From 4e91d3259dc418a2e02c086361bacfe8d03e92fb Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 08:51:14 -0400
Subject: [PATCH 1/8] add a random seed for the layout in circle grid

---
 datamol/viz/_circle_grid.py | 10 ++++++++--
 datamol/viz/utils.py        | 12 ++++++++++--
 2 files changed, 18 insertions(+), 4 deletions(-)

diff --git a/datamol/viz/_circle_grid.py b/datamol/viz/_circle_grid.py
index d332f5d1..dd881f64 100644
--- a/datamol/viz/_circle_grid.py
+++ b/datamol/viz/_circle_grid.py
@@ -98,6 +98,7 @@ def __init__(
         ring_mol_highlight_atoms: Optional[List[List[int]]] = None,
         ring_mol_highlight_bonds: Optional[List[List[int]]] = None,
         kekulize: bool = True,
+        layout_random_seed: Optional[int] = 19,
         **kwargs: Any,
     ):
         """Show molecules in concentric rings, with one molecule at the center
@@ -121,7 +122,8 @@ def __init__(
             ring_mol_highlight_atoms: List of list of atom indices to highlight for molecules at each level of the concentric rings
             ring_mol_highlight_bonds: List of list of bond indices to highlight for molecules at each level of the concentric rings
             ring_color: Color of the concentric rings. Set to None to not draw any ring.
-            kekulize: Whether to kekulize the molecules before drawing
+            kekulize: Whether to kekulize the molecules before drawing.
+            layout_random_seed: Random seed for the layout of the molecules. Set to None for no seed.
             **kwargs: Additional arguments to pass to the drawing function. See RDKit
                 documentation related to `MolDrawOptions` for more details at
                 https://www.rdkit.org/docs/source/rdkit.Chem.Draw.rdMolDraw2D.html.
@@ -146,6 +148,7 @@ def __init__(
         self.center_mol_highlight_atoms = center_mol_highlight_atoms
         self.center_mol_highlight_bonds = center_mol_highlight_bonds
         self.kekulize = kekulize
+        self.layout_random_seed = layout_random_seed
         self._global_legend_size = 0
         if self.legend is not None:
             self._global_legend_size = max(25, self.margin)
@@ -276,12 +279,15 @@ def draw(self):
             highlight_atom=self.center_mol_highlight_atoms,
             highlight_bond=self.center_mol_highlight_bonds,
         )
+
+        rng = random.Random(self.layout_random_seed)
+
         # draw the ring mols
         self.draw_options.scalingFactor *= self.ring_scaler
         for i, mols in enumerate(self.ring_mols):
             radius = radius_list[i]
             ni = len(mols)
-            rand_unit = random.random() * 2 * math.pi
+            rand_unit = rng.random() * 2 * math.pi
             for k, mol in enumerate(mols):
                 center_x = radius * math.cos(2 * k * math.pi / ni + rand_unit) + self.midpoint.x
                 center_y = radius * math.sin(2 * k * math.pi / ni + rand_unit) + self.midpoint.y
diff --git a/datamol/viz/utils.py b/datamol/viz/utils.py
index cad4e268..3de0c732 100644
--- a/datamol/viz/utils.py
+++ b/datamol/viz/utils.py
@@ -6,6 +6,7 @@
 
 from rdkit.Chem import Draw
 
+import PIL.Image
 import PIL.PngImagePlugin
 import datamol as dm
 
@@ -94,7 +95,14 @@ def drawer_to_image(drawer: Draw.rdMolDraw2D.MolDraw2D):
 
 
 def image_to_file(
-    image: Union[str, PIL.PngImagePlugin.PngImageFile, bytes], outfile, as_svg: bool = False
+    image: Union[
+        str,
+        PIL.PngImagePlugin.PngImageFile,
+        bytes,
+        PIL.Image.Image,
+    ],
+    outfile,
+    as_svg: bool = False,
 ):
     """Save image to file. The image can be either a PNG or SVG depending
 
@@ -115,7 +123,7 @@ def image_to_file(
         else:
             if isinstance(image, PIL.PngImagePlugin.PngImageFile):  # type: ignore
                 # in a terminal process
-                image.save(f)
+                image.save(f)  # type: ignore
             else:
                 # in a jupyter kernel process
                 f.write(image.data)  # type: ignore

From bb63870e6357187454ccae96e77e631d9a43488e Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 08:51:59 -0400
Subject: [PATCH 2/8] remove left hover print statement in lasso viz

---
 datamol/viz/_lasso_highlight.py | 1 -
 1 file changed, 1 deletion(-)

diff --git a/datamol/viz/_lasso_highlight.py b/datamol/viz/_lasso_highlight.py
index 80fb6e9d..08208079 100644
--- a/datamol/viz/_lasso_highlight.py
+++ b/datamol/viz/_lasso_highlight.py
@@ -334,7 +334,6 @@ def _draw_multi_matches(
     else:
         _color_list = color_list
 
-    print(len(_color_list), len(indices_set_lists))
     if len(_color_list) < len(indices_set_lists):
         colors_to_add = []
         for i in range(len(indices_set_lists) - len(_color_list)):

From fd3ddf3b3fa87e34cfbe458e9e81a242d456a5c6 Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 09:26:58 -0400
Subject: [PATCH 3/8] allow hex string as colors

---
 datamol/__init__.py               |  6 ++++--
 datamol/types.py                  |  3 ++-
 datamol/viz/_circle_grid.py       | 18 +++++++++++++-----
 datamol/viz/_lasso_highlight.py   | 26 ++++++++++++++++++--------
 datamol/viz/utils.py              | 15 +++++++++++++++
 tests/test_viz.py                 | 17 +++++++++++++++++
 tests/test_viz_lasso_highlight.py |  9 +++++++++
 7 files changed, 78 insertions(+), 16 deletions(-)

diff --git a/datamol/__init__.py b/datamol/__init__.py
index c1e329c3..3ee604ff 100644
--- a/datamol/__init__.py
+++ b/datamol/__init__.py
@@ -22,7 +22,8 @@
     "ChemicalReaction": "datamol.types",
     "Atom": "datamol.types",
     "Bond": "datamol.types",
-    "ColorTuple": "datamol.types",
+    "DatamolColor": "datamol.types",
+    "RDKitColor": "datamol.types",
     # utils
     "parallelized": "datamol.utils",
     "parallelized_with_batches": "datamol.utils",
@@ -209,7 +210,8 @@ def __dir__():
     from .types import ChemicalReaction
     from .types import Atom
     from .types import Bond
-    from .types import ColorTuple
+    from .types import DatamolColor
+    from .types import RDKitColor
 
     from . import utils
 
diff --git a/datamol/types.py b/datamol/types.py
index b48627e0..7c7fa71d 100644
--- a/datamol/types.py
+++ b/datamol/types.py
@@ -12,4 +12,5 @@
 Atom: TypeAlias = Chem.rdchem.Atom
 Bond: TypeAlias = Chem.rdchem.Bond
 
-ColorTuple = Union[Tuple[float, float, float, float], Tuple[float, float, float]]
+RDKitColor = Union[Tuple[float, float, float, float], Tuple[float, float, float]]
+DatamolColor = Union[RDKitColor, str]
diff --git a/datamol/viz/_circle_grid.py b/datamol/viz/_circle_grid.py
index dd881f64..1deccbf4 100644
--- a/datamol/viz/_circle_grid.py
+++ b/datamol/viz/_circle_grid.py
@@ -12,8 +12,11 @@
 from .utils import drawer_to_image
 from .utils import prepare_mol_for_drawing
 from .utils import image_to_file
-from datamol.types import ColorTuple
+from .utils import to_rdkit_color
+
+from datamol.types import DatamolColor
 from datamol.types import Mol
+from datamol.types import RDKitColor
 
 import datamol as dm
 
@@ -27,12 +30,13 @@ def circle_grid(
     ring_scaler: float = 1.0,
     align: Optional[Union[Mol, str, bool]] = None,
     use_svg: bool = True,
-    ring_color: Optional[ColorTuple] = None,
+    ring_color: Optional[DatamolColor] = None,
     center_mol_highlight_atoms: Optional[List[int]] = None,
     center_mol_highlight_bonds: Optional[List[int]] = None,
     ring_mol_highlight_atoms: Optional[List[List[int]]] = None,
     ring_mol_highlight_bonds: Optional[List[List[int]]] = None,
     outfile: Optional[str] = None,
+    layout_random_seed: Optional[int] = 19,
     **kwargs: Any,
 ):
     """Show molecules in concentric rings, with one molecule at the center
@@ -54,6 +58,8 @@ def circle_grid(
         ring_mol_highlight_atoms: List of list of atom indices to highlight for molecules at each level of the concentric rings
         ring_mol_highlight_bonds: List of list of bond indices to highlight for molecules at each level of the concentric rings
         ring_color: Color of the concentric rings. Set to None to not draw any ring.
+        kekulize: Whether to kekulize the molecules before drawing.
+        layout_random_seed: Random seed for the layout of the molecules. Set to None for no seed.
         outfile: Optional path to the save the output file.
         **kwargs: Additional arguments to pass to the drawing function. See RDKit
             documentation related to `MolDrawOptions` for more details at
@@ -75,6 +81,7 @@ def circle_grid(
         center_mol_highlight_bonds=center_mol_highlight_bonds,
         ring_mol_highlight_atoms=ring_mol_highlight_atoms,
         ring_mol_highlight_bonds=ring_mol_highlight_bonds,
+        layout_random_seed=layout_random_seed,
         **kwargs,
     )
     return grid(outfile=outfile)
@@ -92,7 +99,7 @@ def __init__(
         align: Optional[Union[Mol, str, bool]] = None,
         use_svg: bool = True,
         line_width: Optional[float] = None,
-        ring_color: Optional[ColorTuple] = None,
+        ring_color: Optional[DatamolColor] = None,
         center_mol_highlight_atoms: Optional[List[int]] = None,
         center_mol_highlight_bonds: Optional[List[int]] = None,
         ring_mol_highlight_atoms: Optional[List[List[int]]] = None,
@@ -143,6 +150,7 @@ def __init__(
         self.use_svg = use_svg
         self.line_width = line_width
         self.ring_color = ring_color
+        self.ring_color_rdkit: Optional[RDKitColor] = to_rdkit_color(ring_color)
         self.ring_mol_highlight_atoms = ring_mol_highlight_atoms
         self.ring_mol_highlight_bonds = ring_mol_highlight_bonds
         self.center_mol_highlight_atoms = center_mol_highlight_atoms
@@ -329,8 +337,8 @@ def _draw_circles(self):
         for _, radius in enumerate(full_range):
             radius += self.margin // 2
             if radius > self.margin:
-                if self.ring_color is not None:
-                    self.canvas.SetColour(self.ring_color)
+                if self.ring_color_rdkit is not None:
+                    self.canvas.SetColour(self.ring_color_rdkit)
                     self.canvas.DrawArc(self.midpoint, radius, 0, 360, rawCoords=True)
             radius_list.append(radius + radius_step)
         return radius_list
diff --git a/datamol/viz/_lasso_highlight.py b/datamol/viz/_lasso_highlight.py
index 08208079..5bd5f689 100644
--- a/datamol/viz/_lasso_highlight.py
+++ b/datamol/viz/_lasso_highlight.py
@@ -20,9 +20,12 @@
 import numpy as np
 import datamol as dm
 
-from datamol.types import ColorTuple
+from datamol.types import RDKitColor
+from datamol.types import DatamolColor
+
 from .utils import drawer_to_image
 from .utils import prepare_mol_for_drawing
+from .utils import to_rdkit_color
 
 
 def _angle_to_coord(center: np.ndarray, angle: float, radius: float) -> np.ndarray:
@@ -185,7 +188,7 @@ def _draw_substructurematch(
     rel_radius: float = 0.3,
     rel_width: float = 0.5,
     line_width: int = 2,
-    color: Optional[ColorTuple] = None,
+    color: Optional[RDKitColor] = None,
     offset: Optional[Tuple[int, int]] = None,
 ) -> None:
     """Draws the substructure defined by (atom-) `indices`, as lasso-highlight onto `canvas`.
@@ -208,7 +211,7 @@ def _draw_substructurematch(
     # #  Default color is gray.
     if not color:
         color = (0.5, 0.5, 0.5, 1)
-    canvas.SetColour(color)
+    canvas.SetColour(tuple(color))
 
     # Selects first conformer and calculates the mean bond length
     conf = mol.GetConformer(0)
@@ -311,7 +314,7 @@ def _draw_multi_matches(
     r_min: float = 0.3,
     r_dist: float = 0.13,
     relative_bond_width: float = 0.5,
-    color_list: Optional[List[ColorTuple]] = None,
+    color_list: Optional[List[DatamolColor]] = None,
     line_width: int = 2,
     offset: Optional[Tuple[int, int]] = None,
 ):
@@ -365,7 +368,7 @@ def _draw_multi_matches(
             match_atoms,
             rel_radius=ar,
             rel_width=max(relative_bond_width, ar),
-            color=color,
+            color=to_rdkit_color(color),
             line_width=line_width,
             offset=offset,
         )
@@ -393,7 +396,7 @@ def lasso_highlight_image(
     r_min: float = 0.3,
     r_dist: float = 0.13,
     relative_bond_width: float = 0.5,
-    color_list: Optional[List[ColorTuple]] = None,
+    color_list: Optional[List[DatamolColor]] = None,
     line_width: int = 2,
     scale_padding: float = 1.0,
     verbose: bool = False,
@@ -437,6 +440,7 @@ def lasso_highlight_image(
     for i, search_mol in enumerate(search_molecules):
         if isinstance(search_mol, str):
             search_molecules[i] = dm.from_smarts(search_mol)
+
         if search_molecules[i] is None or not isinstance(search_molecules[i], dm.Mol):
             raise ValueError(
                 f"Please enter valid search molecules or smarts: {search_molecules[i]}"
@@ -461,11 +465,17 @@ def lasso_highlight_image(
     ## Step 1: setup drawer and canvas
     if use_svg:
         drawer = rdMolDraw2D.MolDraw2DSVG(
-            mol_size[0] * n_cols, mol_size[1] * n_rows, mol_size[0], mol_size[1]
+            mol_size[0] * n_cols,
+            mol_size[1] * n_rows,
+            mol_size[0],
+            mol_size[1],
         )
     else:
         drawer = rdMolDraw2D.MolDraw2DCairo(
-            mol_size[0] * n_cols, mol_size[1] * n_rows, mol_size[0], mol_size[1]
+            mol_size[0] * n_cols,
+            mol_size[1] * n_rows,
+            mol_size[0],
+            mol_size[1],
         )
 
     # Setting the drawing options
diff --git a/datamol/viz/utils.py b/datamol/viz/utils.py
index 3de0c732..37401d13 100644
--- a/datamol/viz/utils.py
+++ b/datamol/viz/utils.py
@@ -5,11 +5,16 @@
 import fsspec
 
 from rdkit.Chem import Draw
+from matplotlib import colors as mcolors
 
 import PIL.Image
 import PIL.PngImagePlugin
+
 import datamol as dm
 
+from datamol.types import RDKitColor
+from datamol.types import DatamolColor
+
 
 def prepare_mol_for_drawing(mol: Optional[dm.Mol], kekulize: bool = True) -> Optional[dm.Mol]:
     """Prepare the molecule before drawing to avoid any error due to unsanitized molecule
@@ -127,3 +132,13 @@ def image_to_file(
             else:
                 # in a jupyter kernel process
                 f.write(image.data)  # type: ignore
+
+
+def to_rdkit_color(color: Optional[DatamolColor]) -> Optional[RDKitColor]:
+    """If required convert a datamol color (rgb, rgba or hex string) to an RDKit
+    color (rgb or rgba).
+    """
+    if isinstance(color, str):
+        return mcolors.to_rgba(color)  # type: ignore
+    else:
+        return color
diff --git a/tests/test_viz.py b/tests/test_viz.py
index ba031c45..70fabeb6 100644
--- a/tests/test_viz.py
+++ b/tests/test_viz.py
@@ -139,6 +139,23 @@ def test_circle_grid(tmp_path):
     )
 
 
+@pytest.mark.skipif(
+    not dm.is_greater_than_current_rdkit_version("2023.03"),
+    reason="Circle Grid requires rdkit>2022.09",
+)
+def test_circle_grid_with_hex_color(tmp_path):
+    mol = dm.to_mol("CC(=O)OC1=CC=CC=C1C(=O)O")
+    dm.viz.circle_grid(
+        mol,
+        [
+            [dm.to_mol("CCC"), dm.to_mol("CCCCCCC")],
+            [dm.to_mol("CCCO"), dm.to_mol("CCCCCCCO")],
+        ],
+        ring_color="#ff1472",
+        layout_random_seed=None,
+    )
+
+
 def test_to_image_align():
     # Get a list of molecules
     data = dm.data.freesolv()
diff --git a/tests/test_viz_lasso_highlight.py b/tests/test_viz_lasso_highlight.py
index cfb80cb8..542c9464 100644
--- a/tests/test_viz_lasso_highlight.py
+++ b/tests/test_viz_lasso_highlight.py
@@ -192,3 +192,12 @@ def test_atom_indices_list():
         search_molecules=None,
         atom_indices=[4, 5, 6],
     )
+
+
+def test_with_hex_color():
+    dm.viz.lasso_highlight_image(
+        "CC(N)Cc1c[nH]c2ccc3c(c12)CCCO3",
+        search_molecules=None,
+        atom_indices=[4, 5, 6],
+        color_list=["#ff1472"],
+    )

From dcb4614f519bc75dd6be1b529357819b0160ca43 Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 09:41:08 -0400
Subject: [PATCH 4/8] typing

---
 datamol/viz/_circle_grid.py | 2 ++
 1 file changed, 2 insertions(+)

diff --git a/datamol/viz/_circle_grid.py b/datamol/viz/_circle_grid.py
index 1deccbf4..b5bd4fdc 100644
--- a/datamol/viz/_circle_grid.py
+++ b/datamol/viz/_circle_grid.py
@@ -36,6 +36,7 @@ def circle_grid(
     ring_mol_highlight_atoms: Optional[List[List[int]]] = None,
     ring_mol_highlight_bonds: Optional[List[List[int]]] = None,
     outfile: Optional[str] = None,
+    kekulize: bool = True,
     layout_random_seed: Optional[int] = 19,
     **kwargs: Any,
 ):
@@ -81,6 +82,7 @@ def circle_grid(
         center_mol_highlight_bonds=center_mol_highlight_bonds,
         ring_mol_highlight_atoms=ring_mol_highlight_atoms,
         ring_mol_highlight_bonds=ring_mol_highlight_bonds,
+        kekulize=kekulize,
         layout_random_seed=layout_random_seed,
         **kwargs,
     )

From 72ea3fc654d408dd8fce5fb3a7043c65f5138fbd Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 09:57:33 -0400
Subject: [PATCH 5/8] add ring_mol_start_angles_degrees

---
 datamol/viz/_circle_grid.py | 15 ++++++++++++++-
 tests/test_viz.py           | 21 +++++++++++++++++++++
 2 files changed, 35 insertions(+), 1 deletion(-)

diff --git a/datamol/viz/_circle_grid.py b/datamol/viz/_circle_grid.py
index b5bd4fdc..2d4c29b0 100644
--- a/datamol/viz/_circle_grid.py
+++ b/datamol/viz/_circle_grid.py
@@ -31,6 +31,7 @@ def circle_grid(
     align: Optional[Union[Mol, str, bool]] = None,
     use_svg: bool = True,
     ring_color: Optional[DatamolColor] = None,
+    ring_mol_start_angles_degrees: Optional[List[float]] = None,
     center_mol_highlight_atoms: Optional[List[int]] = None,
     center_mol_highlight_bonds: Optional[List[int]] = None,
     ring_mol_highlight_atoms: Optional[List[List[int]]] = None,
@@ -59,6 +60,8 @@ def circle_grid(
         ring_mol_highlight_atoms: List of list of atom indices to highlight for molecules at each level of the concentric rings
         ring_mol_highlight_bonds: List of list of bond indices to highlight for molecules at each level of the concentric rings
         ring_color: Color of the concentric rings. Set to None to not draw any ring.
+        ring_mol_start_angles_degrees: List of angles in degrees to start drawing the molecules at each level of the concentric
+            rings. If None then a random position will be used.
         kekulize: Whether to kekulize the molecules before drawing.
         layout_random_seed: Random seed for the layout of the molecules. Set to None for no seed.
         outfile: Optional path to the save the output file.
@@ -78,6 +81,7 @@ def circle_grid(
         align=align,
         use_svg=use_svg,
         ring_color=ring_color,
+        ring_mol_start_angles_degrees=ring_mol_start_angles_degrees,
         center_mol_highlight_atoms=center_mol_highlight_atoms,
         center_mol_highlight_bonds=center_mol_highlight_bonds,
         ring_mol_highlight_atoms=ring_mol_highlight_atoms,
@@ -102,6 +106,7 @@ def __init__(
         use_svg: bool = True,
         line_width: Optional[float] = None,
         ring_color: Optional[DatamolColor] = None,
+        ring_mol_start_angles_degrees: Optional[List[float]] = None,
         center_mol_highlight_atoms: Optional[List[int]] = None,
         center_mol_highlight_bonds: Optional[List[int]] = None,
         ring_mol_highlight_atoms: Optional[List[List[int]]] = None,
@@ -131,6 +136,8 @@ def __init__(
             ring_mol_highlight_atoms: List of list of atom indices to highlight for molecules at each level of the concentric rings
             ring_mol_highlight_bonds: List of list of bond indices to highlight for molecules at each level of the concentric rings
             ring_color: Color of the concentric rings. Set to None to not draw any ring.
+            ring_mol_start_angles_degrees: List of angles in degrees to start drawing the molecules at each level of the concentric
+                rings. If None then a random position will be used.
             kekulize: Whether to kekulize the molecules before drawing.
             layout_random_seed: Random seed for the layout of the molecules. Set to None for no seed.
             **kwargs: Additional arguments to pass to the drawing function. See RDKit
@@ -152,6 +159,7 @@ def __init__(
         self.use_svg = use_svg
         self.line_width = line_width
         self.ring_color = ring_color
+        self.ring_mol_start_angles_degrees= ring_mol_start_angles_degrees
         self.ring_color_rdkit: Optional[RDKitColor] = to_rdkit_color(ring_color)
         self.ring_mol_highlight_atoms = ring_mol_highlight_atoms
         self.ring_mol_highlight_bonds = ring_mol_highlight_bonds
@@ -297,7 +305,12 @@ def draw(self):
         for i, mols in enumerate(self.ring_mols):
             radius = radius_list[i]
             ni = len(mols)
-            rand_unit = rng.random() * 2 * math.pi
+
+            if self.ring_mol_start_angles_degrees is not None:
+                rand_unit = self.ring_mol_start_angles_degrees[i]
+            else:
+                rand_unit = rng.random() * 2 * math.pi
+
             for k, mol in enumerate(mols):
                 center_x = radius * math.cos(2 * k * math.pi / ni + rand_unit) + self.midpoint.x
                 center_y = radius * math.sin(2 * k * math.pi / ni + rand_unit) + self.midpoint.y
diff --git a/tests/test_viz.py b/tests/test_viz.py
index 70fabeb6..10f87d76 100644
--- a/tests/test_viz.py
+++ b/tests/test_viz.py
@@ -156,6 +156,27 @@ def test_circle_grid_with_hex_color(tmp_path):
     )
 
 
+@pytest.mark.skipif(
+    not dm.is_greater_than_current_rdkit_version("2023.03"),
+    reason="Circle Grid requires rdkit>2022.09",
+)
+def test_circle_grid_with_angle_start(tmp_path):
+    mol = dm.to_mol("CC(=O)OC1=CC=CC=C1C(=O)O")
+    dm.viz.circle_grid(
+        mol,
+        [
+            [dm.to_mol("CCC"), dm.to_mol("CCCCCCC"), dm.to_mol("CCCCCO")],
+            [
+                dm.to_mol("CCCO"),
+            ],
+        ],
+        # ring_color=(0, 0, 0, 0.5),
+        ring_color="#ff1472aa",
+        layout_random_seed=19,
+        ring_mol_start_angles_degrees=[90, 90],
+    )
+
+
 def test_to_image_align():
     # Get a list of molecules
     data = dm.data.freesolv()

From 83e5e6d3051608a3d7c29f4e467e9342a25a795b Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 09:58:51 -0400
Subject: [PATCH 6/8] format

---
 datamol/viz/_circle_grid.py | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/datamol/viz/_circle_grid.py b/datamol/viz/_circle_grid.py
index 2d4c29b0..b59a4269 100644
--- a/datamol/viz/_circle_grid.py
+++ b/datamol/viz/_circle_grid.py
@@ -159,7 +159,7 @@ def __init__(
         self.use_svg = use_svg
         self.line_width = line_width
         self.ring_color = ring_color
-        self.ring_mol_start_angles_degrees= ring_mol_start_angles_degrees
+        self.ring_mol_start_angles_degrees = ring_mol_start_angles_degrees
         self.ring_color_rdkit: Optional[RDKitColor] = to_rdkit_color(ring_color)
         self.ring_mol_highlight_atoms = ring_mol_highlight_atoms
         self.ring_mol_highlight_bonds = ring_mol_highlight_bonds

From 1e1b90ad71226552d469faabe4258b6ad92970ef Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 10:08:13 -0400
Subject: [PATCH 7/8] deg to radian in circle grid

---
 datamol/viz/_circle_grid.py | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/datamol/viz/_circle_grid.py b/datamol/viz/_circle_grid.py
index b59a4269..d25eab93 100644
--- a/datamol/viz/_circle_grid.py
+++ b/datamol/viz/_circle_grid.py
@@ -307,7 +307,7 @@ def draw(self):
             ni = len(mols)
 
             if self.ring_mol_start_angles_degrees is not None:
-                rand_unit = self.ring_mol_start_angles_degrees[i]
+                rand_unit = np.deg2rad(self.ring_mol_start_angles_degrees[i])
             else:
                 rand_unit = rng.random() * 2 * math.pi
 

From e01067a629b021d1bb6ae69f8112af437004cd2a Mon Sep 17 00:00:00 2001
From: Hadrien Mary <hadrien.mary@gmail.com>
Date: Thu, 22 Jun 2023 11:32:33 -0400
Subject: [PATCH 8/8] docstring for the win

---
 datamol/viz/utils.py | 6 ++++--
 1 file changed, 4 insertions(+), 2 deletions(-)

diff --git a/datamol/viz/utils.py b/datamol/viz/utils.py
index 37401d13..bed1d922 100644
--- a/datamol/viz/utils.py
+++ b/datamol/viz/utils.py
@@ -137,8 +137,10 @@ def image_to_file(
 def to_rdkit_color(color: Optional[DatamolColor]) -> Optional[RDKitColor]:
     """If required convert a datamol color (rgb, rgba or hex string) to an RDKit
     color (rgb or rgba).
+
+    Args:
+        color: A datamol color: hex, rgb, rgba or None.
     """
     if isinstance(color, str):
         return mcolors.to_rgba(color)  # type: ignore
-    else:
-        return color
+    return color