcg) { + var c = hcg[1] / 100; + var g = hcg[2] / 100; + + var l = g * (1.0 - c) + 0.5 * c; + var s = 0; + + if (l > 0.0 && l < 0.5) { + s = c / (2 * l); + } else + if (l >= 0.5 && l < 1.0) { + s = c / (2 * (1 - l)); + } + + return [hcg[0], s * 100, l * 100]; +}; + +convert.hcg.hwb = function (hcg) { + var c = hcg[1] / 100; + var g = hcg[2] / 100; + var v = c + g * (1.0 - c); + return [hcg[0], (v - c) * 100, (1 - v) * 100]; +}; + +convert.hwb.hcg = function (hwb) { + var w = hwb[1] / 100; + var b = hwb[2] / 100; + var v = 1 - b; + var c = v - w; + var g = 0; + + if (c < 1) { + g = (v - c) / (1 - c); + } + + return [hwb[0], c * 100, g * 100]; +}; + +convert.apple.rgb = function (apple) { + return [(apple[0] / 65535) * 255, (apple[1] / 65535) * 255, (apple[2] / 65535) * 255]; +}; + +convert.rgb.apple = function (rgb) { + return [(rgb[0] / 255) * 65535, (rgb[1] / 255) * 65535, (rgb[2] / 255) * 65535]; +}; + +convert.gray.rgb = function (args) { + return [args[0] / 100 * 255, args[0] / 100 * 255, args[0] / 100 * 255]; +}; + +convert.gray.hsl = convert.gray.hsv = function (args) { + return [0, 0, args[0]]; +}; + +convert.gray.hwb = function (gray) { + return [0, 100, gray[0]]; +}; + +convert.gray.cmyk = function (gray) { + return [0, 0, 0, gray[0]]; +}; + +convert.gray.lab = function (gray) { + return [gray[0], 0, 0]; +}; + +convert.gray.hex = function (gray) { + var val = Math.round(gray[0] / 100 * 255) & 0xFF; + var integer = (val << 16) + (val << 8) + val; + + var string = integer.toString(16).toUpperCase(); + return '000000'.substring(string.length) + string; +}; + +convert.rgb.gray = function (rgb) { + var val = (rgb[0] + rgb[1] + rgb[2]) / 3; + return [val / 255 * 100]; +}; diff --git a/node_modules/color-convert/index.js b/node_modules/color-convert/index.js new file mode 100644 index 0000000..e65b5d7 --- /dev/null +++ b/node_modules/color-convert/index.js @@ -0,0 +1,78 @@ +var conversions = require('./conversions'); +var route = require('./route'); + +var convert = {}; + +var models = Object.keys(conversions); + +function wrapRaw(fn) { + var wrappedFn = function (args) { + if (args === undefined || args === null) { + return args; + } + + if (arguments.length > 1) { + args = Array.prototype.slice.call(arguments); + } + + return fn(args); + }; + + // preserve .conversion property if there is one + if ('conversion' in fn) { + wrappedFn.conversion = fn.conversion; + } + + return wrappedFn; +} + +function wrapRounded(fn) { + var wrappedFn = function (args) { + if (args === undefined || args === null) { + return args; + } + + if (arguments.length > 1) { + args = Array.prototype.slice.call(arguments); + } + + var result = fn(args); + + // we're assuming the result is an array here. + // see notice in conversions.js; don't use box types + // in conversion functions. + if (typeof result === 'object') { + for (var len = result.length, i = 0; i < len; i++) { + result[i] = Math.round(result[i]); + } + } + + return result; + }; + + // preserve .conversion property if there is one + if ('conversion' in fn) { + wrappedFn.conversion = fn.conversion; + } + + return wrappedFn; +} + +models.forEach(function (fromModel) { + convert[fromModel] = {}; + + Object.defineProperty(convert[fromModel], 'channels', {value: conversions[fromModel].channels}); + Object.defineProperty(convert[fromModel], 'labels', {value: conversions[fromModel].labels}); + + var routes = route(fromModel); + var routeModels = Object.keys(routes); + + routeModels.forEach(function (toModel) { + var fn = routes[toModel]; + + convert[fromModel][toModel] = wrapRounded(fn); + convert[fromModel][toModel].raw = wrapRaw(fn); + }); +}); + +module.exports = convert; diff --git a/node_modules/color-convert/package.json b/node_modules/color-convert/package.json new file mode 100644 index 0000000..819f5fa --- /dev/null +++ b/node_modules/color-convert/package.json @@ -0,0 +1,81 @@ +{ + "_from": "color-convert@^1.9.0", + "_id": "color-convert@1.9.3", + "_inBundle": false, + "_integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "_location": "/color-convert", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "color-convert@^1.9.0", + "name": "color-convert", + "escapedName": "color-convert", + "rawSpec": "^1.9.0", + "saveSpec": null, + "fetchSpec": "^1.9.0" + }, + "_requiredBy": [ + "/ansi-styles" + ], + "_resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "_shasum": "bb71850690e1f136567de629d2d5471deda4c1e8", + "_spec": "color-convert@^1.9.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\ansi-styles", + "author": { + "name": "Heather Arthur", + "email": "fayearthur@gmail.com" + }, + "bugs": { + "url": "https://github.com/Qix-/color-convert/issues" + }, + "bundleDependencies": false, + "dependencies": { + "color-name": "1.1.3" + }, + "deprecated": false, + "description": "Plain color conversion functions", + "devDependencies": { + "chalk": "1.1.1", + "xo": "0.11.2" + }, + "files": [ + "index.js", + "conversions.js", + "css-keywords.js", + "route.js" + ], + "homepage": "https://github.com/Qix-/color-convert#readme", + "keywords": [ + "color", + "colour", + "convert", + "converter", + "conversion", + "rgb", + "hsl", + "hsv", + "hwb", + "cmyk", + "ansi", + "ansi16" + ], + "license": "MIT", + "name": "color-convert", + "repository": { + "type": "git", + "url": "git+https://github.com/Qix-/color-convert.git" + }, + "scripts": { + "pretest": "xo", + "test": "node test/basic.js" + }, + "version": "1.9.3", + "xo": { + "rules": { + "default-case": 0, + "no-inline-comments": 0, + "operator-linebreak": 0 + } + } +} diff --git a/node_modules/color-convert/route.js b/node_modules/color-convert/route.js new file mode 100644 index 0000000..0a1fdea --- /dev/null +++ b/node_modules/color-convert/route.js @@ -0,0 +1,97 @@ +var conversions = require('./conversions'); + +/* + this function routes a model to all other models. + + all functions that are routed have a property `.conversion` attached + to the returned synthetic function. This property is an array + of strings, each with the steps in between the 'from' and 'to' + color models (inclusive). + + conversions that are not possible simply are not included. +*/ + +function buildGraph() { + var graph = {}; + // https://jsperf.com/object-keys-vs-for-in-with-closure/3 + var models = Object.keys(conversions); + + for (var len = models.length, i = 0; i < len; i++) { + graph[models[i]] = { + // http://jsperf.com/1-vs-infinity + // micro-opt, but this is simple. + distance: -1, + parent: null + }; + } + + return graph; +} + +// https://en.wikipedia.org/wiki/Breadth-first_search +function deriveBFS(fromModel) { + var graph = buildGraph(); + var queue = [fromModel]; // unshift -> queue -> pop + + graph[fromModel].distance = 0; + + while (queue.length) { + var current = queue.pop(); + var adjacents = Object.keys(conversions[current]); + + for (var len = adjacents.length, i = 0; i < len; i++) { + var adjacent = adjacents[i]; + var node = graph[adjacent]; + + if (node.distance === -1) { + node.distance = graph[current].distance + 1; + node.parent = current; + queue.unshift(adjacent); + } + } + } + + return graph; +} + +function link(from, to) { + return function (args) { + return to(from(args)); + }; +} + +function wrapConversion(toModel, graph) { + var path = [graph[toModel].parent, toModel]; + var fn = conversions[graph[toModel].parent][toModel]; + + var cur = graph[toModel].parent; + while (graph[cur].parent) { + path.unshift(graph[cur].parent); + fn = link(conversions[graph[cur].parent][cur], fn); + cur = graph[cur].parent; + } + + fn.conversion = path; + return fn; +} + +module.exports = function (fromModel) { + var graph = deriveBFS(fromModel); + var conversion = {}; + + var models = Object.keys(graph); + for (var len = models.length, i = 0; i < len; i++) { + var toModel = models[i]; + var node = graph[toModel]; + + if (node.parent === null) { + // no possible conversion, or this node is the source model. + continue; + } + + conversion[toModel] = wrapConversion(toModel, graph); + } + + return conversion; +}; + diff --git a/node_modules/color-name/.eslintrc.json b/node_modules/color-name/.eslintrc.json new file mode 100644 index 0000000..c50c250 --- /dev/null +++ b/node_modules/color-name/.eslintrc.json @@ -0,0 +1,43 @@ +{ + "env": { + "browser": true, + "node": true, + "commonjs": true, + "es6": true + }, + "extends": "eslint:recommended", + "rules": { + "strict": 2, + "indent": 0, + "linebreak-style": 0, + "quotes": 0, + "semi": 0, + "no-cond-assign": 1, + "no-constant-condition": 1, + "no-duplicate-case": 1, + "no-empty": 1, + "no-ex-assign": 1, + "no-extra-boolean-cast": 1, + "no-extra-semi": 1, + "no-fallthrough": 1, + "no-func-assign": 1, + "no-global-assign": 1, + "no-implicit-globals": 2, + "no-inner-declarations": ["error", "functions"], + "no-irregular-whitespace": 2, + "no-loop-func": 1, + "no-multi-str": 1, + "no-mixed-spaces-and-tabs": 1, + "no-proto": 1, + "no-sequences": 1, + "no-throw-literal": 1, + "no-unmodified-loop-condition": 1, + "no-useless-call": 1, + "no-void": 1, + "no-with": 2, + "wrap-iife": 1, + "no-redeclare": 1, + "no-unused-vars": ["error", { "vars": "all", "args": "none" }], + "no-sparse-arrays": 1 + } +} diff --git a/node_modules/color-name/.npmignore b/node_modules/color-name/.npmignore new file mode 100644 index 0000000..3854c07 --- /dev/null +++ b/node_modules/color-name/.npmignore @@ -0,0 +1,107 @@ +//this will affect all the git repos +git config --global core.excludesfile ~/.gitignore + + +//update files since .ignore won't if already tracked +git rm --cached + +# Compiled source # +################### +*.com +*.class +*.dll +*.exe +*.o +*.so + +# Packages # +############ +# it's better to unpack these files and commit the raw source +# git has its own built in compression methods +*.7z +*.dmg +*.gz +*.iso +*.jar +*.rar +*.tar +*.zip + +# Logs and databases # +###################### +*.log +*.sql +*.sqlite + +# OS generated files # +###################### +.DS_Store +.DS_Store? +._* +.Spotlight-V100 +.Trashes +# Icon? +ehthumbs.db +Thumbs.db +.cache +.project +.settings +.tmproj +*.esproj +nbproject + +# Numerous always-ignore extensions # +##################################### +*.diff +*.err +*.orig +*.rej +*.swn +*.swo +*.swp +*.vi +*~ +*.sass-cache +*.grunt +*.tmp + +# Dreamweaver added files # +########################### +_notes +dwsync.xml + +# Komodo # +########################### +*.komodoproject +.komodotools + +# Node # +##################### +node_modules + +# Bower # +##################### +bower_components + +# Folders to ignore # +##################### +.hg +.svn +.CVS +intermediate +publish +.idea +.graphics +_test +_archive +uploads +tmp + +# Vim files to ignore # +####################### +.VimballRecord +.netrwhist + +bundle.* + +_demo \ No newline at end of file diff --git a/node_modules/color-name/LICENSE b/node_modules/color-name/LICENSE new file mode 100644 index 0000000..4d9802a --- /dev/null +++ b/node_modules/color-name/LICENSE @@ -0,0 +1,8 @@ +The MIT License (MIT) +Copyright (c) 2015 Dmitry Ivanov + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/color-name/README.md b/node_modules/color-name/README.md new file mode 100644 index 0000000..3611a6b --- /dev/null +++ b/node_modules/color-name/README.md @@ -0,0 +1,11 @@ +A JSON with color names and its values. Based on http://dev.w3.org/csswg/css-color/#named-colors. + +[![NPM](https://nodei.co/npm/color-name.png?mini=true)](https://nodei.co/npm/color-name/) + + +```js +var colors = require('color-name'); +colors.red //[255,0,0] +``` + + diff --git a/node_modules/color-name/index.js b/node_modules/color-name/index.js new file mode 100644 index 0000000..e42aa68 --- /dev/null +++ b/node_modules/color-name/index.js @@ -0,0 +1,152 @@ +'use strict' + +module.exports = { + "aliceblue": [240, 248, 255], + "antiquewhite": [250, 235, 215], + "aqua": [0, 255, 255], + "aquamarine": [127, 255, 212], + "azure": [240, 255, 255], + "beige": [245, 245, 220], + "bisque": [255, 228, 196], + "black": [0, 0, 0], + "blanchedalmond": [255, 235, 205], + "blue": [0, 0, 255], + "blueviolet": [138, 43, 226], + "brown": [165, 42, 42], + "burlywood": [222, 184, 135], + "cadetblue": [95, 158, 160], + "chartreuse": [127, 255, 0], + "chocolate": [210, 105, 30], + "coral": [255, 127, 80], + "cornflowerblue": [100, 149, 237], + "cornsilk": [255, 248, 220], + "crimson": [220, 20, 60], + "cyan": [0, 255, 255], + "darkblue": [0, 0, 139], + "darkcyan": [0, 139, 139], + "darkgoldenrod": [184, 134, 11], + "darkgray": [169, 169, 169], + "darkgreen": [0, 100, 0], + "darkgrey": [169, 169, 169], + "darkkhaki": [189, 183, 107], + "darkmagenta": [139, 0, 139], + "darkolivegreen": [85, 107, 47], + "darkorange": [255, 140, 0], + "darkorchid": [153, 50, 204], + "darkred": [139, 0, 0], + "darksalmon": [233, 150, 122], + "darkseagreen": [143, 188, 143], + "darkslateblue": [72, 61, 139], + "darkslategray": [47, 79, 79], + "darkslategrey": [47, 79, 79], + "darkturquoise": [0, 206, 209], + "darkviolet": [148, 0, 211], + "deeppink": [255, 20, 147], + "deepskyblue": [0, 191, 255], + "dimgray": [105, 105, 105], + "dimgrey": [105, 105, 105], + "dodgerblue": [30, 144, 255], + "firebrick": [178, 34, 34], + "floralwhite": [255, 250, 240], + "forestgreen": [34, 139, 34], + "fuchsia": [255, 0, 255], + "gainsboro": [220, 220, 220], + "ghostwhite": [248, 248, 255], + "gold": [255, 215, 0], + "goldenrod": [218, 165, 32], + "gray": [128, 128, 128], + "green": [0, 128, 0], + "greenyellow": [173, 255, 47], + "grey": [128, 128, 128], + "honeydew": [240, 255, 240], + "hotpink": [255, 105, 180], + "indianred": [205, 92, 92], + "indigo": [75, 0, 130], + "ivory": [255, 255, 240], + "khaki": [240, 230, 140], + "lavender": [230, 230, 250], + "lavenderblush": [255, 240, 245], + "lawngreen": [124, 252, 0], + "lemonchiffon": [255, 250, 205], + "lightblue": [173, 216, 230], + "lightcoral": [240, 128, 128], + "lightcyan": [224, 255, 255], + "lightgoldenrodyellow": [250, 250, 210], + "lightgray": [211, 211, 211], + "lightgreen": [144, 238, 144], + "lightgrey": [211, 211, 211], + "lightpink": [255, 182, 193], + "lightsalmon": [255, 160, 122], + "lightseagreen": [32, 178, 170], + "lightskyblue": [135, 206, 250], + "lightslategray": [119, 136, 153], + "lightslategrey": [119, 136, 153], + "lightsteelblue": [176, 196, 222], + "lightyellow": [255, 255, 224], + "lime": [0, 255, 0], + "limegreen": [50, 205, 50], + "linen": [250, 240, 230], + "magenta": [255, 0, 255], + "maroon": [128, 0, 0], + "mediumaquamarine": [102, 205, 170], + "mediumblue": [0, 0, 205], + "mediumorchid": [186, 85, 211], + "mediumpurple": [147, 112, 219], + "mediumseagreen": [60, 179, 113], + "mediumslateblue": [123, 104, 238], + "mediumspringgreen": [0, 250, 154], + "mediumturquoise": [72, 209, 204], + "mediumvioletred": [199, 21, 133], + "midnightblue": [25, 25, 112], + "mintcream": [245, 255, 250], + "mistyrose": [255, 228, 225], + "moccasin": [255, 228, 181], + "navajowhite": [255, 222, 173], + "navy": [0, 0, 128], + "oldlace": [253, 245, 230], + "olive": [128, 128, 0], + "olivedrab": [107, 142, 35], + "orange": [255, 165, 0], + "orangered": [255, 69, 0], + "orchid": [218, 112, 214], + "palegoldenrod": [238, 232, 170], + "palegreen": [152, 251, 152], + "paleturquoise": [175, 238, 238], + "palevioletred": [219, 112, 147], + "papayawhip": [255, 239, 213], + "peachpuff": [255, 218, 185], + "peru": [205, 133, 63], + "pink": [255, 192, 203], + "plum": [221, 160, 221], + "powderblue": [176, 224, 230], + "purple": [128, 0, 128], + "rebeccapurple": [102, 51, 153], + "red": [255, 0, 0], + "rosybrown": [188, 143, 143], + "royalblue": [65, 105, 225], + "saddlebrown": [139, 69, 19], + "salmon": [250, 128, 114], + "sandybrown": [244, 164, 96], + "seagreen": [46, 139, 87], + "seashell": [255, 245, 238], + "sienna": [160, 82, 45], + "silver": [192, 192, 192], + "skyblue": [135, 206, 235], + "slateblue": [106, 90, 205], + "slategray": [112, 128, 144], + "slategrey": [112, 128, 144], + "snow": [255, 250, 250], + "springgreen": [0, 255, 127], + "steelblue": [70, 130, 180], + "tan": [210, 180, 140], + "teal": [0, 128, 128], + "thistle": [216, 191, 216], + "tomato": [255, 99, 71], + "turquoise": [64, 224, 208], + "violet": [238, 130, 238], + "wheat": [245, 222, 179], + "white": [255, 255, 255], + "whitesmoke": [245, 245, 245], + "yellow": [255, 255, 0], + "yellowgreen": [154, 205, 50] +}; diff --git a/node_modules/color-name/package.json b/node_modules/color-name/package.json new file mode 100644 index 0000000..43b3b94 --- /dev/null +++ b/node_modules/color-name/package.json @@ -0,0 +1,53 @@ +{ + "_from": "color-name@1.1.3", + "_id": "color-name@1.1.3", + "_inBundle": false, + "_integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=", + "_location": "/color-name", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "color-name@1.1.3", + "name": "color-name", + "escapedName": "color-name", + "rawSpec": "1.1.3", + "saveSpec": null, + "fetchSpec": "1.1.3" + }, + "_requiredBy": [ + "/color-convert" + ], + "_resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "_shasum": "a7d0558bd89c42f795dd42328f740831ca53bc25", + "_spec": "color-name@1.1.3", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\color-convert", + "author": { + "name": "DY", + "email": "dfcreative@gmail.com" + }, + "bugs": { + "url": "https://github.com/dfcreative/color-name/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "A list of color names and its values", + "homepage": "https://github.com/dfcreative/color-name", + "keywords": [ + "color-name", + "color", + "color-keyword", + "keyword" + ], + "license": "MIT", + "main": "index.js", + "name": "color-name", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/dfcreative/color-name.git" + }, + "scripts": { + "test": "node test.js" + }, + "version": "1.1.3" +} diff --git a/node_modules/color-name/test.js b/node_modules/color-name/test.js new file mode 100644 index 0000000..7a08746 --- /dev/null +++ b/node_modules/color-name/test.js @@ -0,0 +1,7 @@ +'use strict' + +var names = require('./'); +var assert = require('assert'); + +assert.deepEqual(names.red, [255,0,0]); +assert.deepEqual(names.aliceblue, [240,248,255]); diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 0000000..146371e --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,14 @@ +{ + "env": { + "browser": true, + "node": true + }, + "globals": { + "chrome": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 0000000..a764300 --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,20 @@ +sudo: false + +language: node_js + +node_js: + - "4" + - "6" + - "8" + +install: + - make install + +script: + - make lint + - make test + +matrix: + include: + - node_js: '8' + env: BROWSER=1 diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..820d21e --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,395 @@ + +3.1.0 / 2017-09-26 +================== + + * Add `DEBUG_HIDE_DATE` env var (#486) + * Remove ReDoS regexp in %o formatter (#504) + * Remove "component" from package.json + * Remove `component.json` + * Ignore package-lock.json + * Examples: fix colors printout + * Fix: browser detection + * Fix: spelling mistake (#496, @EdwardBetts) + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..3ddd136 --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,58 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +install: node_modules + +browser: dist/debug.js + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +dist/debug.js: src/*.js node_modules + @mkdir -p dist + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + +lint: + @eslint *.js src/*.js + +test-node: + @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +test-browser: + @$(MAKE) browser + @karma start --single-run + +test-all: + @concurrently \ + "make test-node" \ + "make test-browser" + +test: + @if [ "x$(BROWSER)" = "x" ]; then \ + $(MAKE) test-node; \ + else \ + $(MAKE) test-browser; \ + fi + +clean: + rimraf dist coverage + +.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 0000000..8e754d1 --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,368 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows note + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Note that PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Then, run the program to be debugged as usual. + + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..914798c --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,82 @@ +{ + "_from": "debug@=3.1.0", + "_id": "debug@3.1.0", + "_inBundle": false, + "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "debug@=3.1.0", + "name": "debug", + "escapedName": "debug", + "rawSpec": "=3.1.0", + "saveSpec": null, + "fetchSpec": "=3.1.0" + }, + "_requiredBy": [ + "/follow-redirects" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "_shasum": "5bb5a0672628b64149566ba16819e61518c67261", + "_spec": "debug@=3.1.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\follow-redirects", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "14.4.0", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "3.1.0" +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 0000000..f5149ff --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,195 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', + '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', + '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', + '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', + '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', + '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', + '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', + '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', + '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', + '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', + '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 0000000..77e6384 --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,225 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * Active `debug` instances. + */ +exports.instances = []; + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + var prevTime; + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + exports.instances.push(debug); + + return debug; +} + +function destroy () { + var index = exports.instances.indexOf(this); + if (index !== -1) { + exports.instances.splice(index, 1); + return true; + } else { + return false; + } +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < exports.instances.length; i++) { + var instance = exports.instances[i]; + instance.enabled = exports.enabled(instance.namespace); + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 0000000..cabcbcd --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 0000000..d666fb9 --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,186 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [ 6, 2, 3, 4, 5, 1 ]; + +try { + var supportsColor = require('supports-color'); + if (supportsColor && supportsColor.level >= 2) { + exports.colors = [ + 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, + 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, + 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, + 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, + 205, 206, 207, 208, 209, 214, 215, 220, 221 + ]; + } +} catch (err) { + // swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(process.stderr.fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); + var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } else { + return new Date().toISOString() + ' '; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log() { + return process.stderr.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/decamelize/index.js b/node_modules/decamelize/index.js new file mode 100644 index 0000000..8d5bab7 --- /dev/null +++ b/node_modules/decamelize/index.js @@ -0,0 +1,13 @@ +'use strict'; +module.exports = function (str, sep) { + if (typeof str !== 'string') { + throw new TypeError('Expected a string'); + } + + sep = typeof sep === 'undefined' ? '_' : sep; + + return str + .replace(/([a-z\d])([A-Z])/g, '$1' + sep + '$2') + .replace(/([A-Z]+)([A-Z][a-z\d]+)/g, '$1' + sep + '$2') + .toLowerCase(); +}; diff --git a/node_modules/decamelize/license b/node_modules/decamelize/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/node_modules/decamelize/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/decamelize/package.json b/node_modules/decamelize/package.json new file mode 100644 index 0000000..ab0ea21 --- /dev/null +++ b/node_modules/decamelize/package.json @@ -0,0 +1,70 @@ +{ + "_from": "decamelize@^1.2.0", + "_id": "decamelize@1.2.0", + "_inBundle": false, + "_integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", + "_location": "/decamelize", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "decamelize@^1.2.0", + "name": "decamelize", + "escapedName": "decamelize", + "rawSpec": "^1.2.0", + "saveSpec": null, + "fetchSpec": "^1.2.0" + }, + "_requiredBy": [ + "/yargs-parser" + ], + "_resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", + "_shasum": "f6534d15148269b20352e7bee26f501f9a191290", + "_spec": "decamelize@^1.2.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs-parser", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/decamelize/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Convert a camelized string into a lowercased one with a custom separator: unicornRainbow → unicorn_rainbow", + "devDependencies": { + "ava": "*", + "xo": "*" + }, + "engines": { + "node": ">=0.10.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/decamelize#readme", + "keywords": [ + "decamelize", + "decamelcase", + "camelcase", + "lowercase", + "case", + "dash", + "hyphen", + "string", + "str", + "text", + "convert" + ], + "license": "MIT", + "name": "decamelize", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/decamelize.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "1.2.0" +} diff --git a/node_modules/decamelize/readme.md b/node_modules/decamelize/readme.md new file mode 100644 index 0000000..624c7ee --- /dev/null +++ b/node_modules/decamelize/readme.md @@ -0,0 +1,48 @@ +# decamelize [![Build Status](https://travis-ci.org/sindresorhus/decamelize.svg?branch=master)](https://travis-ci.org/sindresorhus/decamelize) + +> Convert a camelized string into a lowercased one with a custom separator
+> Example: `unicornRainbow` → `unicorn_rainbow` + + +## Install + +``` +$ npm install --save decamelize +``` + + +## Usage + +```js +const decamelize = require('decamelize'); + +decamelize('unicornRainbow'); +//=> 'unicorn_rainbow' + +decamelize('unicornRainbow', '-'); +//=> 'unicorn-rainbow' +``` + + +## API + +### decamelize(input, [separator]) + +#### input + +Type: `string` + +#### separator + +Type: `string`
+Default: `_` + + +## Related + +See [`camelcase`](https://github.com/sindresorhus/camelcase) for the inverse. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/emoji-regex/LICENSE-MIT.txt b/node_modules/emoji-regex/LICENSE-MIT.txt new file mode 100644 index 0000000..a41e0a7 --- /dev/null +++ b/node_modules/emoji-regex/LICENSE-MIT.txt @@ -0,0 +1,20 @@ +Copyright Mathias Bynens + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/emoji-regex/README.md b/node_modules/emoji-regex/README.md new file mode 100644 index 0000000..37cf14e --- /dev/null +++ b/node_modules/emoji-regex/README.md @@ -0,0 +1,73 @@ +# emoji-regex [![Build status](https://travis-ci.org/mathiasbynens/emoji-regex.svg?branch=master)](https://travis-ci.org/mathiasbynens/emoji-regex) + +_emoji-regex_ offers a regular expression to match all emoji symbols (including textual representations of emoji) as per the Unicode Standard. + +This repository contains a script that generates this regular expression based on [the data from Unicode Technical Report #51](https://github.com/mathiasbynens/unicode-tr51). Because of this, the regular expression can easily be updated whenever new emoji are added to the Unicode standard. + +## Installation + +Via [npm](https://www.npmjs.com/): + +```bash +npm install emoji-regex +``` + +In [Node.js](https://nodejs.org/): + +```js +const emojiRegex = require('emoji-regex'); +// Note: because the regular expression has the global flag set, this module +// exports a function that returns the regex rather than exporting the regular +// expression itself, to make it impossible to (accidentally) mutate the +// original regular expression. + +const text = ` +\u{231A}: ⌚ default emoji presentation character (Emoji_Presentation) +\u{2194}\u{FE0F}: ↔️ default text presentation character rendered as emoji +\u{1F469}: 👩 emoji modifier base (Emoji_Modifier_Base) +\u{1F469}\u{1F3FF}: 👩🏿 emoji modifier base followed by a modifier +`; + +const regex = emojiRegex(); +let match; +while (match = regex.exec(text)) { + const emoji = match[0]; + console.log(`Matched sequence ${ emoji } — code points: ${ [...emoji].length }`); +} +``` + +Console output: + +``` +Matched sequence ⌚ — code points: 1 +Matched sequence ⌚ — code points: 1 +Matched sequence ↔️ — code points: 2 +Matched sequence ↔️ — code points: 2 +Matched sequence 👩 — code points: 1 +Matched sequence 👩 — code points: 1 +Matched sequence 👩🏿 — code points: 2 +Matched sequence 👩🏿 — code points: 2 +``` + +To match emoji in their textual representation as well (i.e. emoji that are not `Emoji_Presentation` symbols and that aren’t forced to render as emoji by a variation selector), `require` the other regex: + +```js +const emojiRegex = require('emoji-regex/text.js'); +``` + +Additionally, in environments which support ES2015 Unicode escapes, you may `require` ES2015-style versions of the regexes: + +```js +const emojiRegex = require('emoji-regex/es2015/index.js'); +const emojiRegexText = require('emoji-regex/es2015/text.js'); +``` + +## Author + +| [![twitter/mathias](https://gravatar.com/avatar/24e08a9ea84deb17ae121074d0f17125?s=70)](https://twitter.com/mathias "Follow @mathias on Twitter") | +|---| +| [Mathias Bynens](https://mathiasbynens.be/) | + +## License + +_emoji-regex_ is available under the [MIT](https://mths.be/mit) license. diff --git a/node_modules/emoji-regex/es2015/index.js b/node_modules/emoji-regex/es2015/index.js new file mode 100644 index 0000000..0216db9 --- /dev/null +++ b/node_modules/emoji-regex/es2015/index.js @@ -0,0 +1,6 @@ +"use strict"; + +module.exports = () => { + // https://mths.be/emoji + return /\u{1F3F4}(?:\u{E0067}\u{E0062}(?:\u{E0065}\u{E006E}\u{E0067}|\u{E0077}\u{E006C}\u{E0073}|\u{E0073}\u{E0063}\u{E0074})\u{E007F}|\u200D\u2620\uFE0F)|\u{1F469}\u200D\u{1F469}\u200D(?:\u{1F466}\u200D\u{1F466}|\u{1F467}\u200D[\u{1F466}\u{1F467}])|\u{1F468}(?:\u200D(?:\u2764\uFE0F\u200D(?:\u{1F48B}\u200D)?\u{1F468}|[\u{1F468}\u{1F469}]\u200D(?:\u{1F466}\u200D\u{1F466}|\u{1F467}\u200D[\u{1F466}\u{1F467}])|\u{1F466}\u200D\u{1F466}|\u{1F467}\u200D[\u{1F466}\u{1F467}]|[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}])|[\u{1F3FB}-\u{1F3FF}]\u200D[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}])|\u{1F469}\u200D(?:\u2764\uFE0F\u200D(?:\u{1F48B}\u200D[\u{1F468}\u{1F469}]|[\u{1F468}\u{1F469}])|[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}])|\u{1F469}\u200D\u{1F466}\u200D\u{1F466}|(?:\u{1F441}\uFE0F\u200D\u{1F5E8}|\u{1F469}[\u{1F3FB}-\u{1F3FF}]\u200D[\u2695\u2696\u2708]|\u{1F468}(?:[\u{1F3FB}-\u{1F3FF}]\u200D[\u2695\u2696\u2708]|\u200D[\u2695\u2696\u2708])|(?:[\u26F9\u{1F3CB}\u{1F3CC}\u{1F575}]\uFE0F|[\u{1F46F}\u{1F93C}\u{1F9DE}\u{1F9DF}])\u200D[\u2640\u2642]|[\u26F9\u{1F3CB}\u{1F3CC}\u{1F575}][\u{1F3FB}-\u{1F3FF}]\u200D[\u2640\u2642]|[\u{1F3C3}\u{1F3C4}\u{1F3CA}\u{1F46E}\u{1F471}\u{1F473}\u{1F477}\u{1F481}\u{1F482}\u{1F486}\u{1F487}\u{1F645}-\u{1F647}\u{1F64B}\u{1F64D}\u{1F64E}\u{1F6A3}\u{1F6B4}-\u{1F6B6}\u{1F926}\u{1F937}-\u{1F939}\u{1F93D}\u{1F93E}\u{1F9B8}\u{1F9B9}\u{1F9D6}-\u{1F9DD}](?:[\u{1F3FB}-\u{1F3FF}]\u200D[\u2640\u2642]|\u200D[\u2640\u2642])|\u{1F469}\u200D[\u2695\u2696\u2708])\uFE0F|\u{1F469}\u200D\u{1F467}\u200D[\u{1F466}\u{1F467}]|\u{1F469}\u200D\u{1F469}\u200D[\u{1F466}\u{1F467}]|\u{1F468}(?:\u200D(?:[\u{1F468}\u{1F469}]\u200D[\u{1F466}\u{1F467}]|[\u{1F466}\u{1F467}])|[\u{1F3FB}-\u{1F3FF}])|\u{1F3F3}\uFE0F\u200D\u{1F308}|\u{1F469}\u200D\u{1F467}|\u{1F469}[\u{1F3FB}-\u{1F3FF}]\u200D[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}]|\u{1F469}\u200D\u{1F466}|\u{1F1F6}\u{1F1E6}|\u{1F1FD}\u{1F1F0}|\u{1F1F4}\u{1F1F2}|\u{1F469}[\u{1F3FB}-\u{1F3FF}]|\u{1F1ED}[\u{1F1F0}\u{1F1F2}\u{1F1F3}\u{1F1F7}\u{1F1F9}\u{1F1FA}]|\u{1F1EC}[\u{1F1E6}\u{1F1E7}\u{1F1E9}-\u{1F1EE}\u{1F1F1}-\u{1F1F3}\u{1F1F5}-\u{1F1FA}\u{1F1FC}\u{1F1FE}]|\u{1F1EA}[\u{1F1E6}\u{1F1E8}\u{1F1EA}\u{1F1EC}\u{1F1ED}\u{1F1F7}-\u{1F1FA}]|\u{1F1E8}[\u{1F1E6}\u{1F1E8}\u{1F1E9}\u{1F1EB}-\u{1F1EE}\u{1F1F0}-\u{1F1F5}\u{1F1F7}\u{1F1FA}-\u{1F1FF}]|\u{1F1F2}[\u{1F1E6}\u{1F1E8}-\u{1F1ED}\u{1F1F0}-\u{1F1FF}]|\u{1F1F3}[\u{1F1E6}\u{1F1E8}\u{1F1EA}-\u{1F1EC}\u{1F1EE}\u{1F1F1}\u{1F1F4}\u{1F1F5}\u{1F1F7}\u{1F1FA}\u{1F1FF}]|\u{1F1FC}[\u{1F1EB}\u{1F1F8}]|\u{1F1FA}[\u{1F1E6}\u{1F1EC}\u{1F1F2}\u{1F1F3}\u{1F1F8}\u{1F1FE}\u{1F1FF}]|\u{1F1F0}[\u{1F1EA}\u{1F1EC}-\u{1F1EE}\u{1F1F2}\u{1F1F3}\u{1F1F5}\u{1F1F7}\u{1F1FC}\u{1F1FE}\u{1F1FF}]|\u{1F1EF}[\u{1F1EA}\u{1F1F2}\u{1F1F4}\u{1F1F5}]|\u{1F1F8}[\u{1F1E6}-\u{1F1EA}\u{1F1EC}-\u{1F1F4}\u{1F1F7}-\u{1F1F9}\u{1F1FB}\u{1F1FD}-\u{1F1FF}]|\u{1F1EE}[\u{1F1E8}-\u{1F1EA}\u{1F1F1}-\u{1F1F4}\u{1F1F6}-\u{1F1F9}]|\u{1F1FF}[\u{1F1E6}\u{1F1F2}\u{1F1FC}]|\u{1F1EB}[\u{1F1EE}-\u{1F1F0}\u{1F1F2}\u{1F1F4}\u{1F1F7}]|\u{1F1F5}[\u{1F1E6}\u{1F1EA}-\u{1F1ED}\u{1F1F0}-\u{1F1F3}\u{1F1F7}-\u{1F1F9}\u{1F1FC}\u{1F1FE}]|\u{1F1E9}[\u{1F1EA}\u{1F1EC}\u{1F1EF}\u{1F1F0}\u{1F1F2}\u{1F1F4}\u{1F1FF}]|\u{1F1F9}[\u{1F1E6}\u{1F1E8}\u{1F1E9}\u{1F1EB}-\u{1F1ED}\u{1F1EF}-\u{1F1F4}\u{1F1F7}\u{1F1F9}\u{1F1FB}\u{1F1FC}\u{1F1FF}]|\u{1F1E7}[\u{1F1E6}\u{1F1E7}\u{1F1E9}-\u{1F1EF}\u{1F1F1}-\u{1F1F4}\u{1F1F6}-\u{1F1F9}\u{1F1FB}\u{1F1FC}\u{1F1FE}\u{1F1FF}]|[#\*0-9]\uFE0F\u20E3|\u{1F1F1}[\u{1F1E6}-\u{1F1E8}\u{1F1EE}\u{1F1F0}\u{1F1F7}-\u{1F1FB}\u{1F1FE}]|\u{1F1E6}[\u{1F1E8}-\u{1F1EC}\u{1F1EE}\u{1F1F1}\u{1F1F2}\u{1F1F4}\u{1F1F6}-\u{1F1FA}\u{1F1FC}\u{1F1FD}\u{1F1FF}]|\u{1F1F7}[\u{1F1EA}\u{1F1F4}\u{1F1F8}\u{1F1FA}\u{1F1FC}]|\u{1F1FB}[\u{1F1E6}\u{1F1E8}\u{1F1EA}\u{1F1EC}\u{1F1EE}\u{1F1F3}\u{1F1FA}]|\u{1F1FE}[\u{1F1EA}\u{1F1F9}]|[\u{1F3C3}\u{1F3C4}\u{1F3CA}\u{1F46E}\u{1F471}\u{1F473}\u{1F477}\u{1F481}\u{1F482}\u{1F486}\u{1F487}\u{1F645}-\u{1F647}\u{1F64B}\u{1F64D}\u{1F64E}\u{1F6A3}\u{1F6B4}-\u{1F6B6}\u{1F926}\u{1F937}-\u{1F939}\u{1F93D}\u{1F93E}\u{1F9B8}\u{1F9B9}\u{1F9D6}-\u{1F9DD}][\u{1F3FB}-\u{1F3FF}]|[\u26F9\u{1F3CB}\u{1F3CC}\u{1F575}][\u{1F3FB}-\u{1F3FF}]|[\u261D\u270A-\u270D\u{1F385}\u{1F3C2}\u{1F3C7}\u{1F442}\u{1F443}\u{1F446}-\u{1F450}\u{1F466}\u{1F467}\u{1F470}\u{1F472}\u{1F474}-\u{1F476}\u{1F478}\u{1F47C}\u{1F483}\u{1F485}\u{1F4AA}\u{1F574}\u{1F57A}\u{1F590}\u{1F595}\u{1F596}\u{1F64C}\u{1F64F}\u{1F6C0}\u{1F6CC}\u{1F918}-\u{1F91C}\u{1F91E}\u{1F91F}\u{1F930}-\u{1F936}\u{1F9B5}\u{1F9B6}\u{1F9D1}-\u{1F9D5}][\u{1F3FB}-\u{1F3FF}]|[\u231A\u231B\u23E9-\u23EC\u23F0\u23F3\u25FD\u25FE\u2614\u2615\u2648-\u2653\u267F\u2693\u26A1\u26AA\u26AB\u26BD\u26BE\u26C4\u26C5\u26CE\u26D4\u26EA\u26F2\u26F3\u26F5\u26FA\u26FD\u2705\u270A\u270B\u2728\u274C\u274E\u2753-\u2755\u2757\u2795-\u2797\u27B0\u27BF\u2B1B\u2B1C\u2B50\u2B55\u{1F004}\u{1F0CF}\u{1F18E}\u{1F191}-\u{1F19A}\u{1F1E6}-\u{1F1FF}\u{1F201}\u{1F21A}\u{1F22F}\u{1F232}-\u{1F236}\u{1F238}-\u{1F23A}\u{1F250}\u{1F251}\u{1F300}-\u{1F320}\u{1F32D}-\u{1F335}\u{1F337}-\u{1F37C}\u{1F37E}-\u{1F393}\u{1F3A0}-\u{1F3CA}\u{1F3CF}-\u{1F3D3}\u{1F3E0}-\u{1F3F0}\u{1F3F4}\u{1F3F8}-\u{1F43E}\u{1F440}\u{1F442}-\u{1F4FC}\u{1F4FF}-\u{1F53D}\u{1F54B}-\u{1F54E}\u{1F550}-\u{1F567}\u{1F57A}\u{1F595}\u{1F596}\u{1F5A4}\u{1F5FB}-\u{1F64F}\u{1F680}-\u{1F6C5}\u{1F6CC}\u{1F6D0}-\u{1F6D2}\u{1F6EB}\u{1F6EC}\u{1F6F4}-\u{1F6F9}\u{1F910}-\u{1F93A}\u{1F93C}-\u{1F93E}\u{1F940}-\u{1F945}\u{1F947}-\u{1F970}\u{1F973}-\u{1F976}\u{1F97A}\u{1F97C}-\u{1F9A2}\u{1F9B0}-\u{1F9B9}\u{1F9C0}-\u{1F9C2}\u{1F9D0}-\u{1F9FF}]|[#\*0-9\xA9\xAE\u203C\u2049\u2122\u2139\u2194-\u2199\u21A9\u21AA\u231A\u231B\u2328\u23CF\u23E9-\u23F3\u23F8-\u23FA\u24C2\u25AA\u25AB\u25B6\u25C0\u25FB-\u25FE\u2600-\u2604\u260E\u2611\u2614\u2615\u2618\u261D\u2620\u2622\u2623\u2626\u262A\u262E\u262F\u2638-\u263A\u2640\u2642\u2648-\u2653\u265F\u2660\u2663\u2665\u2666\u2668\u267B\u267E\u267F\u2692-\u2697\u2699\u269B\u269C\u26A0\u26A1\u26AA\u26AB\u26B0\u26B1\u26BD\u26BE\u26C4\u26C5\u26C8\u26CE\u26CF\u26D1\u26D3\u26D4\u26E9\u26EA\u26F0-\u26F5\u26F7-\u26FA\u26FD\u2702\u2705\u2708-\u270D\u270F\u2712\u2714\u2716\u271D\u2721\u2728\u2733\u2734\u2744\u2747\u274C\u274E\u2753-\u2755\u2757\u2763\u2764\u2795-\u2797\u27A1\u27B0\u27BF\u2934\u2935\u2B05-\u2B07\u2B1B\u2B1C\u2B50\u2B55\u3030\u303D\u3297\u3299\u{1F004}\u{1F0CF}\u{1F170}\u{1F171}\u{1F17E}\u{1F17F}\u{1F18E}\u{1F191}-\u{1F19A}\u{1F1E6}-\u{1F1FF}\u{1F201}\u{1F202}\u{1F21A}\u{1F22F}\u{1F232}-\u{1F23A}\u{1F250}\u{1F251}\u{1F300}-\u{1F321}\u{1F324}-\u{1F393}\u{1F396}\u{1F397}\u{1F399}-\u{1F39B}\u{1F39E}-\u{1F3F0}\u{1F3F3}-\u{1F3F5}\u{1F3F7}-\u{1F4FD}\u{1F4FF}-\u{1F53D}\u{1F549}-\u{1F54E}\u{1F550}-\u{1F567}\u{1F56F}\u{1F570}\u{1F573}-\u{1F57A}\u{1F587}\u{1F58A}-\u{1F58D}\u{1F590}\u{1F595}\u{1F596}\u{1F5A4}\u{1F5A5}\u{1F5A8}\u{1F5B1}\u{1F5B2}\u{1F5BC}\u{1F5C2}-\u{1F5C4}\u{1F5D1}-\u{1F5D3}\u{1F5DC}-\u{1F5DE}\u{1F5E1}\u{1F5E3}\u{1F5E8}\u{1F5EF}\u{1F5F3}\u{1F5FA}-\u{1F64F}\u{1F680}-\u{1F6C5}\u{1F6CB}-\u{1F6D2}\u{1F6E0}-\u{1F6E5}\u{1F6E9}\u{1F6EB}\u{1F6EC}\u{1F6F0}\u{1F6F3}-\u{1F6F9}\u{1F910}-\u{1F93A}\u{1F93C}-\u{1F93E}\u{1F940}-\u{1F945}\u{1F947}-\u{1F970}\u{1F973}-\u{1F976}\u{1F97A}\u{1F97C}-\u{1F9A2}\u{1F9B0}-\u{1F9B9}\u{1F9C0}-\u{1F9C2}\u{1F9D0}-\u{1F9FF}]\uFE0F|[\u261D\u26F9\u270A-\u270D\u{1F385}\u{1F3C2}-\u{1F3C4}\u{1F3C7}\u{1F3CA}-\u{1F3CC}\u{1F442}\u{1F443}\u{1F446}-\u{1F450}\u{1F466}-\u{1F469}\u{1F46E}\u{1F470}-\u{1F478}\u{1F47C}\u{1F481}-\u{1F483}\u{1F485}-\u{1F487}\u{1F4AA}\u{1F574}\u{1F575}\u{1F57A}\u{1F590}\u{1F595}\u{1F596}\u{1F645}-\u{1F647}\u{1F64B}-\u{1F64F}\u{1F6A3}\u{1F6B4}-\u{1F6B6}\u{1F6C0}\u{1F6CC}\u{1F918}-\u{1F91C}\u{1F91E}\u{1F91F}\u{1F926}\u{1F930}-\u{1F939}\u{1F93D}\u{1F93E}\u{1F9B5}\u{1F9B6}\u{1F9B8}\u{1F9B9}\u{1F9D1}-\u{1F9DD}]/gu; +}; diff --git a/node_modules/emoji-regex/es2015/text.js b/node_modules/emoji-regex/es2015/text.js new file mode 100644 index 0000000..d0a771d --- /dev/null +++ b/node_modules/emoji-regex/es2015/text.js @@ -0,0 +1,6 @@ +"use strict"; + +module.exports = () => { + // https://mths.be/emoji + return /\u{1F3F4}(?:\u{E0067}\u{E0062}(?:\u{E0065}\u{E006E}\u{E0067}|\u{E0077}\u{E006C}\u{E0073}|\u{E0073}\u{E0063}\u{E0074})\u{E007F}|\u200D\u2620\uFE0F)|\u{1F469}\u200D\u{1F469}\u200D(?:\u{1F466}\u200D\u{1F466}|\u{1F467}\u200D[\u{1F466}\u{1F467}])|\u{1F468}(?:\u200D(?:\u2764\uFE0F\u200D(?:\u{1F48B}\u200D)?\u{1F468}|[\u{1F468}\u{1F469}]\u200D(?:\u{1F466}\u200D\u{1F466}|\u{1F467}\u200D[\u{1F466}\u{1F467}])|\u{1F466}\u200D\u{1F466}|\u{1F467}\u200D[\u{1F466}\u{1F467}]|[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}])|[\u{1F3FB}-\u{1F3FF}]\u200D[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}])|\u{1F469}\u200D(?:\u2764\uFE0F\u200D(?:\u{1F48B}\u200D[\u{1F468}\u{1F469}]|[\u{1F468}\u{1F469}])|[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}])|\u{1F469}\u200D\u{1F466}\u200D\u{1F466}|(?:\u{1F441}\uFE0F\u200D\u{1F5E8}|\u{1F469}[\u{1F3FB}-\u{1F3FF}]\u200D[\u2695\u2696\u2708]|\u{1F468}(?:[\u{1F3FB}-\u{1F3FF}]\u200D[\u2695\u2696\u2708]|\u200D[\u2695\u2696\u2708])|(?:[\u26F9\u{1F3CB}\u{1F3CC}\u{1F575}]\uFE0F|[\u{1F46F}\u{1F93C}\u{1F9DE}\u{1F9DF}])\u200D[\u2640\u2642]|[\u26F9\u{1F3CB}\u{1F3CC}\u{1F575}][\u{1F3FB}-\u{1F3FF}]\u200D[\u2640\u2642]|[\u{1F3C3}\u{1F3C4}\u{1F3CA}\u{1F46E}\u{1F471}\u{1F473}\u{1F477}\u{1F481}\u{1F482}\u{1F486}\u{1F487}\u{1F645}-\u{1F647}\u{1F64B}\u{1F64D}\u{1F64E}\u{1F6A3}\u{1F6B4}-\u{1F6B6}\u{1F926}\u{1F937}-\u{1F939}\u{1F93D}\u{1F93E}\u{1F9B8}\u{1F9B9}\u{1F9D6}-\u{1F9DD}](?:[\u{1F3FB}-\u{1F3FF}]\u200D[\u2640\u2642]|\u200D[\u2640\u2642])|\u{1F469}\u200D[\u2695\u2696\u2708])\uFE0F|\u{1F469}\u200D\u{1F467}\u200D[\u{1F466}\u{1F467}]|\u{1F469}\u200D\u{1F469}\u200D[\u{1F466}\u{1F467}]|\u{1F468}(?:\u200D(?:[\u{1F468}\u{1F469}]\u200D[\u{1F466}\u{1F467}]|[\u{1F466}\u{1F467}])|[\u{1F3FB}-\u{1F3FF}])|\u{1F3F3}\uFE0F\u200D\u{1F308}|\u{1F469}\u200D\u{1F467}|\u{1F469}[\u{1F3FB}-\u{1F3FF}]\u200D[\u{1F33E}\u{1F373}\u{1F393}\u{1F3A4}\u{1F3A8}\u{1F3EB}\u{1F3ED}\u{1F4BB}\u{1F4BC}\u{1F527}\u{1F52C}\u{1F680}\u{1F692}\u{1F9B0}-\u{1F9B3}]|\u{1F469}\u200D\u{1F466}|\u{1F1F6}\u{1F1E6}|\u{1F1FD}\u{1F1F0}|\u{1F1F4}\u{1F1F2}|\u{1F469}[\u{1F3FB}-\u{1F3FF}]|\u{1F1ED}[\u{1F1F0}\u{1F1F2}\u{1F1F3}\u{1F1F7}\u{1F1F9}\u{1F1FA}]|\u{1F1EC}[\u{1F1E6}\u{1F1E7}\u{1F1E9}-\u{1F1EE}\u{1F1F1}-\u{1F1F3}\u{1F1F5}-\u{1F1FA}\u{1F1FC}\u{1F1FE}]|\u{1F1EA}[\u{1F1E6}\u{1F1E8}\u{1F1EA}\u{1F1EC}\u{1F1ED}\u{1F1F7}-\u{1F1FA}]|\u{1F1E8}[\u{1F1E6}\u{1F1E8}\u{1F1E9}\u{1F1EB}-\u{1F1EE}\u{1F1F0}-\u{1F1F5}\u{1F1F7}\u{1F1FA}-\u{1F1FF}]|\u{1F1F2}[\u{1F1E6}\u{1F1E8}-\u{1F1ED}\u{1F1F0}-\u{1F1FF}]|\u{1F1F3}[\u{1F1E6}\u{1F1E8}\u{1F1EA}-\u{1F1EC}\u{1F1EE}\u{1F1F1}\u{1F1F4}\u{1F1F5}\u{1F1F7}\u{1F1FA}\u{1F1FF}]|\u{1F1FC}[\u{1F1EB}\u{1F1F8}]|\u{1F1FA}[\u{1F1E6}\u{1F1EC}\u{1F1F2}\u{1F1F3}\u{1F1F8}\u{1F1FE}\u{1F1FF}]|\u{1F1F0}[\u{1F1EA}\u{1F1EC}-\u{1F1EE}\u{1F1F2}\u{1F1F3}\u{1F1F5}\u{1F1F7}\u{1F1FC}\u{1F1FE}\u{1F1FF}]|\u{1F1EF}[\u{1F1EA}\u{1F1F2}\u{1F1F4}\u{1F1F5}]|\u{1F1F8}[\u{1F1E6}-\u{1F1EA}\u{1F1EC}-\u{1F1F4}\u{1F1F7}-\u{1F1F9}\u{1F1FB}\u{1F1FD}-\u{1F1FF}]|\u{1F1EE}[\u{1F1E8}-\u{1F1EA}\u{1F1F1}-\u{1F1F4}\u{1F1F6}-\u{1F1F9}]|\u{1F1FF}[\u{1F1E6}\u{1F1F2}\u{1F1FC}]|\u{1F1EB}[\u{1F1EE}-\u{1F1F0}\u{1F1F2}\u{1F1F4}\u{1F1F7}]|\u{1F1F5}[\u{1F1E6}\u{1F1EA}-\u{1F1ED}\u{1F1F0}-\u{1F1F3}\u{1F1F7}-\u{1F1F9}\u{1F1FC}\u{1F1FE}]|\u{1F1E9}[\u{1F1EA}\u{1F1EC}\u{1F1EF}\u{1F1F0}\u{1F1F2}\u{1F1F4}\u{1F1FF}]|\u{1F1F9}[\u{1F1E6}\u{1F1E8}\u{1F1E9}\u{1F1EB}-\u{1F1ED}\u{1F1EF}-\u{1F1F4}\u{1F1F7}\u{1F1F9}\u{1F1FB}\u{1F1FC}\u{1F1FF}]|\u{1F1E7}[\u{1F1E6}\u{1F1E7}\u{1F1E9}-\u{1F1EF}\u{1F1F1}-\u{1F1F4}\u{1F1F6}-\u{1F1F9}\u{1F1FB}\u{1F1FC}\u{1F1FE}\u{1F1FF}]|[#\*0-9]\uFE0F\u20E3|\u{1F1F1}[\u{1F1E6}-\u{1F1E8}\u{1F1EE}\u{1F1F0}\u{1F1F7}-\u{1F1FB}\u{1F1FE}]|\u{1F1E6}[\u{1F1E8}-\u{1F1EC}\u{1F1EE}\u{1F1F1}\u{1F1F2}\u{1F1F4}\u{1F1F6}-\u{1F1FA}\u{1F1FC}\u{1F1FD}\u{1F1FF}]|\u{1F1F7}[\u{1F1EA}\u{1F1F4}\u{1F1F8}\u{1F1FA}\u{1F1FC}]|\u{1F1FB}[\u{1F1E6}\u{1F1E8}\u{1F1EA}\u{1F1EC}\u{1F1EE}\u{1F1F3}\u{1F1FA}]|\u{1F1FE}[\u{1F1EA}\u{1F1F9}]|[\u{1F3C3}\u{1F3C4}\u{1F3CA}\u{1F46E}\u{1F471}\u{1F473}\u{1F477}\u{1F481}\u{1F482}\u{1F486}\u{1F487}\u{1F645}-\u{1F647}\u{1F64B}\u{1F64D}\u{1F64E}\u{1F6A3}\u{1F6B4}-\u{1F6B6}\u{1F926}\u{1F937}-\u{1F939}\u{1F93D}\u{1F93E}\u{1F9B8}\u{1F9B9}\u{1F9D6}-\u{1F9DD}][\u{1F3FB}-\u{1F3FF}]|[\u26F9\u{1F3CB}\u{1F3CC}\u{1F575}][\u{1F3FB}-\u{1F3FF}]|[\u261D\u270A-\u270D\u{1F385}\u{1F3C2}\u{1F3C7}\u{1F442}\u{1F443}\u{1F446}-\u{1F450}\u{1F466}\u{1F467}\u{1F470}\u{1F472}\u{1F474}-\u{1F476}\u{1F478}\u{1F47C}\u{1F483}\u{1F485}\u{1F4AA}\u{1F574}\u{1F57A}\u{1F590}\u{1F595}\u{1F596}\u{1F64C}\u{1F64F}\u{1F6C0}\u{1F6CC}\u{1F918}-\u{1F91C}\u{1F91E}\u{1F91F}\u{1F930}-\u{1F936}\u{1F9B5}\u{1F9B6}\u{1F9D1}-\u{1F9D5}][\u{1F3FB}-\u{1F3FF}]|[\u231A\u231B\u23E9-\u23EC\u23F0\u23F3\u25FD\u25FE\u2614\u2615\u2648-\u2653\u267F\u2693\u26A1\u26AA\u26AB\u26BD\u26BE\u26C4\u26C5\u26CE\u26D4\u26EA\u26F2\u26F3\u26F5\u26FA\u26FD\u2705\u270A\u270B\u2728\u274C\u274E\u2753-\u2755\u2757\u2795-\u2797\u27B0\u27BF\u2B1B\u2B1C\u2B50\u2B55\u{1F004}\u{1F0CF}\u{1F18E}\u{1F191}-\u{1F19A}\u{1F1E6}-\u{1F1FF}\u{1F201}\u{1F21A}\u{1F22F}\u{1F232}-\u{1F236}\u{1F238}-\u{1F23A}\u{1F250}\u{1F251}\u{1F300}-\u{1F320}\u{1F32D}-\u{1F335}\u{1F337}-\u{1F37C}\u{1F37E}-\u{1F393}\u{1F3A0}-\u{1F3CA}\u{1F3CF}-\u{1F3D3}\u{1F3E0}-\u{1F3F0}\u{1F3F4}\u{1F3F8}-\u{1F43E}\u{1F440}\u{1F442}-\u{1F4FC}\u{1F4FF}-\u{1F53D}\u{1F54B}-\u{1F54E}\u{1F550}-\u{1F567}\u{1F57A}\u{1F595}\u{1F596}\u{1F5A4}\u{1F5FB}-\u{1F64F}\u{1F680}-\u{1F6C5}\u{1F6CC}\u{1F6D0}-\u{1F6D2}\u{1F6EB}\u{1F6EC}\u{1F6F4}-\u{1F6F9}\u{1F910}-\u{1F93A}\u{1F93C}-\u{1F93E}\u{1F940}-\u{1F945}\u{1F947}-\u{1F970}\u{1F973}-\u{1F976}\u{1F97A}\u{1F97C}-\u{1F9A2}\u{1F9B0}-\u{1F9B9}\u{1F9C0}-\u{1F9C2}\u{1F9D0}-\u{1F9FF}]|[#\*0-9\xA9\xAE\u203C\u2049\u2122\u2139\u2194-\u2199\u21A9\u21AA\u231A\u231B\u2328\u23CF\u23E9-\u23F3\u23F8-\u23FA\u24C2\u25AA\u25AB\u25B6\u25C0\u25FB-\u25FE\u2600-\u2604\u260E\u2611\u2614\u2615\u2618\u261D\u2620\u2622\u2623\u2626\u262A\u262E\u262F\u2638-\u263A\u2640\u2642\u2648-\u2653\u265F\u2660\u2663\u2665\u2666\u2668\u267B\u267E\u267F\u2692-\u2697\u2699\u269B\u269C\u26A0\u26A1\u26AA\u26AB\u26B0\u26B1\u26BD\u26BE\u26C4\u26C5\u26C8\u26CE\u26CF\u26D1\u26D3\u26D4\u26E9\u26EA\u26F0-\u26F5\u26F7-\u26FA\u26FD\u2702\u2705\u2708-\u270D\u270F\u2712\u2714\u2716\u271D\u2721\u2728\u2733\u2734\u2744\u2747\u274C\u274E\u2753-\u2755\u2757\u2763\u2764\u2795-\u2797\u27A1\u27B0\u27BF\u2934\u2935\u2B05-\u2B07\u2B1B\u2B1C\u2B50\u2B55\u3030\u303D\u3297\u3299\u{1F004}\u{1F0CF}\u{1F170}\u{1F171}\u{1F17E}\u{1F17F}\u{1F18E}\u{1F191}-\u{1F19A}\u{1F1E6}-\u{1F1FF}\u{1F201}\u{1F202}\u{1F21A}\u{1F22F}\u{1F232}-\u{1F23A}\u{1F250}\u{1F251}\u{1F300}-\u{1F321}\u{1F324}-\u{1F393}\u{1F396}\u{1F397}\u{1F399}-\u{1F39B}\u{1F39E}-\u{1F3F0}\u{1F3F3}-\u{1F3F5}\u{1F3F7}-\u{1F4FD}\u{1F4FF}-\u{1F53D}\u{1F549}-\u{1F54E}\u{1F550}-\u{1F567}\u{1F56F}\u{1F570}\u{1F573}-\u{1F57A}\u{1F587}\u{1F58A}-\u{1F58D}\u{1F590}\u{1F595}\u{1F596}\u{1F5A4}\u{1F5A5}\u{1F5A8}\u{1F5B1}\u{1F5B2}\u{1F5BC}\u{1F5C2}-\u{1F5C4}\u{1F5D1}-\u{1F5D3}\u{1F5DC}-\u{1F5DE}\u{1F5E1}\u{1F5E3}\u{1F5E8}\u{1F5EF}\u{1F5F3}\u{1F5FA}-\u{1F64F}\u{1F680}-\u{1F6C5}\u{1F6CB}-\u{1F6D2}\u{1F6E0}-\u{1F6E5}\u{1F6E9}\u{1F6EB}\u{1F6EC}\u{1F6F0}\u{1F6F3}-\u{1F6F9}\u{1F910}-\u{1F93A}\u{1F93C}-\u{1F93E}\u{1F940}-\u{1F945}\u{1F947}-\u{1F970}\u{1F973}-\u{1F976}\u{1F97A}\u{1F97C}-\u{1F9A2}\u{1F9B0}-\u{1F9B9}\u{1F9C0}-\u{1F9C2}\u{1F9D0}-\u{1F9FF}]\uFE0F?|[\u261D\u26F9\u270A-\u270D\u{1F385}\u{1F3C2}-\u{1F3C4}\u{1F3C7}\u{1F3CA}-\u{1F3CC}\u{1F442}\u{1F443}\u{1F446}-\u{1F450}\u{1F466}-\u{1F469}\u{1F46E}\u{1F470}-\u{1F478}\u{1F47C}\u{1F481}-\u{1F483}\u{1F485}-\u{1F487}\u{1F4AA}\u{1F574}\u{1F575}\u{1F57A}\u{1F590}\u{1F595}\u{1F596}\u{1F645}-\u{1F647}\u{1F64B}-\u{1F64F}\u{1F6A3}\u{1F6B4}-\u{1F6B6}\u{1F6C0}\u{1F6CC}\u{1F918}-\u{1F91C}\u{1F91E}\u{1F91F}\u{1F926}\u{1F930}-\u{1F939}\u{1F93D}\u{1F93E}\u{1F9B5}\u{1F9B6}\u{1F9B8}\u{1F9B9}\u{1F9D1}-\u{1F9DD}]/gu; +}; diff --git a/node_modules/emoji-regex/index.d.ts b/node_modules/emoji-regex/index.d.ts new file mode 100644 index 0000000..2c317cd --- /dev/null +++ b/node_modules/emoji-regex/index.d.ts @@ -0,0 +1,5 @@ +declare module 'emoji-regex' { + function emojiRegex(): RegExp; + + export default emojiRegex; +} diff --git a/node_modules/emoji-regex/index.js b/node_modules/emoji-regex/index.js new file mode 100644 index 0000000..e2237a4 --- /dev/null +++ b/node_modules/emoji-regex/index.js @@ -0,0 +1,6 @@ +"use strict"; + +module.exports = function () { + // https://mths.be/emoji + return /\uD83C\uDFF4(?:\uDB40\uDC67\uDB40\uDC62(?:\uDB40\uDC65\uDB40\uDC6E\uDB40\uDC67|\uDB40\uDC77\uDB40\uDC6C\uDB40\uDC73|\uDB40\uDC73\uDB40\uDC63\uDB40\uDC74)\uDB40\uDC7F|\u200D\u2620\uFE0F)|\uD83D\uDC69\u200D\uD83D\uDC69\u200D(?:\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67]))|\uD83D\uDC68(?:\u200D(?:\u2764\uFE0F\u200D(?:\uD83D\uDC8B\u200D)?\uD83D\uDC68|(?:\uD83D[\uDC68\uDC69])\u200D(?:\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67]))|\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67])|\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3])|(?:\uD83C[\uDFFB-\uDFFF])\u200D(?:\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3]))|\uD83D\uDC69\u200D(?:\u2764\uFE0F\u200D(?:\uD83D\uDC8B\u200D(?:\uD83D[\uDC68\uDC69])|\uD83D[\uDC68\uDC69])|\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3])|\uD83D\uDC69\u200D\uD83D\uDC66\u200D\uD83D\uDC66|(?:\uD83D\uDC41\uFE0F\u200D\uD83D\uDDE8|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2695\u2696\u2708]|\uD83D\uDC68(?:(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2695\u2696\u2708]|\u200D[\u2695\u2696\u2708])|(?:(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)\uFE0F|\uD83D\uDC6F|\uD83E[\uDD3C\uDDDE\uDDDF])\u200D[\u2640\u2642]|(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2640\u2642]|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD37-\uDD39\uDD3D\uDD3E\uDDB8\uDDB9\uDDD6-\uDDDD])(?:(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2640\u2642]|\u200D[\u2640\u2642])|\uD83D\uDC69\u200D[\u2695\u2696\u2708])\uFE0F|\uD83D\uDC69\u200D\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67])|\uD83D\uDC69\u200D\uD83D\uDC69\u200D(?:\uD83D[\uDC66\uDC67])|\uD83D\uDC68(?:\u200D(?:(?:\uD83D[\uDC68\uDC69])\u200D(?:\uD83D[\uDC66\uDC67])|\uD83D[\uDC66\uDC67])|\uD83C[\uDFFB-\uDFFF])|\uD83C\uDFF3\uFE0F\u200D\uD83C\uDF08|\uD83D\uDC69\u200D\uD83D\uDC67|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])\u200D(?:\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3])|\uD83D\uDC69\u200D\uD83D\uDC66|\uD83C\uDDF6\uD83C\uDDE6|\uD83C\uDDFD\uD83C\uDDF0|\uD83C\uDDF4\uD83C\uDDF2|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])|\uD83C\uDDED(?:\uD83C[\uDDF0\uDDF2\uDDF3\uDDF7\uDDF9\uDDFA])|\uD83C\uDDEC(?:\uD83C[\uDDE6\uDDE7\uDDE9-\uDDEE\uDDF1-\uDDF3\uDDF5-\uDDFA\uDDFC\uDDFE])|\uD83C\uDDEA(?:\uD83C[\uDDE6\uDDE8\uDDEA\uDDEC\uDDED\uDDF7-\uDDFA])|\uD83C\uDDE8(?:\uD83C[\uDDE6\uDDE8\uDDE9\uDDEB-\uDDEE\uDDF0-\uDDF5\uDDF7\uDDFA-\uDDFF])|\uD83C\uDDF2(?:\uD83C[\uDDE6\uDDE8-\uDDED\uDDF0-\uDDFF])|\uD83C\uDDF3(?:\uD83C[\uDDE6\uDDE8\uDDEA-\uDDEC\uDDEE\uDDF1\uDDF4\uDDF5\uDDF7\uDDFA\uDDFF])|\uD83C\uDDFC(?:\uD83C[\uDDEB\uDDF8])|\uD83C\uDDFA(?:\uD83C[\uDDE6\uDDEC\uDDF2\uDDF3\uDDF8\uDDFE\uDDFF])|\uD83C\uDDF0(?:\uD83C[\uDDEA\uDDEC-\uDDEE\uDDF2\uDDF3\uDDF5\uDDF7\uDDFC\uDDFE\uDDFF])|\uD83C\uDDEF(?:\uD83C[\uDDEA\uDDF2\uDDF4\uDDF5])|\uD83C\uDDF8(?:\uD83C[\uDDE6-\uDDEA\uDDEC-\uDDF4\uDDF7-\uDDF9\uDDFB\uDDFD-\uDDFF])|\uD83C\uDDEE(?:\uD83C[\uDDE8-\uDDEA\uDDF1-\uDDF4\uDDF6-\uDDF9])|\uD83C\uDDFF(?:\uD83C[\uDDE6\uDDF2\uDDFC])|\uD83C\uDDEB(?:\uD83C[\uDDEE-\uDDF0\uDDF2\uDDF4\uDDF7])|\uD83C\uDDF5(?:\uD83C[\uDDE6\uDDEA-\uDDED\uDDF0-\uDDF3\uDDF7-\uDDF9\uDDFC\uDDFE])|\uD83C\uDDE9(?:\uD83C[\uDDEA\uDDEC\uDDEF\uDDF0\uDDF2\uDDF4\uDDFF])|\uD83C\uDDF9(?:\uD83C[\uDDE6\uDDE8\uDDE9\uDDEB-\uDDED\uDDEF-\uDDF4\uDDF7\uDDF9\uDDFB\uDDFC\uDDFF])|\uD83C\uDDE7(?:\uD83C[\uDDE6\uDDE7\uDDE9-\uDDEF\uDDF1-\uDDF4\uDDF6-\uDDF9\uDDFB\uDDFC\uDDFE\uDDFF])|[#\*0-9]\uFE0F\u20E3|\uD83C\uDDF1(?:\uD83C[\uDDE6-\uDDE8\uDDEE\uDDF0\uDDF7-\uDDFB\uDDFE])|\uD83C\uDDE6(?:\uD83C[\uDDE8-\uDDEC\uDDEE\uDDF1\uDDF2\uDDF4\uDDF6-\uDDFA\uDDFC\uDDFD\uDDFF])|\uD83C\uDDF7(?:\uD83C[\uDDEA\uDDF4\uDDF8\uDDFA\uDDFC])|\uD83C\uDDFB(?:\uD83C[\uDDE6\uDDE8\uDDEA\uDDEC\uDDEE\uDDF3\uDDFA])|\uD83C\uDDFE(?:\uD83C[\uDDEA\uDDF9])|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD37-\uDD39\uDD3D\uDD3E\uDDB8\uDDB9\uDDD6-\uDDDD])(?:\uD83C[\uDFFB-\uDFFF])|(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)(?:\uD83C[\uDFFB-\uDFFF])|(?:[\u261D\u270A-\u270D]|\uD83C[\uDF85\uDFC2\uDFC7]|\uD83D[\uDC42\uDC43\uDC46-\uDC50\uDC66\uDC67\uDC70\uDC72\uDC74-\uDC76\uDC78\uDC7C\uDC83\uDC85\uDCAA\uDD74\uDD7A\uDD90\uDD95\uDD96\uDE4C\uDE4F\uDEC0\uDECC]|\uD83E[\uDD18-\uDD1C\uDD1E\uDD1F\uDD30-\uDD36\uDDB5\uDDB6\uDDD1-\uDDD5])(?:\uD83C[\uDFFB-\uDFFF])|(?:[\u231A\u231B\u23E9-\u23EC\u23F0\u23F3\u25FD\u25FE\u2614\u2615\u2648-\u2653\u267F\u2693\u26A1\u26AA\u26AB\u26BD\u26BE\u26C4\u26C5\u26CE\u26D4\u26EA\u26F2\u26F3\u26F5\u26FA\u26FD\u2705\u270A\u270B\u2728\u274C\u274E\u2753-\u2755\u2757\u2795-\u2797\u27B0\u27BF\u2B1B\u2B1C\u2B50\u2B55]|\uD83C[\uDC04\uDCCF\uDD8E\uDD91-\uDD9A\uDDE6-\uDDFF\uDE01\uDE1A\uDE2F\uDE32-\uDE36\uDE38-\uDE3A\uDE50\uDE51\uDF00-\uDF20\uDF2D-\uDF35\uDF37-\uDF7C\uDF7E-\uDF93\uDFA0-\uDFCA\uDFCF-\uDFD3\uDFE0-\uDFF0\uDFF4\uDFF8-\uDFFF]|\uD83D[\uDC00-\uDC3E\uDC40\uDC42-\uDCFC\uDCFF-\uDD3D\uDD4B-\uDD4E\uDD50-\uDD67\uDD7A\uDD95\uDD96\uDDA4\uDDFB-\uDE4F\uDE80-\uDEC5\uDECC\uDED0-\uDED2\uDEEB\uDEEC\uDEF4-\uDEF9]|\uD83E[\uDD10-\uDD3A\uDD3C-\uDD3E\uDD40-\uDD45\uDD47-\uDD70\uDD73-\uDD76\uDD7A\uDD7C-\uDDA2\uDDB0-\uDDB9\uDDC0-\uDDC2\uDDD0-\uDDFF])|(?:[#\*0-9\xA9\xAE\u203C\u2049\u2122\u2139\u2194-\u2199\u21A9\u21AA\u231A\u231B\u2328\u23CF\u23E9-\u23F3\u23F8-\u23FA\u24C2\u25AA\u25AB\u25B6\u25C0\u25FB-\u25FE\u2600-\u2604\u260E\u2611\u2614\u2615\u2618\u261D\u2620\u2622\u2623\u2626\u262A\u262E\u262F\u2638-\u263A\u2640\u2642\u2648-\u2653\u265F\u2660\u2663\u2665\u2666\u2668\u267B\u267E\u267F\u2692-\u2697\u2699\u269B\u269C\u26A0\u26A1\u26AA\u26AB\u26B0\u26B1\u26BD\u26BE\u26C4\u26C5\u26C8\u26CE\u26CF\u26D1\u26D3\u26D4\u26E9\u26EA\u26F0-\u26F5\u26F7-\u26FA\u26FD\u2702\u2705\u2708-\u270D\u270F\u2712\u2714\u2716\u271D\u2721\u2728\u2733\u2734\u2744\u2747\u274C\u274E\u2753-\u2755\u2757\u2763\u2764\u2795-\u2797\u27A1\u27B0\u27BF\u2934\u2935\u2B05-\u2B07\u2B1B\u2B1C\u2B50\u2B55\u3030\u303D\u3297\u3299]|\uD83C[\uDC04\uDCCF\uDD70\uDD71\uDD7E\uDD7F\uDD8E\uDD91-\uDD9A\uDDE6-\uDDFF\uDE01\uDE02\uDE1A\uDE2F\uDE32-\uDE3A\uDE50\uDE51\uDF00-\uDF21\uDF24-\uDF93\uDF96\uDF97\uDF99-\uDF9B\uDF9E-\uDFF0\uDFF3-\uDFF5\uDFF7-\uDFFF]|\uD83D[\uDC00-\uDCFD\uDCFF-\uDD3D\uDD49-\uDD4E\uDD50-\uDD67\uDD6F\uDD70\uDD73-\uDD7A\uDD87\uDD8A-\uDD8D\uDD90\uDD95\uDD96\uDDA4\uDDA5\uDDA8\uDDB1\uDDB2\uDDBC\uDDC2-\uDDC4\uDDD1-\uDDD3\uDDDC-\uDDDE\uDDE1\uDDE3\uDDE8\uDDEF\uDDF3\uDDFA-\uDE4F\uDE80-\uDEC5\uDECB-\uDED2\uDEE0-\uDEE5\uDEE9\uDEEB\uDEEC\uDEF0\uDEF3-\uDEF9]|\uD83E[\uDD10-\uDD3A\uDD3C-\uDD3E\uDD40-\uDD45\uDD47-\uDD70\uDD73-\uDD76\uDD7A\uDD7C-\uDDA2\uDDB0-\uDDB9\uDDC0-\uDDC2\uDDD0-\uDDFF])\uFE0F|(?:[\u261D\u26F9\u270A-\u270D]|\uD83C[\uDF85\uDFC2-\uDFC4\uDFC7\uDFCA-\uDFCC]|\uD83D[\uDC42\uDC43\uDC46-\uDC50\uDC66-\uDC69\uDC6E\uDC70-\uDC78\uDC7C\uDC81-\uDC83\uDC85-\uDC87\uDCAA\uDD74\uDD75\uDD7A\uDD90\uDD95\uDD96\uDE45-\uDE47\uDE4B-\uDE4F\uDEA3\uDEB4-\uDEB6\uDEC0\uDECC]|\uD83E[\uDD18-\uDD1C\uDD1E\uDD1F\uDD26\uDD30-\uDD39\uDD3D\uDD3E\uDDB5\uDDB6\uDDB8\uDDB9\uDDD1-\uDDDD])/g; +}; diff --git a/node_modules/emoji-regex/package.json b/node_modules/emoji-regex/package.json new file mode 100644 index 0000000..3420223 --- /dev/null +++ b/node_modules/emoji-regex/package.json @@ -0,0 +1,78 @@ +{ + "_from": "emoji-regex@^7.0.1", + "_id": "emoji-regex@7.0.3", + "_inBundle": false, + "_integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==", + "_location": "/emoji-regex", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "emoji-regex@^7.0.1", + "name": "emoji-regex", + "escapedName": "emoji-regex", + "rawSpec": "^7.0.1", + "saveSpec": null, + "fetchSpec": "^7.0.1" + }, + "_requiredBy": [ + "/string-width" + ], + "_resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "_shasum": "933a04052860c85e83c122479c4748a8e4c72156", + "_spec": "emoji-regex@^7.0.1", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\string-width", + "author": { + "name": "Mathias Bynens", + "url": "https://mathiasbynens.be/" + }, + "bugs": { + "url": "https://github.com/mathiasbynens/emoji-regex/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "A regular expression to match all Emoji-only symbols as per the Unicode Standard.", + "devDependencies": { + "@babel/cli": "^7.0.0", + "@babel/core": "^7.0.0", + "@babel/plugin-proposal-unicode-property-regex": "^7.0.0", + "@babel/preset-env": "^7.0.0", + "mocha": "^5.2.0", + "regexgen": "^1.3.0", + "unicode-11.0.0": "^0.7.7", + "unicode-tr51": "^9.0.1" + }, + "files": [ + "LICENSE-MIT.txt", + "index.js", + "index.d.ts", + "text.js", + "es2015/index.js", + "es2015/text.js" + ], + "homepage": "https://mths.be/emoji-regex", + "keywords": [ + "unicode", + "regex", + "regexp", + "regular expressions", + "code points", + "symbols", + "characters", + "emoji" + ], + "license": "MIT", + "main": "index.js", + "name": "emoji-regex", + "repository": { + "type": "git", + "url": "git+https://github.com/mathiasbynens/emoji-regex.git" + }, + "scripts": { + "build": "rm -rf -- es2015; babel src -d .; NODE_ENV=es2015 babel src -d ./es2015; node script/inject-sequences.js", + "test": "mocha", + "test:watch": "npm run test -- --watch" + }, + "types": "index.d.ts", + "version": "7.0.3" +} diff --git a/node_modules/emoji-regex/text.js b/node_modules/emoji-regex/text.js new file mode 100644 index 0000000..199ae3b --- /dev/null +++ b/node_modules/emoji-regex/text.js @@ -0,0 +1,6 @@ +"use strict"; + +module.exports = function () { + // https://mths.be/emoji + return /\uD83C\uDFF4(?:\uDB40\uDC67\uDB40\uDC62(?:\uDB40\uDC65\uDB40\uDC6E\uDB40\uDC67|\uDB40\uDC77\uDB40\uDC6C\uDB40\uDC73|\uDB40\uDC73\uDB40\uDC63\uDB40\uDC74)\uDB40\uDC7F|\u200D\u2620\uFE0F)|\uD83D\uDC69\u200D\uD83D\uDC69\u200D(?:\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67]))|\uD83D\uDC68(?:\u200D(?:\u2764\uFE0F\u200D(?:\uD83D\uDC8B\u200D)?\uD83D\uDC68|(?:\uD83D[\uDC68\uDC69])\u200D(?:\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67]))|\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67])|\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3])|(?:\uD83C[\uDFFB-\uDFFF])\u200D(?:\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3]))|\uD83D\uDC69\u200D(?:\u2764\uFE0F\u200D(?:\uD83D\uDC8B\u200D(?:\uD83D[\uDC68\uDC69])|\uD83D[\uDC68\uDC69])|\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3])|\uD83D\uDC69\u200D\uD83D\uDC66\u200D\uD83D\uDC66|(?:\uD83D\uDC41\uFE0F\u200D\uD83D\uDDE8|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2695\u2696\u2708]|\uD83D\uDC68(?:(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2695\u2696\u2708]|\u200D[\u2695\u2696\u2708])|(?:(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)\uFE0F|\uD83D\uDC6F|\uD83E[\uDD3C\uDDDE\uDDDF])\u200D[\u2640\u2642]|(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2640\u2642]|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD37-\uDD39\uDD3D\uDD3E\uDDB8\uDDB9\uDDD6-\uDDDD])(?:(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2640\u2642]|\u200D[\u2640\u2642])|\uD83D\uDC69\u200D[\u2695\u2696\u2708])\uFE0F|\uD83D\uDC69\u200D\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67])|\uD83D\uDC69\u200D\uD83D\uDC69\u200D(?:\uD83D[\uDC66\uDC67])|\uD83D\uDC68(?:\u200D(?:(?:\uD83D[\uDC68\uDC69])\u200D(?:\uD83D[\uDC66\uDC67])|\uD83D[\uDC66\uDC67])|\uD83C[\uDFFB-\uDFFF])|\uD83C\uDFF3\uFE0F\u200D\uD83C\uDF08|\uD83D\uDC69\u200D\uD83D\uDC67|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])\u200D(?:\uD83C[\uDF3E\uDF73\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDB0-\uDDB3])|\uD83D\uDC69\u200D\uD83D\uDC66|\uD83C\uDDF6\uD83C\uDDE6|\uD83C\uDDFD\uD83C\uDDF0|\uD83C\uDDF4\uD83C\uDDF2|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])|\uD83C\uDDED(?:\uD83C[\uDDF0\uDDF2\uDDF3\uDDF7\uDDF9\uDDFA])|\uD83C\uDDEC(?:\uD83C[\uDDE6\uDDE7\uDDE9-\uDDEE\uDDF1-\uDDF3\uDDF5-\uDDFA\uDDFC\uDDFE])|\uD83C\uDDEA(?:\uD83C[\uDDE6\uDDE8\uDDEA\uDDEC\uDDED\uDDF7-\uDDFA])|\uD83C\uDDE8(?:\uD83C[\uDDE6\uDDE8\uDDE9\uDDEB-\uDDEE\uDDF0-\uDDF5\uDDF7\uDDFA-\uDDFF])|\uD83C\uDDF2(?:\uD83C[\uDDE6\uDDE8-\uDDED\uDDF0-\uDDFF])|\uD83C\uDDF3(?:\uD83C[\uDDE6\uDDE8\uDDEA-\uDDEC\uDDEE\uDDF1\uDDF4\uDDF5\uDDF7\uDDFA\uDDFF])|\uD83C\uDDFC(?:\uD83C[\uDDEB\uDDF8])|\uD83C\uDDFA(?:\uD83C[\uDDE6\uDDEC\uDDF2\uDDF3\uDDF8\uDDFE\uDDFF])|\uD83C\uDDF0(?:\uD83C[\uDDEA\uDDEC-\uDDEE\uDDF2\uDDF3\uDDF5\uDDF7\uDDFC\uDDFE\uDDFF])|\uD83C\uDDEF(?:\uD83C[\uDDEA\uDDF2\uDDF4\uDDF5])|\uD83C\uDDF8(?:\uD83C[\uDDE6-\uDDEA\uDDEC-\uDDF4\uDDF7-\uDDF9\uDDFB\uDDFD-\uDDFF])|\uD83C\uDDEE(?:\uD83C[\uDDE8-\uDDEA\uDDF1-\uDDF4\uDDF6-\uDDF9])|\uD83C\uDDFF(?:\uD83C[\uDDE6\uDDF2\uDDFC])|\uD83C\uDDEB(?:\uD83C[\uDDEE-\uDDF0\uDDF2\uDDF4\uDDF7])|\uD83C\uDDF5(?:\uD83C[\uDDE6\uDDEA-\uDDED\uDDF0-\uDDF3\uDDF7-\uDDF9\uDDFC\uDDFE])|\uD83C\uDDE9(?:\uD83C[\uDDEA\uDDEC\uDDEF\uDDF0\uDDF2\uDDF4\uDDFF])|\uD83C\uDDF9(?:\uD83C[\uDDE6\uDDE8\uDDE9\uDDEB-\uDDED\uDDEF-\uDDF4\uDDF7\uDDF9\uDDFB\uDDFC\uDDFF])|\uD83C\uDDE7(?:\uD83C[\uDDE6\uDDE7\uDDE9-\uDDEF\uDDF1-\uDDF4\uDDF6-\uDDF9\uDDFB\uDDFC\uDDFE\uDDFF])|[#\*0-9]\uFE0F\u20E3|\uD83C\uDDF1(?:\uD83C[\uDDE6-\uDDE8\uDDEE\uDDF0\uDDF7-\uDDFB\uDDFE])|\uD83C\uDDE6(?:\uD83C[\uDDE8-\uDDEC\uDDEE\uDDF1\uDDF2\uDDF4\uDDF6-\uDDFA\uDDFC\uDDFD\uDDFF])|\uD83C\uDDF7(?:\uD83C[\uDDEA\uDDF4\uDDF8\uDDFA\uDDFC])|\uD83C\uDDFB(?:\uD83C[\uDDE6\uDDE8\uDDEA\uDDEC\uDDEE\uDDF3\uDDFA])|\uD83C\uDDFE(?:\uD83C[\uDDEA\uDDF9])|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD37-\uDD39\uDD3D\uDD3E\uDDB8\uDDB9\uDDD6-\uDDDD])(?:\uD83C[\uDFFB-\uDFFF])|(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)(?:\uD83C[\uDFFB-\uDFFF])|(?:[\u261D\u270A-\u270D]|\uD83C[\uDF85\uDFC2\uDFC7]|\uD83D[\uDC42\uDC43\uDC46-\uDC50\uDC66\uDC67\uDC70\uDC72\uDC74-\uDC76\uDC78\uDC7C\uDC83\uDC85\uDCAA\uDD74\uDD7A\uDD90\uDD95\uDD96\uDE4C\uDE4F\uDEC0\uDECC]|\uD83E[\uDD18-\uDD1C\uDD1E\uDD1F\uDD30-\uDD36\uDDB5\uDDB6\uDDD1-\uDDD5])(?:\uD83C[\uDFFB-\uDFFF])|(?:[\u231A\u231B\u23E9-\u23EC\u23F0\u23F3\u25FD\u25FE\u2614\u2615\u2648-\u2653\u267F\u2693\u26A1\u26AA\u26AB\u26BD\u26BE\u26C4\u26C5\u26CE\u26D4\u26EA\u26F2\u26F3\u26F5\u26FA\u26FD\u2705\u270A\u270B\u2728\u274C\u274E\u2753-\u2755\u2757\u2795-\u2797\u27B0\u27BF\u2B1B\u2B1C\u2B50\u2B55]|\uD83C[\uDC04\uDCCF\uDD8E\uDD91-\uDD9A\uDDE6-\uDDFF\uDE01\uDE1A\uDE2F\uDE32-\uDE36\uDE38-\uDE3A\uDE50\uDE51\uDF00-\uDF20\uDF2D-\uDF35\uDF37-\uDF7C\uDF7E-\uDF93\uDFA0-\uDFCA\uDFCF-\uDFD3\uDFE0-\uDFF0\uDFF4\uDFF8-\uDFFF]|\uD83D[\uDC00-\uDC3E\uDC40\uDC42-\uDCFC\uDCFF-\uDD3D\uDD4B-\uDD4E\uDD50-\uDD67\uDD7A\uDD95\uDD96\uDDA4\uDDFB-\uDE4F\uDE80-\uDEC5\uDECC\uDED0-\uDED2\uDEEB\uDEEC\uDEF4-\uDEF9]|\uD83E[\uDD10-\uDD3A\uDD3C-\uDD3E\uDD40-\uDD45\uDD47-\uDD70\uDD73-\uDD76\uDD7A\uDD7C-\uDDA2\uDDB0-\uDDB9\uDDC0-\uDDC2\uDDD0-\uDDFF])|(?:[#\*0-9\xA9\xAE\u203C\u2049\u2122\u2139\u2194-\u2199\u21A9\u21AA\u231A\u231B\u2328\u23CF\u23E9-\u23F3\u23F8-\u23FA\u24C2\u25AA\u25AB\u25B6\u25C0\u25FB-\u25FE\u2600-\u2604\u260E\u2611\u2614\u2615\u2618\u261D\u2620\u2622\u2623\u2626\u262A\u262E\u262F\u2638-\u263A\u2640\u2642\u2648-\u2653\u265F\u2660\u2663\u2665\u2666\u2668\u267B\u267E\u267F\u2692-\u2697\u2699\u269B\u269C\u26A0\u26A1\u26AA\u26AB\u26B0\u26B1\u26BD\u26BE\u26C4\u26C5\u26C8\u26CE\u26CF\u26D1\u26D3\u26D4\u26E9\u26EA\u26F0-\u26F5\u26F7-\u26FA\u26FD\u2702\u2705\u2708-\u270D\u270F\u2712\u2714\u2716\u271D\u2721\u2728\u2733\u2734\u2744\u2747\u274C\u274E\u2753-\u2755\u2757\u2763\u2764\u2795-\u2797\u27A1\u27B0\u27BF\u2934\u2935\u2B05-\u2B07\u2B1B\u2B1C\u2B50\u2B55\u3030\u303D\u3297\u3299]|\uD83C[\uDC04\uDCCF\uDD70\uDD71\uDD7E\uDD7F\uDD8E\uDD91-\uDD9A\uDDE6-\uDDFF\uDE01\uDE02\uDE1A\uDE2F\uDE32-\uDE3A\uDE50\uDE51\uDF00-\uDF21\uDF24-\uDF93\uDF96\uDF97\uDF99-\uDF9B\uDF9E-\uDFF0\uDFF3-\uDFF5\uDFF7-\uDFFF]|\uD83D[\uDC00-\uDCFD\uDCFF-\uDD3D\uDD49-\uDD4E\uDD50-\uDD67\uDD6F\uDD70\uDD73-\uDD7A\uDD87\uDD8A-\uDD8D\uDD90\uDD95\uDD96\uDDA4\uDDA5\uDDA8\uDDB1\uDDB2\uDDBC\uDDC2-\uDDC4\uDDD1-\uDDD3\uDDDC-\uDDDE\uDDE1\uDDE3\uDDE8\uDDEF\uDDF3\uDDFA-\uDE4F\uDE80-\uDEC5\uDECB-\uDED2\uDEE0-\uDEE5\uDEE9\uDEEB\uDEEC\uDEF0\uDEF3-\uDEF9]|\uD83E[\uDD10-\uDD3A\uDD3C-\uDD3E\uDD40-\uDD45\uDD47-\uDD70\uDD73-\uDD76\uDD7A\uDD7C-\uDDA2\uDDB0-\uDDB9\uDDC0-\uDDC2\uDDD0-\uDDFF])\uFE0F?|(?:[\u261D\u26F9\u270A-\u270D]|\uD83C[\uDF85\uDFC2-\uDFC4\uDFC7\uDFCA-\uDFCC]|\uD83D[\uDC42\uDC43\uDC46-\uDC50\uDC66-\uDC69\uDC6E\uDC70-\uDC78\uDC7C\uDC81-\uDC83\uDC85-\uDC87\uDCAA\uDD74\uDD75\uDD7A\uDD90\uDD95\uDD96\uDE45-\uDE47\uDE4B-\uDE4F\uDEA3\uDEB4-\uDEB6\uDEC0\uDECC]|\uD83E[\uDD18-\uDD1C\uDD1E\uDD1F\uDD26\uDD30-\uDD39\uDD3D\uDD3E\uDDB5\uDDB6\uDDB8\uDDB9\uDDD1-\uDDDD])/g; +}; diff --git a/node_modules/find-up/index.js b/node_modules/find-up/index.js new file mode 100644 index 0000000..8e83819 --- /dev/null +++ b/node_modules/find-up/index.js @@ -0,0 +1,46 @@ +'use strict'; +const path = require('path'); +const locatePath = require('locate-path'); + +module.exports = (filename, opts = {}) => { + const startDir = path.resolve(opts.cwd || ''); + const {root} = path.parse(startDir); + + const filenames = [].concat(filename); + + return new Promise(resolve => { + (function find(dir) { + locatePath(filenames, {cwd: dir}).then(file => { + if (file) { + resolve(path.join(dir, file)); + } else if (dir === root) { + resolve(null); + } else { + find(path.dirname(dir)); + } + }); + })(startDir); + }); +}; + +module.exports.sync = (filename, opts = {}) => { + let dir = path.resolve(opts.cwd || ''); + const {root} = path.parse(dir); + + const filenames = [].concat(filename); + + // eslint-disable-next-line no-constant-condition + while (true) { + const file = locatePath.sync(filenames, {cwd: dir}); + + if (file) { + return path.join(dir, file); + } + + if (dir === root) { + return null; + } + + dir = path.dirname(dir); + } +}; diff --git a/node_modules/find-up/license b/node_modules/find-up/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/find-up/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/find-up/package.json b/node_modules/find-up/package.json new file mode 100644 index 0000000..e79d526 --- /dev/null +++ b/node_modules/find-up/package.json @@ -0,0 +1,82 @@ +{ + "_from": "find-up@^3.0.0", + "_id": "find-up@3.0.0", + "_inBundle": false, + "_integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", + "_location": "/find-up", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "find-up@^3.0.0", + "name": "find-up", + "escapedName": "find-up", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", + "_shasum": "49169f1d7993430646da61ecc5ae355c21c97b73", + "_spec": "find-up@^3.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/find-up/issues" + }, + "bundleDependencies": false, + "dependencies": { + "locate-path": "^3.0.0" + }, + "deprecated": false, + "description": "Find a file or directory by walking up parent directories", + "devDependencies": { + "ava": "*", + "tempy": "^0.2.1", + "xo": "*" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/find-up#readme", + "keywords": [ + "find", + "up", + "find-up", + "findup", + "look-up", + "look", + "file", + "search", + "match", + "package", + "resolve", + "parent", + "parents", + "folder", + "directory", + "dir", + "walk", + "walking", + "path" + ], + "license": "MIT", + "name": "find-up", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/find-up.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.0.0" +} diff --git a/node_modules/find-up/readme.md b/node_modules/find-up/readme.md new file mode 100644 index 0000000..810ad7c --- /dev/null +++ b/node_modules/find-up/readme.md @@ -0,0 +1,87 @@ +# find-up [![Build Status: Linux and macOS](https://travis-ci.org/sindresorhus/find-up.svg?branch=master)](https://travis-ci.org/sindresorhus/find-up) [![Build Status: Windows](https://ci.appveyor.com/api/projects/status/l0cyjmvh5lq72vq2/branch/master?svg=true)](https://ci.appveyor.com/project/sindresorhus/find-up/branch/master) + +> Find a file or directory by walking up parent directories + + +## Install + +``` +$ npm install find-up +``` + + +## Usage + +``` +/ +└── Users + └── sindresorhus + ├── unicorn.png + └── foo + └── bar + ├── baz + └── example.js +``` + +`example.js` + +```js +const findUp = require('find-up'); + +(async () => { + console.log(await findUp('unicorn.png')); + //=> '/Users/sindresorhus/unicorn.png' + + console.log(await findUp(['rainbow.png', 'unicorn.png'])); + //=> '/Users/sindresorhus/unicorn.png' +})(); +``` + + +## API + +### findUp(filename, [options]) + +Returns a `Promise` for either the filepath or `null` if it couldn't be found. + +### findUp([filenameA, filenameB], [options]) + +Returns a `Promise` for either the first filepath found (by respecting the order) or `null` if none could be found. + +### findUp.sync(filename, [options]) + +Returns a filepath or `null`. + +### findUp.sync([filenameA, filenameB], [options]) + +Returns the first filepath found (by respecting the order) or `null`. + +#### filename + +Type: `string` + +Filename of the file to find. + +#### options + +Type: `Object` + +##### cwd + +Type: `string`
+Default: `process.cwd()` + +Directory to start from. + + +## Related + +- [find-up-cli](https://github.com/sindresorhus/find-up-cli) - CLI for this module +- [pkg-up](https://github.com/sindresorhus/pkg-up) - Find the closest package.json file +- [pkg-dir](https://github.com/sindresorhus/pkg-dir) - Find the root directory of an npm package +- [resolve-from](https://github.com/sindresorhus/resolve-from) - Resolve the path of a module like `require.resolve()` but from a given path + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/follow-redirects/LICENSE b/node_modules/follow-redirects/LICENSE new file mode 100644 index 0000000..742cbad --- /dev/null +++ b/node_modules/follow-redirects/LICENSE @@ -0,0 +1,18 @@ +Copyright 2014–present Olivier Lalonde , James Talmage , Ruben Verborgh + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/follow-redirects/README.md b/node_modules/follow-redirects/README.md new file mode 100644 index 0000000..6d41337 --- /dev/null +++ b/node_modules/follow-redirects/README.md @@ -0,0 +1,155 @@ +## Follow Redirects + +Drop-in replacement for Nodes `http` and `https` that automatically follows redirects. + +[![npm version](https://img.shields.io/npm/v/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) +[![Build Status](https://travis-ci.org/follow-redirects/follow-redirects.svg?branch=master)](https://travis-ci.org/follow-redirects/follow-redirects) +[![Coverage Status](https://coveralls.io/repos/follow-redirects/follow-redirects/badge.svg?branch=master)](https://coveralls.io/r/follow-redirects/follow-redirects?branch=master) +[![Dependency Status](https://david-dm.org/follow-redirects/follow-redirects.svg)](https://david-dm.org/follow-redirects/follow-redirects) +[![npm downloads](https://img.shields.io/npm/dm/follow-redirects.svg)](https://www.npmjs.com/package/follow-redirects) + +`follow-redirects` provides [request](https://nodejs.org/api/http.html#http_http_request_options_callback) and [get](https://nodejs.org/api/http.html#http_http_get_options_callback) + methods that behave identically to those found on the native [http](https://nodejs.org/api/http.html#http_http_request_options_callback) and [https](https://nodejs.org/api/https.html#https_https_request_options_callback) + modules, with the exception that they will seamlessly follow redirects. + +```javascript +var http = require('follow-redirects').http; +var https = require('follow-redirects').https; + +http.get('http://bit.ly/900913', function (response) { + response.on('data', function (chunk) { + console.log(chunk); + }); +}).on('error', function (err) { + console.error(err); +}); +``` + +You can inspect the final redirected URL through the `responseUrl` property on the `response`. +If no redirection happened, `responseUrl` is the original request URL. + +```javascript +https.request({ + host: 'bitly.com', + path: '/UHfDGO', +}, function (response) { + console.log(response.responseUrl); + // 'http://duckduckgo.com/robots.txt' +}); +``` + +## Options +### Global options +Global options are set directly on the `follow-redirects` module: + +```javascript +var followRedirects = require('follow-redirects'); +followRedirects.maxRedirects = 10; +followRedirects.maxBodyLength = 20 * 1024 * 1024; // 20 MB +``` + +The following global options are supported: + +- `maxRedirects` (default: `21`) – sets the maximum number of allowed redirects; if exceeded, an error will be emitted. + +- `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. + + +### Per-request options +Per-request options are set by passing an `options` object: + +```javascript +var url = require('url'); +var followRedirects = require('follow-redirects'); + +var options = url.parse('http://bit.ly/900913'); +options.maxRedirects = 10; +http.request(options); +``` + +In addition to the [standard HTTP](https://nodejs.org/api/http.html#http_http_request_options_callback) and [HTTPS options](https://nodejs.org/api/https.html#https_https_request_options_callback), +the following per-request options are supported: +- `followRedirects` (default: `true`) – whether redirects should be followed. + +- `maxRedirects` (default: `21`) – sets the maximum number of allowed redirects; if exceeded, an error will be emitted. + +- `maxBodyLength` (default: 10MB) – sets the maximum size of the request body; if exceeded, an error will be emitted. + +- `agents` (default: `undefined`) – sets the `agent` option per protocol, since HTTP and HTTPS use different agents. Example value: `{ http: new http.Agent(), https: new https.Agent() }` + +- `trackRedirects` (default: `false`) – whether to store the redirected response details into the `redirects` array on the response object. + + +### Advanced usage +By default, `follow-redirects` will use the Node.js default implementations +of [`http`](https://nodejs.org/api/http.html) +and [`https`](https://nodejs.org/api/https.html). +To enable features such as caching and/or intermediate request tracking, +you might instead want to wrap `follow-redirects` around custom protocol implementations: + +```javascript +var followRedirects = require('follow-redirects').wrap({ + http: require('your-custom-http'), + https: require('your-custom-https'), +}); +``` + +Such custom protocols only need an implementation of the `request` method. + +## Browserify Usage + +Due to the way `XMLHttpRequest` works, the `browserify` versions of `http` and `https` already follow redirects. + If you are *only* targeting the browser, then this library has little value for you. If you want to write cross + platform code for node and the browser, `follow-redirects` provides a great solution for making the native node + modules behave the same as they do in browserified builds in the browser. To avoid bundling unnecessary code + you should tell browserify to swap out `follow-redirects` with the standard modules when bundling. + To make this easier, you need to change how you require the modules: + +```javascript +var http = require('follow-redirects/http'); +var https = require('follow-redirects/https'); +``` + +You can then replace `follow-redirects` in your browserify configuration like so: + +```javascript +"browser": { + "follow-redirects/http" : "http", + "follow-redirects/https" : "https" +} +``` + +The `browserify-http` module has not kept pace with node development, and no long behaves identically to the native + module when running in the browser. If you are experiencing problems, you may want to check out + [browserify-http-2](https://www.npmjs.com/package/http-browserify-2). It is more actively maintained and + attempts to address a few of the shortcomings of `browserify-http`. In that case, your browserify config should + look something like this: + +```javascript +"browser": { + "follow-redirects/http" : "browserify-http-2/http", + "follow-redirects/https" : "browserify-http-2/https" +} +``` + +## Contributing + +Pull Requests are always welcome. Please [file an issue](https://github.com/follow-redirects/follow-redirects/issues) + detailing your proposal before you invest your valuable time. Additional features and bug fixes should be accompanied + by tests. You can run the test suite locally with a simple `npm test` command. + +## Debug Logging + +`follow-redirects` uses the excellent [debug](https://www.npmjs.com/package/debug) for logging. To turn on logging + set the environment variable `DEBUG=follow-redirects` for debug output from just this module. When running the test + suite it is sometimes advantageous to set `DEBUG=*` to see output from the express server as well. + +## Authors + +- Olivier Lalonde (olalonde@gmail.com) +- James Talmage (james@talmage.io) +- [Ruben Verborgh](https://ruben.verborgh.org/) + +## License + +[https://github.com/follow-redirects/follow-redirects/blob/master/LICENSE](MIT License) diff --git a/node_modules/follow-redirects/http.js b/node_modules/follow-redirects/http.js new file mode 100644 index 0000000..695e356 --- /dev/null +++ b/node_modules/follow-redirects/http.js @@ -0,0 +1 @@ +module.exports = require("./").http; diff --git a/node_modules/follow-redirects/https.js b/node_modules/follow-redirects/https.js new file mode 100644 index 0000000..d21c921 --- /dev/null +++ b/node_modules/follow-redirects/https.js @@ -0,0 +1 @@ +module.exports = require("./").https; diff --git a/node_modules/follow-redirects/index.js b/node_modules/follow-redirects/index.js new file mode 100644 index 0000000..4d7297a --- /dev/null +++ b/node_modules/follow-redirects/index.js @@ -0,0 +1,322 @@ +var url = require("url"); +var http = require("http"); +var https = require("https"); +var assert = require("assert"); +var Writable = require("stream").Writable; +var debug = require("debug")("follow-redirects"); + +// RFC7231§4.2.1: Of the request methods defined by this specification, +// the GET, HEAD, OPTIONS, and TRACE methods are defined to be safe. +var SAFE_METHODS = { GET: true, HEAD: true, OPTIONS: true, TRACE: true }; + +// Create handlers that pass events from native requests +var eventHandlers = Object.create(null); +["abort", "aborted", "error", "socket", "timeout"].forEach(function (event) { + eventHandlers[event] = function (arg) { + this._redirectable.emit(event, arg); + }; +}); + +// An HTTP(S) request that can be redirected +function RedirectableRequest(options, responseCallback) { + // Initialize the request + Writable.call(this); + options.headers = options.headers || {}; + this._options = options; + this._redirectCount = 0; + this._redirects = []; + this._requestBodyLength = 0; + this._requestBodyBuffers = []; + + // Since http.request treats host as an alias of hostname, + // but the url module interprets host as hostname plus port, + // eliminate the host property to avoid confusion. + if (options.host) { + // Use hostname if set, because it has precedence + if (!options.hostname) { + options.hostname = options.host; + } + delete options.host; + } + + // Attach a callback if passed + if (responseCallback) { + this.on("response", responseCallback); + } + + // React to responses of native requests + var self = this; + this._onNativeResponse = function (response) { + self._processResponse(response); + }; + + // Complete the URL object when necessary + if (!options.pathname && options.path) { + var searchPos = options.path.indexOf("?"); + if (searchPos < 0) { + options.pathname = options.path; + } + else { + options.pathname = options.path.substring(0, searchPos); + options.search = options.path.substring(searchPos); + } + } + + // Perform the first request + this._performRequest(); +} +RedirectableRequest.prototype = Object.create(Writable.prototype); + +// Writes buffered data to the current native request +RedirectableRequest.prototype.write = function (data, encoding, callback) { + // Validate input and shift parameters if necessary + if (!(typeof data === "string" || typeof data === "object" && ("length" in data))) { + throw new Error("data should be a string, Buffer or Uint8Array"); + } + if (typeof encoding === "function") { + callback = encoding; + encoding = null; + } + + // Ignore empty buffers, since writing them doesn't invoke the callback + // https://github.com/nodejs/node/issues/22066 + if (data.length === 0) { + if (callback) { + callback(); + } + return; + } + // Only write when we don't exceed the maximum body length + if (this._requestBodyLength + data.length <= this._options.maxBodyLength) { + this._requestBodyLength += data.length; + this._requestBodyBuffers.push({ data: data, encoding: encoding }); + this._currentRequest.write(data, encoding, callback); + } + // Error when we exceed the maximum body length + else { + this.emit("error", new Error("Request body larger than maxBodyLength limit")); + this.abort(); + } +}; + +// Ends the current native request +RedirectableRequest.prototype.end = function (data, encoding, callback) { + // Shift parameters if necessary + if (typeof data === "function") { + callback = data; + data = encoding = null; + } + else if (typeof encoding === "function") { + callback = encoding; + encoding = null; + } + + // Write data and end + var currentRequest = this._currentRequest; + this.write(data || "", encoding, function () { + currentRequest.end(null, null, callback); + }); +}; + +// Sets a header value on the current native request +RedirectableRequest.prototype.setHeader = function (name, value) { + this._options.headers[name] = value; + this._currentRequest.setHeader(name, value); +}; + +// Clears a header value on the current native request +RedirectableRequest.prototype.removeHeader = function (name) { + delete this._options.headers[name]; + this._currentRequest.removeHeader(name); +}; + +// Proxy all other public ClientRequest methods +[ + "abort", "flushHeaders", "getHeader", + "setNoDelay", "setSocketKeepAlive", "setTimeout", +].forEach(function (method) { + RedirectableRequest.prototype[method] = function (a, b) { + return this._currentRequest[method](a, b); + }; +}); + +// Proxy all public ClientRequest properties +["aborted", "connection", "socket"].forEach(function (property) { + Object.defineProperty(RedirectableRequest.prototype, property, { + get: function () { return this._currentRequest[property]; }, + }); +}); + +// Executes the next native request (initial or redirect) +RedirectableRequest.prototype._performRequest = function () { + // Load the native protocol + var protocol = this._options.protocol; + var nativeProtocol = this._options.nativeProtocols[protocol]; + if (!nativeProtocol) { + this.emit("error", new Error("Unsupported protocol " + protocol)); + return; + } + + // If specified, use the agent corresponding to the protocol + // (HTTP and HTTPS use different types of agents) + if (this._options.agents) { + var scheme = protocol.substr(0, protocol.length - 1); + this._options.agent = this._options.agents[scheme]; + } + + // Create the native request + var request = this._currentRequest = + nativeProtocol.request(this._options, this._onNativeResponse); + this._currentUrl = url.format(this._options); + + // Set up event handlers + request._redirectable = this; + for (var event in eventHandlers) { + /* istanbul ignore else */ + if (event) { + request.on(event, eventHandlers[event]); + } + } + + // End a redirected request + // (The first request must be ended explicitly with RedirectableRequest#end) + if (this._isRedirect) { + // Write the request entity and end. + var i = 0; + var buffers = this._requestBodyBuffers; + (function writeNext() { + if (i < buffers.length) { + var buffer = buffers[i++]; + request.write(buffer.data, buffer.encoding, writeNext); + } + else { + request.end(); + } + }()); + } +}; + +// Processes a response from the current native request +RedirectableRequest.prototype._processResponse = function (response) { + // Store the redirected response + if (this._options.trackRedirects) { + this._redirects.push({ + url: this._currentUrl, + headers: response.headers, + statusCode: response.statusCode, + }); + } + + // RFC7231§6.4: The 3xx (Redirection) class of status code indicates + // that further action needs to be taken by the user agent in order to + // fulfill the request. If a Location header field is provided, + // the user agent MAY automatically redirect its request to the URI + // referenced by the Location field value, + // even if the specific status code is not understood. + var location = response.headers.location; + if (location && this._options.followRedirects !== false && + response.statusCode >= 300 && response.statusCode < 400) { + // RFC7231§6.4: A client SHOULD detect and intervene + // in cyclical redirections (i.e., "infinite" redirection loops). + if (++this._redirectCount > this._options.maxRedirects) { + this.emit("error", new Error("Max redirects exceeded.")); + return; + } + + // RFC7231§6.4: Automatic redirection needs to done with + // care for methods not known to be safe […], + // since the user might not wish to redirect an unsafe request. + // RFC7231§6.4.7: The 307 (Temporary Redirect) status code indicates + // that the target resource resides temporarily under a different URI + // and the user agent MUST NOT change the request method + // if it performs an automatic redirection to that URI. + var header; + var headers = this._options.headers; + if (response.statusCode !== 307 && !(this._options.method in SAFE_METHODS)) { + this._options.method = "GET"; + // Drop a possible entity and headers related to it + this._requestBodyBuffers = []; + for (header in headers) { + if (/^content-/i.test(header)) { + delete headers[header]; + } + } + } + + // Drop the Host header, as the redirect might lead to a different host + if (!this._isRedirect) { + for (header in headers) { + if (/^host$/i.test(header)) { + delete headers[header]; + } + } + } + + // Perform the redirected request + var redirectUrl = url.resolve(this._currentUrl, location); + debug("redirecting to", redirectUrl); + Object.assign(this._options, url.parse(redirectUrl)); + this._isRedirect = true; + this._performRequest(); + + // Discard the remainder of the response to avoid waiting for data + response.destroy(); + } + else { + // The response is not a redirect; return it as-is + response.responseUrl = this._currentUrl; + response.redirects = this._redirects; + this.emit("response", response); + + // Clean up + this._requestBodyBuffers = []; + } +}; + +// Wraps the key/value object of protocols with redirect functionality +function wrap(protocols) { + // Default settings + var exports = { + maxRedirects: 21, + maxBodyLength: 10 * 1024 * 1024, + }; + + // Wrap each protocol + var nativeProtocols = {}; + Object.keys(protocols).forEach(function (scheme) { + var protocol = scheme + ":"; + var nativeProtocol = nativeProtocols[protocol] = protocols[scheme]; + var wrappedProtocol = exports[scheme] = Object.create(nativeProtocol); + + // Executes a request, following redirects + wrappedProtocol.request = function (options, callback) { + if (typeof options === "string") { + options = url.parse(options); + options.maxRedirects = exports.maxRedirects; + } + else { + options = Object.assign({ + protocol: protocol, + maxRedirects: exports.maxRedirects, + maxBodyLength: exports.maxBodyLength, + }, options); + } + options.nativeProtocols = nativeProtocols; + assert.equal(options.protocol, protocol, "protocol mismatch"); + debug("options", options); + return new RedirectableRequest(options, callback); + }; + + // Executes a GET request, following redirects + wrappedProtocol.get = function (options, callback) { + var request = wrappedProtocol.request(options, callback); + request.end(); + return request; + }; + }); + return exports; +} + +// Exports +module.exports = wrap({ http: http, https: https }); +module.exports.wrap = wrap; diff --git a/node_modules/follow-redirects/package.json b/node_modules/follow-redirects/package.json new file mode 100644 index 0000000..3d571a4 --- /dev/null +++ b/node_modules/follow-redirects/package.json @@ -0,0 +1,96 @@ +{ + "_from": "follow-redirects@1.5.10", + "_id": "follow-redirects@1.5.10", + "_inBundle": false, + "_integrity": "sha512-0V5l4Cizzvqt5D44aTXbFZz+FtyXV1vrDN6qrelxtfYQKW0KO0W2T/hkE8xvGa/540LkZlkaUjO4ailYTFtHVQ==", + "_location": "/follow-redirects", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "follow-redirects@1.5.10", + "name": "follow-redirects", + "escapedName": "follow-redirects", + "rawSpec": "1.5.10", + "saveSpec": null, + "fetchSpec": "1.5.10" + }, + "_requiredBy": [ + "/axios" + ], + "_resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.10.tgz", + "_shasum": "7b7a9f9aea2fdff36786a94ff643ed07f4ff5e2a", + "_spec": "follow-redirects@1.5.10", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\axios", + "author": { + "name": "Ruben Verborgh", + "email": "ruben@verborgh.org", + "url": "https://ruben.verborgh.org/" + }, + "bugs": { + "url": "https://github.com/follow-redirects/follow-redirects/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Olivier Lalonde", + "email": "olalonde@gmail.com", + "url": "http://www.syskall.com" + }, + { + "name": "James Talmage", + "email": "james@talmage.io" + } + ], + "dependencies": { + "debug": "=3.1.0" + }, + "deprecated": false, + "description": "HTTP and HTTPS modules that follow redirects.", + "devDependencies": { + "concat-stream": "^1.6.0", + "coveralls": "^3.0.2", + "eslint": "^4.19.1", + "express": "^4.16.2", + "mocha": "^5.0.0", + "nyc": "^11.8.0" + }, + "engines": { + "node": ">=4.0" + }, + "files": [ + "index.js", + "create.js", + "http.js", + "https.js" + ], + "homepage": "https://github.com/follow-redirects/follow-redirects", + "keywords": [ + "http", + "https", + "url", + "redirect", + "client", + "location", + "utility" + ], + "license": "MIT", + "main": "index.js", + "name": "follow-redirects", + "nyc": { + "reporter": [ + "lcov", + "text" + ] + }, + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/follow-redirects/follow-redirects.git" + }, + "scripts": { + "lint": "eslint *.js test", + "mocha": "nyc mocha", + "test": "npm run lint && npm run mocha" + }, + "version": "1.5.10" +} diff --git a/node_modules/get-caller-file/LICENSE.md b/node_modules/get-caller-file/LICENSE.md new file mode 100644 index 0000000..bf3e1c0 --- /dev/null +++ b/node_modules/get-caller-file/LICENSE.md @@ -0,0 +1,6 @@ +ISC License (ISC) +Copyright 2018 Stefan Penner + +Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/get-caller-file/README.md b/node_modules/get-caller-file/README.md new file mode 100644 index 0000000..a7d8c07 --- /dev/null +++ b/node_modules/get-caller-file/README.md @@ -0,0 +1,41 @@ +# get-caller-file + +[![Build Status](https://travis-ci.org/stefanpenner/get-caller-file.svg?branch=master)](https://travis-ci.org/stefanpenner/get-caller-file) +[![Build status](https://ci.appveyor.com/api/projects/status/ol2q94g1932cy14a/branch/master?svg=true)](https://ci.appveyor.com/project/embercli/get-caller-file/branch/master) + +This is a utility, which allows a function to figure out from which file it was invoked. It does so by inspecting v8's stack trace at the time it is invoked. + +Inspired by http://stackoverflow.com/questions/13227489 + +*note: this relies on Node/V8 specific APIs, as such other runtimes may not work* + +## Installation + +```bash +yarn add get-caller-file +``` + +## Usage + +Given: + +```js +// ./foo.js +const getCallerFile = require('get-caller-file'); + +module.exports = function() { + return getCallerFile(); // figures out who called it +}; +``` + +```js +// index.js +const foo = require('./foo'); + +foo() // => /full/path/to/this/file/index.js +``` + + +## Options: + +* `getCallerFile(position = 2)`: where position is stack frame whos fileName we want. diff --git a/node_modules/get-caller-file/index.d.ts b/node_modules/get-caller-file/index.d.ts new file mode 100644 index 0000000..babed69 --- /dev/null +++ b/node_modules/get-caller-file/index.d.ts @@ -0,0 +1,2 @@ +declare const _default: (position?: number) => any; +export = _default; diff --git a/node_modules/get-caller-file/index.js b/node_modules/get-caller-file/index.js new file mode 100644 index 0000000..57304f8 --- /dev/null +++ b/node_modules/get-caller-file/index.js @@ -0,0 +1,22 @@ +"use strict"; +// Call this function in a another function to find out the file from +// which that function was called from. (Inspects the v8 stack trace) +// +// Inspired by http://stackoverflow.com/questions/13227489 +module.exports = function getCallerFile(position) { + if (position === void 0) { position = 2; } + if (position >= Error.stackTraceLimit) { + throw new TypeError('getCallerFile(position) requires position be less then Error.stackTraceLimit but position was: `' + position + '` and Error.stackTraceLimit was: `' + Error.stackTraceLimit + '`'); + } + var oldPrepareStackTrace = Error.prepareStackTrace; + Error.prepareStackTrace = function (_, stack) { return stack; }; + var stack = new Error().stack; + Error.prepareStackTrace = oldPrepareStackTrace; + if (stack !== null && typeof stack === 'object') { + // stack[0] holds this file + // stack[1] holds where this function was called + // stack[2] holds the file we're interested in + return stack[position] ? stack[position].getFileName() : undefined; + } +}; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/node_modules/get-caller-file/index.js.map b/node_modules/get-caller-file/index.js.map new file mode 100644 index 0000000..89c655c --- /dev/null +++ b/node_modules/get-caller-file/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["index.ts"],"names":[],"mappings":";AAAA,qEAAqE;AACrE,qEAAqE;AACrE,EAAE;AACF,0DAA0D;AAE1D,iBAAS,SAAS,aAAa,CAAC,QAAY;IAAZ,yBAAA,EAAA,YAAY;IAC1C,IAAI,QAAQ,IAAI,KAAK,CAAC,eAAe,EAAE;QACrC,MAAM,IAAI,SAAS,CAAC,kGAAkG,GAAG,QAAQ,GAAG,oCAAoC,GAAG,KAAK,CAAC,eAAe,GAAG,GAAG,CAAC,CAAC;KACzM;IAED,IAAM,oBAAoB,GAAG,KAAK,CAAC,iBAAiB,CAAC;IACrD,KAAK,CAAC,iBAAiB,GAAG,UAAC,CAAC,EAAE,KAAK,IAAM,OAAA,KAAK,EAAL,CAAK,CAAC;IAC/C,IAAM,KAAK,GAAG,IAAI,KAAK,EAAE,CAAC,KAAK,CAAC;IAChC,KAAK,CAAC,iBAAiB,GAAG,oBAAoB,CAAC;IAG/C,IAAI,KAAK,KAAK,IAAI,IAAI,OAAO,KAAK,KAAK,QAAQ,EAAE;QAC/C,2BAA2B;QAC3B,gDAAgD;QAChD,8CAA8C;QAC9C,OAAO,KAAK,CAAC,QAAQ,CAAC,CAAC,CAAC,CAAE,KAAK,CAAC,QAAQ,CAAS,CAAC,WAAW,EAAE,CAAC,CAAC,CAAC,SAAS,CAAC;KAC7E;AACH,CAAC,CAAC"} \ No newline at end of file diff --git a/node_modules/get-caller-file/package.json b/node_modules/get-caller-file/package.json new file mode 100644 index 0000000..f2b5b53 --- /dev/null +++ b/node_modules/get-caller-file/package.json @@ -0,0 +1,69 @@ +{ + "_from": "get-caller-file@^2.0.1", + "_id": "get-caller-file@2.0.5", + "_inBundle": false, + "_integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "_location": "/get-caller-file", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "get-caller-file@^2.0.1", + "name": "get-caller-file", + "escapedName": "get-caller-file", + "rawSpec": "^2.0.1", + "saveSpec": null, + "fetchSpec": "^2.0.1" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "_shasum": "4f94412a82db32f36e3b0b9741f8a97feb031f7e", + "_spec": "get-caller-file@^2.0.1", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Stefan Penner" + }, + "bugs": { + "url": "https://github.com/stefanpenner/get-caller-file/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "[![Build Status](https://travis-ci.org/stefanpenner/get-caller-file.svg?branch=master)](https://travis-ci.org/stefanpenner/get-caller-file) [![Build status](https://ci.appveyor.com/api/projects/status/ol2q94g1932cy14a/branch/master?svg=true)](https://ci.appveyor.com/project/embercli/get-caller-file/branch/master)", + "devDependencies": { + "@types/chai": "^4.1.7", + "@types/ensure-posix-path": "^1.0.0", + "@types/mocha": "^5.2.6", + "@types/node": "^11.10.5", + "chai": "^4.1.2", + "ensure-posix-path": "^1.0.1", + "mocha": "^5.2.0", + "typescript": "^3.3.3333" + }, + "directories": { + "test": "tests" + }, + "engines": { + "node": "6.* || 8.* || >= 10.*" + }, + "files": [ + "index.js", + "index.js.map", + "index.d.ts" + ], + "homepage": "https://github.com/stefanpenner/get-caller-file#readme", + "license": "ISC", + "main": "index.js", + "name": "get-caller-file", + "repository": { + "type": "git", + "url": "git+https://github.com/stefanpenner/get-caller-file.git" + }, + "scripts": { + "prepare": "tsc", + "test": "mocha test", + "test:debug": "mocha test" + }, + "version": "2.0.5" +} diff --git a/node_modules/is-buffer/LICENSE b/node_modules/is-buffer/LICENSE new file mode 100644 index 0000000..0c068ce --- /dev/null +++ b/node_modules/is-buffer/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Feross Aboukhadijeh + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/is-buffer/README.md b/node_modules/is-buffer/README.md new file mode 100644 index 0000000..cce0a8c --- /dev/null +++ b/node_modules/is-buffer/README.md @@ -0,0 +1,53 @@ +# is-buffer [![travis][travis-image]][travis-url] [![npm][npm-image]][npm-url] [![downloads][downloads-image]][downloads-url] [![javascript style guide][standard-image]][standard-url] + +[travis-image]: https://img.shields.io/travis/feross/is-buffer/master.svg +[travis-url]: https://travis-ci.org/feross/is-buffer +[npm-image]: https://img.shields.io/npm/v/is-buffer.svg +[npm-url]: https://npmjs.org/package/is-buffer +[downloads-image]: https://img.shields.io/npm/dm/is-buffer.svg +[downloads-url]: https://npmjs.org/package/is-buffer +[standard-image]: https://img.shields.io/badge/code_style-standard-brightgreen.svg +[standard-url]: https://standardjs.com + +#### Determine if an object is a [`Buffer`](http://nodejs.org/api/buffer.html) (including the [browserify Buffer](https://github.com/feross/buffer)) + +[![saucelabs][saucelabs-image]][saucelabs-url] + +[saucelabs-image]: https://saucelabs.com/browser-matrix/is-buffer.svg +[saucelabs-url]: https://saucelabs.com/u/is-buffer + +## Why not use `Buffer.isBuffer`? + +This module lets you check if an object is a `Buffer` without using `Buffer.isBuffer` (which includes the whole [buffer](https://github.com/feross/buffer) module in [browserify](http://browserify.org/)). + +It's future-proof and works in node too! + +## install + +```bash +npm install is-buffer +``` + +## usage + +```js +var isBuffer = require('is-buffer') + +isBuffer(new Buffer(4)) // true + +isBuffer(undefined) // false +isBuffer(null) // false +isBuffer('') // false +isBuffer(true) // false +isBuffer(false) // false +isBuffer(0) // false +isBuffer(1) // false +isBuffer(1.0) // false +isBuffer('string') // false +isBuffer({}) // false +isBuffer(function foo () {}) // false +``` + +## license + +MIT. Copyright (C) [Feross Aboukhadijeh](http://feross.org). diff --git a/node_modules/is-buffer/index.js b/node_modules/is-buffer/index.js new file mode 100644 index 0000000..da9bfdd --- /dev/null +++ b/node_modules/is-buffer/index.js @@ -0,0 +1,11 @@ +/*! + * Determine if an object is a Buffer + * + * @author Feross Aboukhadijeh + * @license MIT + */ + +module.exports = function isBuffer (obj) { + return obj != null && obj.constructor != null && + typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj) +} diff --git a/node_modules/is-buffer/package.json b/node_modules/is-buffer/package.json new file mode 100644 index 0000000..fceff4d --- /dev/null +++ b/node_modules/is-buffer/package.json @@ -0,0 +1,80 @@ +{ + "_from": "is-buffer@^2.0.2", + "_id": "is-buffer@2.0.3", + "_inBundle": false, + "_integrity": "sha512-U15Q7MXTuZlrbymiz95PJpZxu8IlipAp4dtS3wOdgPXx3mqBnslrWU14kxfHB+Py/+2PVKSr37dMAgM2A4uArw==", + "_location": "/is-buffer", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "is-buffer@^2.0.2", + "name": "is-buffer", + "escapedName": "is-buffer", + "rawSpec": "^2.0.2", + "saveSpec": null, + "fetchSpec": "^2.0.2" + }, + "_requiredBy": [ + "/axios" + ], + "_resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-2.0.3.tgz", + "_shasum": "4ecf3fcf749cbd1e472689e109ac66261a25e725", + "_spec": "is-buffer@^2.0.2", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\axios", + "author": { + "name": "Feross Aboukhadijeh", + "email": "feross@feross.org", + "url": "https://feross.org" + }, + "bugs": { + "url": "https://github.com/feross/is-buffer/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Determine if an object is a Buffer", + "devDependencies": { + "airtap": "0.0.7", + "standard": "*", + "tape": "^4.0.0" + }, + "engines": { + "node": ">=4" + }, + "homepage": "https://github.com/feross/is-buffer#readme", + "keywords": [ + "arraybuffer", + "browser", + "browser buffer", + "browserify", + "buffer", + "buffers", + "core buffer", + "dataview", + "float32array", + "float64array", + "int16array", + "int32array", + "type", + "typed array", + "uint32array" + ], + "license": "MIT", + "main": "index.js", + "name": "is-buffer", + "repository": { + "type": "git", + "url": "git://github.com/feross/is-buffer.git" + }, + "scripts": { + "test": "standard && npm run test-node && npm run test-browser", + "test-browser": "airtap -- test/*.js", + "test-browser-local": "airtap --local -- test/*.js", + "test-node": "tape test/*.js" + }, + "testling": { + "files": "test/*.js" + }, + "version": "2.0.3" +} diff --git a/node_modules/is-fullwidth-code-point/index.js b/node_modules/is-fullwidth-code-point/index.js new file mode 100644 index 0000000..d506327 --- /dev/null +++ b/node_modules/is-fullwidth-code-point/index.js @@ -0,0 +1,46 @@ +'use strict'; +/* eslint-disable yoda */ +module.exports = x => { + if (Number.isNaN(x)) { + return false; + } + + // code points are derived from: + // http://www.unix.org/Public/UNIDATA/EastAsianWidth.txt + if ( + x >= 0x1100 && ( + x <= 0x115f || // Hangul Jamo + x === 0x2329 || // LEFT-POINTING ANGLE BRACKET + x === 0x232a || // RIGHT-POINTING ANGLE BRACKET + // CJK Radicals Supplement .. Enclosed CJK Letters and Months + (0x2e80 <= x && x <= 0x3247 && x !== 0x303f) || + // Enclosed CJK Letters and Months .. CJK Unified Ideographs Extension A + (0x3250 <= x && x <= 0x4dbf) || + // CJK Unified Ideographs .. Yi Radicals + (0x4e00 <= x && x <= 0xa4c6) || + // Hangul Jamo Extended-A + (0xa960 <= x && x <= 0xa97c) || + // Hangul Syllables + (0xac00 <= x && x <= 0xd7a3) || + // CJK Compatibility Ideographs + (0xf900 <= x && x <= 0xfaff) || + // Vertical Forms + (0xfe10 <= x && x <= 0xfe19) || + // CJK Compatibility Forms .. Small Form Variants + (0xfe30 <= x && x <= 0xfe6b) || + // Halfwidth and Fullwidth Forms + (0xff01 <= x && x <= 0xff60) || + (0xffe0 <= x && x <= 0xffe6) || + // Kana Supplement + (0x1b000 <= x && x <= 0x1b001) || + // Enclosed Ideographic Supplement + (0x1f200 <= x && x <= 0x1f251) || + // CJK Unified Ideographs Extension B .. Tertiary Ideographic Plane + (0x20000 <= x && x <= 0x3fffd) + ) + ) { + return true; + } + + return false; +}; diff --git a/node_modules/is-fullwidth-code-point/license b/node_modules/is-fullwidth-code-point/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/node_modules/is-fullwidth-code-point/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/is-fullwidth-code-point/package.json b/node_modules/is-fullwidth-code-point/package.json new file mode 100644 index 0000000..4573a07 --- /dev/null +++ b/node_modules/is-fullwidth-code-point/package.json @@ -0,0 +1,77 @@ +{ + "_from": "is-fullwidth-code-point@^2.0.0", + "_id": "is-fullwidth-code-point@2.0.0", + "_inBundle": false, + "_integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", + "_location": "/is-fullwidth-code-point", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "is-fullwidth-code-point@^2.0.0", + "name": "is-fullwidth-code-point", + "escapedName": "is-fullwidth-code-point", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/string-width" + ], + "_resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "_shasum": "a3b30a5c4f199183167aaab93beefae3ddfb654f", + "_spec": "is-fullwidth-code-point@^2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\string-width", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/is-fullwidth-code-point/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Check if the character represented by a given Unicode code point is fullwidth", + "devDependencies": { + "ava": "*", + "xo": "*" + }, + "engines": { + "node": ">=4" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/is-fullwidth-code-point#readme", + "keywords": [ + "fullwidth", + "full-width", + "full", + "width", + "unicode", + "character", + "char", + "string", + "str", + "codepoint", + "code", + "point", + "is", + "detect", + "check" + ], + "license": "MIT", + "name": "is-fullwidth-code-point", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/is-fullwidth-code-point.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "2.0.0", + "xo": { + "esnext": true + } +} diff --git a/node_modules/is-fullwidth-code-point/readme.md b/node_modules/is-fullwidth-code-point/readme.md new file mode 100644 index 0000000..093b028 --- /dev/null +++ b/node_modules/is-fullwidth-code-point/readme.md @@ -0,0 +1,39 @@ +# is-fullwidth-code-point [![Build Status](https://travis-ci.org/sindresorhus/is-fullwidth-code-point.svg?branch=master)](https://travis-ci.org/sindresorhus/is-fullwidth-code-point) + +> Check if the character represented by a given [Unicode code point](https://en.wikipedia.org/wiki/Code_point) is [fullwidth](https://en.wikipedia.org/wiki/Halfwidth_and_fullwidth_forms) + + +## Install + +``` +$ npm install --save is-fullwidth-code-point +``` + + +## Usage + +```js +const isFullwidthCodePoint = require('is-fullwidth-code-point'); + +isFullwidthCodePoint('谢'.codePointAt()); +//=> true + +isFullwidthCodePoint('a'.codePointAt()); +//=> false +``` + + +## API + +### isFullwidthCodePoint(input) + +#### input + +Type: `number` + +[Code point](https://en.wikipedia.org/wiki/Code_point) of a character. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/locate-path/index.js b/node_modules/locate-path/index.js new file mode 100644 index 0000000..5aae6ee --- /dev/null +++ b/node_modules/locate-path/index.js @@ -0,0 +1,24 @@ +'use strict'; +const path = require('path'); +const pathExists = require('path-exists'); +const pLocate = require('p-locate'); + +module.exports = (iterable, options) => { + options = Object.assign({ + cwd: process.cwd() + }, options); + + return pLocate(iterable, el => pathExists(path.resolve(options.cwd, el)), options); +}; + +module.exports.sync = (iterable, options) => { + options = Object.assign({ + cwd: process.cwd() + }, options); + + for (const el of iterable) { + if (pathExists.sync(path.resolve(options.cwd, el))) { + return el; + } + } +}; diff --git a/node_modules/locate-path/license b/node_modules/locate-path/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/locate-path/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/locate-path/package.json b/node_modules/locate-path/package.json new file mode 100644 index 0000000..4d45349 --- /dev/null +++ b/node_modules/locate-path/package.json @@ -0,0 +1,76 @@ +{ + "_from": "locate-path@^3.0.0", + "_id": "locate-path@3.0.0", + "_inBundle": false, + "_integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", + "_location": "/locate-path", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "locate-path@^3.0.0", + "name": "locate-path", + "escapedName": "locate-path", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/find-up" + ], + "_resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", + "_shasum": "dbec3b3ab759758071b58fe59fc41871af21400e", + "_spec": "locate-path@^3.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\find-up", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/locate-path/issues" + }, + "bundleDependencies": false, + "dependencies": { + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" + }, + "deprecated": false, + "description": "Get the first path that exists on disk of multiple paths", + "devDependencies": { + "ava": "*", + "xo": "*" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/locate-path#readme", + "keywords": [ + "locate", + "path", + "paths", + "file", + "files", + "exists", + "find", + "finder", + "search", + "searcher", + "array", + "iterable", + "iterator" + ], + "license": "MIT", + "name": "locate-path", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/locate-path.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.0.0" +} diff --git a/node_modules/locate-path/readme.md b/node_modules/locate-path/readme.md new file mode 100644 index 0000000..a1d2e62 --- /dev/null +++ b/node_modules/locate-path/readme.md @@ -0,0 +1,99 @@ +# locate-path [![Build Status](https://travis-ci.org/sindresorhus/locate-path.svg?branch=master)](https://travis-ci.org/sindresorhus/locate-path) + +> Get the first path that exists on disk of multiple paths + + +## Install + +``` +$ npm install locate-path +``` + + +## Usage + +Here we find the first file that exists on disk, in array order. + +```js +const locatePath = require('locate-path'); + +const files = [ + 'unicorn.png', + 'rainbow.png', // Only this one actually exists on disk + 'pony.png' +]; + +(async () => { + console(await locatePath(files)); + //=> 'rainbow' +})(); +``` + + +## API + +### locatePath(input, [options]) + +Returns a `Promise` for the first path that exists or `undefined` if none exists. + +#### input + +Type: `Iterable` + +Paths to check. + +#### options + +Type: `Object` + +##### concurrency + +Type: `number`
+Default: `Infinity`
+Minimum: `1` + +Number of concurrently pending promises. + +##### preserveOrder + +Type: `boolean`
+Default: `true` + +Preserve `input` order when searching. + +Disable this to improve performance if you don't care about the order. + +##### cwd + +Type: `string`
+Default: `process.cwd()` + +Current working directory. + +### locatePath.sync(input, [options]) + +Returns the first path that exists or `undefined` if none exists. + +#### input + +Type: `Iterable` + +Paths to check. + +#### options + +Type: `Object` + +##### cwd + +Same as above. + + +## Related + +- [path-exists](https://github.com/sindresorhus/path-exists) - Check if a path exists + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js new file mode 100644 index 0000000..6a522b1 --- /dev/null +++ b/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/ms/license.md b/node_modules/ms/license.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json new file mode 100644 index 0000000..d385070 --- /dev/null +++ b/node_modules/ms/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ms@2.0.0", + "_id": "ms@2.0.0", + "_inBundle": false, + "_integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", + "_location": "/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.0.0", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.0.0", + "saveSpec": null, + "fetchSpec": "2.0.0" + }, + "_requiredBy": [ + "/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "_shasum": "5608aeadfc00be6c2901df5f9861788de0d597c8", + "_spec": "ms@2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\debug", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny milisecond conversion utility", + "devDependencies": { + "eslint": "3.19.0", + "expect.js": "0.3.1", + "husky": "0.13.3", + "lint-staged": "3.4.1", + "mocha": "3.4.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.0.0" +} diff --git a/node_modules/ms/readme.md b/node_modules/ms/readme.md new file mode 100644 index 0000000..84a9974 --- /dev/null +++ b/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/p-limit/index.d.ts b/node_modules/p-limit/index.d.ts new file mode 100644 index 0000000..02988aa --- /dev/null +++ b/node_modules/p-limit/index.d.ts @@ -0,0 +1,29 @@ +export interface Limit { + /** + * @param fn - Promise-returning/async function. + * @param arguments - Any arguments to pass through to `fn`. Support for passing arguments on to the `fn` is provided in order to be able to avoid creating unnecessary closures. You probably don't need this optimization unless you're pushing a lot of functions. + * @returns The promise returned by calling `fn(...arguments)`. + */ + ( + fn: (...arguments: Arguments) => PromiseLike | ReturnType, + ...arguments: Arguments + ): Promise; + + /** + * The number of promises that are currently running. + */ + readonly activeCount: number; + + /** + * The number of promises that are waiting to run (i.e. their internal `fn` was not called yet). + */ + readonly pendingCount: number; +} + +/** + * Run multiple promise-returning & async functions with limited concurrency. + * + * @param concurrency - Concurrency limit. Minimum: `1`. + * @returns A `limit` function. + */ +export default function pLimit(concurrency: number): Limit; diff --git a/node_modules/p-limit/index.js b/node_modules/p-limit/index.js new file mode 100644 index 0000000..d22fbe8 --- /dev/null +++ b/node_modules/p-limit/index.js @@ -0,0 +1,52 @@ +'use strict'; +const pTry = require('p-try'); + +const pLimit = concurrency => { + if (concurrency < 1) { + throw new TypeError('Expected `concurrency` to be a number from 1 and up'); + } + + const queue = []; + let activeCount = 0; + + const next = () => { + activeCount--; + + if (queue.length > 0) { + queue.shift()(); + } + }; + + const run = (fn, resolve, ...args) => { + activeCount++; + + const result = pTry(fn, ...args); + + resolve(result); + + result.then(next, next); + }; + + const enqueue = (fn, resolve, ...args) => { + if (activeCount < concurrency) { + run(fn, resolve, ...args); + } else { + queue.push(run.bind(null, fn, resolve, ...args)); + } + }; + + const generator = (fn, ...args) => new Promise(resolve => enqueue(fn, resolve, ...args)); + Object.defineProperties(generator, { + activeCount: { + get: () => activeCount + }, + pendingCount: { + get: () => queue.length + } + }); + + return generator; +}; + +module.exports = pLimit; +module.exports.default = pLimit; diff --git a/node_modules/p-limit/license b/node_modules/p-limit/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/p-limit/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/p-limit/package.json b/node_modules/p-limit/package.json new file mode 100644 index 0000000..4bcb769 --- /dev/null +++ b/node_modules/p-limit/package.json @@ -0,0 +1,83 @@ +{ + "_from": "p-limit@^2.0.0", + "_id": "p-limit@2.2.0", + "_inBundle": false, + "_integrity": "sha512-pZbTJpoUsCzV48Mc9Nh51VbwO0X9cuPFE8gYwx9BTCt9SF8/b7Zljd2fVgOxhIF/HDTKgpVzs+GPhyKfjLLFRQ==", + "_location": "/p-limit", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "p-limit@^2.0.0", + "name": "p-limit", + "escapedName": "p-limit", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/p-locate" + ], + "_resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.0.tgz", + "_shasum": "417c9941e6027a9abcba5092dd2904e255b5fbc2", + "_spec": "p-limit@^2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\p-locate", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/p-limit/issues" + }, + "bundleDependencies": false, + "dependencies": { + "p-try": "^2.0.0" + }, + "deprecated": false, + "description": "Run multiple promise-returning & async functions with limited concurrency", + "devDependencies": { + "ava": "^1.2.1", + "delay": "^4.1.0", + "in-range": "^1.0.0", + "random-int": "^1.0.0", + "time-span": "^2.0.0", + "tsd-check": "^0.3.0", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/p-limit#readme", + "keywords": [ + "promise", + "limit", + "limited", + "concurrency", + "throttle", + "throat", + "rate", + "batch", + "ratelimit", + "task", + "queue", + "async", + "await", + "promises", + "bluebird" + ], + "license": "MIT", + "name": "p-limit", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/p-limit.git" + }, + "scripts": { + "test": "xo && ava && tsd-check" + }, + "version": "2.2.0" +} diff --git a/node_modules/p-limit/readme.md b/node_modules/p-limit/readme.md new file mode 100644 index 0000000..b87f3e0 --- /dev/null +++ b/node_modules/p-limit/readme.md @@ -0,0 +1,90 @@ +# p-limit [![Build Status](https://travis-ci.org/sindresorhus/p-limit.svg?branch=master)](https://travis-ci.org/sindresorhus/p-limit) + +> Run multiple promise-returning & async functions with limited concurrency + + +## Install + +``` +$ npm install p-limit +``` + + +## Usage + +```js +const pLimit = require('p-limit'); + +const limit = pLimit(1); + +const input = [ + limit(() => fetchSomething('foo')), + limit(() => fetchSomething('bar')), + limit(() => doSomething()) +]; + +(async () => { + // Only one promise is run at once + const result = await Promise.all(input); + console.log(result); +})(); +``` + + +## API + +### pLimit(concurrency) + +Returns a `limit` function. + +#### concurrency + +Type: `number`
+Minimum: `1` + +Concurrency limit. + +### limit(fn, ...args) + +Returns the promise returned by calling `fn(...args)`. + +#### fn + +Type: `Function` + +Promise-returning/async function. + +#### args + +Any arguments to pass through to `fn`. + +Support for passing arguments on to the `fn` is provided in order to be able to avoid creating unnecessary closures. You probably don't need this optimization unless you're pushing a *lot* of functions. + +### limit.activeCount + +The number of promises that are currently running. + +### limit.pendingCount + +The number of promises that are waiting to run (i.e. their internal `fn` was not called yet). + + +## FAQ + +### How is this different from the [`p-queue`](https://github.com/sindresorhus/p-queue) package? + +This package is only about limiting the number of concurrent executions, while `p-queue` is a fully featured queue implementation with lots of different options, introspection, and ability to pause and clear the queue. + + +## Related + +- [p-queue](https://github.com/sindresorhus/p-queue) - Promise queue with concurrency control +- [p-throttle](https://github.com/sindresorhus/p-throttle) - Throttle promise-returning & async functions +- [p-debounce](https://github.com/sindresorhus/p-debounce) - Debounce promise-returning & async functions +- [p-all](https://github.com/sindresorhus/p-all) - Run promise-returning & async functions concurrently with optional limited concurrency +- [More…](https://github.com/sindresorhus/promise-fun) + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/p-locate/index.js b/node_modules/p-locate/index.js new file mode 100644 index 0000000..4bd08aa --- /dev/null +++ b/node_modules/p-locate/index.js @@ -0,0 +1,34 @@ +'use strict'; +const pLimit = require('p-limit'); + +class EndError extends Error { + constructor(value) { + super(); + this.value = value; + } +} + +// The input can also be a promise, so we `Promise.resolve()` it +const testElement = (el, tester) => Promise.resolve(el).then(tester); + +// The input can also be a promise, so we `Promise.all()` them both +const finder = el => Promise.all(el).then(val => val[1] === true && Promise.reject(new EndError(val[0]))); + +module.exports = (iterable, tester, opts) => { + opts = Object.assign({ + concurrency: Infinity, + preserveOrder: true + }, opts); + + const limit = pLimit(opts.concurrency); + + // Start all the promises concurrently with optional limit + const items = [...iterable].map(el => [el, limit(testElement, el, tester)]); + + // Check the promises either serially or concurrently + const checkLimit = pLimit(opts.preserveOrder ? 1 : Infinity); + + return Promise.all(items.map(el => checkLimit(finder, el))) + .then(() => {}) + .catch(err => err instanceof EndError ? err.value : Promise.reject(err)); +}; diff --git a/node_modules/p-locate/license b/node_modules/p-locate/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/p-locate/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/p-locate/package.json b/node_modules/p-locate/package.json new file mode 100644 index 0000000..bb58bce --- /dev/null +++ b/node_modules/p-locate/package.json @@ -0,0 +1,83 @@ +{ + "_from": "p-locate@^3.0.0", + "_id": "p-locate@3.0.0", + "_inBundle": false, + "_integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", + "_location": "/p-locate", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "p-locate@^3.0.0", + "name": "p-locate", + "escapedName": "p-locate", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/locate-path" + ], + "_resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", + "_shasum": "322d69a05c0264b25997d9f40cd8a891ab0064a4", + "_spec": "p-locate@^3.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\locate-path", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/p-locate/issues" + }, + "bundleDependencies": false, + "dependencies": { + "p-limit": "^2.0.0" + }, + "deprecated": false, + "description": "Get the first fulfilled promise that satisfies the provided testing function", + "devDependencies": { + "ava": "*", + "delay": "^3.0.0", + "in-range": "^1.0.0", + "time-span": "^2.0.0", + "xo": "*" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/p-locate#readme", + "keywords": [ + "promise", + "locate", + "find", + "finder", + "search", + "searcher", + "test", + "array", + "collection", + "iterable", + "iterator", + "race", + "fulfilled", + "fastest", + "async", + "await", + "promises", + "bluebird" + ], + "license": "MIT", + "name": "p-locate", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/p-locate.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.0.0" +} diff --git a/node_modules/p-locate/readme.md b/node_modules/p-locate/readme.md new file mode 100644 index 0000000..3b0173b --- /dev/null +++ b/node_modules/p-locate/readme.md @@ -0,0 +1,88 @@ +# p-locate [![Build Status](https://travis-ci.org/sindresorhus/p-locate.svg?branch=master)](https://travis-ci.org/sindresorhus/p-locate) + +> Get the first fulfilled promise that satisfies the provided testing function + +Think of it like an async version of [`Array#find`](https://developer.mozilla.org/en/docs/Web/JavaScript/Reference/Global_Objects/Array/find). + + +## Install + +``` +$ npm install p-locate +``` + + +## Usage + +Here we find the first file that exists on disk, in array order. + +```js +const pathExists = require('path-exists'); +const pLocate = require('p-locate'); + +const files = [ + 'unicorn.png', + 'rainbow.png', // Only this one actually exists on disk + 'pony.png' +]; + +(async () => { + const foundPath = await pLocate(files, file => pathExists(file)); + + console.log(foundPath); + //=> 'rainbow' +})(); +``` + +*The above is just an example. Use [`locate-path`](https://github.com/sindresorhus/locate-path) if you need this.* + + +## API + +### pLocate(input, tester, [options]) + +Returns a `Promise` that is fulfilled when `tester` resolves to `true` or the iterable is done, or rejects if any of the promises reject. The fulfilled value is the current iterable value or `undefined` if `tester` never resolved to `true`. + +#### input + +Type: `Iterable` + +#### tester(element) + +Type: `Function` + +Expected to return a `Promise` or boolean. + +#### options + +Type: `Object` + +##### concurrency + +Type: `number`
+Default: `Infinity`
+Minimum: `1` + +Number of concurrently pending promises returned by `tester`. + +##### preserveOrder + +Type: `boolean`
+Default: `true` + +Preserve `input` order when searching. + +Disable this to improve performance if you don't care about the order. + + +## Related + +- [p-map](https://github.com/sindresorhus/p-map) - Map over promises concurrently +- [p-filter](https://github.com/sindresorhus/p-filter) - Filter promises concurrently +- [p-any](https://github.com/sindresorhus/p-any) - Wait for any promise to be fulfilled +- [More…](https://github.com/sindresorhus/promise-fun) + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/p-try/index.d.ts b/node_modules/p-try/index.d.ts new file mode 100644 index 0000000..2a7319e --- /dev/null +++ b/node_modules/p-try/index.d.ts @@ -0,0 +1,39 @@ +declare const pTry: { + /** + Start a promise chain. + + @param fn - The function to run to start the promise chain. + @param arguments - Arguments to pass to `fn`. + @returns The value of calling `fn(...arguments)`. If the function throws an error, the returned `Promise` will be rejected with that error. + + @example + ``` + import pTry = require('p-try'); + + (async () => { + try { + const value = await pTry(() => { + return synchronousFunctionThatMightThrow(); + }); + console.log(value); + } catch (error) { + console.error(error); + } + })(); + ``` + */ + ( + fn: (...arguments: ArgumentsType) => PromiseLike | ValueType, + ...arguments: ArgumentsType + ): Promise; + + // TODO: remove this in the next major version, refactor the whole definition to: + // declare function pTry( + // fn: (...arguments: ArgumentsType) => PromiseLike | ValueType, + // ...arguments: ArgumentsType + // ): Promise; + // export = pTry; + default: typeof pTry; +}; + +export = pTry; diff --git a/node_modules/p-try/index.js b/node_modules/p-try/index.js new file mode 100644 index 0000000..db858da --- /dev/null +++ b/node_modules/p-try/index.js @@ -0,0 +1,9 @@ +'use strict'; + +const pTry = (fn, ...arguments_) => new Promise(resolve => { + resolve(fn(...arguments_)); +}); + +module.exports = pTry; +// TODO: remove this in the next major version +module.exports.default = pTry; diff --git a/node_modules/p-try/license b/node_modules/p-try/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/p-try/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/p-try/package.json b/node_modules/p-try/package.json new file mode 100644 index 0000000..541485e --- /dev/null +++ b/node_modules/p-try/package.json @@ -0,0 +1,74 @@ +{ + "_from": "p-try@^2.0.0", + "_id": "p-try@2.2.0", + "_inBundle": false, + "_integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", + "_location": "/p-try", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "p-try@^2.0.0", + "name": "p-try", + "escapedName": "p-try", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/p-limit" + ], + "_resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "_shasum": "cb2868540e313d61de58fafbe35ce9004d5540e6", + "_spec": "p-try@^2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\p-limit", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/p-try/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "`Start a promise chain", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.1", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/p-try#readme", + "keywords": [ + "promise", + "try", + "resolve", + "function", + "catch", + "async", + "await", + "promises", + "settled", + "ponyfill", + "polyfill", + "shim", + "bluebird" + ], + "license": "MIT", + "name": "p-try", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/p-try.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "2.2.0" +} diff --git a/node_modules/p-try/readme.md b/node_modules/p-try/readme.md new file mode 100644 index 0000000..4d7bd64 --- /dev/null +++ b/node_modules/p-try/readme.md @@ -0,0 +1,58 @@ +# p-try [![Build Status](https://travis-ci.org/sindresorhus/p-try.svg?branch=master)](https://travis-ci.org/sindresorhus/p-try) + +> Start a promise chain + +[How is it useful?](http://cryto.net/~joepie91/blog/2016/05/11/what-is-promise-try-and-why-does-it-matter/) + + +## Install + +``` +$ npm install p-try +``` + + +## Usage + +```js +const pTry = require('p-try'); + +(async () => { + try { + const value = await pTry(() => { + return synchronousFunctionThatMightThrow(); + }); + console.log(value); + } catch (error) { + console.error(error); + } +})(); +``` + + +## API + +### pTry(fn, ...arguments) + +Returns a `Promise` resolved with the value of calling `fn(...arguments)`. If the function throws an error, the returned `Promise` will be rejected with that error. + +Support for passing arguments on to the `fn` is provided in order to be able to avoid creating unnecessary closures. You probably don't need this optimization unless you're pushing a *lot* of functions. + +#### fn + +The function to run to start the promise chain. + +#### arguments + +Arguments to pass to `fn`. + + +## Related + +- [p-finally](https://github.com/sindresorhus/p-finally) - `Promise#finally()` ponyfill - Invoked when the promise is settled regardless of outcome +- [More…](https://github.com/sindresorhus/promise-fun) + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/path-exists/index.js b/node_modules/path-exists/index.js new file mode 100644 index 0000000..16ae60a --- /dev/null +++ b/node_modules/path-exists/index.js @@ -0,0 +1,17 @@ +'use strict'; +const fs = require('fs'); + +module.exports = fp => new Promise(resolve => { + fs.access(fp, err => { + resolve(!err); + }); +}); + +module.exports.sync = fp => { + try { + fs.accessSync(fp); + return true; + } catch (err) { + return false; + } +}; diff --git a/node_modules/path-exists/license b/node_modules/path-exists/license new file mode 100644 index 0000000..654d0bf --- /dev/null +++ b/node_modules/path-exists/license @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/path-exists/package.json b/node_modules/path-exists/package.json new file mode 100644 index 0000000..2ac3f2f --- /dev/null +++ b/node_modules/path-exists/package.json @@ -0,0 +1,72 @@ +{ + "_from": "path-exists@^3.0.0", + "_id": "path-exists@3.0.0", + "_inBundle": false, + "_integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "_location": "/path-exists", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "path-exists@^3.0.0", + "name": "path-exists", + "escapedName": "path-exists", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/locate-path" + ], + "_resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "_shasum": "ce0ebeaa5f78cb18925ea7d810d7b59b010fd515", + "_spec": "path-exists@^3.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\locate-path", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/path-exists/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Check if a path exists", + "devDependencies": { + "ava": "*", + "xo": "*" + }, + "engines": { + "node": ">=4" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/path-exists#readme", + "keywords": [ + "path", + "exists", + "exist", + "file", + "filepath", + "fs", + "filesystem", + "file-system", + "access", + "stat" + ], + "license": "MIT", + "name": "path-exists", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/path-exists.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.0.0", + "xo": { + "esnext": true + } +} diff --git a/node_modules/path-exists/readme.md b/node_modules/path-exists/readme.md new file mode 100644 index 0000000..1b65fa7 --- /dev/null +++ b/node_modules/path-exists/readme.md @@ -0,0 +1,50 @@ +# path-exists [![Build Status](https://travis-ci.org/sindresorhus/path-exists.svg?branch=master)](https://travis-ci.org/sindresorhus/path-exists) + +> Check if a path exists + +Because [`fs.exists()`](https://nodejs.org/api/fs.html#fs_fs_exists_path_callback) is being [deprecated](https://github.com/iojs/io.js/issues/103), but there's still a genuine use-case of being able to check if a path exists for other purposes than doing IO with it. + +Never use this before handling a file though: + +> In particular, checking if a file exists before opening it is an anti-pattern that leaves you vulnerable to race conditions: another process may remove the file between the calls to `fs.exists()` and `fs.open()`. Just open the file and handle the error when it's not there. + + +## Install + +``` +$ npm install --save path-exists +``` + + +## Usage + +```js +// foo.js +const pathExists = require('path-exists'); + +pathExists('foo.js').then(exists => { + console.log(exists); + //=> true +}); +``` + + +## API + +### pathExists(path) + +Returns a promise for a boolean of whether the path exists. + +### pathExists.sync(path) + +Returns a boolean of whether the path exists. + + +## Related + +- [path-exists-cli](https://github.com/sindresorhus/path-exists-cli) - CLI for this module + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/require-directory/.jshintrc b/node_modules/require-directory/.jshintrc new file mode 100644 index 0000000..e14e4dc --- /dev/null +++ b/node_modules/require-directory/.jshintrc @@ -0,0 +1,67 @@ +{ + "maxerr" : 50, + "bitwise" : true, + "camelcase" : true, + "curly" : true, + "eqeqeq" : true, + "forin" : true, + "immed" : true, + "indent" : 2, + "latedef" : true, + "newcap" : true, + "noarg" : true, + "noempty" : true, + "nonew" : true, + "plusplus" : true, + "quotmark" : true, + "undef" : true, + "unused" : true, + "strict" : true, + "trailing" : true, + "maxparams" : false, + "maxdepth" : false, + "maxstatements" : false, + "maxcomplexity" : false, + "maxlen" : false, + "asi" : false, + "boss" : false, + "debug" : false, + "eqnull" : true, + "es5" : false, + "esnext" : false, + "moz" : false, + "evil" : false, + "expr" : true, + "funcscope" : true, + "globalstrict" : true, + "iterator" : true, + "lastsemic" : false, + "laxbreak" : false, + "laxcomma" : false, + "loopfunc" : false, + "multistr" : false, + "proto" : false, + "scripturl" : false, + "smarttabs" : false, + "shadow" : false, + "sub" : false, + "supernew" : false, + "validthis" : false, + "browser" : true, + "couch" : false, + "devel" : true, + "dojo" : false, + "jquery" : false, + "mootools" : false, + "node" : true, + "nonstandard" : false, + "prototypejs" : false, + "rhino" : false, + "worker" : false, + "wsh" : false, + "yui" : false, + "nomen" : true, + "onevar" : true, + "passfail" : false, + "white" : true +} diff --git a/node_modules/require-directory/.npmignore b/node_modules/require-directory/.npmignore new file mode 100644 index 0000000..47cf365 --- /dev/null +++ b/node_modules/require-directory/.npmignore @@ -0,0 +1 @@ +test/** diff --git a/node_modules/require-directory/.travis.yml b/node_modules/require-directory/.travis.yml new file mode 100644 index 0000000..20fd86b --- /dev/null +++ b/node_modules/require-directory/.travis.yml @@ -0,0 +1,3 @@ +language: node_js +node_js: + - 0.10 diff --git a/node_modules/require-directory/LICENSE b/node_modules/require-directory/LICENSE new file mode 100644 index 0000000..a70f253 --- /dev/null +++ b/node_modules/require-directory/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2011 Troy Goode + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/require-directory/README.markdown b/node_modules/require-directory/README.markdown new file mode 100644 index 0000000..926a063 --- /dev/null +++ b/node_modules/require-directory/README.markdown @@ -0,0 +1,184 @@ +# require-directory + +Recursively iterates over specified directory, `require()`'ing each file, and returning a nested hash structure containing those modules. + +**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)** + +[![NPM](https://nodei.co/npm/require-directory.png?downloads=true&stars=true)](https://nodei.co/npm/require-directory/) + +[![build status](https://secure.travis-ci.org/troygoode/node-require-directory.png)](http://travis-ci.org/troygoode/node-require-directory) + +## How To Use + +### Installation (via [npm](https://npmjs.org/package/require-directory)) + +```bash +$ npm install require-directory +``` + +### Usage + +A common pattern in node.js is to include an index file which creates a hash of the files in its current directory. Given a directory structure like so: + +* app.js +* routes/ + * index.js + * home.js + * auth/ + * login.js + * logout.js + * register.js + +`routes/index.js` uses `require-directory` to build the hash (rather than doing so manually) like so: + +```javascript +var requireDirectory = require('require-directory'); +module.exports = requireDirectory(module); +``` + +`app.js` references `routes/index.js` like any other module, but it now has a hash/tree of the exports from the `./routes/` directory: + +```javascript +var routes = require('./routes'); + +// snip + +app.get('/', routes.home); +app.get('/register', routes.auth.register); +app.get('/login', routes.auth.login); +app.get('/logout', routes.auth.logout); +``` + +The `routes` variable above is the equivalent of this: + +```javascript +var routes = { + home: require('routes/home.js'), + auth: { + login: require('routes/auth/login.js'), + logout: require('routes/auth/logout.js'), + register: require('routes/auth/register.js') + } +}; +``` + +*Note that `routes.index` will be `undefined` as you would hope.* + +### Specifying Another Directory + +You can specify which directory you want to build a tree of (if it isn't the current directory for whatever reason) by passing it as the second parameter. Not specifying the path (`requireDirectory(module)`) is the equivelant of `requireDirectory(module, __dirname)`: + +```javascript +var requireDirectory = require('require-directory'); +module.exports = requireDirectory(module, './some/subdirectory'); +``` + +For example, in the [example in the Usage section](#usage) we could have avoided creating `routes/index.js` and instead changed the first lines of `app.js` to: + +```javascript +var requireDirectory = require('require-directory'); +var routes = requireDirectory(module, './routes'); +``` + +## Options + +You can pass an options hash to `require-directory` as the 2nd parameter (or 3rd if you're passing the path to another directory as the 2nd parameter already). Here are the available options: + +### Whitelisting + +Whitelisting (either via RegExp or function) allows you to specify that only certain files be loaded. + +```javascript +var requireDirectory = require('require-directory'), + whitelist = /onlyinclude.js$/, + hash = requireDirectory(module, {include: whitelist}); +``` + +```javascript +var requireDirectory = require('require-directory'), + check = function(path){ + if(/onlyinclude.js$/.test(path)){ + return true; // don't include + }else{ + return false; // go ahead and include + } + }, + hash = requireDirectory(module, {include: check}); +``` + +### Blacklisting + +Blacklisting (either via RegExp or function) allows you to specify that all but certain files should be loaded. + +```javascript +var requireDirectory = require('require-directory'), + blacklist = /dontinclude\.js$/, + hash = requireDirectory(module, {exclude: blacklist}); +``` + +```javascript +var requireDirectory = require('require-directory'), + check = function(path){ + if(/dontinclude\.js$/.test(path)){ + return false; // don't include + }else{ + return true; // go ahead and include + } + }, + hash = requireDirectory(module, {exclude: check}); +``` + +### Visiting Objects As They're Loaded + +`require-directory` takes a function as the `visit` option that will be called for each module that is added to module.exports. + +```javascript +var requireDirectory = require('require-directory'), + visitor = function(obj) { + console.log(obj); // will be called for every module that is loaded + }, + hash = requireDirectory(module, {visit: visitor}); +``` + +The visitor can also transform the objects by returning a value: + +```javascript +var requireDirectory = require('require-directory'), + visitor = function(obj) { + return obj(new Date()); + }, + hash = requireDirectory(module, {visit: visitor}); +``` + +### Renaming Keys + +```javascript +var requireDirectory = require('require-directory'), + renamer = function(name) { + return name.toUpperCase(); + }, + hash = requireDirectory(module, {rename: renamer}); +``` + +### No Recursion + +```javascript +var requireDirectory = require('require-directory'), + hash = requireDirectory(module, {recurse: false}); +``` + +## Run Unit Tests + +```bash +$ npm run lint +$ npm test +``` + +## License + +[MIT License](http://www.opensource.org/licenses/mit-license.php) + +## Author + +[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com)) + diff --git a/node_modules/require-directory/index.js b/node_modules/require-directory/index.js new file mode 100644 index 0000000..cd37da7 --- /dev/null +++ b/node_modules/require-directory/index.js @@ -0,0 +1,86 @@ +'use strict'; + +var fs = require('fs'), + join = require('path').join, + resolve = require('path').resolve, + dirname = require('path').dirname, + defaultOptions = { + extensions: ['js', 'json', 'coffee'], + recurse: true, + rename: function (name) { + return name; + }, + visit: function (obj) { + return obj; + } + }; + +function checkFileInclusion(path, filename, options) { + return ( + // verify file has valid extension + (new RegExp('\\.(' + options.extensions.join('|') + ')$', 'i').test(filename)) && + + // if options.include is a RegExp, evaluate it and make sure the path passes + !(options.include && options.include instanceof RegExp && !options.include.test(path)) && + + // if options.include is a function, evaluate it and make sure the path passes + !(options.include && typeof options.include === 'function' && !options.include(path, filename)) && + + // if options.exclude is a RegExp, evaluate it and make sure the path doesn't pass + !(options.exclude && options.exclude instanceof RegExp && options.exclude.test(path)) && + + // if options.exclude is a function, evaluate it and make sure the path doesn't pass + !(options.exclude && typeof options.exclude === 'function' && options.exclude(path, filename)) + ); +} + +function requireDirectory(m, path, options) { + var retval = {}; + + // path is optional + if (path && !options && typeof path !== 'string') { + options = path; + path = null; + } + + // default options + options = options || {}; + for (var prop in defaultOptions) { + if (typeof options[prop] === 'undefined') { + options[prop] = defaultOptions[prop]; + } + } + + // if no path was passed in, assume the equivelant of __dirname from caller + // otherwise, resolve path relative to the equivalent of __dirname + path = !path ? dirname(m.filename) : resolve(dirname(m.filename), path); + + // get the path of each file in specified directory, append to current tree node, recurse + fs.readdirSync(path).forEach(function (filename) { + var joined = join(path, filename), + files, + key, + obj; + + if (fs.statSync(joined).isDirectory() && options.recurse) { + // this node is a directory; recurse + files = requireDirectory(m, joined, options); + // exclude empty directories + if (Object.keys(files).length) { + retval[options.rename(filename, joined, filename)] = files; + } + } else { + if (joined !== m.filename && checkFileInclusion(joined, filename, options)) { + // hash node key shouldn't include file extension + key = filename.substring(0, filename.lastIndexOf('.')); + obj = m.require(joined); + retval[options.rename(key, joined, filename)] = options.visit(obj, joined, filename) || obj; + } + } + }); + + return retval; +} + +module.exports = requireDirectory; +module.exports.defaults = defaultOptions; diff --git a/node_modules/require-directory/package.json b/node_modules/require-directory/package.json new file mode 100644 index 0000000..56ed30e --- /dev/null +++ b/node_modules/require-directory/package.json @@ -0,0 +1,69 @@ +{ + "_from": "require-directory@^2.1.1", + "_id": "require-directory@2.1.1", + "_inBundle": false, + "_integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=", + "_location": "/require-directory", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "require-directory@^2.1.1", + "name": "require-directory", + "escapedName": "require-directory", + "rawSpec": "^2.1.1", + "saveSpec": null, + "fetchSpec": "^2.1.1" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", + "_shasum": "8c64ad5fd30dab1c976e2344ffe7f792a6a6df42", + "_spec": "require-directory@^2.1.1", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Troy Goode", + "email": "troygoode@gmail.com", + "url": "http://github.com/troygoode/" + }, + "bugs": { + "url": "http://github.com/troygoode/node-require-directory/issues/" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Troy Goode", + "email": "troygoode@gmail.com", + "url": "http://github.com/troygoode/" + } + ], + "deprecated": false, + "description": "Recursively iterates over specified directory, require()'ing each file, and returning a nested hash structure containing those modules.", + "devDependencies": { + "jshint": "^2.6.0", + "mocha": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + }, + "homepage": "https://github.com/troygoode/node-require-directory/", + "keywords": [ + "require", + "directory", + "library", + "recursive" + ], + "license": "MIT", + "main": "index.js", + "name": "require-directory", + "repository": { + "type": "git", + "url": "git://github.com/troygoode/node-require-directory.git" + }, + "scripts": { + "lint": "jshint index.js test/test.js", + "test": "mocha" + }, + "version": "2.1.1" +} diff --git a/node_modules/require-main-filename/CHANGELOG.md b/node_modules/require-main-filename/CHANGELOG.md new file mode 100644 index 0000000..717d59e --- /dev/null +++ b/node_modules/require-main-filename/CHANGELOG.md @@ -0,0 +1,26 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + + +# [2.0.0](https://github.com/yargs/require-main-filename/compare/v1.0.2...v2.0.0) (2019-01-28) + + +### Chores + +* drop support for Node 0.10 ([#11](https://github.com/yargs/require-main-filename/issues/11)) ([87f4e13](https://github.com/yargs/require-main-filename/commit/87f4e13)) + + +### BREAKING CHANGES + +* drop support for Node 0.10/0.12 + + + + +## [1.0.2](https://github.com/yargs/require-main-filename/compare/v1.0.1...v1.0.2) (2017-06-16) + + +### Bug Fixes + +* add files to package.json ([#4](https://github.com/yargs/require-main-filename/issues/4)) ([fa29988](https://github.com/yargs/require-main-filename/commit/fa29988)) diff --git a/node_modules/require-main-filename/LICENSE.txt b/node_modules/require-main-filename/LICENSE.txt new file mode 100644 index 0000000..836440b --- /dev/null +++ b/node_modules/require-main-filename/LICENSE.txt @@ -0,0 +1,14 @@ +Copyright (c) 2016, Contributors + +Permission to use, copy, modify, and/or distribute this software +for any purpose with or without fee is hereby granted, provided +that the above copyright notice and this permission notice +appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE +LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES +OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/require-main-filename/README.md b/node_modules/require-main-filename/README.md new file mode 100644 index 0000000..820d9f5 --- /dev/null +++ b/node_modules/require-main-filename/README.md @@ -0,0 +1,26 @@ +# require-main-filename + +[![Build Status](https://travis-ci.org/yargs/require-main-filename.png)](https://travis-ci.org/yargs/require-main-filename) +[![Coverage Status](https://coveralls.io/repos/yargs/require-main-filename/badge.svg?branch=master)](https://coveralls.io/r/yargs/require-main-filename?branch=master) +[![NPM version](https://img.shields.io/npm/v/require-main-filename.svg)](https://www.npmjs.com/package/require-main-filename) + +`require.main.filename` is great for figuring out the entry +point for the current application. This can be combined with a module like +[pkg-conf](https://www.npmjs.com/package/pkg-conf) to, _as if by magic_, load +top-level configuration. + +Unfortunately, `require.main.filename` sometimes fails when an application is +executed with an alternative process manager, e.g., [iisnode](https://github.com/tjanczuk/iisnode). + +`require-main-filename` is a shim that addresses this problem. + +## Usage + +```js +var main = require('require-main-filename')() +// use main as an alternative to require.main.filename. +``` + +## License + +ISC diff --git a/node_modules/require-main-filename/index.js b/node_modules/require-main-filename/index.js new file mode 100644 index 0000000..dca7f0c --- /dev/null +++ b/node_modules/require-main-filename/index.js @@ -0,0 +1,18 @@ +module.exports = function (_require) { + _require = _require || require + var main = _require.main + if (main && isIISNode(main)) return handleIISNode(main) + else return main ? main.filename : process.cwd() +} + +function isIISNode (main) { + return /\\iisnode\\/.test(main.filename) +} + +function handleIISNode (main) { + if (!main.children.length) { + return main.filename + } else { + return main.children[0].filename + } +} diff --git a/node_modules/require-main-filename/package.json b/node_modules/require-main-filename/package.json new file mode 100644 index 0000000..07eed5e --- /dev/null +++ b/node_modules/require-main-filename/package.json @@ -0,0 +1,63 @@ +{ + "_from": "require-main-filename@^2.0.0", + "_id": "require-main-filename@2.0.0", + "_inBundle": false, + "_integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", + "_location": "/require-main-filename", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "require-main-filename@^2.0.0", + "name": "require-main-filename", + "escapedName": "require-main-filename", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "_shasum": "d0b329ecc7cc0f61649f62215be69af54aa8989b", + "_spec": "require-main-filename@^2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Ben Coe", + "email": "ben@npmjs.com" + }, + "bugs": { + "url": "https://github.com/yargs/require-main-filename/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "shim for require.main.filename() that works in as many environments as possible", + "devDependencies": { + "chai": "^4.0.0", + "standard": "^10.0.3", + "standard-version": "^4.0.0", + "tap": "^11.0.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/yargs/require-main-filename#readme", + "keywords": [ + "require", + "shim", + "iisnode" + ], + "license": "ISC", + "main": "index.js", + "name": "require-main-filename", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/yargs/require-main-filename.git" + }, + "scripts": { + "pretest": "standard", + "release": "standard-version", + "test": "tap --coverage test.js" + }, + "version": "2.0.0" +} diff --git a/node_modules/set-blocking/CHANGELOG.md b/node_modules/set-blocking/CHANGELOG.md new file mode 100644 index 0000000..03bf591 --- /dev/null +++ b/node_modules/set-blocking/CHANGELOG.md @@ -0,0 +1,26 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + + +# [2.0.0](https://github.com/yargs/set-blocking/compare/v1.0.0...v2.0.0) (2016-05-17) + + +### Features + +* add an isTTY check ([#3](https://github.com/yargs/set-blocking/issues/3)) ([66ce277](https://github.com/yargs/set-blocking/commit/66ce277)) + + +### BREAKING CHANGES + +* stdio/stderr will not be set to blocking if isTTY === false + + + + +# 1.0.0 (2016-05-14) + + +### Features + +* implemented shim for stream._handle.setBlocking ([6bde0c0](https://github.com/yargs/set-blocking/commit/6bde0c0)) diff --git a/node_modules/set-blocking/LICENSE.txt b/node_modules/set-blocking/LICENSE.txt new file mode 100644 index 0000000..836440b --- /dev/null +++ b/node_modules/set-blocking/LICENSE.txt @@ -0,0 +1,14 @@ +Copyright (c) 2016, Contributors + +Permission to use, copy, modify, and/or distribute this software +for any purpose with or without fee is hereby granted, provided +that the above copyright notice and this permission notice +appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE +LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES +OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/set-blocking/README.md b/node_modules/set-blocking/README.md new file mode 100644 index 0000000..e93b420 --- /dev/null +++ b/node_modules/set-blocking/README.md @@ -0,0 +1,31 @@ +# set-blocking + +[![Build Status](https://travis-ci.org/yargs/set-blocking.svg)](https://travis-ci.org/yargs/set-blocking) +[![NPM version](https://img.shields.io/npm/v/set-blocking.svg)](https://www.npmjs.com/package/set-blocking) +[![Coverage Status](https://coveralls.io/repos/yargs/set-blocking/badge.svg?branch=)](https://coveralls.io/r/yargs/set-blocking?branch=master) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) + +set blocking `stdio` and `stderr` ensuring that terminal output does not truncate. + +```js +const setBlocking = require('set-blocking') +setBlocking(true) +console.log(someLargeStringToOutput) +``` + +## Historical Context/Word of Warning + +This was created as a shim to address the bug discussed in [node #6456](https://github.com/nodejs/node/issues/6456). This bug crops up on +newer versions of Node.js (`0.12+`), truncating terminal output. + +You should be mindful of the side-effects caused by using `set-blocking`: + +* if your module sets blocking to `true`, it will effect other modules + consuming your library. In [yargs](https://github.com/yargs/yargs/blob/master/yargs.js#L653) we only call + `setBlocking(true)` once we already know we are about to call `process.exit(code)`. +* this patch will not apply to subprocesses spawned with `isTTY = true`, this is + the [default `spawn()` behavior](https://nodejs.org/api/child_process.html#child_process_child_process_spawn_command_args_options). + +## License + +ISC diff --git a/node_modules/set-blocking/index.js b/node_modules/set-blocking/index.js new file mode 100644 index 0000000..6f78774 --- /dev/null +++ b/node_modules/set-blocking/index.js @@ -0,0 +1,7 @@ +module.exports = function (blocking) { + [process.stdout, process.stderr].forEach(function (stream) { + if (stream._handle && stream.isTTY && typeof stream._handle.setBlocking === 'function') { + stream._handle.setBlocking(blocking) + } + }) +} diff --git a/node_modules/set-blocking/package.json b/node_modules/set-blocking/package.json new file mode 100644 index 0000000..4bd1478 --- /dev/null +++ b/node_modules/set-blocking/package.json @@ -0,0 +1,70 @@ +{ + "_from": "set-blocking@^2.0.0", + "_id": "set-blocking@2.0.0", + "_inBundle": false, + "_integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=", + "_location": "/set-blocking", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "set-blocking@^2.0.0", + "name": "set-blocking", + "escapedName": "set-blocking", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "_shasum": "045f9782d011ae9a6803ddd382b24392b3d890f7", + "_spec": "set-blocking@^2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Ben Coe", + "email": "ben@npmjs.com" + }, + "bugs": { + "url": "https://github.com/yargs/set-blocking/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "set blocking stdio and stderr ensuring that terminal output does not truncate", + "devDependencies": { + "chai": "^3.5.0", + "coveralls": "^2.11.9", + "mocha": "^2.4.5", + "nyc": "^6.4.4", + "standard": "^7.0.1", + "standard-version": "^2.2.1" + }, + "files": [ + "index.js", + "LICENSE.txt" + ], + "homepage": "https://github.com/yargs/set-blocking#readme", + "keywords": [ + "flush", + "terminal", + "blocking", + "shim", + "stdio", + "stderr" + ], + "license": "ISC", + "main": "index.js", + "name": "set-blocking", + "repository": { + "type": "git", + "url": "git+https://github.com/yargs/set-blocking.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "pretest": "standard", + "test": "nyc mocha ./test/*.js", + "version": "standard-version" + }, + "version": "2.0.0" +} diff --git a/node_modules/string-width/index.js b/node_modules/string-width/index.js new file mode 100644 index 0000000..33c9d6c --- /dev/null +++ b/node_modules/string-width/index.js @@ -0,0 +1,39 @@ +'use strict'; +const stripAnsi = require('strip-ansi'); +const isFullwidthCodePoint = require('is-fullwidth-code-point'); +const emojiRegex = require('emoji-regex')(); + +module.exports = input => { + input = input.replace(emojiRegex, ' '); + + if (typeof input !== 'string' || input.length === 0) { + return 0; + } + + input = stripAnsi(input); + + let width = 0; + + for (let i = 0; i < input.length; i++) { + const code = input.codePointAt(i); + + // Ignore control characters + if (code <= 0x1F || (code >= 0x7F && code <= 0x9F)) { + continue; + } + + // Ignore combining characters + if (code >= 0x300 && code <= 0x36F) { + continue; + } + + // Surrogates + if (code > 0xFFFF) { + i++; + } + + width += isFullwidthCodePoint(code) ? 2 : 1; + } + + return width; +}; diff --git a/node_modules/string-width/license b/node_modules/string-width/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/string-width/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/string-width/package.json b/node_modules/string-width/package.json new file mode 100644 index 0000000..d7ee082 --- /dev/null +++ b/node_modules/string-width/package.json @@ -0,0 +1,90 @@ +{ + "_from": "string-width@^3.0.0", + "_id": "string-width@3.1.0", + "_inBundle": false, + "_integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "_location": "/string-width", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "string-width@^3.0.0", + "name": "string-width", + "escapedName": "string-width", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/cliui", + "/wrap-ansi", + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "_shasum": "22767be21b62af1081574306f69ac51b62203961", + "_spec": "string-width@^3.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/string-width/issues" + }, + "bundleDependencies": false, + "dependencies": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + }, + "deprecated": false, + "description": "Get the visual width of a string - the number of columns required to display it", + "devDependencies": { + "ava": "^1.0.1", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/string-width#readme", + "keywords": [ + "string", + "str", + "character", + "char", + "unicode", + "width", + "visual", + "column", + "columns", + "fullwidth", + "full-width", + "full", + "ansi", + "escape", + "codes", + "cli", + "command-line", + "terminal", + "console", + "cjk", + "chinese", + "japanese", + "korean", + "fixed-width" + ], + "license": "MIT", + "name": "string-width", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/string-width.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.1.0" +} diff --git a/node_modules/string-width/readme.md b/node_modules/string-width/readme.md new file mode 100644 index 0000000..d39d95f --- /dev/null +++ b/node_modules/string-width/readme.md @@ -0,0 +1,45 @@ +# string-width [![Build Status](https://travis-ci.org/sindresorhus/string-width.svg?branch=master)](https://travis-ci.org/sindresorhus/string-width) + +> Get the visual width of a string - the number of columns required to display it + +Some Unicode characters are [fullwidth](https://en.wikipedia.org/wiki/Halfwidth_and_fullwidth_forms) and use double the normal width. [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) are stripped and doesn't affect the width. + +Useful to be able to measure the actual width of command-line output. + + +## Install + +``` +$ npm install string-width +``` + + +## Usage + +```js +const stringWidth = require('string-width'); + +stringWidth('古'); +//=> 2 + +stringWidth('\u001b[1m古\u001b[22m'); +//=> 2 + +stringWidth('a'); +//=> 1 + +stringWidth('\u001B]8;;https://github.com\u0007Click\u001B]8;;\u0007'); +// => 5 +``` + + +## Related + +- [string-width-cli](https://github.com/sindresorhus/string-width-cli) - CLI for this module +- [string-length](https://github.com/sindresorhus/string-length) - Get the real length of a string +- [widest-line](https://github.com/sindresorhus/widest-line) - Get the visual width of the widest line in a string + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/node_modules/strip-ansi/index.d.ts b/node_modules/strip-ansi/index.d.ts new file mode 100644 index 0000000..44e954d --- /dev/null +++ b/node_modules/strip-ansi/index.d.ts @@ -0,0 +1,15 @@ +/** +Strip [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) from a string. + +@example +``` +import stripAnsi from 'strip-ansi'; + +stripAnsi('\u001B[4mUnicorn\u001B[0m'); +//=> 'Unicorn' + +stripAnsi('\u001B]8;;https://github.com\u0007Click\u001B]8;;\u0007'); +//=> 'Click' +``` +*/ +export default function stripAnsi(string: string): string; diff --git a/node_modules/strip-ansi/index.js b/node_modules/strip-ansi/index.js new file mode 100644 index 0000000..9788c96 --- /dev/null +++ b/node_modules/strip-ansi/index.js @@ -0,0 +1,7 @@ +'use strict'; +const ansiRegex = require('ansi-regex'); + +const stripAnsi = string => typeof string === 'string' ? string.replace(ansiRegex(), '') : string; + +module.exports = stripAnsi; +module.exports.default = stripAnsi; diff --git a/node_modules/strip-ansi/license b/node_modules/strip-ansi/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/strip-ansi/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/strip-ansi/package.json b/node_modules/strip-ansi/package.json new file mode 100644 index 0000000..663da04 --- /dev/null +++ b/node_modules/strip-ansi/package.json @@ -0,0 +1,88 @@ +{ + "_from": "strip-ansi@^5.2.0", + "_id": "strip-ansi@5.2.0", + "_inBundle": false, + "_integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "_location": "/strip-ansi", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "strip-ansi@^5.2.0", + "name": "strip-ansi", + "escapedName": "strip-ansi", + "rawSpec": "^5.2.0", + "saveSpec": null, + "fetchSpec": "^5.2.0" + }, + "_requiredBy": [ + "/cliui", + "/string-width", + "/wrap-ansi" + ], + "_resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "_shasum": "8c9a536feb6afc962bdfa5b104a5091c1ad9c0ae", + "_spec": "strip-ansi@^5.2.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\cliui", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/strip-ansi/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-regex": "^4.1.0" + }, + "deprecated": false, + "description": "Strip ANSI escape codes from a string", + "devDependencies": { + "ava": "^1.3.1", + "tsd-check": "^0.5.0", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/chalk/strip-ansi#readme", + "keywords": [ + "strip", + "trim", + "remove", + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "name": "strip-ansi", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/strip-ansi.git" + }, + "scripts": { + "test": "xo && ava && tsd-check" + }, + "version": "5.2.0" +} diff --git a/node_modules/strip-ansi/readme.md b/node_modules/strip-ansi/readme.md new file mode 100644 index 0000000..8681fe8 --- /dev/null +++ b/node_modules/strip-ansi/readme.md @@ -0,0 +1,61 @@ +# strip-ansi [![Build Status](https://travis-ci.org/chalk/strip-ansi.svg?branch=master)](https://travis-ci.org/chalk/strip-ansi) + +> Strip [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) from a string + +--- + +
+ + Get professional support for 'strip-ansi' with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+ +--- + +## Install + +``` +$ npm install strip-ansi +``` + + +## Usage + +```js +const stripAnsi = require('strip-ansi'); + +stripAnsi('\u001B[4mUnicorn\u001B[0m'); +//=> 'Unicorn' + +stripAnsi('\u001B]8;;https://github.com\u0007Click\u001B]8;;\u0007'); +//=> 'Click' +``` + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## Related + +- [strip-ansi-cli](https://github.com/chalk/strip-ansi-cli) - CLI for this module +- [strip-ansi-stream](https://github.com/chalk/strip-ansi-stream) - Streaming version of this module +- [has-ansi](https://github.com/chalk/has-ansi) - Check if a string has ANSI escape codes +- [ansi-regex](https://github.com/chalk/ansi-regex) - Regular expression for matching ANSI escape codes +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +## License + +MIT diff --git a/node_modules/which-module/CHANGELOG.md b/node_modules/which-module/CHANGELOG.md new file mode 100644 index 0000000..863d469 --- /dev/null +++ b/node_modules/which-module/CHANGELOG.md @@ -0,0 +1,26 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + + +# [2.0.0](https://github.com/nexdrew/which-module/compare/v1.0.0...v2.0.0) (2017-05-01) + + +### Features + +* remove Node < 4 from official testing/support ([#22](https://github.com/nexdrew/which-module/issues/22)) ([ee7aff4](https://github.com/nexdrew/which-module/commit/ee7aff4)) + + +### BREAKING CHANGES + +* Node 0.10 or 0.12 no longer supported, please update to Node 4+ or use which-module@1.0.0 + + + + +# 1.0.0 (2016-06-06) + + +### Features + +* initial code ([08074cd](https://github.com/nexdrew/which-module/commit/08074cd)) diff --git a/node_modules/which-module/LICENSE b/node_modules/which-module/LICENSE new file mode 100644 index 0000000..ab601b6 --- /dev/null +++ b/node_modules/which-module/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2016, Contributors + +Permission to use, copy, modify, and/or distribute this software for any purpose +with or without fee is hereby granted, provided that the above copyright notice +and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS +OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF +THIS SOFTWARE. diff --git a/node_modules/which-module/README.md b/node_modules/which-module/README.md new file mode 100644 index 0000000..a8c4bf8 --- /dev/null +++ b/node_modules/which-module/README.md @@ -0,0 +1,55 @@ +# which-module + +> Find the module object for something that was require()d + +[![Build Status](https://travis-ci.org/nexdrew/which-module.svg?branch=master)](https://travis-ci.org/nexdrew/which-module) +[![Coverage Status](https://coveralls.io/repos/github/nexdrew/which-module/badge.svg?branch=master)](https://coveralls.io/github/nexdrew/which-module?branch=master) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) + +Find the `module` object in `require.cache` for something that was `require()`d +or `import`ed - essentially a reverse `require()` lookup. + +Useful for libs that want to e.g. lookup a filename for a module or submodule +that it did not `require()` itself. + +## Install and Usage + +``` +npm install --save which-module +``` + +```js +const whichModule = require('which-module') + +console.log(whichModule(require('something'))) +// Module { +// id: '/path/to/project/node_modules/something/index.js', +// exports: [Function], +// parent: ..., +// filename: '/path/to/project/node_modules/something/index.js', +// loaded: true, +// children: [], +// paths: [ '/path/to/project/node_modules/something/node_modules', +// '/path/to/project/node_modules', +// '/path/to/node_modules', +// '/path/node_modules', +// '/node_modules' ] } +``` + +## API + +### `whichModule(exported)` + +Return the [`module` object](https://nodejs.org/api/modules.html#modules_the_module_object), +if any, that represents the given argument in the `require.cache`. + +`exported` can be anything that was previously `require()`d or `import`ed as a +module, submodule, or dependency - which means `exported` is identical to the +`module.exports` returned by this method. + +If `exported` did not come from the `exports` of a `module` in `require.cache`, +then this method returns `null`. + +## License + +ISC © Contributors diff --git a/node_modules/which-module/index.js b/node_modules/which-module/index.js new file mode 100644 index 0000000..45559b7 --- /dev/null +++ b/node_modules/which-module/index.js @@ -0,0 +1,9 @@ +'use strict' + +module.exports = function whichModule (exported) { + for (var i = 0, files = Object.keys(require.cache), mod; i < files.length; i++) { + mod = require.cache[files[i]] + if (mod.exports === exported) return mod + } + return null +} diff --git a/node_modules/which-module/package.json b/node_modules/which-module/package.json new file mode 100644 index 0000000..3954390 --- /dev/null +++ b/node_modules/which-module/package.json @@ -0,0 +1,68 @@ +{ + "_from": "which-module@^2.0.0", + "_id": "which-module@2.0.0", + "_inBundle": false, + "_integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=", + "_location": "/which-module", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "which-module@^2.0.0", + "name": "which-module", + "escapedName": "which-module", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", + "_shasum": "d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a", + "_spec": "which-module@^2.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "nexdrew" + }, + "bugs": { + "url": "https://github.com/nexdrew/which-module/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Find the module object for something that was require()d", + "devDependencies": { + "ava": "^0.19.1", + "coveralls": "^2.13.1", + "nyc": "^10.3.0", + "standard": "^10.0.2", + "standard-version": "^4.0.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/nexdrew/which-module#readme", + "keywords": [ + "which", + "module", + "exports", + "filename", + "require", + "reverse", + "lookup" + ], + "license": "ISC", + "main": "index.js", + "name": "which-module", + "repository": { + "type": "git", + "url": "git+https://github.com/nexdrew/which-module.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "pretest": "standard", + "release": "standard-version", + "test": "nyc ava" + }, + "version": "2.0.0" +} diff --git a/node_modules/wrap-ansi/index.js b/node_modules/wrap-ansi/index.js new file mode 100644 index 0000000..5038bb0 --- /dev/null +++ b/node_modules/wrap-ansi/index.js @@ -0,0 +1,188 @@ +'use strict'; +const stringWidth = require('string-width'); +const stripAnsi = require('strip-ansi'); +const ansiStyles = require('ansi-styles'); + +const ESCAPES = new Set([ + '\u001B', + '\u009B' +]); + +const END_CODE = 39; + +const wrapAnsi = code => `${ESCAPES.values().next().value}[${code}m`; + +// Calculate the length of words split on ' ', ignoring +// the extra characters added by ansi escape codes +const wordLengths = string => string.split(' ').map(character => stringWidth(character)); + +// Wrap a long word across multiple rows +// Ansi escape codes do not count towards length +const wrapWord = (rows, word, columns) => { + const characters = [...word]; + + let insideEscape = false; + let visible = stringWidth(stripAnsi(rows[rows.length - 1])); + + for (const [index, character] of characters.entries()) { + const characterLength = stringWidth(character); + + if (visible + characterLength <= columns) { + rows[rows.length - 1] += character; + } else { + rows.push(character); + visible = 0; + } + + if (ESCAPES.has(character)) { + insideEscape = true; + } else if (insideEscape && character === 'm') { + insideEscape = false; + continue; + } + + if (insideEscape) { + continue; + } + + visible += characterLength; + + if (visible === columns && index < characters.length - 1) { + rows.push(''); + visible = 0; + } + } + + // It's possible that the last row we copy over is only + // ansi escape characters, handle this edge-case + if (!visible && rows[rows.length - 1].length > 0 && rows.length > 1) { + rows[rows.length - 2] += rows.pop(); + } +}; + +// Trims spaces from a string ignoring invisible sequences +const stringVisibleTrimSpacesRight = str => { + const words = str.split(' '); + let last = words.length; + + while (last > 0) { + if (stringWidth(words[last - 1]) > 0) { + break; + } + + last--; + } + + if (last === words.length) { + return str; + } + + return words.slice(0, last).join(' ') + words.slice(last).join(''); +}; + +// The wrap-ansi module can be invoked +// in either 'hard' or 'soft' wrap mode +// +// 'hard' will never allow a string to take up more +// than columns characters +// +// 'soft' allows long words to expand past the column length +const exec = (string, columns, options = {}) => { + if (options.trim !== false && string.trim() === '') { + return ''; + } + + let pre = ''; + let ret = ''; + let escapeCode; + + const lengths = wordLengths(string); + let rows = ['']; + + for (const [index, word] of string.split(' ').entries()) { + if (options.trim !== false) { + rows[rows.length - 1] = rows[rows.length - 1].trimLeft(); + } + + let rowLength = stringWidth(rows[rows.length - 1]); + + if (index !== 0) { + if (rowLength >= columns && (options.wordWrap === false || options.trim === false)) { + // If we start with a new word but the current row length equals the length of the columns, add a new row + rows.push(''); + rowLength = 0; + } + + if (rowLength > 0 || options.trim === false) { + rows[rows.length - 1] += ' '; + rowLength++; + } + } + + // In 'hard' wrap mode, the length of a line is + // never allowed to extend past 'columns' + if (options.hard && lengths[index] > columns) { + const remainingColumns = (columns - rowLength); + const breaksStartingThisLine = 1 + Math.floor((lengths[index] - remainingColumns - 1) / columns); + const breaksStartingNextLine = Math.floor((lengths[index] - 1) / columns); + if (breaksStartingNextLine < breaksStartingThisLine) { + rows.push(''); + } + + wrapWord(rows, word, columns); + continue; + } + + if (rowLength + lengths[index] > columns && rowLength > 0 && lengths[index] > 0) { + if (options.wordWrap === false && rowLength < columns) { + wrapWord(rows, word, columns); + continue; + } + + rows.push(''); + } + + if (rowLength + lengths[index] > columns && options.wordWrap === false) { + wrapWord(rows, word, columns); + continue; + } + + rows[rows.length - 1] += word; + } + + if (options.trim !== false) { + rows = rows.map(stringVisibleTrimSpacesRight); + } + + pre = rows.join('\n'); + + for (const [index, character] of [...pre].entries()) { + ret += character; + + if (ESCAPES.has(character)) { + const code = parseFloat(/\d[^m]*/.exec(pre.slice(index, index + 4))); + escapeCode = code === END_CODE ? null : code; + } + + const code = ansiStyles.codes.get(Number(escapeCode)); + + if (escapeCode && code) { + if (pre[index + 1] === '\n') { + ret += wrapAnsi(code); + } else if (character === '\n') { + ret += wrapAnsi(escapeCode); + } + } + } + + return ret; +}; + +// For each newline, invoke the method separately +module.exports = (string, columns, options) => { + return String(string) + .normalize() + .split('\n') + .map(line => exec(line, columns, options)) + .join('\n'); +}; diff --git a/node_modules/wrap-ansi/license b/node_modules/wrap-ansi/license new file mode 100644 index 0000000..e7af2f7 --- /dev/null +++ b/node_modules/wrap-ansi/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/wrap-ansi/package.json b/node_modules/wrap-ansi/package.json new file mode 100644 index 0000000..63c1056 --- /dev/null +++ b/node_modules/wrap-ansi/package.json @@ -0,0 +1,93 @@ +{ + "_from": "wrap-ansi@^5.1.0", + "_id": "wrap-ansi@5.1.0", + "_inBundle": false, + "_integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==", + "_location": "/wrap-ansi", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "wrap-ansi@^5.1.0", + "name": "wrap-ansi", + "escapedName": "wrap-ansi", + "rawSpec": "^5.1.0", + "saveSpec": null, + "fetchSpec": "^5.1.0" + }, + "_requiredBy": [ + "/cliui" + ], + "_resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", + "_shasum": "1fd1f67235d5b6d0fee781056001bfb694c03b09", + "_spec": "wrap-ansi@^5.1.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\cliui", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/wrap-ansi/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-styles": "^3.2.0", + "string-width": "^3.0.0", + "strip-ansi": "^5.0.0" + }, + "deprecated": false, + "description": "Wordwrap a string with ANSI escape codes", + "devDependencies": { + "ava": "^1.2.1", + "chalk": "^2.4.2", + "coveralls": "^3.0.3", + "has-ansi": "^3.0.0", + "nyc": "^13.3.0", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/chalk/wrap-ansi#readme", + "keywords": [ + "wrap", + "break", + "wordwrap", + "wordbreak", + "linewrap", + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "name": "wrap-ansi", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/wrap-ansi.git" + }, + "scripts": { + "test": "xo && nyc ava" + }, + "version": "5.1.0" +} diff --git a/node_modules/wrap-ansi/readme.md b/node_modules/wrap-ansi/readme.md new file mode 100644 index 0000000..73b87de --- /dev/null +++ b/node_modules/wrap-ansi/readme.md @@ -0,0 +1,108 @@ +# wrap-ansi [![Build Status](https://travis-ci.org/chalk/wrap-ansi.svg?branch=master)](https://travis-ci.org/chalk/wrap-ansi) [![Coverage Status](https://coveralls.io/repos/github/chalk/wrap-ansi/badge.svg?branch=master)](https://coveralls.io/github/chalk/wrap-ansi?branch=master) + +> Wordwrap a string with [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) + + +## Install + +``` +$ npm install wrap-ansi +``` + + +## Usage + +```js +const chalk = require('chalk'); +const wrapAnsi = require('wrap-ansi'); + +const input = 'The quick brown ' + chalk.red('fox jumped over ') + + 'the lazy ' + chalk.green('dog and then ran away with the unicorn.'); + +console.log(wrapAnsi(input, 20)); +``` + + + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+ +--- + + +## API + +### wrapAnsi(input, columns, [options]) + +Wrap words to the specified column width. + +#### input + +Type: `string` + +String with ANSI escape codes. Like one styled by [`chalk`](https://github.com/chalk/chalk). + +#### columns + +Type: `number` + +Number of columns to wrap the text to. + +#### options + +Type: `Object` + +##### hard + +Type: `boolean`
+Default: `false` + +By default the wrap is soft, meaning long words may extend past the column width. Setting this to `true` will make it hard wrap at the column width. + +##### wordWrap + +Type: `boolean`
+Default: `true` + +By default, an attempt is made to split words at spaces, ensuring that they don't extend past the configured columns. If wordWrap is `false`, each column will instead be completely filled splitting words as necessary. + +##### trim + +Type: `boolean`
+Default: `true` + +Whitespace on all lines is removed by default. Set this option to `false` if you don't want to trim. + + +## Related + +- [slice-ansi](https://github.com/chalk/slice-ansi) - Slice a string with ANSI escape codes +- [cli-truncate](https://github.com/sindresorhus/cli-truncate) - Truncate a string to a specific width in the terminal +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right +- [jsesc](https://github.com/mathiasbynens/jsesc) - Generate ASCII-only output from Unicode strings. Useful for creating test fixtures. + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) +- [Benjamin Coe](https://github.com/bcoe) + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## License + +MIT diff --git a/node_modules/y18n/CHANGELOG.md b/node_modules/y18n/CHANGELOG.md new file mode 100644 index 0000000..c259076 --- /dev/null +++ b/node_modules/y18n/CHANGELOG.md @@ -0,0 +1,21 @@ +# Change Log + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + + +# [4.0.0](https://github.com/yargs/y18n/compare/v3.2.1...v4.0.0) (2017-10-10) + + +### Bug Fixes + +* allow support for falsy values like 0 in tagged literal ([#45](https://github.com/yargs/y18n/issues/45)) ([c926123](https://github.com/yargs/y18n/commit/c926123)) + + +### Features + +* **__:** added tagged template literal support ([#44](https://github.com/yargs/y18n/issues/44)) ([0598daf](https://github.com/yargs/y18n/commit/0598daf)) + + +### BREAKING CHANGES + +* **__:** dropping Node 0.10/Node 0.12 support diff --git a/node_modules/y18n/LICENSE b/node_modules/y18n/LICENSE new file mode 100644 index 0000000..3c157f0 --- /dev/null +++ b/node_modules/y18n/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2015, Contributors + +Permission to use, copy, modify, and/or distribute this software for any purpose +with or without fee is hereby granted, provided that the above copyright notice +and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS +OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF +THIS SOFTWARE. diff --git a/node_modules/y18n/README.md b/node_modules/y18n/README.md new file mode 100644 index 0000000..826474f --- /dev/null +++ b/node_modules/y18n/README.md @@ -0,0 +1,109 @@ +# y18n + +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] +[![NPM version][npm-image]][npm-url] +[![js-standard-style][standard-image]][standard-url] +[![Conventional Commits](https://img.shields.io/badge/Conventional%20Commits-1.0.0-yellow.svg)](https://conventionalcommits.org) + +The bare-bones internationalization library used by yargs. + +Inspired by [i18n](https://www.npmjs.com/package/i18n). + +## Examples + +_simple string translation:_ + +```js +var __ = require('y18n').__ + +console.log(__('my awesome string %s', 'foo')) +``` + +output: + +`my awesome string foo` + +_using tagged template literals_ + +```js +var __ = require('y18n').__ +var str = 'foo' + +console.log(__`my awesome string ${str}`) +``` + +output: + +`my awesome string foo` + +_pluralization support:_ + +```js +var __n = require('y18n').__n + +console.log(__n('one fish %s', '%d fishes %s', 2, 'foo')) +``` + +output: + +`2 fishes foo` + +## JSON Language Files + +The JSON language files should be stored in a `./locales` folder. +File names correspond to locales, e.g., `en.json`, `pirate.json`. + +When strings are observed for the first time they will be +added to the JSON file corresponding to the current locale. + +## Methods + +### require('y18n')(config) + +Create an instance of y18n with the config provided, options include: + +* `directory`: the locale directory, default `./locales`. +* `updateFiles`: should newly observed strings be updated in file, default `true`. +* `locale`: what locale should be used. +* `fallbackToLanguage`: should fallback to a language-only file (e.g. `en.json`) + be allowed if a file matching the locale does not exist (e.g. `en_US.json`), + default `true`. + +### y18n.\_\_(str, arg, arg, arg) + +Print a localized string, `%s` will be replaced with `arg`s. + +This function can also be used as a tag for a template literal. You can use it +like this: __`hello ${'world'}`. This will be equivalent to +`__('hello %s', 'world')`. + +### y18n.\_\_n(singularString, pluralString, count, arg, arg, arg) + +Print a localized string with appropriate pluralization. If `%d` is provided +in the string, the `count` will replace this placeholder. + +### y18n.setLocale(str) + +Set the current locale being used. + +### y18n.getLocale() + +What locale is currently being used? + +### y18n.updateLocale(obj) + +Update the current locale with the key value pairs in `obj`. + +## License + +ISC + +[travis-url]: https://travis-ci.org/yargs/y18n +[travis-image]: https://img.shields.io/travis/yargs/y18n.svg +[coveralls-url]: https://coveralls.io/github/yargs/y18n +[coveralls-image]: https://img.shields.io/coveralls/yargs/y18n.svg +[npm-url]: https://npmjs.org/package/y18n +[npm-image]: https://img.shields.io/npm/v/y18n.svg +[standard-image]: https://img.shields.io/badge/code%20style-standard-brightgreen.svg +[standard-url]: https://github.com/feross/standard diff --git a/node_modules/y18n/index.js b/node_modules/y18n/index.js new file mode 100644 index 0000000..d720681 --- /dev/null +++ b/node_modules/y18n/index.js @@ -0,0 +1,188 @@ +var fs = require('fs') +var path = require('path') +var util = require('util') + +function Y18N (opts) { + // configurable options. + opts = opts || {} + this.directory = opts.directory || './locales' + this.updateFiles = typeof opts.updateFiles === 'boolean' ? opts.updateFiles : true + this.locale = opts.locale || 'en' + this.fallbackToLanguage = typeof opts.fallbackToLanguage === 'boolean' ? opts.fallbackToLanguage : true + + // internal stuff. + this.cache = {} + this.writeQueue = [] +} + +Y18N.prototype.__ = function () { + if (typeof arguments[0] !== 'string') { + return this._taggedLiteral.apply(this, arguments) + } + var args = Array.prototype.slice.call(arguments) + var str = args.shift() + var cb = function () {} // start with noop. + + if (typeof args[args.length - 1] === 'function') cb = args.pop() + cb = cb || function () {} // noop. + + if (!this.cache[this.locale]) this._readLocaleFile() + + // we've observed a new string, update the language file. + if (!this.cache[this.locale][str] && this.updateFiles) { + this.cache[this.locale][str] = str + + // include the current directory and locale, + // since these values could change before the + // write is performed. + this._enqueueWrite([this.directory, this.locale, cb]) + } else { + cb() + } + + return util.format.apply(util, [this.cache[this.locale][str] || str].concat(args)) +} + +Y18N.prototype._taggedLiteral = function (parts) { + var args = arguments + var str = '' + parts.forEach(function (part, i) { + var arg = args[i + 1] + str += part + if (typeof arg !== 'undefined') { + str += '%s' + } + }) + return this.__.apply(null, [str].concat([].slice.call(arguments, 1))) +} + +Y18N.prototype._enqueueWrite = function (work) { + this.writeQueue.push(work) + if (this.writeQueue.length === 1) this._processWriteQueue() +} + +Y18N.prototype._processWriteQueue = function () { + var _this = this + var work = this.writeQueue[0] + + // destructure the enqueued work. + var directory = work[0] + var locale = work[1] + var cb = work[2] + + var languageFile = this._resolveLocaleFile(directory, locale) + var serializedLocale = JSON.stringify(this.cache[locale], null, 2) + + fs.writeFile(languageFile, serializedLocale, 'utf-8', function (err) { + _this.writeQueue.shift() + if (_this.writeQueue.length > 0) _this._processWriteQueue() + cb(err) + }) +} + +Y18N.prototype._readLocaleFile = function () { + var localeLookup = {} + var languageFile = this._resolveLocaleFile(this.directory, this.locale) + + try { + localeLookup = JSON.parse(fs.readFileSync(languageFile, 'utf-8')) + } catch (err) { + if (err instanceof SyntaxError) { + err.message = 'syntax error in ' + languageFile + } + + if (err.code === 'ENOENT') localeLookup = {} + else throw err + } + + this.cache[this.locale] = localeLookup +} + +Y18N.prototype._resolveLocaleFile = function (directory, locale) { + var file = path.resolve(directory, './', locale + '.json') + if (this.fallbackToLanguage && !this._fileExistsSync(file) && ~locale.lastIndexOf('_')) { + // attempt fallback to language only + var languageFile = path.resolve(directory, './', locale.split('_')[0] + '.json') + if (this._fileExistsSync(languageFile)) file = languageFile + } + return file +} + +// this only exists because fs.existsSync() "will be deprecated" +// see https://nodejs.org/api/fs.html#fs_fs_existssync_path +Y18N.prototype._fileExistsSync = function (file) { + try { + return fs.statSync(file).isFile() + } catch (err) { + return false + } +} + +Y18N.prototype.__n = function () { + var args = Array.prototype.slice.call(arguments) + var singular = args.shift() + var plural = args.shift() + var quantity = args.shift() + + var cb = function () {} // start with noop. + if (typeof args[args.length - 1] === 'function') cb = args.pop() + + if (!this.cache[this.locale]) this._readLocaleFile() + + var str = quantity === 1 ? singular : plural + if (this.cache[this.locale][singular]) { + str = this.cache[this.locale][singular][quantity === 1 ? 'one' : 'other'] + } + + // we've observed a new string, update the language file. + if (!this.cache[this.locale][singular] && this.updateFiles) { + this.cache[this.locale][singular] = { + one: singular, + other: plural + } + + // include the current directory and locale, + // since these values could change before the + // write is performed. + this._enqueueWrite([this.directory, this.locale, cb]) + } else { + cb() + } + + // if a %d placeholder is provided, add quantity + // to the arguments expanded by util.format. + var values = [str] + if (~str.indexOf('%d')) values.push(quantity) + + return util.format.apply(util, values.concat(args)) +} + +Y18N.prototype.setLocale = function (locale) { + this.locale = locale +} + +Y18N.prototype.getLocale = function () { + return this.locale +} + +Y18N.prototype.updateLocale = function (obj) { + if (!this.cache[this.locale]) this._readLocaleFile() + + for (var key in obj) { + this.cache[this.locale][key] = obj[key] + } +} + +module.exports = function (opts) { + var y18n = new Y18N(opts) + + // bind all functions to y18n, so that + // they can be used in isolation. + for (var key in y18n) { + if (typeof y18n[key] === 'function') { + y18n[key] = y18n[key].bind(y18n) + } + } + + return y18n +} diff --git a/node_modules/y18n/package.json b/node_modules/y18n/package.json new file mode 100644 index 0000000..66250f8 --- /dev/null +++ b/node_modules/y18n/package.json @@ -0,0 +1,67 @@ +{ + "_from": "y18n@^4.0.0", + "_id": "y18n@4.0.0", + "_inBundle": false, + "_integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==", + "_location": "/y18n", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "y18n@^4.0.0", + "name": "y18n", + "escapedName": "y18n", + "rawSpec": "^4.0.0", + "saveSpec": null, + "fetchSpec": "^4.0.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", + "_shasum": "95ef94f85ecc81d007c264e190a120f0a3c8566b", + "_spec": "y18n@^4.0.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Ben Coe", + "email": "ben@npmjs.com" + }, + "bugs": { + "url": "https://github.com/yargs/y18n/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "the bare-bones internationalization library used by yargs", + "devDependencies": { + "chai": "^4.0.1", + "coveralls": "^3.0.0", + "mocha": "^4.0.1", + "nyc": "^11.0.1", + "rimraf": "^2.5.0", + "standard": "^10.0.0-beta.0", + "standard-version": "^4.2.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/yargs/y18n", + "keywords": [ + "i18n", + "internationalization", + "yargs" + ], + "license": "ISC", + "main": "index.js", + "name": "y18n", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/yargs/y18n.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "pretest": "standard", + "release": "standard-version", + "test": "nyc mocha" + }, + "version": "4.0.0" +} diff --git a/node_modules/yargs-parser/CHANGELOG.md b/node_modules/yargs-parser/CHANGELOG.md new file mode 100644 index 0000000..df11c00 --- /dev/null +++ b/node_modules/yargs-parser/CHANGELOG.md @@ -0,0 +1,467 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +### [13.1.1](https://www.github.com/yargs/yargs-parser/compare/v13.1.0...v13.1.1) (2019-06-10) + + +### Bug Fixes + +* convert values to strings when tokenizing ([#167](https://www.github.com/yargs/yargs-parser/issues/167)) ([57b7883](https://www.github.com/yargs/yargs-parser/commit/57b7883)) +* nargs should allow duplicates when duplicate-arguments-array=false ([#164](https://www.github.com/yargs/yargs-parser/issues/164)) ([47ccb0b](https://www.github.com/yargs/yargs-parser/commit/47ccb0b)) +* should populate "_" when given config with "short-option-groups" false ([#179](https://www.github.com/yargs/yargs-parser/issues/179)) ([6055974](https://www.github.com/yargs/yargs-parser/commit/6055974)) + +## [13.1.0](https://github.com/yargs/yargs-parser/compare/v13.0.0...v13.1.0) (2019-05-05) + + +### Features + +* add `strip-aliased` and `strip-dashed` configuration options. ([#172](https://github.com/yargs/yargs-parser/issues/172)) ([a3936aa](https://github.com/yargs/yargs-parser/commit/a3936aa)) +* support boolean which do not consume next argument. ([#171](https://github.com/yargs/yargs-parser/issues/171)) ([0ae7fcb](https://github.com/yargs/yargs-parser/commit/0ae7fcb)) + + + + +# [13.0.0](https://github.com/yargs/yargs-parser/compare/v12.0.0...v13.0.0) (2019-02-02) + + +### Features + +* don't coerce number from string with leading '0' or '+' ([#158](https://github.com/yargs/yargs-parser/issues/158)) ([18d0fd5](https://github.com/yargs/yargs-parser/commit/18d0fd5)) + + +### BREAKING CHANGES + +* options with leading '+' or '0' now parse as strings + + + + +# [12.0.0](https://github.com/yargs/yargs-parser/compare/v11.1.1...v12.0.0) (2019-01-29) + + +### Bug Fixes + +* better handling of quoted strings ([#153](https://github.com/yargs/yargs-parser/issues/153)) ([2fb71b2](https://github.com/yargs/yargs-parser/commit/2fb71b2)) + + +### Features + +* default value is now used if no right-hand value provided for numbers/strings ([#156](https://github.com/yargs/yargs-parser/issues/156)) ([5a7c46a](https://github.com/yargs/yargs-parser/commit/5a7c46a)) + + +### BREAKING CHANGES + +* a flag with no right-hand value no longer populates defaulted options with `undefined`. +* quotes at beginning and endings of strings are not removed during parsing. + + + + +## [11.1.1](https://github.com/yargs/yargs-parser/compare/v11.1.0...v11.1.1) (2018-11-19) + + +### Bug Fixes + +* ensure empty string is added into argv._ ([#140](https://github.com/yargs/yargs-parser/issues/140)) ([79cda98](https://github.com/yargs/yargs-parser/commit/79cda98)) + + +### Reverts + +* make requiresArg work in conjunction with arrays ([#136](https://github.com/yargs/yargs-parser/issues/136)) ([f4a3063](https://github.com/yargs/yargs-parser/commit/f4a3063)) + + + + +# [11.1.0](https://github.com/yargs/yargs-parser/compare/v11.0.0...v11.1.0) (2018-11-10) + + +### Bug Fixes + +* handling of one char alias ([#139](https://github.com/yargs/yargs-parser/issues/139)) ([ee56e31](https://github.com/yargs/yargs-parser/commit/ee56e31)) + + +### Features + +* add halt-at-non-option configuration option ([#130](https://github.com/yargs/yargs-parser/issues/130)) ([a849fce](https://github.com/yargs/yargs-parser/commit/a849fce)) + + + + +# [11.0.0](https://github.com/yargs/yargs-parser/compare/v10.1.0...v11.0.0) (2018-10-06) + + +### Bug Fixes + +* flatten-duplicate-arrays:false for more than 2 arrays ([#128](https://github.com/yargs/yargs-parser/issues/128)) ([2bc395f](https://github.com/yargs/yargs-parser/commit/2bc395f)) +* hyphenated flags combined with dot notation broke parsing ([#131](https://github.com/yargs/yargs-parser/issues/131)) ([dc788da](https://github.com/yargs/yargs-parser/commit/dc788da)) +* make requiresArg work in conjunction with arrays ([#136](https://github.com/yargs/yargs-parser/issues/136)) ([77ae1d4](https://github.com/yargs/yargs-parser/commit/77ae1d4)) + + +### Chores + +* update dependencies ([6dc42a1](https://github.com/yargs/yargs-parser/commit/6dc42a1)) + + +### Features + +* also add camelCase array options ([#125](https://github.com/yargs/yargs-parser/issues/125)) ([08c0117](https://github.com/yargs/yargs-parser/commit/08c0117)) +* array.type can now be provided, supporting coercion ([#132](https://github.com/yargs/yargs-parser/issues/132)) ([4b8cfce](https://github.com/yargs/yargs-parser/commit/4b8cfce)) + + +### BREAKING CHANGES + +* drops Node 4 support +* the argv object is now populated differently (correctly) when hyphens and dot notation are used in conjunction. + + + + +# [10.1.0](https://github.com/yargs/yargs-parser/compare/v10.0.0...v10.1.0) (2018-06-29) + + +### Features + +* add `set-placeholder-key` configuration ([#123](https://github.com/yargs/yargs-parser/issues/123)) ([19386ee](https://github.com/yargs/yargs-parser/commit/19386ee)) + + + + +# [10.0.0](https://github.com/yargs/yargs-parser/compare/v9.0.2...v10.0.0) (2018-04-04) + + +### Bug Fixes + +* do not set boolean flags if not defined in `argv` ([#119](https://github.com/yargs/yargs-parser/issues/119)) ([f6e6599](https://github.com/yargs/yargs-parser/commit/f6e6599)) + + +### BREAKING CHANGES + +* `boolean` flags defined without a `default` value will now behave like other option type and won't be set in the parsed results when the user doesn't set the corresponding CLI arg. + +Previous behavior: +```js +var parse = require('yargs-parser'); + +parse('--flag', {boolean: ['flag']}); +// => { _: [], flag: true } + +parse('--no-flag', {boolean: ['flag']}); +// => { _: [], flag: false } + +parse('', {boolean: ['flag']}); +// => { _: [], flag: false } +``` + +New behavior: +```js +var parse = require('yargs-parser'); + +parse('--flag', {boolean: ['flag']}); +// => { _: [], flag: true } + +parse('--no-flag', {boolean: ['flag']}); +// => { _: [], flag: false } + +parse('', {boolean: ['flag']}); +// => { _: [] } => flag not set similarly to other option type +``` + + + + +## [9.0.2](https://github.com/yargs/yargs-parser/compare/v9.0.1...v9.0.2) (2018-01-20) + + +### Bug Fixes + +* nargs was still aggressively consuming too many arguments ([9b28aad](https://github.com/yargs/yargs-parser/commit/9b28aad)) + + + + +## [9.0.1](https://github.com/yargs/yargs-parser/compare/v9.0.0...v9.0.1) (2018-01-20) + + +### Bug Fixes + +* nargs was consuming too many arguments ([4fef206](https://github.com/yargs/yargs-parser/commit/4fef206)) + + + + +# [9.0.0](https://github.com/yargs/yargs-parser/compare/v8.1.0...v9.0.0) (2018-01-20) + + +### Features + +* narg arguments no longer consume flag arguments ([#114](https://github.com/yargs/yargs-parser/issues/114)) ([60bb9b3](https://github.com/yargs/yargs-parser/commit/60bb9b3)) + + +### BREAKING CHANGES + +* arguments of form --foo, -abc, will no longer be consumed by nargs + + + + +# [8.1.0](https://github.com/yargs/yargs-parser/compare/v8.0.0...v8.1.0) (2017-12-20) + + +### Bug Fixes + +* allow null config values ([#108](https://github.com/yargs/yargs-parser/issues/108)) ([d8b14f9](https://github.com/yargs/yargs-parser/commit/d8b14f9)) +* ensure consistent parsing of dot-notation arguments ([#102](https://github.com/yargs/yargs-parser/issues/102)) ([c9bd79c](https://github.com/yargs/yargs-parser/commit/c9bd79c)) +* implement [@antoniom](https://github.com/antoniom)'s fix for camel-case expansion ([3087e1d](https://github.com/yargs/yargs-parser/commit/3087e1d)) +* only run coercion functions once, despite aliases. ([#76](https://github.com/yargs/yargs-parser/issues/76)) ([#103](https://github.com/yargs/yargs-parser/issues/103)) ([507aaef](https://github.com/yargs/yargs-parser/commit/507aaef)) +* scientific notation circumvented bounds check ([#110](https://github.com/yargs/yargs-parser/issues/110)) ([3571f57](https://github.com/yargs/yargs-parser/commit/3571f57)) +* tokenizer should ignore spaces at the beginning of the argString ([#106](https://github.com/yargs/yargs-parser/issues/106)) ([f34ead9](https://github.com/yargs/yargs-parser/commit/f34ead9)) + + +### Features + +* make combining arrays a configurable option ([#111](https://github.com/yargs/yargs-parser/issues/111)) ([c8bf536](https://github.com/yargs/yargs-parser/commit/c8bf536)) +* merge array from arguments with array from config ([#83](https://github.com/yargs/yargs-parser/issues/83)) ([806ddd6](https://github.com/yargs/yargs-parser/commit/806ddd6)) + + + + +# [8.0.0](https://github.com/yargs/yargs-parser/compare/v7.0.0...v8.0.0) (2017-10-05) + + +### Bug Fixes + +* Ignore multiple spaces between arguments. ([#100](https://github.com/yargs/yargs-parser/issues/100)) ([d137227](https://github.com/yargs/yargs-parser/commit/d137227)) + + +### Features + +* allow configuration of prefix for boolean negation ([#94](https://github.com/yargs/yargs-parser/issues/94)) ([00bde7d](https://github.com/yargs/yargs-parser/commit/00bde7d)) +* reworking how numbers are parsed ([#104](https://github.com/yargs/yargs-parser/issues/104)) ([fba00eb](https://github.com/yargs/yargs-parser/commit/fba00eb)) + + +### BREAKING CHANGES + +* strings that fail `Number.isSafeInteger()` are no longer coerced into numbers. + + + + +# [7.0.0](https://github.com/yargs/yargs-parser/compare/v6.0.1...v7.0.0) (2017-05-02) + + +### Chores + +* revert populate-- logic ([#91](https://github.com/yargs/yargs-parser/issues/91)) ([6003e6d](https://github.com/yargs/yargs-parser/commit/6003e6d)) + + +### BREAKING CHANGES + +* populate-- now defaults to false. + + + + +## [6.0.1](https://github.com/yargs/yargs-parser/compare/v6.0.0...v6.0.1) (2017-05-01) + + +### Bug Fixes + +* default '--' to undefined when not provided; this is closer to the array API ([#90](https://github.com/yargs/yargs-parser/issues/90)) ([4e739cc](https://github.com/yargs/yargs-parser/commit/4e739cc)) + + + + +# [6.0.0](https://github.com/yargs/yargs-parser/compare/v4.2.1...v6.0.0) (2017-05-01) + + +### Bug Fixes + +* environment variables should take precedence over config file ([#81](https://github.com/yargs/yargs-parser/issues/81)) ([76cee1f](https://github.com/yargs/yargs-parser/commit/76cee1f)) +* parsing hints should apply for dot notation keys ([#86](https://github.com/yargs/yargs-parser/issues/86)) ([3e47d62](https://github.com/yargs/yargs-parser/commit/3e47d62)) + + +### Chores + +* upgrade to newest version of camelcase ([#87](https://github.com/yargs/yargs-parser/issues/87)) ([f1903aa](https://github.com/yargs/yargs-parser/commit/f1903aa)) + + +### Features + +* add -- option which allows arguments after the -- flag to be returned separated from positional arguments ([#84](https://github.com/yargs/yargs-parser/issues/84)) ([2572ca8](https://github.com/yargs/yargs-parser/commit/2572ca8)) +* when parsing stops, we now populate "--" by default ([#88](https://github.com/yargs/yargs-parser/issues/88)) ([cd666db](https://github.com/yargs/yargs-parser/commit/cd666db)) + + +### BREAKING CHANGES + +* rather than placing arguments in "_", when parsing is stopped via "--"; we now populate an array called "--" by default. +* camelcase now requires Node 4+. +* environment variables will now override config files (args, env, config-file, config-object) + + + + +# [5.0.0](https://github.com/yargs/yargs-parser/compare/v4.2.1...v5.0.0) (2017-02-18) + + +### Bug Fixes + +* environment variables should take precedence over config file ([#81](https://github.com/yargs/yargs-parser/issues/81)) ([76cee1f](https://github.com/yargs/yargs-parser/commit/76cee1f)) + + +### BREAKING CHANGES + +* environment variables will now override config files (args, env, config-file, config-object) + + + + +## [4.2.1](https://github.com/yargs/yargs-parser/compare/v4.2.0...v4.2.1) (2017-01-02) + + +### Bug Fixes + +* flatten/duplicate regression ([#75](https://github.com/yargs/yargs-parser/issues/75)) ([68d68a0](https://github.com/yargs/yargs-parser/commit/68d68a0)) + + + + +# [4.2.0](https://github.com/yargs/yargs-parser/compare/v4.1.0...v4.2.0) (2016-12-01) + + +### Bug Fixes + +* inner objects in configs had their keys appended to top-level key when dot-notation was disabled ([#72](https://github.com/yargs/yargs-parser/issues/72)) ([0b1b5f9](https://github.com/yargs/yargs-parser/commit/0b1b5f9)) + + +### Features + +* allow multiple arrays to be provided, rather than always combining ([#71](https://github.com/yargs/yargs-parser/issues/71)) ([0f0fb2d](https://github.com/yargs/yargs-parser/commit/0f0fb2d)) + + + + +# [4.1.0](https://github.com/yargs/yargs-parser/compare/v4.0.2...v4.1.0) (2016-11-07) + + +### Features + +* apply coercions to default options ([#65](https://github.com/yargs/yargs-parser/issues/65)) ([c79052b](https://github.com/yargs/yargs-parser/commit/c79052b)) +* handle dot notation boolean options ([#63](https://github.com/yargs/yargs-parser/issues/63)) ([02c3545](https://github.com/yargs/yargs-parser/commit/02c3545)) + + + + +## [4.0.2](https://github.com/yargs/yargs-parser/compare/v4.0.1...v4.0.2) (2016-09-30) + + +### Bug Fixes + +* whoops, let's make the assign not change the Object key order ([29d069a](https://github.com/yargs/yargs-parser/commit/29d069a)) + + + + +## [4.0.1](https://github.com/yargs/yargs-parser/compare/v4.0.0...v4.0.1) (2016-09-30) + + +### Bug Fixes + +* lodash.assign was deprecated ([#59](https://github.com/yargs/yargs-parser/issues/59)) ([5e7eb11](https://github.com/yargs/yargs-parser/commit/5e7eb11)) + + + + +# [4.0.0](https://github.com/yargs/yargs-parser/compare/v3.2.0...v4.0.0) (2016-09-26) + + +### Bug Fixes + +* coerce should be applied to the final objects and arrays created ([#57](https://github.com/yargs/yargs-parser/issues/57)) ([4ca69da](https://github.com/yargs/yargs-parser/commit/4ca69da)) + + +### BREAKING CHANGES + +* coerce is no longer applied to individual arguments in an implicit array. + + + + +# [3.2.0](https://github.com/yargs/yargs-parser/compare/v3.1.0...v3.2.0) (2016-08-13) + + +### Features + +* coerce full array instead of each element ([#51](https://github.com/yargs/yargs-parser/issues/51)) ([cc4dc56](https://github.com/yargs/yargs-parser/commit/cc4dc56)) + + + + +# [3.1.0](https://github.com/yargs/yargs-parser/compare/v3.0.0...v3.1.0) (2016-08-09) + + +### Bug Fixes + +* address pkgConf parsing bug outlined in [#37](https://github.com/yargs/yargs-parser/issues/37) ([#45](https://github.com/yargs/yargs-parser/issues/45)) ([be76ee6](https://github.com/yargs/yargs-parser/commit/be76ee6)) +* better parsing of negative values ([#44](https://github.com/yargs/yargs-parser/issues/44)) ([2e43692](https://github.com/yargs/yargs-parser/commit/2e43692)) +* check aliases when guessing defaults for arguments fixes [#41](https://github.com/yargs/yargs-parser/issues/41) ([#43](https://github.com/yargs/yargs-parser/issues/43)) ([f3e4616](https://github.com/yargs/yargs-parser/commit/f3e4616)) + + +### Features + +* added coerce option, for providing specialized argument parsing ([#42](https://github.com/yargs/yargs-parser/issues/42)) ([7b49cd2](https://github.com/yargs/yargs-parser/commit/7b49cd2)) + + + + +# [3.0.0](https://github.com/yargs/yargs-parser/compare/v2.4.1...v3.0.0) (2016-08-07) + + +### Bug Fixes + +* parsing issue with numeric character in group of options ([#19](https://github.com/yargs/yargs-parser/issues/19)) ([f743236](https://github.com/yargs/yargs-parser/commit/f743236)) +* upgraded lodash.assign ([5d7fdf4](https://github.com/yargs/yargs-parser/commit/5d7fdf4)) + +### BREAKING CHANGES + +* subtle change to how values are parsed in a group of single-character arguments. +* _first released in 3.1.0, better handling of negative values should be considered a breaking change._ + + + + +## [2.4.1](https://github.com/yargs/yargs-parser/compare/v2.4.0...v2.4.1) (2016-07-16) + + +### Bug Fixes + +* **count:** do not increment a default value ([#39](https://github.com/yargs/yargs-parser/issues/39)) ([b04a189](https://github.com/yargs/yargs-parser/commit/b04a189)) + + + + +# [2.4.0](https://github.com/yargs/yargs-parser/compare/v2.3.0...v2.4.0) (2016-04-11) + + +### Features + +* **environment:** Support nested options in environment variables ([#26](https://github.com/yargs/yargs-parser/issues/26)) thanks [@elas7](https://github.com/elas7) \o/ ([020778b](https://github.com/yargs/yargs-parser/commit/020778b)) + + + + +# [2.3.0](https://github.com/yargs/yargs-parser/compare/v2.2.0...v2.3.0) (2016-04-09) + + +### Bug Fixes + +* **boolean:** fix for boolean options with non boolean defaults (#20) ([2dbe86b](https://github.com/yargs/yargs-parser/commit/2dbe86b)), closes [(#20](https://github.com/(/issues/20) +* **package:** remove tests from tarball ([0353c0d](https://github.com/yargs/yargs-parser/commit/0353c0d)) +* **parsing:** handle calling short option with an empty string as the next value. ([a867165](https://github.com/yargs/yargs-parser/commit/a867165)) +* boolean flag when next value contains the strings 'true' or 'false'. ([69941a6](https://github.com/yargs/yargs-parser/commit/69941a6)) +* update dependencies; add standard-version bin for next release (#24) ([822d9d5](https://github.com/yargs/yargs-parser/commit/822d9d5)) + +### Features + +* **configuration:** Allow to pass configuration objects to yargs-parser ([0780900](https://github.com/yargs/yargs-parser/commit/0780900)) +* **normalize:** allow normalize to work with arrays ([e0eaa1a](https://github.com/yargs/yargs-parser/commit/e0eaa1a)) diff --git a/node_modules/yargs-parser/LICENSE.txt b/node_modules/yargs-parser/LICENSE.txt new file mode 100644 index 0000000..836440b --- /dev/null +++ b/node_modules/yargs-parser/LICENSE.txt @@ -0,0 +1,14 @@ +Copyright (c) 2016, Contributors + +Permission to use, copy, modify, and/or distribute this software +for any purpose with or without fee is hereby granted, provided +that the above copyright notice and this permission notice +appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE +LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES +OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/yargs-parser/README.md b/node_modules/yargs-parser/README.md new file mode 100644 index 0000000..dde9f84 --- /dev/null +++ b/node_modules/yargs-parser/README.md @@ -0,0 +1,396 @@ +# yargs-parser + +[![Build Status](https://travis-ci.org/yargs/yargs-parser.svg)](https://travis-ci.org/yargs/yargs-parser) +[![Coverage Status](https://coveralls.io/repos/yargs/yargs-parser/badge.svg?branch=)](https://coveralls.io/r/yargs/yargs-parser?branch=master) +[![NPM version](https://img.shields.io/npm/v/yargs-parser.svg)](https://www.npmjs.com/package/yargs-parser) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) + + +The mighty option parser used by [yargs](https://github.com/yargs/yargs). + +visit the [yargs website](http://yargs.js.org/) for more examples, and thorough usage instructions. + + + +## Example + +```sh +npm i yargs-parser --save +``` + +```js +var argv = require('yargs-parser')(process.argv.slice(2)) +console.log(argv) +``` + +```sh +node example.js --foo=33 --bar hello +{ _: [], foo: 33, bar: 'hello' } +``` + +_or parse a string!_ + +```js +var argv = require('./')('--foo=99 --bar=33') +console.log(argv) +``` + +```sh +{ _: [], foo: 99, bar: 33 } +``` + +Convert an array of mixed types before passing to `yargs-parser`: + +```js +var parse = require('yargs-parser') +parse(['-f', 11, '--zoom', 55].join(' ')) // <-- array to string +parse(['-f', 11, '--zoom', 55].map(String)) // <-- array of strings +``` + +## API + +### require('yargs-parser')(args, opts={}) + +Parses command line arguments returning a simple mapping of keys and values. + +**expects:** + +* `args`: a string or array of strings representing the options to parse. +* `opts`: provide a set of hints indicating how `args` should be parsed: + * `opts.alias`: an object representing the set of aliases for a key: `{alias: {foo: ['f']}}`. + * `opts.array`: indicate that keys should be parsed as an array: `{array: ['foo', 'bar']}`.
+ Indicate that keys should be parsed as an array and coerced to booleans / numbers:
+ `{array: [{ key: 'foo', boolean: true }, {key: 'bar', number: true}]}`. + * `opts.boolean`: arguments should be parsed as booleans: `{boolean: ['x', 'y']}`. + * `opts.coerce`: provide a custom synchronous function that returns a coerced value from the argument provided + (or throws an error). For arrays the function is called only once for the entire array:
+ `{coerce: {foo: function (arg) {return modifiedArg}}}`. + * `opts.config`: indicate a key that represents a path to a configuration file (this file will be loaded and parsed). + * `opts.configObjects`: configuration objects to parse, their properties will be set as arguments:
+ `{configObjects: [{'x': 5, 'y': 33}, {'z': 44}]}`. + * `opts.configuration`: provide configuration options to the yargs-parser (see: [configuration](#configuration)). + * `opts.count`: indicate a key that should be used as a counter, e.g., `-vvv` = `{v: 3}`. + * `opts.default`: provide default values for keys: `{default: {x: 33, y: 'hello world!'}}`. + * `opts.envPrefix`: environment variables (`process.env`) with the prefix provided should be parsed. + * `opts.narg`: specify that a key requires `n` arguments: `{narg: {x: 2}}`. + * `opts.normalize`: `path.normalize()` will be applied to values set to this key. + * `opts.number`: keys should be treated as numbers. + * `opts.string`: keys should be treated as strings (even if they resemble a number `-x 33`). + +**returns:** + +* `obj`: an object representing the parsed value of `args` + * `key/value`: key value pairs for each argument and their aliases. + * `_`: an array representing the positional arguments. + * [optional] `--`: an array with arguments after the end-of-options flag `--`. + +### require('yargs-parser').detailed(args, opts={}) + +Parses a command line string, returning detailed information required by the +yargs engine. + +**expects:** + +* `args`: a string or array of strings representing options to parse. +* `opts`: provide a set of hints indicating how `args`, inputs are identical to `require('yargs-parser')(args, opts={})`. + +**returns:** + +* `argv`: an object representing the parsed value of `args` + * `key/value`: key value pairs for each argument and their aliases. + * `_`: an array representing the positional arguments. +* `error`: populated with an error object if an exception occurred during parsing. +* `aliases`: the inferred list of aliases built by combining lists in `opts.alias`. +* `newAliases`: any new aliases added via camel-case expansion. +* `configuration`: the configuration loaded from the `yargs` stanza in package.json. + + + +### Configuration + +The yargs-parser applies several automated transformations on the keys provided +in `args`. These features can be turned on and off using the `configuration` field +of `opts`. + +```js +var parsed = parser(['--no-dice'], { + configuration: { + 'boolean-negation': false + } +}) +``` + +### short option groups + +* default: `true`. +* key: `short-option-groups`. + +Should a group of short-options be treated as boolean flags? + +```sh +node example.js -abc +{ _: [], a: true, b: true, c: true } +``` + +_if disabled:_ + +```sh +node example.js -abc +{ _: [], abc: true } +``` + +### camel-case expansion + +* default: `true`. +* key: `camel-case-expansion`. + +Should hyphenated arguments be expanded into camel-case aliases? + +```sh +node example.js --foo-bar +{ _: [], 'foo-bar': true, fooBar: true } +``` + +_if disabled:_ + +```sh +node example.js --foo-bar +{ _: [], 'foo-bar': true } +``` + +### dot-notation + +* default: `true` +* key: `dot-notation` + +Should keys that contain `.` be treated as objects? + +```sh +node example.js --foo.bar +{ _: [], foo: { bar: true } } +``` + +_if disabled:_ + +```sh +node example.js --foo.bar +{ _: [], "foo.bar": true } +``` + +### parse numbers + +* default: `true` +* key: `parse-numbers` + +Should keys that look like numbers be treated as such? + +```sh +node example.js --foo=99.3 +{ _: [], foo: 99.3 } +``` + +_if disabled:_ + +```sh +node example.js --foo=99.3 +{ _: [], foo: "99.3" } +``` + +### boolean negation + +* default: `true` +* key: `boolean-negation` + +Should variables prefixed with `--no` be treated as negations? + +```sh +node example.js --no-foo +{ _: [], foo: false } +``` + +_if disabled:_ + +```sh +node example.js --no-foo +{ _: [], "no-foo": true } +``` + +### combine arrays + +* default: `false` +* key: `combine-arrays` + +Should arrays be combined when provided by both command line arguments and +a configuration file. + +### duplicate arguments array + +* default: `true` +* key: `duplicate-arguments-array` + +Should arguments be coerced into an array when duplicated: + +```sh +node example.js -x 1 -x 2 +{ _: [], x: [1, 2] } +``` + +_if disabled:_ + +```sh +node example.js -x 1 -x 2 +{ _: [], x: 2 } +``` + +### flatten duplicate arrays + +* default: `true` +* key: `flatten-duplicate-arrays` + +Should array arguments be coerced into a single array when duplicated: + +```sh +node example.js -x 1 2 -x 3 4 +{ _: [], x: [1, 2, 3, 4] } +``` + +_if disabled:_ + +```sh +node example.js -x 1 2 -x 3 4 +{ _: [], x: [[1, 2], [3, 4]] } +``` + +### negation prefix + +* default: `no-` +* key: `negation-prefix` + +The prefix to use for negated boolean variables. + +```sh +node example.js --no-foo +{ _: [], foo: false } +``` + +_if set to `quux`:_ + +```sh +node example.js --quuxfoo +{ _: [], foo: false } +``` + +### populate -- + +* default: `false`. +* key: `populate--` + +Should unparsed flags be stored in `--` or `_`. + +_If disabled:_ + +```sh +node example.js a -b -- x y +{ _: [ 'a', 'x', 'y' ], b: true } +``` + +_If enabled:_ + +```sh +node example.js a -b -- x y +{ _: [ 'a' ], '--': [ 'x', 'y' ], b: true } +``` + +### set placeholder key + +* default: `false`. +* key: `set-placeholder-key`. + +Should a placeholder be added for keys not set via the corresponding CLI argument? + +_If disabled:_ + +```sh +node example.js -a 1 -c 2 +{ _: [], a: 1, c: 2 } +``` + +_If enabled:_ + +```sh +node example.js -a 1 -c 2 +{ _: [], a: 1, b: undefined, c: 2 } +``` + +### halt at non-option + +* default: `false`. +* key: `halt-at-non-option`. + +Should parsing stop at the first positional argument? This is similar to how e.g. `ssh` parses its command line. + +_If disabled:_ + +```sh +node example.js -a run b -x y +{ _: [ 'b' ], a: 'run', x: 'y' } +``` + +_If enabled:_ + +```sh +node example.js -a run b -x y +{ _: [ 'b', '-x', 'y' ], a: 'run' } +``` + +### strip aliased + +* default: `false` +* key: `strip-aliased` + +Should aliases be removed before returning results? + +_If disabled:_ + +```sh +node example.js --test-field 1 +{ _: [], 'test-field': 1, testField: 1, 'test-alias': 1, testAlias: 1 } +``` + +_If enabled:_ + +```sh +node example.js --test-field 1 +{ _: [], 'test-field': 1, testField: 1 } +``` + +### strip dashed + +* default: `false` +* key: `strip-dashed` + +Should dashed keys be removed before returning results? This option has no effect if +`camel-case-exansion` is disabled. + +_If disabled:_ + +```sh +node example.js --test-field 1 +{ _: [], 'test-field': 1, testField: 1 } +``` + +_If enabled:_ + +```sh +node example.js --test-field 1 +{ _: [], testField: 1 } +``` + +## Special Thanks + +The yargs project evolves from optimist and minimist. It owes its +existence to a lot of James Halliday's hard work. Thanks [substack](https://github.com/substack) **beep** **boop** \o/ + +## License + +ISC diff --git a/node_modules/yargs-parser/index.js b/node_modules/yargs-parser/index.js new file mode 100644 index 0000000..a6c95ba --- /dev/null +++ b/node_modules/yargs-parser/index.js @@ -0,0 +1,903 @@ +var camelCase = require('camelcase') +var decamelize = require('decamelize') +var path = require('path') +var tokenizeArgString = require('./lib/tokenize-arg-string') +var util = require('util') + +function parse (args, opts) { + if (!opts) opts = {} + // allow a string argument to be passed in rather + // than an argv array. + args = tokenizeArgString(args) + + // aliases might have transitive relationships, normalize this. + var aliases = combineAliases(opts.alias || {}) + var configuration = Object.assign({ + 'short-option-groups': true, + 'camel-case-expansion': true, + 'dot-notation': true, + 'parse-numbers': true, + 'boolean-negation': true, + 'negation-prefix': 'no-', + 'duplicate-arguments-array': true, + 'flatten-duplicate-arrays': true, + 'populate--': false, + 'combine-arrays': false, + 'set-placeholder-key': false, + 'halt-at-non-option': false, + 'strip-aliased': false, + 'strip-dashed': false + }, opts.configuration) + var defaults = opts.default || {} + var configObjects = opts.configObjects || [] + var envPrefix = opts.envPrefix + var notFlagsOption = configuration['populate--'] + var notFlagsArgv = notFlagsOption ? '--' : '_' + var newAliases = {} + // allow a i18n handler to be passed in, default to a fake one (util.format). + var __ = opts.__ || util.format + var error = null + var flags = { + aliases: {}, + arrays: {}, + bools: {}, + strings: {}, + numbers: {}, + counts: {}, + normalize: {}, + configs: {}, + defaulted: {}, + nargs: {}, + coercions: {}, + keys: [] + } + var negative = /^-[0-9]+(\.[0-9]+)?/ + var negatedBoolean = new RegExp('^--' + configuration['negation-prefix'] + '(.+)') + + ;[].concat(opts.array).filter(Boolean).forEach(function (opt) { + var key = opt.key || opt + + // assign to flags[bools|strings|numbers] + const assignment = Object.keys(opt).map(function (key) { + return ({ + boolean: 'bools', + string: 'strings', + number: 'numbers' + })[key] + }).filter(Boolean).pop() + + // assign key to be coerced + if (assignment) { + flags[assignment][key] = true + } + + flags.arrays[key] = true + flags.keys.push(key) + }) + + ;[].concat(opts.boolean).filter(Boolean).forEach(function (key) { + flags.bools[key] = true + flags.keys.push(key) + }) + + ;[].concat(opts.string).filter(Boolean).forEach(function (key) { + flags.strings[key] = true + flags.keys.push(key) + }) + + ;[].concat(opts.number).filter(Boolean).forEach(function (key) { + flags.numbers[key] = true + flags.keys.push(key) + }) + + ;[].concat(opts.count).filter(Boolean).forEach(function (key) { + flags.counts[key] = true + flags.keys.push(key) + }) + + ;[].concat(opts.normalize).filter(Boolean).forEach(function (key) { + flags.normalize[key] = true + flags.keys.push(key) + }) + + Object.keys(opts.narg || {}).forEach(function (k) { + flags.nargs[k] = opts.narg[k] + flags.keys.push(k) + }) + + Object.keys(opts.coerce || {}).forEach(function (k) { + flags.coercions[k] = opts.coerce[k] + flags.keys.push(k) + }) + + if (Array.isArray(opts.config) || typeof opts.config === 'string') { + ;[].concat(opts.config).filter(Boolean).forEach(function (key) { + flags.configs[key] = true + }) + } else { + Object.keys(opts.config || {}).forEach(function (k) { + flags.configs[k] = opts.config[k] + }) + } + + // create a lookup table that takes into account all + // combinations of aliases: {f: ['foo'], foo: ['f']} + extendAliases(opts.key, aliases, opts.default, flags.arrays) + + // apply default values to all aliases. + Object.keys(defaults).forEach(function (key) { + (flags.aliases[key] || []).forEach(function (alias) { + defaults[alias] = defaults[key] + }) + }) + + var argv = { _: [] } + + Object.keys(flags.bools).forEach(function (key) { + if (Object.prototype.hasOwnProperty.call(defaults, key)) { + setArg(key, defaults[key]) + setDefaulted(key) + } + }) + + var notFlags = [] + + for (var i = 0; i < args.length; i++) { + var arg = args[i] + var broken + var key + var letters + var m + var next + var value + + // -- separated by = + if (arg.match(/^--.+=/) || ( + !configuration['short-option-groups'] && arg.match(/^-.+=/) + )) { + // Using [\s\S] instead of . because js doesn't support the + // 'dotall' regex modifier. See: + // http://stackoverflow.com/a/1068308/13216 + m = arg.match(/^--?([^=]+)=([\s\S]*)$/) + + // nargs format = '--f=monkey washing cat' + if (checkAllAliases(m[1], flags.nargs)) { + args.splice(i + 1, 0, m[2]) + i = eatNargs(i, m[1], args) + // arrays format = '--f=a b c' + } else if (checkAllAliases(m[1], flags.arrays) && args.length > i + 1) { + args.splice(i + 1, 0, m[2]) + i = eatArray(i, m[1], args) + } else { + setArg(m[1], m[2]) + } + } else if (arg.match(negatedBoolean) && configuration['boolean-negation']) { + key = arg.match(negatedBoolean)[1] + setArg(key, false) + + // -- seperated by space. + } else if (arg.match(/^--.+/) || ( + !configuration['short-option-groups'] && arg.match(/^-[^-]+/) + )) { + key = arg.match(/^--?(.+)/)[1] + + // nargs format = '--foo a b c' + if (checkAllAliases(key, flags.nargs)) { + i = eatNargs(i, key, args) + // array format = '--foo a b c' + } else if (checkAllAliases(key, flags.arrays) && args.length > i + 1) { + i = eatArray(i, key, args) + } else { + next = flags.nargs[key] === 0 ? undefined : args[i + 1] + + if (next !== undefined && (!next.match(/^-/) || + next.match(negative)) && + !checkAllAliases(key, flags.bools) && + !checkAllAliases(key, flags.counts)) { + setArg(key, next) + i++ + } else if (/^(true|false)$/.test(next)) { + setArg(key, next) + i++ + } else { + setArg(key, defaultValue(key)) + } + } + + // dot-notation flag seperated by '='. + } else if (arg.match(/^-.\..+=/)) { + m = arg.match(/^-([^=]+)=([\s\S]*)$/) + setArg(m[1], m[2]) + + // dot-notation flag seperated by space. + } else if (arg.match(/^-.\..+/)) { + next = args[i + 1] + key = arg.match(/^-(.\..+)/)[1] + + if (next !== undefined && !next.match(/^-/) && + !checkAllAliases(key, flags.bools) && + !checkAllAliases(key, flags.counts)) { + setArg(key, next) + i++ + } else { + setArg(key, defaultValue(key)) + } + } else if (arg.match(/^-[^-]+/) && !arg.match(negative)) { + letters = arg.slice(1, -1).split('') + broken = false + + for (var j = 0; j < letters.length; j++) { + next = arg.slice(j + 2) + + if (letters[j + 1] && letters[j + 1] === '=') { + value = arg.slice(j + 3) + key = letters[j] + + // nargs format = '-f=monkey washing cat' + if (checkAllAliases(key, flags.nargs)) { + args.splice(i + 1, 0, value) + i = eatNargs(i, key, args) + // array format = '-f=a b c' + } else if (checkAllAliases(key, flags.arrays) && args.length > i + 1) { + args.splice(i + 1, 0, value) + i = eatArray(i, key, args) + } else { + setArg(key, value) + } + + broken = true + break + } + + if (next === '-') { + setArg(letters[j], next) + continue + } + + // current letter is an alphabetic character and next value is a number + if (/[A-Za-z]/.test(letters[j]) && + /^-?\d+(\.\d*)?(e-?\d+)?$/.test(next)) { + setArg(letters[j], next) + broken = true + break + } + + if (letters[j + 1] && letters[j + 1].match(/\W/)) { + setArg(letters[j], next) + broken = true + break + } else { + setArg(letters[j], defaultValue(letters[j])) + } + } + + key = arg.slice(-1)[0] + + if (!broken && key !== '-') { + // nargs format = '-f a b c' + if (checkAllAliases(key, flags.nargs)) { + i = eatNargs(i, key, args) + // array format = '-f a b c' + } else if (checkAllAliases(key, flags.arrays) && args.length > i + 1) { + i = eatArray(i, key, args) + } else { + next = args[i + 1] + + if (next !== undefined && (!/^(-|--)[^-]/.test(next) || + next.match(negative)) && + !checkAllAliases(key, flags.bools) && + !checkAllAliases(key, flags.counts)) { + setArg(key, next) + i++ + } else if (/^(true|false)$/.test(next)) { + setArg(key, next) + i++ + } else { + setArg(key, defaultValue(key)) + } + } + } + } else if (arg === '--') { + notFlags = args.slice(i + 1) + break + } else if (configuration['halt-at-non-option']) { + notFlags = args.slice(i) + break + } else { + argv._.push(maybeCoerceNumber('_', arg)) + } + } + + // order of precedence: + // 1. command line arg + // 2. value from env var + // 3. value from config file + // 4. value from config objects + // 5. configured default value + applyEnvVars(argv, true) // special case: check env vars that point to config file + applyEnvVars(argv, false) + setConfig(argv) + setConfigObjects() + applyDefaultsAndAliases(argv, flags.aliases, defaults) + applyCoercions(argv) + if (configuration['set-placeholder-key']) setPlaceholderKeys(argv) + + // for any counts either not in args or without an explicit default, set to 0 + Object.keys(flags.counts).forEach(function (key) { + if (!hasKey(argv, key.split('.'))) setArg(key, 0) + }) + + // '--' defaults to undefined. + if (notFlagsOption && notFlags.length) argv[notFlagsArgv] = [] + notFlags.forEach(function (key) { + argv[notFlagsArgv].push(key) + }) + + if (configuration['camel-case-expansion'] && configuration['strip-dashed']) { + Object.keys(argv).filter(key => key !== '--' && key.includes('-')).forEach(key => { + delete argv[key] + }) + } + + if (configuration['strip-aliased']) { + // XXX Switch to [].concat(...Object.values(aliases)) once node.js 6 is dropped + ;[].concat(...Object.keys(aliases).map(k => aliases[k])).forEach(alias => { + if (configuration['camel-case-expansion']) { + delete argv[alias.split('.').map(prop => camelCase(prop)).join('.')] + } + + delete argv[alias] + }) + } + + // how many arguments should we consume, based + // on the nargs option? + function eatNargs (i, key, args) { + var ii + const toEat = checkAllAliases(key, flags.nargs) + + // nargs will not consume flag arguments, e.g., -abc, --foo, + // and terminates when one is observed. + var available = 0 + for (ii = i + 1; ii < args.length; ii++) { + if (!args[ii].match(/^-[^0-9]/)) available++ + else break + } + + if (available < toEat) error = Error(__('Not enough arguments following: %s', key)) + + const consumed = Math.min(available, toEat) + for (ii = i + 1; ii < (consumed + i + 1); ii++) { + setArg(key, args[ii]) + } + + return (i + consumed) + } + + // if an option is an array, eat all non-hyphenated arguments + // following it... YUM! + // e.g., --foo apple banana cat becomes ["apple", "banana", "cat"] + function eatArray (i, key, args) { + var start = i + 1 + var argsToSet = [] + var multipleArrayFlag = i > 0 + for (var ii = i + 1; ii < args.length; ii++) { + if (/^-/.test(args[ii]) && !negative.test(args[ii])) { + if (ii === start) { + setArg(key, defaultForType('array')) + } + multipleArrayFlag = true + break + } + i = ii + argsToSet.push(args[ii]) + } + if (multipleArrayFlag) { + setArg(key, argsToSet.map(function (arg) { + return processValue(key, arg) + })) + } else { + argsToSet.forEach(function (arg) { + setArg(key, arg) + }) + } + + return i + } + + function setArg (key, val) { + unsetDefaulted(key) + + if (/-/.test(key) && configuration['camel-case-expansion']) { + var alias = key.split('.').map(function (prop) { + return camelCase(prop) + }).join('.') + addNewAlias(key, alias) + } + + var value = processValue(key, val) + + var splitKey = key.split('.') + setKey(argv, splitKey, value) + + // handle populating aliases of the full key + if (flags.aliases[key]) { + flags.aliases[key].forEach(function (x) { + x = x.split('.') + setKey(argv, x, value) + }) + } + + // handle populating aliases of the first element of the dot-notation key + if (splitKey.length > 1 && configuration['dot-notation']) { + ;(flags.aliases[splitKey[0]] || []).forEach(function (x) { + x = x.split('.') + + // expand alias with nested objects in key + var a = [].concat(splitKey) + a.shift() // nuke the old key. + x = x.concat(a) + + setKey(argv, x, value) + }) + } + + // Set normalize getter and setter when key is in 'normalize' but isn't an array + if (checkAllAliases(key, flags.normalize) && !checkAllAliases(key, flags.arrays)) { + var keys = [key].concat(flags.aliases[key] || []) + keys.forEach(function (key) { + argv.__defineSetter__(key, function (v) { + val = path.normalize(v) + }) + + argv.__defineGetter__(key, function () { + return typeof val === 'string' ? path.normalize(val) : val + }) + }) + } + } + + function addNewAlias (key, alias) { + if (!(flags.aliases[key] && flags.aliases[key].length)) { + flags.aliases[key] = [alias] + newAliases[alias] = true + } + if (!(flags.aliases[alias] && flags.aliases[alias].length)) { + addNewAlias(alias, key) + } + } + + function processValue (key, val) { + // strings may be quoted, clean this up as we assign values. + if (typeof val === 'string' && + (val[0] === "'" || val[0] === '"') && + val[val.length - 1] === val[0] + ) { + val = val.substring(1, val.length - 1) + } + + // handle parsing boolean arguments --foo=true --bar false. + if (checkAllAliases(key, flags.bools) || checkAllAliases(key, flags.counts)) { + if (typeof val === 'string') val = val === 'true' + } + + var value = maybeCoerceNumber(key, val) + + // increment a count given as arg (either no value or value parsed as boolean) + if (checkAllAliases(key, flags.counts) && (isUndefined(value) || typeof value === 'boolean')) { + value = increment + } + + // Set normalized value when key is in 'normalize' and in 'arrays' + if (checkAllAliases(key, flags.normalize) && checkAllAliases(key, flags.arrays)) { + if (Array.isArray(val)) value = val.map(path.normalize) + else value = path.normalize(val) + } + return value + } + + function maybeCoerceNumber (key, value) { + if (!checkAllAliases(key, flags.strings) && !checkAllAliases(key, flags.coercions)) { + const shouldCoerceNumber = isNumber(value) && configuration['parse-numbers'] && ( + Number.isSafeInteger(Math.floor(value)) + ) + if (shouldCoerceNumber || (!isUndefined(value) && checkAllAliases(key, flags.numbers))) value = Number(value) + } + return value + } + + // set args from config.json file, this should be + // applied last so that defaults can be applied. + function setConfig (argv) { + var configLookup = {} + + // expand defaults/aliases, in-case any happen to reference + // the config.json file. + applyDefaultsAndAliases(configLookup, flags.aliases, defaults) + + Object.keys(flags.configs).forEach(function (configKey) { + var configPath = argv[configKey] || configLookup[configKey] + if (configPath) { + try { + var config = null + var resolvedConfigPath = path.resolve(process.cwd(), configPath) + + if (typeof flags.configs[configKey] === 'function') { + try { + config = flags.configs[configKey](resolvedConfigPath) + } catch (e) { + config = e + } + if (config instanceof Error) { + error = config + return + } + } else { + config = require(resolvedConfigPath) + } + + setConfigObject(config) + } catch (ex) { + if (argv[configKey]) error = Error(__('Invalid JSON config file: %s', configPath)) + } + } + }) + } + + // set args from config object. + // it recursively checks nested objects. + function setConfigObject (config, prev) { + Object.keys(config).forEach(function (key) { + var value = config[key] + var fullKey = prev ? prev + '.' + key : key + + // if the value is an inner object and we have dot-notation + // enabled, treat inner objects in config the same as + // heavily nested dot notations (foo.bar.apple). + if (typeof value === 'object' && value !== null && !Array.isArray(value) && configuration['dot-notation']) { + // if the value is an object but not an array, check nested object + setConfigObject(value, fullKey) + } else { + // setting arguments via CLI takes precedence over + // values within the config file. + if (!hasKey(argv, fullKey.split('.')) || (flags.defaulted[fullKey]) || (flags.arrays[fullKey] && configuration['combine-arrays'])) { + setArg(fullKey, value) + } + } + }) + } + + // set all config objects passed in opts + function setConfigObjects () { + if (typeof configObjects === 'undefined') return + configObjects.forEach(function (configObject) { + setConfigObject(configObject) + }) + } + + function applyEnvVars (argv, configOnly) { + if (typeof envPrefix === 'undefined') return + + var prefix = typeof envPrefix === 'string' ? envPrefix : '' + Object.keys(process.env).forEach(function (envVar) { + if (prefix === '' || envVar.lastIndexOf(prefix, 0) === 0) { + // get array of nested keys and convert them to camel case + var keys = envVar.split('__').map(function (key, i) { + if (i === 0) { + key = key.substring(prefix.length) + } + return camelCase(key) + }) + + if (((configOnly && flags.configs[keys.join('.')]) || !configOnly) && (!hasKey(argv, keys) || flags.defaulted[keys.join('.')])) { + setArg(keys.join('.'), process.env[envVar]) + } + } + }) + } + + function applyCoercions (argv) { + var coerce + var applied = {} + Object.keys(argv).forEach(function (key) { + if (!applied.hasOwnProperty(key)) { // If we haven't already coerced this option via one of its aliases + coerce = checkAllAliases(key, flags.coercions) + if (typeof coerce === 'function') { + try { + var value = coerce(argv[key]) + ;([].concat(flags.aliases[key] || [], key)).forEach(ali => { + applied[ali] = argv[ali] = value + }) + } catch (err) { + error = err + } + } + } + }) + } + + function setPlaceholderKeys (argv) { + flags.keys.forEach((key) => { + // don't set placeholder keys for dot notation options 'foo.bar'. + if (~key.indexOf('.')) return + if (typeof argv[key] === 'undefined') argv[key] = undefined + }) + return argv + } + + function applyDefaultsAndAliases (obj, aliases, defaults) { + Object.keys(defaults).forEach(function (key) { + if (!hasKey(obj, key.split('.'))) { + setKey(obj, key.split('.'), defaults[key]) + + ;(aliases[key] || []).forEach(function (x) { + if (hasKey(obj, x.split('.'))) return + setKey(obj, x.split('.'), defaults[key]) + }) + } + }) + } + + function hasKey (obj, keys) { + var o = obj + + if (!configuration['dot-notation']) keys = [keys.join('.')] + + keys.slice(0, -1).forEach(function (key) { + o = (o[key] || {}) + }) + + var key = keys[keys.length - 1] + + if (typeof o !== 'object') return false + else return key in o + } + + function setKey (obj, keys, value) { + var o = obj + + if (!configuration['dot-notation']) keys = [keys.join('.')] + + keys.slice(0, -1).forEach(function (key, index) { + if (typeof o === 'object' && o[key] === undefined) { + o[key] = {} + } + + if (typeof o[key] !== 'object' || Array.isArray(o[key])) { + // ensure that o[key] is an array, and that the last item is an empty object. + if (Array.isArray(o[key])) { + o[key].push({}) + } else { + o[key] = [o[key], {}] + } + + // we want to update the empty object at the end of the o[key] array, so set o to that object + o = o[key][o[key].length - 1] + } else { + o = o[key] + } + }) + + var key = keys[keys.length - 1] + + var isTypeArray = checkAllAliases(keys.join('.'), flags.arrays) + var isValueArray = Array.isArray(value) + var duplicate = configuration['duplicate-arguments-array'] + + // nargs has higher priority than duplicate + if (!duplicate && checkAllAliases(key, flags.nargs)) { + duplicate = true + if ((!isUndefined(o[key]) && flags.nargs[key] === 1) || (Array.isArray(o[key]) && o[key].length === flags.nargs[key])) { + o[key] = undefined + } + } + + if (value === increment) { + o[key] = increment(o[key]) + } else if (Array.isArray(o[key])) { + if (duplicate && isTypeArray && isValueArray) { + o[key] = configuration['flatten-duplicate-arrays'] ? o[key].concat(value) : (Array.isArray(o[key][0]) ? o[key] : [o[key]]).concat([value]) + } else if (!duplicate && Boolean(isTypeArray) === Boolean(isValueArray)) { + o[key] = value + } else { + o[key] = o[key].concat([value]) + } + } else if (o[key] === undefined && isTypeArray) { + o[key] = isValueArray ? value : [value] + } else if (duplicate && !(o[key] === undefined || checkAllAliases(key, flags.bools) || checkAllAliases(keys.join('.'), flags.bools) || checkAllAliases(key, flags.counts))) { + o[key] = [ o[key], value ] + } else { + o[key] = value + } + } + + // extend the aliases list with inferred aliases. + function extendAliases (...args) { + args.forEach(function (obj) { + Object.keys(obj || {}).forEach(function (key) { + // short-circuit if we've already added a key + // to the aliases array, for example it might + // exist in both 'opts.default' and 'opts.key'. + if (flags.aliases[key]) return + + flags.aliases[key] = [].concat(aliases[key] || []) + // For "--option-name", also set argv.optionName + flags.aliases[key].concat(key).forEach(function (x) { + if (/-/.test(x) && configuration['camel-case-expansion']) { + var c = camelCase(x) + if (c !== key && flags.aliases[key].indexOf(c) === -1) { + flags.aliases[key].push(c) + newAliases[c] = true + } + } + }) + // For "--optionName", also set argv['option-name'] + flags.aliases[key].concat(key).forEach(function (x) { + if (x.length > 1 && /[A-Z]/.test(x) && configuration['camel-case-expansion']) { + var c = decamelize(x, '-') + if (c !== key && flags.aliases[key].indexOf(c) === -1) { + flags.aliases[key].push(c) + newAliases[c] = true + } + } + }) + flags.aliases[key].forEach(function (x) { + flags.aliases[x] = [key].concat(flags.aliases[key].filter(function (y) { + return x !== y + })) + }) + }) + }) + } + + // check if a flag is set for any of a key's aliases. + function checkAllAliases (key, flag) { + var isSet = false + var toCheck = [].concat(flags.aliases[key] || [], key) + + toCheck.forEach(function (key) { + if (flag[key]) isSet = flag[key] + }) + + return isSet + } + + function setDefaulted (key) { + [].concat(flags.aliases[key] || [], key).forEach(function (k) { + flags.defaulted[k] = true + }) + } + + function unsetDefaulted (key) { + [].concat(flags.aliases[key] || [], key).forEach(function (k) { + delete flags.defaulted[k] + }) + } + + // make a best effor to pick a default value + // for an option based on name and type. + function defaultValue (key) { + if (!checkAllAliases(key, flags.bools) && + !checkAllAliases(key, flags.counts) && + `${key}` in defaults) { + return defaults[key] + } else { + return defaultForType(guessType(key)) + } + } + + // return a default value, given the type of a flag., + // e.g., key of type 'string' will default to '', rather than 'true'. + function defaultForType (type) { + var def = { + boolean: true, + string: '', + number: undefined, + array: [] + } + + return def[type] + } + + // given a flag, enforce a default type. + function guessType (key) { + var type = 'boolean' + + if (checkAllAliases(key, flags.strings)) type = 'string' + else if (checkAllAliases(key, flags.numbers)) type = 'number' + else if (checkAllAliases(key, flags.arrays)) type = 'array' + + return type + } + + function isNumber (x) { + if (x === null || x === undefined) return false + // if loaded from config, may already be a number. + if (typeof x === 'number') return true + // hexadecimal. + if (/^0x[0-9a-f]+$/i.test(x)) return true + // don't treat 0123 as a number; as it drops the leading '0'. + if (x.length > 1 && x[0] === '0') return false + return /^[-]?(?:\d+(?:\.\d*)?|\.\d+)(e[-+]?\d+)?$/.test(x) + } + + function isUndefined (num) { + return num === undefined + } + + return { + argv: argv, + error: error, + aliases: flags.aliases, + newAliases: newAliases, + configuration: configuration + } +} + +// if any aliases reference each other, we should +// merge them together. +function combineAliases (aliases) { + var aliasArrays = [] + var change = true + var combined = {} + + // turn alias lookup hash {key: ['alias1', 'alias2']} into + // a simple array ['key', 'alias1', 'alias2'] + Object.keys(aliases).forEach(function (key) { + aliasArrays.push( + [].concat(aliases[key], key) + ) + }) + + // combine arrays until zero changes are + // made in an iteration. + while (change) { + change = false + for (var i = 0; i < aliasArrays.length; i++) { + for (var ii = i + 1; ii < aliasArrays.length; ii++) { + var intersect = aliasArrays[i].filter(function (v) { + return aliasArrays[ii].indexOf(v) !== -1 + }) + + if (intersect.length) { + aliasArrays[i] = aliasArrays[i].concat(aliasArrays[ii]) + aliasArrays.splice(ii, 1) + change = true + break + } + } + } + } + + // map arrays back to the hash-lookup (de-dupe while + // we're at it). + aliasArrays.forEach(function (aliasArray) { + aliasArray = aliasArray.filter(function (v, i, self) { + return self.indexOf(v) === i + }) + combined[aliasArray.pop()] = aliasArray + }) + + return combined +} + +// this function should only be called when a count is given as an arg +// it is NOT called to set a default value +// thus we can start the count at 1 instead of 0 +function increment (orig) { + return orig !== undefined ? orig + 1 : 1 +} + +function Parser (args, opts) { + var result = parse(args.slice(), opts) + + return result.argv +} + +// parse arguments and return detailed +// meta information, aliases, etc. +Parser.detailed = function (args, opts) { + return parse(args.slice(), opts) +} + +module.exports = Parser diff --git a/node_modules/yargs-parser/lib/tokenize-arg-string.js b/node_modules/yargs-parser/lib/tokenize-arg-string.js new file mode 100644 index 0000000..fe05e27 --- /dev/null +++ b/node_modules/yargs-parser/lib/tokenize-arg-string.js @@ -0,0 +1,40 @@ +// take an un-split argv string and tokenize it. +module.exports = function (argString) { + if (Array.isArray(argString)) { + return argString.map(e => typeof e !== 'string' ? e + '' : e) + } + + argString = argString.trim() + + var i = 0 + var prevC = null + var c = null + var opening = null + var args = [] + + for (var ii = 0; ii < argString.length; ii++) { + prevC = c + c = argString.charAt(ii) + + // split on spaces unless we're in quotes. + if (c === ' ' && !opening) { + if (!(prevC === ' ')) { + i++ + } + continue + } + + // don't split the string if we're in matching + // opening or closing single and double quotes. + if (c === opening) { + opening = null + } else if ((c === "'" || c === '"') && !opening) { + opening = c + } + + if (!args[i]) args[i] = '' + args[i] += c + } + + return args +} diff --git a/node_modules/yargs-parser/package.json b/node_modules/yargs-parser/package.json new file mode 100644 index 0000000..753d92a --- /dev/null +++ b/node_modules/yargs-parser/package.json @@ -0,0 +1,79 @@ +{ + "_from": "yargs-parser@^13.1.0", + "_id": "yargs-parser@13.1.1", + "_inBundle": false, + "_integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==", + "_location": "/yargs-parser", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "yargs-parser@^13.1.0", + "name": "yargs-parser", + "escapedName": "yargs-parser", + "rawSpec": "^13.1.0", + "saveSpec": null, + "fetchSpec": "^13.1.0" + }, + "_requiredBy": [ + "/yargs" + ], + "_resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz", + "_shasum": "d26058532aa06d365fe091f6a1fc06b2f7e5eca0", + "_spec": "yargs-parser@^13.1.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima\\node_modules\\yargs", + "author": { + "name": "Ben Coe", + "email": "ben@npmjs.com" + }, + "bugs": { + "url": "https://github.com/yargs/yargs-parser/issues" + }, + "bundleDependencies": false, + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + }, + "deprecated": false, + "description": "the mighty option parser used by yargs", + "devDependencies": { + "chai": "^4.2.0", + "coveralls": "^3.0.2", + "mocha": "^5.2.0", + "nyc": "^14.1.0", + "standard": "^12.0.1", + "standard-version": "^6.0.0" + }, + "engine": { + "node": ">=6" + }, + "files": [ + "lib", + "index.js" + ], + "homepage": "https://github.com/yargs/yargs-parser#readme", + "keywords": [ + "argument", + "parser", + "yargs", + "command", + "cli", + "parsing", + "option", + "args", + "argument" + ], + "license": "ISC", + "main": "index.js", + "name": "yargs-parser", + "repository": { + "url": "git+ssh://git@github.com/yargs/yargs-parser.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "posttest": "standard", + "release": "standard-version", + "test": "nyc mocha test/*.js" + }, + "version": "13.1.1" +} diff --git a/node_modules/yargs/CHANGELOG.md b/node_modules/yargs/CHANGELOG.md new file mode 100644 index 0000000..d789870 --- /dev/null +++ b/node_modules/yargs/CHANGELOG.md @@ -0,0 +1,1335 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +## [13.3.0](https://www.github.com/yargs/yargs/compare/v13.2.4...v13.3.0) (2019-06-10) + + +### Bug Fixes + +* **deps:** yargs-parser update addressing several parsing bugs ([#1357](https://www.github.com/yargs/yargs/issues/1357)) ([e230d5b](https://www.github.com/yargs/yargs/commit/e230d5b)) + + +### Features + +* **i18n:** swap out os-locale dependency for simple inline implementation ([#1356](https://www.github.com/yargs/yargs/issues/1356)) ([4dfa19b](https://www.github.com/yargs/yargs/commit/4dfa19b)) +* support defaultDescription for positional arguments ([812048c](https://www.github.com/yargs/yargs/commit/812048c)) + +### [13.2.4](https://github.com/yargs/yargs/compare/v13.2.3...v13.2.4) (2019-05-13) + + +### Bug Fixes + +* **i18n:** rename unclear 'implication failed' to 'missing dependent arguments' ([#1317](https://github.com/yargs/yargs/issues/1317)) ([bf46813](https://github.com/yargs/yargs/commit/bf46813)) + + + +### [13.2.3](https://github.com/yargs/yargs/compare/v13.2.2...v13.2.3) (2019-05-05) + + +### Bug Fixes + +* **deps:** upgrade cliui for compatibility with latest chalk. ([#1330](https://github.com/yargs/yargs/issues/1330)) ([b20db65](https://github.com/yargs/yargs/commit/b20db65)) +* address issues with dutch translation ([#1316](https://github.com/yargs/yargs/issues/1316)) ([0295132](https://github.com/yargs/yargs/commit/0295132)) + + +### Tests + +* accept differently formatted output ([#1327](https://github.com/yargs/yargs/issues/1327)) ([c294d1b](https://github.com/yargs/yargs/commit/c294d1b)) + + + +## [13.2.2](https://github.com/yargs/yargs/compare/v13.2.1...v13.2.2) (2019-03-06) + + + +## [13.2.1](https://github.com/yargs/yargs/compare/v13.2.0...v13.2.1) (2019-02-18) + + +### Bug Fixes + +* add zsh script to files array ([3180224](https://github.com/yargs/yargs/commit/3180224)) +* support options/sub-commands in zsh completion ([0a96394](https://github.com/yargs/yargs/commit/0a96394)) + + +# [13.2.0](https://github.com/yargs/yargs/compare/v13.1.0...v13.2.0) (2019-02-15) + + +### Features + +* zsh auto completion ([#1292](https://github.com/yargs/yargs/issues/1292)) ([16c5d25](https://github.com/yargs/yargs/commit/16c5d25)), closes [#1156](https://github.com/yargs/yargs/issues/1156) + + + +# [13.1.0](https://github.com/yargs/yargs/compare/v13.0.0...v13.1.0) (2019-02-12) + + +### Features + +* add applyBeforeValidation, for applying sync middleware before validation ([5be206a](https://github.com/yargs/yargs/commit/5be206a)) + + + + +# [13.0.0](https://github.com/yargs/yargs/compare/v12.0.5...v13.0.0) (2019-02-02) + + +### Bug Fixes + +* **deps:** Update os-locale to avoid security vulnerability ([#1270](https://github.com/yargs/yargs/issues/1270)) ([27bf739](https://github.com/yargs/yargs/commit/27bf739)) +* **validation:** Use the error as a message when none exists otherwise ([#1268](https://github.com/yargs/yargs/issues/1268)) ([0510fe6](https://github.com/yargs/yargs/commit/0510fe6)) +* better bash path completion ([#1272](https://github.com/yargs/yargs/issues/1272)) ([da75ea2](https://github.com/yargs/yargs/commit/da75ea2)) +* middleware added multiple times due to reference bug ([#1282](https://github.com/yargs/yargs/issues/1282)) ([64af518](https://github.com/yargs/yargs/commit/64af518)) + + +### Chores + +* ~drop Node 6 from testing matrix ([#1287](https://github.com/yargs/yargs/issues/1287)) ([ef16792](https://github.com/yargs/yargs/commit/ef16792))~ + * _opting to not drop Node 6 support until April, [see](https://github.com/nodejs/Release)._ +* update dependencies ([#1284](https://github.com/yargs/yargs/issues/1284)) ([f25de4f](https://github.com/yargs/yargs/commit/f25de4f)) + + +### Features + +* Add `.parserConfiguration()` method, deprecating package.json config ([#1262](https://github.com/yargs/yargs/issues/1262)) ([3c6869a](https://github.com/yargs/yargs/commit/3c6869a)) +* adds config option for sorting command output ([#1256](https://github.com/yargs/yargs/issues/1256)) ([6916ce9](https://github.com/yargs/yargs/commit/6916ce9)) +* options/positionals with leading '+' and '0' no longer parse as numbers ([#1286](https://github.com/yargs/yargs/issues/1286)) ([e9dc3aa](https://github.com/yargs/yargs/commit/e9dc3aa)) +* support promises in middleware ([f3a4e4f](https://github.com/yargs/yargs/commit/f3a4e4f)) + + +### BREAKING CHANGES + +* options with leading '+' or '0' now parse as strings +* dropping Node 6 which hits end of life in April 2019 +* see [yargs-parser@12.0.0 CHANGELOG](https://github.com/yargs/yargs-parser/blob/master/CHANGELOG.md#breaking-changes) +* we now warn if the yargs stanza package.json is used. + + + + +## [12.0.5](https://github.com/yargs/yargs/compare/v12.0.4...v12.0.5) (2018-11-19) + + +### Bug Fixes + +* allows camel-case, variadic arguments, and strict mode to be combined ([#1247](https://github.com/yargs/yargs/issues/1247)) ([eacc035](https://github.com/yargs/yargs/commit/eacc035)) + + + + +## [12.0.4](https://github.com/yargs/yargs/compare/v12.0.3...v12.0.4) (2018-11-10) + + +### Bug Fixes + +* don't load config when processing positionals ([5d0dc92](https://github.com/yargs/yargs/commit/5d0dc92)) + + + + +## [12.0.3](https://github.com/yargs/yargs/compare/v12.0.2...v12.0.3) (2018-10-06) + + +### Bug Fixes + +* $0 contains first arg in bundled electron apps ([#1206](https://github.com/yargs/yargs/issues/1206)) ([567820b](https://github.com/yargs/yargs/commit/567820b)) +* accept single function for middleware ([66fd6f7](https://github.com/yargs/yargs/commit/66fd6f7)), closes [#1214](https://github.com/yargs/yargs/issues/1214) [#1214](https://github.com/yargs/yargs/issues/1214) +* hide `hidden` options from help output even if they are in a group ([#1221](https://github.com/yargs/yargs/issues/1221)) ([da54028](https://github.com/yargs/yargs/commit/da54028)) +* improve Norwegian Bokmål translations ([#1208](https://github.com/yargs/yargs/issues/1208)) ([a458fa4](https://github.com/yargs/yargs/commit/a458fa4)) +* improve Norwegian Nynorsk translations ([#1207](https://github.com/yargs/yargs/issues/1207)) ([d422eb5](https://github.com/yargs/yargs/commit/d422eb5)) + + + + +## [12.0.2](https://github.com/yargs/yargs/compare/v12.0.1...v12.0.2) (2018-09-04) + + +### Bug Fixes + +* middleware should work regardless of when method is called ([664b265](https://github.com/yargs/yargs/commit/664b265)), closes [#1178](https://github.com/yargs/yargs/issues/1178) +* translation not working when using __ with a single parameter ([#1183](https://github.com/yargs/yargs/issues/1183)) ([f449aea](https://github.com/yargs/yargs/commit/f449aea)) +* upgrade os-locale to version that addresses license issue ([#1195](https://github.com/yargs/yargs/issues/1195)) ([efc0970](https://github.com/yargs/yargs/commit/efc0970)) + + + + +## [12.0.1](https://github.com/yargs/yargs/compare/v12.0.0...v12.0.1) (2018-06-29) + + + + +# [12.0.0](https://github.com/yargs/yargs/compare/v11.1.0...v12.0.0) (2018-06-26) + + +### Bug Fixes + +* .argv and .parse() now invoke identical code path ([#1126](https://github.com/yargs/yargs/issues/1126)) ([f13ebf4](https://github.com/yargs/yargs/commit/f13ebf4)) +* remove the trailing white spaces from the help output ([#1090](https://github.com/yargs/yargs/issues/1090)) ([3f0746c](https://github.com/yargs/yargs/commit/3f0746c)) +* **completion:** Avoid default command and recommendations during completion ([#1123](https://github.com/yargs/yargs/issues/1123)) ([036e7c5](https://github.com/yargs/yargs/commit/036e7c5)) + + +### Chores + +* test Node.js 6, 8 and 10 ([#1160](https://github.com/yargs/yargs/issues/1160)) ([84f9d2b](https://github.com/yargs/yargs/commit/84f9d2b)) +* upgrade to version of yargs-parser that does not populate value for unset boolean ([#1104](https://github.com/yargs/yargs/issues/1104)) ([d4705f4](https://github.com/yargs/yargs/commit/d4705f4)) + + +### Features + +* add support for global middleware, useful for shared tasks like metrics ([#1119](https://github.com/yargs/yargs/issues/1119)) ([9d71ac7](https://github.com/yargs/yargs/commit/9d71ac7)) +* allow setting scriptName $0 ([#1143](https://github.com/yargs/yargs/issues/1143)) ([a2f2eae](https://github.com/yargs/yargs/commit/a2f2eae)) +* remove `setPlaceholderKeys` ([#1105](https://github.com/yargs/yargs/issues/1105)) ([6ee2c82](https://github.com/yargs/yargs/commit/6ee2c82)) + + +### BREAKING CHANGES + +* Options absent from `argv` (not set via CLI argument) are now absent from the parsed result object rather than being set with `undefined` +* drop Node 4 from testing matrix, such that we'll gradually start drifting away from supporting Node 4. +* yargs-parser does not populate 'false' when boolean flag is not passed +* tests that assert against help output will need to be updated + + + + +# [11.1.0](https://github.com/yargs/yargs/compare/v11.0.0...v11.1.0) (2018-03-04) + + +### Bug Fixes + +* choose correct config directory when require.main does not exist ([#1056](https://github.com/yargs/yargs/issues/1056)) ([a04678c](https://github.com/yargs/yargs/commit/a04678c)) + + +### Features + +* allow hidden options to be displayed with --show-hidden ([#1061](https://github.com/yargs/yargs/issues/1061)) ([ea862ae](https://github.com/yargs/yargs/commit/ea862ae)) +* extend *.rc files in addition to json ([#1080](https://github.com/yargs/yargs/issues/1080)) ([11691a6](https://github.com/yargs/yargs/commit/11691a6)) + + + + +# [11.0.0](https://github.com/yargs/yargs/compare/v10.1.2...v11.0.0) (2018-01-22) + + +### Bug Fixes + +* Set implicit nargs=1 when type=number requiresArg=true ([#1050](https://github.com/yargs/yargs/issues/1050)) ([2b56812](https://github.com/yargs/yargs/commit/2b56812)) + + +### Features + +* requiresArg is now simply an alias for nargs(1) ([#1054](https://github.com/yargs/yargs/issues/1054)) ([a3ddacc](https://github.com/yargs/yargs/commit/a3ddacc)) + + +### BREAKING CHANGES + +* requiresArg now has significantly different error output, matching nargs. + + + + +## [10.1.2](https://github.com/yargs/yargs/compare/v10.1.1...v10.1.2) (2018-01-17) + + +### Bug Fixes + +* requiresArg should only be enforced if argument exists ([#1043](https://github.com/yargs/yargs/issues/1043)) ([fbf41ae](https://github.com/yargs/yargs/commit/fbf41ae)) + + + + +## [10.1.1](https://github.com/yargs/yargs/compare/v10.1.0...v10.1.1) (2018-01-09) + + +### Bug Fixes + +* Add `dirname` sanity check on `findUp` ([#1036](https://github.com/yargs/yargs/issues/1036)) ([331d103](https://github.com/yargs/yargs/commit/331d103)) + + + + +# [10.1.0](https://github.com/yargs/yargs/compare/v10.0.3...v10.1.0) (2018-01-01) + + +### Bug Fixes + +* 'undefined' should be taken to mean no argument was provided ([#1015](https://github.com/yargs/yargs/issues/1015)) ([c679e90](https://github.com/yargs/yargs/commit/c679e90)) + + +### Features + +* add missing simple chinese locale strings ([#1004](https://github.com/yargs/yargs/issues/1004)) ([3cc24ec](https://github.com/yargs/yargs/commit/3cc24ec)) +* add Norwegian Nynorsk translations ([#1028](https://github.com/yargs/yargs/issues/1028)) ([a5ac213](https://github.com/yargs/yargs/commit/a5ac213)) +* async command handlers ([#1001](https://github.com/yargs/yargs/issues/1001)) ([241124b](https://github.com/yargs/yargs/commit/241124b)) +* middleware ([#881](https://github.com/yargs/yargs/issues/881)) ([77b8dbc](https://github.com/yargs/yargs/commit/77b8dbc)) + + + + +## [10.0.3](https://github.com/yargs/yargs/compare/v10.0.2...v10.0.3) (2017-10-21) + + +### Bug Fixes + +* parse array rather than string, so that quotes are safe ([#993](https://github.com/yargs/yargs/issues/993)) ([c351685](https://github.com/yargs/yargs/commit/c351685)) + + + + +## [10.0.2](https://github.com/yargs/yargs/compare/v10.0.1...v10.0.2) (2017-10-21) + + +### Bug Fixes + +* fix tiny spacing issue with usage ([#992](https://github.com/yargs/yargs/issues/992)) ([7871327](https://github.com/yargs/yargs/commit/7871327)) + + + + +## [10.0.1](https://github.com/yargs/yargs/compare/v10.0.0...v10.0.1) (2017-10-19) + + +### Bug Fixes + +* help strings for nested commands were missing parent commands ([#990](https://github.com/yargs/yargs/issues/990)) ([cd1ca15](https://github.com/yargs/yargs/commit/cd1ca15)) +* use correct completion command in generated completion script ([#988](https://github.com/yargs/yargs/issues/988)) ([3c8ac1d](https://github.com/yargs/yargs/commit/3c8ac1d)) + + + + +# [10.0.0](https://github.com/yargs/yargs/compare/v9.1.0...v10.0.0) (2017-10-18) + + +### Bug Fixes + +* config and normalize can be disabled with false ([#952](https://github.com/yargs/yargs/issues/952)) ([3bb8771](https://github.com/yargs/yargs/commit/3bb8771)) +* less eager help command execution ([#972](https://github.com/yargs/yargs/issues/972)) ([8c1d7bf](https://github.com/yargs/yargs/commit/8c1d7bf)) +* the positional argument parse was clobbering global flag arguments ([#984](https://github.com/yargs/yargs/issues/984)) ([7e58453](https://github.com/yargs/yargs/commit/7e58453)) + + +### Features + +* .usage() can now be used to configure a default command ([#975](https://github.com/yargs/yargs/issues/975)) ([7269531](https://github.com/yargs/yargs/commit/7269531)) +* hidden options are now explicitly indicated using "hidden" flag ([#962](https://github.com/yargs/yargs/issues/962)) ([280d0d6](https://github.com/yargs/yargs/commit/280d0d6)) +* introduce .positional() for configuring positional arguments ([#967](https://github.com/yargs/yargs/issues/967)) ([cb16460](https://github.com/yargs/yargs/commit/cb16460)) +* replace $0 with file basename ([#983](https://github.com/yargs/yargs/issues/983)) ([20bb99b](https://github.com/yargs/yargs/commit/20bb99b)) + + +### BREAKING CHANGES + +* .usage() no longer accepts an options object as the second argument. It can instead be used as an alias for configuring a default command. +* previously hidden options were simply implied using a falsy description +* help command now only executes if it's the last positional in argv._ + + + + +# [9.1.0](https://github.com/yargs/yargs/compare/v9.0.1...v9.1.0) (2017-09-25) + + +### Bug Fixes + +* **command:** Run default cmd even if the only cmd ([#950](https://github.com/yargs/yargs/issues/950)) ([7b22203](https://github.com/yargs/yargs/commit/7b22203)) + + +### Features + +* multiple usage calls are now collected, not replaced ([#958](https://github.com/yargs/yargs/issues/958)) ([74a38b2](https://github.com/yargs/yargs/commit/74a38b2)) + + + + +## [9.0.1](https://github.com/yargs/yargs/compare/v9.0.0...v9.0.1) (2017-09-17) + + +### Bug Fixes + +* implications fails only displayed once ([#954](https://github.com/yargs/yargs/issues/954)) ([ac8088b](https://github.com/yargs/yargs/commit/ac8088b)) + + + + +# [9.0.0](https://github.com/yargs/yargs/compare/v8.0.2...v9.0.0) (2017-09-03) + + +### Bug Fixes + +* 'undefined' default value for choices resulted in validation failing ([782b896](https://github.com/yargs/yargs/commit/782b896)) +* address bug with handling of arrays of implications ([c240661](https://github.com/yargs/yargs/commit/c240661)) +* defaulting keys to 'undefined' interfered with conflicting key logic ([a8e0cff](https://github.com/yargs/yargs/commit/a8e0cff)) +* don't bother calling JSON.stringify() on string default values ([#891](https://github.com/yargs/yargs/issues/891)) ([628be21](https://github.com/yargs/yargs/commit/628be21)) +* exclude positional arguments from completion output ([#927](https://github.com/yargs/yargs/issues/927)) ([71c7ec7](https://github.com/yargs/yargs/commit/71c7ec7)) +* strict mode should not fail for hidden options ([#949](https://github.com/yargs/yargs/issues/949)) ([0e0c58d](https://github.com/yargs/yargs/commit/0e0c58d)) + + +### Features + +* allow implies and conflicts to accept array values ([#922](https://github.com/yargs/yargs/issues/922)) ([abdc7da](https://github.com/yargs/yargs/commit/abdc7da)) +* allow parse with no arguments as alias for yargs.argv ([#944](https://github.com/yargs/yargs/issues/944)) ([a9f03e7](https://github.com/yargs/yargs/commit/a9f03e7)) +* enable .help() and .version() by default ([#912](https://github.com/yargs/yargs/issues/912)) ([1ef44e0](https://github.com/yargs/yargs/commit/1ef44e0)) +* to allow both undefined and nulls, for benefit of TypeScript ([#945](https://github.com/yargs/yargs/issues/945)) ([792564d](https://github.com/yargs/yargs/commit/792564d)) + + +### BREAKING CHANGES + +* version() and help() are now enabled by default, and show up in help output; the implicit help command can no longer be enabled/disabled independently from the help command itself (which can now be disabled). +* parse() now behaves as an alias for .argv, unless a parseCallback is provided. + + + + +## [8.0.2](https://github.com/yargs/yargs/compare/v8.0.1...v8.0.2) (2017-06-12) + + + + +## [8.0.1](https://github.com/yargs/yargs/compare/v8.0.0...v8.0.1) (2017-05-02) + + + + +# [8.0.0](https://github.com/yargs/yargs/compare/v7.1.0...v8.0.0) (2017-05-01) + + +### Bug Fixes + +* commands are now applied in order, from left to right ([#857](https://github.com/yargs/yargs/issues/857)) ([baba863](https://github.com/yargs/yargs/commit/baba863)) +* help now takes precedence over command recommendation ([#866](https://github.com/yargs/yargs/issues/866)) ([17e3567](https://github.com/yargs/yargs/commit/17e3567)) +* positional arguments now work if no handler is provided to inner command ([#864](https://github.com/yargs/yargs/issues/864)) ([e28ded3](https://github.com/yargs/yargs/commit/e28ded3)) + + +### Chores + +* upgrade yargs-parser ([#867](https://github.com/yargs/yargs/issues/867)) ([8f9c6c6](https://github.com/yargs/yargs/commit/8f9c6c6)) + + +### Features + +* allow extends to inherit from a module ([#865](https://github.com/yargs/yargs/issues/865)) ([89456d9](https://github.com/yargs/yargs/commit/89456d9)) +* allow strict mode to be disabled ([#840](https://github.com/yargs/yargs/issues/840)) ([6f78c05](https://github.com/yargs/yargs/commit/6f78c05)) + + +### BREAKING CHANGES + +* extends functionality now always loads the JSON provided, rather than reading from a specific key +* Node 4+ is now required; this will allow us to start updating our dependencies. +* the first argument to strict() is now used to enable/disable its functionality, rather than controlling whether or not it is global. + + + + +# [7.1.0](https://github.com/yargs/yargs/compare/v7.0.2...v7.1.0) (2017-04-13) + + +### Bug Fixes + +* fix demandOption no longer treats 'false' as truthy ([#829](https://github.com/yargs/yargs/issues/829)) ([c748dd2](https://github.com/yargs/yargs/commit/c748dd2)) +* get terminalWidth in non interactive mode no longer causes a validation exception ([#837](https://github.com/yargs/yargs/issues/837)) ([360e301](https://github.com/yargs/yargs/commit/360e301)) +* we shouldn't output help if we've printed a prior help-like message ([#847](https://github.com/yargs/yargs/issues/847)) ([17e89bd](https://github.com/yargs/yargs/commit/17e89bd)) + + +### Features + +* add support for numeric commands ([#825](https://github.com/yargs/yargs/issues/825)) ([fde0564](https://github.com/yargs/yargs/commit/fde0564)) + + + + +## [7.0.2](https://github.com/yargs/yargs/compare/v7.0.1...v7.0.2) (2017-03-10) + + +### Bug Fixes + +* populating placeholder arguments broke validation ([b3eb2fe](https://github.com/yargs/yargs/commit/b3eb2fe)) + + + + +## [7.0.1](https://github.com/yargs/yargs/compare/v7.0.0...v7.0.1) (2017-03-03) + + +### Bug Fixes + +* --help with default command should print top-level help ([#810](https://github.com/yargs/yargs/issues/810)) ([9c03fa4](https://github.com/yargs/yargs/commit/9c03fa4)) + + + + +# [7.0.0](https://github.com/yargs/yargs/compare/v6.6.0...v7.0.0) (2017-02-26) + + +### Bug Fixes + +* address min/max validation message regression ([#750](https://github.com/yargs/yargs/issues/750)) ([2e5ce0f](https://github.com/yargs/yargs/commit/2e5ce0f)) +* address positional argument strict() bug introduced in [#766](https://github.com/yargs/yargs/issues/766) ([#784](https://github.com/yargs/yargs/issues/784)) ([a8528e6](https://github.com/yargs/yargs/commit/a8528e6)) +* console.warn() rather than throwing errors when api signatures are incorrect ([#804](https://github.com/yargs/yargs/issues/804)) ([a607061](https://github.com/yargs/yargs/commit/a607061)) +* context should override parsed argv ([#786](https://github.com/yargs/yargs/issues/786)) ([0997288](https://github.com/yargs/yargs/commit/0997288)) +* context variables are now recognized in strict() mode ([#796](https://github.com/yargs/yargs/issues/796)) ([48575cd](https://github.com/yargs/yargs/commit/48575cd)) +* errors were not bubbling appropriately from sub-commands to top-level ([#802](https://github.com/yargs/yargs/issues/802)) ([8a992f5](https://github.com/yargs/yargs/commit/8a992f5)) +* positional arguments of sub-commands threw strict() exception ([#805](https://github.com/yargs/yargs/issues/805)) ([f3f074b](https://github.com/yargs/yargs/commit/f3f074b)) +* pull in yargs-parser with modified env precedence ([#787](https://github.com/yargs/yargs/issues/787)) ([e0fbbe5](https://github.com/yargs/yargs/commit/e0fbbe5)) +* running parse() multiple times on the same yargs instance caused exception if help() enabled ([#790](https://github.com/yargs/yargs/issues/790)) ([07e39b7](https://github.com/yargs/yargs/commit/07e39b7)) +* use path.resolve() to support node 0.10 ([#797](https://github.com/yargs/yargs/issues/797)) ([49a93fc](https://github.com/yargs/yargs/commit/49a93fc)) + + +### Features + +* add conflicts and implies shorthands. ([#753](https://github.com/yargs/yargs/issues/753)) ([bd1472b](https://github.com/yargs/yargs/commit/bd1472b)) +* add traditional Chinese translation ([#780](https://github.com/yargs/yargs/issues/780)) ([6ab6a95](https://github.com/yargs/yargs/commit/6ab6a95)) +* allow provided config object to extend other configs ([#779](https://github.com/yargs/yargs/issues/779)) ([3280dd0](https://github.com/yargs/yargs/commit/3280dd0)) +* function argument validation ([#773](https://github.com/yargs/yargs/issues/773)) ([22ed9bb](https://github.com/yargs/yargs/commit/22ed9bb)) +* if only one column is provided for examples, allow it to take up the entire line ([#749](https://github.com/yargs/yargs/issues/749)) ([7931652](https://github.com/yargs/yargs/commit/7931652)) +* introduce custom yargs error object ([#765](https://github.com/yargs/yargs/issues/765)) ([8308efa](https://github.com/yargs/yargs/commit/8308efa)) +* introduces support for default commands, using the '*' identifier ([#785](https://github.com/yargs/yargs/issues/785)) ([d78a0f5](https://github.com/yargs/yargs/commit/d78a0f5)) +* rethink how options are inherited by commands ([#766](https://github.com/yargs/yargs/issues/766)) ([ab1fa4b](https://github.com/yargs/yargs/commit/ab1fa4b)) + + +### BREAKING CHANGES + +* `extends` key in config file is now used for extending other config files +* environment variables now take precedence over config files. +* context now takes precedence over argv and defaults +* the arguments passed to functions are now validated, there's a good chance this will throw exceptions for a few folks who are using the API in an unexpected way. +* by default options, and many of yargs' parsing helpers will now default to being applied globally; such that they are no-longer reset before being passed into commands. +* yargs will no longer aggressively suppress errors, allowing errors that are not generated internally to bubble. + + + + +# [6.6.0](https://github.com/yargs/yargs/compare/v6.5.0...v6.6.0) (2016-12-29) + + +### Bug Fixes + +* [object Object] was accidentally being populated on options object ([#736](https://github.com/yargs/yargs/issues/736)) ([f755e27](https://github.com/yargs/yargs/commit/f755e27)) +* do not use cwd when resolving package.json for yargs parsing config ([#726](https://github.com/yargs/yargs/issues/726)) ([9bdaab7](https://github.com/yargs/yargs/commit/9bdaab7)) + + +### Features + +* implement conflicts() for defining mutually exclusive arguments; thanks [@madcampos](https://github.com/madcampos)! ([#741](https://github.com/yargs/yargs/issues/741)) ([5883779](https://github.com/yargs/yargs/commit/5883779)) +* split demand() into demandCommand()/demandOption() ([#740](https://github.com/yargs/yargs/issues/740)) ([66573c8](https://github.com/yargs/yargs/commit/66573c8)) +* support for positional argument aliases ([#727](https://github.com/yargs/yargs/issues/727)) ([27e1a57](https://github.com/yargs/yargs/commit/27e1a57)) + + + + +# [6.5.0](https://github.com/yargs/yargs/compare/v6.4.0...v6.5.0) (2016-12-01) + + +### Bug Fixes + +* still freeze/unfreeze if parse() is called in isolation ([#717](https://github.com/yargs/yargs/issues/717)) ([30a9492](https://github.com/yargs/yargs/commit/30a9492)) + + +### Features + +* pull in yargs-parser introducing additional settings ([#688](https://github.com/yargs/yargs/issues/688)), and fixing [#716](https://github.com/yargs/yargs/issues/716) ([#722](https://github.com/yargs/yargs/issues/722)) ([702995a](https://github.com/yargs/yargs/commit/702995a)) + + + + +# [6.4.0](https://github.com/yargs/yargs/compare/v6.3.0...v6.4.0) (2016-11-13) + + +### Bug Fixes + +* **locales:** correct some Russian translations ([#691](https://github.com/yargs/yargs/issues/691)) ([a980671](https://github.com/yargs/yargs/commit/a980671)) + + +### Features + +* **locales:** Added Belarusian translation ([#690](https://github.com/yargs/yargs/issues/690)) ([68dac1f](https://github.com/yargs/yargs/commit/68dac1f)) +* **locales:** Create nl.json ([#687](https://github.com/yargs/yargs/issues/687)) ([46ce1bb](https://github.com/yargs/yargs/commit/46ce1bb)) +* update to yargs-parser that addresses [#598](https://github.com/yargs/yargs/issues/598), [#617](https://github.com/yargs/yargs/issues/617) ([#700](https://github.com/yargs/yargs/issues/700)) ([54cb31d](https://github.com/yargs/yargs/commit/54cb31d)) +* yargs is now passed as the third-argument to fail handler ([#613](https://github.com/yargs/yargs/issues/613)) ([21b74f9](https://github.com/yargs/yargs/commit/21b74f9)) + + +### Performance Improvements + +* normalizing package data is an expensive operation ([#705](https://github.com/yargs/yargs/issues/705)) ([49cf533](https://github.com/yargs/yargs/commit/49cf533)) + + + + +# [6.3.0](https://github.com/yargs/yargs/compare/v6.2.0...v6.3.0) (2016-10-19) + + +### Bug Fixes + +* **command:** subcommands via commandDir() now supported for parse(msg, cb) ([#678](https://github.com/yargs/yargs/issues/678)) ([6b85cc6](https://github.com/yargs/yargs/commit/6b85cc6)) + + +### Features + +* **locales:** Add Thai locale file ([#679](https://github.com/yargs/yargs/issues/679)) ([c05e36b](https://github.com/yargs/yargs/commit/c05e36b)) + + + + +# [6.2.0](https://github.com/yargs/yargs/compare/v6.1.1...v6.2.0) (2016-10-16) + + +### Bug Fixes + +* stop applying parser to context object ([#675](https://github.com/yargs/yargs/issues/675)) ([3fe9b8f](https://github.com/yargs/yargs/commit/3fe9b8f)) + + +### Features + +* add new pt_BR translations ([#674](https://github.com/yargs/yargs/issues/674)) ([5615a82](https://github.com/yargs/yargs/commit/5615a82)) +* Italian translations for 'did you mean' and 'aliases' ([#673](https://github.com/yargs/yargs/issues/673)) ([81984e6](https://github.com/yargs/yargs/commit/81984e6)) + + + + +## [6.1.1](https://github.com/yargs/yargs/compare/v6.1.0...v6.1.1) (2016-10-15) + + +### Bug Fixes + +* freeze was not resetting configObjects to initial state; addressed performance issue raised by [@nexdrew](https://github.com/nexdrew). ([#670](https://github.com/yargs/yargs/issues/670)) ([ae4bcd4](https://github.com/yargs/yargs/commit/ae4bcd4)) + + + + +# [6.1.0](https://github.com/yargs/yargs/compare/v6.0.0...v6.1.0) (2016-10-15) + + +### Bug Fixes + +* **locales:** change some translations ([#667](https://github.com/yargs/yargs/issues/667)) ([aa966c5](https://github.com/yargs/yargs/commit/aa966c5)) +* **locales:** conform hi locale to y18n.__n expectations ([#666](https://github.com/yargs/yargs/issues/666)) ([22adb18](https://github.com/yargs/yargs/commit/22adb18)) + + +### Features + +* initial support for command aliases ([#647](https://github.com/yargs/yargs/issues/647)) ([127a040](https://github.com/yargs/yargs/commit/127a040)) +* **command:** add camelcase commands to argv ([#658](https://github.com/yargs/yargs/issues/658)) ([b1cabae](https://github.com/yargs/yargs/commit/b1cabae)) +* **locales:** add Hindi translations ([9290912](https://github.com/yargs/yargs/commit/9290912)) +* **locales:** add Hungarian translations ([be92327](https://github.com/yargs/yargs/commit/be92327)) +* **locales:** Japanese translations for 'did you mean' and 'aliases' ([#651](https://github.com/yargs/yargs/issues/651)) ([5eb78fc](https://github.com/yargs/yargs/commit/5eb78fc)) +* **locales:** Polish translations for 'did you mean' and 'aliases' ([#650](https://github.com/yargs/yargs/issues/650)) ([c951c0e](https://github.com/yargs/yargs/commit/c951c0e)) +* reworking yargs API to make it easier to run in headless environments, e.g., Slack ([#646](https://github.com/yargs/yargs/issues/646)) ([f284c29](https://github.com/yargs/yargs/commit/f284c29)) +* Turkish translations for 'did you mean' and 'aliases' ([#660](https://github.com/yargs/yargs/issues/660)) ([072fd45](https://github.com/yargs/yargs/commit/072fd45)) + + + + +# [6.0.0](https://github.com/yargs/yargs/compare/v5.0.0...v6.0.0) (2016-09-30) + + +### Bug Fixes + +* changed parsing of the command string to ignore extra spaces ([#600](https://github.com/yargs/yargs/issues/600)) ([e8e5a72](https://github.com/yargs/yargs/commit/e8e5a72)) +* drop lodash.assign ([#641](https://github.com/yargs/yargs/issues/641)) ([ad3146f](https://github.com/yargs/yargs/commit/ad3146f)) +* for args that have skipValidation set to `true`, check if the parsed arg is `true` ([#619](https://github.com/yargs/yargs/issues/619)) ([658a34c](https://github.com/yargs/yargs/commit/658a34c)) +* upgrade standard, and fix appveyor config so that it works with newest standard ([#607](https://github.com/yargs/yargs/issues/607)) ([c301f42](https://github.com/yargs/yargs/commit/c301f42)) + + +### Chores + +* upgrade yargs-parser ([#633](https://github.com/yargs/yargs/issues/633)) ([cc1224e](https://github.com/yargs/yargs/commit/cc1224e)) + + +### Features + +* make opts object optional for .option() ([#624](https://github.com/yargs/yargs/issues/624)) ([4f29de6](https://github.com/yargs/yargs/commit/4f29de6)) + + +### Performance Improvements + +* defer windowWidth() to improve perf for non-help usage ([#610](https://github.com/yargs/yargs/issues/610)) ([cbc3636](https://github.com/yargs/yargs/commit/cbc3636)) + + +### BREAKING CHANGES + +* coerce is now applied as a final step after other parsing is complete + + + + +# [5.0.0](https://github.com/yargs/yargs/compare/v4.8.1...v5.0.0) (2016-08-14) + + +### Bug Fixes + +* **default:** Remove undocumented alias of default() ([#469](https://github.com/yargs/yargs/issues/469)) ([b8591b2](https://github.com/yargs/yargs/commit/b8591b2)) +* remove deprecated zh.json ([#578](https://github.com/yargs/yargs/issues/578)) ([317c62c](https://github.com/yargs/yargs/commit/317c62c)) + + +### Features + +* .help() API can now enable implicit help command ([#574](https://github.com/yargs/yargs/issues/574)) ([7645019](https://github.com/yargs/yargs/commit/7645019)) +* **command:** builder function no longer needs to return the yargs instance ([#549](https://github.com/yargs/yargs/issues/549)) ([eaa2873](https://github.com/yargs/yargs/commit/eaa2873)) +* add coerce api ([#586](https://github.com/yargs/yargs/issues/586)) ([1d53ccb](https://github.com/yargs/yargs/commit/1d53ccb)) +* adds recommendCommands() for command suggestions ([#580](https://github.com/yargs/yargs/issues/580)) ([59474dc](https://github.com/yargs/yargs/commit/59474dc)) +* apply .env() globally ([#553](https://github.com/yargs/yargs/issues/553)) ([be65728](https://github.com/yargs/yargs/commit/be65728)) +* apply default builder to command() and apply fail() handlers globally ([#583](https://github.com/yargs/yargs/issues/583)) ([0aaa68b](https://github.com/yargs/yargs/commit/0aaa68b)) +* update yargs-parser to version 3.1.0 ([#581](https://github.com/yargs/yargs/issues/581)) ([882a127](https://github.com/yargs/yargs/commit/882a127)) + + +### Performance Improvements + +* defer requiring most external libs until needed ([#584](https://github.com/yargs/yargs/issues/584)) ([f9b0ed4](https://github.com/yargs/yargs/commit/f9b0ed4)) + + +### BREAKING CHANGES + +* fail is now applied globally. +* we now default to an empty builder function when command is executed with no builder. +* yargs-parser now better handles negative integer values, at the cost of handling numeric option names, e.g., -1 hello +* default: removed undocumented `defaults` alias for `default`. +* introduces a default `help` command which outputs help, as an alternative to a help flag. +* interpret demand() numbers as relative to executing command ([#582](https://github.com/yargs/yargs/issues/582)) ([927810c](https://github.com/yargs/yargs/commit/927810c)) + + + + +## [4.8.1](https://github.com/yargs/yargs/compare/v4.8.0...v4.8.1) (2016-07-16) + + +### Bug Fixes + +* **commandDir:** make dir relative to caller instead of require.main.filename ([#548](https://github.com/yargs/yargs/issues/548)) ([3c2e479](https://github.com/yargs/yargs/commit/3c2e479)) +* add config lookup for .implies() ([#556](https://github.com/yargs/yargs/issues/556)) ([8d7585c](https://github.com/yargs/yargs/commit/8d7585c)) +* cache pkg lookups by path to avoid returning the wrong one ([#552](https://github.com/yargs/yargs/issues/552)) ([fea7e0b](https://github.com/yargs/yargs/commit/fea7e0b)) +* positional arguments were not being handled appropriately by parse() ([#559](https://github.com/yargs/yargs/issues/559)) ([063a866](https://github.com/yargs/yargs/commit/063a866)) +* pull in [@nexdrew](https://github.com/nexdrew)'s fixes to yargs-parser ([#560](https://github.com/yargs/yargs/issues/560)) ([c77c080](https://github.com/yargs/yargs/commit/c77c080)), closes [#560](https://github.com/yargs/yargs/issues/560) + + + + +# [4.8.0](https://github.com/yargs/yargs/compare/v4.7.1...v4.8.0) (2016-07-09) + + +### Bug Fixes + +* drop unused camelcase dependency fixes [#516](https://github.com/yargs/yargs/issues/516) ([#525](https://github.com/yargs/yargs/issues/525)) ([365fb9a](https://github.com/yargs/yargs/commit/365fb9a)), closes [#516](https://github.com/yargs/yargs/issues/516) [#525](https://github.com/yargs/yargs/issues/525) +* fake a tty in tests, so that we can use the new set-blocking ([#512](https://github.com/yargs/yargs/issues/512)) ([a54c742](https://github.com/yargs/yargs/commit/a54c742)) +* ignore invalid package.json during read-pkg-up ([#546](https://github.com/yargs/yargs/issues/546)) ([e058c87](https://github.com/yargs/yargs/commit/e058c87)) +* keep both zh and zh_CN until yargs[@5](https://github.com/5).x ([0f8faa7](https://github.com/yargs/yargs/commit/0f8faa7)) +* lazy-load package.json and cache. get rid of pkg-conf dependency. ([#544](https://github.com/yargs/yargs/issues/544)) ([2609b2e](https://github.com/yargs/yargs/commit/2609b2e)) +* we now respect the order of _ when applying commands ([#537](https://github.com/yargs/yargs/issues/537)) ([ed86b78](https://github.com/yargs/yargs/commit/ed86b78)) + + +### Features + +* add .commandDir(dir) to API to apply all command modules from a relative directory ([#494](https://github.com/yargs/yargs/issues/494)) ([b299dff](https://github.com/yargs/yargs/commit/b299dff)) +* **command:** derive missing command string from module filename ([#527](https://github.com/yargs/yargs/issues/527)) ([20d4b8a](https://github.com/yargs/yargs/commit/20d4b8a)) +* builder is now optional for a command module ([#545](https://github.com/yargs/yargs/issues/545)) ([8d6ad6e](https://github.com/yargs/yargs/commit/8d6ad6e)) + + + + +## [4.7.1](https://github.com/yargs/yargs/compare/v4.7.0...v4.7.1) (2016-05-15) + + +### Bug Fixes + +* switch to using `const` rather than `var` ([#499](https://github.com/yargs/yargs/pull/499)) +* make stdout flush on newer versions of Node.js ([#501](https://github.com/yargs/yargs/issues/501)) ([9f8c6f4](https://github.com/yargs/yargs/commit/9f8c6f4)) + + + + +# [4.7.0](https://github.com/yargs/yargs/compare/v4.6.0...v4.7.0) (2016-05-02) + + +### Bug Fixes + +* **pkgConf:** fix aliases issues in .pkgConf() ([#478](https://github.com/yargs/yargs/issues/478))([b900502](https://github.com/yargs/yargs/commit/b900502)) + + +### Features + +* **completion:** allow to get completions for any string, not just process.argv ([#470](https://github.com/yargs/yargs/issues/470))([74fcfbc](https://github.com/yargs/yargs/commit/74fcfbc)) +* **configuration:** Allow to directly pass a configuration object to .config() ([#480](https://github.com/yargs/yargs/issues/480))([e0a7e05](https://github.com/yargs/yargs/commit/e0a7e05)) +* **validation:** Add .skipValidation() method ([#471](https://github.com/yargs/yargs/issues/471))([d72badb](https://github.com/yargs/yargs/commit/d72badb)) + + + + +# [4.6.0](https://github.com/yargs/yargs/compare/v4.5.0...v4.6.0) (2016-04-11) + + +### Bug Fixes + +* **my brand!:** I agree with [@osher](https://github.com/osher) lightweight isn't a huge selling point of ours any longer, see [#468](https://github.com/yargs/yargs/issues/468) ([c46d7e1](https://github.com/yargs/yargs/commit/c46d7e1)) + +### Features + +* switch to standard-version for release management ([f70f801](https://github.com/yargs/yargs/commit/f70f801)) +* upgrade to version of yargs-parser that introduces some slick new features, great work [@elas7](https://github.com/elas7). update cliui, replace win-spawn, replace badge. ([#475](https://github.com/yargs/yargs/issues/475)) ([f915dd4](https://github.com/yargs/yargs/commit/f915dd4)) + + + + +# [4.5.0](https://github.com/yargs/yargs/compare/v4.4.0...v4.5.0) (2016-04-05) + + +### Bug Fixes + +* **windows:** handle $0 better on Windows platforms ([eb6e03f](https://github.com/yargs/yargs/commit/eb6e03f)) + +### Features + +* **commands:** implemented variadic positional arguments ([51d926e](https://github.com/yargs/yargs/commit/51d926e)) +* **completion:** completion now better handles aliases, and avoids duplicating keys. ([86416c8](https://github.com/yargs/yargs/commit/86416c8)) +* **config:** If invoking .config() without parameters, set a default option ([0413dd1](https://github.com/yargs/yargs/commit/0413dd1)) +* **conventional-changelog:** switching to using conventional-changelog for generating the changelog ([a2b5a2a](https://github.com/yargs/yargs/commit/a2b5a2a)) + + + +### v4.4.0 (2016/04/03 21:10 +07:00) + +- [#454](https://github.com/yargs/yargs/pull/454) fix demand() when second argument is an array (@elas7) +- [#452](https://github.com/yargs/yargs/pull/452) fix code example for `.help()` docs (@maxrimue) +- [#450](https://github.com/yargs/yargs/pull/450) fix for bash completion trailing space edge-case (@elas7) +- [#448](https://github.com/yargs/yargs/pull/448) allow a method to be passed to `showHelp`, rather than a log-level (@osher) +- [#446](https://github.com/yargs/yargs/pull/446) update yargs-parser, y18n, nyc, cliui, pkg-conf (@bcoe) +- [#436](https://github.com/yargs/yargs/pull/436) the rebase method is only used by tests, do not export it in two places (@elas7) +- [#428](https://github.com/yargs/yargs/pull/428) initial support for subcommands (@nexdrew) + +### v4.3.2 (2016/3/20 15:07 +07:00) + +- [#445](https://github.com/yargs/yargs/pull/445) strict mode was failing if no commands were registered (@nexdrew) +- [#443](https://github.com/yargs/yargs/pull/443) adds Italian translation \o/ (@madrisan) +- [#441](https://github.com/yargs/yargs/pull/441) remove duplicate keys from array options configuration (@elas7) +- [#437](https://github.com/yargs/yargs/pull/437) standardize tests for .command() (@lrlna) + +### v4.3.0 (2016/3/12 14:19 +07:00) + +- [#432](https://github.com/yargs/yargs/pull/432) non-singleton version of yargs (@bcoe) +- [#422, #425, #420] translations for number (@zkat, @rilut, @maxrimue, @watilde) +- [#414](https://github.com/yargs/yargs/pull/414) all command options can be defined in module now (@nexdrew) + +### v4.2.0 (2016/2/22 11:02 +07:00) + +- [#395](https://github.com/yargs/yargs/pull/395) do not reset groups if they contain + global keys (@novemberborn) +- [#393](https://github.com/yargs/yargs/pull/393) use sane default for usage strings (@nexdrew) +- [#392](https://github.com/yargs/yargs/pull/392) resetting wrap() was causing layout issues + with commands (@nexdrew) +- [#391](https://github.com/yargs/yargs/pull/391) commands were being added multiple times (@nexdrew) + +### v4.0.0 (2016/2/14 1:27 +07:00) + +- [#384](https://github.com/bcoe/yargs/pull/384) add new number type to yargs (@lrlna, @maxrimue) +- [#382](https://github.com/bcoe/yargs/pull/382) pass error as extra parameter to fail (@gajus) +- [#378](https://github.com/bcoe/yargs/pull/378) introduces the pkgConf feature, which tells + yargs to load default argument values from a key on a project's package.json (@bcoe) +- [#376](https://github.com/bcoe/yargs/pull/376) **breaking change**, make help() method signature + more consistent with other commands (@maxrimue) +- [#368](https://github.com/bcoe/yargs/pull/368) **breaking change**, overhaul to command handling API: + introducing named positional arguments, commands as modules, introduces the concept of global options (options that don't reset). (@nexdrew, @bcoe). +- [#364](https://github.com/bcoe/yargs/pull/364) add the slick new yargs website to the package.json (@iarna). +- [#357](https://github.com/bcoe/yargs/pull/357) .strict() now requires that a valid command is provided (@lrlna) +- [#356](https://github.com/bcoe/yargs/pull/356) pull the parsing bits of yargs into the separate module yargs-parser. Various parsing options can now be turned on and off using configuration (@bcoe). +- [#330](https://github.com/bcoe/yargs/pull/330) **breaking change**, fix inconsistencies with `.version()` API. (@maxrimue). + +### v3.32.0 (2016/1/14 10:13 +07:00) + +- [#344](https://github.com/bcoe/yargs/pull/344) yargs now has a code of conduct and contributor guidelines (@bcoe) +- [#341](https://github.com/bcoe/yargs/issues/341) Fix edge-case with camel-case arguments (@davibe) +- [#331](https://github.com/bcoe/yargs/pull/331) Handle parsing a raw argument string (@kellyselden) +- [#325](https://github.com/bcoe/yargs/pull/325) Tweaks to make tests pass again on Windows (@isaacs) +- [#321](https://github.com/bcoe/yargs/pull/321) Custom config parsing function (@bcoe) + +### v3.31.0 (2015/12/03 10:15 +07:00) + +- [#239](https://github.com/bcoe/yargs/pull/239) Pass argv to commands (@bcoe) +- [#308](https://github.com/bcoe/yargs/pull/308) Yargs now handles environment variables (@nexdrew) +- [#302](https://github.com/bcoe/yargs/pull/302) Add Indonesian translation (@rilut) +- [#300](https://github.com/bcoe/yargs/pull/300) Add Turkish translation (@feyzo) +- [#298](https://github.com/bcoe/yargs/pull/298) Add Norwegian Bokmål translation (@sindresorhus) +- [#297](https://github.com/bcoe/yargs/pull/297) Fix for layout of cjk characters (@disjukr) +- [#296](https://github.com/bcoe/yargs/pull/296) Add Korean translation (@disjukr) + +### v3.30.0 (2015/11/13 16:29 +07:00) + +- [#293](https://github.com/bcoe/yargs/pull/293) Polish language support (@kamilogorek) +- [#291](https://github.com/bcoe/yargs/pull/291) fix edge-cases with `.alias()` (@bcoe) +- [#289](https://github.com/bcoe/yargs/pull/289) group options in custom groups (@bcoe) + +### v3.29.0 (2015/10/16 21:51 +07:00) + +- [#282](https://github.com/bcoe/yargs/pull/282) completions now accept promises (@LinusU) +- [#281](https://github.com/bcoe/yargs/pull/281) fix parsing issues with dot notation (@bcoe) + +### v3.28.0 (2015/10/16 1:55 +07:00) + +- [#277](https://github.com/bcoe/yargs/pull/277) adds support for ansi escape codes (@bcoe) + +### v3.27.0 (2015/10/08 1:55 +00:00) + +- [#271](https://github.com/bcoe/yargs/pull/273) skips validation for help or version flags with exitProcess(false) (@tepez) +- [#273](https://github.com/bcoe/yargs/pull/273) implements single output for errors with exitProcess(false) (@nexdrew) +- [#269](https://github.com/bcoe/yargs/pull/269) verifies single output for errors with exitProcess(false) (@tepez) +- [#268](https://github.com/bcoe/yargs/pull/268) adds Chinese translation (@qiu8310) +- [#266](https://github.com/bcoe/yargs/pull/266) adds case for -- after -- in parser test (@geophree) + +### v3.26.0 (2015/09/25 2:14 +00:00) + +- [#263](https://github.com/bcoe/yargs/pull/263) document count() and option() object keys (@nexdrew) +- [#259](https://github.com/bcoe/yargs/pull/259) remove util in readme (@38elements) +- [#258](https://github.com/bcoe/yargs/pull/258) node v4 builds, update deps (@nexdrew) +- [#257](https://github.com/bcoe/yargs/pull/257) fix spelling errors (@dkoleary88) + +### v3.25.0 (2015/09/13 7:38 -07:00) + +- [#254](https://github.com/bcoe/yargs/pull/254) adds Japanese translation (@oti) +- [#253](https://github.com/bcoe/yargs/pull/253) fixes for tests on Windows (@bcoe) + +### v3.24.0 (2015/09/04 12:02 +00:00) + +- [#248](https://github.com/bcoe/yargs/pull/248) reinstate os-locale, no spawning (@nexdrew) +- [#249](https://github.com/bcoe/yargs/pull/249) use travis container-based infrastructure (@nexdrew) +- [#247](https://github.com/bcoe/yargs/pull/247) upgrade standard (@nexdrew) + +### v3.23.0 (2015/08/30 23:00 +00:00) + +- [#246](https://github.com/bcoe/yargs/pull/246) detect locale based only on environment variables (@bcoe) +- [#244](https://github.com/bcoe/yargs/pull/244) adds Windows CI testing (@bcoe) +- [#245](https://github.com/bcoe/yargs/pull/245) adds OSX CI testing (@bcoe, @nexdrew) + +### v3.22.0 (2015/08/28 22:26 +00:00) +- [#242](https://github.com/bcoe/yargs/pull/242) adds detectLocale config option (@bcoe) + +### v3.21.1 (2015/08/28 20:58 +00:00) +- [#240](https://github.com/bcoe/yargs/pull/240) hot-fix for Atom on Windows (@bcoe) + +### v3.21.0 (2015/08/21 21:20 +00:00) +- [#238](https://github.com/bcoe/yargs/pull/238) upgrade camelcase, window-size, chai, mocha (@nexdrew) +- [#237](https://github.com/bcoe/yargs/pull/237) adds defaultDescription to option() (@nexdrew) + +### v3.20.0 (2015/08/20 01:29 +00:00) +- [#231](https://github.com/bcoe/yargs/pull/231) Merge pull request #231 from bcoe/detect-locale (@sindresorhus) +- [#235](https://github.com/bcoe/yargs/pull/235) adds german translation to yargs (@maxrimue) + +### v3.19.0 (2015/08/14 05:12 +00:00) +- [#224](https://github.com/bcoe/yargs/pull/224) added Portuguese translation (@codemonkey3045) + +### v3.18.1 (2015/08/12 05:53 +00:00) + +- [#228](https://github.com/bcoe/yargs/pull/228) notes about embedding yargs in Electron (@etiktin) +- [#223](https://github.com/bcoe/yargs/pull/223) make booleans work in config files (@sgentle) + +### v3.18.0 (2015/08/06 20:05 +00:00) +- [#222](https://github.com/bcoe/yargs/pull/222) updates fr locale (@nexdrew) +- [#221](https://github.com/bcoe/yargs/pull/221) adds missing locale strings (@nexdrew) +- [#220](https://github.com/bcoe/yargs/pull/220) adds es locale (@zkat) + +### v3.17.1 (2015/08/02 19:35 +00:00) +- [#218](https://github.com/bcoe/yargs/pull/218) upgrades nyc (@bcoe) + +### v3.17.0 (2015/08/02 18:39 +00:00) +- [#217](https://github.com/bcoe/yargs/pull/217) sort methods in README.md (@nexdrew) +- [#215](https://github.com/bcoe/yargs/pull/215) adds fr locale (@LoicMahieu) + +### v3.16.0 (2015/07/30 04:35 +00:00) +- [#210](https://github.com/bcoe/yargs/pull/210) adds i18n support to yargs (@bcoe) +- [#209](https://github.com/bcoe/yargs/pull/209) adds choices type to yargs (@nexdrew) +- [#207](https://github.com/bcoe/yargs/pull/207) pretty new shields from shields.io (@SimenB) +- [#208](https://github.com/bcoe/yargs/pull/208) improvements to README.md (@nexdrew) +- [#205](https://github.com/bcoe/yargs/pull/205) faster build times on Travis (@ChristianMurphy) + +### v3.15.0 (2015/07/06 06:01 +00:00) +- [#197](https://github.com/bcoe/yargs/pull/197) tweaks to how errors bubble up from parser.js (@bcoe) +- [#193](https://github.com/bcoe/yargs/pull/193) upgraded nyc, reporting now happens by default (@bcoe) + +### v3.14.0 (2015/06/28 02:12 +00:00) + +- [#192](https://github.com/bcoe/yargs/pull/192) standard style nits (@bcoe) +- [#190](https://github.com/bcoe/yargs/pull/190) allow for hidden commands, e.g., + .completion('completion', false) (@tschaub) + +### v3.13.0 (2015/06/24 04:12 +00:00) + +- [#187](https://github.com/bcoe/yargs/pull/187) completion now behaves differently + if it is being run in the context of a command (@tschaub) +- [#186](https://github.com/bcoe/yargs/pull/186) if no matches are found for a completion + default to filename completion (@tschaub) + +### v3.12.0 (2015/06/19 03:23 +00:00) +- [#183](https://github.com/bcoe/yargs/pull/183) don't complete commands if they've already been completed (@tschaub) +- [#181](https://github.com/bcoe/yargs/pull/181) various fixes for completion. (@bcoe, @tschaub) +- [#182](https://github.com/bcoe/yargs/pull/182) you can now set a maximum # of of required arguments (@bcoe) + +### v3.11.0 (2015/06/15 05:15 +00:00) + +- [#173](https://github.com/bcoe/yargs/pull/173) update standard, window-size, chai (@bcoe) +- [#171](https://github.com/bcoe/yargs/pull/171) a description can now be set + when providing a config option. (@5c077yP) + +### v3.10.0 (2015/05/29 04:25 +00:00) + +- [#165](https://github.com/bcoe/yargs/pull/165) expose yargs.terminalWidth() thanks @ensonic (@bcoe) +- [#164](https://github.com/bcoe/yargs/pull/164) better array handling thanks @getify (@bcoe) + +### v3.9.1 (2015/05/20 05:14 +00:00) +- [b6662b6](https://github.com/bcoe/yargs/commit/b6662b6774cfeab4876f41ec5e2f67b7698f4e2f) clarify .config() docs (@linclark) +- [0291360](https://github.com/bcoe/yargs/commit/02913606285ce31ce81d7f12c48d8a3029776ec7) fixed tests, switched to nyc for coverage, fixed security issue, added Lin as collaborator (@bcoe) + +### v3.9.0 (2015/05/10 18:32 +00:00) +- [#157](https://github.com/bcoe/yargs/pull/157) Merge pull request #157 from bcoe/command-yargs. allows handling of command specific arguments. Thanks for the suggestion @ohjames (@bcoe) +- [#158](https://github.com/bcoe/yargs/pull/158) Merge pull request #158 from kemitchell/spdx-license. Update license format (@kemitchell) + +### v3.8.0 (2015/04/24 23:10 +00:00) +- [#154](https://github.com/bcoe/yargs/pull/154) showHelp's method signature was misleading fixes #153 (@bcoe) +- [#151](https://github.com/bcoe/yargs/pull/151) refactor yargs' table layout logic to use new helper library (@bcoe) +- [#150](https://github.com/bcoe/yargs/pull/150) Fix README example in argument requirements (@annonymouse) + +### v3.7.2 (2015/04/13 11:52 -07:00) + +* [679fbbf](https://github.com/bcoe/yargs/commit/679fbbf55904030ccee8a2635e8e5f46551ab2f0) updated yargs to use the [standard](https://github.com/feross/standard) style guide (agokjr) +* [22382ee](https://github.com/bcoe/yargs/commit/22382ee9f5b495bc2586c1758cd1091cec3647f9 various bug fixes for $0 (@nylen) + +### v3.7.1 (2015/04/10 11:06 -07:00) + +* [89e1992](https://github.com/bcoe/yargs/commit/89e1992a004ba73609b5f9ee6890c4060857aba4) detect iojs bin along with node bin. (@bcoe) +* [755509e](https://github.com/bcoe/yargs/commit/755509ea90041e5f7833bba3b8c5deffe56f0aab) improvements to example documentation in README.md (@rstacruz) +* [0d2dfc8](https://github.com/bcoe/yargs/commit/0d2dfc822a43418242908ad97ddd5291a1b35dc6) showHelp() no longer requires that .argv has been called (@bcoe) + +### v3.7.0 (2015/04/04 02:29 -07:00) + +* [56cbe2d](https://github.com/bcoe/yargs/commit/56cbe2ddd33dc176dcbf97ba40559864a9f114e4) make .requiresArg() work with type hints. (@bcoe). +* [2f5d562](https://github.com/bcoe/yargs/commit/2f5d5624f736741deeedf6a664d57bc4d857bdd0) serialize arrays and objects in usage strings. (@bcoe). +* [5126304](https://github.com/bcoe/yargs/commit/5126304dd18351fc28f10530616fdd9361e0af98) be more lenient about alias/primary key ordering in chaining API. (@bcoe) + +### v3.6.0 (2015/03/21 01:00 +00:00) +- [4e24e22](https://github.com/bcoe/yargs/commit/4e24e22e6a195e55ab943ede704a0231ac33b99c) support for .js configuration files. (@pirxpilot) + +### v3.5.4 (2015/03/12 05:56 +00:00) +- [c16cc08](https://github.com/bcoe/yargs/commit/c16cc085501155cf7fd853ccdf8584b05ab92b78) message for non-option arguments is now optional, thanks to (@raine) + +### v3.5.3 (2015/03/09 06:14 +00:00) +- [870b428](https://github.com/bcoe/yargs/commit/870b428cf515d560926ca392555b7ad57dba9e3d) completion script was missing in package.json (@bcoe) + +### v3.5.2 (2015/03/09 06:11 +00:00) +- [58a4b24](https://github.com/bcoe/yargs/commit/58a4b2473ebbb326713d522be53e32d3aabb08d2) parse was being called multiple times, resulting in strange behavior (@bcoe) + +### v3.5.1 (2015/03/09 04:55 +00:00) +- [4e588e0](https://github.com/bcoe/yargs/commit/4e588e055afbeb9336533095f051496e3977f515) accidentally left testing logic in (@bcoe) + +### v3.5.0 (2015/03/09 04:49 +00:00) +- [718bacd](https://github.com/bcoe/yargs/commit/718bacd81b9b44f786af76b2afe491fe06274f19) added support for bash completions see #4 (@bcoe) +- [a192882](https://github.com/bcoe/yargs/commit/a19288270fc431396c42af01125eeb4443664528) downgrade to mocha 2.1.0 until https://github.com/mochajs/mocha/issues/1585 can be sorted out (@bcoe) + +### v3.4.7 (2015/03/09 04:09 +00:00) +- [9845e5c](https://github.com/bcoe/yargs/commit/9845e5c1a9c684ba0be3f0bfb40e7b62ab49d9c8) the Argv singleton was not being updated when manually parsing arguments, fixes #114 (@bcoe) + +### v3.4.6 (2015/03/09 04:01 +00:00) +- [45b4c80](https://github.com/bcoe/yargs/commit/45b4c80b890d02770b0a94f326695a8a566e8fe9) set placeholders for all keys fixes #115 (@bcoe) + +### v3.4.5 (2015/03/01 20:31 +00:00) +- [a758e0b](https://github.com/bcoe/yargs/commit/a758e0b2556184f067cf3d9c4ef886d39817ebd2) fix for count consuming too many arguments (@bcoe) + +### v3.4.4 (2015/02/28 04:52 +00:00) +- [0476af7](https://github.com/bcoe/yargs/commit/0476af757966acf980d998b45108221d4888cfcb) added nargs feature, allowing you to specify the number of arguments after an option (@bcoe) +- [092477d](https://github.com/bcoe/yargs/commit/092477d7ab3efbf0ba11cede57f7d8cfc70b024f) updated README with full example of v3.0 API (@bcoe) + +### v3.3.3 (2015/02/28 04:23 +00:00) +- [0c4b769](https://github.com/bcoe/yargs/commit/0c4b769516cd8d93a7c4e5e675628ae0049aa9a8) remove string dependency, which conflicted with other libraries see #106 (@bcoe) + +### v3.3.2 (2015/02/28 04:11 +00:00) +- [2a98906](https://github.com/bcoe/yargs/commit/2a9890675821c0e7a12f146ce008b0562cb8ec9a) add $0 to epilog (@schnittstabil) + +### v3.3.1 (2015/02/24 03:28 +00:00) +- [ad485ce](https://github.com/bcoe/yargs/commit/ad485ce748ebdfce25b88ef9d6e83d97a2f68987) fix for applying defaults to camel-case args (@bcoe) + +### v3.3.0 (2015/02/24 00:49 +00:00) +- [8bfe36d](https://github.com/bcoe/yargs/commit/8bfe36d7fb0f93a799ea3f4c756a7467c320f8c0) fix and document restart() command, as a tool for building nested CLIs (@bcoe) + +### v3.2.1 (2015/02/22 05:45 +00:00) +- [49a6d18](https://github.com/bcoe/yargs/commit/49a6d1822a4ef9b1ea6f90cc366be60912628885) you can now provide a function that generates a default value (@bcoe) + +### v3.2.0 (2015/02/22 05:24 +00:00) +- [7a55886](https://github.com/bcoe/yargs/commit/7a55886c9343cf71a20744ca5cdd56d2ea7412d5) improvements to yargs two-column text layout (@bcoe) +- [b6ab513](https://github.com/bcoe/yargs/commit/b6ab5136a4c3fa6aa496f6b6360382e403183989) Tweak NPM version badge (@nylen) + +### v3.1.0 (2015/02/19 19:37 +00:00) +- [9bd2379](https://github.com/bcoe/yargs/commit/9bd237921cf1b61fd9f32c0e6d23f572fc225861) version now accepts a function, making it easy to load version #s from a package.json (@bcoe) + +### v3.0.4 (2015/02/14 01:40 +00:00) +- [0b7c19b](https://github.com/bcoe/yargs/commit/0b7c19beaecb747267ca4cc10e5cb2a8550bc4b7) various fixes for dot-notation handling (@bcoe) + +### v3.0.3 (2015/02/14 00:59 +00:00) +- [c3f35e9](https://github.com/bcoe/yargs/commit/c3f35e99bd5a0d278073fcadd95e2d778616cc17) make sure dot-notation is applied to aliases (@bcoe) + +### 3.0.2 (2015/02/13 16:50 +00:00) +- [74c8967](https://github.com/bcoe/yargs/commit/74c8967c340c204a0a7edf8a702b6f46c2705435) document epilog shorthand of epilogue. (@bcoe) +- [670110f](https://github.com/bcoe/yargs/commit/670110fc01bedc4831b6fec6afac54517d5a71bc) any non-truthy value now causes check to fail see #76 (@bcoe) +- [0d8f791](https://github.com/bcoe/yargs/commit/0d8f791a33c11ced4cd431ea8d3d3a337d456b56) finished implementing my wish-list of fetures for yargs 3.0. see #88 (@bcoe) +- [5768447](https://github.com/bcoe/yargs/commit/5768447447c4c8e8304f178846206ce86540f063) fix coverage. (@bcoe) +- [82e793f](https://github.com/bcoe/yargs/commit/82e793f3f61c41259eaacb67f0796aea2cf2aaa0) detect console width and perform word-wrapping. (@bcoe) +- [67476b3](https://github.com/bcoe/yargs/commit/67476b37eea07fee55f23f35b9e0c7d76682b86d) refactor two-column table layout so that we can use it for examples and usage (@bcoe) +- [4724cdf](https://github.com/bcoe/yargs/commit/4724cdfcc8e37ae1ca3dcce9d762f476e9ef4bb4) major refactor of index.js, in prep for 3.x release. (@bcoe) + +### v2.3.0 (2015/02/08 20:41 +00:00) +- [d824620](https://github.com/bcoe/yargs/commit/d824620493df4e63664af1fe320764dd1a9244e6) allow for undefined boolean defaults (@ashi009) + +### v2.2.0 (2015/02/08 20:07 +00:00) +- [d6edd98](https://github.com/bcoe/yargs/commit/d6edd9848826e7389ed1393858c45d03961365fd) in-prep for further refactoring, and a 3.x release I've shuffled some things around and gotten test-coverage to 100%. (@bcoe) + +### v2.1.2 (2015/02/08 06:05 +00:00) +- [d640745](https://github.com/bcoe/yargs/commit/d640745a7b9f8d476e0223879d056d18d9c265c4) switch to path.relative (@bcoe) +- [3bfd41f](https://github.com/bcoe/yargs/commit/3bfd41ff262a041f29d828b88936a79c63cad594) remove mocha.opts. (@bcoe) +- [47a2f35](https://github.com/bcoe/yargs/commit/47a2f357091db70903a402d6765501c1d63f15fe) document using .string('_') for string ids. see #56 (@bcoe) +- [#57](https://github.com/bcoe/yargs/pull/57) Merge pull request #57 from eush77/option-readme (@eush77) + +### v2.1.1 (2015/02/06 08:08 +00:00) +- [01c6c61](https://github.com/bcoe/yargs/commit/01c6c61d67b4ebf88f41f0b32a345ec67f0ac17d) fix for #71, 'newAliases' of undefined (@bcoe) + +### v2.1.0 (2015/02/06 07:59 +00:00) +- [6a1a3fa](https://github.com/bcoe/yargs/commit/6a1a3fa731958e26ccd56885f183dd8985cc828f) try to guess argument types, and apply sensible defaults see #73 (@bcoe) + +### v2.0.1 (2015/02/06 07:54 +00:00) +- [96a06b2](https://github.com/bcoe/yargs/commit/96a06b2650ff1d085a52b7328d8bba614c20cc12) Fix for strange behavior with --sort option, see #51 (@bcoe) + +### v2.0.0 (2015/02/06 07:45 +00:00) +- [0250517](https://github.com/bcoe/yargs/commit/0250517c9643e53f431b824e8ccfa54937414011) - [108fb84](https://github.com/bcoe/yargs/commit/108fb8409a3a63dcaf99d917fe4dfcfaa1de236d) fixed bug with boolean parsing, when bools separated by = see #66 (@bcoe) +- [a465a59](https://github.com/bcoe/yargs/commit/a465a5915f912715738de890982e4f8395958b10) Add `files` field to the package.json (@shinnn) +- [31043de](https://github.com/bcoe/yargs/commit/31043de7a38a17c4c97711f1099f5fb164334db3) fix for yargs.argv having the same keys added multiple times see #63 (@bcoe) +- [2d68c5b](https://github.com/bcoe/yargs/commit/2d68c5b91c976431001c4863ce47c9297850f1ad) Disable process.exit calls using .exitProcess(false) (@cianclarke) +- [45da9ec](https://github.com/bcoe/yargs/commit/45da9ec4c55a7bd394721bc6a1db0dabad7bc52a) Mention .option in README (@eush77) + +### v1.3.2 (2014/10/06 21:56 +00:00) +- [b8d3472](https://github.com/bcoe/yargs/commit/b8d34725482e5821a3cc809c0df71378f282f526) 1.3.2 (@chevex) + +### list (2014/08/30 18:41 +00:00) +- [fbc777f](https://github.com/bcoe/yargs/commit/fbc777f416eeefd37c84e44d27d7dfc7c1925721) Now that yargs is the successor to optimist, I'm changing the README language to be more universal. Pirate speak isn't very accessible to non-native speakers. (@chevex) +- [a54d068](https://github.com/bcoe/yargs/commit/a54d0682ae2efc2394d407ab171cc8a8bbd135ea) version output will not print extra newline (@boneskull) +- [1cef5d6](https://github.com/bcoe/yargs/commit/1cef5d62a9d6d61a3948a49574892e01932cc6ae) Added contributors section to package.json (@chrisn) +- [cc295c0](https://github.com/bcoe/yargs/commit/cc295c0a80a2de267e0155b60d315fc4b6f7c709) Added 'require' and 'required' as synonyms for 'demand' (@chrisn) +- [d0bf951](https://github.com/bcoe/yargs/commit/d0bf951d949066b6280101ed606593d079ee15c8) Updating minimist. (@chevex) +- [c15f8e7](https://github.com/bcoe/yargs/commit/c15f8e7f245b261e542cf205ce4f4313630cbdb4) Fix #31 (bad interaction between camelCase options and strict mode) (@nylen) +- [d991b9b](https://github.com/bcoe/yargs/commit/d991b9be687a68812dee1e3b185ba64b7778b82d) Added .help() and .version() methods (@chrisn) +- [e8c8aa4](https://github.com/bcoe/yargs/commit/e8c8aa46268379357cb11e9fc34b8c403037724b) Added .showHelpOnFail() method (@chrisn) +- [e855af4](https://github.com/bcoe/yargs/commit/e855af4a933ea966b5bbdd3c4c6397a4bac1a053) Allow boolean flag with .demand() (@chrisn) +- [14dbec2](https://github.com/bcoe/yargs/commit/14dbec24fb7380683198e2b20c4deb8423e64bea) Fixes issue #22. Arguments are no longer printed to the console when using .config. (@chevex) +- [bef74fc](https://github.com/bcoe/yargs/commit/bef74fcddc1544598a804f80d0a3728459f196bf) Informing users that Yargs is the official optimist successor. (@chevex) +- [#24](https://github.com/bcoe/yargs/pull/24) Merge pull request #24 from chrisn/strict (@chrisn) +- [889a2b2](https://github.com/bcoe/yargs/commit/889a2b28eb9768801b05163360a470d0fd6c8b79) Added requiresArg option, for options that require values (@chrisn) +- [eb16369](https://github.com/bcoe/yargs/commit/eb163692262be1fe80b992fd8803d5923c5a9b18) Added .strict() method, to report error if unknown arguments are given (@chrisn) +- [0471c3f](https://github.com/bcoe/yargs/commit/0471c3fd999e1ad4e6cded88b8aa02013b66d14f) Changed optimist to yargs in usage-options.js example (@chrisn) +- [5c88f74](https://github.com/bcoe/yargs/commit/5c88f74e3cf031b17c54b4b6606c83e485ff520e) Change optimist to yargs in examples (@chrisn) +- [66f12c8](https://github.com/bcoe/yargs/commit/66f12c82ba3c943e4de8ca862980e835da8ecb3a) Fix a couple of bad interactions between aliases and defaults (@nylen) +- [8fa1d80](https://github.com/bcoe/yargs/commit/8fa1d80f14b03eb1f2898863a61f1d1615bceb50) Document second argument of usage(message, opts) (@Gobie) +- [56e6528](https://github.com/bcoe/yargs/commit/56e6528cf674ff70d63083fb044ff240f608448e) For "--some-option", also set argv.someOption (@nylen) +- [ed5f6d3](https://github.com/bcoe/yargs/commit/ed5f6d33f57ad1086b11c91b51100f7c6c7fa8ee) Finished porting unit tests to Mocha. (@chevex) + +### v1.0.15 (2014/02/05 23:18 +00:00) +- [e2b1fc0](https://github.com/bcoe/yargs/commit/e2b1fc0c4a59cf532ae9b01b275e1ef57eeb64d2) 1.0.15 update to badges (@chevex) + +### v1.0.14 (2014/02/05 23:17 +00:00) +- [f33bbb0](https://github.com/bcoe/yargs/commit/f33bbb0f00fe18960f849cc8e15a7428a4cd59b8) Revert "Fixed issue which caused .demand function not to work correctly." (@chevex) + +### v1.0.13 (2014/02/05 22:13 +00:00) +- [6509e5e](https://github.com/bcoe/yargs/commit/6509e5e7dee6ef1a1f60eea104be0faa1a045075) Fixed issue which caused .demand function not to work correctly. (@chevex) + +### v1.0.12 (2013/12/13 00:09 +00:00) +- [05eb267](https://github.com/bcoe/yargs/commit/05eb26741c9ce446b33ff006e5d33221f53eaceb) 1.0.12 (@chevex) + +### v1.0.11 (2013/12/13 00:07 +00:00) +- [c1bde46](https://github.com/bcoe/yargs/commit/c1bde46e37318a68b87d17a50c130c861d6ce4a9) 1.0.11 (@chevex) + +### v1.0.10 (2013/12/12 23:57 +00:00) +- [dfebf81](https://github.com/bcoe/yargs/commit/dfebf8164c25c650701528ee581ca483a99dc21c) Fixed formatting in README (@chevex) + +### v1.0.9 (2013/12/12 23:47 +00:00) +- [0b4e34a](https://github.com/bcoe/yargs/commit/0b4e34af5e6d84a9dbb3bb6d02cd87588031c182) Update README.md (@chevex) + +### v1.0.8 (2013/12/06 16:36 +00:00) +- [#1](https://github.com/bcoe/yargs/pull/1) fix error caused by check() see #1 (@martinheidegger) + +### v1.0.7 (2013/11/24 18:01 +00:00) +- [a247d88](https://github.com/bcoe/yargs/commit/a247d88d6e46644cbb7303c18b1bb678fc132d72) Modified Pirate Joe image. (@chevex) + +### v1.0.6 (2013/11/23 19:21 +00:00) +- [d7f69e1](https://github.com/bcoe/yargs/commit/d7f69e1d34bc929736a8bdccdc724583e21b7eab) Updated Pirate Joe image. (@chevex) + +### v1.0.5 (2013/11/23 19:09 +00:00) +- [ece809c](https://github.com/bcoe/yargs/commit/ece809cf317cc659175e1d66d87f3ca68c2760be) Updated readme notice again. (@chevex) + +### v1.0.4 (2013/11/23 19:05 +00:00) +- [9e81e81](https://github.com/bcoe/yargs/commit/9e81e81654028f83ba86ffc3ac772a0476084e5e) Updated README with a notice about yargs being a fork of optimist and what that implies. (@chevex) + +### v1.0.3 (2013/11/23 17:43 +00:00) +- [65e7a78](https://github.com/bcoe/yargs/commit/65e7a782c86764944d63d084416aba9ee6019c5f) Changed some small wording in README.md. (@chevex) +- [459e20e](https://github.com/bcoe/yargs/commit/459e20e539b366b85128dd281ccd42221e96c7da) Fix a bug in the options function, when string and boolean options weren't applied to aliases. (@shockone) + +### v1.0.2 (2013/11/23 09:46 +00:00) +- [3d80ebe](https://github.com/bcoe/yargs/commit/3d80ebed866d3799224b6f7d596247186a3898a9) 1.0.2 (@chevex) + +### v1.0.1 (2013/11/23 09:39 +00:00) +- [f80ff36](https://github.com/bcoe/yargs/commit/f80ff3642d580d4b68bf9f5a94277481bd027142) Updated image. (@chevex) + +### v1.0.0 (2013/11/23 09:33 +00:00) +- [54e31d5](https://github.com/bcoe/yargs/commit/54e31d505f820b80af13644e460894b320bf25a3) Rebranded from optimist to yargs in the spirit of the fork :D (@chevex) +- [4ebb6c5](https://github.com/bcoe/yargs/commit/4ebb6c59f44787db7c24c5b8fe2680f01a23f498) Added documentation for demandCount(). (@chevex) +- [4561ce6](https://github.com/bcoe/yargs/commit/4561ce66dcffa95f49e8b4449b25b94cd68acb25) Simplified the error messages returned by .check(). (@chevex) +- [661c678](https://github.com/bcoe/yargs/commit/661c67886f479b16254a830b7e1db3be29e6b7a6) Fixed an issue with demand not accepting a zero value. (@chevex) +- [731dd3c](https://github.com/bcoe/yargs/commit/731dd3c37624790490bd6df4d5f1da8f4348279e) Add .fail(fn) so death isn't the only option. Should fix issue #39. (@chevex) +- [fa15417](https://github.com/bcoe/yargs/commit/fa15417ff9e70dace0d726627a5818654824c1d8) Added a few missing 'return self' (@chevex) +- [e655e4d](https://github.com/bcoe/yargs/commit/e655e4d99d1ae1d3695ef755d51c2de08d669761) Fix showing help in certain JS environments. (@chevex) +- [a746a31](https://github.com/bcoe/yargs/commit/a746a31cd47c87327028e6ea33762d6187ec5c87) Better string representation of default values. (@chevex) +- [6134619](https://github.com/bcoe/yargs/commit/6134619a7e90b911d5443230b644c5d447c1a68c) Implies: conditional demands (@chevex) +- [046b93b](https://github.com/bcoe/yargs/commit/046b93b5d40a27367af4cb29726e4d781d934639) Added support for JSON config files. (@chevex) +- [a677ec0](https://github.com/bcoe/yargs/commit/a677ec0a0ecccd99c75e571d03323f950688da03) Add .example(cmd, desc) feature. (@chevex) +- [1bd4375](https://github.com/bcoe/yargs/commit/1bd4375e11327ba1687d4bb6e5e9f3c30c1be2af) Added 'defaults' as alias to 'default' so as to avoid usage of a reserved keyword. (@chevex) +- [6b753c1](https://github.com/bcoe/yargs/commit/6b753c16ca09e723060e70b773b430323b29c45c) add .normalize(args..) support for normalizing paths (@chevex) +- [33d7d59](https://github.com/bcoe/yargs/commit/33d7d59341d364f03d3a25f0a55cb99004dbbe4b) Customize error messages with demand(key, msg) (@chevex) +- [647d37f](https://github.com/bcoe/yargs/commit/647d37f164c20f4bafbf67dd9db6cd6e2cd3b49f) Merge branch 'rewrite-duplicate-test' of github.com:isbadawi/node-optimist (@chevex) +- [9059d1a](https://github.com/bcoe/yargs/commit/9059d1ad5e8aea686c2a01c89a23efdf929fff2e) Pass aliases object to check functions for greater versatility. (@chevex) +- [623dc26](https://github.com/bcoe/yargs/commit/623dc26c7331abff2465ef8532e3418996d42fe6) Added ability to count boolean options and rolled minimist library back into project. (@chevex) +- [49f0dce](https://github.com/bcoe/yargs/commit/49f0dcef35de4db544c3966350d36eb5838703f6) Fixed small typo. (@chevex) +- [79ec980](https://github.com/bcoe/yargs/commit/79ec9806d9ca6eb0014cfa4b6d1849f4f004baf2) Removed dependency on wordwrap module. (@chevex) +- [ea14630](https://github.com/bcoe/yargs/commit/ea14630feddd69d1de99dd8c0e08948f4c91f00a) Merge branch 'master' of github.com:chbrown/node-optimist (@chevex) +- [2b75da2](https://github.com/bcoe/yargs/commit/2b75da2624061e0f4f3107d20303c06ec9054906) Merge branch 'master' of github.com:seanzhou1023/node-optimist (@chevex) +- [d9bda11](https://github.com/bcoe/yargs/commit/d9bda1116e26f3b40e833ca9ca19263afea53565) Merge branch 'patch-1' of github.com:thefourtheye/node-optimist (@chevex) +- [d6cc606](https://github.com/bcoe/yargs/commit/d6cc6064a4f1bea38a16a4430b8a1334832fbeff) Renamed README. (@chevex) +- [9498d3f](https://github.com/bcoe/yargs/commit/9498d3f59acfb5e102826503e681623c3a64b178) Renamed readme and added .gitignore. (@chevex) +- [bbd1fe3](https://github.com/bcoe/yargs/commit/bbd1fe37fefa366dde0fb3dc44d91fe8b28f57f5) Included examples for ```help``` and ```showHelp``` functions and fixed few formatting issues (@thefourtheye) +- [37fea04](https://github.com/bcoe/yargs/commit/37fea0470a5796a0294c1dcfff68d8041650e622) .alias({}) behaves differently based on mapping direction when generating descriptions (@chbrown) +- [855b20d](https://github.com/bcoe/yargs/commit/855b20d0be567ca121d06b30bea64001b74f3d6d) Documented function signatures are useful for dynamically typed languages. (@chbrown) + +### 0.6.0 (2013/06/25 08:48 +00:00) +- [d37bfe0](https://github.com/bcoe/yargs/commit/d37bfe05ae6d295a0ab481efe4881222412791f4) all tests passing using minimist (@substack) +- [76f1352](https://github.com/bcoe/yargs/commit/76f135270399d01f2bbc621e524a5966e5c422fd) all parse tests now passing (@substack) +- [a7b6754](https://github.com/bcoe/yargs/commit/a7b6754276c38d1565479a5685c3781aeb947816) using minimist, some tests passing (@substack) +- [6655688](https://github.com/bcoe/yargs/commit/66556882aa731cbbbe16cc4d42c85740a2e98099) Give credit where its due (@DeadAlready) +- [602a2a9](https://github.com/bcoe/yargs/commit/602a2a92a459f93704794ad51b115bbb08b535ce) v0.5.3 - Remove wordwrap as dependency (@DeadAlready) + +### 0.5.2 (2013/05/31 03:46 +00:00) +- [4497ca5](https://github.com/bcoe/yargs/commit/4497ca55e332760a37b866ec119ded347ca27a87) fixed the whitespace bug without breaking anything else (@substack) +- [5a3dd1a](https://github.com/bcoe/yargs/commit/5a3dd1a4e0211a38613c6e02f61328e1031953fa) failing test for whitespace arg (@substack) + +### 0.5.1 (2013/05/30 07:17 +00:00) +- [a20228f](https://github.com/bcoe/yargs/commit/a20228f62a454755dd07f628a7c5759113918327) fix parse() to work with functions before it (@substack) +- [b13bd4c](https://github.com/bcoe/yargs/commit/b13bd4cac856a9821d42fa173bdb58f089365a7d) failing test for parse() with modifiers (@substack) + +### 0.5.0 (2013/05/18 21:59 +00:00) +- [c474a64](https://github.com/bcoe/yargs/commit/c474a649231527915c222156e3b40806d365a87c) fixes for dash (@substack) + +### 0.4.0 (2013/04/13 19:03 +00:00) +- [dafe3e1](https://github.com/bcoe/yargs/commit/dafe3e18d7c6e7c2d68e06559df0e5cbea3adb14) failing short test (@substack) + +### 0.3.7 (2013/04/04 04:07 +00:00) +- [6c7a0ec](https://github.com/bcoe/yargs/commit/6c7a0ec94ce4199a505f0518b4d6635d4e47cc81) Fix for windows. On windows there is no _ in environment. (@hdf) + +### 0.3.6 (2013/04/04 04:04 +00:00) +- [e72346a](https://github.com/bcoe/yargs/commit/e72346a727b7267af5aa008b418db89970873f05) Add support for newlines in -a="" arguments (@danielbeardsley) +- [71e1fb5](https://github.com/bcoe/yargs/commit/71e1fb55ea9987110a669ac6ec12338cfff3821c) drop 0.4, add 0.8 to travis (@substack) + +### 0.3.5 (2012/10/10 11:09 +00:00) +- [ee692b3](https://github.com/bcoe/yargs/commit/ee692b37554c70a0bb16389a50a26b66745cbbea) Fix parsing booleans (@vojtajina) +- [5045122](https://github.com/bcoe/yargs/commit/5045122664c3f5b4805addf1be2148d5856f7ce8) set $0 properly in the tests (@substack) + +### 0.3.4 (2012/04/30 06:54 +00:00) +- [f28c0e6](https://github.com/bcoe/yargs/commit/f28c0e62ca94f6e0bb2e6d82fc3d91a55e69b903) bump for string "true" params (@substack) +- [8f44aeb](https://github.com/bcoe/yargs/commit/8f44aeb74121ddd689580e2bf74ef86a605e9bf2) Fix failing test for aliased booleans. (@coderarity) +- [b9f7b61](https://github.com/bcoe/yargs/commit/b9f7b613b1e68e11e6c23fbda9e555a517dcc976) Add failing test for short aliased booleans. (@coderarity) + +### 0.3.3 (2012/04/30 06:45 +00:00) +- [541bac8](https://github.com/bcoe/yargs/commit/541bac8dd787a5f1a5d28f6d8deb1627871705e7) Fixes #37. + +### 0.3.2 (2012/04/12 20:28 +00:00) +- [3a0f014](https://github.com/bcoe/yargs/commit/3a0f014c1451280ac1c9caa1f639d31675586eec) travis badge (@substack) +- [4fb60bf](https://github.com/bcoe/yargs/commit/4fb60bf17845f4ce3293f8ca49c9a1a7c736cfce) Fix boolean aliases. (@coderarity) +- [f14dda5](https://github.com/bcoe/yargs/commit/f14dda546efc4fe06ace04d36919bfbb7634f79b) Adjusted package.json to use tap (@jfhbrook) +- [88e5d32](https://github.com/bcoe/yargs/commit/88e5d32295be6e544c8d355ff84e355af38a1c74) test/usage.js no longer hangs (@jfhbrook) +- [e1e740c](https://github.com/bcoe/yargs/commit/e1e740c27082f3ce84deca2093d9db2ef735d0e5) two tests for combined boolean/alias opts parsing (@jfhbrook) + +### 0.3.1 (2011/12/31 08:44 +00:00) +- [d09b719](https://github.com/bcoe/yargs/commit/d09b71980ef711b6cf3918cd19beec8257e40e82) If "default" is set to false it was not passed on, fixed. (@wolframkriesing) + +### 0.3.0 (2011/12/09 06:03 +00:00) +- [6e74aa7](https://github.com/bcoe/yargs/commit/6e74aa7b46a65773e20c0cb68d2d336d4a0d553d) bump and documented dot notation (@substack) + +### 0.2.7 (2011/10/20 02:25 +00:00) +- [94adee2](https://github.com/bcoe/yargs/commit/94adee20e17b58d0836f80e8b9cdbe9813800916) argv._ can be told 'Hey! argv._! Don't be messing with my args.', and it WILL obey (@colinta) +- [c46fdd5](https://github.com/bcoe/yargs/commit/c46fdd56a05410ae4a1e724a4820c82e77ff5469) optimistic critter image (@substack) +- [5c95c73](https://github.com/bcoe/yargs/commit/5c95c73aedf4c7482bd423e10c545e86d7c8a125) alias options() to option() (@substack) +- [f7692ea](https://github.com/bcoe/yargs/commit/f7692ea8da342850af819367833abb685fde41d8) [fix] Fix for parsing boolean edge case (@indexzero) +- [d1f92d1](https://github.com/bcoe/yargs/commit/d1f92d1425bd7f356055e78621b30cdf9741a3c2) +- [b01bda8](https://github.com/bcoe/yargs/commit/b01bda8d86e455bbf74ce497864cb8ab5b9fb847) [fix test] Update to ensure optimist is aware of default booleans. Associated tests included (@indexzero) +- [aa753e7](https://github.com/bcoe/yargs/commit/aa753e7c54fb3a12f513769a0ff6d54aa0f63943) [dist test] Update devDependencies in package.json. Update test pathing to be more npm and require.paths future-proof (@indexzero) +- [7bfce2f](https://github.com/bcoe/yargs/commit/7bfce2f3b3c98e6539e7549d35fbabced7e9341e) s/sys/util/ (@substack) +- [d420a7a](https://github.com/bcoe/yargs/commit/d420a7a9c890d2cdb11acfaf3ea3f43bc3e39f41) update usage output (@substack) +- [cf86eed](https://github.com/bcoe/yargs/commit/cf86eede2e5fc7495b6ec15e6d137d9ac814f075) some sage readme protips about parsing rules (@substack) +- [5da9f7a](https://github.com/bcoe/yargs/commit/5da9f7a5c0e1758ec7c5801fb3e94d3f6e970513) documented all the methods finally (@substack) +- [8ca6879](https://github.com/bcoe/yargs/commit/8ca6879311224b25933642987300f6a29de5c21b) fenced syntax highlighting (@substack) +- [b72bacf](https://github.com/bcoe/yargs/commit/b72bacf1d02594778c1935405bc8137eb61761dc) right-alignment of wrapped extra params (@substack) +- [2b980bf](https://github.com/bcoe/yargs/commit/2b980bf2656b4ee8fc5134dc5f56a48855c35198) now with .wrap() (@substack) +- [d614f63](https://github.com/bcoe/yargs/commit/d614f639654057d1b7e35e3f5a306e88ec2ad1e4) don't show 'Options:' when there aren't any (@substack) +- [691eda3](https://github.com/bcoe/yargs/commit/691eda354df97b5a86168317abcbcaabdc08a0fb) failing test for multi-aliasing (@substack) +- [0826c9f](https://github.com/bcoe/yargs/commit/0826c9f462109feab2bc7a99346d22e72bf774b7) "Options:" > "options:" (@substack) +- [72f7490](https://github.com/bcoe/yargs/commit/72f749025d01b7f295738ed370a669d885fbada0) [minor] Update formatting for `.showHelp()` (@indexzero) +- [75aecce](https://github.com/bcoe/yargs/commit/75aeccea74329094072f95800e02c275e7d999aa) options works again, too lazy to write a proper test right now (@substack) +- [f742e54](https://github.com/bcoe/yargs/commit/f742e5439817c662dc3bd8734ddd6467e6018cfd) line_count_options example, which breaks (@substack) +- [4ca06b8](https://github.com/bcoe/yargs/commit/4ca06b8b4ea99b5d5714b315a2a8576bee6e5537) line count example (@substack) +- [eeb8423](https://github.com/bcoe/yargs/commit/eeb8423e0a5ecc9dc3eb1e6df9f3f8c1c88f920b) remove self.argv setting in boolean (@substack) +- [6903412](https://github.com/bcoe/yargs/commit/69034126804660af9cc20ea7f4457b50338ee3d7) removed camel case for now (@substack) +- [5a0d88b](https://github.com/bcoe/yargs/commit/5a0d88bf23e9fa79635dd034e2a1aa992acc83cd) remove dead longest checking code (@substack) +- [d782170](https://github.com/bcoe/yargs/commit/d782170babf7284b1aa34f5350df0dd49c373fa8) .help() too (@substack) +- [622ec17](https://github.com/bcoe/yargs/commit/622ec17379bb5374fdbb190404c82bc600975791) rm old help generator (@substack) +- [7c8baac](https://github.com/bcoe/yargs/commit/7c8baac4d66195e9f5158503ea9ebfb61153dab7) nub keys (@substack) +- [8197785](https://github.com/bcoe/yargs/commit/8197785ad4762465084485b041abd722f69bf344) generate help message based on the previous calls, todo: nub (@substack) +- [3ffbdc3](https://github.com/bcoe/yargs/commit/3ffbdc33c8f5e83d4ea2ac60575ce119570c7ede) stub out new showHelp, better checks (@substack) +- [d4e21f5](https://github.com/bcoe/yargs/commit/d4e21f56a4830f7de841900d3c79756fb9886184) let .options() take single options too (@substack) +- [3c4cf29](https://github.com/bcoe/yargs/commit/3c4cf2901a29bac119cca8e983028d8669230ec6) .options() is now heaps simpler (@substack) +- [89f0d04](https://github.com/bcoe/yargs/commit/89f0d043cbccd302f10ab30c2069e05d2bf817c9) defaults work again, all tests pass (@substack) +- [dd87333](https://github.com/bcoe/yargs/commit/dd8733365423006a6e4156372ebb55f98323af58) update test error messages, down to 2 failing tests (@substack) +- [53f7bc6](https://github.com/bcoe/yargs/commit/53f7bc626b9875f2abdfc5dd7a80bde7f14143a3) fix for bools doubling up, passes the parse test again, others fail (@substack) +- [2213e2d](https://github.com/bcoe/yargs/commit/2213e2ddc7263226fba717fb041dc3fde9bc2ee4) refactored for an argv getter, failing several tests (@substack) +- [d1e7379](https://github.com/bcoe/yargs/commit/d1e737970f15c6c006bebdd8917706827ff2f0f2) just rescan for now, alias test passes (@substack) +- [b2f8c99](https://github.com/bcoe/yargs/commit/b2f8c99cc477a8eb0fdf4cf178e1785b63185cfd) failing alias test (@substack) +- [d0c0174](https://github.com/bcoe/yargs/commit/d0c0174daa144bfb6dc7290fdc448c393c475e15) .alias() (@substack) +- [d85f431](https://github.com/bcoe/yargs/commit/d85f431ad7d07b058af3f2a57daa51495576c164) [api] Remove `.describe()` in favor of building upon the existing `.usage()` API (@indexzero) +- [edbd527](https://github.com/bcoe/yargs/commit/edbd5272a8e213e71acd802782135c7f9699913a) [doc api] Add `.describe()`, `.options()`, and `.showHelp()` methods along with example. (@indexzero) +- [be4902f](https://github.com/bcoe/yargs/commit/be4902ff0961ae8feb9093f2c0a4066463ded2cf) updates for coffee since it now does argv the node way (@substack) +- [e24cb23](https://github.com/bcoe/yargs/commit/e24cb23798ee64e53b60815e7fda78b87f42390c) more general coffeescript detection (@substack) +- [78ac753](https://github.com/bcoe/yargs/commit/78ac753e5d0ec32a96d39d893272afe989e42a4d) Don't trigger the CoffeeScript hack when running under node_g. (@papandreou) +- [bcfe973](https://github.com/bcoe/yargs/commit/bcfe9731d7f90d4632281b8a52e8d76eb0195ae6) .string() but failing test (@substack) +- [1987aca](https://github.com/bcoe/yargs/commit/1987aca28c7ba4e8796c07bbc547cb984804c826) test hex strings (@substack) +- [ef36db3](https://github.com/bcoe/yargs/commit/ef36db32259b0b0d62448dc907c760e5554fb7e7) more keywords (@substack) +- [cc53c56](https://github.com/bcoe/yargs/commit/cc53c56329960bed6ab077a79798e991711ba01d) Added camelCase function that converts --multi-word-option to camel case (so it becomes argv.multiWordOption). (@papandreou) +- [60b57da](https://github.com/bcoe/yargs/commit/60b57da36797716e5783a633c6d5c79099016d45) fixed boolean bug by rescanning (@substack) +- [dff6d07](https://github.com/bcoe/yargs/commit/dff6d078d97f8ac503c7d18dcc7b7a8c364c2883) boolean examples (@substack) +- [0e380b9](https://github.com/bcoe/yargs/commit/0e380b92c4ef4e3c8dac1da18b5c31d85b1d02c9) boolean() with passing test (@substack) +- [62644d4](https://github.com/bcoe/yargs/commit/62644d4bffbb8d1bbf0c2baf58a1d14a6359ef07) coffee compatibility with node regex for versions too (@substack) +- [430fafc](https://github.com/bcoe/yargs/commit/430fafcf1683d23774772826581acff84b456827) argv._ fixed by fixing the coffee detection (@substack) +- [343b8af](https://github.com/bcoe/yargs/commit/343b8afefd98af274ebe21b5a16b3a949ec5429f) whichNodeArgs test fails too (@substack) +- [63df2f3](https://github.com/bcoe/yargs/commit/63df2f371f31e63d7f1dec2cbf0022a5f08da9d2) replicated mnot's bug in whichNodeEmpty test (@substack) +- [35473a4](https://github.com/bcoe/yargs/commit/35473a4d93a45e5e7e512af8bb54ebb532997ae1) test for ./bin usage (@substack) +- [13df151](https://github.com/bcoe/yargs/commit/13df151e44228eed10e5441c7cd163e086c458a4) don't coerce booleans to numbers (@substack) +- [85f8007](https://github.com/bcoe/yargs/commit/85f8007e93b8be7124feea64b1f1916d8ba1894a) package bump for automatic number conversion (@substack) +- [8f17014](https://github.com/bcoe/yargs/commit/8f170141cded4ccc0c6d67a849c5bf996aa29643) updated readme and examples with new auto-numberification goodness (@substack) +- [73dc901](https://github.com/bcoe/yargs/commit/73dc9011ac968e39b55e19e916084a839391b506) auto number conversion works yay (@substack) +- [bcec56b](https://github.com/bcoe/yargs/commit/bcec56b3d031e018064cbb691539ccc4f28c14ad) failing test for not-implemented auto numification (@substack) +- [ebd2844](https://github.com/bcoe/yargs/commit/ebd2844d683feeac583df79af0e5124a7a7db04e) odd that eql doesn't check types careflly (@substack) +- [fd854b0](https://github.com/bcoe/yargs/commit/fd854b02e512ce854b76386d395672a7969c1bc4) package author + keywords (@substack) +- [656a1d5](https://github.com/bcoe/yargs/commit/656a1d5a1b7c0e49d72e80cb13f20671d56f76c6) updated readme with .default() stuff (@substack) +- [cd7f8c5](https://github.com/bcoe/yargs/commit/cd7f8c55f0b82b79b690d14c5f806851236998a1) passing tests for new .default() behavior (@substack) +- [932725e](https://github.com/bcoe/yargs/commit/932725e39ce65bc91a0385a5fab659a5fa976ac2) new default() thing for setting default key/values (@substack) +- [4e6c7ab](https://github.com/bcoe/yargs/commit/4e6c7aba6374ac9ebc6259ecf91f13af7bce40e3) test for coffee usage (@substack) +- [d54ffcc](https://github.com/bcoe/yargs/commit/d54ffccf2a5a905f51ed5108f7c647f35d64ae23) new --key value style with passing tests. NOTE: changes existing behavior (@substack) +- [ed2a2d5](https://github.com/bcoe/yargs/commit/ed2a2d5d828100ebeef6385c0fb88d146a5cfe9b) package bump for summatix's coffee script fix (@substack) +- [75a975e](https://github.com/bcoe/yargs/commit/75a975eed8430d28e2a79dc9e6d819ad545f4587) Added support for CoffeeScript (@summatix) +- [56b2b1d](https://github.com/bcoe/yargs/commit/56b2b1de8d11f8a2b91979d8ae2d6db02d8fe64d) test coverage for the falsy check() usage (@substack) +- [a4843a9](https://github.com/bcoe/yargs/commit/a4843a9f0e69ffb4afdf6a671d89eb6f218be35d) check bug fixed plus a handy string (@substack) +- [857bd2d](https://github.com/bcoe/yargs/commit/857bd2db933a5aaa9cfecba0ced2dc9b415f8111) tests for demandCount, back up to 100% coverage (@substack) +- [073b776](https://github.com/bcoe/yargs/commit/073b7768ebd781668ef05c13f9003aceca2f5c35) call demandCount from demand (@substack) +- [4bd4b7a](https://github.com/bcoe/yargs/commit/4bd4b7a085c8b6ce1d885a0f486cc9865cee2db1) add demandCount to check for the number of arguments in the _ list (@marshall) +- [b8689ac](https://github.com/bcoe/yargs/commit/b8689ac68dacf248119d242bba39a41cb0adfa07) Rebase checks. That will be its own module eventually. (@substack) +- [e688370](https://github.com/bcoe/yargs/commit/e688370b576f0aa733c3f46183df69e1b561668e) a $0 like in perl (@substack) +- [2e5e196](https://github.com/bcoe/yargs/commit/2e5e1960fc19afb21fb3293752316eaa8bcd3609) usage test hacking around process and console (@substack) +- [fcc3521](https://github.com/bcoe/yargs/commit/fcc352163fbec6a1dfe8caf47a0df39de24fe016) description pun (@substack) +- [87a1fe2](https://github.com/bcoe/yargs/commit/87a1fe29037ca2ca5fefda85141aaeb13e8ce761) mit/x11 license (@substack) +- [8d089d2](https://github.com/bcoe/yargs/commit/8d089d24cd687c0bde3640a96c09b78f884900dd) bool example is more consistent and also shows off short option grouping (@substack) +- [448d747](https://github.com/bcoe/yargs/commit/448d7473ac68e8e03d8befc9457b0d9e21725be0) start of the readme and examples (@substack) +- [da74dea](https://github.com/bcoe/yargs/commit/da74dea799a9b59dbf022cbb8001bfdb0d52eec9) more tests for long and short captures (@substack) +- [ab6387e](https://github.com/bcoe/yargs/commit/ab6387e6769ca4af82ca94c4c67c7319f0d9fcfa) silly bug in the tests with s/not/no/, all tests pass now (@substack) +- [102496a](https://github.com/bcoe/yargs/commit/102496a319e8e06f6550d828fc2f72992c7d9ecc) hack an instance for process.argv onto Argv so the export can be called to create an instance or used for argv, which is the most common case (@substack) +- [a01caeb](https://github.com/bcoe/yargs/commit/a01caeb532546d19f68f2b2b87f7036cfe1aaedd) divide example (@substack) +- [443da55](https://github.com/bcoe/yargs/commit/443da55736acbaf8ff8b04d1b9ce19ab016ddda2) start of the lib with a package.json (@substack) diff --git a/node_modules/yargs/LICENSE b/node_modules/yargs/LICENSE new file mode 100644 index 0000000..747ab11 --- /dev/null +++ b/node_modules/yargs/LICENSE @@ -0,0 +1,22 @@ +Copyright 2010 James Halliday (mail@substack.net) +Modified work Copyright 2014 Contributors (ben@npmjs.com) + +This project is free software released under the MIT/X11 license: + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/yargs/README.md b/node_modules/yargs/README.md new file mode 100644 index 0000000..6b7d096 --- /dev/null +++ b/node_modules/yargs/README.md @@ -0,0 +1,122 @@ +

+ +

+

Yargs

+

+ Yargs be a node.js library fer hearties tryin' ter parse optstrings +

+
+ +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] +[![NPM version][npm-image]][npm-url] +[![js-standard-style][standard-image]][standard-url] +[![Conventional Commits][conventional-commits-image]][conventional-commits-url] +[![Slack][slack-image]][slack-url] + +## Description : +Yargs helps you build interactive command line tools, by parsing arguments and generating an elegant user interface. + +It gives you: + +* commands and (grouped) options (`my-program.js serve --port=5000`). +* a dynamically generated help menu based on your arguments. + +> + +* bash-completion shortcuts for commands and options. +* and [tons more](/docs/api.md). + +## Installation + +Stable version: +```bash +npm i yargs +``` + +Bleeding edge version with the most recent features: +```bash +npm i yargs@next +``` + +## Usage : + +### Simple Example + +````javascript +#!/usr/bin/env node +const argv = require('yargs').argv + +if (argv.ships > 3 && argv.distance < 53.5) { + console.log('Plunder more riffiwobbles!') +} else { + console.log('Retreat from the xupptumblers!') +} +```` + +```bash +$ ./plunder.js --ships=4 --distance=22 +Plunder more riffiwobbles! + +$ ./plunder.js --ships 12 --distance 98.7 +Retreat from the xupptumblers! +``` + +### Complex Example + +```javascript +#!/usr/bin/env node +require('yargs') // eslint-disable-line + .command('serve [port]', 'start the server', (yargs) => { + yargs + .positional('port', { + describe: 'port to bind on', + default: 5000 + }) + }, (argv) => { + if (argv.verbose) console.info(`start server on :${argv.port}`) + serve(argv.port) + }) + .option('verbose', { + alias: 'v', + default: false + }) + .argv +``` + +Run the example above with `--help` to see the help for the application. + +## Community : + +Having problems? want to contribute? join our [community slack](http://devtoolscommunity.herokuapp.com). + +## Documentation : + +### Table of Contents + +* [Yargs' API](/docs/api.md) +* [Examples](/docs/examples.md) +* [Parsing Tricks](/docs/tricks.md) + * [Stop the Parser](/docs/tricks.md#stop) + * [Negating Boolean Arguments](/docs/tricks.md#negate) + * [Numbers](/docs/tricks.md#numbers) + * [Arrays](/docs/tricks.md#arrays) + * [Objects](/docs/tricks.md#objects) +* [Advanced Topics](/docs/advanced.md) + * [Composing Your App Using Commands](/docs/advanced.md#commands) + * [Building Configurable CLI Apps](/docs/advanced.md#configuration) + * [Customizing Yargs' Parser](/docs/advanced.md#customizing) +* [Contributing](/contributing.md) + +[travis-url]: https://travis-ci.org/yargs/yargs +[travis-image]: https://img.shields.io/travis/yargs/yargs/master.svg +[coveralls-url]: https://coveralls.io/github/yargs/yargs +[coveralls-image]: https://img.shields.io/coveralls/yargs/yargs.svg +[npm-url]: https://www.npmjs.com/package/yargs +[npm-image]: https://img.shields.io/npm/v/yargs.svg +[standard-image]: https://img.shields.io/badge/code%20style-standard-brightgreen.svg +[standard-url]: http://standardjs.com/ +[conventional-commits-image]: https://img.shields.io/badge/Conventional%20Commits-1.0.0-yellow.svg +[conventional-commits-url]: https://conventionalcommits.org/ +[slack-image]: http://devtoolscommunity.herokuapp.com/badge.svg +[slack-url]: http://devtoolscommunity.herokuapp.com diff --git a/node_modules/yargs/index.js b/node_modules/yargs/index.js new file mode 100644 index 0000000..dfed54b --- /dev/null +++ b/node_modules/yargs/index.js @@ -0,0 +1,32 @@ +'use strict' +// classic singleton yargs API, to use yargs +// without running as a singleton do: +// require('yargs/yargs')(process.argv.slice(2)) +const yargs = require('./yargs') + +Argv(process.argv.slice(2)) + +module.exports = Argv + +function Argv (processArgs, cwd) { + const argv = yargs(processArgs, cwd, require) + singletonify(argv) + return argv +} + +/* Hack an instance of Argv with process.argv into Argv + so people can do + require('yargs')(['--beeble=1','-z','zizzle']).argv + to parse a list of args and + require('yargs').argv + to get a parsed version of process.argv. +*/ +function singletonify (inst) { + Object.keys(inst).forEach((key) => { + if (key === 'argv') { + Argv.__defineGetter__(key, inst.__lookupGetter__(key)) + } else { + Argv[key] = typeof inst[key] === 'function' ? inst[key].bind(inst) : inst[key] + } + }) +} diff --git a/node_modules/yargs/lib/apply-extends.js b/node_modules/yargs/lib/apply-extends.js new file mode 100644 index 0000000..1436b65 --- /dev/null +++ b/node_modules/yargs/lib/apply-extends.js @@ -0,0 +1,53 @@ + +'use strict' +const fs = require('fs') +const path = require('path') +const YError = require('./yerror') + +let previouslyVisitedConfigs = [] + +function checkForCircularExtends (cfgPath) { + if (previouslyVisitedConfigs.indexOf(cfgPath) > -1) { + throw new YError(`Circular extended configurations: '${cfgPath}'.`) + } +} + +function getPathToDefaultConfig (cwd, pathToExtend) { + return path.resolve(cwd, pathToExtend) +} + +function applyExtends (config, cwd) { + let defaultConfig = {} + + if (config.hasOwnProperty('extends')) { + if (typeof config.extends !== 'string') return defaultConfig + const isPath = /\.json|\..*rc$/.test(config.extends) + let pathToDefault = null + if (!isPath) { + try { + pathToDefault = require.resolve(config.extends) + } catch (err) { + // most likely this simply isn't a module. + } + } else { + pathToDefault = getPathToDefaultConfig(cwd, config.extends) + } + // maybe the module uses key for some other reason, + // err on side of caution. + if (!pathToDefault && !isPath) return config + + checkForCircularExtends(pathToDefault) + + previouslyVisitedConfigs.push(pathToDefault) + + defaultConfig = isPath ? JSON.parse(fs.readFileSync(pathToDefault, 'utf8')) : require(config.extends) + delete config.extends + defaultConfig = applyExtends(defaultConfig, path.dirname(pathToDefault)) + } + + previouslyVisitedConfigs = [] + + return Object.assign({}, defaultConfig, config) +} + +module.exports = applyExtends diff --git a/node_modules/yargs/lib/argsert.js b/node_modules/yargs/lib/argsert.js new file mode 100644 index 0000000..f310b4e --- /dev/null +++ b/node_modules/yargs/lib/argsert.js @@ -0,0 +1,68 @@ +'use strict' + +// hoisted due to circular dependency on command. +module.exports = argsert +const command = require('./command')() +const YError = require('./yerror') + +const positionName = ['first', 'second', 'third', 'fourth', 'fifth', 'sixth'] +function argsert (expected, callerArguments, length) { + // TODO: should this eventually raise an exception. + try { + // preface the argument description with "cmd", so + // that we can run it through yargs' command parser. + let position = 0 + let parsed = { demanded: [], optional: [] } + if (typeof expected === 'object') { + length = callerArguments + callerArguments = expected + } else { + parsed = command.parseCommand(`cmd ${expected}`) + } + const args = [].slice.call(callerArguments) + + while (args.length && args[args.length - 1] === undefined) args.pop() + length = length || args.length + + if (length < parsed.demanded.length) { + throw new YError(`Not enough arguments provided. Expected ${parsed.demanded.length} but received ${args.length}.`) + } + + const totalCommands = parsed.demanded.length + parsed.optional.length + if (length > totalCommands) { + throw new YError(`Too many arguments provided. Expected max ${totalCommands} but received ${length}.`) + } + + parsed.demanded.forEach((demanded) => { + const arg = args.shift() + const observedType = guessType(arg) + const matchingTypes = demanded.cmd.filter(type => type === observedType || type === '*') + if (matchingTypes.length === 0) argumentTypeError(observedType, demanded.cmd, position, false) + position += 1 + }) + + parsed.optional.forEach((optional) => { + if (args.length === 0) return + const arg = args.shift() + const observedType = guessType(arg) + const matchingTypes = optional.cmd.filter(type => type === observedType || type === '*') + if (matchingTypes.length === 0) argumentTypeError(observedType, optional.cmd, position, true) + position += 1 + }) + } catch (err) { + console.warn(err.stack) + } +} + +function guessType (arg) { + if (Array.isArray(arg)) { + return 'array' + } else if (arg === null) { + return 'null' + } + return typeof arg +} + +function argumentTypeError (observedType, allowedTypes, position, optional) { + throw new YError(`Invalid ${positionName[position] || 'manyith'} argument. Expected ${allowedTypes.join(' or ')} but received ${observedType}.`) +} diff --git a/node_modules/yargs/lib/command.js b/node_modules/yargs/lib/command.js new file mode 100644 index 0000000..895423a --- /dev/null +++ b/node_modules/yargs/lib/command.js @@ -0,0 +1,437 @@ +'use strict' + +const inspect = require('util').inspect +const isPromise = require('./is-promise') +const { applyMiddleware, commandMiddlewareFactory } = require('./middleware') +const path = require('path') +const Parser = require('yargs-parser') + +const DEFAULT_MARKER = /(^\*)|(^\$0)/ + +// handles parsing positional arguments, +// and populating argv with said positional +// arguments. +module.exports = function command (yargs, usage, validation, globalMiddleware) { + const self = {} + let handlers = {} + let aliasMap = {} + let defaultCommand + globalMiddleware = globalMiddleware || [] + + self.addHandler = function addHandler (cmd, description, builder, handler, commandMiddleware) { + let aliases = [] + const middlewares = commandMiddlewareFactory(commandMiddleware) + handler = handler || (() => {}) + + if (Array.isArray(cmd)) { + aliases = cmd.slice(1) + cmd = cmd[0] + } else if (typeof cmd === 'object') { + let command = (Array.isArray(cmd.command) || typeof cmd.command === 'string') ? cmd.command : moduleName(cmd) + if (cmd.aliases) command = [].concat(command).concat(cmd.aliases) + self.addHandler(command, extractDesc(cmd), cmd.builder, cmd.handler, cmd.middlewares) + return + } + + // allow a module to be provided instead of separate builder and handler + if (typeof builder === 'object' && builder.builder && typeof builder.handler === 'function') { + self.addHandler([cmd].concat(aliases), description, builder.builder, builder.handler, builder.middlewares) + return + } + + // parse positionals out of cmd string + const parsedCommand = self.parseCommand(cmd) + + // remove positional args from aliases only + aliases = aliases.map(alias => self.parseCommand(alias).cmd) + + // check for default and filter out '*'' + let isDefault = false + const parsedAliases = [parsedCommand.cmd].concat(aliases).filter((c) => { + if (DEFAULT_MARKER.test(c)) { + isDefault = true + return false + } + return true + }) + + // standardize on $0 for default command. + if (parsedAliases.length === 0 && isDefault) parsedAliases.push('$0') + + // shift cmd and aliases after filtering out '*' + if (isDefault) { + parsedCommand.cmd = parsedAliases[0] + aliases = parsedAliases.slice(1) + cmd = cmd.replace(DEFAULT_MARKER, parsedCommand.cmd) + } + + // populate aliasMap + aliases.forEach((alias) => { + aliasMap[alias] = parsedCommand.cmd + }) + + if (description !== false) { + usage.command(cmd, description, isDefault, aliases) + } + + handlers[parsedCommand.cmd] = { + original: cmd, + description: description, + handler, + builder: builder || {}, + middlewares: middlewares || [], + demanded: parsedCommand.demanded, + optional: parsedCommand.optional + } + + if (isDefault) defaultCommand = handlers[parsedCommand.cmd] + } + + self.addDirectory = function addDirectory (dir, context, req, callerFile, opts) { + opts = opts || {} + // disable recursion to support nested directories of subcommands + if (typeof opts.recurse !== 'boolean') opts.recurse = false + // exclude 'json', 'coffee' from require-directory defaults + if (!Array.isArray(opts.extensions)) opts.extensions = ['js'] + // allow consumer to define their own visitor function + const parentVisit = typeof opts.visit === 'function' ? opts.visit : o => o + // call addHandler via visitor function + opts.visit = function visit (obj, joined, filename) { + const visited = parentVisit(obj, joined, filename) + // allow consumer to skip modules with their own visitor + if (visited) { + // check for cyclic reference + // each command file path should only be seen once per execution + if (~context.files.indexOf(joined)) return visited + // keep track of visited files in context.files + context.files.push(joined) + self.addHandler(visited) + } + return visited + } + require('require-directory')({ require: req, filename: callerFile }, dir, opts) + } + + // lookup module object from require()d command and derive name + // if module was not require()d and no name given, throw error + function moduleName (obj) { + const mod = require('which-module')(obj) + if (!mod) throw new Error(`No command name given for module: ${inspect(obj)}`) + return commandFromFilename(mod.filename) + } + + // derive command name from filename + function commandFromFilename (filename) { + return path.basename(filename, path.extname(filename)) + } + + function extractDesc (obj) { + for (let keys = ['describe', 'description', 'desc'], i = 0, l = keys.length, test; i < l; i++) { + test = obj[keys[i]] + if (typeof test === 'string' || typeof test === 'boolean') return test + } + return false + } + + self.parseCommand = function parseCommand (cmd) { + const extraSpacesStrippedCommand = cmd.replace(/\s{2,}/g, ' ') + const splitCommand = extraSpacesStrippedCommand.split(/\s+(?![^[]*]|[^<]*>)/) + const bregex = /\.*[\][<>]/g + const parsedCommand = { + cmd: (splitCommand.shift()).replace(bregex, ''), + demanded: [], + optional: [] + } + splitCommand.forEach((cmd, i) => { + let variadic = false + cmd = cmd.replace(/\s/g, '') + if (/\.+[\]>]/.test(cmd) && i === splitCommand.length - 1) variadic = true + if (/^\[/.test(cmd)) { + parsedCommand.optional.push({ + cmd: cmd.replace(bregex, '').split('|'), + variadic + }) + } else { + parsedCommand.demanded.push({ + cmd: cmd.replace(bregex, '').split('|'), + variadic + }) + } + }) + return parsedCommand + } + + self.getCommands = () => Object.keys(handlers).concat(Object.keys(aliasMap)) + + self.getCommandHandlers = () => handlers + + self.hasDefaultCommand = () => !!defaultCommand + + self.runCommand = function runCommand (command, yargs, parsed, commandIndex) { + let aliases = parsed.aliases + const commandHandler = handlers[command] || handlers[aliasMap[command]] || defaultCommand + const currentContext = yargs.getContext() + let numFiles = currentContext.files.length + const parentCommands = currentContext.commands.slice() + + // what does yargs look like after the buidler is run? + let innerArgv = parsed.argv + let innerYargs = null + let positionalMap = {} + if (command) { + currentContext.commands.push(command) + currentContext.fullCommands.push(commandHandler.original) + } + if (typeof commandHandler.builder === 'function') { + // a function can be provided, which builds + // up a yargs chain and possibly returns it. + innerYargs = commandHandler.builder(yargs.reset(parsed.aliases)) + // if the builder function did not yet parse argv with reset yargs + // and did not explicitly set a usage() string, then apply the + // original command string as usage() for consistent behavior with + // options object below. + if (yargs.parsed === false) { + if (shouldUpdateUsage(yargs)) { + yargs.getUsageInstance().usage( + usageFromParentCommandsCommandHandler(parentCommands, commandHandler), + commandHandler.description + ) + } + innerArgv = innerYargs ? innerYargs._parseArgs(null, null, true, commandIndex) : yargs._parseArgs(null, null, true, commandIndex) + } else { + innerArgv = yargs.parsed.argv + } + + if (innerYargs && yargs.parsed === false) aliases = innerYargs.parsed.aliases + else aliases = yargs.parsed.aliases + } else if (typeof commandHandler.builder === 'object') { + // as a short hand, an object can instead be provided, specifying + // the options that a command takes. + innerYargs = yargs.reset(parsed.aliases) + if (shouldUpdateUsage(innerYargs)) { + innerYargs.getUsageInstance().usage( + usageFromParentCommandsCommandHandler(parentCommands, commandHandler), + commandHandler.description + ) + } + Object.keys(commandHandler.builder).forEach((key) => { + innerYargs.option(key, commandHandler.builder[key]) + }) + innerArgv = innerYargs._parseArgs(null, null, true, commandIndex) + aliases = innerYargs.parsed.aliases + } + + if (!yargs._hasOutput()) { + positionalMap = populatePositionals(commandHandler, innerArgv, currentContext, yargs) + } + + const middlewares = globalMiddleware.slice(0).concat(commandHandler.middlewares || []) + applyMiddleware(innerArgv, yargs, middlewares, true) + + // we apply validation post-hoc, so that custom + // checks get passed populated positional arguments. + if (!yargs._hasOutput()) yargs._runValidation(innerArgv, aliases, positionalMap, yargs.parsed.error) + + if (commandHandler.handler && !yargs._hasOutput()) { + yargs._setHasOutput() + + innerArgv = applyMiddleware(innerArgv, yargs, middlewares, false) + + const handlerResult = isPromise(innerArgv) + ? innerArgv.then(argv => commandHandler.handler(argv)) + : commandHandler.handler(innerArgv) + + if (isPromise(handlerResult)) { + handlerResult.catch(error => + yargs.getUsageInstance().fail(null, error) + ) + } + } + + if (command) { + currentContext.commands.pop() + currentContext.fullCommands.pop() + } + numFiles = currentContext.files.length - numFiles + if (numFiles > 0) currentContext.files.splice(numFiles * -1, numFiles) + + return innerArgv + } + + function shouldUpdateUsage (yargs) { + return !yargs.getUsageInstance().getUsageDisabled() && + yargs.getUsageInstance().getUsage().length === 0 + } + + function usageFromParentCommandsCommandHandler (parentCommands, commandHandler) { + const c = DEFAULT_MARKER.test(commandHandler.original) ? commandHandler.original.replace(DEFAULT_MARKER, '').trim() : commandHandler.original + const pc = parentCommands.filter((c) => { return !DEFAULT_MARKER.test(c) }) + pc.push(c) + return `$0 ${pc.join(' ')}` + } + + self.runDefaultBuilderOn = function (yargs) { + if (shouldUpdateUsage(yargs)) { + // build the root-level command string from the default string. + const commandString = DEFAULT_MARKER.test(defaultCommand.original) + ? defaultCommand.original : defaultCommand.original.replace(/^[^[\]<>]*/, '$0 ') + yargs.getUsageInstance().usage( + commandString, + defaultCommand.description + ) + } + const builder = defaultCommand.builder + if (typeof builder === 'function') { + builder(yargs) + } else { + Object.keys(builder).forEach((key) => { + yargs.option(key, builder[key]) + }) + } + } + + // transcribe all positional arguments "command [apple]" + // onto argv. + function populatePositionals (commandHandler, argv, context, yargs) { + argv._ = argv._.slice(context.commands.length) // nuke the current commands + const demanded = commandHandler.demanded.slice(0) + const optional = commandHandler.optional.slice(0) + const positionalMap = {} + + validation.positionalCount(demanded.length, argv._.length) + + while (demanded.length) { + const demand = demanded.shift() + populatePositional(demand, argv, positionalMap) + } + + while (optional.length) { + const maybe = optional.shift() + populatePositional(maybe, argv, positionalMap) + } + + argv._ = context.commands.concat(argv._) + + postProcessPositionals(argv, positionalMap, self.cmdToParseOptions(commandHandler.original)) + + return positionalMap + } + + function populatePositional (positional, argv, positionalMap, parseOptions) { + const cmd = positional.cmd[0] + if (positional.variadic) { + positionalMap[cmd] = argv._.splice(0).map(String) + } else { + if (argv._.length) positionalMap[cmd] = [String(argv._.shift())] + } + } + + // we run yargs-parser against the positional arguments + // applying the same parsing logic used for flags. + function postProcessPositionals (argv, positionalMap, parseOptions) { + // combine the parsing hints we've inferred from the command + // string with explicitly configured parsing hints. + const options = Object.assign({}, yargs.getOptions()) + options.default = Object.assign(parseOptions.default, options.default) + options.alias = Object.assign(parseOptions.alias, options.alias) + options.array = options.array.concat(parseOptions.array) + delete options.config // don't load config when processing positionals. + + const unparsed = [] + Object.keys(positionalMap).forEach((key) => { + positionalMap[key].map((value) => { + unparsed.push(`--${key}`) + unparsed.push(value) + }) + }) + + // short-circuit parse. + if (!unparsed.length) return + + const parsed = Parser.detailed(unparsed, options) + + if (parsed.error) { + yargs.getUsageInstance().fail(parsed.error.message, parsed.error) + } else { + // only copy over positional keys (don't overwrite + // flag arguments that were already parsed). + const positionalKeys = Object.keys(positionalMap) + Object.keys(positionalMap).forEach((key) => { + [].push.apply(positionalKeys, parsed.aliases[key]) + }) + + Object.keys(parsed.argv).forEach((key) => { + if (positionalKeys.indexOf(key) !== -1) { + // any new aliases need to be placed in positionalMap, which + // is used for validation. + if (!positionalMap[key]) positionalMap[key] = parsed.argv[key] + argv[key] = parsed.argv[key] + } + }) + } + } + + self.cmdToParseOptions = function (cmdString) { + const parseOptions = { + array: [], + default: {}, + alias: {}, + demand: {} + } + + const parsed = self.parseCommand(cmdString) + parsed.demanded.forEach((d) => { + const cmds = d.cmd.slice(0) + const cmd = cmds.shift() + if (d.variadic) { + parseOptions.array.push(cmd) + parseOptions.default[cmd] = [] + } + cmds.forEach((c) => { + parseOptions.alias[cmd] = c + }) + parseOptions.demand[cmd] = true + }) + + parsed.optional.forEach((o) => { + const cmds = o.cmd.slice(0) + const cmd = cmds.shift() + if (o.variadic) { + parseOptions.array.push(cmd) + parseOptions.default[cmd] = [] + } + cmds.forEach((c) => { + parseOptions.alias[cmd] = c + }) + }) + + return parseOptions + } + + self.reset = () => { + handlers = {} + aliasMap = {} + defaultCommand = undefined + return self + } + + // used by yargs.parse() to freeze + // the state of commands such that + // we can apply .parse() multiple times + // with the same yargs instance. + let frozen + self.freeze = () => { + frozen = {} + frozen.handlers = handlers + frozen.aliasMap = aliasMap + frozen.defaultCommand = defaultCommand + } + self.unfreeze = () => { + handlers = frozen.handlers + aliasMap = frozen.aliasMap + defaultCommand = frozen.defaultCommand + frozen = undefined + } + + return self +} diff --git a/node_modules/yargs/lib/completion-templates.js b/node_modules/yargs/lib/completion-templates.js new file mode 100644 index 0000000..43714fb --- /dev/null +++ b/node_modules/yargs/lib/completion-templates.js @@ -0,0 +1,49 @@ +exports.completionShTemplate = +`###-begin-{{app_name}}-completions-### +# +# yargs command completion script +# +# Installation: {{app_path}} {{completion_command}} >> ~/.bashrc +# or {{app_path}} {{completion_command}} >> ~/.bash_profile on OSX. +# +_yargs_completions() +{ + local cur_word args type_list + + cur_word="\${COMP_WORDS[COMP_CWORD]}" + args=("\${COMP_WORDS[@]}") + + # ask yargs to generate completions. + type_list=$({{app_path}} --get-yargs-completions "\${args[@]}") + + COMPREPLY=( $(compgen -W "\${type_list}" -- \${cur_word}) ) + + # if no match was found, fall back to filename completion + if [ \${#COMPREPLY[@]} -eq 0 ]; then + COMPREPLY=() + fi + + return 0 +} +complete -o default -F _yargs_completions {{app_name}} +###-end-{{app_name}}-completions-### +` + +exports.completionZshTemplate = `###-begin-{{app_name}}-completions-### +# +# yargs command completion script +# +# Installation: {{app_path}} {{completion_command}} >> ~/.zshrc +# or {{app_path}} {{completion_command}} >> ~/.zsh_profile on OSX. +# +_{{app_name}}_yargs_completions() +{ + local reply + local si=$IFS + IFS=$'\n' reply=($(COMP_CWORD="$((CURRENT-1))" COMP_LINE="$BUFFER" COMP_POINT="$CURSOR" {{app_path}} --get-yargs-completions "\${words[@]}")) + IFS=$si + _describe 'values' reply +} +compdef _{{app_name}}_yargs_completions {{app_name}} +###-end-{{app_name}}-completions-### +` diff --git a/node_modules/yargs/lib/completion.js b/node_modules/yargs/lib/completion.js new file mode 100644 index 0000000..e5cdd58 --- /dev/null +++ b/node_modules/yargs/lib/completion.js @@ -0,0 +1,115 @@ +'use strict' +const path = require('path') + +// add bash completions to your +// yargs-powered applications. +module.exports = function completion (yargs, usage, command) { + const self = { + completionKey: 'get-yargs-completions' + } + + const zshShell = process.env.SHELL && process.env.SHELL.indexOf('zsh') !== -1 + // get a list of completion commands. + // 'args' is the array of strings from the line to be completed + self.getCompletion = function getCompletion (args, done) { + const completions = [] + const current = args.length ? args[args.length - 1] : '' + const argv = yargs.parse(args, true) + const aliases = yargs.parsed.aliases + const parentCommands = yargs.getContext().commands + + // a custom completion function can be provided + // to completion(). + if (completionFunction) { + if (completionFunction.length < 3) { + const result = completionFunction(current, argv) + + // promise based completion function. + if (typeof result.then === 'function') { + return result.then((list) => { + process.nextTick(() => { done(list) }) + }).catch((err) => { + process.nextTick(() => { throw err }) + }) + } + + // synchronous completion function. + return done(result) + } else { + // asynchronous completion function + return completionFunction(current, argv, (completions) => { + done(completions) + }) + } + } + + const handlers = command.getCommandHandlers() + for (let i = 0, ii = args.length; i < ii; ++i) { + if (handlers[args[i]] && handlers[args[i]].builder) { + const builder = handlers[args[i]].builder + if (typeof builder === 'function') { + const y = yargs.reset() + builder(y) + return y.argv + } + } + } + + if (!current.match(/^-/) && parentCommands[parentCommands.length - 1] !== current) { + usage.getCommands().forEach((usageCommand) => { + const commandName = command.parseCommand(usageCommand[0]).cmd + if (args.indexOf(commandName) === -1) { + if (!zshShell) { + completions.push(commandName) + } else { + const desc = usageCommand[1] || '' + completions.push(commandName.replace(/:/g, '\\:') + ':' + desc) + } + } + }) + } + + if (current.match(/^-/) || (current === '' && completions.length === 0)) { + const descs = usage.getDescriptions() + Object.keys(yargs.getOptions().key).forEach((key) => { + // If the key and its aliases aren't in 'args', add the key to 'completions' + const keyAndAliases = [key].concat(aliases[key] || []) + const notInArgs = keyAndAliases.every(val => args.indexOf(`--${val}`) === -1) + if (notInArgs) { + if (!zshShell) { + completions.push(`--${key}`) + } else { + const desc = descs[key] || '' + completions.push(`--${key.replace(/:/g, '\\:')}:${desc.replace('__yargsString__:', '')}`) + } + } + }) + } + + done(completions) + } + + // generate the completion script to add to your .bashrc. + self.generateCompletionScript = function generateCompletionScript ($0, cmd) { + const templates = require('./completion-templates') + let script = zshShell ? templates.completionZshTemplate : templates.completionShTemplate + const name = path.basename($0) + + // add ./to applications not yet installed as bin. + if ($0.match(/\.js$/)) $0 = `./${$0}` + + script = script.replace(/{{app_name}}/g, name) + script = script.replace(/{{completion_command}}/g, cmd) + return script.replace(/{{app_path}}/g, $0) + } + + // register a function to perform your own custom + // completions., this function can be either + // synchrnous or asynchronous. + let completionFunction = null + self.registerFunction = (fn) => { + completionFunction = fn + } + + return self +} diff --git a/node_modules/yargs/lib/decamelize.js b/node_modules/yargs/lib/decamelize.js new file mode 100644 index 0000000..c3a4151 --- /dev/null +++ b/node_modules/yargs/lib/decamelize.js @@ -0,0 +1,32 @@ +/* +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +*/ +'use strict' + +module.exports = (text, separator) => { + separator = typeof separator === 'undefined' ? '_' : separator + + return text + .replace(/([a-z\d])([A-Z])/g, `$1${separator}$2`) + .replace(/([A-Z]+)([A-Z][a-z\d]+)/g, `$1${separator}$2`) + .toLowerCase() +} diff --git a/node_modules/yargs/lib/is-promise.js b/node_modules/yargs/lib/is-promise.js new file mode 100644 index 0000000..0516def --- /dev/null +++ b/node_modules/yargs/lib/is-promise.js @@ -0,0 +1,3 @@ +module.exports = function isPromise (maybePromise) { + return maybePromise instanceof Promise +} diff --git a/node_modules/yargs/lib/levenshtein.js b/node_modules/yargs/lib/levenshtein.js new file mode 100644 index 0000000..c66c1ba --- /dev/null +++ b/node_modules/yargs/lib/levenshtein.js @@ -0,0 +1,58 @@ +/* +Copyright (c) 2011 Andrei Mackenzie + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +*/ + +// levenshtein distance algorithm, pulled from Andrei Mackenzie's MIT licensed. +// gist, which can be found here: https://gist.github.com/andrei-m/982927 +'use strict' +// Compute the edit distance between the two given strings +module.exports = function levenshtein (a, b) { + if (a.length === 0) return b.length + if (b.length === 0) return a.length + + const matrix = [] + + // increment along the first column of each row + let i + for (i = 0; i <= b.length; i++) { + matrix[i] = [i] + } + + // increment each column in the first row + let j + for (j = 0; j <= a.length; j++) { + matrix[0][j] = j + } + + // Fill in the rest of the matrix + for (i = 1; i <= b.length; i++) { + for (j = 1; j <= a.length; j++) { + if (b.charAt(i - 1) === a.charAt(j - 1)) { + matrix[i][j] = matrix[i - 1][j - 1] + } else { + matrix[i][j] = Math.min(matrix[i - 1][j - 1] + 1, // substitution + Math.min(matrix[i][j - 1] + 1, // insertion + matrix[i - 1][j] + 1)) // deletion + } + } + } + + return matrix[b.length][a.length] +} diff --git a/node_modules/yargs/lib/middleware.js b/node_modules/yargs/lib/middleware.js new file mode 100644 index 0000000..9f9c196 --- /dev/null +++ b/node_modules/yargs/lib/middleware.js @@ -0,0 +1,65 @@ +'use strict' + +// hoisted due to circular dependency on command. +module.exports = { + applyMiddleware, + commandMiddlewareFactory, + globalMiddlewareFactory +} +const isPromise = require('./is-promise') +const argsert = require('./argsert') + +function globalMiddlewareFactory (globalMiddleware, context) { + return function (callback, applyBeforeValidation = false) { + argsert(' [boolean]', [callback, applyBeforeValidation], arguments.length) + if (Array.isArray(callback)) { + for (let i = 0; i < callback.length; i++) { + if (typeof callback[i] !== 'function') { + throw Error('middleware must be a function') + } + callback[i].applyBeforeValidation = applyBeforeValidation + } + Array.prototype.push.apply(globalMiddleware, callback) + } else if (typeof callback === 'function') { + callback.applyBeforeValidation = applyBeforeValidation + globalMiddleware.push(callback) + } + return context + } +} + +function commandMiddlewareFactory (commandMiddleware) { + if (!commandMiddleware) return [] + return commandMiddleware.map(middleware => { + middleware.applyBeforeValidation = false + return middleware + }) +} + +function applyMiddleware (argv, yargs, middlewares, beforeValidation) { + const beforeValidationError = new Error('middleware cannot return a promise when applyBeforeValidation is true') + return middlewares + .reduce((accumulation, middleware) => { + if (middleware.applyBeforeValidation !== beforeValidation && + !isPromise(accumulation)) { + return accumulation + } + + if (isPromise(accumulation)) { + return accumulation + .then(initialObj => + Promise.all([initialObj, middleware(initialObj, yargs)]) + ) + .then(([initialObj, middlewareObj]) => + Object.assign(initialObj, middlewareObj) + ) + } else { + const result = middleware(argv, yargs) + if (beforeValidation && isPromise(result)) throw beforeValidationError + + return isPromise(result) + ? result.then(middlewareObj => Object.assign(accumulation, middlewareObj)) + : Object.assign(accumulation, result) + } + }, argv) +} diff --git a/node_modules/yargs/lib/obj-filter.js b/node_modules/yargs/lib/obj-filter.js new file mode 100644 index 0000000..c344ac5 --- /dev/null +++ b/node_modules/yargs/lib/obj-filter.js @@ -0,0 +1,11 @@ +'use strict' +module.exports = function objFilter (original, filter) { + const obj = {} + filter = filter || ((k, v) => true) + Object.keys(original || {}).forEach((key) => { + if (filter(key, original[key])) { + obj[key] = original[key] + } + }) + return obj +} diff --git a/node_modules/yargs/lib/usage.js b/node_modules/yargs/lib/usage.js new file mode 100644 index 0000000..8c3b068 --- /dev/null +++ b/node_modules/yargs/lib/usage.js @@ -0,0 +1,540 @@ +'use strict' +// this file handles outputting usage instructions, +// failures, etc. keeps logging in one place. +const decamelize = require('./decamelize') +const stringWidth = require('string-width') +const objFilter = require('./obj-filter') +const path = require('path') +const setBlocking = require('set-blocking') +const YError = require('./yerror') + +module.exports = function usage (yargs, y18n) { + const __ = y18n.__ + const self = {} + + // methods for ouputting/building failure message. + const fails = [] + self.failFn = function failFn (f) { + fails.push(f) + } + + let failMessage = null + let showHelpOnFail = true + self.showHelpOnFail = function showHelpOnFailFn (enabled, message) { + if (typeof enabled === 'string') { + message = enabled + enabled = true + } else if (typeof enabled === 'undefined') { + enabled = true + } + failMessage = message + showHelpOnFail = enabled + return self + } + + let failureOutput = false + self.fail = function fail (msg, err) { + const logger = yargs._getLoggerInstance() + + if (fails.length) { + for (let i = fails.length - 1; i >= 0; --i) { + fails[i](msg, err, self) + } + } else { + if (yargs.getExitProcess()) setBlocking(true) + + // don't output failure message more than once + if (!failureOutput) { + failureOutput = true + if (showHelpOnFail) { + yargs.showHelp('error') + logger.error() + } + if (msg || err) logger.error(msg || err) + if (failMessage) { + if (msg || err) logger.error('') + logger.error(failMessage) + } + } + + err = err || new YError(msg) + if (yargs.getExitProcess()) { + return yargs.exit(1) + } else if (yargs._hasParseCallback()) { + return yargs.exit(1, err) + } else { + throw err + } + } + } + + // methods for ouputting/building help (usage) message. + let usages = [] + let usageDisabled = false + self.usage = (msg, description) => { + if (msg === null) { + usageDisabled = true + usages = [] + return + } + usageDisabled = false + usages.push([msg, description || '']) + return self + } + self.getUsage = () => { + return usages + } + self.getUsageDisabled = () => { + return usageDisabled + } + + self.getPositionalGroupName = () => { + return __('Positionals:') + } + + let examples = [] + self.example = (cmd, description) => { + examples.push([cmd, description || '']) + } + + let commands = [] + self.command = function command (cmd, description, isDefault, aliases) { + // the last default wins, so cancel out any previously set default + if (isDefault) { + commands = commands.map((cmdArray) => { + cmdArray[2] = false + return cmdArray + }) + } + commands.push([cmd, description || '', isDefault, aliases]) + } + self.getCommands = () => commands + + let descriptions = {} + self.describe = function describe (key, desc) { + if (typeof key === 'object') { + Object.keys(key).forEach((k) => { + self.describe(k, key[k]) + }) + } else { + descriptions[key] = desc + } + } + self.getDescriptions = () => descriptions + + let epilog + self.epilog = (msg) => { + epilog = msg + } + + let wrapSet = false + let wrap + self.wrap = (cols) => { + wrapSet = true + wrap = cols + } + + function getWrap () { + if (!wrapSet) { + wrap = windowWidth() + wrapSet = true + } + + return wrap + } + + const deferY18nLookupPrefix = '__yargsString__:' + self.deferY18nLookup = str => deferY18nLookupPrefix + str + + const defaultGroup = 'Options:' + self.help = function help () { + normalizeAliases() + + // handle old demanded API + const base$0 = path.basename(yargs.$0) + const demandedOptions = yargs.getDemandedOptions() + const demandedCommands = yargs.getDemandedCommands() + const groups = yargs.getGroups() + const options = yargs.getOptions() + + let keys = [] + keys = keys.concat(Object.keys(descriptions)) + keys = keys.concat(Object.keys(demandedOptions)) + keys = keys.concat(Object.keys(demandedCommands)) + keys = keys.concat(Object.keys(options.default)) + keys = keys.filter(filterHiddenOptions) + keys = Object.keys(keys.reduce((acc, key) => { + if (key !== '_') acc[key] = true + return acc + }, {})) + + const theWrap = getWrap() + const ui = require('cliui')({ + width: theWrap, + wrap: !!theWrap + }) + + // the usage string. + if (!usageDisabled) { + if (usages.length) { + // user-defined usage. + usages.forEach((usage) => { + ui.div(`${usage[0].replace(/\$0/g, base$0)}`) + if (usage[1]) { + ui.div({ text: `${usage[1]}`, padding: [1, 0, 0, 0] }) + } + }) + ui.div() + } else if (commands.length) { + let u = null + // demonstrate how commands are used. + if (demandedCommands._) { + u = `${base$0} <${__('command')}>\n` + } else { + u = `${base$0} [${__('command')}]\n` + } + ui.div(`${u}`) + } + } + + // your application's commands, i.e., non-option + // arguments populated in '_'. + if (commands.length) { + ui.div(__('Commands:')) + + const context = yargs.getContext() + const parentCommands = context.commands.length ? `${context.commands.join(' ')} ` : '' + + if (yargs.getParserConfiguration()['sort-commands'] === true) { + commands = commands.sort((a, b) => a[0].localeCompare(b[0])) + } + + commands.forEach((command) => { + const commandString = `${base$0} ${parentCommands}${command[0].replace(/^\$0 ?/, '')}` // drop $0 from default commands. + ui.span( + { + text: commandString, + padding: [0, 2, 0, 2], + width: maxWidth(commands, theWrap, `${base$0}${parentCommands}`) + 4 + }, + { text: command[1] } + ) + const hints = [] + if (command[2]) hints.push(`[${__('default:').slice(0, -1)}]`) // TODO hacking around i18n here + if (command[3] && command[3].length) { + hints.push(`[${__('aliases:')} ${command[3].join(', ')}]`) + } + if (hints.length) { + ui.div({ text: hints.join(' '), padding: [0, 0, 0, 2], align: 'right' }) + } else { + ui.div() + } + }) + + ui.div() + } + + // perform some cleanup on the keys array, making it + // only include top-level keys not their aliases. + const aliasKeys = (Object.keys(options.alias) || []) + .concat(Object.keys(yargs.parsed.newAliases) || []) + + keys = keys.filter(key => !yargs.parsed.newAliases[key] && aliasKeys.every(alias => (options.alias[alias] || []).indexOf(key) === -1)) + + // populate 'Options:' group with any keys that have not + // explicitly had a group set. + if (!groups[defaultGroup]) groups[defaultGroup] = [] + addUngroupedKeys(keys, options.alias, groups) + + // display 'Options:' table along with any custom tables: + Object.keys(groups).forEach((groupName) => { + if (!groups[groupName].length) return + + // if we've grouped the key 'f', but 'f' aliases 'foobar', + // normalizedKeys should contain only 'foobar'. + const normalizedKeys = groups[groupName].filter(filterHiddenOptions).map((key) => { + if (~aliasKeys.indexOf(key)) return key + for (let i = 0, aliasKey; (aliasKey = aliasKeys[i]) !== undefined; i++) { + if (~(options.alias[aliasKey] || []).indexOf(key)) return aliasKey + } + return key + }) + + if (normalizedKeys.length < 1) return + + ui.div(__(groupName)) + + // actually generate the switches string --foo, -f, --bar. + const switches = normalizedKeys.reduce((acc, key) => { + acc[key] = [ key ].concat(options.alias[key] || []) + .map(sw => { + // for the special positional group don't + // add '--' or '-' prefix. + if (groupName === self.getPositionalGroupName()) return sw + else return (sw.length > 1 ? '--' : '-') + sw + }) + .join(', ') + + return acc + }, {}) + + normalizedKeys.forEach((key) => { + const kswitch = switches[key] + let desc = descriptions[key] || '' + let type = null + + if (~desc.lastIndexOf(deferY18nLookupPrefix)) desc = __(desc.substring(deferY18nLookupPrefix.length)) + + if (~options.boolean.indexOf(key)) type = `[${__('boolean')}]` + if (~options.count.indexOf(key)) type = `[${__('count')}]` + if (~options.string.indexOf(key)) type = `[${__('string')}]` + if (~options.normalize.indexOf(key)) type = `[${__('string')}]` + if (~options.array.indexOf(key)) type = `[${__('array')}]` + if (~options.number.indexOf(key)) type = `[${__('number')}]` + + const extra = [ + type, + (key in demandedOptions) ? `[${__('required')}]` : null, + options.choices && options.choices[key] ? `[${__('choices:')} ${ + self.stringifiedValues(options.choices[key])}]` : null, + defaultString(options.default[key], options.defaultDescription[key]) + ].filter(Boolean).join(' ') + + ui.span( + { text: kswitch, padding: [0, 2, 0, 2], width: maxWidth(switches, theWrap) + 4 }, + desc + ) + + if (extra) ui.div({ text: extra, padding: [0, 0, 0, 2], align: 'right' }) + else ui.div() + }) + + ui.div() + }) + + // describe some common use-cases for your application. + if (examples.length) { + ui.div(__('Examples:')) + + examples.forEach((example) => { + example[0] = example[0].replace(/\$0/g, base$0) + }) + + examples.forEach((example) => { + if (example[1] === '') { + ui.div( + { + text: example[0], + padding: [0, 2, 0, 2] + } + ) + } else { + ui.div( + { + text: example[0], + padding: [0, 2, 0, 2], + width: maxWidth(examples, theWrap) + 4 + }, { + text: example[1] + } + ) + } + }) + + ui.div() + } + + // the usage string. + if (epilog) { + const e = epilog.replace(/\$0/g, base$0) + ui.div(`${e}\n`) + } + + // Remove the trailing white spaces + return ui.toString().replace(/\s*$/, '') + } + + // return the maximum width of a string + // in the left-hand column of a table. + function maxWidth (table, theWrap, modifier) { + let width = 0 + + // table might be of the form [leftColumn], + // or {key: leftColumn} + if (!Array.isArray(table)) { + table = Object.keys(table).map(key => [table[key]]) + } + + table.forEach((v) => { + width = Math.max( + stringWidth(modifier ? `${modifier} ${v[0]}` : v[0]), + width + ) + }) + + // if we've enabled 'wrap' we should limit + // the max-width of the left-column. + if (theWrap) width = Math.min(width, parseInt(theWrap * 0.5, 10)) + + return width + } + + // make sure any options set for aliases, + // are copied to the keys being aliased. + function normalizeAliases () { + // handle old demanded API + const demandedOptions = yargs.getDemandedOptions() + const options = yargs.getOptions() + + ;(Object.keys(options.alias) || []).forEach((key) => { + options.alias[key].forEach((alias) => { + // copy descriptions. + if (descriptions[alias]) self.describe(key, descriptions[alias]) + // copy demanded. + if (alias in demandedOptions) yargs.demandOption(key, demandedOptions[alias]) + // type messages. + if (~options.boolean.indexOf(alias)) yargs.boolean(key) + if (~options.count.indexOf(alias)) yargs.count(key) + if (~options.string.indexOf(alias)) yargs.string(key) + if (~options.normalize.indexOf(alias)) yargs.normalize(key) + if (~options.array.indexOf(alias)) yargs.array(key) + if (~options.number.indexOf(alias)) yargs.number(key) + }) + }) + } + + // given a set of keys, place any keys that are + // ungrouped under the 'Options:' grouping. + function addUngroupedKeys (keys, aliases, groups) { + let groupedKeys = [] + let toCheck = null + Object.keys(groups).forEach((group) => { + groupedKeys = groupedKeys.concat(groups[group]) + }) + + keys.forEach((key) => { + toCheck = [key].concat(aliases[key]) + if (!toCheck.some(k => groupedKeys.indexOf(k) !== -1)) { + groups[defaultGroup].push(key) + } + }) + return groupedKeys + } + + function filterHiddenOptions (key) { + return yargs.getOptions().hiddenOptions.indexOf(key) < 0 || yargs.parsed.argv[yargs.getOptions().showHiddenOpt] + } + + self.showHelp = (level) => { + const logger = yargs._getLoggerInstance() + if (!level) level = 'error' + const emit = typeof level === 'function' ? level : logger[level] + emit(self.help()) + } + + self.functionDescription = (fn) => { + const description = fn.name ? decamelize(fn.name, '-') : __('generated-value') + return ['(', description, ')'].join('') + } + + self.stringifiedValues = function stringifiedValues (values, separator) { + let string = '' + const sep = separator || ', ' + const array = [].concat(values) + + if (!values || !array.length) return string + + array.forEach((value) => { + if (string.length) string += sep + string += JSON.stringify(value) + }) + + return string + } + + // format the default-value-string displayed in + // the right-hand column. + function defaultString (value, defaultDescription) { + let string = `[${__('default:')} ` + + if (value === undefined && !defaultDescription) return null + + if (defaultDescription) { + string += defaultDescription + } else { + switch (typeof value) { + case 'string': + string += `"${value}"` + break + case 'object': + string += JSON.stringify(value) + break + default: + string += value + } + } + + return `${string}]` + } + + // guess the width of the console window, max-width 80. + function windowWidth () { + const maxWidth = 80 + if (typeof process === 'object' && process.stdout && process.stdout.columns) { + return Math.min(maxWidth, process.stdout.columns) + } else { + return maxWidth + } + } + + // logic for displaying application version. + let version = null + self.version = (ver) => { + version = ver + } + + self.showVersion = () => { + const logger = yargs._getLoggerInstance() + logger.log(version) + } + + self.reset = function reset (localLookup) { + // do not reset wrap here + // do not reset fails here + failMessage = null + failureOutput = false + usages = [] + usageDisabled = false + epilog = undefined + examples = [] + commands = [] + descriptions = objFilter(descriptions, (k, v) => !localLookup[k]) + return self + } + + let frozen + self.freeze = function freeze () { + frozen = {} + frozen.failMessage = failMessage + frozen.failureOutput = failureOutput + frozen.usages = usages + frozen.usageDisabled = usageDisabled + frozen.epilog = epilog + frozen.examples = examples + frozen.commands = commands + frozen.descriptions = descriptions + } + self.unfreeze = function unfreeze () { + failMessage = frozen.failMessage + failureOutput = frozen.failureOutput + usages = frozen.usages + usageDisabled = frozen.usageDisabled + epilog = frozen.epilog + examples = frozen.examples + commands = frozen.commands + descriptions = frozen.descriptions + frozen = undefined + } + + return self +} diff --git a/node_modules/yargs/lib/validation.js b/node_modules/yargs/lib/validation.js new file mode 100644 index 0000000..e9bbb12 --- /dev/null +++ b/node_modules/yargs/lib/validation.js @@ -0,0 +1,341 @@ +'use strict' +const argsert = require('./argsert') +const objFilter = require('./obj-filter') +const specialKeys = ['$0', '--', '_'] + +// validation-type-stuff, missing params, +// bad implications, custom checks. +module.exports = function validation (yargs, usage, y18n) { + const __ = y18n.__ + const __n = y18n.__n + const self = {} + + // validate appropriate # of non-option + // arguments were provided, i.e., '_'. + self.nonOptionCount = function nonOptionCount (argv) { + const demandedCommands = yargs.getDemandedCommands() + // don't count currently executing commands + const _s = argv._.length - yargs.getContext().commands.length + + if (demandedCommands._ && (_s < demandedCommands._.min || _s > demandedCommands._.max)) { + if (_s < demandedCommands._.min) { + if (demandedCommands._.minMsg !== undefined) { + usage.fail( + // replace $0 with observed, $1 with expected. + demandedCommands._.minMsg ? demandedCommands._.minMsg.replace(/\$0/g, _s).replace(/\$1/, demandedCommands._.min) : null + ) + } else { + usage.fail( + __('Not enough non-option arguments: got %s, need at least %s', _s, demandedCommands._.min) + ) + } + } else if (_s > demandedCommands._.max) { + if (demandedCommands._.maxMsg !== undefined) { + usage.fail( + // replace $0 with observed, $1 with expected. + demandedCommands._.maxMsg ? demandedCommands._.maxMsg.replace(/\$0/g, _s).replace(/\$1/, demandedCommands._.max) : null + ) + } else { + usage.fail( + __('Too many non-option arguments: got %s, maximum of %s', _s, demandedCommands._.max) + ) + } + } + } + } + + // validate the appropriate # of + // positional arguments were provided: + self.positionalCount = function positionalCount (required, observed) { + if (observed < required) { + usage.fail( + __('Not enough non-option arguments: got %s, need at least %s', observed, required) + ) + } + } + + // make sure all the required arguments are present. + self.requiredArguments = function requiredArguments (argv) { + const demandedOptions = yargs.getDemandedOptions() + let missing = null + + Object.keys(demandedOptions).forEach((key) => { + if (!argv.hasOwnProperty(key) || typeof argv[key] === 'undefined') { + missing = missing || {} + missing[key] = demandedOptions[key] + } + }) + + if (missing) { + const customMsgs = [] + Object.keys(missing).forEach((key) => { + const msg = missing[key] + if (msg && customMsgs.indexOf(msg) < 0) { + customMsgs.push(msg) + } + }) + + const customMsg = customMsgs.length ? `\n${customMsgs.join('\n')}` : '' + + usage.fail(__n( + 'Missing required argument: %s', + 'Missing required arguments: %s', + Object.keys(missing).length, + Object.keys(missing).join(', ') + customMsg + )) + } + } + + // check for unknown arguments (strict-mode). + self.unknownArguments = function unknownArguments (argv, aliases, positionalMap) { + const commandKeys = yargs.getCommandInstance().getCommands() + const unknown = [] + const currentContext = yargs.getContext() + + Object.keys(argv).forEach((key) => { + if (specialKeys.indexOf(key) === -1 && + !positionalMap.hasOwnProperty(key) && + !yargs._getParseContext().hasOwnProperty(key) && + !aliases.hasOwnProperty(key) + ) { + unknown.push(key) + } + }) + + if (commandKeys.length > 0) { + argv._.slice(currentContext.commands.length).forEach((key) => { + if (commandKeys.indexOf(key) === -1) { + unknown.push(key) + } + }) + } + + if (unknown.length > 0) { + usage.fail(__n( + 'Unknown argument: %s', + 'Unknown arguments: %s', + unknown.length, + unknown.join(', ') + )) + } + } + + // validate arguments limited to enumerated choices + self.limitedChoices = function limitedChoices (argv) { + const options = yargs.getOptions() + const invalid = {} + + if (!Object.keys(options.choices).length) return + + Object.keys(argv).forEach((key) => { + if (specialKeys.indexOf(key) === -1 && + options.choices.hasOwnProperty(key)) { + [].concat(argv[key]).forEach((value) => { + // TODO case-insensitive configurability + if (options.choices[key].indexOf(value) === -1 && + value !== undefined) { + invalid[key] = (invalid[key] || []).concat(value) + } + }) + } + }) + + const invalidKeys = Object.keys(invalid) + + if (!invalidKeys.length) return + + let msg = __('Invalid values:') + invalidKeys.forEach((key) => { + msg += `\n ${__( + 'Argument: %s, Given: %s, Choices: %s', + key, + usage.stringifiedValues(invalid[key]), + usage.stringifiedValues(options.choices[key]) + )}` + }) + usage.fail(msg) + } + + // custom checks, added using the `check` option on yargs. + let checks = [] + self.check = function check (f, global) { + checks.push({ + func: f, + global + }) + } + + self.customChecks = function customChecks (argv, aliases) { + for (let i = 0, f; (f = checks[i]) !== undefined; i++) { + const func = f.func + let result = null + try { + result = func(argv, aliases) + } catch (err) { + usage.fail(err.message ? err.message : err, err) + continue + } + + if (!result) { + usage.fail(__('Argument check failed: %s', func.toString())) + } else if (typeof result === 'string' || result instanceof Error) { + usage.fail(result.toString(), result) + } + } + } + + // check implications, argument foo implies => argument bar. + let implied = {} + self.implies = function implies (key, value) { + argsert(' [array|number|string]', [key, value], arguments.length) + + if (typeof key === 'object') { + Object.keys(key).forEach((k) => { + self.implies(k, key[k]) + }) + } else { + yargs.global(key) + if (!implied[key]) { + implied[key] = [] + } + if (Array.isArray(value)) { + value.forEach((i) => self.implies(key, i)) + } else { + implied[key].push(value) + } + } + } + self.getImplied = function getImplied () { + return implied + } + + self.implications = function implications (argv) { + const implyFail = [] + + Object.keys(implied).forEach((key) => { + const origKey = key + ;(implied[key] || []).forEach((value) => { + let num + let key = origKey + const origValue = value + + // convert string '1' to number 1 + num = Number(key) + key = isNaN(num) ? key : num + + if (typeof key === 'number') { + // check length of argv._ + key = argv._.length >= key + } else if (key.match(/^--no-.+/)) { + // check if key doesn't exist + key = key.match(/^--no-(.+)/)[1] + key = !argv[key] + } else { + // check if key exists + key = argv[key] + } + + num = Number(value) + value = isNaN(num) ? value : num + + if (typeof value === 'number') { + value = argv._.length >= value + } else if (value.match(/^--no-.+/)) { + value = value.match(/^--no-(.+)/)[1] + value = !argv[value] + } else { + value = argv[value] + } + if (key && !value) { + implyFail.push(` ${origKey} -> ${origValue}`) + } + }) + }) + + if (implyFail.length) { + let msg = `${__('Implications failed:')}\n` + + implyFail.forEach((value) => { + msg += (value) + }) + + usage.fail(msg) + } + } + + let conflicting = {} + self.conflicts = function conflicts (key, value) { + argsert(' [array|string]', [key, value], arguments.length) + + if (typeof key === 'object') { + Object.keys(key).forEach((k) => { + self.conflicts(k, key[k]) + }) + } else { + yargs.global(key) + if (!conflicting[key]) { + conflicting[key] = [] + } + if (Array.isArray(value)) { + value.forEach((i) => self.conflicts(key, i)) + } else { + conflicting[key].push(value) + } + } + } + self.getConflicting = () => conflicting + + self.conflicting = function conflictingFn (argv) { + Object.keys(argv).forEach((key) => { + if (conflicting[key]) { + conflicting[key].forEach((value) => { + // we default keys to 'undefined' that have been configured, we should not + // apply conflicting check unless they are a value other than 'undefined'. + if (value && argv[key] !== undefined && argv[value] !== undefined) { + usage.fail(__('Arguments %s and %s are mutually exclusive', key, value)) + } + }) + } + }) + } + + self.recommendCommands = function recommendCommands (cmd, potentialCommands) { + const distance = require('./levenshtein') + const threshold = 3 // if it takes more than three edits, let's move on. + potentialCommands = potentialCommands.sort((a, b) => b.length - a.length) + + let recommended = null + let bestDistance = Infinity + for (let i = 0, candidate; (candidate = potentialCommands[i]) !== undefined; i++) { + const d = distance(cmd, candidate) + if (d <= threshold && d < bestDistance) { + bestDistance = d + recommended = candidate + } + } + if (recommended) usage.fail(__('Did you mean %s?', recommended)) + } + + self.reset = function reset (localLookup) { + implied = objFilter(implied, (k, v) => !localLookup[k]) + conflicting = objFilter(conflicting, (k, v) => !localLookup[k]) + checks = checks.filter(c => c.global) + return self + } + + let frozen + self.freeze = function freeze () { + frozen = {} + frozen.implied = implied + frozen.checks = checks + frozen.conflicting = conflicting + } + self.unfreeze = function unfreeze () { + implied = frozen.implied + checks = frozen.checks + conflicting = frozen.conflicting + frozen = undefined + } + + return self +} diff --git a/node_modules/yargs/lib/yerror.js b/node_modules/yargs/lib/yerror.js new file mode 100644 index 0000000..53375a0 --- /dev/null +++ b/node_modules/yargs/lib/yerror.js @@ -0,0 +1,11 @@ +'use strict' +function YError (msg) { + this.name = 'YError' + this.message = msg || 'yargs error' + Error.captureStackTrace(this, YError) +} + +YError.prototype = Object.create(Error.prototype) +YError.prototype.constructor = YError + +module.exports = YError diff --git a/node_modules/yargs/locales/be.json b/node_modules/yargs/locales/be.json new file mode 100644 index 0000000..141ebe1 --- /dev/null +++ b/node_modules/yargs/locales/be.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Каманды:", + "Options:": "Опцыі:", + "Examples:": "Прыклады:", + "boolean": "булевы тып", + "count": "падлік", + "string": "радковы тып", + "number": "лік", + "array": "масіў", + "required": "неабходна", + "default:": "па змаўчанні:", + "choices:": "магчымасці:", + "aliases:": "аліасы:", + "generated-value": "згенераванае значэнне", + "Not enough non-option arguments: got %s, need at least %s": "Недастаткова неапцыйных аргументаў: ёсць %s, трэба як мінімум %s", + "Too many non-option arguments: got %s, maximum of %s": "Занадта шмат неапцыйных аргументаў: ёсць %s, максімум дапушчальна %s", + "Missing argument value: %s": { + "one": "Не хапае значэння аргументу: %s", + "other": "Не хапае значэнняў аргументаў: %s" + }, + "Missing required argument: %s": { + "one": "Не хапае неабходнага аргументу: %s", + "other": "Не хапае неабходных аргументаў: %s" + }, + "Unknown argument: %s": { + "one": "Невядомы аргумент: %s", + "other": "Невядомыя аргументы: %s" + }, + "Invalid values:": "Несапраўдныя значэння:", + "Argument: %s, Given: %s, Choices: %s": "Аргумент: %s, Дадзенае значэнне: %s, Магчымасці: %s", + "Argument check failed: %s": "Праверка аргументаў не ўдалася: %s", + "Implications failed:": "Дадзены аргумент патрабуе наступны дадатковы аргумент:", + "Not enough arguments following: %s": "Недастаткова наступных аргументаў: %s", + "Invalid JSON config file: %s": "Несапраўдны файл канфігурацыі JSON: %s", + "Path to JSON config file": "Шлях да файла канфігурацыі JSON", + "Show help": "Паказаць дапамогу", + "Show version number": "Паказаць нумар версіі", + "Did you mean %s?": "Вы мелі на ўвазе %s?" +} diff --git a/node_modules/yargs/locales/de.json b/node_modules/yargs/locales/de.json new file mode 100644 index 0000000..05d9837 --- /dev/null +++ b/node_modules/yargs/locales/de.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Kommandos:", + "Options:": "Optionen:", + "Examples:": "Beispiele:", + "boolean": "boolean", + "count": "Zähler", + "string": "string", + "number": "Zahl", + "array": "array", + "required": "erforderlich", + "default:": "Standard:", + "choices:": "Möglichkeiten:", + "aliases:": "Aliase:", + "generated-value": "Generierter-Wert", + "Not enough non-option arguments: got %s, need at least %s": "Nicht genügend Argumente ohne Optionen: %s vorhanden, mindestens %s benötigt", + "Too many non-option arguments: got %s, maximum of %s": "Zu viele Argumente ohne Optionen: %s vorhanden, maximal %s erlaubt", + "Missing argument value: %s": { + "one": "Fehlender Argumentwert: %s", + "other": "Fehlende Argumentwerte: %s" + }, + "Missing required argument: %s": { + "one": "Fehlendes Argument: %s", + "other": "Fehlende Argumente: %s" + }, + "Unknown argument: %s": { + "one": "Unbekanntes Argument: %s", + "other": "Unbekannte Argumente: %s" + }, + "Invalid values:": "Unzulässige Werte:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Gegeben: %s, Möglichkeiten: %s", + "Argument check failed: %s": "Argumente-Check fehlgeschlagen: %s", + "Implications failed:": "Fehlende abhängige Argumente:", + "Not enough arguments following: %s": "Nicht genügend Argumente nach: %s", + "Invalid JSON config file: %s": "Fehlerhafte JSON-Config Datei: %s", + "Path to JSON config file": "Pfad zur JSON-Config Datei", + "Show help": "Hilfe anzeigen", + "Show version number": "Version anzeigen", + "Did you mean %s?": "Meintest du %s?" +} diff --git a/node_modules/yargs/locales/en.json b/node_modules/yargs/locales/en.json new file mode 100644 index 0000000..b32a63f --- /dev/null +++ b/node_modules/yargs/locales/en.json @@ -0,0 +1,42 @@ +{ + "Commands:": "Commands:", + "Options:": "Options:", + "Examples:": "Examples:", + "boolean": "boolean", + "count": "count", + "string": "string", + "number": "number", + "array": "array", + "required": "required", + "default:": "default:", + "choices:": "choices:", + "aliases:": "aliases:", + "generated-value": "generated-value", + "Not enough non-option arguments: got %s, need at least %s": "Not enough non-option arguments: got %s, need at least %s", + "Too many non-option arguments: got %s, maximum of %s": "Too many non-option arguments: got %s, maximum of %s", + "Missing argument value: %s": { + "one": "Missing argument value: %s", + "other": "Missing argument values: %s" + }, + "Missing required argument: %s": { + "one": "Missing required argument: %s", + "other": "Missing required arguments: %s" + }, + "Unknown argument: %s": { + "one": "Unknown argument: %s", + "other": "Unknown arguments: %s" + }, + "Invalid values:": "Invalid values:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Given: %s, Choices: %s", + "Argument check failed: %s": "Argument check failed: %s", + "Implications failed:": "Missing dependent arguments:", + "Not enough arguments following: %s": "Not enough arguments following: %s", + "Invalid JSON config file: %s": "Invalid JSON config file: %s", + "Path to JSON config file": "Path to JSON config file", + "Show help": "Show help", + "Show version number": "Show version number", + "Did you mean %s?": "Did you mean %s?", + "Arguments %s and %s are mutually exclusive" : "Arguments %s and %s are mutually exclusive", + "Positionals:": "Positionals:", + "command": "command" +} diff --git a/node_modules/yargs/locales/es.json b/node_modules/yargs/locales/es.json new file mode 100644 index 0000000..d7c8af9 --- /dev/null +++ b/node_modules/yargs/locales/es.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Comandos:", + "Options:": "Opciones:", + "Examples:": "Ejemplos:", + "boolean": "booleano", + "count": "cuenta", + "string": "cadena de caracteres", + "number": "número", + "array": "tabla", + "required": "requerido", + "default:": "defecto:", + "choices:": "selección:", + "aliases:": "alias:", + "generated-value": "valor-generado", + "Not enough non-option arguments: got %s, need at least %s": "Hacen falta argumentos no-opcionales: Número recibido %s, necesita por lo menos %s", + "Too many non-option arguments: got %s, maximum of %s": "Demasiados argumentos no-opcionales: Número recibido %s, máximo es %s", + "Missing argument value: %s": { + "one": "Falta argumento: %s", + "other": "Faltan argumentos: %s" + }, + "Missing required argument: %s": { + "one": "Falta argumento requerido: %s", + "other": "Faltan argumentos requeridos: %s" + }, + "Unknown argument: %s": { + "one": "Argumento desconocido: %s", + "other": "Argumentos desconocidos: %s" + }, + "Invalid values:": "Valores inválidos:", + "Argument: %s, Given: %s, Choices: %s": "Argumento: %s, Recibido: %s, Seleccionados: %s", + "Argument check failed: %s": "Verificación de argumento ha fallado: %s", + "Implications failed:": "Implicaciones fallidas:", + "Not enough arguments following: %s": "No hay suficientes argumentos después de: %s", + "Invalid JSON config file: %s": "Archivo de configuración JSON inválido: %s", + "Path to JSON config file": "Ruta al archivo de configuración JSON", + "Show help": "Muestra ayuda", + "Show version number": "Muestra número de versión", + "Did you mean %s?": "Quisiste decir %s?" +} diff --git a/node_modules/yargs/locales/fr.json b/node_modules/yargs/locales/fr.json new file mode 100644 index 0000000..cf9c74b --- /dev/null +++ b/node_modules/yargs/locales/fr.json @@ -0,0 +1,37 @@ +{ + "Commands:": "Commandes:", + "Options:": "Options:", + "Examples:": "Exemples:", + "boolean": "booléen", + "count": "comptage", + "string": "chaine de caractère", + "number": "nombre", + "array": "tableau", + "required": "requis", + "default:": "défaut:", + "choices:": "choix:", + "generated-value": "valeur générée", + "Not enough non-option arguments: got %s, need at least %s": "Pas assez d'arguments non-option: reçu %s, besoin d'au moins %s", + "Too many non-option arguments: got %s, maximum of %s": "Trop d'arguments non-option: reçu %s, maximum %s", + "Missing argument value: %s": { + "one": "Argument manquant: %s", + "other": "Arguments manquants: %s" + }, + "Missing required argument: %s": { + "one": "Argument requis manquant: %s", + "other": "Arguments requis manquants: %s" + }, + "Unknown argument: %s": { + "one": "Argument inconnu: %s", + "other": "Arguments inconnus: %s" + }, + "Invalid values:": "Valeurs invalides:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Donné: %s, Choix: %s", + "Argument check failed: %s": "Echec de la vérification de l'argument: %s", + "Implications failed:": "Arguments dépendants manquants:", + "Not enough arguments following: %s": "Pas assez d'arguments suivant: %s", + "Invalid JSON config file: %s": "Fichier de configuration JSON invalide: %s", + "Path to JSON config file": "Chemin du fichier de configuration JSON", + "Show help": "Affiche de l'aide", + "Show version number": "Affiche le numéro de version" +} diff --git a/node_modules/yargs/locales/hi.json b/node_modules/yargs/locales/hi.json new file mode 100644 index 0000000..2cd677a --- /dev/null +++ b/node_modules/yargs/locales/hi.json @@ -0,0 +1,42 @@ +{ + "Commands:": "आदेश:", + "Options:": "विकल्प:", + "Examples:": "उदाहरण:", + "boolean": "सत्यता", + "count": "संख्या", + "string": "वर्णों का तार ", + "number": "अंक", + "array": "सरणी", + "required": "आवश्यक", + "default:": "डिफॉल्ट:", + "choices:": "विकल्प:", + "aliases:": "उपनाम:", + "generated-value": "उत्पन्न-मूल्य", + "Not enough non-option arguments: got %s, need at least %s": "पर्याप्त गैर-विकल्प तर्क प्राप्त नहीं: %s प्राप्त, कम से कम %s की आवश्यकता है", + "Too many non-option arguments: got %s, maximum of %s": "बहुत सारे गैर-विकल्प तर्क: %s प्राप्त, अधिकतम %s मान्य", + "Missing argument value: %s": { + "one": "कुछ तर्को के मूल्य गुम हैं: %s", + "other": "कुछ तर्को के मूल्य गुम हैं: %s" + }, + "Missing required argument: %s": { + "one": "आवश्यक तर्क गुम हैं: %s", + "other": "आवश्यक तर्क गुम हैं: %s" + }, + "Unknown argument: %s": { + "one": "अज्ञात तर्क प्राप्त: %s", + "other": "अज्ञात तर्क प्राप्त: %s" + }, + "Invalid values:": "अमान्य मूल्य:", + "Argument: %s, Given: %s, Choices: %s": "तर्क: %s, प्राप्त: %s, विकल्प: %s", + "Argument check failed: %s": "तर्क जांच विफल: %s", + "Implications failed:": "दिए गए तर्क के लिए अतिरिक्त तर्क की अपेक्षा है:", + "Not enough arguments following: %s": "निम्नलिखित के बाद पर्याप्त तर्क नहीं प्राप्त: %s", + "Invalid JSON config file: %s": "अमान्य JSON config फाइल: %s", + "Path to JSON config file": "JSON config फाइल का पथ", + "Show help": "सहायता दिखाएँ", + "Show version number": "Version संख्या दिखाएँ", + "Did you mean %s?": "क्या आपका मतलब है %s?", + "Arguments %s and %s are mutually exclusive" : "तर्क %s और %s परस्पर अनन्य हैं", + "Positionals:": "स्थानीय:", + "command": "आदेश" +} diff --git a/node_modules/yargs/locales/hu.json b/node_modules/yargs/locales/hu.json new file mode 100644 index 0000000..7b7d166 --- /dev/null +++ b/node_modules/yargs/locales/hu.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Parancsok:", + "Options:": "Opciók:", + "Examples:": "Példák:", + "boolean": "boolean", + "count": "számláló", + "string": "szöveg", + "number": "szám", + "array": "tömb", + "required": "kötelező", + "default:": "alapértelmezett:", + "choices:": "lehetőségek:", + "aliases:": "aliaszok:", + "generated-value": "generált-érték", + "Not enough non-option arguments: got %s, need at least %s": "Nincs elég nem opcionális argumentum: %s van, legalább %s kell", + "Too many non-option arguments: got %s, maximum of %s": "Túl sok nem opciánlis argumentum van: %s van, maximum %s lehet", + "Missing argument value: %s": { + "one": "Hiányzó argumentum érték: %s", + "other": "Hiányzó argumentum értékek: %s" + }, + "Missing required argument: %s": { + "one": "Hiányzó kötelező argumentum: %s", + "other": "Hiányzó kötelező argumentumok: %s" + }, + "Unknown argument: %s": { + "one": "Ismeretlen argumentum: %s", + "other": "Ismeretlen argumentumok: %s" + }, + "Invalid values:": "Érvénytelen érték:", + "Argument: %s, Given: %s, Choices: %s": "Argumentum: %s, Megadott: %s, Lehetőségek: %s", + "Argument check failed: %s": "Argumentum ellenőrzés sikertelen: %s", + "Implications failed:": "Implikációk sikertelenek:", + "Not enough arguments following: %s": "Nem elég argumentum követi: %s", + "Invalid JSON config file: %s": "Érvénytelen JSON konfigurációs file: %s", + "Path to JSON config file": "JSON konfigurációs file helye", + "Show help": "Súgo megjelenítése", + "Show version number": "Verziószám megjelenítése", + "Did you mean %s?": "Erre gondoltál %s?" +} diff --git a/node_modules/yargs/locales/id.json b/node_modules/yargs/locales/id.json new file mode 100644 index 0000000..87e441c --- /dev/null +++ b/node_modules/yargs/locales/id.json @@ -0,0 +1,43 @@ + +{ + "Commands:": "Perintah:", + "Options:": "Pilihan:", + "Examples:": "Contoh:", + "boolean": "boolean", + "count": "jumlah", + "number": "nomor", + "string": "string", + "array": "larik", + "required": "diperlukan", + "default:": "bawaan:", + "aliases:": "istilah lain:", + "choices:": "pilihan:", + "generated-value": "nilai-yang-dihasilkan", + "Not enough non-option arguments: got %s, need at least %s": "Argumen wajib kurang: hanya %s, minimal %s", + "Too many non-option arguments: got %s, maximum of %s": "Terlalu banyak argumen wajib: ada %s, maksimal %s", + "Missing argument value: %s": { + "one": "Kurang argumen: %s", + "other": "Kurang argumen: %s" + }, + "Missing required argument: %s": { + "one": "Kurang argumen wajib: %s", + "other": "Kurang argumen wajib: %s" + }, + "Unknown argument: %s": { + "one": "Argumen tak diketahui: %s", + "other": "Argumen tak diketahui: %s" + }, + "Invalid values:": "Nilai-nilai tidak valid:", + "Argument: %s, Given: %s, Choices: %s": "Argumen: %s, Diberikan: %s, Pilihan: %s", + "Argument check failed: %s": "Pemeriksaan argument gagal: %s", + "Implications failed:": "Implikasi gagal:", + "Not enough arguments following: %s": "Kurang argumen untuk: %s", + "Invalid JSON config file: %s": "Berkas konfigurasi JSON tidak valid: %s", + "Path to JSON config file": "Alamat berkas konfigurasi JSON", + "Show help": "Lihat bantuan", + "Show version number": "Lihat nomor versi", + "Did you mean %s?": "Maksud Anda: %s?", + "Arguments %s and %s are mutually exclusive" : "Argumen %s dan %s saling eksklusif", + "Positionals:": "Posisional-posisional:", + "command": "perintah" +} diff --git a/node_modules/yargs/locales/it.json b/node_modules/yargs/locales/it.json new file mode 100644 index 0000000..9ee900d --- /dev/null +++ b/node_modules/yargs/locales/it.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Comandi:", + "Options:": "Opzioni:", + "Examples:": "Esempi:", + "boolean": "booleano", + "count": "contatore", + "string": "stringa", + "number": "numero", + "array": "vettore", + "required": "richiesto", + "default:": "predefinito:", + "choices:": "scelte:", + "aliases:": "alias:", + "generated-value": "valore generato", + "Not enough non-option arguments: got %s, need at least %s": "Numero insufficiente di argomenti non opzione: inseriti %s, richiesti almeno %s", + "Too many non-option arguments: got %s, maximum of %s": "Troppi argomenti non opzione: inseriti %s, massimo possibile %s", + "Missing argument value: %s": { + "one": "Argomento mancante: %s", + "other": "Argomenti mancanti: %s" + }, + "Missing required argument: %s": { + "one": "Argomento richiesto mancante: %s", + "other": "Argomenti richiesti mancanti: %s" + }, + "Unknown argument: %s": { + "one": "Argomento sconosciuto: %s", + "other": "Argomenti sconosciuti: %s" + }, + "Invalid values:": "Valori non validi:", + "Argument: %s, Given: %s, Choices: %s": "Argomento: %s, Richiesto: %s, Scelte: %s", + "Argument check failed: %s": "Controllo dell'argomento fallito: %s", + "Implications failed:": "Argomenti dipendenti mancanti:", + "Not enough arguments following: %s": "Argomenti insufficienti dopo: %s", + "Invalid JSON config file: %s": "File di configurazione JSON non valido: %s", + "Path to JSON config file": "Percorso del file di configurazione JSON", + "Show help": "Mostra la schermata di aiuto", + "Show version number": "Mostra il numero di versione", + "Did you mean %s?": "Intendi forse %s?" +} diff --git a/node_modules/yargs/locales/ja.json b/node_modules/yargs/locales/ja.json new file mode 100644 index 0000000..64ee6d3 --- /dev/null +++ b/node_modules/yargs/locales/ja.json @@ -0,0 +1,42 @@ +{ + "Commands:": "コマンド:", + "Options:": "オプション:", + "Examples:": "例:", + "boolean": "真偽", + "count": "カウント", + "string": "文字列", + "number": "数値", + "array": "配列", + "required": "必須", + "default:": "デフォルト:", + "choices:": "選択してください:", + "aliases:": "エイリアス:", + "generated-value": "生成された値", + "Not enough non-option arguments: got %s, need at least %s": "オプションではない引数が %s 個では不足しています。少なくとも %s 個の引数が必要です:", + "Too many non-option arguments: got %s, maximum of %s": "オプションではない引数が %s 個では多すぎます。最大で %s 個までです:", + "Missing argument value: %s": { + "one": "引数が見つかりません: %s", + "other": "引数が見つかりません: %s" + }, + "Missing required argument: %s": { + "one": "必須の引数が見つかりません: %s", + "other": "必須の引数が見つかりません: %s" + }, + "Unknown argument: %s": { + "one": "未知の引数です: %s", + "other": "未知の引数です: %s" + }, + "Invalid values:": "不正な値です:", + "Argument: %s, Given: %s, Choices: %s": "引数は %s です。指定できるのは %s つです。選択してください: %s", + "Argument check failed: %s": "引数のチェックに失敗しました: %s", + "Implications failed:": "オプションの組み合わせで不正が生じました:", + "Not enough arguments following: %s": "次の引数が不足しています。: %s", + "Invalid JSON config file: %s": "JSONの設定ファイルが不正です: %s", + "Path to JSON config file": "JSONの設定ファイルまでのpath", + "Show help": "ヘルプを表示", + "Show version number": "バージョンを表示", + "Did you mean %s?": "もしかして %s?", + "Arguments %s and %s are mutually exclusive" : "引数 %s と %s は同時に指定できません", + "Positionals:": "位置:", + "command": "コマンド" +} diff --git a/node_modules/yargs/locales/ko.json b/node_modules/yargs/locales/ko.json new file mode 100644 index 0000000..0eaeab2 --- /dev/null +++ b/node_modules/yargs/locales/ko.json @@ -0,0 +1,42 @@ +{ + "Commands:": "명령:", + "Options:": "옵션:", + "Examples:": "예시:", + "boolean": "여부", + "count": "개수", + "string": "문자열", + "number": "숫자", + "array": "배열", + "required": "필수", + "default:": "기본:", + "choices:": "선택:", + "aliases:": "별칭:", + "generated-value": "생성된 값", + "Not enough non-option arguments: got %s, need at least %s": "옵션이 아닌 인자가 충분치 않습니다: %s개를 받았지만, 적어도 %s개는 필요합니다", + "Too many non-option arguments: got %s, maximum of %s": "옵션이 아닌 인자가 너무 많습니다: %s개를 받았지만, %s개 이하여야 합니다", + "Missing argument value: %s": { + "one": "인자값을 받지 못했습니다: %s", + "other": "인자값들을 받지 못했습니다: %s" + }, + "Missing required argument: %s": { + "one": "필수 인자를 받지 못했습니다: %s", + "other": "필수 인자들을 받지 못했습니다: %s" + }, + "Unknown argument: %s": { + "one": "알 수 없는 인자입니다: %s", + "other": "알 수 없는 인자들입니다: %s" + }, + "Invalid values:": "잘못된 값입니다:", + "Argument: %s, Given: %s, Choices: %s": "인자: %s, 입력받은 값: %s, 선택지: %s", + "Argument check failed: %s": "유효하지 않은 인자입니다: %s", + "Implications failed:": "옵션의 조합이 잘못되었습니다:", + "Not enough arguments following: %s": "인자가 충분하게 주어지지 않았습니다: %s", + "Invalid JSON config file: %s": "유효하지 않은 JSON 설정파일입니다: %s", + "Path to JSON config file": "JSON 설정파일 경로", + "Show help": "도움말을 보여줍니다", + "Show version number": "버전 넘버를 보여줍니다", + "Did you mean %s?": "찾고계신게 %s입니까?", + "Arguments %s and %s are mutually exclusive" : "%s와 %s 인자는 같이 사용될 수 없습니다", + "Positionals:": "위치:", + "command": "명령" +} diff --git a/node_modules/yargs/locales/nb.json b/node_modules/yargs/locales/nb.json new file mode 100644 index 0000000..55be1fb --- /dev/null +++ b/node_modules/yargs/locales/nb.json @@ -0,0 +1,37 @@ +{ + "Commands:": "Kommandoer:", + "Options:": "Alternativer:", + "Examples:": "Eksempler:", + "boolean": "boolsk", + "count": "antall", + "string": "streng", + "number": "nummer", + "array": "matrise", + "required": "obligatorisk", + "default:": "standard:", + "choices:": "valg:", + "generated-value": "generert-verdi", + "Not enough non-option arguments: got %s, need at least %s": "Ikke nok ikke-alternativ argumenter: fikk %s, trenger minst %s", + "Too many non-option arguments: got %s, maximum of %s": "For mange ikke-alternativ argumenter: fikk %s, maksimum %s", + "Missing argument value: %s": { + "one": "Mangler argument verdi: %s", + "other": "Mangler argument verdier: %s" + }, + "Missing required argument: %s": { + "one": "Mangler obligatorisk argument: %s", + "other": "Mangler obligatoriske argumenter: %s" + }, + "Unknown argument: %s": { + "one": "Ukjent argument: %s", + "other": "Ukjente argumenter: %s" + }, + "Invalid values:": "Ugyldige verdier:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Gitt: %s, Valg: %s", + "Argument check failed: %s": "Argumentsjekk mislyktes: %s", + "Implications failed:": "Konsekvensene mislyktes:", + "Not enough arguments following: %s": "Ikke nok følgende argumenter: %s", + "Invalid JSON config file: %s": "Ugyldig JSON konfigurasjonsfil: %s", + "Path to JSON config file": "Bane til JSON konfigurasjonsfil", + "Show help": "Vis hjelp", + "Show version number": "Vis versjonsnummer" +} diff --git a/node_modules/yargs/locales/nl.json b/node_modules/yargs/locales/nl.json new file mode 100644 index 0000000..5d62e0f --- /dev/null +++ b/node_modules/yargs/locales/nl.json @@ -0,0 +1,42 @@ +{ + "Commands:": "Commando's:", + "Options:": "Opties:", + "Examples:": "Voorbeelden:", + "boolean": "booleaans", + "count": "aantal", + "string": "string", + "number": "getal", + "array": "lijst", + "required": "verplicht", + "default:": "standaard:", + "choices:": "keuzes:", + "aliases:": "aliassen:", + "generated-value": "gegenereerde waarde", + "Not enough non-option arguments: got %s, need at least %s": "Niet genoeg niet-optie-argumenten: %s gekregen, minstens %s nodig", + "Too many non-option arguments: got %s, maximum of %s": "Te veel niet-optie-argumenten: %s gekregen, maximum is %s", + "Missing argument value: %s": { + "one": "Missende argumentwaarde: %s", + "other": "Missende argumentwaarden: %s" + }, + "Missing required argument: %s": { + "one": "Missend verplicht argument: %s", + "other": "Missende verplichte argumenten: %s" + }, + "Unknown argument: %s": { + "one": "Onbekend argument: %s", + "other": "Onbekende argumenten: %s" + }, + "Invalid values:": "Ongeldige waarden:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Gegeven: %s, Keuzes: %s", + "Argument check failed: %s": "Argumentcontrole mislukt: %s", + "Implications failed:": "Ontbrekende afhankelijke argumenten:", + "Not enough arguments following: %s": "Niet genoeg argumenten na: %s", + "Invalid JSON config file: %s": "Ongeldig JSON-config-bestand: %s", + "Path to JSON config file": "Pad naar JSON-config-bestand", + "Show help": "Toon help", + "Show version number": "Toon versienummer", + "Did you mean %s?": "Bedoelde u misschien %s?", + "Arguments %s and %s are mutually exclusive": "Argumenten %s en %s kunnen niet tegelijk gebruikt worden", + "Positionals:": "Positie-afhankelijke argumenten", + "command": "commando" +} diff --git a/node_modules/yargs/locales/nn.json b/node_modules/yargs/locales/nn.json new file mode 100644 index 0000000..5a3c951 --- /dev/null +++ b/node_modules/yargs/locales/nn.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Kommandoar:", + "Options:": "Alternativ:", + "Examples:": "Døme:", + "boolean": "boolsk", + "count": "mengd", + "string": "streng", + "number": "nummer", + "array": "matrise", + "required": "obligatorisk", + "default:": "standard:", + "choices:": "val:", + "generated-value": "generert-verdi", + "Not enough non-option arguments: got %s, need at least %s": + "Ikkje nok ikkje-alternativ argument: fekk %s, treng minst %s", + "Too many non-option arguments: got %s, maximum of %s": + "For mange ikkje-alternativ argument: fekk %s, maksimum %s", + "Missing argument value: %s": { + "one": "Manglar argumentverdi: %s", + "other": "Manglar argumentverdiar: %s" + }, + "Missing required argument: %s": { + "one": "Manglar obligatorisk argument: %s", + "other": "Manglar obligatoriske argument: %s" + }, + "Unknown argument: %s": { + "one": "Ukjent argument: %s", + "other": "Ukjende argument: %s" + }, + "Invalid values:": "Ugyldige verdiar:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Gjeve: %s, Val: %s", + "Argument check failed: %s": "Argumentsjekk mislukkast: %s", + "Implications failed:": "Konsekvensane mislukkast:", + "Not enough arguments following: %s": "Ikkje nok fylgjande argument: %s", + "Invalid JSON config file: %s": "Ugyldig JSON konfigurasjonsfil: %s", + "Path to JSON config file": "Bane til JSON konfigurasjonsfil", + "Show help": "Vis hjelp", + "Show version number": "Vis versjonsnummer" +} diff --git a/node_modules/yargs/locales/pirate.json b/node_modules/yargs/locales/pirate.json new file mode 100644 index 0000000..dcb5cb7 --- /dev/null +++ b/node_modules/yargs/locales/pirate.json @@ -0,0 +1,13 @@ +{ + "Commands:": "Choose yer command:", + "Options:": "Options for me hearties!", + "Examples:": "Ex. marks the spot:", + "required": "requi-yar-ed", + "Missing required argument: %s": { + "one": "Ye be havin' to set the followin' argument land lubber: %s", + "other": "Ye be havin' to set the followin' arguments land lubber: %s" + }, + "Show help": "Parlay this here code of conduct", + "Show version number": "'Tis the version ye be askin' fer", + "Arguments %s and %s are mutually exclusive" : "Yon scurvy dogs %s and %s be as bad as rum and a prudish wench" +} diff --git a/node_modules/yargs/locales/pl.json b/node_modules/yargs/locales/pl.json new file mode 100644 index 0000000..6926a45 --- /dev/null +++ b/node_modules/yargs/locales/pl.json @@ -0,0 +1,42 @@ +{ + "Commands:": "Polecenia:", + "Options:": "Opcje:", + "Examples:": "Przykłady:", + "boolean": "boolean", + "count": "ilość", + "string": "ciąg znaków", + "number": "liczba", + "array": "tablica", + "required": "wymagany", + "default:": "domyślny:", + "choices:": "dostępne:", + "aliases:": "aliasy:", + "generated-value": "wygenerowana-wartość", + "Not enough non-option arguments: got %s, need at least %s": "Niewystarczająca ilość argumentów: otrzymano %s, wymagane co najmniej %s", + "Too many non-option arguments: got %s, maximum of %s": "Zbyt duża ilość argumentów: otrzymano %s, wymagane co najwyżej %s", + "Missing argument value: %s": { + "one": "Brak wartości dla argumentu: %s", + "other": "Brak wartości dla argumentów: %s" + }, + "Missing required argument: %s": { + "one": "Brak wymaganego argumentu: %s", + "other": "Brak wymaganych argumentów: %s" + }, + "Unknown argument: %s": { + "one": "Nieznany argument: %s", + "other": "Nieznane argumenty: %s" + }, + "Invalid values:": "Nieprawidłowe wartości:", + "Argument: %s, Given: %s, Choices: %s": "Argument: %s, Otrzymano: %s, Dostępne: %s", + "Argument check failed: %s": "Weryfikacja argumentów nie powiodła się: %s", + "Implications failed:": "Założenia nie zostały spełnione:", + "Not enough arguments following: %s": "Niewystarczająca ilość argumentów następujących po: %s", + "Invalid JSON config file: %s": "Nieprawidłowy plik konfiguracyjny JSON: %s", + "Path to JSON config file": "Ścieżka do pliku konfiguracyjnego JSON", + "Show help": "Pokaż pomoc", + "Show version number": "Pokaż numer wersji", + "Did you mean %s?": "Czy chodziło Ci o %s?", + "Arguments %s and %s are mutually exclusive": "Argumenty %s i %s wzajemnie się wykluczają", + "Positionals:": "Pozycyjne:", + "command": "polecenie" +} diff --git a/node_modules/yargs/locales/pt.json b/node_modules/yargs/locales/pt.json new file mode 100644 index 0000000..75c3921 --- /dev/null +++ b/node_modules/yargs/locales/pt.json @@ -0,0 +1,38 @@ +{ + "Commands:": "Comandos:", + "Options:": "Opções:", + "Examples:": "Exemplos:", + "boolean": "boolean", + "count": "contagem", + "string": "cadeia de caracteres", + "number": "número", + "array": "arranjo", + "required": "requerido", + "default:": "padrão:", + "choices:": "escolhas:", + "generated-value": "valor-gerado", + "Not enough non-option arguments: got %s, need at least %s": "Argumentos insuficientes não opcionais: Argumento %s, necessário pelo menos %s", + "Too many non-option arguments: got %s, maximum of %s": "Excesso de argumentos não opcionais: recebido %s, máximo de %s", + "Missing argument value: %s": { + "one": "Falta valor de argumento: %s", + "other": "Falta valores de argumento: %s" + }, + "Missing required argument: %s": { + "one": "Falta argumento obrigatório: %s", + "other": "Faltando argumentos obrigatórios: %s" + }, + "Unknown argument: %s": { + "one": "Argumento desconhecido: %s", + "other": "Argumentos desconhecidos: %s" + }, + "Invalid values:": "Valores inválidos:", + "Argument: %s, Given: %s, Choices: %s": "Argumento: %s, Dado: %s, Escolhas: %s", + "Argument check failed: %s": "Verificação de argumento falhou: %s", + "Implications failed:": "Implicações falharam:", + "Not enough arguments following: %s": "Insuficientes argumentos a seguir: %s", + "Invalid JSON config file: %s": "Arquivo de configuração em JSON esta inválido: %s", + "Path to JSON config file": "Caminho para o arquivo de configuração em JSON", + "Show help": "Mostra ajuda", + "Show version number": "Mostra número de versão", + "Arguments %s and %s are mutually exclusive" : "Argumentos %s e %s são mutualmente exclusivos" +} diff --git a/node_modules/yargs/locales/pt_BR.json b/node_modules/yargs/locales/pt_BR.json new file mode 100644 index 0000000..904cb66 --- /dev/null +++ b/node_modules/yargs/locales/pt_BR.json @@ -0,0 +1,42 @@ +{ + "Commands:": "Comandos:", + "Options:": "Opções:", + "Examples:": "Exemplos:", + "boolean": "booleano", + "count": "contagem", + "string": "string", + "number": "número", + "array": "array", + "required": "obrigatório", + "default:": "padrão:", + "choices:": "opções:", + "aliases:": "sinônimos:", + "generated-value": "valor-gerado", + "Not enough non-option arguments: got %s, need at least %s": "Argumentos insuficientes: Argumento %s, necessário pelo menos %s", + "Too many non-option arguments: got %s, maximum of %s": "Excesso de argumentos: recebido %s, máximo de %s", + "Missing argument value: %s": { + "one": "Falta valor de argumento: %s", + "other": "Falta valores de argumento: %s" + }, + "Missing required argument: %s": { + "one": "Falta argumento obrigatório: %s", + "other": "Faltando argumentos obrigatórios: %s" + }, + "Unknown argument: %s": { + "one": "Argumento desconhecido: %s", + "other": "Argumentos desconhecidos: %s" + }, + "Invalid values:": "Valores inválidos:", + "Argument: %s, Given: %s, Choices: %s": "Argumento: %s, Dado: %s, Opções: %s", + "Argument check failed: %s": "Verificação de argumento falhou: %s", + "Implications failed:": "Implicações falharam:", + "Not enough arguments following: %s": "Argumentos insuficientes a seguir: %s", + "Invalid JSON config file: %s": "Arquivo JSON de configuração inválido: %s", + "Path to JSON config file": "Caminho para o arquivo JSON de configuração", + "Show help": "Exibe ajuda", + "Show version number": "Exibe a versão", + "Did you mean %s?": "Você quis dizer %s?", + "Arguments %s and %s are mutually exclusive" : "Argumentos %s e %s são mutualmente exclusivos", + "Positionals:": "Posicionais:", + "command": "comando" +} diff --git a/node_modules/yargs/locales/ru.json b/node_modules/yargs/locales/ru.json new file mode 100644 index 0000000..cb7b88b --- /dev/null +++ b/node_modules/yargs/locales/ru.json @@ -0,0 +1,39 @@ +{ + "Commands:": "Команды:", + "Options:": "Опции:", + "Examples:": "Примеры:", + "boolean": "булевый тип", + "count": "подсчет", + "string": "строковой тип", + "number": "число", + "array": "массив", + "required": "необходимо", + "default:": "по умолчанию:", + "choices:": "возможности:", + "aliases:": "алиасы:", + "generated-value": "генерированное значение", + "Not enough non-option arguments: got %s, need at least %s": "Недостаточно неопционных аргументов: есть %s, нужно как минимум %s", + "Too many non-option arguments: got %s, maximum of %s": "Слишком много неопционных аргументов: есть %s, максимум допустимо %s", + "Missing argument value: %s": { + "one": "Не хватает значения аргумента: %s", + "other": "Не хватает значений аргументов: %s" + }, + "Missing required argument: %s": { + "one": "Не хватает необходимого аргумента: %s", + "other": "Не хватает необходимых аргументов: %s" + }, + "Unknown argument: %s": { + "one": "Неизвестный аргумент: %s", + "other": "Неизвестные аргументы: %s" + }, + "Invalid values:": "Недействительные значения:", + "Argument: %s, Given: %s, Choices: %s": "Аргумент: %s, Данное значение: %s, Возможности: %s", + "Argument check failed: %s": "Проверка аргументов не удалась: %s", + "Implications failed:": "Данный аргумент требует следующий дополнительный аргумент:", + "Not enough arguments following: %s": "Недостаточно следующих аргументов: %s", + "Invalid JSON config file: %s": "Недействительный файл конфигурации JSON: %s", + "Path to JSON config file": "Путь к файлу конфигурации JSON", + "Show help": "Показать помощь", + "Show version number": "Показать номер версии", + "Did you mean %s?": "Вы имели в виду %s?" +} diff --git a/node_modules/yargs/locales/th.json b/node_modules/yargs/locales/th.json new file mode 100644 index 0000000..3f08dcd --- /dev/null +++ b/node_modules/yargs/locales/th.json @@ -0,0 +1,39 @@ +{ + "Commands:": "คอมมาน", + "Options:": "ออฟชั่น", + "Examples:": "ตัวอย่าง", + "boolean": "บูลีน", + "count": "นับ", + "string": "สตริง", + "number": "ตัวเลข", + "array": "อาเรย์", + "required": "จำเป็น", + "default:": "ค่าเริ่มต้น", + "choices:": "ตัวเลือก", + "aliases:": "เอเลียส", + "generated-value": "ค่าที่ถูกสร้างขึ้น", + "Not enough non-option arguments: got %s, need at least %s": "ใส่อาร์กิวเมนต์ไม่ครบตามจำนวนที่กำหนด: ใส่ค่ามาจำนวน %s ค่า, แต่ต้องการอย่างน้อย %s ค่า", + "Too many non-option arguments: got %s, maximum of %s": "ใส่อาร์กิวเมนต์เกินจำนวนที่กำหนด: ใส่ค่ามาจำนวน %s ค่า, แต่ต้องการมากที่สุด %s ค่า", + "Missing argument value: %s": { + "one": "ค่าอาร์กิวเมนต์ที่ขาดไป: %s", + "other": "ค่าอาร์กิวเมนต์ที่ขาดไป: %s" + }, + "Missing required argument: %s": { + "one": "อาร์กิวเมนต์จำเป็นที่ขาดไป: %s", + "other": "อาร์กิวเมนต์จำเป็นที่ขาดไป: %s" + }, + "Unknown argument: %s": { + "one": "อาร์กิวเมนต์ที่ไม่รู้จัก: %s", + "other": "อาร์กิวเมนต์ที่ไม่รู้จัก: %s" + }, + "Invalid values:": "ค่าไม่ถูกต้อง:", + "Argument: %s, Given: %s, Choices: %s": "อาร์กิวเมนต์: %s, ได้รับ: %s, ตัวเลือก: %s", + "Argument check failed: %s": "ตรวจสอบพบอาร์กิวเมนต์ที่ไม่ถูกต้อง: %s", + "Implications failed:": "Implications ไม่สำเร็จ:", + "Not enough arguments following: %s": "ใส่อาร์กิวเมนต์ไม่ครบ: %s", + "Invalid JSON config file: %s": "ไฟล์คอนฟิค JSON ไม่ถูกต้อง: %s", + "Path to JSON config file": "พาทไฟล์คอนฟิค JSON", + "Show help": "ขอความช่วยเหลือ", + "Show version number": "แสดงตัวเลขเวอร์ชั่น", + "Did you mean %s?": "คุณหมายถึง %s?" +} diff --git a/node_modules/yargs/locales/tr.json b/node_modules/yargs/locales/tr.json new file mode 100644 index 0000000..9b06c52 --- /dev/null +++ b/node_modules/yargs/locales/tr.json @@ -0,0 +1,41 @@ +{ + "Commands:": "Komutlar:", + "Options:": "Seçenekler:", + "Examples:": "Örnekler:", + "boolean": "boolean", + "count": "sayı", + "string": "string", + "number": "numara", + "array": "array", + "required": "zorunlu", + "default:": "varsayılan:", + "choices:": "seçimler:", + "aliases:": "takma adlar:", + "generated-value": "oluşturulan-değer", + "Not enough non-option arguments: got %s, need at least %s": "Seçenek dışı argümanlar yetersiz: %s bulundu, %s gerekli", + "Too many non-option arguments: got %s, maximum of %s": "Seçenek dışı argümanlar gereğinden fazla: %s bulundu, azami %s", + "Missing argument value: %s": { + "one": "Eksik argüman değeri: %s", + "other": "Eksik argüman değerleri: %s" + }, + "Missing required argument: %s": { + "one": "Eksik zorunlu argüman: %s", + "other": "Eksik zorunlu argümanlar: %s" + }, + "Unknown argument: %s": { + "one": "Bilinmeyen argüman: %s", + "other": "Bilinmeyen argümanlar: %s" + }, + "Invalid values:": "Geçersiz değerler:", + "Argument: %s, Given: %s, Choices: %s": "Argüman: %s, Verilen: %s, Seçimler: %s", + "Argument check failed: %s": "Argüman kontrolü başarısız oldu: %s", + "Implications failed:": "Sonuçlar başarısız oldu:", + "Not enough arguments following: %s": "%s için yeterli argüman bulunamadı", + "Invalid JSON config file: %s": "Geçersiz JSON yapılandırma dosyası: %s", + "Path to JSON config file": "JSON yapılandırma dosya konumu", + "Show help": "Yardım detaylarını göster", + "Show version number": "Versiyon detaylarını göster", + "Did you mean %s?": "Bunu mu demek istediniz: %s?", + "Positionals:": "Sıralılar:", + "command": "komut" +} diff --git a/node_modules/yargs/locales/zh_CN.json b/node_modules/yargs/locales/zh_CN.json new file mode 100644 index 0000000..03a3d94 --- /dev/null +++ b/node_modules/yargs/locales/zh_CN.json @@ -0,0 +1,41 @@ +{ + "Commands:": "命令：", + "Options:": "选项：", + "Examples:": "示例：", + "boolean": "布尔", + "count": "计数", + "string": "字符串", + "number": "数字", + "array": "数组", + "required": "必需", + "default:": "默认值:", + "choices:": "可选值:", + "generated-value": "生成的值", + "Not enough non-option arguments: got %s, need at least %s": "缺少 non-option 参数：传入了 %s 个, 至少需要 %s 个", + "Too many non-option arguments: got %s, maximum of %s": "non-option 参数过多：传入了 %s 个, 最大允许 %s 个", + "Missing argument value: %s": { + "one": "没有给此选项指定值：%s", + "other": "没有给这些选项指定值：%s" + }, + "Missing required argument: %s": { + "one": "缺少必须的选项：%s", + "other": "缺少这些必须的选项：%s" + }, + "Unknown argument: %s": { + "one": "无法识别的选项：%s", + "other": "无法识别这些选项：%s" + }, + "Invalid values:": "无效的选项值：", + "Argument: %s, Given: %s, Choices: %s": "选项名称: %s, 传入的值: %s, 可选的值：%s", + "Argument check failed: %s": "选项值验证失败：%s", + "Implications failed:": "缺少依赖的选项：", + "Not enough arguments following: %s": "没有提供足够的值给此选项：%s", + "Invalid JSON config file: %s": "无效的 JSON 配置文件：%s", + "Path to JSON config file": "JSON 配置文件的路径", + "Show help": "显示帮助信息", + "Show version number": "显示版本号", + "Did you mean %s?": "是指 %s?", + "Arguments %s and %s are mutually exclusive" : "选项 %s 和 %s 是互斥的", + "Positionals:": "位置：", + "command": "命令" +} diff --git a/node_modules/yargs/locales/zh_TW.json b/node_modules/yargs/locales/zh_TW.json new file mode 100644 index 0000000..1249888 --- /dev/null +++ b/node_modules/yargs/locales/zh_TW.json @@ -0,0 +1,40 @@ +{ + "Commands:": "命令：", + "Options:": "選項：", + "Examples:": "例：", + "boolean": "布林", + "count": "次數", + "string": "字串", + "number": "數字", + "array": "陣列", + "required": "必須", + "default:": "預設值:", + "choices:": "可選值:", + "aliases:": "別名:", + "generated-value": "生成的值", + "Not enough non-option arguments: got %s, need at least %s": "non-option 引數不足：只傳入了 %s 個, 至少要 %s 個", + "Too many non-option arguments: got %s, maximum of %s": "non-option 引數過多：傳入了 %s 個, 但最多 %s 個", + "Missing argument value: %s": { + "one": "此引數無指定值：%s", + "other": "這些引數無指定值：%s" + }, + "Missing required argument: %s": { + "one": "缺少必須的引數：%s", + "other": "缺少這些必須的引數：%s" + }, + "Unknown argument: %s": { + "one": "未知的引數：%s", + "other": "未知的這些引數：%s" + }, + "Invalid values:": "無效的選項值：", + "Argument: %s, Given: %s, Choices: %s": "引數名稱: %s, 傳入的值: %s, 可選的值：%s", + "Argument check failed: %s": "引數驗證失敗：%s", + "Implications failed:": "缺少依賴的選項：", + "Not enough arguments following: %s": "沒有提供足夠的值給此引數：%s", + "Invalid JSON config file: %s": "無效的 JSON 設置文件：%s", + "Path to JSON config file": "JSON 設置文件的路徑", + "Show help": "顯示說明", + "Show version number": "顯示版本", + "Did you mean %s?": "是指 %s?", + "Arguments %s and %s are mutually exclusive" : "引數 %s 和 %s 是互斥的" +} diff --git a/node_modules/yargs/package.json b/node_modules/yargs/package.json new file mode 100644 index 0000000..1d382a5 --- /dev/null +++ b/node_modules/yargs/package.json @@ -0,0 +1,107 @@ +{ + "_from": "yargs@^13.3.0", + "_id": "yargs@13.3.0", + "_inBundle": false, + "_integrity": "sha512-2eehun/8ALW8TLoIl7MVaRUrg+yCnenu8B4kBlRxj3GJGDKU1Og7sMXPNm1BYyM1DOJmTZ4YeN/Nwxv+8XJsUA==", + "_location": "/yargs", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "yargs@^13.3.0", + "name": "yargs", + "escapedName": "yargs", + "rawSpec": "^13.3.0", + "saveSpec": null, + "fetchSpec": "^13.3.0" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/yargs/-/yargs-13.3.0.tgz", + "_shasum": "4c657a55e07e5f2cf947f8a366567c04a0dedc83", + "_spec": "yargs@^13.3.0", + "_where": "C:\\Users\\delva\\OneDrive\\Escritorio\\node\\05-clima", + "bugs": { + "url": "https://github.com/yargs/yargs/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Yargs Contributors", + "url": "https://github.com/yargs/yargs/graphs/contributors" + } + ], + "dependencies": { + "cliui": "^5.0.0", + "find-up": "^3.0.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^3.0.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^13.1.1" + }, + "deprecated": false, + "description": "yargs the modern, pirate-themed, successor to optimist.", + "devDependencies": { + "chai": "^4.2.0", + "chalk": "^2.4.2", + "coveralls": "^3.0.3", + "cpr": "^3.0.1", + "cross-spawn": "^6.0.4", + "es6-promise": "^4.2.5", + "hashish": "0.0.4", + "mocha": "^5.2.0", + "nyc": "^14.1.0", + "rimraf": "^2.6.3", + "standard": "^12.0.1", + "standard-version": "^6.0.1", + "which": "^1.3.1", + "yargs-test-extends": "^1.0.1" + }, + "engine": { + "node": ">=6" + }, + "files": [ + "index.js", + "yargs.js", + "lib", + "locales", + "completion.sh.hbs", + "completion.zsh.hbs", + "LICENSE" + ], + "homepage": "https://yargs.js.org/", + "keywords": [ + "argument", + "args", + "option", + "parser", + "parsing", + "cli", + "command" + ], + "license": "MIT", + "main": "./index.js", + "name": "yargs", + "repository": { + "type": "git", + "url": "git+https://github.com/yargs/yargs.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "pretest": "standard", + "release": "standard-version", + "test": "nyc --cache mocha --require ./test/before.js --timeout=12000 --check-leaks" + }, + "standard": { + "ignore": [ + "**/example/**" + ] + }, + "version": "13.3.0" +} diff --git a/node_modules/yargs/yargs.js b/node_modules/yargs/yargs.js new file mode 100644 index 0000000..f1bf8c6 --- /dev/null +++ b/node_modules/yargs/yargs.js @@ -0,0 +1,1206 @@ +'use strict' +const argsert = require('./lib/argsert') +const fs = require('fs') +const Command = require('./lib/command') +const Completion = require('./lib/completion') +const Parser = require('yargs-parser') +const path = require('path') +const Usage = require('./lib/usage') +const Validation = require('./lib/validation') +const Y18n = require('y18n') +const objFilter = require('./lib/obj-filter') +const setBlocking = require('set-blocking') +const applyExtends = require('./lib/apply-extends') +const { globalMiddlewareFactory } = require('./lib/middleware') +const YError = require('./lib/yerror') + +exports = module.exports = Yargs +function Yargs (processArgs, cwd, parentRequire) { + processArgs = processArgs || [] // handle calling yargs(). + + const self = {} + let command = null + let completion = null + let groups = {} + let globalMiddleware = [] + let output = '' + let preservedGroups = {} + let usage = null + let validation = null + + const y18n = Y18n({ + directory: path.resolve(__dirname, './locales'), + updateFiles: false + }) + + self.middleware = globalMiddlewareFactory(globalMiddleware, self) + + if (!cwd) cwd = process.cwd() + + self.scriptName = function scriptName (scriptName) { + self.$0 = scriptName + return self + } + + // ignore the node bin, specify this in your + // bin file with #!/usr/bin/env node + if (/\b(node|iojs|electron)(\.exe)?$/.test(process.argv[0])) { + self.$0 = process.argv.slice(1, 2) + } else { + self.$0 = process.argv.slice(0, 1) + } + + self.$0 = self.$0 + .map((x, i) => { + const b = rebase(cwd, x) + return x.match(/^(\/|([a-zA-Z]:)?\\)/) && b.length < x.length ? b : x + }) + .join(' ').trim() + + if (process.env._ !== undefined && process.argv[1] === process.env._) { + self.$0 = process.env._.replace( + `${path.dirname(process.execPath)}/`, '' + ) + } + + // use context object to keep track of resets, subcommand execution, etc + // submodules should modify and check the state of context as necessary + const context = { resets: -1, commands: [], fullCommands: [], files: [] } + self.getContext = () => context + + // puts yargs back into an initial state. any keys + // that have been set to "global" will not be reset + // by this action. + let options + self.resetOptions = self.reset = function resetOptions (aliases) { + context.resets++ + aliases = aliases || {} + options = options || {} + // put yargs back into an initial state, this + // logic is used to build a nested command + // hierarchy. + const tmpOptions = {} + tmpOptions.local = options.local ? options.local : [] + tmpOptions.configObjects = options.configObjects ? options.configObjects : [] + + // if a key has been explicitly set as local, + // we should reset it before passing options to command. + const localLookup = {} + tmpOptions.local.forEach((l) => { + localLookup[l] = true + ;(aliases[l] || []).forEach((a) => { + localLookup[a] = true + }) + }) + + // preserve all groups not set to local. + preservedGroups = Object.keys(groups).reduce((acc, groupName) => { + const keys = groups[groupName].filter(key => !(key in localLookup)) + if (keys.length > 0) { + acc[groupName] = keys + } + return acc + }, {}) + // groups can now be reset + groups = {} + + const arrayOptions = [ + 'array', 'boolean', 'string', 'skipValidation', + 'count', 'normalize', 'number', + 'hiddenOptions' + ] + + const objectOptions = [ + 'narg', 'key', 'alias', 'default', 'defaultDescription', + 'config', 'choices', 'demandedOptions', 'demandedCommands', 'coerce' + ] + + arrayOptions.forEach((k) => { + tmpOptions[k] = (options[k] || []).filter(k => !localLookup[k]) + }) + + objectOptions.forEach((k) => { + tmpOptions[k] = objFilter(options[k], (k, v) => !localLookup[k]) + }) + + tmpOptions.envPrefix = options.envPrefix + options = tmpOptions + + // if this is the first time being executed, create + // instances of all our helpers -- otherwise just reset. + usage = usage ? usage.reset(localLookup) : Usage(self, y18n) + validation = validation ? validation.reset(localLookup) : Validation(self, usage, y18n) + command = command ? command.reset() : Command(self, usage, validation, globalMiddleware) + if (!completion) completion = Completion(self, usage, command) + + completionCommand = null + output = '' + exitError = null + hasOutput = false + self.parsed = false + + return self + } + self.resetOptions() + + // temporary hack: allow "freezing" of reset-able state for parse(msg, cb) + let frozen + function freeze () { + frozen = {} + frozen.options = options + frozen.configObjects = options.configObjects.slice(0) + frozen.exitProcess = exitProcess + frozen.groups = groups + usage.freeze() + validation.freeze() + command.freeze() + frozen.strict = strict + frozen.completionCommand = completionCommand + frozen.output = output + frozen.exitError = exitError + frozen.hasOutput = hasOutput + frozen.parsed = self.parsed + } + function unfreeze () { + options = frozen.options + options.configObjects = frozen.configObjects + exitProcess = frozen.exitProcess + groups = frozen.groups + output = frozen.output + exitError = frozen.exitError + hasOutput = frozen.hasOutput + self.parsed = frozen.parsed + usage.unfreeze() + validation.unfreeze() + command.unfreeze() + strict = frozen.strict + completionCommand = frozen.completionCommand + parseFn = null + parseContext = null + frozen = undefined + } + + self.boolean = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('boolean', keys) + return self + } + + self.array = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('array', keys) + return self + } + + self.number = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('number', keys) + return self + } + + self.normalize = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('normalize', keys) + return self + } + + self.count = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('count', keys) + return self + } + + self.string = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('string', keys) + return self + } + + self.requiresArg = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintObject(self.nargs, false, 'narg', keys, 1) + return self + } + + self.skipValidation = function (keys) { + argsert('', [keys], arguments.length) + populateParserHintArray('skipValidation', keys) + return self + } + + function populateParserHintArray (type, keys, value) { + keys = [].concat(keys) + keys.forEach((key) => { + options[type].push(key) + }) + } + + self.nargs = function (key, value) { + argsert(' [number]', [key, value], arguments.length) + populateParserHintObject(self.nargs, false, 'narg', key, value) + return self + } + + self.choices = function (key, value) { + argsert(' [string|array]', [key, value], arguments.length) + populateParserHintObject(self.choices, true, 'choices', key, value) + return self + } + + self.alias = function (key, value) { + argsert(' [string|array]', [key, value], arguments.length) + populateParserHintObject(self.alias, true, 'alias', key, value) + return self + } + + // TODO: actually deprecate self.defaults. + self.default = self.defaults = function (key, value, defaultDescription) { + argsert(' [*] [string]', [key, value, defaultDescription], arguments.length) + if (defaultDescription) options.defaultDescription[key] = defaultDescription + if (typeof value === 'function') { + if (!options.defaultDescription[key]) options.defaultDescription[key] = usage.functionDescription(value) + value = value.call() + } + populateParserHintObject(self.default, false, 'default', key, value) + return self + } + + self.describe = function (key, desc) { + argsert(' [string]', [key, desc], arguments.length) + populateParserHintObject(self.describe, false, 'key', key, true) + usage.describe(key, desc) + return self + } + + self.demandOption = function (keys, msg) { + argsert(' [string]', [keys, msg], arguments.length) + populateParserHintObject(self.demandOption, false, 'demandedOptions', keys, msg) + return self + } + + self.coerce = function (keys, value) { + argsert(' [function]', [keys, value], arguments.length) + populateParserHintObject(self.coerce, false, 'coerce', keys, value) + return self + } + + function populateParserHintObject (builder, isArray, type, key, value) { + if (Array.isArray(key)) { + // an array of keys with one value ['x', 'y', 'z'], function parse () {} + const temp = {} + key.forEach((k) => { + temp[k] = value + }) + builder(temp) + } else if (typeof key === 'object') { + // an object of key value pairs: {'x': parse () {}, 'y': parse() {}} + Object.keys(key).forEach((k) => { + builder(k, key[k]) + }) + } else { + // a single key value pair 'x', parse() {} + if (isArray) { + options[type][key] = (options[type][key] || []).concat(value) + } else { + options[type][key] = value + } + } + } + + function deleteFromParserHintObject (optionKey) { + // delete from all parsing hints: + // boolean, array, key, alias, etc. + Object.keys(options).forEach((hintKey) => { + const hint = options[hintKey] + if (Array.isArray(hint)) { + if (~hint.indexOf(optionKey)) hint.splice(hint.indexOf(optionKey), 1) + } else if (typeof hint === 'object') { + delete hint[optionKey] + } + }) + // now delete the description from usage.js. + delete usage.getDescriptions()[optionKey] + } + + self.config = function config (key, msg, parseFn) { + argsert('[object|string] [string|function] [function]', [key, msg, parseFn], arguments.length) + // allow a config object to be provided directly. + if (typeof key === 'object') { + key = applyExtends(key, cwd) + options.configObjects = (options.configObjects || []).concat(key) + return self + } + + // allow for a custom parsing function. + if (typeof msg === 'function') { + parseFn = msg + msg = null + } + + key = key || 'config' + self.describe(key, msg || usage.deferY18nLookup('Path to JSON config file')) + ;(Array.isArray(key) ? key : [key]).forEach((k) => { + options.config[k] = parseFn || true + }) + + return self + } + + self.example = function (cmd, description) { + argsert(' [string]', [cmd, description], arguments.length) + usage.example(cmd, description) + return self + } + + self.command = function (cmd, description, builder, handler, middlewares) { + argsert(' [string|boolean] [function|object] [function] [array]', [cmd, description, builder, handler, middlewares], arguments.length) + command.addHandler(cmd, description, builder, handler, middlewares) + return self + } + + self.commandDir = function (dir, opts) { + argsert(' [object]', [dir, opts], arguments.length) + const req = parentRequire || require + command.addDirectory(dir, self.getContext(), req, require('get-caller-file')(), opts) + return self + } + + // TODO: deprecate self.demand in favor of + // .demandCommand() .demandOption(). + self.demand = self.required = self.require = function demand (keys, max, msg) { + // you can optionally provide a 'max' key, + // which will raise an exception if too many '_' + // options are provided. + if (Array.isArray(max)) { + max.forEach((key) => { + self.demandOption(key, msg) + }) + max = Infinity + } else if (typeof max !== 'number') { + msg = max + max = Infinity + } + + if (typeof keys === 'number') { + self.demandCommand(keys, max, msg, msg) + } else if (Array.isArray(keys)) { + keys.forEach((key) => { + self.demandOption(key, msg) + }) + } else { + if (typeof msg === 'string') { + self.demandOption(keys, msg) + } else if (msg === true || typeof msg === 'undefined') { + self.demandOption(keys) + } + } + + return self + } + + self.demandCommand = function demandCommand (min, max, minMsg, maxMsg) { + argsert('[number] [number|string] [string|null|undefined] [string|null|undefined]', [min, max, minMsg, maxMsg], arguments.length) + + if (typeof min === 'undefined') min = 1 + + if (typeof max !== 'number') { + minMsg = max + max = Infinity + } + + self.global('_', false) + + options.demandedCommands._ = { + min, + max, + minMsg, + maxMsg + } + + return self + } + + self.getDemandedOptions = () => { + argsert([], 0) + return options.demandedOptions + } + + self.getDemandedCommands = () => { + argsert([], 0) + return options.demandedCommands + } + + self.implies = function (key, value) { + argsert(' [number|string|array]', [key, value], arguments.length) + validation.implies(key, value) + return self + } + + self.conflicts = function (key1, key2) { + argsert(' [string|array]', [key1, key2], arguments.length) + validation.conflicts(key1, key2) + return self + } + + self.usage = function (msg, description, builder, handler) { + argsert(' [string|boolean] [function|object] [function]', [msg, description, builder, handler], arguments.length) + + if (description !== undefined) { + // .usage() can be used as an alias for defining + // a default command. + if ((msg || '').match(/^\$0( |$)/)) { + return self.command(msg, description, builder, handler) + } else { + throw new YError('.usage() description must start with $0 if being used as alias for .command()') + } + } else { + usage.usage(msg) + return self + } + } + + self.epilogue = self.epilog = function (msg) { + argsert('', [msg], arguments.length) + usage.epilog(msg) + return self + } + + self.fail = function (f) { + argsert('', [f], arguments.length) + usage.failFn(f) + return self + } + + self.check = function (f, _global) { + argsert(' [boolean]', [f, _global], arguments.length) + validation.check(f, _global !== false) + return self + } + + self.global = function global (globals, global) { + argsert(' [boolean]', [globals, global], arguments.length) + globals = [].concat(globals) + if (global !== false) { + options.local = options.local.filter(l => globals.indexOf(l) === -1) + } else { + globals.forEach((g) => { + if (options.local.indexOf(g) === -1) options.local.push(g) + }) + } + return self + } + + self.pkgConf = function pkgConf (key, rootPath) { + argsert(' [string]', [key, rootPath], arguments.length) + let conf = null + // prefer cwd to require-main-filename in this method + // since we're looking for e.g. "nyc" config in nyc consumer + // rather than "yargs" config in nyc (where nyc is the main filename) + const obj = pkgUp(rootPath || cwd) + + // If an object exists in the key, add it to options.configObjects + if (obj[key] && typeof obj[key] === 'object') { + conf = applyExtends(obj[key], rootPath || cwd) + options.configObjects = (options.configObjects || []).concat(conf) + } + + return self + } + + const pkgs = {} + function pkgUp (rootPath) { + const npath = rootPath || '*' + if (pkgs[npath]) return pkgs[npath] + const findUp = require('find-up') + + let obj = {} + try { + let startDir = rootPath || require('require-main-filename')(parentRequire || require) + + // When called in an environment that lacks require.main.filename, such as a jest test runner, + // startDir is already process.cwd(), and should not be shortened. + // Whether or not it is _actually_ a directory (e.g., extensionless bin) is irrelevant, find-up handles it. + if (!rootPath && path.extname(startDir)) { + startDir = path.dirname(startDir) + } + + const pkgJsonPath = findUp.sync('package.json', { + cwd: startDir + }) + obj = JSON.parse(fs.readFileSync(pkgJsonPath)) + } catch (noop) {} + + pkgs[npath] = obj || {} + return pkgs[npath] + } + + let parseFn = null + let parseContext = null + self.parse = function parse (args, shortCircuit, _parseFn) { + argsert('[string|array] [function|boolean|object] [function]', [args, shortCircuit, _parseFn], arguments.length) + if (typeof args === 'undefined') { + return self._parseArgs(processArgs) + } + + // a context object can optionally be provided, this allows + // additional information to be passed to a command handler. + if (typeof shortCircuit === 'object') { + parseContext = shortCircuit + shortCircuit = _parseFn + } + + // by providing a function as a second argument to + // parse you can capture output that would otherwise + // default to printing to stdout/stderr. + if (typeof shortCircuit === 'function') { + parseFn = shortCircuit + shortCircuit = null + } + // completion short-circuits the parsing process, + // skipping validation, etc. + if (!shortCircuit) processArgs = args + + freeze() + if (parseFn) exitProcess = false + + const parsed = self._parseArgs(args, shortCircuit) + if (parseFn) parseFn(exitError, parsed, output) + unfreeze() + + return parsed + } + + self._getParseContext = () => parseContext || {} + + self._hasParseCallback = () => !!parseFn + + self.option = self.options = function option (key, opt) { + argsert(' [object]', [key, opt], arguments.length) + if (typeof key === 'object') { + Object.keys(key).forEach((k) => { + self.options(k, key[k]) + }) + } else { + if (typeof opt !== 'object') { + opt = {} + } + + options.key[key] = true // track manually set keys. + + if (opt.alias) self.alias(key, opt.alias) + + const demand = opt.demand || opt.required || opt.require + + // deprecated, use 'demandOption' instead + if (demand) { + self.demand(key, demand) + } + + if (opt.demandOption) { + self.demandOption(key, typeof opt.demandOption === 'string' ? opt.demandOption : undefined) + } + + if ('conflicts' in opt) { + self.conflicts(key, opt.conflicts) + } + + if ('default' in opt) { + self.default(key, opt.default) + } + + if ('implies' in opt) { + self.implies(key, opt.implies) + } + + if ('nargs' in opt) { + self.nargs(key, opt.nargs) + } + + if (opt.config) { + self.config(key, opt.configParser) + } + + if (opt.normalize) { + self.normalize(key) + } + + if ('choices' in opt) { + self.choices(key, opt.choices) + } + + if ('coerce' in opt) { + self.coerce(key, opt.coerce) + } + + if ('group' in opt) { + self.group(key, opt.group) + } + + if (opt.boolean || opt.type === 'boolean') { + self.boolean(key) + if (opt.alias) self.boolean(opt.alias) + } + + if (opt.array || opt.type === 'array') { + self.array(key) + if (opt.alias) self.array(opt.alias) + } + + if (opt.number || opt.type === 'number') { + self.number(key) + if (opt.alias) self.number(opt.alias) + } + + if (opt.string || opt.type === 'string') { + self.string(key) + if (opt.alias) self.string(opt.alias) + } + + if (opt.count || opt.type === 'count') { + self.count(key) + } + + if (typeof opt.global === 'boolean') { + self.global(key, opt.global) + } + + if (opt.defaultDescription) { + options.defaultDescription[key] = opt.defaultDescription + } + + if (opt.skipValidation) { + self.skipValidation(key) + } + + const desc = opt.describe || opt.description || opt.desc + self.describe(key, desc) + if (opt.hidden) { + self.hide(key) + } + + if (opt.requiresArg) { + self.requiresArg(key) + } + } + + return self + } + self.getOptions = () => options + + self.positional = function (key, opts) { + argsert(' ', [key, opts], arguments.length) + if (context.resets === 0) { + throw new YError(".positional() can only be called in a command's builder function") + } + + // .positional() only supports a subset of the configuration + // options available to .option(). + const supportedOpts = ['default', 'defaultDescription', 'implies', 'normalize', + 'choices', 'conflicts', 'coerce', 'type', 'describe', + 'desc', 'description', 'alias'] + opts = objFilter(opts, (k, v) => { + let accept = supportedOpts.indexOf(k) !== -1 + // type can be one of string|number|boolean. + if (k === 'type' && ['string', 'number', 'boolean'].indexOf(v) === -1) accept = false + return accept + }) + + // copy over any settings that can be inferred from the command string. + const fullCommand = context.fullCommands[context.fullCommands.length - 1] + const parseOptions = fullCommand ? command.cmdToParseOptions(fullCommand) : { + array: [], + alias: {}, + default: {}, + demand: {} + } + Object.keys(parseOptions).forEach((pk) => { + if (Array.isArray(parseOptions[pk])) { + if (parseOptions[pk].indexOf(key) !== -1) opts[pk] = true + } else { + if (parseOptions[pk][key] && !(pk in opts)) opts[pk] = parseOptions[pk][key] + } + }) + self.group(key, usage.getPositionalGroupName()) + return self.option(key, opts) + } + + self.group = function group (opts, groupName) { + argsert(' ', [opts, groupName], arguments.length) + const existing = preservedGroups[groupName] || groups[groupName] + if (preservedGroups[groupName]) { + // we now only need to track this group name in groups. + delete preservedGroups[groupName] + } + + const seen = {} + groups[groupName] = (existing || []).concat(opts).filter((key) => { + if (seen[key]) return false + return (seen[key] = true) + }) + return self + } + // combine explicit and preserved groups. explicit groups should be first + self.getGroups = () => Object.assign({}, groups, preservedGroups) + + // as long as options.envPrefix is not undefined, + // parser will apply env vars matching prefix to argv + self.env = function (prefix) { + argsert('[string|boolean]', [prefix], arguments.length) + if (prefix === false) options.envPrefix = undefined + else options.envPrefix = prefix || '' + return self + } + + self.wrap = function (cols) { + argsert('', [cols], arguments.length) + usage.wrap(cols) + return self + } + + let strict = false + self.strict = function (enabled) { + argsert('[boolean]', [enabled], arguments.length) + strict = enabled !== false + return self + } + self.getStrict = () => strict + + let parserConfig = {} + self.parserConfiguration = function parserConfiguration (config) { + argsert('', [config], arguments.length) + parserConfig = config + return self + } + self.getParserConfiguration = () => parserConfig + + self.showHelp = function (level) { + argsert('[string|function]', [level], arguments.length) + if (!self.parsed) self._parseArgs(processArgs) // run parser, if it has not already been executed. + if (command.hasDefaultCommand()) { + context.resets++ // override the restriction on top-level positoinals. + command.runDefaultBuilderOn(self, true) + } + usage.showHelp(level) + return self + } + + let versionOpt = null + self.version = function version (opt, msg, ver) { + const defaultVersionOpt = 'version' + argsert('[boolean|string] [string] [string]', [opt, msg, ver], arguments.length) + + // nuke the key previously configured + // to return version #. + if (versionOpt) { + deleteFromParserHintObject(versionOpt) + usage.version(undefined) + versionOpt = null + } + + if (arguments.length === 0) { + ver = guessVersion() + opt = defaultVersionOpt + } else if (arguments.length === 1) { + if (opt === false) { // disable default 'version' key. + return self + } + ver = opt + opt = defaultVersionOpt + } else if (arguments.length === 2) { + ver = msg + msg = null + } + + versionOpt = typeof opt === 'string' ? opt : defaultVersionOpt + msg = msg || usage.deferY18nLookup('Show version number') + + usage.version(ver || undefined) + self.boolean(versionOpt) + self.describe(versionOpt, msg) + return self + } + + function guessVersion () { + const obj = pkgUp() + + return obj.version || 'unknown' + } + + let helpOpt = null + self.addHelpOpt = self.help = function addHelpOpt (opt, msg) { + const defaultHelpOpt = 'help' + argsert('[string|boolean] [string]', [opt, msg], arguments.length) + + // nuke the key previously configured + // to return help. + if (helpOpt) { + deleteFromParserHintObject(helpOpt) + helpOpt = null + } + + if (arguments.length === 1) { + if (opt === false) return self + } + + // use arguments, fallback to defaults for opt and msg + helpOpt = typeof opt === 'string' ? opt : defaultHelpOpt + self.boolean(helpOpt) + self.describe(helpOpt, msg || usage.deferY18nLookup('Show help')) + return self + } + + const defaultShowHiddenOpt = 'show-hidden' + options.showHiddenOpt = defaultShowHiddenOpt + self.addShowHiddenOpt = self.showHidden = function addShowHiddenOpt (opt, msg) { + argsert('[string|boolean] [string]', [opt, msg], arguments.length) + + if (arguments.length === 1) { + if (opt === false) return self + } + + const showHiddenOpt = typeof opt === 'string' ? opt : defaultShowHiddenOpt + self.boolean(showHiddenOpt) + self.describe(showHiddenOpt, msg || usage.deferY18nLookup('Show hidden options')) + options.showHiddenOpt = showHiddenOpt + return self + } + + self.hide = function hide (key) { + argsert('', [key], arguments.length) + options.hiddenOptions.push(key) + return self + } + + self.showHelpOnFail = function showHelpOnFail (enabled, message) { + argsert('[boolean|string] [string]', [enabled, message], arguments.length) + usage.showHelpOnFail(enabled, message) + return self + } + + var exitProcess = true + self.exitProcess = function (enabled) { + argsert('[boolean]', [enabled], arguments.length) + if (typeof enabled !== 'boolean') { + enabled = true + } + exitProcess = enabled + return self + } + self.getExitProcess = () => exitProcess + + var completionCommand = null + self.completion = function (cmd, desc, fn) { + argsert('[string] [string|boolean|function] [function]', [cmd, desc, fn], arguments.length) + + // a function to execute when generating + // completions can be provided as the second + // or third argument to completion. + if (typeof desc === 'function') { + fn = desc + desc = null + } + + // register the completion command. + completionCommand = cmd || 'completion' + if (!desc && desc !== false) { + desc = 'generate completion script' + } + self.command(completionCommand, desc) + + // a function can be provided + if (fn) completion.registerFunction(fn) + + return self + } + + self.showCompletionScript = function ($0) { + argsert('[string]', [$0], arguments.length) + $0 = $0 || self.$0 + _logger.log(completion.generateCompletionScript($0, completionCommand)) + return self + } + + self.getCompletion = function (args, done) { + argsert(' ', [args, done], arguments.length) + completion.getCompletion(args, done) + } + + self.locale = function (locale) { + argsert('[string]', [locale], arguments.length) + if (arguments.length === 0) { + guessLocale() + return y18n.getLocale() + } + detectLocale = false + y18n.setLocale(locale) + return self + } + + self.updateStrings = self.updateLocale = function (obj) { + argsert('', [obj], arguments.length) + detectLocale = false + y18n.updateLocale(obj) + return self + } + + let detectLocale = true + self.detectLocale = function (detect) { + argsert('', [detect], arguments.length) + detectLocale = detect + return self + } + self.getDetectLocale = () => detectLocale + + var hasOutput = false + var exitError = null + // maybe exit, always capture + // context about why we wanted to exit. + self.exit = (code, err) => { + hasOutput = true + exitError = err + if (exitProcess) process.exit(code) + } + + // we use a custom logger that buffers output, + // so that we can print to non-CLIs, e.g., chat-bots. + const _logger = { + log () { + const args = [] + for (let i = 0; i < arguments.length; i++) args.push(arguments[i]) + if (!self._hasParseCallback()) console.log.apply(console, args) + hasOutput = true + if (output.length) output += '\n' + output += args.join(' ') + }, + error () { + const args = [] + for (let i = 0; i < arguments.length; i++) args.push(arguments[i]) + if (!self._hasParseCallback()) console.error.apply(console, args) + hasOutput = true + if (output.length) output += '\n' + output += args.join(' ') + } + } + self._getLoggerInstance = () => _logger + // has yargs output an error our help + // message in the current execution context. + self._hasOutput = () => hasOutput + + self._setHasOutput = () => { + hasOutput = true + } + + let recommendCommands + self.recommendCommands = function (recommend) { + argsert('[boolean]', [recommend], arguments.length) + recommendCommands = typeof recommend === 'boolean' ? recommend : true + return self + } + + self.getUsageInstance = () => usage + + self.getValidationInstance = () => validation + + self.getCommandInstance = () => command + + self.terminalWidth = () => { + argsert([], 0) + return typeof process.stdout.columns !== 'undefined' ? process.stdout.columns : null + } + + Object.defineProperty(self, 'argv', { + get: () => self._parseArgs(processArgs), + enumerable: true + }) + + self._parseArgs = function parseArgs (args, shortCircuit, _skipValidation, commandIndex) { + let skipValidation = !!_skipValidation + args = args || processArgs + + options.__ = y18n.__ + options.configuration = self.getParserConfiguration() + + // Deprecated + let pkgConfig = pkgUp()['yargs'] + if (pkgConfig) { + console.warn('Configuring yargs through package.json is deprecated and will be removed in the next major release, please use the JS API instead.') + options.configuration = Object.assign({}, pkgConfig, options.configuration) + } + + const parsed = Parser.detailed(args, options) + let argv = parsed.argv + if (parseContext) argv = Object.assign({}, argv, parseContext) + const aliases = parsed.aliases + + argv.$0 = self.$0 + self.parsed = parsed + + try { + guessLocale() // guess locale lazily, so that it can be turned off in chain. + + // while building up the argv object, there + // are two passes through the parser. If completion + // is being performed short-circuit on the first pass. + if (shortCircuit) { + return argv + } + + // if there's a handler associated with a + // command defer processing to it. + if (helpOpt) { + // consider any multi-char helpOpt alias as a valid help command + // unless all helpOpt aliases are single-char + // note that parsed.aliases is a normalized bidirectional map :) + const helpCmds = [helpOpt] + .concat(aliases[helpOpt] || []) + .filter(k => k.length > 1) + // check if help should trigger and strip it from _. + if (~helpCmds.indexOf(argv._[argv._.length - 1])) { + argv._.pop() + argv[helpOpt] = true + } + } + + const handlerKeys = command.getCommands() + const requestCompletions = completion.completionKey in argv + const skipRecommendation = argv[helpOpt] || requestCompletions + const skipDefaultCommand = skipRecommendation && (handlerKeys.length > 1 || handlerKeys[0] !== '$0') + + if (argv._.length) { + if (handlerKeys.length) { + let firstUnknownCommand + for (let i = (commandIndex || 0), cmd; argv._[i] !== undefined; i++) { + cmd = String(argv._[i]) + if (~handlerKeys.indexOf(cmd) && cmd !== completionCommand) { + // commands are executed using a recursive algorithm that executes + // the deepest command first; we keep track of the position in the + // argv._ array that is currently being executed. + return command.runCommand(cmd, self, parsed, i + 1) + } else if (!firstUnknownCommand && cmd !== completionCommand) { + firstUnknownCommand = cmd + break + } + } + + // run the default command, if defined + if (command.hasDefaultCommand() && !skipDefaultCommand) { + return command.runCommand(null, self, parsed) + } + + // recommend a command if recommendCommands() has + // been enabled, and no commands were found to execute + if (recommendCommands && firstUnknownCommand && !skipRecommendation) { + validation.recommendCommands(firstUnknownCommand, handlerKeys) + } + } + + // generate a completion script for adding to ~/.bashrc. + if (completionCommand && ~argv._.indexOf(completionCommand) && !requestCompletions) { + if (exitProcess) setBlocking(true) + self.showCompletionScript() + self.exit(0) + } + } else if (command.hasDefaultCommand() && !skipDefaultCommand) { + return command.runCommand(null, self, parsed) + } + + // we must run completions first, a user might + // want to complete the --help or --version option. + if (requestCompletions) { + if (exitProcess) setBlocking(true) + + // we allow for asynchronous completions, + // e.g., loading in a list of commands from an API. + const completionArgs = args.slice(args.indexOf(`--${completion.completionKey}`) + 1) + completion.getCompletion(completionArgs, (completions) => { + ;(completions || []).forEach((completion) => { + _logger.log(completion) + }) + + self.exit(0) + }) + return argv + } + + // Handle 'help' and 'version' options + // if we haven't already output help! + if (!hasOutput) { + Object.keys(argv).forEach((key) => { + if (key === helpOpt && argv[key]) { + if (exitProcess) setBlocking(true) + + skipValidation = true + self.showHelp('log') + self.exit(0) + } else if (key === versionOpt && argv[key]) { + if (exitProcess) setBlocking(true) + + skipValidation = true + usage.showVersion() + self.exit(0) + } + }) + } + + // Check if any of the options to skip validation were provided + if (!skipValidation && options.skipValidation.length > 0) { + skipValidation = Object.keys(argv).some(key => options.skipValidation.indexOf(key) >= 0 && argv[key] === true) + } + + // If the help or version options where used and exitProcess is false, + // or if explicitly skipped, we won't run validations. + if (!skipValidation) { + if (parsed.error) throw new YError(parsed.error.message) + + // if we're executed via bash completion, don't + // bother with validation. + if (!requestCompletions) { + self._runValidation(argv, aliases, {}, parsed.error) + } + } + } catch (err) { + if (err instanceof YError) usage.fail(err.message, err) + else throw err + } + + return argv + } + + self._runValidation = function runValidation (argv, aliases, positionalMap, parseErrors) { + if (parseErrors) throw new YError(parseErrors.message || parseErrors) + validation.nonOptionCount(argv) + validation.requiredArguments(argv) + if (strict) validation.unknownArguments(argv, aliases, positionalMap) + validation.customChecks(argv, aliases) + validation.limitedChoices(argv) + validation.implications(argv) + validation.conflicting(argv) + } + + function guessLocale () { + if (!detectLocale) return + + try { + const { env } = process + const locale = env.LC_ALL || env.LC_MESSAGES || env.LANG || env.LANGUAGE || 'en_US' + self.locale(locale.replace(/[.:].*/, '')) + } catch (err) { + // if we explode looking up locale just noop + // we'll keep using the default language 'en'. + } + } + + // an app should almost always have --version and --help, + // if you *really* want to disable this use .help(false)/.version(false). + self.help() + self.version() + + return self +} + +// rebase an absolute path to a relative one with respect to a base directory +// exported for tests +exports.rebase = rebase +function rebase (base, dir) { + return path.relative(base, dir) +} diff --git a/package-lock.json b/package-lock.json new file mode 100644 index 0000000..7cc739e --- /dev/null +++ b/package-lock.json @@ -0,0 +1,226 @@ +{ + "name": "05-clima", + "version": "1.0.0", + "lockfileVersion": 1, + "requires": true, + "dependencies": { + "ansi-regex": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==" + }, + "ansi-styles": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "requires": { + "color-convert": "^1.9.0" + } + }, + "axios": { + "version": "0.19.0", + "resolved": "https://registry.npmjs.org/axios/-/axios-0.19.0.tgz", + "integrity": "sha512-1uvKqKQta3KBxIz14F2v06AEHZ/dIoeKfbTRkK1E5oqjDnuEerLmYTgJB5AiQZHJcljpg1TuRzdjDR06qNk0DQ==", + "requires": { + "follow-redirects": "1.5.10", + "is-buffer": "^2.0.2" + } + }, + "camelcase": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==" + }, + "cliui": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", + "integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==", + "requires": { + "string-width": "^3.1.0", + "strip-ansi": "^5.2.0", + "wrap-ansi": "^5.1.0" + } + }, + "color-convert": { + "version": "1.9.3", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "requires": { + "color-name": "1.1.3" + } + }, + "color-name": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" + }, + "debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "requires": { + "ms": "2.0.0" + } + }, + "decamelize": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", + "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=" + }, + "emoji-regex": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==" + }, + "find-up": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", + "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", + "requires": { + "locate-path": "^3.0.0" + } + }, + "follow-redirects": { + "version": "1.5.10", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.10.tgz", + "integrity": "sha512-0V5l4Cizzvqt5D44aTXbFZz+FtyXV1vrDN6qrelxtfYQKW0KO0W2T/hkE8xvGa/540LkZlkaUjO4ailYTFtHVQ==", + "requires": { + "debug": "=3.1.0" + } + }, + "get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==" + }, + "is-buffer": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-2.0.3.tgz", + "integrity": "sha512-U15Q7MXTuZlrbymiz95PJpZxu8IlipAp4dtS3wOdgPXx3mqBnslrWU14kxfHB+Py/+2PVKSr37dMAgM2A4uArw==" + }, + "is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=" + }, + "locate-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", + "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", + "requires": { + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" + } + }, + "ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "p-limit": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.2.0.tgz", + "integrity": "sha512-pZbTJpoUsCzV48Mc9Nh51VbwO0X9cuPFE8gYwx9BTCt9SF8/b7Zljd2fVgOxhIF/HDTKgpVzs+GPhyKfjLLFRQ==", + "requires": { + "p-try": "^2.0.0" + } + }, + "p-locate": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", + "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", + "requires": { + "p-limit": "^2.0.0" + } + }, + "p-try": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==" + }, + "path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=" + }, + "require-directory": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", + "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=" + }, + "require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" + }, + "set-blocking": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=" + }, + "string-width": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "requires": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + } + }, + "strip-ansi": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "requires": { + "ansi-regex": "^4.1.0" + } + }, + "which-module": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", + "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=" + }, + "wrap-ansi": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", + "integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==", + "requires": { + "ansi-styles": "^3.2.0", + "string-width": "^3.0.0", + "strip-ansi": "^5.0.0" + } + }, + "y18n": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", + "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==" + }, + "yargs": { + "version": "13.3.0", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.3.0.tgz", + "integrity": "sha512-2eehun/8ALW8TLoIl7MVaRUrg+yCnenu8B4kBlRxj3GJGDKU1Og7sMXPNm1BYyM1DOJmTZ4YeN/Nwxv+8XJsUA==", + "requires": { + "cliui": "^5.0.0", + "find-up": "^3.0.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^3.0.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^13.1.1" + } + }, + "yargs-parser": { + "version": "13.1.1", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.1.tgz", + "integrity": "sha512-oVAVsHz6uFrg3XQheFII8ESO2ssAf9luWuAd6Wexsu4F3OtIW0o8IribPXYrD4WC24LWtPrJlGy87y5udK+dxQ==", + "requires": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + } + } + } +} diff --git a/package.json b/package.json new file mode 100644 index 0000000..ef99c9e --- /dev/null +++ b/package.json @@ -0,0 +1,16 @@ +{ + "name": "05-clima", + "version": "1.0.0", + "description": "", + "main": "app.js", + "dependencies": { + "axios": "^0.19.0", + "yargs": "^13.3.0" + }, + "devDependencies": {}, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "author": "", + "license": "ISC" +}