diff --git a/.github/workflows/trigger-loadtest.yml b/.github/workflows/trigger-loadtest.yml index 9321af2..7211375 100644 --- a/.github/workflows/trigger-loadtest.yml +++ b/.github/workflows/trigger-loadtest.yml @@ -8,7 +8,7 @@ on: description: "Branch to take test code and helm/cron setup from" required: false type: string - default: "main" + default: main branch_img: description: "Branch to take Dockerfile/img from" required: false diff --git a/README.md b/README.md index af67cff..753f5a2 100644 --- a/README.md +++ b/README.md @@ -8,7 +8,9 @@ Go to Actions > Trigger Loadtest > Run workflow. In the dialog enter the following and replace the UPPERCASE words in the right column with the appropriate values (see explanation below). -| Use workflow from | DBP-1012-setup-loadtest-env | +| Field | Value | +| --- | --- | +| Use workflow from | main | | Branch to take tests and helm/cron setup from | main | | sets PATTERN env var used as k6 input | PATTERN | | sets CONFIG env var used as k6 input | CONFIG | @@ -17,10 +19,52 @@ In the dialog enter the following and replace the UPPERCASE words in the right c ### Values explained +| Value | Description | +| --- | --- | | PATTERN | a glob that matches a file in `loadtest/usecases`, i.e. `1` or `login` | -| CONFIG | one of spike, stress, breakpoint, debug; see `loadtest/util/config.ts` | +| CONFIG | one of spike, stress, breakpoint, debug, plateau; see `loadtest/util/config.ts` | | SCENARIO | target environment; one of dev-scenario, staging-scenario, prod-scenario; see `charts/schulportal-load-tests/values.yaml` | +### Notes +#### Adding different load patterns +In `loadtest/util/config.ts` define an entry in the enum, extend the function that converts strings into enum values and add your desired configs. + +```typescript +export enum CONFIG { + YOURCONFIG = "yourconfig", + // ... +} +export function getConfig(): CONFIG { + const config = __ENV["CONFIG"]; + if (config == CONFIG.YOURCONFIG.toString()) return CONFIG.YOURCONFIG; + // ... +} + +export function getDefaultOptions() { + const config = getConfig(); + const maxVUs = MAX_VUS ?? 10; + switch (config) { + case CONFIG.YOURCONFIG: + return { + stages: [ + { duration: "30s", target: maxVUs }, // ramp up to maxVUs + { duration: "30s", target: maxVUs }, // hold + { duration: "10s", target: 0 }, // ramp down + ], + // OPTIONAL: conditions to stop the test early + thresholds: { + http_req_failed: [{ threshold: "rate<0.10", abortOnFail: true }], + http_req_duration: [{ threshold: "p(95)<5000", abortOnFail: true }], + }, + }; + // ... + } +} +``` + +#### Running against different environments +In `charts/schulportal-load-tests/values.yaml` define a scenario with your desired base-url. + ## Local ### Setup @@ -45,6 +89,7 @@ Tests are categorized as spike stress breakpoint +plateau ``` To run all usecases with the stress-configuration against `https://example.env/`: diff --git a/loadtest/api-client/generated/AuthApi.md b/loadtest/api-client/generated/AuthApi.md index 45426b7..b563496 100644 --- a/loadtest/api-client/generated/AuthApi.md +++ b/loadtest/api-client/generated/AuthApi.md @@ -1,24 +1,22 @@ # .AuthApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**authenticationControllerInfo**](AuthApi.md#authenticationControllerInfo) | **GET** /api/auth/logininfo | Info about logged in user. -[**authenticationControllerLogin**](AuthApi.md#authenticationControllerLogin) | **GET** /api/auth/login | Used to start OIDC authentication. -[**authenticationControllerLogout**](AuthApi.md#authenticationControllerLogout) | **GET** /api/auth/logout | Used to log out the current user. -[**authenticationControllerResetPassword**](AuthApi.md#authenticationControllerResetPassword) | **GET** /api/auth/reset-password | Redirect to Keycloak password reset. +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| --------------------------------------------------------------------------------------------- | -------------------------------- | ------------------------------------ | +| [**authenticationControllerInfo**](AuthApi.md#authenticationControllerInfo) | **GET** /api/auth/logininfo | Info about logged in user. | +| [**authenticationControllerLogin**](AuthApi.md#authenticationControllerLogin) | **GET** /api/auth/login | Used to start OIDC authentication. | +| [**authenticationControllerLogout**](AuthApi.md#authenticationControllerLogout) | **GET** /api/auth/logout | Used to log out the current user. | +| [**authenticationControllerResetPassword**](AuthApi.md#authenticationControllerResetPassword) | **GET** /api/auth/reset-password | Redirect to Keycloak password reset. | # **authenticationControllerInfo** -> UserinfoResponse authenticationControllerInfo() +> UserinfoResponse authenticationControllerInfo() ### Example - ```typescript -import { createConfiguration, AuthApi } from ''; +import { createConfiguration, AuthApi } from ""; const configuration = createConfiguration(); const apiInstance = new AuthApi(configuration); @@ -26,13 +24,12 @@ const apiInstance = new AuthApi(configuration); const request = {}; const data = await apiInstance.authenticationControllerInfo(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -44,48 +41,44 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Returns info about the logged in user. | - | -**401** | User is not logged in. | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------- | ---------------- | +| **200** | Returns info about the logged in user. | - | +| **401** | User is not logged in. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **authenticationControllerLogin** -> authenticationControllerLogin() +> authenticationControllerLogin() ### Example - ```typescript -import { createConfiguration, AuthApi } from ''; -import type { AuthApiAuthenticationControllerLoginRequest } from ''; +import { createConfiguration, AuthApi } from ""; +import type { AuthApiAuthenticationControllerLoginRequest } from ""; const configuration = createConfiguration(); const apiInstance = new AuthApi(configuration); const request: AuthApiAuthenticationControllerLoginRequest = { - redirectUrl: "redirectUrl_example", }; const data = await apiInstance.authenticationControllerLogin(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **redirectUrl** | [**string**] | | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| --------------- | ------------ | ----------- | -------------------------------- | +| **redirectUrl** | [**string**] | | (optional) defaults to undefined | ### Return type @@ -97,26 +90,25 @@ No authorization required ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**302** | Redirection to orchestrate OIDC flow. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------- | ---------------- | +| **302** | Redirection to orchestrate OIDC flow. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **authenticationControllerLogout** -> authenticationControllerLogout() +> authenticationControllerLogout() ### Example - ```typescript -import { createConfiguration, AuthApi } from ''; +import { createConfiguration, AuthApi } from ""; const configuration = createConfiguration(); const apiInstance = new AuthApi(configuration); @@ -124,13 +116,12 @@ const apiInstance = new AuthApi(configuration); const request = {}; const data = await apiInstance.authenticationControllerLogout(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -142,51 +133,47 @@ void (empty response body) ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**302** | Redirect to logout. | - | -**500** | Internal server error while trying to log out. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **302** | Redirect to logout. | - | +| **500** | Internal server error while trying to log out. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **authenticationControllerResetPassword** -> authenticationControllerResetPassword() +> authenticationControllerResetPassword() ### Example - ```typescript -import { createConfiguration, AuthApi } from ''; -import type { AuthApiAuthenticationControllerResetPasswordRequest } from ''; +import { createConfiguration, AuthApi } from ""; +import type { AuthApiAuthenticationControllerResetPasswordRequest } from ""; const configuration = createConfiguration(); const apiInstance = new AuthApi(configuration); const request: AuthApiAuthenticationControllerResetPasswordRequest = { - redirectUrl: "redirectUrl_example", - + loginHint: "login_hint_example", }; const data = await apiInstance.authenticationControllerResetPassword(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **redirectUrl** | [**string**] | | defaults to undefined - **loginHint** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| --------------- | ------------ | ----------- | --------------------- | +| **redirectUrl** | [**string**] | | defaults to undefined | +| **loginHint** | [**string**] | | defaults to undefined | ### Return type @@ -198,15 +185,13 @@ No authorization required ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**302** | Redirect to Keycloak password reset page. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ----------------------------------------- | ---------------- | +| **302** | Redirect to Keycloak password reset page. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/Class2FAApi.md b/loadtest/api-client/generated/Class2FAApi.md index 9e5ec3d..42a1445 100644 --- a/loadtest/api-client/generated/Class2FAApi.md +++ b/loadtest/api-client/generated/Class2FAApi.md @@ -1,52 +1,51 @@ # .Class2FAApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**privacyIdeaAdministrationControllerAssignHardwareToken**](Class2FAApi.md#privacyIdeaAdministrationControllerAssignHardwareToken) | **POST** /api/2fa-token/assign/hardwareToken | -[**privacyIdeaAdministrationControllerGetTwoAuthState**](Class2FAApi.md#privacyIdeaAdministrationControllerGetTwoAuthState) | **GET** /api/2fa-token/state | -[**privacyIdeaAdministrationControllerInitializeSoftwareToken**](Class2FAApi.md#privacyIdeaAdministrationControllerInitializeSoftwareToken) | **POST** /api/2fa-token/init | -[**privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication**](Class2FAApi.md#privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication) | **GET** /api/2fa-token/required | -[**privacyIdeaAdministrationControllerResetToken**](Class2FAApi.md#privacyIdeaAdministrationControllerResetToken) | **PUT** /api/2fa-token/reset | -[**privacyIdeaAdministrationControllerVerifyToken**](Class2FAApi.md#privacyIdeaAdministrationControllerVerifyToken) | **POST** /api/2fa-token/verify | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ----------------------------------------------------------------------------------------------------------------------------------------------------------- | -------------------------------------------- | ----------- | +| [**privacyIdeaAdministrationControllerAssignHardwareToken**](Class2FAApi.md#privacyIdeaAdministrationControllerAssignHardwareToken) | **POST** /api/2fa-token/assign/hardwareToken | +| [**privacyIdeaAdministrationControllerGetTwoAuthState**](Class2FAApi.md#privacyIdeaAdministrationControllerGetTwoAuthState) | **GET** /api/2fa-token/state | +| [**privacyIdeaAdministrationControllerInitializeSoftwareToken**](Class2FAApi.md#privacyIdeaAdministrationControllerInitializeSoftwareToken) | **POST** /api/2fa-token/init | +| [**privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication**](Class2FAApi.md#privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication) | **GET** /api/2fa-token/required | +| [**privacyIdeaAdministrationControllerResetToken**](Class2FAApi.md#privacyIdeaAdministrationControllerResetToken) | **PUT** /api/2fa-token/reset | +| [**privacyIdeaAdministrationControllerVerifyToken**](Class2FAApi.md#privacyIdeaAdministrationControllerVerifyToken) | **POST** /api/2fa-token/verify | # **privacyIdeaAdministrationControllerAssignHardwareToken** -> AssignHardwareTokenResponse privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams) +> AssignHardwareTokenResponse privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams) ### Example - ```typescript -import { createConfiguration, Class2FAApi } from ''; -import type { Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest } from ''; +import { createConfiguration, Class2FAApi } from ""; +import type { Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new Class2FAApi(configuration); -const request: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest = { - - assignHardwareTokenBodyParams: { - serial: "serial_example", - otp: "otp_example", - referrer: "referrer_example", - userId: "userId_example", - }, -}; - -const data = await apiInstance.privacyIdeaAdministrationControllerAssignHardwareToken(request); -console.log('API called successfully. Returned data:', data); +const request: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest = + { + assignHardwareTokenBodyParams: { + serial: "serial_example", + otp: "otp_example", + referrer: "referrer_example", + userId: "userId_example", + }, + }; + +const data = + await apiInstance.privacyIdeaAdministrationControllerAssignHardwareToken( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **assignHardwareTokenBodyParams** | **AssignHardwareTokenBodyParams**| | - +| Name | Type | Description | Notes | +| --------------------------------- | --------------------------------- | ----------- | ----- | +| **assignHardwareTokenBodyParams** | **AssignHardwareTokenBodyParams** | | ### Return type @@ -58,52 +57,50 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The hardware token was successfully assigned. | - | -**400** | Not found. | - | -**401** | Not authorized to assign hardware token. | - | -**403** | Insufficient permissions to reset token. | - | -**404** | Insufficient permissions to assign hardware token. | - | -**500** | Internal server error while assigning a hardware token. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ---------------- | +| **201** | The hardware token was successfully assigned. | - | +| **400** | Not found. | - | +| **401** | Not authorized to assign hardware token. | - | +| **403** | Insufficient permissions to reset token. | - | +| **404** | Insufficient permissions to assign hardware token. | - | +| **500** | Internal server error while assigning a hardware token. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **privacyIdeaAdministrationControllerGetTwoAuthState** -> TokenStateResponse privacyIdeaAdministrationControllerGetTwoAuthState() +> TokenStateResponse privacyIdeaAdministrationControllerGetTwoAuthState() ### Example - ```typescript -import { createConfiguration, Class2FAApi } from ''; -import type { Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest } from ''; +import { createConfiguration, Class2FAApi } from ""; +import type { Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest } from ""; const configuration = createConfiguration(); const apiInstance = new Class2FAApi(configuration); -const request: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest = { - - personId: "personId_example", -}; +const request: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest = + { + personId: "personId_example", + }; -const data = await apiInstance.privacyIdeaAdministrationControllerGetTwoAuthState(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.privacyIdeaAdministrationControllerGetTwoAuthState(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------- | --------------------- | +| **personId** | [**string**] | | defaults to undefined | ### Return type @@ -115,54 +112,54 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The token state was successfully returned. | - | -**400** | A username was not given or not found. | - | -**401** | Not authorized to get token state. | - | -**403** | Insufficient permissions to get token state. | - | -**404** | Insufficient permissions to get token state. | - | -**500** | Internal server error while retrieving token state. | - | + +| Status code | Description | Response headers | +| ----------- | --------------------------------------------------- | ---------------- | +| **201** | The token state was successfully returned. | - | +| **400** | A username was not given or not found. | - | +| **401** | Not authorized to get token state. | - | +| **403** | Insufficient permissions to get token state. | - | +| **404** | Insufficient permissions to get token state. | - | +| **500** | Internal server error while retrieving token state. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **privacyIdeaAdministrationControllerInitializeSoftwareToken** -> string privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams) +> string privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams) ### Example - ```typescript -import { createConfiguration, Class2FAApi } from ''; -import type { Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest } from ''; +import { createConfiguration, Class2FAApi } from ""; +import type { Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new Class2FAApi(configuration); -const request: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest = { - - tokenInitBodyParams: { - personId: "personId_example", - }, -}; - -const data = await apiInstance.privacyIdeaAdministrationControllerInitializeSoftwareToken(request); -console.log('API called successfully. Returned data:', data); +const request: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest = + { + tokenInitBodyParams: { + personId: "personId_example", + }, + }; + +const data = + await apiInstance.privacyIdeaAdministrationControllerInitializeSoftwareToken( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **tokenInitBodyParams** | **TokenInitBodyParams**| | - +| Name | Type | Description | Notes | +| ----------------------- | ----------------------- | ----------- | ----- | +| **tokenInitBodyParams** | **TokenInitBodyParams** | | ### Return type @@ -174,52 +171,52 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The token was successfully created. | - | -**400** | A username was not given or not found. | - | -**401** | Not authorized to create token. | - | -**403** | Insufficient permissions to create token. | - | -**404** | Insufficient permissions to create token. | - | -**500** | Internal server error while creating a token. | - | + +| Status code | Description | Response headers | +| ----------- | --------------------------------------------- | ---------------- | +| **201** | The token was successfully created. | - | +| **400** | A username was not given or not found. | - | +| **401** | Not authorized to create token. | - | +| **403** | Insufficient permissions to create token. | - | +| **404** | Insufficient permissions to create token. | - | +| **500** | Internal server error while creating a token. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication** -> TokenRequiredResponse privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication() +> TokenRequiredResponse privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication() ### Example - ```typescript -import { createConfiguration, Class2FAApi } from ''; -import type { Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest } from ''; +import { createConfiguration, Class2FAApi } from ""; +import type { Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new Class2FAApi(configuration); -const request: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest = { - - personId: "personId_example", -}; +const request: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest = + { + personId: "personId_example", + }; -const data = await apiInstance.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------- | --------------------- | +| **personId** | [**string**] | | defaults to undefined | ### Return type @@ -231,52 +228,50 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The requirement was successfully returned. | - | -**400** | A username was not given or not found. | - | -**401** | Not authorized to get requirement information. | - | -**403** | Insufficient permissions to get requirement information. | - | -**404** | Insufficient permissions to get requirement information. | - | -**500** | Internal server error while getting requirement information. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------ | ---------------- | +| **200** | The requirement was successfully returned. | - | +| **400** | A username was not given or not found. | - | +| **401** | Not authorized to get requirement information. | - | +| **403** | Insufficient permissions to get requirement information. | - | +| **404** | Insufficient permissions to get requirement information. | - | +| **500** | Internal server error while getting requirement information. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **privacyIdeaAdministrationControllerResetToken** -> boolean privacyIdeaAdministrationControllerResetToken() +> boolean privacyIdeaAdministrationControllerResetToken() ### Example - ```typescript -import { createConfiguration, Class2FAApi } from ''; -import type { Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest } from ''; +import { createConfiguration, Class2FAApi } from ""; +import type { Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new Class2FAApi(configuration); -const request: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest = { - - personId: "personId_example", -}; +const request: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest = + { + personId: "personId_example", + }; -const data = await apiInstance.privacyIdeaAdministrationControllerResetToken(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.privacyIdeaAdministrationControllerResetToken(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------- | --------------------- | +| **personId** | [**string**] | | defaults to undefined | ### Return type @@ -288,55 +283,53 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The token was successfully reset. | - | -**400** | A username was not given or not found. | - | -**401** | Not authorized to reset token. | - | -**403** | Insufficient permissions to reset token. | - | -**404** | Insufficient permissions to reset token. | - | -**500** | Internal server error while reseting a token. | - | + +| Status code | Description | Response headers | +| ----------- | --------------------------------------------- | ---------------- | +| **201** | The token was successfully reset. | - | +| **400** | A username was not given or not found. | - | +| **401** | Not authorized to reset token. | - | +| **403** | Insufficient permissions to reset token. | - | +| **404** | Insufficient permissions to reset token. | - | +| **500** | Internal server error while reseting a token. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **privacyIdeaAdministrationControllerVerifyToken** -> void privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams) +> void privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams) ### Example - ```typescript -import { createConfiguration, Class2FAApi } from ''; -import type { Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest } from ''; +import { createConfiguration, Class2FAApi } from ""; +import type { Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new Class2FAApi(configuration); -const request: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest = { - - tokenVerifyBodyParams: { - personId: "personId_example", - otp: "otp_example", - }, -}; - -const data = await apiInstance.privacyIdeaAdministrationControllerVerifyToken(request); -console.log('API called successfully. Returned data:', data); +const request: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest = + { + tokenVerifyBodyParams: { + personId: "personId_example", + otp: "otp_example", + }, + }; + +const data = + await apiInstance.privacyIdeaAdministrationControllerVerifyToken(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **tokenVerifyBodyParams** | **TokenVerifyBodyParams**| | - +| Name | Type | Description | Notes | +| ------------------------- | ------------------------- | ----------- | ----- | +| **tokenVerifyBodyParams** | **TokenVerifyBodyParams** | | ### Return type @@ -348,20 +341,18 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: Not defined - +- **Content-Type**: application/json +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The token was successfully verified. | - | -**400** | A username was not given or not found. | - | -**401** | Not authorized to verify token. | - | -**403** | Insufficient permissions to verify token. | - | -**404** | Insufficient permissions to verify token. | - | -**500** | Internal server error while verifying a token. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **201** | The token was successfully verified. | - | +| **400** | A username was not given or not found. | - | +| **401** | Not authorized to verify token. | - | +| **403** | Insufficient permissions to verify token. | - | +| **404** | Insufficient permissions to verify token. | - | +| **500** | Internal server error while verifying a token. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/CronApi.md b/loadtest/api-client/generated/CronApi.md index 43fa0cb..74b830f 100644 --- a/loadtest/api-client/generated/CronApi.md +++ b/loadtest/api-client/generated/CronApi.md @@ -1,24 +1,22 @@ # .CronApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**cronControllerKoPersUserLock**](CronApi.md#cronControllerKoPersUserLock) | **PUT** /api/cron/kopers-lock | -[**cronControllerPersonWithoutOrgDelete**](CronApi.md#cronControllerPersonWithoutOrgDelete) | **PUT** /api/cron/person-without-org | -[**cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers**](CronApi.md#cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers) | **PUT** /api/cron/kontext-expired | -[**cronControllerUnlockUsersWithExpiredLocks**](CronApi.md#cronControllerUnlockUsersWithExpiredLocks) | **PUT** /api/cron/unlock | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ------------------------------------------------------------------------------------------------------------------------------------------------------- | ------------------------------------ | ----------- | +| [**cronControllerKoPersUserLock**](CronApi.md#cronControllerKoPersUserLock) | **PUT** /api/cron/kopers-lock | +| [**cronControllerPersonWithoutOrgDelete**](CronApi.md#cronControllerPersonWithoutOrgDelete) | **PUT** /api/cron/person-without-org | +| [**cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers**](CronApi.md#cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers) | **PUT** /api/cron/kontext-expired | +| [**cronControllerUnlockUsersWithExpiredLocks**](CronApi.md#cronControllerUnlockUsersWithExpiredLocks) | **PUT** /api/cron/unlock | # **cronControllerKoPersUserLock** -> boolean cronControllerKoPersUserLock() +> boolean cronControllerKoPersUserLock() ### Example - ```typescript -import { createConfiguration, CronApi } from ''; +import { createConfiguration, CronApi } from ""; const configuration = createConfiguration(); const apiInstance = new CronApi(configuration); @@ -26,13 +24,12 @@ const apiInstance = new CronApi(configuration); const request = {}; const data = await apiInstance.cronControllerKoPersUserLock(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -44,31 +41,30 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | User were successfully locked. | - | -**400** | User are not given or not found | - | -**401** | Not authorized to lock user. | - | -**403** | Insufficient permissions to lock user. | - | -**404** | Insufficient permissions to lock user. | - | -**500** | Internal server error while trying to lock user. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------ | ---------------- | +| **201** | User were successfully locked. | - | +| **400** | User are not given or not found | - | +| **401** | Not authorized to lock user. | - | +| **403** | Insufficient permissions to lock user. | - | +| **404** | Insufficient permissions to lock user. | - | +| **500** | Internal server error while trying to lock user. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **cronControllerPersonWithoutOrgDelete** -> boolean cronControllerPersonWithoutOrgDelete() +> boolean cronControllerPersonWithoutOrgDelete() ### Example - ```typescript -import { createConfiguration, CronApi } from ''; +import { createConfiguration, CronApi } from ""; const configuration = createConfiguration(); const apiInstance = new CronApi(configuration); @@ -76,13 +72,12 @@ const apiInstance = new CronApi(configuration); const request = {}; const data = await apiInstance.cronControllerPersonWithoutOrgDelete(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -94,45 +89,46 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | User were successfully removed. | - | -**400** | User are not given or not found | - | -**401** | Not authorized to remove user. | - | -**403** | Insufficient permissions to delete user. | - | -**404** | Insufficient permissions to delete user. | - | -**500** | Internal server error while trying to remove user. | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------- | ---------------- | +| **201** | User were successfully removed. | - | +| **400** | User are not given or not found | - | +| **401** | Not authorized to remove user. | - | +| **403** | Insufficient permissions to delete user. | - | +| **404** | Insufficient permissions to delete user. | - | +| **500** | Internal server error while trying to remove user. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers** -> boolean cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers() +> boolean cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers() ### Example - ```typescript -import { createConfiguration, CronApi } from ''; +import { createConfiguration, CronApi } from ""; const configuration = createConfiguration(); const apiInstance = new CronApi(configuration); const request = {}; -const data = await apiInstance.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -144,45 +140,44 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | Personenkontexte were successfully removed from users. | - | -**400** | Personenkontexte are not given or not found. | - | -**401** | Not authorized to remove personenkontexte from users. | - | -**403** | Insufficient permissions to remove personenkontexte from users. | - | -**404** | Insufficient permissions to remove personenkontexte from users. | - | -**500** | Internal server error while trying to remove personenkontexte from users. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------------------- | ---------------- | +| **201** | Personenkontexte were successfully removed from users. | - | +| **400** | Personenkontexte are not given or not found. | - | +| **401** | Not authorized to remove personenkontexte from users. | - | +| **403** | Insufficient permissions to remove personenkontexte from users. | - | +| **404** | Insufficient permissions to remove personenkontexte from users. | - | +| **500** | Internal server error while trying to remove personenkontexte from users. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **cronControllerUnlockUsersWithExpiredLocks** -> boolean cronControllerUnlockUsersWithExpiredLocks() +> boolean cronControllerUnlockUsersWithExpiredLocks() ### Example - ```typescript -import { createConfiguration, CronApi } from ''; +import { createConfiguration, CronApi } from ""; const configuration = createConfiguration(); const apiInstance = new CronApi(configuration); const request = {}; -const data = await apiInstance.cronControllerUnlockUsersWithExpiredLocks(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.cronControllerUnlockUsersWithExpiredLocks(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -194,19 +189,17 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The users were successfully unlocked. | - | -**401** | Not authorized to unlock users. | - | -**403** | Insufficient permissions to unlock users. | - | -**404** | Insufficient permissions to unlock users. | - | -**500** | Internal server error while trying to unlock users. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | --------------------------------------------------- | ---------------- | +| **200** | The users were successfully unlocked. | - | +| **401** | Not authorized to unlock users. | - | +| **403** | Insufficient permissions to unlock users. | - | +| **404** | Insufficient permissions to unlock users. | - | +| **500** | Internal server error while trying to unlock users. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/DbiamPersonenkontexteApi.md b/loadtest/api-client/generated/DbiamPersonenkontexteApi.md index 34f9cfb..fb152c8 100644 --- a/loadtest/api-client/generated/DbiamPersonenkontexteApi.md +++ b/loadtest/api-client/generated/DbiamPersonenkontexteApi.md @@ -1,51 +1,50 @@ # .DbiamPersonenkontexteApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**dBiamPersonenkontextControllerCreatePersonenkontextMigration**](DbiamPersonenkontexteApi.md#dBiamPersonenkontextControllerCreatePersonenkontextMigration) | **POST** /api/dbiam/personenkontext | -[**dBiamPersonenkontextControllerFindPersonenkontextsByPerson**](DbiamPersonenkontexteApi.md#dBiamPersonenkontextControllerFindPersonenkontextsByPerson) | **GET** /api/dbiam/personenkontext/{personId} | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ------------------------------------------------------------------------------------------------------------------------------------------------------------ | --------------------------------------------- | ----------- | +| [**dBiamPersonenkontextControllerCreatePersonenkontextMigration**](DbiamPersonenkontexteApi.md#dBiamPersonenkontextControllerCreatePersonenkontextMigration) | **POST** /api/dbiam/personenkontext | +| [**dBiamPersonenkontextControllerFindPersonenkontextsByPerson**](DbiamPersonenkontexteApi.md#dBiamPersonenkontextControllerFindPersonenkontextsByPerson) | **GET** /api/dbiam/personenkontext/{personId} | # **dBiamPersonenkontextControllerCreatePersonenkontextMigration** -> DBiamPersonenkontextResponse dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams) +> DBiamPersonenkontextResponse dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams) ### Example - ```typescript -import { createConfiguration, DbiamPersonenkontexteApi } from ''; -import type { DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest } from ''; +import { createConfiguration, DbiamPersonenkontexteApi } from ""; +import type { DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new DbiamPersonenkontexteApi(configuration); -const request: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest = { - - dbiamPersonenkontextMigrationBodyParams: { - personId: "personId_example", - username: "username_example", - organisationId: "organisationId_example", - rolleId: "rolleId_example", - befristung: new Date('1970-01-01T00:00:00.00Z'), - email: "email_example", - migrationRunType: "ITSLEARNING", - }, -}; - -const data = await apiInstance.dBiamPersonenkontextControllerCreatePersonenkontextMigration(request); -console.log('API called successfully. Returned data:', data); +const request: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest = + { + dbiamPersonenkontextMigrationBodyParams: { + personId: "personId_example", + username: "username_example", + organisationId: "organisationId_example", + rolleId: "rolleId_example", + befristung: new Date("1970-01-01T00:00:00.00Z"), + email: "email_example", + migrationRunType: "ITSLEARNING", + }, + }; + +const data = + await apiInstance.dBiamPersonenkontextControllerCreatePersonenkontextMigration( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **dbiamPersonenkontextMigrationBodyParams** | **DbiamPersonenkontextMigrationBodyParams**| | - +| Name | Type | Description | Notes | +| ------------------------------------------- | ------------------------------------------- | ----------- | ----- | +| **dbiamPersonenkontextMigrationBodyParams** | **DbiamPersonenkontextMigrationBodyParams** | | ### Return type @@ -57,51 +56,52 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | Personenkontext was successfully created. | - | -**400** | The personenkontext could not be created, may due to unsatisfied specifications. | - | -**401** | Not authorized to create personenkontext. | - | -**403** | Insufficient permission to create personenkontext. | - | -**500** | Internal server error while creating personenkontext. | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------------------------- | ---------------- | +| **201** | Personenkontext was successfully created. | - | +| **400** | The personenkontext could not be created, may due to unsatisfied specifications. | - | +| **401** | Not authorized to create personenkontext. | - | +| **403** | Insufficient permission to create personenkontext. | - | +| **500** | Internal server error while creating personenkontext. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **dBiamPersonenkontextControllerFindPersonenkontextsByPerson** -> Array dBiamPersonenkontextControllerFindPersonenkontextsByPerson() +> Array dBiamPersonenkontextControllerFindPersonenkontextsByPerson() ### Example - ```typescript -import { createConfiguration, DbiamPersonenkontexteApi } from ''; -import type { DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest } from ''; +import { createConfiguration, DbiamPersonenkontexteApi } from ""; +import type { DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest } from ""; const configuration = createConfiguration(); const apiInstance = new DbiamPersonenkontexteApi(configuration); -const request: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest = { +const request: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest = + { // The ID for the person. - personId: "personId_example", -}; + personId: "personId_example", + }; -const data = await apiInstance.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The ID for the person. | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ---------------------- | --------------------- | +| **personId** | [**string**] | The ID for the person. | defaults to undefined | ### Return type @@ -113,18 +113,16 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenkontexte were successfully returned. | - | -**401** | Not authorized to get available personenkontexte. | - | -**403** | Insufficient permission to get personenkontexte for this user. | - | -**500** | Internal server error while getting personenkontexte. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------- | ---------------- | +| **200** | The personenkontexte were successfully returned. | - | +| **401** | Not authorized to get available personenkontexte. | - | +| **403** | Insufficient permission to get personenkontexte for this user. | - | +| **500** | Internal server error while getting personenkontexte. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md b/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md index a082f5f..8516526 100644 --- a/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md +++ b/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md @@ -1,47 +1,44 @@ # .DbiamPersonenuebersichtApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**dBiamPersonenuebersichtControllerFindPersonenuebersichten**](DbiamPersonenuebersichtApi.md#dBiamPersonenuebersichtControllerFindPersonenuebersichten) | **POST** /api/dbiam/personenuebersicht | -[**dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson**](DbiamPersonenuebersichtApi.md#dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson) | **GET** /api/dbiam/personenuebersicht/{personId} | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ------------------------------------------------------------------------------------------------------------------------------------------------------------------------ | ------------------------------------------------ | ----------- | +| [**dBiamPersonenuebersichtControllerFindPersonenuebersichten**](DbiamPersonenuebersichtApi.md#dBiamPersonenuebersichtControllerFindPersonenuebersichten) | **POST** /api/dbiam/personenuebersicht | +| [**dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson**](DbiamPersonenuebersichtApi.md#dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson) | **GET** /api/dbiam/personenuebersicht/{personId} | # **dBiamPersonenuebersichtControllerFindPersonenuebersichten** -> DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams) +> DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams) ### Example - ```typescript -import { createConfiguration, DbiamPersonenuebersichtApi } from ''; -import type { DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest } from ''; +import { createConfiguration, DbiamPersonenuebersichtApi } from ""; +import type { DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new DbiamPersonenuebersichtApi(configuration); -const request: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest = { - - personenuebersichtBodyParams: { - personIds: [ - "personIds_example", - ], - }, -}; - -const data = await apiInstance.dBiamPersonenuebersichtControllerFindPersonenuebersichten(request); -console.log('API called successfully. Returned data:', data); +const request: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest = + { + personenuebersichtBodyParams: { + personIds: ["personIds_example"], + }, + }; + +const data = + await apiInstance.dBiamPersonenuebersichtControllerFindPersonenuebersichten( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personenuebersichtBodyParams** | **PersonenuebersichtBodyParams**| | - +| Name | Type | Description | Notes | +| -------------------------------- | -------------------------------- | ----------- | ----- | +| **personenuebersichtBodyParams** | **PersonenuebersichtBodyParams** | | ### Return type @@ -53,50 +50,51 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenuebersichten were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get personenuebersichten. | - | -**403** | Insufficient permission to get personenuebersichten. | - | -**500** | Internal server error while getting personenuebersichten. | - | + +| Status code | Description | Response headers | +| ----------- | --------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The personenuebersichten were successfully returned. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get personenuebersichten. | - | +| **403** | Insufficient permission to get personenuebersichten. | - | +| **500** | Internal server error while getting personenuebersichten. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson** -> DBiamPersonenuebersichtResponse dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson() +> DBiamPersonenuebersichtResponse dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson() ### Example - ```typescript -import { createConfiguration, DbiamPersonenuebersichtApi } from ''; -import type { DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest } from ''; +import { createConfiguration, DbiamPersonenuebersichtApi } from ""; +import type { DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest } from ""; const configuration = createConfiguration(); const apiInstance = new DbiamPersonenuebersichtApi(configuration); -const request: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest = { +const request: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest = + { // The ID for the person. - personId: "personId_example", -}; - -const data = await apiInstance.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(request); -console.log('API called successfully. Returned data:', data); + personId: "personId_example", + }; + +const data = + await apiInstance.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The ID for the person. | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ---------------------- | --------------------- | +| **personId** | [**string**] | The ID for the person. | defaults to undefined | ### Return type @@ -108,18 +106,16 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenuebersichten were successfully returned. | - | -**401** | Not authorized to get personenuebersicht. | - | -**403** | Insufficient permission to get personenuebersicht. | - | -**500** | Internal server error while getting personenuebersicht. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ---------------- | +| **200** | The personenuebersichten were successfully returned. | - | +| **401** | Not authorized to get personenuebersicht. | - | +| **403** | Insufficient permission to get personenuebersicht. | - | +| **500** | Internal server error while getting personenuebersicht. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/ImportApi.md b/loadtest/api-client/generated/ImportApi.md index 79b7e13..96cb138 100644 --- a/loadtest/api-client/generated/ImportApi.md +++ b/loadtest/api-client/generated/ImportApi.md @@ -1,45 +1,42 @@ # .ImportApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**importControllerDeleteImportTransaction**](ImportApi.md#importControllerDeleteImportTransaction) | **DELETE** /api/import/{importvorgangId} | -[**importControllerExecuteImport**](ImportApi.md#importControllerExecuteImport) | **POST** /api/import/execute | -[**importControllerUploadFile**](ImportApi.md#importControllerUploadFile) | **POST** /api/import/upload | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| --------------------------------------------------------------------------------------------------- | ---------------------------------------- | ----------- | +| [**importControllerDeleteImportTransaction**](ImportApi.md#importControllerDeleteImportTransaction) | **DELETE** /api/import/{importvorgangId} | +| [**importControllerExecuteImport**](ImportApi.md#importControllerExecuteImport) | **POST** /api/import/execute | +| [**importControllerUploadFile**](ImportApi.md#importControllerUploadFile) | **POST** /api/import/upload | # **importControllerDeleteImportTransaction** + > void importControllerDeleteImportTransaction() Delete a role by id. ### Example - ```typescript -import { createConfiguration, ImportApi } from ''; -import type { ImportApiImportControllerDeleteImportTransactionRequest } from ''; +import { createConfiguration, ImportApi } from ""; +import type { ImportApiImportControllerDeleteImportTransactionRequest } from ""; const configuration = createConfiguration(); const apiInstance = new ImportApi(configuration); const request: ImportApiImportControllerDeleteImportTransactionRequest = { - // The id of an import transaction + // The id of an import transaction importvorgangId: "importvorgangId_example", }; const data = await apiInstance.importControllerDeleteImportTransaction(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **importvorgangId** | [**string**] | The id of an import transaction | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------- | ------------ | ------------------------------- | --------------------- | +| **importvorgangId** | [**string**] | The id of an import transaction | defaults to undefined | ### Return type @@ -51,36 +48,34 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**204** | Import transaction was deleted successfully. | - | -**400** | Something went wrong with the found import transaction. | - | -**401** | Not authorized to delete the import transaction. | - | -**404** | The import transaction that should be deleted does not exist. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------- | ---------------- | +| **204** | Import transaction was deleted successfully. | - | +| **400** | Something went wrong with the found import transaction. | - | +| **401** | Not authorized to delete the import transaction. | - | +| **404** | The import transaction that should be deleted does not exist. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **importControllerExecuteImport** -> HttpFile importControllerExecuteImport(importvorgangByIdBodyParams) +> HttpFile importControllerExecuteImport(importvorgangByIdBodyParams) ### Example - ```typescript -import { createConfiguration, ImportApi } from ''; -import type { ImportApiImportControllerExecuteImportRequest } from ''; +import { createConfiguration, ImportApi } from ""; +import type { ImportApiImportControllerExecuteImportRequest } from ""; const configuration = createConfiguration(); const apiInstance = new ImportApi(configuration); const request: ImportApiImportControllerExecuteImportRequest = { - importvorgangByIdBodyParams: { importvorgangId: "importvorgangId_example", organisationId: "organisationId_example", @@ -89,16 +84,14 @@ const request: ImportApiImportControllerExecuteImportRequest = { }; const data = await apiInstance.importControllerExecuteImport(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **importvorgangByIdBodyParams** | **ImportvorgangByIdBodyParams**| | - +| Name | Type | Description | Notes | +| ------------------------------- | ------------------------------- | ----------- | ----- | +| **importvorgangByIdBodyParams** | **ImportvorgangByIdBodyParams** | | ### Return type @@ -110,58 +103,57 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: text/plain - +- **Content-Type**: application/json +- **Accept**: text/plain ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Import transaction was executed successfully. The text file can be downloaded | - | -**400** | Something went wrong with the found import transaction. | - | -**401** | Not authorized to execute the import transaction. | - | -**403** | Insufficient permissions to execute the import transaction. | - | -**404** | The import transaction does not exist. | - | -**500** | Internal server error while executing the import transaction. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------------------------------- | ---------------- | +| **200** | Import transaction was executed successfully. The text file can be downloaded | - | +| **400** | Something went wrong with the found import transaction. | - | +| **401** | Not authorized to execute the import transaction. | - | +| **403** | Insufficient permissions to execute the import transaction. | - | +| **404** | The import transaction does not exist. | - | +| **500** | Internal server error while executing the import transaction. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **importControllerUploadFile** -> ImportUploadResponse importControllerUploadFile() +> ImportUploadResponse importControllerUploadFile() ### Example - ```typescript -import { createConfiguration, ImportApi } from ''; -import type { ImportApiImportControllerUploadFileRequest } from ''; +import { createConfiguration, ImportApi } from ""; +import type { ImportApiImportControllerUploadFileRequest } from ""; const configuration = createConfiguration(); const apiInstance = new ImportApi(configuration); const request: ImportApiImportControllerUploadFileRequest = { - organisationId: "organisationId_example", - + rolleId: "rolleId_example", - - file: { data: Buffer.from(fs.readFileSync('/path/to/file', 'utf-8')), name: '/path/to/file' }, + + file: { + data: Buffer.from(fs.readFileSync("/path/to/file", "utf-8")), + name: "/path/to/file", + }, }; const data = await apiInstance.importControllerUploadFile(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | | defaults to undefined - **rolleId** | [**string**] | | defaults to undefined - **file** | [**HttpFile**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | -------------- | ----------- | --------------------- | +| **organisationId** | [**string**] | | defaults to undefined | +| **rolleId** | [**string**] | | defaults to undefined | +| **file** | [**HttpFile**] | | defaults to undefined | ### Return type @@ -173,19 +165,17 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: multipart/form-data - - **Accept**: application/json - +- **Content-Type**: multipart/form-data +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Returns an import upload response object. | - | -**400** | The CSV file was not valid. | - | -**401** | Not authorized to import data with a CSV file. | - | -**403** | Insufficient permissions to import data with a CSV file. | - | -**500** | Internal server error while importing data with a CSV file. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------------- | ---------------- | +| **200** | Returns an import upload response object. | - | +| **400** | The CSV file was not valid. | - | +| **401** | Not authorized to import data with a CSV file. | - | +| **403** | Insufficient permissions to import data with a CSV file. | - | +| **500** | Internal server error while importing data with a CSV file. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/OrganisationenApi.md b/loadtest/api-client/generated/OrganisationenApi.md index 8d72787..0a99688 100644 --- a/loadtest/api-client/generated/OrganisationenApi.md +++ b/loadtest/api-client/generated/OrganisationenApi.md @@ -1,60 +1,60 @@ # .OrganisationenApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**organisationControllerAddAdministrierteOrganisation**](OrganisationenApi.md#organisationControllerAddAdministrierteOrganisation) | **POST** /api/organisationen/{organisationId}/administriert | -[**organisationControllerAddZugehoerigeOrganisation**](OrganisationenApi.md#organisationControllerAddZugehoerigeOrganisation) | **POST** /api/organisationen/{organisationId}/zugehoerig | -[**organisationControllerCreateOrganisation**](OrganisationenApi.md#organisationControllerCreateOrganisation) | **POST** /api/organisationen | -[**organisationControllerDeleteKlasse**](OrganisationenApi.md#organisationControllerDeleteKlasse) | **DELETE** /api/organisationen/{organisationId}/klasse | -[**organisationControllerEnableForitslearning**](OrganisationenApi.md#organisationControllerEnableForitslearning) | **PUT** /api/organisationen/{organisationId}/enable-for-its-learning | -[**organisationControllerFindOrganisationById**](OrganisationenApi.md#organisationControllerFindOrganisationById) | **GET** /api/organisationen/{organisationId} | -[**organisationControllerFindOrganizations**](OrganisationenApi.md#organisationControllerFindOrganizations) | **GET** /api/organisationen | -[**organisationControllerGetAdministrierteOrganisationen**](OrganisationenApi.md#organisationControllerGetAdministrierteOrganisationen) | **GET** /api/organisationen/{organisationId}/administriert | -[**organisationControllerGetParentsByIds**](OrganisationenApi.md#organisationControllerGetParentsByIds) | **POST** /api/organisationen/parents-by-ids | -[**organisationControllerGetRootChildren**](OrganisationenApi.md#organisationControllerGetRootChildren) | **GET** /api/organisationen/root/children | -[**organisationControllerGetRootOrganisation**](OrganisationenApi.md#organisationControllerGetRootOrganisation) | **GET** /api/organisationen/root | -[**organisationControllerGetZugehoerigeOrganisationen**](OrganisationenApi.md#organisationControllerGetZugehoerigeOrganisationen) | **GET** /api/organisationen/{organisationId}/zugehoerig | -[**organisationControllerUpdateOrganisation**](OrganisationenApi.md#organisationControllerUpdateOrganisation) | **PUT** /api/organisationen/{organisationId} | -[**organisationControllerUpdateOrganisationName**](OrganisationenApi.md#organisationControllerUpdateOrganisationName) | **PATCH** /api/organisationen/{organisationId}/name | - +All URIs are relative to _http://localhost_ + +| Method | HTTP request | Description | +| --------------------------------------------------------------------------------------------------------------------------------------- | -------------------------------------------------------------------- | ----------- | +| [**organisationControllerAddAdministrierteOrganisation**](OrganisationenApi.md#organisationControllerAddAdministrierteOrganisation) | **POST** /api/organisationen/{organisationId}/administriert | +| [**organisationControllerAddZugehoerigeOrganisation**](OrganisationenApi.md#organisationControllerAddZugehoerigeOrganisation) | **POST** /api/organisationen/{organisationId}/zugehoerig | +| [**organisationControllerCreateOrganisation**](OrganisationenApi.md#organisationControllerCreateOrganisation) | **POST** /api/organisationen | +| [**organisationControllerDeleteKlasse**](OrganisationenApi.md#organisationControllerDeleteKlasse) | **DELETE** /api/organisationen/{organisationId}/klasse | +| [**organisationControllerEnableForitslearning**](OrganisationenApi.md#organisationControllerEnableForitslearning) | **PUT** /api/organisationen/{organisationId}/enable-for-its-learning | +| [**organisationControllerFindOrganisationById**](OrganisationenApi.md#organisationControllerFindOrganisationById) | **GET** /api/organisationen/{organisationId} | +| [**organisationControllerFindOrganizations**](OrganisationenApi.md#organisationControllerFindOrganizations) | **GET** /api/organisationen | +| [**organisationControllerGetAdministrierteOrganisationen**](OrganisationenApi.md#organisationControllerGetAdministrierteOrganisationen) | **GET** /api/organisationen/{organisationId}/administriert | +| [**organisationControllerGetParentsByIds**](OrganisationenApi.md#organisationControllerGetParentsByIds) | **POST** /api/organisationen/parents-by-ids | +| [**organisationControllerGetRootChildren**](OrganisationenApi.md#organisationControllerGetRootChildren) | **GET** /api/organisationen/root/children | +| [**organisationControllerGetRootOrganisation**](OrganisationenApi.md#organisationControllerGetRootOrganisation) | **GET** /api/organisationen/root | +| [**organisationControllerGetZugehoerigeOrganisationen**](OrganisationenApi.md#organisationControllerGetZugehoerigeOrganisationen) | **GET** /api/organisationen/{organisationId}/zugehoerig | +| [**organisationControllerUpdateOrganisation**](OrganisationenApi.md#organisationControllerUpdateOrganisation) | **PUT** /api/organisationen/{organisationId} | +| [**organisationControllerUpdateOrganisationName**](OrganisationenApi.md#organisationControllerUpdateOrganisationName) | **PATCH** /api/organisationen/{organisationId}/name | # **organisationControllerAddAdministrierteOrganisation** -> void organisationControllerAddAdministrierteOrganisation(organisationByIdBodyParams) +> void organisationControllerAddAdministrierteOrganisation(organisationByIdBodyParams) ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest = { +const request: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest = + { // The id of an organization - organisationId: "organisationId_example", - - organisationByIdBodyParams: { organisationId: "organisationId_example", - }, -}; -const data = await apiInstance.organisationControllerAddAdministrierteOrganisation(request); -console.log('API called successfully. Returned data:', data); -``` + organisationByIdBodyParams: { + organisationId: "organisationId_example", + }, + }; +const data = + await apiInstance.organisationControllerAddAdministrierteOrganisation( + request, + ); +console.log("API called successfully. Returned data:", data); +``` ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationByIdBodyParams** | **OrganisationByIdBodyParams**| | - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------------------ | ------------------------------ | ------------------------- | --------------------- | +| **organisationByIdBodyParams** | **OrganisationByIdBodyParams** | | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -66,56 +66,55 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The organisation was successfully updated. | - | -**400** | The organisation could not be modified. | - | -**401** | Not authorized to modify the organisation. | - | -**403** | Not permitted to modify the organisation. | - | -**500** | Internal server error while modifying the organisation. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ---------------- | +| **201** | The organisation was successfully updated. | - | +| **400** | The organisation could not be modified. | - | +| **401** | Not authorized to modify the organisation. | - | +| **403** | Not permitted to modify the organisation. | - | +| **500** | Internal server error while modifying the organisation. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerAddZugehoerigeOrganisation** -> void organisationControllerAddZugehoerigeOrganisation(organisationByIdBodyParams) +> void organisationControllerAddZugehoerigeOrganisation(organisationByIdBodyParams) ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest = { +const request: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest = + { // The id of an organization - organisationId: "organisationId_example", - - organisationByIdBodyParams: { organisationId: "organisationId_example", - }, -}; -const data = await apiInstance.organisationControllerAddZugehoerigeOrganisation(request); -console.log('API called successfully. Returned data:', data); -``` + organisationByIdBodyParams: { + organisationId: "organisationId_example", + }, + }; +const data = + await apiInstance.organisationControllerAddZugehoerigeOrganisation(request); +console.log("API called successfully. Returned data:", data); +``` ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationByIdBodyParams** | **OrganisationByIdBodyParams**| | - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------------------ | ------------------------------ | ------------------------- | --------------------- | +| **organisationByIdBodyParams** | **OrganisationByIdBodyParams** | | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -127,61 +126,59 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The organisation was successfully updated. | - | -**400** | The organisation could not be modified. | - | -**401** | Not authorized to modify the organisation. | - | -**403** | Not permitted to modify the organisation. | - | -**500** | Internal server error while modifying the organisation. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ---------------- | +| **201** | The organisation was successfully updated. | - | +| **400** | The organisation could not be modified. | - | +| **401** | Not authorized to modify the organisation. | - | +| **403** | Not permitted to modify the organisation. | - | +| **500** | Internal server error while modifying the organisation. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerCreateOrganisation** -> OrganisationResponse organisationControllerCreateOrganisation(createOrganisationBodyParams) +> OrganisationResponse organisationControllerCreateOrganisation(createOrganisationBodyParams) ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerCreateOrganisationRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerCreateOrganisationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerCreateOrganisationRequest = { - - createOrganisationBodyParams: { - administriertVon: "administriertVon_example", - zugehoerigZu: "zugehoerigZu_example", - kennung: "kennung_example", - name: "name_example", - namensergaenzung: "namensergaenzung_example", - kuerzel: "kuerzel_example", - typ: "ROOT", - traegerschaft: "01", - emailAdress: "emailAdress_example", - }, -}; - -const data = await apiInstance.organisationControllerCreateOrganisation(request); -console.log('API called successfully. Returned data:', data); +const request: OrganisationenApiOrganisationControllerCreateOrganisationRequest = + { + createOrganisationBodyParams: { + administriertVon: "administriertVon_example", + zugehoerigZu: "zugehoerigZu_example", + kennung: "kennung_example", + name: "name_example", + namensergaenzung: "namensergaenzung_example", + kuerzel: "kuerzel_example", + typ: "ROOT", + traegerschaft: "01", + emailAdress: "emailAdress_example", + }, + }; + +const data = + await apiInstance.organisationControllerCreateOrganisation(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **createOrganisationBodyParams** | **CreateOrganisationBodyParams**| | - +| Name | Type | Description | Notes | +| -------------------------------- | -------------------------------- | ----------- | ----- | +| **createOrganisationBodyParams** | **CreateOrganisationBodyParams** | | ### Return type @@ -193,52 +190,50 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The organisation was successfully created. | - | -**400** | The organisation already exists. | - | -**401** | Not authorized to create the organisation. | - | -**403** | Not permitted to create the organisation. | - | -**500** | Internal server error while creating the organisation. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------ | ---------------- | +| **201** | The organisation was successfully created. | - | +| **400** | The organisation already exists. | - | +| **401** | Not authorized to create the organisation. | - | +| **403** | Not permitted to create the organisation. | - | +| **500** | Internal server error while creating the organisation. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerDeleteKlasse** + > void organisationControllerDeleteKlasse() Delete an organisation of type Klasse by id. ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerDeleteKlasseRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerDeleteKlasseRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); const request: OrganisationenApiOrganisationControllerDeleteKlasseRequest = { - // The id of an organization + // The id of an organization organisationId: "organisationId_example", }; const data = await apiInstance.organisationControllerDeleteKlasse(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | ------------ | ------------------------- | --------------------- | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -250,50 +245,49 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**204** | The organisation was deleted successfully. | - | -**400** | The input was not valid. | - | -**401** | Not authorized to delete the organisation. | - | -**404** | The organisation that should be deleted does not exist. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ---------------- | +| **204** | The organisation was deleted successfully. | - | +| **400** | The input was not valid. | - | +| **401** | Not authorized to delete the organisation. | - | +| **404** | The organisation that should be deleted does not exist. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerEnableForitslearning** -> OrganisationResponseLegacy organisationControllerEnableForitslearning() +> OrganisationResponseLegacy organisationControllerEnableForitslearning() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerEnableForitslearningRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerEnableForitslearningRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerEnableForitslearningRequest = { +const request: OrganisationenApiOrganisationControllerEnableForitslearningRequest = + { // The id of an organization - organisationId: "organisationId_example", -}; + organisationId: "organisationId_example", + }; -const data = await apiInstance.organisationControllerEnableForitslearning(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.organisationControllerEnableForitslearning(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | ------------ | ------------------------- | --------------------- | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -305,51 +299,50 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organization was successfully enabled for itslearning. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**400** | The organisation could not be modified. | - | -**401** | Not authorized to modify the organisation. | - | -**403** | Not permitted to modify the organisation. | - | -**500** | Internal server error while modifying the organisation. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The organization was successfully enabled for itslearning. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **400** | The organisation could not be modified. | - | +| **401** | Not authorized to modify the organisation. | - | +| **403** | Not permitted to modify the organisation. | - | +| **500** | Internal server error while modifying the organisation. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerFindOrganisationById** -> OrganisationResponse organisationControllerFindOrganisationById() +> OrganisationResponse organisationControllerFindOrganisationById() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerFindOrganisationByIdRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerFindOrganisationByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest = { +const request: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest = + { // The id of an organization - organisationId: "organisationId_example", -}; + organisationId: "organisationId_example", + }; -const data = await apiInstance.organisationControllerFindOrganisationById(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.organisationControllerFindOrganisationById(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | ------------ | ------------------------- | --------------------- | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -361,87 +354,77 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organization was successfully pulled. | - | -**400** | Organization ID is required | - | -**401** | Not authorized to get the organization. | - | -**403** | Insufficient permissions to get the organization. | - | -**404** | The organization does not exist. | - | -**500** | Internal server error while getting the organization. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------- | ---------------- | +| **200** | The organization was successfully pulled. | - | +| **400** | Organization ID is required | - | +| **401** | Not authorized to get the organization. | - | +| **403** | Insufficient permissions to get the organization. | - | +| **404** | The organization does not exist. | - | +| **500** | Internal server error while getting the organization. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerFindOrganizations** -> Array organisationControllerFindOrganizations() +> Array organisationControllerFindOrganizations() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerFindOrganizationsRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerFindOrganizationsRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerFindOrganizationsRequest = { +const request: OrganisationenApiOrganisationControllerFindOrganizationsRequest = + { // The offset of the paginated list. (optional) - offset: 3.14, + offset: 3.14, // The requested limit for the page size. (optional) - limit: 3.14, - - kennung: "kennung_example", - - name: "name_example", - - searchString: "searchString_example", - - typ: "ROOT", - - systemrechte: [ - "ROLLEN_VERWALTEN", - ], - - excludeTyp: [ - "ROOT", - ], - - administriertVon: [ - "administriertVon_example", - ], + limit: 3.14, + + kennung: "kennung_example", + + name: "name_example", + + searchString: "searchString_example", + + typ: "ROOT", + + systemrechte: ["ROLLEN_VERWALTEN"], + + excludeTyp: ["ROOT"], + + administriertVon: ["administriertVon_example"], // Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). (optional) - organisationIds: [ - "organisationIds_example", - ], -}; + organisationIds: ["organisationIds_example"], + }; const data = await apiInstance.organisationControllerFindOrganizations(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **kennung** | [**string**] | | (optional) defaults to undefined - **name** | [**string**] | | (optional) defaults to undefined - **searchString** | [**string**] | | (optional) defaults to undefined - **typ** | **OrganisationsTyp** | | (optional) defaults to undefined - **systemrechte** | **Array<RollenSystemRecht>** | | (optional) defaults to undefined - **excludeTyp** | **Array<OrganisationsTyp>** | | (optional) defaults to undefined - **administriertVon** | **Array<string>** | | (optional) defaults to undefined - **organisationIds** | **Array<string>** | Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| -------------------- | ---------------------------------- | ------------------------------------------------------------------------------------------------------------------------------------------ | -------------------------------- | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **kennung** | [**string**] | | (optional) defaults to undefined | +| **name** | [**string**] | | (optional) defaults to undefined | +| **searchString** | [**string**] | | (optional) defaults to undefined | +| **typ** | **OrganisationsTyp** | | (optional) defaults to undefined | +| **systemrechte** | **Array<RollenSystemRecht>** | | (optional) defaults to undefined | +| **excludeTyp** | **Array<OrganisationsTyp>** | | (optional) defaults to undefined | +| **administriertVon** | **Array<string>** | | (optional) defaults to undefined | +| **organisationIds** | **Array<string>** | Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). | (optional) defaults to undefined | ### Return type @@ -453,59 +436,60 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organizations were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get organizations. | - | -**403** | Insufficient permissions to get organizations. | - | -**500** | Internal server error while getting all organizations. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------ | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The organizations were successfully returned. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get organizations. | - | +| **403** | Insufficient permissions to get organizations. | - | +| **500** | Internal server error while getting all organizations. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerGetAdministrierteOrganisationen** -> Array organisationControllerGetAdministrierteOrganisationen() +> Array organisationControllerGetAdministrierteOrganisationen() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest = { +const request: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest = + { // The id of an organization - organisationId: "organisationId_example", + organisationId: "organisationId_example", // The offset of the paginated list. (optional) - offset: 3.14, + offset: 3.14, // The requested limit for the page size. (optional) - limit: 3.14, - - searchFilter: "searchFilter_example", -}; + limit: 3.14, -const data = await apiInstance.organisationControllerGetAdministrierteOrganisationen(request); -console.log('API called successfully. Returned data:', data); -``` + searchFilter: "searchFilter_example", + }; +const data = + await apiInstance.organisationControllerGetAdministrierteOrganisationen( + request, + ); +console.log("API called successfully. Returned data:", data); +``` ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | The id of an organization | defaults to undefined - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **searchFilter** | [**string**] | | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | ------------ | -------------------------------------- | -------------------------------- | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **searchFilter** | [**string**] | | (optional) defaults to undefined | ### Return type @@ -517,54 +501,48 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organizations were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get organizations. | - | -**403** | Insufficient permissions to get organizations. | - | -**500** | Internal server error while getting all organizations. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------ | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The organizations were successfully returned. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get organizations. | - | +| **403** | Insufficient permissions to get organizations. | - | +| **500** | Internal server error while getting all organizations. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerGetParentsByIds** -> ParentOrganisationenResponse organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams) +> ParentOrganisationenResponse organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams) ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerGetParentsByIdsRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerGetParentsByIdsRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); const request: OrganisationenApiOrganisationControllerGetParentsByIdsRequest = { - parentOrganisationsByIdsBodyParams: { - organisationIds: [ - "organisationIds_example", - ], + organisationIds: ["organisationIds_example"], }, }; const data = await apiInstance.organisationControllerGetParentsByIds(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **parentOrganisationsByIdsBodyParams** | **ParentOrganisationsByIdsBodyParams**| | - +| Name | Type | Description | Notes | +| -------------------------------------- | -------------------------------------- | ----------- | ----- | +| **parentOrganisationsByIdsBodyParams** | **ParentOrganisationsByIdsBodyParams** | | ### Return type @@ -576,29 +554,28 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The parent organizations were successfully pulled. | - | -**401** | Not authorized to get the organizations. | - | -**403** | Insufficient permissions to get the organizations. | - | -**500** | Internal server error while getting the organization. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------- | ---------------- | +| **200** | The parent organizations were successfully pulled. | - | +| **401** | Not authorized to get the organizations. | - | +| **403** | Insufficient permissions to get the organizations. | - | +| **500** | Internal server error while getting the organization. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerGetRootChildren** -> OrganisationRootChildrenResponse organisationControllerGetRootChildren() +> OrganisationRootChildrenResponse organisationControllerGetRootChildren() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; +import { createConfiguration, OrganisationenApi } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); @@ -606,13 +583,12 @@ const apiInstance = new OrganisationenApi(configuration); const request = {}; const data = await apiInstance.organisationControllerGetRootChildren(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -624,43 +600,42 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The root organizations were successfully pulled. | - | -**401** | Not authorized to get the organizations. | - | -**403** | Insufficient permissions to get the organizations. | - | -**500** | Internal server error while getting the organization. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------- | ---------------- | +| **200** | The root organizations were successfully pulled. | - | +| **401** | Not authorized to get the organizations. | - | +| **403** | Insufficient permissions to get the organizations. | - | +| **500** | Internal server error while getting the organization. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerGetRootOrganisation** -> OrganisationResponse organisationControllerGetRootOrganisation() +> OrganisationResponse organisationControllerGetRootOrganisation() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; +import { createConfiguration, OrganisationenApi } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); const request = {}; -const data = await apiInstance.organisationControllerGetRootOrganisation(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.organisationControllerGetRootOrganisation(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -672,51 +647,50 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The root organization was successfully retrieved. | - | -**401** | Not authorized to get the root organization. | - | -**403** | Insufficient permissions to get the root organization. | - | -**404** | The root organization does not exist. | - | -**500** | Internal server error while getting the root organization. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------------------- | ---------------- | +| **200** | The root organization was successfully retrieved. | - | +| **401** | Not authorized to get the root organization. | - | +| **403** | Insufficient permissions to get the root organization. | - | +| **404** | The root organization does not exist. | - | +| **500** | Internal server error while getting the root organization. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerGetZugehoerigeOrganisationen** -> Array organisationControllerGetZugehoerigeOrganisationen() +> Array organisationControllerGetZugehoerigeOrganisationen() ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest = { +const request: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest = + { // The id of an organization - organisationId: "organisationId_example", -}; + organisationId: "organisationId_example", + }; -const data = await apiInstance.organisationControllerGetZugehoerigeOrganisationen(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.organisationControllerGetZugehoerigeOrganisationen(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | ------------ | ------------------------- | --------------------- | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -728,63 +702,62 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organizations were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get organizations. | - | -**403** | Insufficient permissions to get organizations. | - | -**500** | Internal server error while getting all organizations. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------ | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The organizations were successfully returned. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get organizations. | - | +| **403** | Insufficient permissions to get organizations. | - | +| **500** | Internal server error while getting all organizations. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerUpdateOrganisation** -> OrganisationResponse organisationControllerUpdateOrganisation(updateOrganisationBodyParams) +> OrganisationResponse organisationControllerUpdateOrganisation(updateOrganisationBodyParams) ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerUpdateOrganisationRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerUpdateOrganisationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerUpdateOrganisationRequest = { +const request: OrganisationenApiOrganisationControllerUpdateOrganisationRequest = + { // The id of an organization - organisationId: "organisationId_example", - - updateOrganisationBodyParams: { - administriertVon: "administriertVon_example", - zugehoerigZu: "zugehoerigZu_example", - kennung: "kennung_example", - name: "name_example", - namensergaenzung: "namensergaenzung_example", - kuerzel: "kuerzel_example", - typ: "ROOT", - traegerschaft: "01", - emailAdress: "emailAdress_example", - }, -}; + organisationId: "organisationId_example", -const data = await apiInstance.organisationControllerUpdateOrganisation(request); -console.log('API called successfully. Returned data:', data); + updateOrganisationBodyParams: { + administriertVon: "administriertVon_example", + zugehoerigZu: "zugehoerigZu_example", + kennung: "kennung_example", + name: "name_example", + namensergaenzung: "namensergaenzung_example", + kuerzel: "kuerzel_example", + typ: "ROOT", + traegerschaft: "01", + emailAdress: "emailAdress_example", + }, + }; + +const data = + await apiInstance.organisationControllerUpdateOrganisation(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **updateOrganisationBodyParams** | **UpdateOrganisationBodyParams**| | - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| -------------------------------- | -------------------------------- | ------------------------- | --------------------- | +| **updateOrganisationBodyParams** | **UpdateOrganisationBodyParams** | | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -796,58 +769,57 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organisation was successfully updated. | - | -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The organisation was not found. | - | -**500** | An internal server error occurred. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **200** | The organisation was successfully updated. | - | +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The organisation was not found. | - | +| **500** | An internal server error occurred. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **organisationControllerUpdateOrganisationName** -> OrganisationResponseLegacy organisationControllerUpdateOrganisationName(organisationByNameBodyParams) +> OrganisationResponseLegacy organisationControllerUpdateOrganisationName(organisationByNameBodyParams) ### Example - ```typescript -import { createConfiguration, OrganisationenApi } from ''; -import type { OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest } from ''; +import { createConfiguration, OrganisationenApi } from ""; +import type { OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest } from ""; const configuration = createConfiguration(); const apiInstance = new OrganisationenApi(configuration); -const request: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest = { +const request: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest = + { // The id of an organization - organisationId: "organisationId_example", - - organisationByNameBodyParams: { - name: "name_example", - version: 3.14, - }, -}; + organisationId: "organisationId_example", -const data = await apiInstance.organisationControllerUpdateOrganisationName(request); -console.log('API called successfully. Returned data:', data); -``` + organisationByNameBodyParams: { + name: "name_example", + version: 3.14, + }, + }; +const data = + await apiInstance.organisationControllerUpdateOrganisationName(request); +console.log("API called successfully. Returned data:", data); +``` ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationByNameBodyParams** | **OrganisationByNameBodyParams**| | - **organisationId** | [**string**] | The id of an organization | defaults to undefined - +| Name | Type | Description | Notes | +| -------------------------------- | -------------------------------- | ------------------------- | --------------------- | +| **organisationByNameBodyParams** | **OrganisationByNameBodyParams** | | +| **organisationId** | [**string**] | The id of an organization | defaults to undefined | ### Return type @@ -859,19 +831,17 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The organizations were successfully updated. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**400** | The organisation could not be modified. | - | -**401** | Not authorized to modify the organisation. | - | -**403** | Not permitted to modify the organisation. | - | -**500** | Internal server error while modifying the organisation. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The organizations were successfully updated. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **400** | The organisation could not be modified. | - | +| **401** | Not authorized to modify the organisation. | - | +| **403** | Not permitted to modify the organisation. | - | +| **500** | Internal server error while modifying the organisation. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/PersonAdministrationApi.md b/loadtest/api-client/generated/PersonAdministrationApi.md index be88651..df29ee9 100644 --- a/loadtest/api-client/generated/PersonAdministrationApi.md +++ b/loadtest/api-client/generated/PersonAdministrationApi.md @@ -1,45 +1,43 @@ # .PersonAdministrationApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**personAdministrationControllerFindRollen**](PersonAdministrationApi.md#personAdministrationControllerFindRollen) | **GET** /api/person-administration/rollen | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ------------------------------------------------------------------------------------------------------------------- | ----------------------------------------- | ----------- | +| [**personAdministrationControllerFindRollen**](PersonAdministrationApi.md#personAdministrationControllerFindRollen) | **GET** /api/person-administration/rollen | # **personAdministrationControllerFindRollen** -> FindRollenResponse personAdministrationControllerFindRollen() +> FindRollenResponse personAdministrationControllerFindRollen() ### Example - ```typescript -import { createConfiguration, PersonAdministrationApi } from ''; -import type { PersonAdministrationApiPersonAdministrationControllerFindRollenRequest } from ''; +import { createConfiguration, PersonAdministrationApi } from ""; +import type { PersonAdministrationApiPersonAdministrationControllerFindRollenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonAdministrationApi(configuration); -const request: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = { +const request: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = + { // Rolle name used to filter for rollen in personenkontext. (optional) - rolleName: "rolleName_example", + rolleName: "rolleName_example", // The limit of items for the request. (optional) - limit: 3.14, -}; + limit: 3.14, + }; -const data = await apiInstance.personAdministrationControllerFindRollen(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.personAdministrationControllerFindRollen(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleName** | [**string**] | Rolle name used to filter for rollen in personenkontext. | (optional) defaults to undefined - **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ------------- | ------------ | -------------------------------------------------------- | -------------------------------- | +| **rolleName** | [**string**] | Rolle name used to filter for rollen in personenkontext. | (optional) defaults to undefined | +| **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined | ### Return type @@ -51,18 +49,16 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The rollen for the logged-in user were successfully returned. | - | -**401** | Not authorized to get available rollen for the logged-in user. | - | -**403** | Insufficient permission to get rollen for the logged-in user. | - | -**500** | Internal server error while getting rollen for the logged-in user. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------------ | ---------------- | +| **200** | The rollen for the logged-in user were successfully returned. | - | +| **401** | Not authorized to get available rollen for the logged-in user. | - | +| **403** | Insufficient permission to get rollen for the logged-in user. | - | +| **500** | Internal server error while getting rollen for the logged-in user. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/PersonInfoApi.md b/loadtest/api-client/generated/PersonInfoApi.md index 80f3394..daf6fd1 100644 --- a/loadtest/api-client/generated/PersonInfoApi.md +++ b/loadtest/api-client/generated/PersonInfoApi.md @@ -1,21 +1,19 @@ # .PersonInfoApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**personInfoControllerInfo**](PersonInfoApi.md#personInfoControllerInfo) | **GET** /api/person-info | Info about logged in person. +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ------------------------------------------------------------------------- | ------------------------ | ---------------------------- | +| [**personInfoControllerInfo**](PersonInfoApi.md#personInfoControllerInfo) | **GET** /api/person-info | Info about logged in person. | # **personInfoControllerInfo** -> PersonInfoResponse personInfoControllerInfo() +> PersonInfoResponse personInfoControllerInfo() ### Example - ```typescript -import { createConfiguration, PersonInfoApi } from ''; +import { createConfiguration, PersonInfoApi } from ""; const configuration = createConfiguration(); const apiInstance = new PersonInfoApi(configuration); @@ -23,13 +21,12 @@ const apiInstance = new PersonInfoApi(configuration); const request = {}; const data = await apiInstance.personInfoControllerInfo(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -41,16 +38,14 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Returns info about the person. | - | -**401** | person is not logged in. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ------------------------------ | ---------------- | +| **200** | Returns info about the person. | - | +| **401** | person is not logged in. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/PersonenApi.md b/loadtest/api-client/generated/PersonenApi.md index 704f928..fcf420c 100644 --- a/loadtest/api-client/generated/PersonenApi.md +++ b/loadtest/api-client/generated/PersonenApi.md @@ -1,38 +1,35 @@ # .PersonenApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**personControllerCreatePersonMigration**](PersonenApi.md#personControllerCreatePersonMigration) | **POST** /api/personen | -[**personControllerCreatePersonenkontext**](PersonenApi.md#personControllerCreatePersonenkontext) | **POST** /api/personen/{personId}/personenkontexte | -[**personControllerDeletePersonById**](PersonenApi.md#personControllerDeletePersonById) | **DELETE** /api/personen/{personId} | -[**personControllerFindPersonById**](PersonenApi.md#personControllerFindPersonById) | **GET** /api/personen/{personId} | -[**personControllerFindPersonenkontexte**](PersonenApi.md#personControllerFindPersonenkontexte) | **GET** /api/personen/{personId}/personenkontexte | -[**personControllerFindPersons**](PersonenApi.md#personControllerFindPersons) | **GET** /api/personen | -[**personControllerLockPerson**](PersonenApi.md#personControllerLockPerson) | **PUT** /api/personen/{personId}/lock-user | -[**personControllerResetPasswordByPersonId**](PersonenApi.md#personControllerResetPasswordByPersonId) | **PATCH** /api/personen/{personId}/password | -[**personControllerSyncPerson**](PersonenApi.md#personControllerSyncPerson) | **POST** /api/personen/{personId}/sync | -[**personControllerUpdateMetadata**](PersonenApi.md#personControllerUpdateMetadata) | **PATCH** /api/personen/{personId}/metadata | -[**personControllerUpdatePerson**](PersonenApi.md#personControllerUpdatePerson) | **PUT** /api/personen/{personId} | - +All URIs are relative to _http://localhost_ + +| Method | HTTP request | Description | +| ----------------------------------------------------------------------------------------------------- | -------------------------------------------------- | ----------- | +| [**personControllerCreatePersonMigration**](PersonenApi.md#personControllerCreatePersonMigration) | **POST** /api/personen | +| [**personControllerCreatePersonenkontext**](PersonenApi.md#personControllerCreatePersonenkontext) | **POST** /api/personen/{personId}/personenkontexte | +| [**personControllerDeletePersonById**](PersonenApi.md#personControllerDeletePersonById) | **DELETE** /api/personen/{personId} | +| [**personControllerFindPersonById**](PersonenApi.md#personControllerFindPersonById) | **GET** /api/personen/{personId} | +| [**personControllerFindPersonenkontexte**](PersonenApi.md#personControllerFindPersonenkontexte) | **GET** /api/personen/{personId}/personenkontexte | +| [**personControllerFindPersons**](PersonenApi.md#personControllerFindPersons) | **GET** /api/personen | +| [**personControllerLockPerson**](PersonenApi.md#personControllerLockPerson) | **PUT** /api/personen/{personId}/lock-user | +| [**personControllerResetPasswordByPersonId**](PersonenApi.md#personControllerResetPasswordByPersonId) | **PATCH** /api/personen/{personId}/password | +| [**personControllerSyncPerson**](PersonenApi.md#personControllerSyncPerson) | **POST** /api/personen/{personId}/sync | +| [**personControllerUpdateMetadata**](PersonenApi.md#personControllerUpdateMetadata) | **PATCH** /api/personen/{personId}/metadata | +| [**personControllerUpdatePerson**](PersonenApi.md#personControllerUpdatePerson) | **PUT** /api/personen/{personId} | # **personControllerCreatePersonMigration** -> PersonendatensatzResponse personControllerCreatePersonMigration(createPersonMigrationBodyParams) +> PersonendatensatzResponse personControllerCreatePersonMigration(createPersonMigrationBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerCreatePersonMigrationRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerCreatePersonMigrationRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerCreatePersonMigrationRequest = { - createPersonMigrationBodyParams: { personId: "personId_example", familienname: "familienname_example", @@ -44,16 +41,14 @@ const request: PersonenApiPersonControllerCreatePersonMigrationRequest = { }; const data = await apiInstance.personControllerCreatePersonMigration(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **createPersonMigrationBodyParams** | **CreatePersonMigrationBodyParams**| | - +| Name | Type | Description | Notes | +| ----------------------------------- | ----------------------------------- | ----------- | ----- | +| **createPersonMigrationBodyParams** | **CreatePersonMigrationBodyParams** | | ### Return type @@ -65,52 +60,48 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The person was successfully created. | - | -**400** | A username was given. Creation with username is not supported. | - | -**401** | Not authorized to create the person. | - | -**403** | Insufficient permissions to create the person. | - | -**404** | Insufficient permissions to create the person. | - | -**500** | Internal server error while creating the person. | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------- | ---------------- | +| **201** | The person was successfully created. | - | +| **400** | A username was given. Creation with username is not supported. | - | +| **401** | Not authorized to create the person. | - | +| **403** | Insufficient permissions to create the person. | - | +| **404** | Insufficient permissions to create the person. | - | +| **500** | Internal server error while creating the person. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerCreatePersonenkontext** -> void personControllerCreatePersonenkontext() +> void personControllerCreatePersonenkontext() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerCreatePersonenkontextRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerCreatePersonenkontextRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerCreatePersonenkontextRequest = { - personId: "personId_example", }; const data = await apiInstance.personControllerCreatePersonenkontext(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------- | --------------------- | +| **personId** | [**string**] | | defaults to undefined | ### Return type @@ -122,52 +113,49 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenkontext was successfully created. | - | -**400** | The personenkontext already exists. | - | -**401** | Not authorized to create the personenkontext. | - | -**403** | Not permitted to create the personenkontext. | - | -**404** | Insufficient permissions to create personenkontext for person. | - | -**500** | Internal server error while creating the personenkontext. | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------- | ---------------- | +| **200** | The personenkontext was successfully created. | - | +| **400** | The personenkontext already exists. | - | +| **401** | Not authorized to create the personenkontext. | - | +| **403** | Not permitted to create the personenkontext. | - | +| **404** | Insufficient permissions to create personenkontext for person. | - | +| **500** | Internal server error while creating the personenkontext. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerDeletePersonById** -> void personControllerDeletePersonById() +> void personControllerDeletePersonById() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerDeletePersonByIdRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerDeletePersonByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerDeletePersonByIdRequest = { - // The id for the account. + // The id for the account. personId: "personId_example", }; const data = await apiInstance.personControllerDeletePersonById(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The id for the account. | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------------------- | --------------------- | +| **personId** | [**string**] | The id for the account. | defaults to undefined | ### Return type @@ -179,52 +167,49 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**204** | The person and all their kontexte were successfully deleted. | - | -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The person was not found. | - | -**500** | An internal server error occurred. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------ | ---------------- | +| **204** | The person and all their kontexte were successfully deleted. | - | +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The person was not found. | - | +| **500** | An internal server error occurred. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerFindPersonById** -> PersonendatensatzResponse personControllerFindPersonById() +> PersonendatensatzResponse personControllerFindPersonById() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerFindPersonByIdRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerFindPersonByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerFindPersonByIdRequest = { - // The id for the account. + // The id for the account. personId: "personId_example", }; const data = await apiInstance.personControllerFindPersonById(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The id for the account. | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------------------- | --------------------- | +| **personId** | [**string**] | The id for the account. | defaults to undefined | ### Return type @@ -236,70 +221,67 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The person was successfully returned. | - | -**400** | Person ID is required | - | -**401** | Not authorized to get the person. | - | -**403** | Insufficient permissions to get the person. | - | -**404** | The person does not exist or insufficient permissions. | - | -**500** | Internal server error while getting the person. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------ | ---------------- | +| **200** | The person was successfully returned. | - | +| **400** | Person ID is required | - | +| **401** | Not authorized to get the person. | - | +| **403** | Insufficient permissions to get the person. | - | +| **404** | The person does not exist or insufficient permissions. | - | +| **500** | Internal server error while getting the person. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerFindPersonenkontexte** -> PersonControllerFindPersonenkontexte200Response personControllerFindPersonenkontexte() +> PersonControllerFindPersonenkontexte200Response personControllerFindPersonenkontexte() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerFindPersonenkontexteRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerFindPersonenkontexteRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerFindPersonenkontexteRequest = { - // The id for the account. + // The id for the account. personId: "personId_example", - // The offset of the paginated list. (optional) + // The offset of the paginated list. (optional) offset: 3.14, - // The requested limit for the page size. (optional) + // The requested limit for the page size. (optional) limit: 3.14, - + personId2: "personId_example", - + referrer: "referrer_example", - + personenstatus: "AKTIV", - + sichtfreigabe: "ja", }; const data = await apiInstance.personControllerFindPersonenkontexte(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The id for the account. | defaults to undefined - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **personId2** | [**string**] | | (optional) defaults to undefined - **referrer** | [**string**] | | (optional) defaults to undefined - **personenstatus** | **Personenstatus** | | (optional) defaults to undefined - **sichtfreigabe** | **Sichtfreigabe** | | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ------------------ | ------------------ | -------------------------------------- | -------------------------------- | +| **personId** | [**string**] | The id for the account. | defaults to undefined | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **personId2** | [**string**] | | (optional) defaults to undefined | +| **referrer** | [**string**] | | (optional) defaults to undefined | +| **personenstatus** | **Personenstatus** | | (optional) defaults to undefined | +| **sichtfreigabe** | **Sichtfreigabe** | | (optional) defaults to undefined | ### Return type @@ -311,85 +293,78 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenkontexte were successfully pulled. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get personenkontexte. | - | -**403** | Insufficient permissions to get personenkontexte. | - | -**404** | No personenkontexte were found. | - | -**500** | Internal server error while getting all personenkontexte. | - | + +| Status code | Description | Response headers | +| ----------- | --------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The personenkontexte were successfully pulled. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get personenkontexte. | - | +| **403** | Insufficient permissions to get personenkontexte. | - | +| **404** | No personenkontexte were found. | - | +| **500** | Internal server error while getting all personenkontexte. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerFindPersons** -> Array personControllerFindPersons() +> Array personControllerFindPersons() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerFindPersonsRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerFindPersonsRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerFindPersonsRequest = { - // The offset of the paginated list. (optional) + // The offset of the paginated list. (optional) offset: 3.14, - // The requested limit for the page size. (optional) + // The requested limit for the page size. (optional) limit: 3.14, - + referrer: "referrer_example", - + familienname: "familienname_example", - + vorname: "vorname_example", - + sichtfreigabe: "nein", - // List of Organisation ID used to filter for Persons. (optional) - organisationIDs: [ - "organisationIDs_example", - ], - // List of Role ID used to filter for Persons. (optional) - rolleIDs: [ - "rolleIDs_example", - ], - // Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. (optional) + // List of Organisation ID used to filter for Persons. (optional) + organisationIDs: ["organisationIDs_example"], + // List of Role ID used to filter for Persons. (optional) + rolleIDs: ["rolleIDs_example"], + // Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. (optional) suchFilter: "suchFilter_example", - // Order to sort by. (optional) + // Order to sort by. (optional) sortOrder: "asc", - // Field to sort by. (optional) + // Field to sort by. (optional) sortField: "familienname", }; const data = await apiInstance.personControllerFindPersons(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **referrer** | [**string**] | | (optional) defaults to undefined - **familienname** | [**string**] | | (optional) defaults to undefined - **vorname** | [**string**] | | (optional) defaults to undefined - **sichtfreigabe** | [**'ja' | 'nein'**]**Array<'ja' | 'nein'>** | | (optional) defaults to 'nein' - **organisationIDs** | **Array<string>** | List of Organisation ID used to filter for Persons. | (optional) defaults to undefined - **rolleIDs** | **Array<string>** | List of Role ID used to filter for Persons. | (optional) defaults to undefined - **suchFilter** | [**string**] | Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. | (optional) defaults to undefined - **sortOrder** | [**'asc' | 'desc'**]**Array<'asc' | 'desc'>** | Order to sort by. | (optional) defaults to undefined - **sortField** | [**'familienname' | 'vorname' | 'personalnummer' | 'referrer'**]**Array<'familienname' | 'vorname' | 'personalnummer' | 'referrer'>** | Field to sort by. | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ------------------- | --------------------------- | ---------------------------------------------------------------------------------------------------------------- | -------------------------------- | ------------------------------------------------------------------------------------------------------------------------------------------- | ----------------- | -------------------------------- | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **referrer** | [**string**] | | (optional) defaults to undefined | +| **familienname** | [**string**] | | (optional) defaults to undefined | +| **vorname** | [**string**] | | (optional) defaults to undefined | +| **sichtfreigabe** | [\*\*'ja' | 'nein'**]**Array<'ja' | 'nein'>\*\* | | (optional) defaults to 'nein' | +| **organisationIDs** | **Array<string>** | List of Organisation ID used to filter for Persons. | (optional) defaults to undefined | +| **rolleIDs** | **Array<string>** | List of Role ID used to filter for Persons. | (optional) defaults to undefined | +| **suchFilter** | [**string**] | Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. | (optional) defaults to undefined | +| **sortOrder** | [\*\*'asc' | 'desc'**]**Array<'asc' | 'desc'>\*\* | Order to sort by. | (optional) defaults to undefined | +| **sortField** | [\*\*'familienname' | 'vorname' | 'personalnummer' | 'referrer'**]**Array<'familienname' | 'vorname' | 'personalnummer' | 'referrer'>\*\* | Field to sort by. | (optional) defaults to undefined | ### Return type @@ -401,57 +376,53 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The persons were successfully returned. WARNING: This endpoint returns all persons as default when no paging parameters were set. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get persons. | - | -**403** | Insufficient permissions to get persons. | - | -**500** | Internal server error while getting all persons. | - | + +| Status code | Description | Response headers | +| ----------- | --------------------------------------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The persons were successfully returned. WARNING: This endpoint returns all persons as default when no paging parameters were set. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get persons. | - | +| **403** | Insufficient permissions to get persons. | - | +| **500** | Internal server error while getting all persons. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerLockPerson** -> PersonLockResponse personControllerLockPerson(lockUserBodyParams) +> PersonLockResponse personControllerLockPerson(lockUserBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerLockPersonRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerLockPersonRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerLockPersonRequest = { - personId: "personId_example", - + lockUserBodyParams: { lock: true, lockedBy: "lockedBy_example", - lockedUntil: new Date('1970-01-01T00:00:00.00Z'), + lockedUntil: new Date("1970-01-01T00:00:00.00Z"), }, }; const data = await apiInstance.personControllerLockPerson(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **lockUserBodyParams** | **LockUserBodyParams**| | - **personId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ---------------------- | ---------------------- | ----------- | --------------------- | +| **lockUserBodyParams** | **LockUserBodyParams** | | +| **personId** | [**string**] | | defaults to undefined | ### Return type @@ -463,51 +434,48 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | User has been successfully updated. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The person was not found. | - | -**500** | An internal server error occurred. | - | -**502** | A downstream server returned an error. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **200** | User has been successfully updated. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The person was not found. | - | +| **500** | An internal server error occurred. | - | +| **502** | A downstream server returned an error. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerResetPasswordByPersonId** -> string personControllerResetPasswordByPersonId() +> string personControllerResetPasswordByPersonId() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerResetPasswordByPersonIdRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerResetPasswordByPersonIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerResetPasswordByPersonIdRequest = { - // The id for the account. + // The id for the account. personId: "personId_example", }; const data = await apiInstance.personControllerResetPasswordByPersonId(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The id for the account. | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------------------- | --------------------- | +| **personId** | [**string**] | The id for the account. | defaults to undefined | ### Return type @@ -519,49 +487,45 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**202** | Password for person was successfully reset. | - | -**404** | The person does not exist or insufficient permissions to update person. | - | -**500** | Internal server error. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------------------------- | ---------------- | +| **202** | Password for person was successfully reset. | - | +| **404** | The person does not exist or insufficient permissions to update person. | - | +| **500** | Internal server error. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerSyncPerson** -> void personControllerSyncPerson() +> void personControllerSyncPerson() ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerSyncPersonRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerSyncPersonRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerSyncPersonRequest = { - personId: "personId_example", }; const data = await apiInstance.personControllerSyncPerson(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| ------------ | ------------ | ----------- | --------------------- | +| **personId** | [**string**] | | defaults to undefined | ### Return type @@ -573,60 +537,57 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | User will be synced. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The person was not found. | - | -**500** | An internal server error occurred. | - | -**502** | A downstream server returned an error. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **200** | User will be synced. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The person was not found. | - | +| **500** | An internal server error occurred. | - | +| **502** | A downstream server returned an error. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerUpdateMetadata** -> PersonendatensatzResponse personControllerUpdateMetadata(personMetadataBodyParams) +> PersonendatensatzResponse personControllerUpdateMetadata(personMetadataBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerUpdateMetadataRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerUpdateMetadataRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerUpdateMetadataRequest = { - // The id for the account. + // The id for the account. personId: "personId_example", - + personMetadataBodyParams: { familienname: "familienname_example", vorname: "vorname_example", personalnummer: "personalnummer_example", - lastModified: new Date('1970-01-01T00:00:00.00Z'), + lastModified: new Date("1970-01-01T00:00:00.00Z"), revision: "revision_example", }, }; const data = await apiInstance.personControllerUpdateMetadata(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personMetadataBodyParams** | **PersonMetadataBodyParams**| | - **personId** | [**string**] | The id for the account. | defaults to undefined - +| Name | Type | Description | Notes | +| ---------------------------- | ---------------------------- | ----------------------- | --------------------- | +| **personMetadataBodyParams** | **PersonMetadataBodyParams** | | +| **personId** | [**string**] | The id for the account. | defaults to undefined | ### Return type @@ -638,39 +599,38 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The metadata for user was successfully updated. | - | -**400** | Request has a wrong format. | - | -**401** | Not authorized to update the metadata. | - | -**403** | Not permitted to update the metadata. | - | -**500** | Internal server error while updating the metadata for user. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------------- | ---------------- | +| **200** | The metadata for user was successfully updated. | - | +| **400** | Request has a wrong format. | - | +| **401** | Not authorized to update the metadata. | - | +| **403** | Not permitted to update the metadata. | - | +| **500** | Internal server error while updating the metadata for user. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personControllerUpdatePerson** -> PersonendatensatzResponse personControllerUpdatePerson(updatePersonBodyParams) +> PersonendatensatzResponse personControllerUpdatePerson(updatePersonBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenApi } from ''; -import type { PersonenApiPersonControllerUpdatePersonRequest } from ''; +import { createConfiguration, PersonenApi } from ""; +import type { PersonenApiPersonControllerUpdatePersonRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenApi(configuration); const request: PersonenApiPersonControllerUpdatePersonRequest = { - // The id for the account. + // The id for the account. personId: "personId_example", - + updatePersonBodyParams: { referrer: "referrer_example", stammorganisation: "stammorganisation_example", @@ -681,19 +641,13 @@ const request: PersonenApiPersonControllerUpdatePersonRequest = { initialenvorname: "initialenvorname_example", rufname: "rufname_example", titel: "titel_example", - anrede: [ - "anrede_example", - ], - namenssuffix: [ - "namenssuffix_example", - ], - namenspraefix: [ - "namenspraefix_example", - ], + anrede: ["anrede_example"], + namenssuffix: ["namenssuffix_example"], + namenspraefix: ["namenspraefix_example"], sortierindex: "sortierindex_example", }, geburt: { - datum: new Date('1970-01-01T00:00:00.00Z'), + datum: new Date("1970-01-01T00:00:00.00Z"), geburtsort: "geburtsort_example", }, geschlecht: "m", @@ -705,17 +659,15 @@ const request: PersonenApiPersonControllerUpdatePersonRequest = { }; const data = await apiInstance.personControllerUpdatePerson(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **updatePersonBodyParams** | **UpdatePersonBodyParams**| | - **personId** | [**string**] | The id for the account. | defaults to undefined - +| Name | Type | Description | Notes | +| -------------------------- | -------------------------- | ----------------------- | --------------------- | +| **updatePersonBodyParams** | **UpdatePersonBodyParams** | | +| **personId** | [**string**] | The id for the account. | defaults to undefined | ### Return type @@ -727,20 +679,18 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The person was successfully updated. | - | -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The person was not found or insufficient permissions to update person. | - | -**500** | An internal server error occurred. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------------------------------- | ---------------- | +| **200** | The person was successfully updated. | - | +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The person was not found or insufficient permissions to update person. | - | +| **500** | An internal server error occurred. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/PersonenFrontendApi.md b/loadtest/api-client/generated/PersonenFrontendApi.md index 48a0298..49af255 100644 --- a/loadtest/api-client/generated/PersonenFrontendApi.md +++ b/loadtest/api-client/generated/PersonenFrontendApi.md @@ -1,76 +1,68 @@ # .PersonenFrontendApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**personFrontendControllerFindPersons**](PersonenFrontendApi.md#personFrontendControllerFindPersons) | **GET** /api/personen-frontend | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ----------------------------------------------------------------------------------------------------- | ------------------------------ | ----------- | +| [**personFrontendControllerFindPersons**](PersonenFrontendApi.md#personFrontendControllerFindPersons) | **GET** /api/personen-frontend | # **personFrontendControllerFindPersons** -> PersonFrontendControllerFindPersons200Response personFrontendControllerFindPersons() +> PersonFrontendControllerFindPersons200Response personFrontendControllerFindPersons() ### Example - ```typescript -import { createConfiguration, PersonenFrontendApi } from ''; -import type { PersonenFrontendApiPersonFrontendControllerFindPersonsRequest } from ''; +import { createConfiguration, PersonenFrontendApi } from ""; +import type { PersonenFrontendApiPersonFrontendControllerFindPersonsRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenFrontendApi(configuration); const request: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = { - // The offset of the paginated list. (optional) + // The offset of the paginated list. (optional) offset: 3.14, - // The requested limit for the page size. (optional) + // The requested limit for the page size. (optional) limit: 3.14, - + referrer: "referrer_example", - + familienname: "familienname_example", - + vorname: "vorname_example", - + sichtfreigabe: "nein", - // List of Organisation ID used to filter for Persons. (optional) - organisationIDs: [ - "organisationIDs_example", - ], - // List of Role ID used to filter for Persons. (optional) - rolleIDs: [ - "rolleIDs_example", - ], - // Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. (optional) + // List of Organisation ID used to filter for Persons. (optional) + organisationIDs: ["organisationIDs_example"], + // List of Role ID used to filter for Persons. (optional) + rolleIDs: ["rolleIDs_example"], + // Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. (optional) suchFilter: "suchFilter_example", - // Order to sort by. (optional) + // Order to sort by. (optional) sortOrder: "asc", - // Field to sort by. (optional) + // Field to sort by. (optional) sortField: "familienname", }; const data = await apiInstance.personFrontendControllerFindPersons(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **referrer** | [**string**] | | (optional) defaults to undefined - **familienname** | [**string**] | | (optional) defaults to undefined - **vorname** | [**string**] | | (optional) defaults to undefined - **sichtfreigabe** | [**'ja' | 'nein'**]**Array<'ja' | 'nein'>** | | (optional) defaults to 'nein' - **organisationIDs** | **Array<string>** | List of Organisation ID used to filter for Persons. | (optional) defaults to undefined - **rolleIDs** | **Array<string>** | List of Role ID used to filter for Persons. | (optional) defaults to undefined - **suchFilter** | [**string**] | Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. | (optional) defaults to undefined - **sortOrder** | [**'asc' | 'desc'**]**Array<'asc' | 'desc'>** | Order to sort by. | (optional) defaults to undefined - **sortField** | [**'familienname' | 'vorname' | 'personalnummer' | 'referrer'**]**Array<'familienname' | 'vorname' | 'personalnummer' | 'referrer'>** | Field to sort by. | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ------------------- | --------------------------- | ---------------------------------------------------------------------------------------------------------------- | -------------------------------- | ------------------------------------------------------------------------------------------------------------------------------------------- | ----------------- | -------------------------------- | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **referrer** | [**string**] | | (optional) defaults to undefined | +| **familienname** | [**string**] | | (optional) defaults to undefined | +| **vorname** | [**string**] | | (optional) defaults to undefined | +| **sichtfreigabe** | [\*\*'ja' | 'nein'**]**Array<'ja' | 'nein'>\*\* | | (optional) defaults to 'nein' | +| **organisationIDs** | **Array<string>** | List of Organisation ID used to filter for Persons. | (optional) defaults to undefined | +| **rolleIDs** | **Array<string>** | List of Role ID used to filter for Persons. | (optional) defaults to undefined | +| **suchFilter** | [**string**] | Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. | (optional) defaults to undefined | +| **sortOrder** | [\*\*'asc' | 'desc'**]**Array<'asc' | 'desc'>\*\* | Order to sort by. | (optional) defaults to undefined | +| **sortField** | [\*\*'familienname' | 'vorname' | 'personalnummer' | 'referrer'**]**Array<'familienname' | 'vorname' | 'personalnummer' | 'referrer'>\*\* | Field to sort by. | (optional) defaults to undefined | ### Return type @@ -82,18 +74,16 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The persons were successfully returned. WARNING: This endpoint returns all persons as default when no paging parameters were set. | - | -**401** | Not authorized to get persons. | - | -**403** | Insufficient permissions to get persons. | - | -**500** | Internal server error while getting all persons. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | --------------------------------------------------------------------------------------------------------------------------------- | ---------------- | +| **200** | The persons were successfully returned. WARNING: This endpoint returns all persons as default when no paging parameters were set. | - | +| **401** | Not authorized to get persons. | - | +| **403** | Insufficient permissions to get persons. | - | +| **500** | Internal server error while getting all persons. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/PersonenkontextApi.md b/loadtest/api-client/generated/PersonenkontextApi.md index 1f0d05c..70f5e01 100644 --- a/loadtest/api-client/generated/PersonenkontextApi.md +++ b/loadtest/api-client/generated/PersonenkontextApi.md @@ -1,62 +1,60 @@ # .PersonenkontextApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**dbiamPersonenkontextWorkflowControllerCommit**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerCommit) | **PUT** /api/personenkontext-workflow/{personId} | -[**dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte) | **POST** /api/personenkontext-workflow | -[**dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten) | **GET** /api/personenkontext-workflow/schulstrukturknoten | -[**dbiamPersonenkontextWorkflowControllerProcessStep**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerProcessStep) | **GET** /api/personenkontext-workflow/step | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| -------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | --------------------------------------------------------- | ----------- | +| [**dbiamPersonenkontextWorkflowControllerCommit**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerCommit) | **PUT** /api/personenkontext-workflow/{personId} | +| [**dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte) | **POST** /api/personenkontext-workflow | +| [**dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten) | **GET** /api/personenkontext-workflow/schulstrukturknoten | +| [**dbiamPersonenkontextWorkflowControllerProcessStep**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerProcessStep) | **GET** /api/personenkontext-workflow/step | # **dbiamPersonenkontextWorkflowControllerCommit** -> PersonenkontexteUpdateResponse dbiamPersonenkontextWorkflowControllerCommit(dbiamUpdatePersonenkontexteBodyParams) +> PersonenkontexteUpdateResponse dbiamPersonenkontextWorkflowControllerCommit(dbiamUpdatePersonenkontexteBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenkontextApi } from ''; -import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest } from ''; +import { createConfiguration, PersonenkontextApi } from ""; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontextApi(configuration); -const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest = { +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest = + { // The ID for the person. - personId: "personId_example", - - dbiamUpdatePersonenkontexteBodyParams: { - lastModified: new Date('1970-01-01T00:00:00.00Z'), - count: 3.14, - personenkontexte: [ - { - personId: "personId_example", - organisationId: "organisationId_example", - rolleId: "rolleId_example", - befristung: new Date('1970-01-01T00:00:00.00Z'), - }, - ], - }, - - personalnummer: "personalnummer_example", -}; - -const data = await apiInstance.dbiamPersonenkontextWorkflowControllerCommit(request); -console.log('API called successfully. Returned data:', data); -``` + personId: "personId_example", + + dbiamUpdatePersonenkontexteBodyParams: { + lastModified: new Date("1970-01-01T00:00:00.00Z"), + count: 3.14, + personenkontexte: [ + { + personId: "personId_example", + organisationId: "organisationId_example", + rolleId: "rolleId_example", + befristung: new Date("1970-01-01T00:00:00.00Z"), + }, + ], + }, + personalnummer: "personalnummer_example", + }; -### Parameters +const data = + await apiInstance.dbiamPersonenkontextWorkflowControllerCommit(request); +console.log("API called successfully. Returned data:", data); +``` -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **dbiamUpdatePersonenkontexteBodyParams** | **DbiamUpdatePersonenkontexteBodyParams**| | - **personId** | [**string**] | The ID for the person. | defaults to undefined - **personalnummer** | [**string**] | | (optional) defaults to undefined +### Parameters +| Name | Type | Description | Notes | +| ----------------------------------------- | ----------------------------------------- | ---------------------- | -------------------------------- | +| **dbiamUpdatePersonenkontexteBodyParams** | **DbiamUpdatePersonenkontexteBodyParams** | | +| **personId** | [**string**] | The ID for the person. | defaults to undefined | +| **personalnummer** | [**string**] | | (optional) defaults to undefined | ### Return type @@ -68,63 +66,63 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Add or remove personenkontexte as one operation. Returns the Personenkontexte existing after update. | - | -**400** | The personenkontexte could not be updated, may due to unsatisfied specifications. | - | -**401** | Not authorized to update personenkontexte. | - | -**403** | Insufficient permission to update personenkontexte. | - | -**409** | Changes are conflicting with current state of personenkontexte. | - | -**500** | Internal server error while updating personenkontexte. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------------------------------------------------------------- | ---------------- | +| **200** | Add or remove personenkontexte as one operation. Returns the Personenkontexte existing after update. | - | +| **400** | The personenkontexte could not be updated, may due to unsatisfied specifications. | - | +| **401** | Not authorized to update personenkontexte. | - | +| **403** | Insufficient permission to update personenkontexte. | - | +| **409** | Changes are conflicting with current state of personenkontexte. | - | +| **500** | Internal server error while updating personenkontexte. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte** -> DBiamPersonResponse dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams) +> DBiamPersonResponse dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenkontextApi } from ''; -import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest } from ''; +import { createConfiguration, PersonenkontextApi } from ""; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontextApi(configuration); -const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest = { - - dbiamCreatePersonWithPersonenkontexteBodyParams: { - familienname: "familienname_example", - vorname: "vorname_example", - personalnummer: "personalnummer_example", - befristung: new Date('1970-01-01T00:00:00.00Z'), - createPersonenkontexte: [ - { - organisationId: "organisationId_example", - rolleId: "rolleId_example", - }, - ], - }, -}; - -const data = await apiInstance.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(request); -console.log('API called successfully. Returned data:', data); +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest = + { + dbiamCreatePersonWithPersonenkontexteBodyParams: { + familienname: "familienname_example", + vorname: "vorname_example", + personalnummer: "personalnummer_example", + befristung: new Date("1970-01-01T00:00:00.00Z"), + createPersonenkontexte: [ + { + organisationId: "organisationId_example", + rolleId: "rolleId_example", + }, + ], + }, + }; + +const data = + await apiInstance.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **dbiamCreatePersonWithPersonenkontexteBodyParams** | **DbiamCreatePersonWithPersonenkontexteBodyParams**| | - +| Name | Type | Description | Notes | +| --------------------------------------------------- | --------------------------------------------------- | ----------- | ----- | +| **dbiamCreatePersonWithPersonenkontexteBodyParams** | **DbiamCreatePersonWithPersonenkontexteBodyParams** | | ### Return type @@ -136,57 +134,58 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | Person with Personenkontext was successfully created. | - | -**400** | The person and the personenkontext could not be created, may due to unsatisfied specifications. | - | -**401** | Not authorized to create person with personenkontext. | - | -**403** | Insufficient permission to create person with personenkontext. | - | -**500** | Internal server error while creating person with personenkontext. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------------------------------------------------- | ---------------- | +| **201** | Person with Personenkontext was successfully created. | - | +| **400** | The person and the personenkontext could not be created, may due to unsatisfied specifications. | - | +| **401** | Not authorized to create person with personenkontext. | - | +| **403** | Insufficient permission to create person with personenkontext. | - | +| **500** | Internal server error while creating person with personenkontext. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten** -> FindSchulstrukturknotenResponse dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten() +> FindSchulstrukturknotenResponse dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten() ### Example - ```typescript -import { createConfiguration, PersonenkontextApi } from ''; -import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest } from ''; +import { createConfiguration, PersonenkontextApi } from ""; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontextApi(configuration); -const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest = { +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest = + { // RolleId used to filter for schulstrukturknoten in personenkontext. - rolleId: "rolleId_example", + rolleId: "rolleId_example", // Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. (optional) - sskName: "sskName_example", + sskName: "sskName_example", // The limit of items for the request. (optional) - limit: 3.14, -}; - -const data = await apiInstance.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(request); -console.log('API called successfully. Returned data:', data); + limit: 3.14, + }; + +const data = + await apiInstance.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleId** | [**string**] | RolleId used to filter for schulstrukturknoten in personenkontext. | defaults to undefined - **sskName** | [**string**] | Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. | (optional) defaults to undefined - **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ----------- | ------------ | -------------------------------------------------------------------------------- | -------------------------------- | +| **rolleId** | [**string**] | RolleId used to filter for schulstrukturknoten in personenkontext. | defaults to undefined | +| **sskName** | [**string**] | Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. | (optional) defaults to undefined | +| **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined | ### Return type @@ -198,62 +197,61 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The schulstrukturknoten for a personenkontext were successfully returned. | - | -**401** | Not authorized to get available schulstrukturknoten for personenkontexte. | - | -**403** | Insufficient permission to get schulstrukturknoten for personenkontext. | - | -**500** | Internal server error while getting schulstrukturknoten for personenkontexte. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------------------------------------- | ---------------- | +| **200** | The schulstrukturknoten for a personenkontext were successfully returned. | - | +| **401** | Not authorized to get available schulstrukturknoten for personenkontexte. | - | +| **403** | Insufficient permission to get schulstrukturknoten for personenkontext. | - | +| **500** | Internal server error while getting schulstrukturknoten for personenkontexte. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **dbiamPersonenkontextWorkflowControllerProcessStep** -> PersonenkontextWorkflowResponse dbiamPersonenkontextWorkflowControllerProcessStep() +> PersonenkontextWorkflowResponse dbiamPersonenkontextWorkflowControllerProcessStep() ### Example - ```typescript -import { createConfiguration, PersonenkontextApi } from ''; -import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest } from ''; +import { createConfiguration, PersonenkontextApi } from ""; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontextApi(configuration); -const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = { +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = + { // ID of the organisation to filter the rollen later (optional) - organisationId: "organisationId_example", + organisationId: "organisationId_example", // ID of the rolle. (optional) - rolleId: "rolleId_example", + rolleId: "rolleId_example", // Rolle name used to filter for rollen in personenkontext. (optional) - rolleName: "rolleName_example", + rolleName: "rolleName_example", // Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. (optional) - organisationName: "organisationName_example", + organisationName: "organisationName_example", // The limit of items for the request. (optional) - limit: 3.14, -}; + limit: 3.14, + }; -const data = await apiInstance.dbiamPersonenkontextWorkflowControllerProcessStep(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.dbiamPersonenkontextWorkflowControllerProcessStep(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **organisationId** | [**string**] | ID of the organisation to filter the rollen later | (optional) defaults to undefined - **rolleId** | [**string**] | ID of the rolle. | (optional) defaults to undefined - **rolleName** | [**string**] | Rolle name used to filter for rollen in personenkontext. | (optional) defaults to undefined - **organisationName** | [**string**] | Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. | (optional) defaults to undefined - **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| -------------------- | ------------ | -------------------------------------------------------------------------------- | -------------------------------- | +| **organisationId** | [**string**] | ID of the organisation to filter the rollen later | (optional) defaults to undefined | +| **rolleId** | [**string**] | ID of the rolle. | (optional) defaults to undefined | +| **rolleName** | [**string**] | Rolle name used to filter for rollen in personenkontext. | (optional) defaults to undefined | +| **organisationName** | [**string**] | Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. | (optional) defaults to undefined | +| **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined | ### Return type @@ -265,18 +263,16 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Initialize or process data from the person creation form. Valid combinations: - Both organisationId and rolleId are undefined: Fetch all possible organisations. - organisationId is provided, but rolleId is undefined: Fetch Rollen for the given organisation. - Both organisationId and rolleId are provided: Check if the Rolle can be committed for the organisation. Note: Providing rolleId without organisationId is invalid. | - | -**401** | Not authorized to get available data for personenkontext. | - | -**403** | Insufficient permission to get data for personenkontext. | - | -**500** | Internal server error while getting data for personenkontext. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | ---------------- | +| **200** | Initialize or process data from the person creation form. Valid combinations: - Both organisationId and rolleId are undefined: Fetch all possible organisations. - organisationId is provided, but rolleId is undefined: Fetch Rollen for the given organisation. - Both organisationId and rolleId are provided: Check if the Rolle can be committed for the organisation. Note: Providing rolleId without organisationId is invalid. | - | +| **401** | Not authorized to get available data for personenkontext. | - | +| **403** | Insufficient permission to get data for personenkontext. | - | +| **500** | Internal server error while getting data for personenkontext. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/PersonenkontexteApi.md b/loadtest/api-client/generated/PersonenkontexteApi.md index 21d0161..30e7489 100644 --- a/loadtest/api-client/generated/PersonenkontexteApi.md +++ b/loadtest/api-client/generated/PersonenkontexteApi.md @@ -1,51 +1,49 @@ # .PersonenkontexteApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**personenkontextControllerDeletePersonenkontextById**](PersonenkontexteApi.md#personenkontextControllerDeletePersonenkontextById) | **DELETE** /api/personenkontexte/{personenkontextId} | -[**personenkontextControllerFindPersonenkontextById**](PersonenkontexteApi.md#personenkontextControllerFindPersonenkontextById) | **GET** /api/personenkontexte/{personenkontextId} | -[**personenkontextControllerFindPersonenkontexte**](PersonenkontexteApi.md#personenkontextControllerFindPersonenkontexte) | **GET** /api/personenkontexte | -[**personenkontextControllerHatSystemRecht**](PersonenkontexteApi.md#personenkontextControllerHatSystemRecht) | **GET** /api/personenkontexte/{personId}/hatSystemrecht | -[**personenkontextControllerUpdatePersonenkontextWithId**](PersonenkontexteApi.md#personenkontextControllerUpdatePersonenkontextWithId) | **PUT** /api/personenkontexte/{personenkontextId} | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| --------------------------------------------------------------------------------------------------------------------------------------- | ------------------------------------------------------- | ----------- | +| [**personenkontextControllerDeletePersonenkontextById**](PersonenkontexteApi.md#personenkontextControllerDeletePersonenkontextById) | **DELETE** /api/personenkontexte/{personenkontextId} | +| [**personenkontextControllerFindPersonenkontextById**](PersonenkontexteApi.md#personenkontextControllerFindPersonenkontextById) | **GET** /api/personenkontexte/{personenkontextId} | +| [**personenkontextControllerFindPersonenkontexte**](PersonenkontexteApi.md#personenkontextControllerFindPersonenkontexte) | **GET** /api/personenkontexte | +| [**personenkontextControllerHatSystemRecht**](PersonenkontexteApi.md#personenkontextControllerHatSystemRecht) | **GET** /api/personenkontexte/{personId}/hatSystemrecht | +| [**personenkontextControllerUpdatePersonenkontextWithId**](PersonenkontexteApi.md#personenkontextControllerUpdatePersonenkontextWithId) | **PUT** /api/personenkontexte/{personenkontextId} | # **personenkontextControllerDeletePersonenkontextById** -> void personenkontextControllerDeletePersonenkontextById(deleteRevisionBodyParams) +> void personenkontextControllerDeletePersonenkontextById(deleteRevisionBodyParams) ### Example - ```typescript -import { createConfiguration, PersonenkontexteApi } from ''; -import type { PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest } from ''; +import { createConfiguration, PersonenkontexteApi } from ""; +import type { PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontexteApi(configuration); -const request: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest = { +const request: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest = + { // The id for the personenkontext. - personenkontextId: "personenkontextId_example", - - deleteRevisionBodyParams: { - revision: "revision_example", - }, -}; - -const data = await apiInstance.personenkontextControllerDeletePersonenkontextById(request); -console.log('API called successfully. Returned data:', data); -``` + personenkontextId: "personenkontextId_example", + deleteRevisionBodyParams: { + revision: "revision_example", + }, + }; -### Parameters +const data = + await apiInstance.personenkontextControllerDeletePersonenkontextById(request); +console.log("API called successfully. Returned data:", data); +``` -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **deleteRevisionBodyParams** | **DeleteRevisionBodyParams**| | - **personenkontextId** | [**string**] | The id for the personenkontext. | defaults to undefined +### Parameters +| Name | Type | Description | Notes | +| ---------------------------- | ---------------------------- | ------------------------------- | --------------------- | +| **deleteRevisionBodyParams** | **DeleteRevisionBodyParams** | | +| **personenkontextId** | [**string**] | The id for the personenkontext. | defaults to undefined | ### Return type @@ -57,52 +55,51 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: Not defined - +- **Content-Type**: application/json +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**204** | The personenkontext was successfully deleted. | - | -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The personenkontext was not found. | - | -**500** | An internal server error occurred. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **204** | The personenkontext was successfully deleted. | - | +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The personenkontext was not found. | - | +| **500** | An internal server error occurred. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personenkontextControllerFindPersonenkontextById** -> PersonendatensatzResponseAutomapper personenkontextControllerFindPersonenkontextById() +> PersonendatensatzResponseAutomapper personenkontextControllerFindPersonenkontextById() ### Example - ```typescript -import { createConfiguration, PersonenkontexteApi } from ''; -import type { PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest } from ''; +import { createConfiguration, PersonenkontexteApi } from ""; +import type { PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontexteApi(configuration); -const request: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest = { +const request: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest = + { // The id for the personenkontext. - personenkontextId: "personenkontextId_example", -}; + personenkontextId: "personenkontextId_example", + }; -const data = await apiInstance.personenkontextControllerFindPersonenkontextById(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.personenkontextControllerFindPersonenkontextById(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personenkontextId** | [**string**] | The id for the personenkontext. | defaults to undefined - +| Name | Type | Description | Notes | +| --------------------- | ------------ | ------------------------------- | --------------------- | +| **personenkontextId** | [**string**] | The id for the personenkontext. | defaults to undefined | ### Return type @@ -114,67 +111,66 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenkontext was successfully returned. | - | -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The personenkontext was not found. | - | -**500** | An internal server error occurred. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **200** | The personenkontext was successfully returned. | - | +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The personenkontext was not found. | - | +| **500** | An internal server error occurred. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personenkontextControllerFindPersonenkontexte** -> Array personenkontextControllerFindPersonenkontexte() +> Array personenkontextControllerFindPersonenkontexte() ### Example - ```typescript -import { createConfiguration, PersonenkontexteApi } from ''; -import type { PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest } from ''; +import { createConfiguration, PersonenkontexteApi } from ""; +import type { PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontexteApi(configuration); -const request: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = { +const request: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = + { // The offset of the paginated list. (optional) - offset: 3.14, + offset: 3.14, // The requested limit for the page size. (optional) - limit: 3.14, - - personId: "personId_example", - - referrer: "referrer_example", - - personenstatus: "AKTIV", - - sichtfreigabe: "ja", -}; - -const data = await apiInstance.personenkontextControllerFindPersonenkontexte(request); -console.log('API called successfully. Returned data:', data); -``` + limit: 3.14, + personId: "personId_example", -### Parameters + referrer: "referrer_example", + + personenstatus: "AKTIV", -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **personId** | [**string**] | | (optional) defaults to undefined - **referrer** | [**string**] | | (optional) defaults to undefined - **personenstatus** | **Personenstatus** | | (optional) defaults to undefined - **sichtfreigabe** | **Sichtfreigabe** | | (optional) defaults to undefined + sichtfreigabe: "ja", + }; +const data = + await apiInstance.personenkontextControllerFindPersonenkontexte(request); +console.log("API called successfully. Returned data:", data); +``` + +### Parameters + +| Name | Type | Description | Notes | +| ------------------ | ------------------ | -------------------------------------- | -------------------------------- | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **personId** | [**string**] | | (optional) defaults to undefined | +| **referrer** | [**string**] | | (optional) defaults to undefined | +| **personenstatus** | **Personenstatus** | | (optional) defaults to undefined | +| **sichtfreigabe** | **Sichtfreigabe** | | (optional) defaults to undefined | ### Return type @@ -186,55 +182,53 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenkontexte were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The personenkontexte were not found. | - | -**500** | An internal server error occurred. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------ | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The personenkontexte were successfully returned. | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The personenkontexte were not found. | - | +| **500** | An internal server error occurred. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personenkontextControllerHatSystemRecht** -> SystemrechtResponse personenkontextControllerHatSystemRecht() +> SystemrechtResponse personenkontextControllerHatSystemRecht() ### Example - ```typescript -import { createConfiguration, PersonenkontexteApi } from ''; -import type { PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest } from ''; +import { createConfiguration, PersonenkontexteApi } from ""; +import type { PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontexteApi(configuration); -const request: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest = { +const request: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest = + { // The id for the account. - personId: "personId_example", - - systemRecht: "ROLLEN_VERWALTEN", -}; + personId: "personId_example", + + systemRecht: "ROLLEN_VERWALTEN", + }; const data = await apiInstance.personenkontextControllerHatSystemRecht(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personId** | [**string**] | The id for the account. | defaults to undefined - **systemRecht** | **RollenSystemRecht** | | defaults to undefined - +| Name | Type | Description | Notes | +| --------------- | --------------------- | ----------------------- | --------------------- | +| **personId** | [**string**] | The id for the account. | defaults to undefined | +| **systemRecht** | **RollenSystemRecht** | | defaults to undefined | ### Return type @@ -246,48 +240,48 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The SchulStrukturKnoten associated with this personId and systemrecht. Can return empty list | - | -**404** | The systemrecht could not be found (does not exist as type of systemrecht). | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------------------------------------- | ---------------- | +| **200** | The SchulStrukturKnoten associated with this personId and systemrecht. Can return empty list | - | +| **404** | The systemrecht could not be found (does not exist as type of systemrecht). | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **personenkontextControllerUpdatePersonenkontextWithId** -> PersonenkontextResponse personenkontextControllerUpdatePersonenkontextWithId() +> PersonenkontextResponse personenkontextControllerUpdatePersonenkontextWithId() ### Example - ```typescript -import { createConfiguration, PersonenkontexteApi } from ''; -import type { PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest } from ''; +import { createConfiguration, PersonenkontexteApi } from ""; +import type { PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new PersonenkontexteApi(configuration); -const request: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest = { - - personenkontextId: "personenkontextId_example", -}; +const request: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest = + { + personenkontextId: "personenkontextId_example", + }; -const data = await apiInstance.personenkontextControllerUpdatePersonenkontextWithId(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.personenkontextControllerUpdatePersonenkontextWithId( + request, + ); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **personenkontextId** | [**string**] | | defaults to undefined - +| Name | Type | Description | Notes | +| --------------------- | ------------ | ----------- | --------------------- | +| **personenkontextId** | [**string**] | | defaults to undefined | ### Return type @@ -299,20 +293,18 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The personenkontext was successfully updated. | - | -**400** | Request has wrong format. | - | -**401** | Request is not authorized. | - | -**403** | Insufficient permissions to perform operation. | - | -**404** | The personenkontext was not found. | - | -**500** | An internal server error occurred. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------- | ---------------- | +| **200** | The personenkontext was successfully updated. | - | +| **400** | Request has wrong format. | - | +| **401** | Request is not authorized. | - | +| **403** | Insufficient permissions to perform operation. | - | +| **404** | The personenkontext was not found. | - | +| **500** | An internal server error occurred. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/ProviderApi.md b/loadtest/api-client/generated/ProviderApi.md index 5cb0ee1..33e117e 100644 --- a/loadtest/api-client/generated/ProviderApi.md +++ b/loadtest/api-client/generated/ProviderApi.md @@ -1,38 +1,37 @@ # .ProviderApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**providerControllerGetAllServiceProviders**](ProviderApi.md#providerControllerGetAllServiceProviders) | **GET** /api/provider/all | -[**providerControllerGetAvailableServiceProviders**](ProviderApi.md#providerControllerGetAvailableServiceProviders) | **GET** /api/provider | -[**providerControllerGetServiceProviderLogo**](ProviderApi.md#providerControllerGetServiceProviderLogo) | **GET** /api/provider/{angebotId}/logo | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ------------------------------------------------------------------------------------------------------------------- | -------------------------------------- | ----------- | +| [**providerControllerGetAllServiceProviders**](ProviderApi.md#providerControllerGetAllServiceProviders) | **GET** /api/provider/all | +| [**providerControllerGetAvailableServiceProviders**](ProviderApi.md#providerControllerGetAvailableServiceProviders) | **GET** /api/provider | +| [**providerControllerGetServiceProviderLogo**](ProviderApi.md#providerControllerGetServiceProviderLogo) | **GET** /api/provider/{angebotId}/logo | # **providerControllerGetAllServiceProviders** + > Array providerControllerGetAllServiceProviders() Get all service-providers. ### Example - ```typescript -import { createConfiguration, ProviderApi } from ''; +import { createConfiguration, ProviderApi } from ""; const configuration = createConfiguration(); const apiInstance = new ProviderApi(configuration); const request = {}; -const data = await apiInstance.providerControllerGetAllServiceProviders(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.providerControllerGetAllServiceProviders(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -44,44 +43,44 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The service-providers were successfully returned. | - | -**401** | Not authorized to get available service providers. | - | -**403** | Insufficient permissions to get service-providers. | - | -**500** | Internal server error while getting all service-providers. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------------------- | ---------------- | +| **200** | The service-providers were successfully returned. | - | +| **401** | Not authorized to get available service providers. | - | +| **403** | Insufficient permissions to get service-providers. | - | +| **500** | Internal server error while getting all service-providers. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **providerControllerGetAvailableServiceProviders** + > Array providerControllerGetAvailableServiceProviders() Get service-providers available for logged-in user. ### Example - ```typescript -import { createConfiguration, ProviderApi } from ''; +import { createConfiguration, ProviderApi } from ""; const configuration = createConfiguration(); const apiInstance = new ProviderApi(configuration); const request = {}; -const data = await apiInstance.providerControllerGetAvailableServiceProviders(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.providerControllerGetAvailableServiceProviders(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -93,50 +92,48 @@ This endpoint does not need any parameter. ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The service-providers were successfully returned. | - | -**401** | Not authorized to get available service providers. | - | -**403** | Insufficient permissions to get service-providers. | - | -**500** | Internal server error while getting all service-providers. | - | + +| Status code | Description | Response headers | +| ----------- | ---------------------------------------------------------- | ---------------- | +| **200** | The service-providers were successfully returned. | - | +| **401** | Not authorized to get available service providers. | - | +| **403** | Insufficient permissions to get service-providers. | - | +| **500** | Internal server error while getting all service-providers. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **providerControllerGetServiceProviderLogo** -> any providerControllerGetServiceProviderLogo() +> any providerControllerGetServiceProviderLogo() ### Example - ```typescript -import { createConfiguration, ProviderApi } from ''; -import type { ProviderApiProviderControllerGetServiceProviderLogoRequest } from ''; +import { createConfiguration, ProviderApi } from ""; +import type { ProviderApiProviderControllerGetServiceProviderLogoRequest } from ""; const configuration = createConfiguration(); const apiInstance = new ProviderApi(configuration); const request: ProviderApiProviderControllerGetServiceProviderLogoRequest = { - // The id of the service provider + // The id of the service provider angebotId: "angebotId_example", }; -const data = await apiInstance.providerControllerGetServiceProviderLogo(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.providerControllerGetServiceProviderLogo(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **angebotId** | [**string**] | The id of the service provider | defaults to undefined - +| Name | Type | Description | Notes | +| ------------- | ------------ | ------------------------------ | --------------------- | +| **angebotId** | [**string**] | The id of the service provider | defaults to undefined | ### Return type @@ -148,20 +145,18 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: image/* - +- **Content-Type**: Not defined +- **Accept**: image/\* ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The logo for the service provider was successfully returned. | - | -**400** | Angebot ID is required. | - | -**401** | Not authorized to get service provider logo. | - | -**403** | Insufficient permissions to get the logo. | - | -**404** | The service-provider does not exist or has no logo. | - | -**500** | Internal server error while getting the logo. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------ | ---------------- | +| **200** | The logo for the service provider was successfully returned. | - | +| **400** | Angebot ID is required. | - | +| **401** | Not authorized to get service provider logo. | - | +| **403** | Insufficient permissions to get the logo. | - | +| **404** | The service-provider does not exist or has no logo. | - | +| **500** | Internal server error while getting the logo. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/README.md b/loadtest/api-client/generated/README.md index f1f2196..a631efd 100644 --- a/loadtest/api-client/generated/README.md +++ b/loadtest/api-client/generated/README.md @@ -5,6 +5,7 @@ This generator creates TypeScript/JavaScript client that utilizes fetch-api. ### Building To build and compile the typescript sources to javascript use: + ``` npm install npm run build @@ -12,7 +13,7 @@ npm run build ### Publishing -First build the package then run ```npm publish``` +First build the package then run `npm publish` ### Consuming @@ -32,8 +33,8 @@ npm install PATH_TO_GENERATED_PACKAGE --save ### Usage -Below code snippet shows exemplary usage of the configuration and the API based -on the typical `PetStore` example used for OpenAPI. +Below code snippet shows exemplary usage of the configuration and the API based +on the typical `PetStore` example used for OpenAPI. ``` import * as your_api from 'your_api_package' @@ -44,7 +45,7 @@ const authConfig: your_api.AuthMethodsConfiguration = { } // Implements a simple middleware to modify requests before (`pre`) they are sent -// and after (`post`) they have been received +// and after (`post`) they have been received class Test implements your_api.Middleware { pre(context: your_api.RequestContext): Promise { // Modify context here and return diff --git a/loadtest/api-client/generated/RolleApi.md b/loadtest/api-client/generated/RolleApi.md index 703f922..150ee8c 100644 --- a/loadtest/api-client/generated/RolleApi.md +++ b/loadtest/api-client/generated/RolleApi.md @@ -1,56 +1,53 @@ # .RolleApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**rolleControllerAddSystemRecht**](RolleApi.md#rolleControllerAddSystemRecht) | **PATCH** /api/rolle/{rolleId} | -[**rolleControllerCreateRolle**](RolleApi.md#rolleControllerCreateRolle) | **POST** /api/rolle | -[**rolleControllerDeleteRolle**](RolleApi.md#rolleControllerDeleteRolle) | **DELETE** /api/rolle/{rolleId} | -[**rolleControllerFindRolleByIdWithServiceProviders**](RolleApi.md#rolleControllerFindRolleByIdWithServiceProviders) | **GET** /api/rolle/{rolleId} | -[**rolleControllerFindRollen**](RolleApi.md#rolleControllerFindRollen) | **GET** /api/rolle | -[**rolleControllerGetRolleServiceProviderIds**](RolleApi.md#rolleControllerGetRolleServiceProviderIds) | **GET** /api/rolle/{rolleId}/serviceProviders | -[**rolleControllerRemoveServiceProviderById**](RolleApi.md#rolleControllerRemoveServiceProviderById) | **DELETE** /api/rolle/{rolleId}/serviceProviders | -[**rolleControllerUpdateRolle**](RolleApi.md#rolleControllerUpdateRolle) | **PUT** /api/rolle/{rolleId} | -[**rolleControllerUpdateServiceProvidersById**](RolleApi.md#rolleControllerUpdateServiceProvidersById) | **PUT** /api/rolle/{rolleId}/serviceProviders | - +All URIs are relative to _http://localhost_ + +| Method | HTTP request | Description | +| -------------------------------------------------------------------------------------------------------------------- | ------------------------------------------------ | ----------- | +| [**rolleControllerAddSystemRecht**](RolleApi.md#rolleControllerAddSystemRecht) | **PATCH** /api/rolle/{rolleId} | +| [**rolleControllerCreateRolle**](RolleApi.md#rolleControllerCreateRolle) | **POST** /api/rolle | +| [**rolleControllerDeleteRolle**](RolleApi.md#rolleControllerDeleteRolle) | **DELETE** /api/rolle/{rolleId} | +| [**rolleControllerFindRolleByIdWithServiceProviders**](RolleApi.md#rolleControllerFindRolleByIdWithServiceProviders) | **GET** /api/rolle/{rolleId} | +| [**rolleControllerFindRollen**](RolleApi.md#rolleControllerFindRollen) | **GET** /api/rolle | +| [**rolleControllerGetRolleServiceProviderIds**](RolleApi.md#rolleControllerGetRolleServiceProviderIds) | **GET** /api/rolle/{rolleId}/serviceProviders | +| [**rolleControllerRemoveServiceProviderById**](RolleApi.md#rolleControllerRemoveServiceProviderById) | **DELETE** /api/rolle/{rolleId}/serviceProviders | +| [**rolleControllerUpdateRolle**](RolleApi.md#rolleControllerUpdateRolle) | **PUT** /api/rolle/{rolleId} | +| [**rolleControllerUpdateServiceProvidersById**](RolleApi.md#rolleControllerUpdateServiceProvidersById) | **PUT** /api/rolle/{rolleId}/serviceProviders | # **rolleControllerAddSystemRecht** + > void rolleControllerAddSystemRecht(addSystemrechtBodyParams) Add systemrecht to a rolle. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerAddSystemRechtRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerAddSystemRechtRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerAddSystemRechtRequest = { - // The id for the rolle. + // The id for the rolle. rolleId: "rolleId_example", - + addSystemrechtBodyParams: { systemRecht: "ROLLEN_VERWALTEN", }, }; const data = await apiInstance.rolleControllerAddSystemRecht(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **addSystemrechtBodyParams** | **AddSystemrechtBodyParams**| | - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ---------------------------- | ---------------------------- | --------------------- | --------------------- | +| **addSystemrechtBodyParams** | **AddSystemrechtBodyParams** | | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -62,62 +59,56 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: Not defined - +- **Content-Type**: application/json +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The systemrecht was successfully added to rolle. | - | -**400** | The input was not valid. | - | -**401** | Not authorized to create the rolle. | - | -**403** | Insufficient permissions to create the rolle. | - | -**500** | Internal server error while adding systemrecht to rolle. | - | + +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------- | ---------------- | +| **200** | The systemrecht was successfully added to rolle. | - | +| **400** | The input was not valid. | - | +| **401** | Not authorized to create the rolle. | - | +| **403** | Insufficient permissions to create the rolle. | - | +| **500** | Internal server error while adding systemrecht to rolle. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerCreateRolle** + > RolleResponse rolleControllerCreateRolle(createRolleBodyParams) Create a new rolle. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerCreateRolleRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerCreateRolleRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerCreateRolleRequest = { - createRolleBodyParams: { name: "name_example", - administeredBySchulstrukturknoten: "administeredBySchulstrukturknoten_example", + administeredBySchulstrukturknoten: + "administeredBySchulstrukturknoten_example", rollenart: "LERN", - merkmale: [ - "BEFRISTUNG_PFLICHT", - ], - systemrechte: [ - "ROLLEN_VERWALTEN", - ], + merkmale: ["BEFRISTUNG_PFLICHT"], + systemrechte: ["ROLLEN_VERWALTEN"], }, }; const data = await apiInstance.rolleControllerCreateRolle(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **createRolleBodyParams** | **CreateRolleBodyParams**| | - +| Name | Type | Description | Notes | +| ------------------------- | ------------------------- | ----------- | ----- | +| **createRolleBodyParams** | **CreateRolleBodyParams** | | ### Return type @@ -129,52 +120,50 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**201** | The rolle was successfully created. | - | -**400** | The input was not valid. | - | -**401** | Not authorized to create the rolle. | - | -**403** | Insufficient permissions to create the rolle. | - | -**500** | Internal server error while creating the rolle. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------- | ---------------- | +| **201** | The rolle was successfully created. | - | +| **400** | The input was not valid. | - | +| **401** | Not authorized to create the rolle. | - | +| **403** | Insufficient permissions to create the rolle. | - | +| **500** | Internal server error while creating the rolle. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerDeleteRolle** + > void rolleControllerDeleteRolle() Delete a role by id. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerDeleteRolleRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerDeleteRolleRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerDeleteRolleRequest = { - // The id for the rolle. + // The id for the rolle. rolleId: "rolleId_example", }; const data = await apiInstance.rolleControllerDeleteRolle(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ----------- | ------------ | --------------------- | --------------------- | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -186,51 +175,51 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**204** | Role was deleted successfully. | - | -**400** | The input was not valid. | - | -**401** | Not authorized to delete the role. | - | -**404** | The rolle that should be deleted does not exist. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------ | ---------------- | +| **204** | Role was deleted successfully. | - | +| **400** | The input was not valid. | - | +| **401** | Not authorized to delete the role. | - | +| **404** | The rolle that should be deleted does not exist. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerFindRolleByIdWithServiceProviders** + > RolleWithServiceProvidersResponse rolleControllerFindRolleByIdWithServiceProviders() Get rolle by id. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); -const request: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest = { +const request: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest = + { // The id for the rolle. - rolleId: "rolleId_example", -}; + rolleId: "rolleId_example", + }; -const data = await apiInstance.rolleControllerFindRolleByIdWithServiceProviders(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.rolleControllerFindRolleByIdWithServiceProviders(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ----------- | ------------ | --------------------- | --------------------- | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -242,57 +231,55 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The rolle was successfully returned. | - | -**401** | Not authorized to get rolle by id. | - | -**403** | Insufficient permission to get rolle by id. | - | -**500** | Internal server error while getting rolle by id. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------ | ---------------- | +| **200** | The rolle was successfully returned. | - | +| **401** | Not authorized to get rolle by id. | - | +| **403** | Insufficient permission to get rolle by id. | - | +| **500** | Internal server error while getting rolle by id. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerFindRollen** + > Array rolleControllerFindRollen() List all rollen. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerFindRollenRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerFindRollenRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerFindRollenRequest = { - // The offset of the paginated list. (optional) + // The offset of the paginated list. (optional) offset: 3.14, - // The requested limit for the page size. (optional) + // The requested limit for the page size. (optional) limit: 3.14, - // The name for the role. (optional) + // The name for the role. (optional) searchStr: "searchStr_example", }; const data = await apiInstance.rolleControllerFindRollen(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined - **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined - **searchStr** | [**string**] | The name for the role. | (optional) defaults to undefined - +| Name | Type | Description | Notes | +| ------------- | ------------ | -------------------------------------- | -------------------------------- | +| **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined | +| **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined | +| **searchStr** | [**string**] | The name for the role. | (optional) defaults to undefined | ### Return type @@ -304,51 +291,50 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The rollen were successfully returned | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| -**401** | Not authorized to get rollen. | - | -**403** | Insufficient permissions to get rollen. | - | -**500** | Internal server error while getting all rollen. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- | +| **200** | The rollen were successfully returned | _ X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
_ X-Paging-Limit - The maximum amount of items returned in one request.
_ X-Paging-Total - The total amount of items in the list.
_ X-Paging-pageTotal - The total amount of items in the paginated list.
| +| **401** | Not authorized to get rollen. | - | +| **403** | Insufficient permissions to get rollen. | - | +| **500** | Internal server error while getting all rollen. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerGetRolleServiceProviderIds** + > RolleServiceProviderResponse rolleControllerGetRolleServiceProviderIds() Get service-providers for a rolle by its id. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerGetRolleServiceProviderIdsRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerGetRolleServiceProviderIdsRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerGetRolleServiceProviderIdsRequest = { - // The id for the rolle. + // The id for the rolle. rolleId: "rolleId_example", }; -const data = await apiInstance.rolleControllerGetRolleServiceProviderIds(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.rolleControllerGetRolleServiceProviderIds(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ----------- | ------------ | --------------------- | --------------------- | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -360,58 +346,55 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: application/json - +- **Content-Type**: Not defined +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Returns a list of service-provider ids. | - | -**401** | Not authorized to retrieve service-providers for rolle. | - | -**404** | The rolle does not exist. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------- | ---------------- | +| **200** | Returns a list of service-provider ids. | - | +| **401** | Not authorized to retrieve service-providers for rolle. | - | +| **404** | The rolle does not exist. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerRemoveServiceProviderById** + > void rolleControllerRemoveServiceProviderById(rolleServiceProviderBodyParams) Remove a service-provider from a rolle by id. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerRemoveServiceProviderByIdRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerRemoveServiceProviderByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerRemoveServiceProviderByIdRequest = { - // The id for the rolle. + // The id for the rolle. rolleId: "rolleId_example", - + rolleServiceProviderBodyParams: { - serviceProviderIds: [ - "serviceProviderIds_example", - ], + serviceProviderIds: ["serviceProviderIds_example"], version: 3.14, }, }; -const data = await apiInstance.rolleControllerRemoveServiceProviderById(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.rolleControllerRemoveServiceProviderById(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleServiceProviderBodyParams** | **RolleServiceProviderBodyParams**| | - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ---------------------------------- | ---------------------------------- | --------------------- | --------------------- | +| **rolleServiceProviderBodyParams** | **RolleServiceProviderBodyParams** | | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -423,65 +406,57 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: Not defined - +- **Content-Type**: application/json +- **Accept**: Not defined ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Removing service-provider finished successfully. | - | -**401** | Not authorized to retrieve service-providers for rolle. | - | -**404** | The rolle or the service-provider that should be removed does not exist. | - | + +| Status code | Description | Response headers | +| ----------- | ------------------------------------------------------------------------ | ---------------- | +| **200** | Removing service-provider finished successfully. | - | +| **401** | Not authorized to retrieve service-providers for rolle. | - | +| **404** | The rolle or the service-provider that should be removed does not exist. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerUpdateRolle** + > RolleWithServiceProvidersResponse rolleControllerUpdateRolle(updateRolleBodyParams) Update rolle. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerUpdateRolleRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerUpdateRolleRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerUpdateRolleRequest = { - // The id for the rolle. + // The id for the rolle. rolleId: "rolleId_example", - + updateRolleBodyParams: { name: "name_example", - merkmale: [ - "BEFRISTUNG_PFLICHT", - ], - systemrechte: [ - "ROLLEN_VERWALTEN", - ], - serviceProviderIds: [ - "serviceProviderIds_example", - ], + merkmale: ["BEFRISTUNG_PFLICHT"], + systemrechte: ["ROLLEN_VERWALTEN"], + serviceProviderIds: ["serviceProviderIds_example"], version: 3.14, }, }; const data = await apiInstance.rolleControllerUpdateRolle(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **updateRolleBodyParams** | **UpdateRolleBodyParams**| | - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ------------------------- | ------------------------- | --------------------- | --------------------- | +| **updateRolleBodyParams** | **UpdateRolleBodyParams** | | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -493,60 +468,57 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | The rolle was successfully updated. | - | -**400** | The input was not valid. | - | -**401** | Not authorized to update the rolle. | - | -**403** | Insufficient permissions to update the rolle. | - | -**500** | Internal server error while updating the rolle. | - | + +| Status code | Description | Response headers | +| ----------- | ----------------------------------------------- | ---------------- | +| **200** | The rolle was successfully updated. | - | +| **400** | The input was not valid. | - | +| **401** | Not authorized to update the rolle. | - | +| **403** | Insufficient permissions to update the rolle. | - | +| **500** | Internal server error while updating the rolle. | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) # **rolleControllerUpdateServiceProvidersById** + > Array rolleControllerUpdateServiceProvidersById(rolleServiceProviderBodyParams) Add a service-provider to a rolle by id. ### Example - ```typescript -import { createConfiguration, RolleApi } from ''; -import type { RolleApiRolleControllerUpdateServiceProvidersByIdRequest } from ''; +import { createConfiguration, RolleApi } from ""; +import type { RolleApiRolleControllerUpdateServiceProvidersByIdRequest } from ""; const configuration = createConfiguration(); const apiInstance = new RolleApi(configuration); const request: RolleApiRolleControllerUpdateServiceProvidersByIdRequest = { - // The id for the rolle. + // The id for the rolle. rolleId: "rolleId_example", - + rolleServiceProviderBodyParams: { - serviceProviderIds: [ - "serviceProviderIds_example", - ], + serviceProviderIds: ["serviceProviderIds_example"], version: 3.14, }, }; -const data = await apiInstance.rolleControllerUpdateServiceProvidersById(request); -console.log('API called successfully. Returned data:', data); +const data = + await apiInstance.rolleControllerUpdateServiceProvidersById(request); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -Name | Type | Description | Notes -------------- | ------------- | ------------- | ------------- - **rolleServiceProviderBodyParams** | **RolleServiceProviderBodyParams**| | - **rolleId** | [**string**] | The id for the rolle. | defaults to undefined - +| Name | Type | Description | Notes | +| ---------------------------------- | ---------------------------------- | --------------------- | --------------------- | +| **rolleServiceProviderBodyParams** | **RolleServiceProviderBodyParams** | | +| **rolleId** | [**string**] | The id for the rolle. | defaults to undefined | ### Return type @@ -558,19 +530,17 @@ Name | Type | Description | Notes ### HTTP request headers - - **Content-Type**: application/json - - **Accept**: application/json - +- **Content-Type**: application/json +- **Accept**: application/json ### HTTP response details -| Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | Adding service-provider finished successfully. | - | -**400** | The service-provider is already attached to rolle. | - | -**401** | Not authorized to retrieve service-providers for rolle. | - | -**404** | The rolle or the service-provider to add does not exist. | - | -**500** | Internal server error, the service-provider may could not be found after attaching to rolle. | - | - -[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) +| Status code | Description | Response headers | +| ----------- | -------------------------------------------------------------------------------------------- | ---------------- | +| **200** | Adding service-provider finished successfully. | - | +| **400** | The service-provider is already attached to rolle. | - | +| **401** | Not authorized to retrieve service-providers for rolle. | - | +| **404** | The rolle or the service-provider to add does not exist. | - | +| **500** | Internal server error, the service-provider may could not be found after attaching to rolle. | - | +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) diff --git a/loadtest/api-client/generated/StatusApi.md b/loadtest/api-client/generated/StatusApi.md index 84011ac..e35ea73 100644 --- a/loadtest/api-client/generated/StatusApi.md +++ b/loadtest/api-client/generated/StatusApi.md @@ -1,21 +1,19 @@ # .StatusApi -All URIs are relative to *http://localhost* - -Method | HTTP request | Description -------------- | ------------- | ------------- -[**statusControllerGetStatus**](StatusApi.md#statusControllerGetStatus) | **GET** /api/status | +All URIs are relative to _http://localhost_ +| Method | HTTP request | Description | +| ----------------------------------------------------------------------- | ------------------- | ----------- | +| [**statusControllerGetStatus**](StatusApi.md#statusControllerGetStatus) | **GET** /api/status | # **statusControllerGetStatus** -> void statusControllerGetStatus() +> void statusControllerGetStatus() ### Example - ```typescript -import { createConfiguration, StatusApi } from ''; +import { createConfiguration, StatusApi } from ""; const configuration = createConfiguration(); const apiInstance = new StatusApi(configuration); @@ -23,13 +21,12 @@ const apiInstance = new StatusApi(configuration); const request = {}; const data = await apiInstance.statusControllerGetStatus(request); -console.log('API called successfully. Returned data:', data); +console.log("API called successfully. Returned data:", data); ``` - ### Parameters -This endpoint does not need any parameter. +This endpoint does not need any parameter. ### Return type @@ -41,15 +38,13 @@ No authorization required ### HTTP request headers - - **Content-Type**: Not defined - - **Accept**: Not defined - +- **Content-Type**: Not defined +- **Accept**: Not defined ### HTTP response details + | Status code | Description | Response headers | -|-------------|-------------|------------------| -**200** | | - | +| ----------- | ----------- | ---------------- | +| **200** | | - | [[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) - - diff --git a/loadtest/api-client/generated/apis/AuthApi.ts b/loadtest/api-client/generated/apis/AuthApi.ts index fccfd8c..b4875f3 100644 --- a/loadtest/api-client/generated/apis/AuthApi.ts +++ b/loadtest/api-client/generated/apis/AuthApi.ts @@ -1,265 +1,397 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { UserinfoResponse } from '../models/UserinfoResponse.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { UserinfoResponse } from "../models/UserinfoResponse.ts"; /** * no description */ export class AuthApiRequestFactory extends BaseAPIRequestFactory { - - /** - * Info about logged in user. - */ - public async authenticationControllerInfo(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/auth/logininfo'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + /** + * Info about logged in user. + */ + public async authenticationControllerInfo( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/auth/logininfo"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); } - - /** - * Used to start OIDC authentication. - * @param redirectUrl - */ - public async authenticationControllerLogin(redirectUrl?: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - // Path Params - const localVarPath = '/api/auth/login'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (redirectUrl !== undefined) { - requestContext.setQueryParam("redirectUrl", ObjectSerializer.serialize(redirectUrl, "string", "")); - } - - - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); } - /** - * Used to log out the current user. - */ - public async authenticationControllerLogout(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/auth/logout'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } - /** - * Redirect to Keycloak password reset. - * @param redirectUrl - * @param loginHint - */ - public async authenticationControllerResetPassword(redirectUrl: string, loginHint: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; + return requestContext; + } + + /** + * Used to start OIDC authentication. + * @param redirectUrl + */ + public async authenticationControllerLogin( + redirectUrl?: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/auth/login"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (redirectUrl !== undefined) { + requestContext.setQueryParam( + "redirectUrl", + ObjectSerializer.serialize(redirectUrl, "string", ""), + ); + } - // verify required parameter 'redirectUrl' is not null or undefined - if (redirectUrl === null || redirectUrl === undefined) { - throw new RequiredError("AuthApi", "authenticationControllerResetPassword", "redirectUrl"); - } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * Used to log out the current user. + */ + public async authenticationControllerLogout( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/auth/logout"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - // verify required parameter 'loginHint' is not null or undefined - if (loginHint === null || loginHint === undefined) { - throw new RequiredError("AuthApi", "authenticationControllerResetPassword", "loginHint"); - } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public async authenticationControllerResetPassword( + redirectUrl: string, + loginHint: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'redirectUrl' is not null or undefined + if (redirectUrl === null || redirectUrl === undefined) { + throw new RequiredError( + "AuthApi", + "authenticationControllerResetPassword", + "redirectUrl", + ); + } - // Path Params - const localVarPath = '/api/auth/reset-password'; + // verify required parameter 'loginHint' is not null or undefined + if (loginHint === null || loginHint === undefined) { + throw new RequiredError( + "AuthApi", + "authenticationControllerResetPassword", + "loginHint", + ); + } - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + // Path Params + const localVarPath = "/api/auth/reset-password"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (redirectUrl !== undefined) { + requestContext.setQueryParam( + "redirectUrl", + ObjectSerializer.serialize(redirectUrl, "string", ""), + ); + } - // Query Params - if (redirectUrl !== undefined) { - requestContext.setQueryParam("redirectUrl", ObjectSerializer.serialize(redirectUrl, "string", "")); - } + // Query Params + if (loginHint !== undefined) { + requestContext.setQueryParam( + "login_hint", + ObjectSerializer.serialize(loginHint, "string", ""), + ); + } - // Query Params - if (loginHint !== undefined) { - requestContext.setQueryParam("login_hint", ObjectSerializer.serialize(loginHint, "string", "")); - } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } +} - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } +export class AuthApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerInfo + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerInfoWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: UserinfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "UserinfoResponse", + "", + ) as UserinfoResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "User is not logged in.", + undefined, + response.headers, + ); + } - return requestContext; + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: UserinfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "UserinfoResponse", + "", + ) as UserinfoResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } -} + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerLogin + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerLoginWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("302", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Redirection to orchestrate OIDC flow.", + undefined, + response.headers, + ); + } -export class AuthApiResponseProcessor { + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to authenticationControllerInfo - * @throws ApiException if the response code was not in [200, 299] - */ - public async authenticationControllerInfoWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: UserinfoResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "UserinfoResponse", "" - ) as UserinfoResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "User is not logged in.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: UserinfoResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "UserinfoResponse", "" - ) as UserinfoResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerLogout + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerLogoutWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("302", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Redirect to logout.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while trying to log out.", + undefined, + response.headers, + ); } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to authenticationControllerLogin - * @throws ApiException if the response code was not in [200, 299] - */ - public async authenticationControllerLoginWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("302", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Redirection to orchestrate OIDC flow.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to authenticationControllerLogout - * @throws ApiException if the response code was not in [200, 299] - */ - public async authenticationControllerLogoutWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("302", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Redirect to logout.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while trying to log out.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerResetPassword + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerResetPasswordWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("302", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Redirect to Keycloak password reset page.", + undefined, + response.headers, + ); } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to authenticationControllerResetPassword - * @throws ApiException if the response code was not in [200, 299] - */ - public async authenticationControllerResetPasswordWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("302", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Redirect to Keycloak password reset page.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/Class2FAApi.ts b/loadtest/api-client/generated/apis/Class2FAApi.ts index acc7c80..0db5bb9 100644 --- a/loadtest/api-client/generated/apis/Class2FAApi.ts +++ b/loadtest/api-client/generated/apis/Class2FAApi.ts @@ -1,575 +1,939 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; -import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; -import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; -import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; -import { TokenStateResponse } from '../models/TokenStateResponse.ts'; -import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { AssignHardwareTokenBodyParams } from "../models/AssignHardwareTokenBodyParams.ts"; +import { AssignHardwareTokenResponse } from "../models/AssignHardwareTokenResponse.ts"; +import { TokenInitBodyParams } from "../models/TokenInitBodyParams.ts"; +import { TokenRequiredResponse } from "../models/TokenRequiredResponse.ts"; +import { TokenStateResponse } from "../models/TokenStateResponse.ts"; +import { TokenVerifyBodyParams } from "../models/TokenVerifyBodyParams.ts"; /** * no description */ export class Class2FAApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param assignHardwareTokenBodyParams + */ + public async privacyIdeaAdministrationControllerAssignHardwareToken( + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'assignHardwareTokenBodyParams' is not null or undefined + if ( + assignHardwareTokenBodyParams === null || + assignHardwareTokenBodyParams === undefined + ) { + throw new RequiredError( + "Class2FAApi", + "privacyIdeaAdministrationControllerAssignHardwareToken", + "assignHardwareTokenBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/2fa-token/assign/hardwareToken"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + assignHardwareTokenBodyParams, + "AssignHardwareTokenBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async privacyIdeaAdministrationControllerGetTwoAuthState( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "Class2FAApi", + "privacyIdeaAdministrationControllerGetTwoAuthState", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/2fa-token/state"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam( + "personId", + ObjectSerializer.serialize(personId, "string", ""), + ); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param tokenInitBodyParams + */ + public async privacyIdeaAdministrationControllerInitializeSoftwareToken( + tokenInitBodyParams: TokenInitBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'tokenInitBodyParams' is not null or undefined + if (tokenInitBodyParams === null || tokenInitBodyParams === undefined) { + throw new RequiredError( + "Class2FAApi", + "privacyIdeaAdministrationControllerInitializeSoftwareToken", + "tokenInitBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/2fa-token/init"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + tokenInitBodyParams, + "TokenInitBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "Class2FAApi", + "privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication", + "personId", + ); + } - /** - * @param assignHardwareTokenBodyParams - */ - public async privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'assignHardwareTokenBodyParams' is not null or undefined - if (assignHardwareTokenBodyParams === null || assignHardwareTokenBodyParams === undefined) { - throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerAssignHardwareToken", "assignHardwareTokenBodyParams"); - } - - - // Path Params - const localVarPath = '/api/2fa-token/assign/hardwareToken'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(assignHardwareTokenBodyParams, "AssignHardwareTokenBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId - */ - public async privacyIdeaAdministrationControllerGetTwoAuthState(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerGetTwoAuthState", "personId"); - } - - - // Path Params - const localVarPath = '/api/2fa-token/state'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (personId !== undefined) { - requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param tokenInitBodyParams - */ - public async privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'tokenInitBodyParams' is not null or undefined - if (tokenInitBodyParams === null || tokenInitBodyParams === undefined) { - throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerInitializeSoftwareToken", "tokenInitBodyParams"); - } - - - // Path Params - const localVarPath = '/api/2fa-token/init'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(tokenInitBodyParams, "TokenInitBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId - */ - public async privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication", "personId"); - } - - - // Path Params - const localVarPath = '/api/2fa-token/required'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (personId !== undefined) { - requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId - */ - public async privacyIdeaAdministrationControllerResetToken(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerResetToken", "personId"); - } - - - // Path Params - const localVarPath = '/api/2fa-token/reset'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (personId !== undefined) { - requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param tokenVerifyBodyParams - */ - public async privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'tokenVerifyBodyParams' is not null or undefined - if (tokenVerifyBodyParams === null || tokenVerifyBodyParams === undefined) { - throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerVerifyToken", "tokenVerifyBodyParams"); - } - - - // Path Params - const localVarPath = '/api/2fa-token/verify'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(tokenVerifyBodyParams, "TokenVerifyBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + // Path Params + const localVarPath = "/api/2fa-token/required"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam( + "personId", + ObjectSerializer.serialize(personId, "string", ""), + ); } + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async privacyIdeaAdministrationControllerResetToken( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "Class2FAApi", + "privacyIdeaAdministrationControllerResetToken", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/2fa-token/reset"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam( + "personId", + ObjectSerializer.serialize(personId, "string", ""), + ); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param tokenVerifyBodyParams + */ + public async privacyIdeaAdministrationControllerVerifyToken( + tokenVerifyBodyParams: TokenVerifyBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'tokenVerifyBodyParams' is not null or undefined + if (tokenVerifyBodyParams === null || tokenVerifyBodyParams === undefined) { + throw new RequiredError( + "Class2FAApi", + "privacyIdeaAdministrationControllerVerifyToken", + "tokenVerifyBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/2fa-token/verify"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + tokenVerifyBodyParams, + "TokenVerifyBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class Class2FAApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerAssignHardwareToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: AssignHardwareTokenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "AssignHardwareTokenResponse", + "", + ) as AssignHardwareTokenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to assign hardware token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to reset token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to assign hardware token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while assigning a hardware token.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: AssignHardwareTokenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "AssignHardwareTokenResponse", + "", + ) as AssignHardwareTokenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerGetTwoAuthState + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: TokenStateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenStateResponse", + "", + ) as TokenStateResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A username was not given or not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get token state.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get token state.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get token state.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while retrieving token state.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: TokenStateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenStateResponse", + "", + ) as TokenStateResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerInitializeSoftwareToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", + "", + ) as string; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A username was not given or not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating a token.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", + "", + ) as string; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: TokenRequiredResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenRequiredResponse", + "", + ) as TokenRequiredResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A username was not given or not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get requirement information.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get requirement information.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get requirement information.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting requirement information.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: TokenRequiredResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenRequiredResponse", + "", + ) as TokenRequiredResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerResetToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A username was not given or not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to reset token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to reset token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to reset token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while reseting a token.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerVerifyToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A username was not given or not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to verify token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to verify token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to verify token.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while verifying a token.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerAssignHardwareToken - * @throws ApiException if the response code was not in [200, 299] - */ - public async privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: AssignHardwareTokenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "AssignHardwareTokenResponse", "" - ) as AssignHardwareTokenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to assign hardware token.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to reset token.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to assign hardware token.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while assigning a hardware token.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: AssignHardwareTokenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "AssignHardwareTokenResponse", "" - ) as AssignHardwareTokenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerGetTwoAuthState - * @throws ApiException if the response code was not in [200, 299] - */ - public async privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: TokenStateResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "TokenStateResponse", "" - ) as TokenStateResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get token state.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get token state.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get token state.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while retrieving token state.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: TokenStateResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "TokenStateResponse", "" - ) as TokenStateResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerInitializeSoftwareToken - * @throws ApiException if the response code was not in [200, 299] - */ - public async privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: string = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "string", "" - ) as string; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create token.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create token.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create token.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating a token.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: string = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "string", "" - ) as string; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication - * @throws ApiException if the response code was not in [200, 299] - */ - public async privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: TokenRequiredResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "TokenRequiredResponse", "" - ) as TokenRequiredResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get requirement information.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get requirement information.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get requirement information.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting requirement information.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: TokenRequiredResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "TokenRequiredResponse", "" - ) as TokenRequiredResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerResetToken - * @throws ApiException if the response code was not in [200, 299] - */ - public async privacyIdeaAdministrationControllerResetTokenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to reset token.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to reset token.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to reset token.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while reseting a token.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerVerifyToken - * @throws ApiException if the response code was not in [200, 299] - */ - public async privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to verify token.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to verify token.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to verify token.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while verifying a token.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/CronApi.ts b/loadtest/api-client/generated/apis/CronApi.ts index 199c5f7..da0b044 100644 --- a/loadtest/api-client/generated/apis/CronApi.ts +++ b/loadtest/api-client/generated/apis/CronApi.ts @@ -1,326 +1,533 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; /** * no description */ export class CronApiRequestFactory extends BaseAPIRequestFactory { + /** + */ + public async cronControllerKoPersUserLock( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/cron/kopers-lock"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async cronControllerPersonWithoutOrgDelete( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/cron/person-without-org"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/cron/kontext-expired"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } - /** - */ - public async cronControllerKoPersUserLock(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/cron/kopers-lock'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - */ - public async cronControllerPersonWithoutOrgDelete(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/cron/person-without-org'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - */ - public async cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/cron/kontext-expired'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - */ - public async cronControllerUnlockUsersWithExpiredLocks(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/cron/unlock'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + return requestContext; + } + + /** + */ + public async cronControllerUnlockUsersWithExpiredLocks( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/cron/unlock"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class CronApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerKoPersUserLock + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerKoPersUserLockWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "User are not given or not found", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to lock user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to lock user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to lock user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while trying to lock user.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerPersonWithoutOrgDelete + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerPersonWithoutOrgDeleteWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "User are not given or not found", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to remove user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to delete user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to delete user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while trying to remove user.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Personenkontexte are not given or not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to remove personenkontexte from users.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to remove personenkontexte from users.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to remove personenkontexte from users.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while trying to remove personenkontexte from users.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerUnlockUsersWithExpiredLocks + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to unlock users.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to unlock users.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to unlock users.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while trying to unlock users.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to cronControllerKoPersUserLock - * @throws ApiException if the response code was not in [200, 299] - */ - public async cronControllerKoPersUserLockWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "User are not given or not found", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to lock user.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to lock user.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to lock user.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while trying to lock user.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to cronControllerPersonWithoutOrgDelete - * @throws ApiException if the response code was not in [200, 299] - */ - public async cronControllerPersonWithoutOrgDeleteWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "User are not given or not found", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to remove user.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to delete user.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to delete user.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while trying to remove user.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers - * @throws ApiException if the response code was not in [200, 299] - */ - public async cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Personenkontexte are not given or not found.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to remove personenkontexte from users.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to remove personenkontexte from users.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to remove personenkontexte from users.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while trying to remove personenkontexte from users.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to cronControllerUnlockUsersWithExpiredLocks - * @throws ApiException if the response code was not in [200, 299] - */ - public async cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to unlock users.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to unlock users.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to unlock users.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while trying to unlock users.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: boolean = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "boolean", "" - ) as boolean; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", + "", + ) as boolean; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts b/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts index 2671c93..77aad58 100644 --- a/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts +++ b/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts @@ -1,199 +1,313 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; - -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; -import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { DbiamPersonenkontextError } from "../models/DbiamPersonenkontextError.ts"; +import { DbiamPersonenkontextMigrationBodyParams } from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; /** * no description */ export class DbiamPersonenkontexteApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public async dBiamPersonenkontextControllerCreatePersonenkontextMigration( + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'dbiamPersonenkontextMigrationBodyParams' is not null or undefined + if ( + dbiamPersonenkontextMigrationBodyParams === null || + dbiamPersonenkontextMigrationBodyParams === undefined + ) { + throw new RequiredError( + "DbiamPersonenkontexteApi", + "dBiamPersonenkontextControllerCreatePersonenkontextMigration", + "dbiamPersonenkontextMigrationBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/dbiam/personenkontext"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + dbiamPersonenkontextMigrationBodyParams, + "DbiamPersonenkontextMigrationBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - /** - * @param dbiamPersonenkontextMigrationBodyParams - */ - public async dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'dbiamPersonenkontextMigrationBodyParams' is not null or undefined - if (dbiamPersonenkontextMigrationBodyParams === null || dbiamPersonenkontextMigrationBodyParams === undefined) { - throw new RequiredError("DbiamPersonenkontexteApi", "dBiamPersonenkontextControllerCreatePersonenkontextMigration", "dbiamPersonenkontextMigrationBodyParams"); - } - - - // Path Params - const localVarPath = '/api/dbiam/personenkontext'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(dbiamPersonenkontextMigrationBodyParams, "DbiamPersonenkontextMigrationBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The ID for the person. - */ - public async dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("DbiamPersonenkontexteApi", "dBiamPersonenkontextControllerFindPersonenkontextsByPerson", "personId"); - } - - - // Path Params - const localVarPath = '/api/dbiam/personenkontext/{personId}' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } + + /** + * @param personId The ID for the person. + */ + public async dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "DbiamPersonenkontexteApi", + "dBiamPersonenkontextControllerFindPersonenkontextsByPerson", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/dbiam/personenkontext/{personId}".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class DbiamPersonenkontexteApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenkontextControllerCreatePersonenkontextMigration + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: DBiamPersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenkontextResponse", + "", + ) as DBiamPersonenkontextResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonenkontextError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonenkontextError", + "", + ) as DbiamPersonenkontextError; + throw new ApiException( + response.httpStatusCode, + "The personenkontext could not be created, may due to unsatisfied specifications.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to create personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating personenkontext.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenkontextResponse", + "", + ) as DBiamPersonenkontextResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenkontextControllerFindPersonenkontextsByPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get available personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get personenkontexte for this user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting personenkontexte.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dBiamPersonenkontextControllerCreatePersonenkontextMigration - * @throws ApiException if the response code was not in [200, 299] - */ - public async dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: DBiamPersonenkontextResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonenkontextResponse", "" - ) as DBiamPersonenkontextResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamPersonenkontextError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamPersonenkontextError", "" - ) as DbiamPersonenkontextError; - throw new ApiException(response.httpStatusCode, "The personenkontext could not be created, may due to unsatisfied specifications.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create personenkontext.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to create personenkontext.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating personenkontext.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: DBiamPersonenkontextResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonenkontextResponse", "" - ) as DBiamPersonenkontextResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dBiamPersonenkontextControllerFindPersonenkontextsByPerson - * @throws ApiException if the response code was not in [200, 299] - */ - public async dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get available personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get personenkontexte for this user.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting personenkontexte.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts b/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts index b55103f..8f0b0b1 100644 --- a/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts +++ b/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts @@ -1,192 +1,304 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; - -import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; -import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; -import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +import { DBiamPersonenuebersichtResponse } from "../models/DBiamPersonenuebersichtResponse.ts"; +import { PersonenuebersichtBodyParams } from "../models/PersonenuebersichtBodyParams.ts"; /** * no description */ export class DbiamPersonenuebersichtApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param personenuebersichtBodyParams + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichten( + personenuebersichtBodyParams: PersonenuebersichtBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenuebersichtBodyParams' is not null or undefined + if ( + personenuebersichtBodyParams === null || + personenuebersichtBodyParams === undefined + ) { + throw new RequiredError( + "DbiamPersonenuebersichtApi", + "dBiamPersonenuebersichtControllerFindPersonenuebersichten", + "personenuebersichtBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/dbiam/personenuebersicht"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + personenuebersichtBodyParams, + "PersonenuebersichtBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The ID for the person. + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "DbiamPersonenuebersichtApi", + "dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/dbiam/personenuebersicht/{personId}".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); - /** - * @param personenuebersichtBodyParams - */ - public async dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personenuebersichtBodyParams' is not null or undefined - if (personenuebersichtBodyParams === null || personenuebersichtBodyParams === undefined) { - throw new RequiredError("DbiamPersonenuebersichtApi", "dBiamPersonenuebersichtControllerFindPersonenuebersichten", "personenuebersichtBodyParams"); - } - - - // Path Params - const localVarPath = '/api/dbiam/personenuebersicht'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(personenuebersichtBodyParams, "PersonenuebersichtBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The ID for the person. - */ - public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("DbiamPersonenuebersichtApi", "dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson", "personId"); - } - - - // Path Params - const localVarPath = '/api/dbiam/personenuebersicht/{personId}' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class DbiamPersonenuebersichtApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenuebersichtControllerFindPersonenuebersichten + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + response: ResponseContext, + ): Promise< + HttpInfo + > { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response", + "", + ) as DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get personenuebersichten.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get personenuebersichten.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting personenuebersichten.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response", + "", + ) as DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: DBiamPersonenuebersichtResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtResponse", + "", + ) as DBiamPersonenuebersichtResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get personenuebersicht.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get personenuebersicht.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting personenuebersicht.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dBiamPersonenuebersichtControllerFindPersonenuebersichten - * @throws ApiException if the response code was not in [200, 299] - */ - public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response", "" - ) as DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get personenuebersichten.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get personenuebersichten.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting personenuebersichten.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response", "" - ) as DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson - * @throws ApiException if the response code was not in [200, 299] - */ - public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: DBiamPersonenuebersichtResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonenuebersichtResponse", "" - ) as DBiamPersonenuebersichtResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get personenuebersicht.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get personenuebersicht.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting personenuebersicht.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: DBiamPersonenuebersichtResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonenuebersichtResponse", "" - ) as DBiamPersonenuebersichtResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonenuebersichtResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtResponse", + "", + ) as DBiamPersonenuebersichtResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/ImportApi.ts b/loadtest/api-client/generated/apis/ImportApi.ts index 33c03ae..736c96e 100644 --- a/loadtest/api-client/generated/apis/ImportApi.ts +++ b/loadtest/api-client/generated/apis/ImportApi.ts @@ -1,331 +1,506 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { DbiamImportError } from '../models/DbiamImportError.ts'; -import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; -import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { DbiamImportError } from "../models/DbiamImportError.ts"; +import { ImportUploadResponse } from "../models/ImportUploadResponse.ts"; +import { ImportvorgangByIdBodyParams } from "../models/ImportvorgangByIdBodyParams.ts"; /** * no description */ export class ImportApiRequestFactory extends BaseAPIRequestFactory { + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public async importControllerDeleteImportTransaction( + importvorgangId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'importvorgangId' is not null or undefined + if (importvorgangId === null || importvorgangId === undefined) { + throw new RequiredError( + "ImportApi", + "importControllerDeleteImportTransaction", + "importvorgangId", + ); + } + + // Path Params + const localVarPath = "/api/import/{importvorgangId}".replace( + "{" + "importvorgangId" + "}", + encodeURIComponent(String(importvorgangId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.DELETE, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param importvorgangByIdBodyParams + */ + public async importControllerExecuteImport( + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'importvorgangByIdBodyParams' is not null or undefined + if ( + importvorgangByIdBodyParams === null || + importvorgangByIdBodyParams === undefined + ) { + throw new RequiredError( + "ImportApi", + "importControllerExecuteImport", + "importvorgangByIdBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/import/execute"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + importvorgangByIdBodyParams, + "ImportvorgangByIdBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } - /** - * Delete a role by id. - * - * @param importvorgangId The id of an import transaction - */ - public async importControllerDeleteImportTransaction(importvorgangId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'importvorgangId' is not null or undefined - if (importvorgangId === null || importvorgangId === undefined) { - throw new RequiredError("ImportApi", "importControllerDeleteImportTransaction", "importvorgangId"); - } - - - // Path Params - const localVarPath = '/api/import/{importvorgangId}' - .replace('{' + 'importvorgangId' + '}', encodeURIComponent(String(importvorgangId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param importvorgangByIdBodyParams - */ - public async importControllerExecuteImport(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'importvorgangByIdBodyParams' is not null or undefined - if (importvorgangByIdBodyParams === null || importvorgangByIdBodyParams === undefined) { - throw new RequiredError("ImportApi", "importControllerExecuteImport", "importvorgangByIdBodyParams"); - } - - - // Path Params - const localVarPath = '/api/import/execute'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(importvorgangByIdBodyParams, "ImportvorgangByIdBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId - * @param rolleId - * @param file - */ - public async importControllerUploadFile(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("ImportApi", "importControllerUploadFile", "organisationId"); - } - - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("ImportApi", "importControllerUploadFile", "rolleId"); - } - - - // verify required parameter 'file' is not null or undefined - if (file === null || file === undefined) { - throw new RequiredError("ImportApi", "importControllerUploadFile", "file"); - } - - - // Path Params - const localVarPath = '/api/import/upload'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Form Params - const useForm = canConsumeForm([ - 'multipart/form-data', - ]); - - let localVarFormParams - if (useForm) { - localVarFormParams = new FormData(); - } else { - localVarFormParams = new URLSearchParams(); - } - - if (organisationId !== undefined) { - // TODO: replace .append with .set - localVarFormParams.append('organisationId', organisationId as any); - } - if (rolleId !== undefined) { - // TODO: replace .append with .set - localVarFormParams.append('rolleId', rolleId as any); - } - if (file !== undefined) { - // TODO: replace .append with .set - if (localVarFormParams instanceof FormData) { - localVarFormParams.append('file', file, file.name); - } - } - - requestContext.setBody(localVarFormParams); - - if(!useForm) { - const contentType = ObjectSerializer.getPreferredMediaType([ - "multipart/form-data" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - } - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + return requestContext; + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public async importControllerUploadFile( + organisationId: string, + rolleId: string, + file: HttpFile, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "ImportApi", + "importControllerUploadFile", + "organisationId", + ); } + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "ImportApi", + "importControllerUploadFile", + "rolleId", + ); + } + + // verify required parameter 'file' is not null or undefined + if (file === null || file === undefined) { + throw new RequiredError( + "ImportApi", + "importControllerUploadFile", + "file", + ); + } + + // Path Params + const localVarPath = "/api/import/upload"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Form Params + const useForm = canConsumeForm(["multipart/form-data"]); + + let localVarFormParams; + if (useForm) { + localVarFormParams = new FormData(); + } else { + localVarFormParams = new URLSearchParams(); + } + + if (organisationId !== undefined) { + // TODO: replace .append with .set + localVarFormParams.append("organisationId", organisationId as any); + } + if (rolleId !== undefined) { + // TODO: replace .append with .set + localVarFormParams.append("rolleId", rolleId as any); + } + if (file !== undefined) { + // TODO: replace .append with .set + if (localVarFormParams instanceof FormData) { + localVarFormParams.append("file", file, file.name); + } + } + + requestContext.setBody(localVarFormParams); + + if (!useForm) { + const contentType = ObjectSerializer.getPreferredMediaType([ + "multipart/form-data", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class ImportApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to importControllerDeleteImportTransaction + * @throws ApiException if the response code was not in [200, 299] + */ + public async importControllerDeleteImportTransactionWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamImportError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamImportError", + "", + ) as DbiamImportError; + throw new ApiException( + response.httpStatusCode, + "Something went wrong with the found import transaction.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to delete the import transaction.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The import transaction that should be deleted does not exist.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to importControllerExecuteImport + * @throws ApiException if the response code was not in [200, 299] + */ + public async importControllerExecuteImportWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: HttpFile = + (await response.getBodyAsFile()) as any as HttpFile; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamImportError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamImportError", + "binary", + ) as DbiamImportError; + throw new ApiException( + response.httpStatusCode, + "Something went wrong with the found import transaction.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to execute the import transaction.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to execute the import transaction.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The import transaction does not exist.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while executing the import transaction.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: HttpFile = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "HttpFile", + "binary", + ) as HttpFile; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to importControllerUploadFile + * @throws ApiException if the response code was not in [200, 299] + */ + public async importControllerUploadFileWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: ImportUploadResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ImportUploadResponse", + "", + ) as ImportUploadResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The CSV file was not valid.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to import data with a CSV file.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to import data with a CSV file.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while importing data with a CSV file.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to importControllerDeleteImportTransaction - * @throws ApiException if the response code was not in [200, 299] - */ - public async importControllerDeleteImportTransactionWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("204", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamImportError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamImportError", "" - ) as DbiamImportError; - throw new ApiException(response.httpStatusCode, "Something went wrong with the found import transaction.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to delete the import transaction.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The import transaction that should be deleted does not exist.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to importControllerExecuteImport - * @throws ApiException if the response code was not in [200, 299] - */ - public async importControllerExecuteImportWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: HttpFile = await response.getBodyAsFile() as any as HttpFile; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamImportError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamImportError", "binary" - ) as DbiamImportError; - throw new ApiException(response.httpStatusCode, "Something went wrong with the found import transaction.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to execute the import transaction.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to execute the import transaction.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The import transaction does not exist.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while executing the import transaction.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: HttpFile = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "HttpFile", "binary" - ) as HttpFile; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to importControllerUploadFile - * @throws ApiException if the response code was not in [200, 299] - */ - public async importControllerUploadFileWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: ImportUploadResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "ImportUploadResponse", "" - ) as ImportUploadResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The CSV file was not valid.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to import data with a CSV file.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to import data with a CSV file.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while importing data with a CSV file.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: ImportUploadResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "ImportUploadResponse", "" - ) as ImportUploadResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: ImportUploadResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ImportUploadResponse", + "", + ) as ImportUploadResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/OrganisationenApi.ts b/loadtest/api-client/generated/apis/OrganisationenApi.ts index 4cf1723..04f476f 100644 --- a/loadtest/api-client/generated/apis/OrganisationenApi.ts +++ b/loadtest/api-client/generated/apis/OrganisationenApi.ts @@ -1,1361 +1,2179 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; -import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; -import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; -import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; -import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { CreateOrganisationBodyParams } from "../models/CreateOrganisationBodyParams.ts"; +import { DbiamOrganisationError } from "../models/DbiamOrganisationError.ts"; +import { OrganisationByIdBodyParams } from "../models/OrganisationByIdBodyParams.ts"; +import { OrganisationByNameBodyParams } from "../models/OrganisationByNameBodyParams.ts"; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { OrganisationRootChildrenResponse } from "../models/OrganisationRootChildrenResponse.ts"; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { ParentOrganisationenResponse } from "../models/ParentOrganisationenResponse.ts"; +import { ParentOrganisationsByIdsBodyParams } from "../models/ParentOrganisationsByIdsBodyParams.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { UpdateOrganisationBodyParams } from "../models/UpdateOrganisationBodyParams.ts"; /** * no description */ export class OrganisationenApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public async organisationControllerAddAdministrierteOrganisation( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerAddAdministrierteOrganisation", + "organisationId", + ); + } + + // verify required parameter 'organisationByIdBodyParams' is not null or undefined + if ( + organisationByIdBodyParams === null || + organisationByIdBodyParams === undefined + ) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerAddAdministrierteOrganisation", + "organisationByIdBodyParams", + ); + } + + // Path Params + const localVarPath = + "/api/organisationen/{organisationId}/administriert".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + organisationByIdBodyParams, + "OrganisationByIdBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public async organisationControllerAddZugehoerigeOrganisation( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerAddZugehoerigeOrganisation", + "organisationId", + ); + } + + // verify required parameter 'organisationByIdBodyParams' is not null or undefined + if ( + organisationByIdBodyParams === null || + organisationByIdBodyParams === undefined + ) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerAddZugehoerigeOrganisation", + "organisationByIdBodyParams", + ); + } + + // Path Params + const localVarPath = + "/api/organisationen/{organisationId}/zugehoerig".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + organisationByIdBodyParams, + "OrganisationByIdBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param createOrganisationBodyParams + */ + public async organisationControllerCreateOrganisation( + createOrganisationBodyParams: CreateOrganisationBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'createOrganisationBodyParams' is not null or undefined + if ( + createOrganisationBodyParams === null || + createOrganisationBodyParams === undefined + ) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerCreateOrganisation", + "createOrganisationBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/organisationen"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + createOrganisationBodyParams, + "CreateOrganisationBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public async organisationControllerDeleteKlasse( + organisationId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerDeleteKlasse", + "organisationId", + ); + } + + // Path Params + const localVarPath = "/api/organisationen/{organisationId}/klasse".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.DELETE, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + */ + public async organisationControllerEnableForitslearning( + organisationId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerEnableForitslearning", + "organisationId", + ); + } + + // Path Params + const localVarPath = + "/api/organisationen/{organisationId}/enable-for-its-learning".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + */ + public async organisationControllerFindOrganisationById( + organisationId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerFindOrganisationById", + "organisationId", + ); + } + + // Path Params + const localVarPath = "/api/organisationen/{organisationId}".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param kennung + * @param name + * @param searchString + * @param typ + * @param systemrechte + * @param excludeTyp + * @param administriertVon + * @param organisationIds Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public async organisationControllerFindOrganizations( + offset?: number, + limit?: number, + kennung?: string, + name?: string, + searchString?: string, + typ?: OrganisationsTyp, + systemrechte?: Array, + excludeTyp?: Array, + administriertVon?: Array, + organisationIds?: Array, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/organisationen"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + + // Query Params + if (kennung !== undefined) { + requestContext.setQueryParam( + "kennung", + ObjectSerializer.serialize(kennung, "string", ""), + ); + } + + // Query Params + if (name !== undefined) { + requestContext.setQueryParam( + "name", + ObjectSerializer.serialize(name, "string", ""), + ); + } + + // Query Params + if (searchString !== undefined) { + requestContext.setQueryParam( + "searchString", + ObjectSerializer.serialize(searchString, "string", ""), + ); + } + + // Query Params + if (typ !== undefined) { + const serializedParams = ObjectSerializer.serialize( + typ, + "OrganisationsTyp", + "", + ); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + // Query Params + if (systemrechte !== undefined) { + const serializedParams = ObjectSerializer.serialize( + systemrechte, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("systemrechte", serializedParam); + } + } + + // Query Params + if (excludeTyp !== undefined) { + const serializedParams = ObjectSerializer.serialize( + excludeTyp, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("excludeTyp", serializedParam); + } + } + + // Query Params + if (administriertVon !== undefined) { + const serializedParams = ObjectSerializer.serialize( + administriertVon, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("administriertVon", serializedParam); + } + } + + // Query Params + if (organisationIds !== undefined) { + const serializedParams = ObjectSerializer.serialize( + organisationIds, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("organisationIds", serializedParam); + } + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param searchFilter + */ + public async organisationControllerGetAdministrierteOrganisationen( + organisationId: string, + offset?: number, + limit?: number, + searchFilter?: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerGetAdministrierteOrganisationen", + "organisationId", + ); + } + + // Path Params + const localVarPath = + "/api/organisationen/{organisationId}/administriert".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + + // Query Params + if (searchFilter !== undefined) { + requestContext.setQueryParam( + "searchFilter", + ObjectSerializer.serialize(searchFilter, "string", ""), + ); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public async organisationControllerGetParentsByIds( + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'parentOrganisationsByIdsBodyParams' is not null or undefined + if ( + parentOrganisationsByIdsBodyParams === null || + parentOrganisationsByIdsBodyParams === undefined + ) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerGetParentsByIds", + "parentOrganisationsByIdsBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/organisationen/parents-by-ids"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + parentOrganisationsByIdsBodyParams, + "ParentOrganisationsByIdsBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async organisationControllerGetRootChildren( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/organisationen/root/children"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async organisationControllerGetRootOrganisation( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/organisationen/root"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + */ + public async organisationControllerGetZugehoerigeOrganisationen( + organisationId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerGetZugehoerigeOrganisationen", + "organisationId", + ); + } + + // Path Params + const localVarPath = + "/api/organisationen/{organisationId}/zugehoerig".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public async organisationControllerUpdateOrganisation( + organisationId: string, + updateOrganisationBodyParams: UpdateOrganisationBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerUpdateOrganisation", + "organisationId", + ); + } + + // verify required parameter 'updateOrganisationBodyParams' is not null or undefined + if ( + updateOrganisationBodyParams === null || + updateOrganisationBodyParams === undefined + ) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerUpdateOrganisation", + "updateOrganisationBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/organisationen/{organisationId}".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + updateOrganisationBodyParams, + "UpdateOrganisationBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public async organisationControllerAddAdministrierteOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerAddAdministrierteOrganisation", "organisationId"); - } - - - // verify required parameter 'organisationByIdBodyParams' is not null or undefined - if (organisationByIdBodyParams === null || organisationByIdBodyParams === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerAddAdministrierteOrganisation", "organisationByIdBodyParams"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/administriert' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(organisationByIdBodyParams, "OrganisationByIdBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public async organisationControllerAddZugehoerigeOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerAddZugehoerigeOrganisation", "organisationId"); - } - - - // verify required parameter 'organisationByIdBodyParams' is not null or undefined - if (organisationByIdBodyParams === null || organisationByIdBodyParams === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerAddZugehoerigeOrganisation", "organisationByIdBodyParams"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/zugehoerig' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(organisationByIdBodyParams, "OrganisationByIdBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param createOrganisationBodyParams - */ - public async organisationControllerCreateOrganisation(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'createOrganisationBodyParams' is not null or undefined - if (createOrganisationBodyParams === null || createOrganisationBodyParams === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerCreateOrganisation", "createOrganisationBodyParams"); - } - - - // Path Params - const localVarPath = '/api/organisationen'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(createOrganisationBodyParams, "CreateOrganisationBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param organisationId The id of an organization - */ - public async organisationControllerDeleteKlasse(organisationId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerDeleteKlasse", "organisationId"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/klasse' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - */ - public async organisationControllerEnableForitslearning(organisationId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerEnableForitslearning", "organisationId"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/enable-for-its-learning' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - */ - public async organisationControllerFindOrganisationById(organisationId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerFindOrganisationById", "organisationId"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param kennung - * @param name - * @param searchString - * @param typ - * @param systemrechte - * @param excludeTyp - * @param administriertVon - * @param organisationIds Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). - */ - public async organisationControllerFindOrganizations(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - - - - - - - - - - // Path Params - const localVarPath = '/api/organisationen'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - // Query Params - if (kennung !== undefined) { - requestContext.setQueryParam("kennung", ObjectSerializer.serialize(kennung, "string", "")); - } - - // Query Params - if (name !== undefined) { - requestContext.setQueryParam("name", ObjectSerializer.serialize(name, "string", "")); - } - - // Query Params - if (searchString !== undefined) { - requestContext.setQueryParam("searchString", ObjectSerializer.serialize(searchString, "string", "")); - } - - // Query Params - if (typ !== undefined) { - const serializedParams = ObjectSerializer.serialize(typ, "OrganisationsTyp", ""); - for (const key of Object.keys(serializedParams)) { - requestContext.setQueryParam(key, serializedParams[key]); - } - } - - // Query Params - if (systemrechte !== undefined) { - const serializedParams = ObjectSerializer.serialize(systemrechte, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("systemrechte", serializedParam); - } - } - - // Query Params - if (excludeTyp !== undefined) { - const serializedParams = ObjectSerializer.serialize(excludeTyp, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("excludeTyp", serializedParam); - } - } - - // Query Params - if (administriertVon !== undefined) { - const serializedParams = ObjectSerializer.serialize(administriertVon, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("administriertVon", serializedParam); - } - } - - // Query Params - if (organisationIds !== undefined) { - const serializedParams = ObjectSerializer.serialize(organisationIds, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("organisationIds", serializedParam); - } - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param searchFilter - */ - public async organisationControllerGetAdministrierteOrganisationen(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerGetAdministrierteOrganisationen", "organisationId"); - } - - - - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/administriert' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - // Query Params - if (searchFilter !== undefined) { - requestContext.setQueryParam("searchFilter", ObjectSerializer.serialize(searchFilter, "string", "")); - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param parentOrganisationsByIdsBodyParams - */ - public async organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'parentOrganisationsByIdsBodyParams' is not null or undefined - if (parentOrganisationsByIdsBodyParams === null || parentOrganisationsByIdsBodyParams === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerGetParentsByIds", "parentOrganisationsByIdsBodyParams"); - } - - - // Path Params - const localVarPath = '/api/organisationen/parents-by-ids'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(parentOrganisationsByIdsBodyParams, "ParentOrganisationsByIdsBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - */ - public async organisationControllerGetRootChildren(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/organisationen/root/children'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - */ - public async organisationControllerGetRootOrganisation(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/organisationen/root'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - */ - public async organisationControllerGetZugehoerigeOrganisationen(organisationId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerGetZugehoerigeOrganisationen", "organisationId"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/zugehoerig' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - * @param updateOrganisationBodyParams - */ - public async organisationControllerUpdateOrganisation(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisation", "organisationId"); - } - - - // verify required parameter 'updateOrganisationBodyParams' is not null or undefined - if (updateOrganisationBodyParams === null || updateOrganisationBodyParams === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisation", "updateOrganisationBodyParams"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(updateOrganisationBodyParams, "UpdateOrganisationBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId The id of an organization - * @param organisationByNameBodyParams - */ - public async organisationControllerUpdateOrganisationName(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'organisationId' is not null or undefined - if (organisationId === null || organisationId === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisationName", "organisationId"); - } - - - // verify required parameter 'organisationByNameBodyParams' is not null or undefined - if (organisationByNameBodyParams === null || organisationByNameBodyParams === undefined) { - throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisationName", "organisationByNameBodyParams"); - } - - - // Path Params - const localVarPath = '/api/organisationen/{organisationId}/name' - .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(organisationByNameBodyParams, "OrganisationByNameBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public async organisationControllerUpdateOrganisationName( + organisationId: string, + organisationByNameBodyParams: OrganisationByNameBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerUpdateOrganisationName", + "organisationId", + ); + } + + // verify required parameter 'organisationByNameBodyParams' is not null or undefined + if ( + organisationByNameBodyParams === null || + organisationByNameBodyParams === undefined + ) { + throw new RequiredError( + "OrganisationenApi", + "organisationControllerUpdateOrganisationName", + "organisationByNameBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/organisationen/{organisationId}/name".replace( + "{" + "organisationId" + "}", + encodeURIComponent(String(organisationId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PATCH, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + organisationByNameBodyParams, + "OrganisationByNameBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class OrganisationenApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerAddAdministrierteOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerAddAdministrierteOrganisationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "The organisation could not be modified.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while modifying the organisation.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerAddZugehoerigeOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "The organisation could not be modified.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while modifying the organisation.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerCreateOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerCreateOrganisationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "The organisation already exists.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to create the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating the organisation.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerDeleteKlasse + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerDeleteKlasseWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "The input was not valid.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to delete the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The organisation that should be deleted does not exist.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerEnableForitslearning + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerEnableForitslearningWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", + "", + ) as OrganisationResponseLegacy; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "The organisation could not be modified.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while modifying the organisation.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", + "", + ) as OrganisationResponseLegacy; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerFindOrganisationById + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerFindOrganisationByIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Organization ID is required", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get the organization.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get the organization.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The organization does not exist.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting the organization.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerFindOrganizations + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerFindOrganizationsWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all organizations.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetAdministrierteOrganisationen + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all organizations.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetParentsByIds + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetParentsByIdsWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: ParentOrganisationenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ParentOrganisationenResponse", + "", + ) as ParentOrganisationenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get the organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get the organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting the organization.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: ParentOrganisationenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ParentOrganisationenResponse", + "", + ) as ParentOrganisationenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetRootChildren + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetRootChildrenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationRootChildrenResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationRootChildrenResponse", + "", + ) as OrganisationRootChildrenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get the organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get the organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting the organization.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationRootChildrenResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationRootChildrenResponse", + "", + ) as OrganisationRootChildrenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetRootOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetRootOrganisationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get the root organization.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get the root organization.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The root organization does not exist.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting the root organization.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetZugehoerigeOrganisationen + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get organizations.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all organizations.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerUpdateOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerUpdateOrganisationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The organisation was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", + "", + ) as OrganisationResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerUpdateOrganisationName + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerUpdateOrganisationNameWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", + "", + ) as OrganisationResponseLegacy; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", + "", + ) as DbiamOrganisationError; + throw new ApiException( + response.httpStatusCode, + "The organisation could not be modified.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to modify the organisation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while modifying the organisation.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerAddAdministrierteOrganisation - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerAddAdministrierteOrganisationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerAddZugehoerigeOrganisation - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerAddZugehoerigeOrganisationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerCreateOrganisation - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerCreateOrganisationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "The organisation already exists.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create the organisation.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to create the organisation.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating the organisation.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerDeleteKlasse - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerDeleteKlasseWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("204", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to delete the organisation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The organisation that should be deleted does not exist.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerEnableForitslearning - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerEnableForitslearningWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponseLegacy", "" - ) as OrganisationResponseLegacy; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponseLegacy", "" - ) as OrganisationResponseLegacy; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerFindOrganisationById - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerFindOrganisationByIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Organization ID is required", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get the organization.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the organization.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The organization does not exist.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting the organization.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerFindOrganizations - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerFindOrganizationsWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get organizations.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get organizations.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all organizations.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerGetAdministrierteOrganisationen - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerGetAdministrierteOrganisationenWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get organizations.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get organizations.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all organizations.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerGetParentsByIds - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerGetParentsByIdsWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: ParentOrganisationenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "ParentOrganisationenResponse", "" - ) as ParentOrganisationenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get the organizations.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the organizations.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting the organization.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: ParentOrganisationenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "ParentOrganisationenResponse", "" - ) as ParentOrganisationenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerGetRootChildren - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerGetRootChildrenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: OrganisationRootChildrenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationRootChildrenResponse", "" - ) as OrganisationRootChildrenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get the organizations.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the organizations.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting the organization.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationRootChildrenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationRootChildrenResponse", "" - ) as OrganisationRootChildrenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerGetRootOrganisation - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerGetRootOrganisationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get the root organization.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the root organization.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The root organization does not exist.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting the root organization.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerGetZugehoerigeOrganisationen - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get organizations.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get organizations.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all organizations.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerUpdateOrganisation - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerUpdateOrganisationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "Request has wrong format.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The organisation was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponse", "" - ) as OrganisationResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to organisationControllerUpdateOrganisationName - * @throws ApiException if the response code was not in [200, 299] - */ - public async organisationControllerUpdateOrganisationNameWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponseLegacy", "" - ) as OrganisationResponseLegacy; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamOrganisationError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamOrganisationError", "" - ) as DbiamOrganisationError; - throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "OrganisationResponseLegacy", "" - ) as OrganisationResponseLegacy; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", + "", + ) as OrganisationResponseLegacy; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/PersonAdministrationApi.ts b/loadtest/api-client/generated/apis/PersonAdministrationApi.ts index d646c03..bd4f830 100644 --- a/loadtest/api-client/generated/apis/PersonAdministrationApi.ts +++ b/loadtest/api-client/generated/apis/PersonAdministrationApi.ts @@ -1,107 +1,160 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { FindRollenResponse } from '../models/FindRollenResponse.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { FindRollenResponse } from "../models/FindRollenResponse.ts"; /** * no description */ export class PersonAdministrationApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param rolleName Rolle name used to filter for rollen in personenkontext. + * @param limit The limit of items for the request. + */ + public async personAdministrationControllerFindRollen( + rolleName?: string, + limit?: number, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/person-administration/rollen"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (rolleName !== undefined) { + requestContext.setQueryParam( + "rolleName", + ObjectSerializer.serialize(rolleName, "string", ""), + ); + } - /** - * @param rolleName Rolle name used to filter for rollen in personenkontext. - * @param limit The limit of items for the request. - */ - public async personAdministrationControllerFindRollen(rolleName?: string, limit?: number, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - - // Path Params - const localVarPath = '/api/person-administration/rollen'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (rolleName !== undefined) { - requestContext.setQueryParam("rolleName", ObjectSerializer.serialize(rolleName, "string", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class PersonAdministrationApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personAdministrationControllerFindRollen + * @throws ApiException if the response code was not in [200, 299] + */ + public async personAdministrationControllerFindRollenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: FindRollenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindRollenResponse", + "", + ) as FindRollenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get available rollen for the logged-in user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get rollen for the logged-in user.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting rollen for the logged-in user.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personAdministrationControllerFindRollen - * @throws ApiException if the response code was not in [200, 299] - */ - public async personAdministrationControllerFindRollenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: FindRollenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "FindRollenResponse", "" - ) as FindRollenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get available rollen for the logged-in user.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get rollen for the logged-in user.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting rollen for the logged-in user.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: FindRollenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "FindRollenResponse", "" - ) as FindRollenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: FindRollenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindRollenResponse", + "", + ) as FindRollenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/PersonInfoApi.ts b/loadtest/api-client/generated/apis/PersonInfoApi.ts index 158b2d0..239a3ce 100644 --- a/loadtest/api-client/generated/apis/PersonInfoApi.ts +++ b/loadtest/api-client/generated/apis/PersonInfoApi.ts @@ -1,88 +1,125 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; - -import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; +import { PersonInfoResponse } from "../models/PersonInfoResponse.ts"; /** * no description */ export class PersonInfoApiRequestFactory extends BaseAPIRequestFactory { + /** + * Info about logged in person. + */ + public async personInfoControllerInfo( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; - /** - * Info about logged in person. - */ - public async personInfoControllerInfo(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/person-info'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + // Path Params + const localVarPath = "/api/person-info"; + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class PersonInfoApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personInfoControllerInfo + * @throws ApiException if the response code was not in [200, 299] + */ + public async personInfoControllerInfoWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonInfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonInfoResponse", + "", + ) as PersonInfoResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "person is not logged in.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personInfoControllerInfo - * @throws ApiException if the response code was not in [200, 299] - */ - public async personInfoControllerInfoWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonInfoResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonInfoResponse", "" - ) as PersonInfoResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "person is not logged in.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonInfoResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonInfoResponse", "" - ) as PersonInfoResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonInfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonInfoResponse", + "", + ) as PersonInfoResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/PersonenApi.ts b/loadtest/api-client/generated/apis/PersonenApi.ts index b2c1dd6..e27db5a 100644 --- a/loadtest/api-client/generated/apis/PersonenApi.ts +++ b/loadtest/api-client/generated/apis/PersonenApi.ts @@ -1,1119 +1,1803 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; -import { DbiamPersonError } from '../models/DbiamPersonError.ts'; -import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; -import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; -import { PersonLockResponse } from '../models/PersonLockResponse.ts'; -import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; -import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; -import { Personenstatus } from '../models/Personenstatus.ts'; -import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; -import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { CreatePersonMigrationBodyParams } from "../models/CreatePersonMigrationBodyParams.ts"; +import { DbiamPersonError } from "../models/DbiamPersonError.ts"; +import { LockUserBodyParams } from "../models/LockUserBodyParams.ts"; +import { PersonControllerFindPersonenkontexte200Response } from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +import { PersonLockResponse } from "../models/PersonLockResponse.ts"; +import { PersonMetadataBodyParams } from "../models/PersonMetadataBodyParams.ts"; +import { PersonendatensatzResponse } from "../models/PersonendatensatzResponse.ts"; +import { Personenstatus } from "../models/Personenstatus.ts"; +import { Sichtfreigabe } from "../models/Sichtfreigabe.ts"; +import { UpdatePersonBodyParams } from "../models/UpdatePersonBodyParams.ts"; /** * no description */ export class PersonenApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param createPersonMigrationBodyParams + */ + public async personControllerCreatePersonMigration( + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'createPersonMigrationBodyParams' is not null or undefined + if ( + createPersonMigrationBodyParams === null || + createPersonMigrationBodyParams === undefined + ) { + throw new RequiredError( + "PersonenApi", + "personControllerCreatePersonMigration", + "createPersonMigrationBodyParams", + ); + } - /** - * @param createPersonMigrationBodyParams - */ - public async personControllerCreatePersonMigration(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'createPersonMigrationBodyParams' is not null or undefined - if (createPersonMigrationBodyParams === null || createPersonMigrationBodyParams === undefined) { - throw new RequiredError("PersonenApi", "personControllerCreatePersonMigration", "createPersonMigrationBodyParams"); - } - - - // Path Params - const localVarPath = '/api/personen'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(createPersonMigrationBodyParams, "CreatePersonMigrationBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * - * @param personId - */ - public async personControllerCreatePersonenkontext(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerCreatePersonenkontext", "personId"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}/personenkontexte' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - */ - public async personControllerDeletePersonById(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerDeletePersonById", "personId"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - */ - public async personControllerFindPersonById(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerFindPersonById", "personId"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param personId2 - * @param referrer - * @param personenstatus - * @param sichtfreigabe - */ - public async personControllerFindPersonenkontexte(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise { - let _config = _options || this.configuration; + // Path Params + const localVarPath = "/api/personen"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + createPersonMigrationBodyParams, + "CreatePersonMigrationBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerFindPersonenkontexte", "personId"); - } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * + * @param personId + */ + public async personControllerCreatePersonenkontext( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerCreatePersonenkontext", + "personId", + ); + } + // Path Params + const localVarPath = "/api/personen/{personId}/personenkontexte".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + */ + public async personControllerDeletePersonById( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerDeletePersonById", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/personen/{personId}".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.DELETE, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + */ + public async personControllerFindPersonById( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerFindPersonById", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/personen/{personId}".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param personId2 + * @param referrer + * @param personenstatus + * @param sichtfreigabe + */ + public async personControllerFindPersonenkontexte( + personId: string, + offset?: number, + limit?: number, + personId2?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerFindPersonenkontexte", + "personId", + ); + } + + // Path Params + const localVarPath = "/api/personen/{personId}/personenkontexte".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + + // Query Params + if (personId2 !== undefined) { + requestContext.setQueryParam( + "personId", + ObjectSerializer.serialize(personId2, "string", ""), + ); + } + + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam( + "referrer", + ObjectSerializer.serialize(referrer, "string", ""), + ); + } + + // Query Params + if (personenstatus !== undefined) { + const serializedParams = ObjectSerializer.serialize( + personenstatus, + "Personenstatus", + "", + ); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + // Query Params + if (sichtfreigabe !== undefined) { + const serializedParams = ObjectSerializer.serialize( + sichtfreigabe, + "Sichtfreigabe", + "", + ); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param referrer + * @param familienname + * @param vorname + * @param sichtfreigabe + * @param organisationIDs List of Organisation ID used to filter for Persons. + * @param rolleIDs List of Role ID used to filter for Persons. + * @param suchFilter Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param sortOrder Order to sort by. + * @param sortField Field to sort by. + */ + public async personControllerFindPersons( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/personen"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam( + "referrer", + ObjectSerializer.serialize(referrer, "string", ""), + ); + } + // Query Params + if (familienname !== undefined) { + requestContext.setQueryParam( + "familienname", + ObjectSerializer.serialize(familienname, "string", ""), + ); + } - // Path Params - const localVarPath = '/api/personen/{personId}/personenkontexte' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + // Query Params + if (vorname !== undefined) { + requestContext.setQueryParam( + "vorname", + ObjectSerializer.serialize(vorname, "string", ""), + ); + } - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + // Query Params + if (sichtfreigabe !== undefined) { + requestContext.setQueryParam( + "sichtfreigabe", + ObjectSerializer.serialize(sichtfreigabe, "'ja' | 'nein'", ""), + ); + } - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } + // Query Params + if (organisationIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize( + organisationIDs, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("organisationIDs", serializedParam); + } + } - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } + // Query Params + if (rolleIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize( + rolleIDs, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("rolleIDs", serializedParam); + } + } - // Query Params - if (personId2 !== undefined) { - requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId2, "string", "")); - } + // Query Params + if (suchFilter !== undefined) { + requestContext.setQueryParam( + "suchFilter", + ObjectSerializer.serialize(suchFilter, "string", ""), + ); + } - // Query Params - if (referrer !== undefined) { - requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); - } + // Query Params + if (sortOrder !== undefined) { + requestContext.setQueryParam( + "sortOrder", + ObjectSerializer.serialize(sortOrder, "'asc' | 'desc'", ""), + ); + } - // Query Params - if (personenstatus !== undefined) { - const serializedParams = ObjectSerializer.serialize(personenstatus, "Personenstatus", ""); - for (const key of Object.keys(serializedParams)) { - requestContext.setQueryParam(key, serializedParams[key]); - } - } + // Query Params + if (sortField !== undefined) { + requestContext.setQueryParam( + "sortField", + ObjectSerializer.serialize( + sortField, + "'familienname' | 'vorname' | 'personalnummer' | 'referrer'", + "", + ), + ); + } - // Query Params - if (sichtfreigabe !== undefined) { - const serializedParams = ObjectSerializer.serialize(sichtfreigabe, "Sichtfreigabe", ""); - for (const key of Object.keys(serializedParams)) { - requestContext.setQueryParam(key, serializedParams[key]); - } - } + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } + return requestContext; + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public async personControllerLockPerson( + personId: string, + lockUserBodyParams: LockUserBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerLockPerson", + "personId", + ); + } - return requestContext; + // verify required parameter 'lockUserBodyParams' is not null or undefined + if (lockUserBodyParams === null || lockUserBodyParams === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerLockPerson", + "lockUserBodyParams", + ); } - /** - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param referrer - * @param familienname - * @param vorname - * @param sichtfreigabe - * @param organisationIDs List of Organisation ID used to filter for Persons. - * @param rolleIDs List of Role ID used to filter for Persons. - * @param suchFilter Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param sortOrder Order to sort by. - * @param sortField Field to sort by. - */ - public async personControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise { - let _config = _options || this.configuration; + // Path Params + const localVarPath = "/api/personen/{personId}/lock-user".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(lockUserBodyParams, "LockUserBodyParams", ""), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * @param personId The id for the account. + */ + public async personControllerResetPasswordByPersonId( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerResetPasswordByPersonId", + "personId", + ); + } + // Path Params + const localVarPath = "/api/personen/{personId}/password".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PATCH, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * @param personId + */ + public async personControllerSyncPerson( + personId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerSyncPerson", + "personId", + ); + } + // Path Params + const localVarPath = "/api/personen/{personId}/sync".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + return requestContext; + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public async personControllerUpdateMetadata( + personId: string, + personMetadataBodyParams: PersonMetadataBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerUpdateMetadata", + "personId", + ); + } + // verify required parameter 'personMetadataBodyParams' is not null or undefined + if ( + personMetadataBodyParams === null || + personMetadataBodyParams === undefined + ) { + throw new RequiredError( + "PersonenApi", + "personControllerUpdateMetadata", + "personMetadataBodyParams", + ); + } + // Path Params + const localVarPath = "/api/personen/{personId}/metadata".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PATCH, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + personMetadataBodyParams, + "PersonMetadataBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } - // Path Params - const localVarPath = '/api/personen'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - // Query Params - if (referrer !== undefined) { - requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); - } - - // Query Params - if (familienname !== undefined) { - requestContext.setQueryParam("familienname", ObjectSerializer.serialize(familienname, "string", "")); - } - - // Query Params - if (vorname !== undefined) { - requestContext.setQueryParam("vorname", ObjectSerializer.serialize(vorname, "string", "")); - } - - // Query Params - if (sichtfreigabe !== undefined) { - requestContext.setQueryParam("sichtfreigabe", ObjectSerializer.serialize(sichtfreigabe, "'ja' | 'nein'", "")); - } - - // Query Params - if (organisationIDs !== undefined) { - const serializedParams = ObjectSerializer.serialize(organisationIDs, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("organisationIDs", serializedParam); - } - } - - // Query Params - if (rolleIDs !== undefined) { - const serializedParams = ObjectSerializer.serialize(rolleIDs, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("rolleIDs", serializedParam); - } - } - - // Query Params - if (suchFilter !== undefined) { - requestContext.setQueryParam("suchFilter", ObjectSerializer.serialize(suchFilter, "string", "")); - } - - // Query Params - if (sortOrder !== undefined) { - requestContext.setQueryParam("sortOrder", ObjectSerializer.serialize(sortOrder, "'asc' | 'desc'", "")); - } - - // Query Params - if (sortField !== undefined) { - requestContext.setQueryParam("sortField", ObjectSerializer.serialize(sortField, "'familienname' | 'vorname' | 'personalnummer' | 'referrer'", "")); - } + return requestContext; + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public async personControllerUpdatePerson( + personId: string, + updatePersonBodyParams: UpdatePersonBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenApi", + "personControllerUpdatePerson", + "personId", + ); + } + // verify required parameter 'updatePersonBodyParams' is not null or undefined + if ( + updatePersonBodyParams === null || + updatePersonBodyParams === undefined + ) { + throw new RequiredError( + "PersonenApi", + "personControllerUpdatePerson", + "updatePersonBodyParams", + ); + } - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } + // Path Params + const localVarPath = "/api/personen/{personId}".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + updatePersonBodyParams, + "UpdatePersonBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - /** - * @param personId - * @param lockUserBodyParams - */ - public async personControllerLockPerson(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerLockPerson", "personId"); - } - - - // verify required parameter 'lockUserBodyParams' is not null or undefined - if (lockUserBodyParams === null || lockUserBodyParams === undefined) { - throw new RequiredError("PersonenApi", "personControllerLockPerson", "lockUserBodyParams"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}/lock-user' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(lockUserBodyParams, "LockUserBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - */ - public async personControllerResetPasswordByPersonId(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerResetPasswordByPersonId", "personId"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}/password' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId - */ - public async personControllerSyncPerson(personId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerSyncPerson", "personId"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}/sync' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - * @param personMetadataBodyParams - */ - public async personControllerUpdateMetadata(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerUpdateMetadata", "personId"); - } - - - // verify required parameter 'personMetadataBodyParams' is not null or undefined - if (personMetadataBodyParams === null || personMetadataBodyParams === undefined) { - throw new RequiredError("PersonenApi", "personControllerUpdateMetadata", "personMetadataBodyParams"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}/metadata' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(personMetadataBodyParams, "PersonMetadataBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - * @param updatePersonBodyParams - */ - public async personControllerUpdatePerson(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenApi", "personControllerUpdatePerson", "personId"); - } - - - // verify required parameter 'updatePersonBodyParams' is not null or undefined - if (updatePersonBodyParams === null || updatePersonBodyParams === undefined) { - throw new RequiredError("PersonenApi", "personControllerUpdatePerson", "updatePersonBodyParams"); - } - - - // Path Params - const localVarPath = '/api/personen/{personId}' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(updatePersonBodyParams, "UpdatePersonBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class PersonenApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerCreatePersonMigration + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerCreatePersonMigrationWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A username was given. Creation with username is not supported.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create the person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create the person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create the person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating the person.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerCreatePersonenkontext + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerCreatePersonenkontextWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The personenkontext already exists.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create the personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to create the personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create personenkontext for person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating the personenkontext.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerDeletePersonById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerDeletePersonByIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The person was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerFindPersonById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerFindPersonByIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Person ID is required", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get the person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get the person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The person does not exist or insufficient permissions.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting the person.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerFindPersonenkontexte + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerFindPersonenkontexteWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonControllerFindPersonenkontexte200Response = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonControllerFindPersonenkontexte200Response", + "", + ) as PersonControllerFindPersonenkontexte200Response; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "No personenkontexte were found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all personenkontexte.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonControllerFindPersonenkontexte200Response = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonControllerFindPersonenkontexte200Response", + "", + ) as PersonControllerFindPersonenkontexte200Response; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerFindPersons + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerFindPersonsWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get persons.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get persons.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all persons.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerLockPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerLockPersonWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonLockResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonLockResponse", + "", + ) as PersonLockResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The person was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + if (isCodeInRange("502", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A downstream server returned an error.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonLockResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonLockResponse", + "", + ) as PersonLockResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerResetPasswordByPersonId + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerResetPasswordByPersonIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("202", response.httpStatusCode)) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", + "", + ) as string; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The person does not exist or insufficient permissions to update person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", + "", + ) as string; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerSyncPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerSyncPersonWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The person was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + if (isCodeInRange("502", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "A downstream server returned an error.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerUpdateMetadata + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerUpdateMetadataWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonError", + "", + ) as DbiamPersonError; + throw new ApiException( + response.httpStatusCode, + "Request has a wrong format.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to update the metadata.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not permitted to update the metadata.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while updating the metadata for user.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerUpdatePerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerUpdatePersonWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The person was not found or insufficient permissions to update person.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerCreatePersonMigration - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerCreatePersonMigrationWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A username was given. Creation with username is not supported.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create the person.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the person.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the person.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating the person.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerCreatePersonenkontext - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerCreatePersonenkontextWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The personenkontext already exists.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create the personenkontext.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to create the personenkontext.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create personenkontext for person.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating the personenkontext.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerDeletePersonById - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerDeletePersonByIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("204", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The person was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerFindPersonById - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerFindPersonByIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Person ID is required", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get the person.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the person.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The person does not exist or insufficient permissions.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting the person.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerFindPersonenkontexte - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerFindPersonenkontexteWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonControllerFindPersonenkontexte200Response = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonControllerFindPersonenkontexte200Response", "" - ) as PersonControllerFindPersonenkontexte200Response; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "No personenkontexte were found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all personenkontexte.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonControllerFindPersonenkontexte200Response = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonControllerFindPersonenkontexte200Response", "" - ) as PersonControllerFindPersonenkontexte200Response; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerFindPersons - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerFindPersonsWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get persons.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get persons.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all persons.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerLockPerson - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerLockPersonWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonLockResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonLockResponse", "" - ) as PersonLockResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The person was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - if (isCodeInRange("502", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A downstream server returned an error.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonLockResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonLockResponse", "" - ) as PersonLockResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerResetPasswordByPersonId - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerResetPasswordByPersonIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("202", response.httpStatusCode)) { - const body: string = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "string", "" - ) as string; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The person does not exist or insufficient permissions to update person.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: string = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "string", "" - ) as string; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerSyncPerson - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerSyncPersonWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The person was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - if (isCodeInRange("502", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "A downstream server returned an error.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerUpdateMetadata - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerUpdateMetadataWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamPersonError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamPersonError", "" - ) as DbiamPersonError; - throw new ApiException(response.httpStatusCode, "Request has a wrong format.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to update the metadata.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not permitted to update the metadata.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while updating the metadata for user.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personControllerUpdatePerson - * @throws ApiException if the response code was not in [200, 299] - */ - public async personControllerUpdatePersonWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The person was not found or insufficient permissions to update person.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonendatensatzResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponse", "" - ) as PersonendatensatzResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", + "", + ) as PersonendatensatzResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/PersonenFrontendApi.ts b/loadtest/api-client/generated/apis/PersonenFrontendApi.ts index d68e7f3..4440b70 100644 --- a/loadtest/api-client/generated/apis/PersonenFrontendApi.ts +++ b/loadtest/api-client/generated/apis/PersonenFrontendApi.ts @@ -1,176 +1,264 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { PersonFrontendControllerFindPersons200Response } from "../models/PersonFrontendControllerFindPersons200Response.ts"; /** * no description */ export class PersonenFrontendApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param referrer + * @param familienname + * @param vorname + * @param sichtfreigabe + * @param organisationIDs List of Organisation ID used to filter for Persons. + * @param rolleIDs List of Role ID used to filter for Persons. + * @param suchFilter Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param sortOrder Order to sort by. + * @param sortField Field to sort by. + */ + public async personFrontendControllerFindPersons( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/personen-frontend"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } - /** - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param referrer - * @param familienname - * @param vorname - * @param sichtfreigabe - * @param organisationIDs List of Organisation ID used to filter for Persons. - * @param rolleIDs List of Role ID used to filter for Persons. - * @param suchFilter Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param sortOrder Order to sort by. - * @param sortField Field to sort by. - */ - public async personFrontendControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - - - - - - - - - - - // Path Params - const localVarPath = '/api/personen-frontend'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - // Query Params - if (referrer !== undefined) { - requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); - } + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } - // Query Params - if (familienname !== undefined) { - requestContext.setQueryParam("familienname", ObjectSerializer.serialize(familienname, "string", "")); - } + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam( + "referrer", + ObjectSerializer.serialize(referrer, "string", ""), + ); + } - // Query Params - if (vorname !== undefined) { - requestContext.setQueryParam("vorname", ObjectSerializer.serialize(vorname, "string", "")); - } + // Query Params + if (familienname !== undefined) { + requestContext.setQueryParam( + "familienname", + ObjectSerializer.serialize(familienname, "string", ""), + ); + } - // Query Params - if (sichtfreigabe !== undefined) { - requestContext.setQueryParam("sichtfreigabe", ObjectSerializer.serialize(sichtfreigabe, "'ja' | 'nein'", "")); - } + // Query Params + if (vorname !== undefined) { + requestContext.setQueryParam( + "vorname", + ObjectSerializer.serialize(vorname, "string", ""), + ); + } - // Query Params - if (organisationIDs !== undefined) { - const serializedParams = ObjectSerializer.serialize(organisationIDs, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("organisationIDs", serializedParam); - } - } + // Query Params + if (sichtfreigabe !== undefined) { + requestContext.setQueryParam( + "sichtfreigabe", + ObjectSerializer.serialize(sichtfreigabe, "'ja' | 'nein'", ""), + ); + } - // Query Params - if (rolleIDs !== undefined) { - const serializedParams = ObjectSerializer.serialize(rolleIDs, "Array", ""); - for (const serializedParam of serializedParams) { - requestContext.appendQueryParam("rolleIDs", serializedParam); - } - } + // Query Params + if (organisationIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize( + organisationIDs, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("organisationIDs", serializedParam); + } + } - // Query Params - if (suchFilter !== undefined) { - requestContext.setQueryParam("suchFilter", ObjectSerializer.serialize(suchFilter, "string", "")); - } + // Query Params + if (rolleIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize( + rolleIDs, + "Array", + "", + ); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("rolleIDs", serializedParam); + } + } - // Query Params - if (sortOrder !== undefined) { - requestContext.setQueryParam("sortOrder", ObjectSerializer.serialize(sortOrder, "'asc' | 'desc'", "")); - } + // Query Params + if (suchFilter !== undefined) { + requestContext.setQueryParam( + "suchFilter", + ObjectSerializer.serialize(suchFilter, "string", ""), + ); + } - // Query Params - if (sortField !== undefined) { - requestContext.setQueryParam("sortField", ObjectSerializer.serialize(sortField, "'familienname' | 'vorname' | 'personalnummer' | 'referrer'", "")); - } + // Query Params + if (sortOrder !== undefined) { + requestContext.setQueryParam( + "sortOrder", + ObjectSerializer.serialize(sortOrder, "'asc' | 'desc'", ""), + ); + } + // Query Params + if (sortField !== undefined) { + requestContext.setQueryParam( + "sortField", + ObjectSerializer.serialize( + sortField, + "'familienname' | 'vorname' | 'personalnummer' | 'referrer'", + "", + ), + ); + } - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class PersonenFrontendApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personFrontendControllerFindPersons + * @throws ApiException if the response code was not in [200, 299] + */ + public async personFrontendControllerFindPersonsWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonFrontendControllerFindPersons200Response = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonFrontendControllerFindPersons200Response", + "", + ) as PersonFrontendControllerFindPersons200Response; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get persons.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get persons.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all persons.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personFrontendControllerFindPersons - * @throws ApiException if the response code was not in [200, 299] - */ - public async personFrontendControllerFindPersonsWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonFrontendControllerFindPersons200Response = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonFrontendControllerFindPersons200Response", "" - ) as PersonFrontendControllerFindPersons200Response; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get persons.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get persons.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all persons.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonFrontendControllerFindPersons200Response = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonFrontendControllerFindPersons200Response", "" - ) as PersonFrontendControllerFindPersons200Response; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonFrontendControllerFindPersons200Response = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonFrontendControllerFindPersons200Response", + "", + ) as PersonFrontendControllerFindPersons200Response; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/PersonenkontextApi.ts b/loadtest/api-client/generated/apis/PersonenkontextApi.ts index 98e15ce..ac2756d 100644 --- a/loadtest/api-client/generated/apis/PersonenkontextApi.ts +++ b/loadtest/api-client/generated/apis/PersonenkontextApi.ts @@ -1,442 +1,696 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; -import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; -import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; -import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; -import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; -import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; -import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; -import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { DBiamPersonResponse } from "../models/DBiamPersonResponse.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DbiamPersonenkontextError } from "../models/DbiamPersonenkontextError.ts"; +import { DbiamPersonenkontexteUpdateError } from "../models/DbiamPersonenkontexteUpdateError.ts"; +import { DbiamUpdatePersonenkontexteBodyParams } from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +import { FindSchulstrukturknotenResponse } from "../models/FindSchulstrukturknotenResponse.ts"; +import { PersonenkontextWorkflowResponse } from "../models/PersonenkontextWorkflowResponse.ts"; +import { PersonenkontexteUpdateResponse } from "../models/PersonenkontexteUpdateResponse.ts"; /** * no description */ export class PersonenkontextApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param personalnummer + */ + public async dbiamPersonenkontextWorkflowControllerCommit( + personId: string, + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, + personalnummer?: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenkontextApi", + "dbiamPersonenkontextWorkflowControllerCommit", + "personId", + ); + } + + // verify required parameter 'dbiamUpdatePersonenkontexteBodyParams' is not null or undefined + if ( + dbiamUpdatePersonenkontexteBodyParams === null || + dbiamUpdatePersonenkontexteBodyParams === undefined + ) { + throw new RequiredError( + "PersonenkontextApi", + "dbiamPersonenkontextWorkflowControllerCommit", + "dbiamUpdatePersonenkontexteBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/personenkontext-workflow/{personId}".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (personalnummer !== undefined) { + requestContext.setQueryParam( + "personalnummer", + ObjectSerializer.serialize(personalnummer, "string", ""), + ); + } + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + dbiamUpdatePersonenkontexteBodyParams, + "DbiamUpdatePersonenkontexteBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public async dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'dbiamCreatePersonWithPersonenkontexteBodyParams' is not null or undefined + if ( + dbiamCreatePersonWithPersonenkontexteBodyParams === null || + dbiamCreatePersonWithPersonenkontexteBodyParams === undefined + ) { + throw new RequiredError( + "PersonenkontextApi", + "dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte", + "dbiamCreatePersonWithPersonenkontexteBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/personenkontext-workflow"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + dbiamCreatePersonWithPersonenkontexteBodyParams, + "DbiamCreatePersonWithPersonenkontexteBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } - /** - * @param personId The ID for the person. - * @param dbiamUpdatePersonenkontexteBodyParams - * @param personalnummer - */ - public async dbiamPersonenkontextWorkflowControllerCommit(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerCommit", "personId"); - } - - - // verify required parameter 'dbiamUpdatePersonenkontexteBodyParams' is not null or undefined - if (dbiamUpdatePersonenkontexteBodyParams === null || dbiamUpdatePersonenkontexteBodyParams === undefined) { - throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerCommit", "dbiamUpdatePersonenkontexteBodyParams"); - } - - - - // Path Params - const localVarPath = '/api/personenkontext-workflow/{personId}' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (personalnummer !== undefined) { - requestContext.setQueryParam("personalnummer", ObjectSerializer.serialize(personalnummer, "string", "")); - } - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(dbiamUpdatePersonenkontexteBodyParams, "DbiamUpdatePersonenkontexteBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param dbiamCreatePersonWithPersonenkontexteBodyParams - */ - public async dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'dbiamCreatePersonWithPersonenkontexteBodyParams' is not null or undefined - if (dbiamCreatePersonWithPersonenkontexteBodyParams === null || dbiamCreatePersonWithPersonenkontexteBodyParams === undefined) { - throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte", "dbiamCreatePersonWithPersonenkontexteBodyParams"); - } - - - // Path Params - const localVarPath = '/api/personenkontext-workflow'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(dbiamCreatePersonWithPersonenkontexteBodyParams, "DbiamCreatePersonWithPersonenkontexteBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. - * @param sskName Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param limit The limit of items for the request. - */ - public async dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten", "rolleId"); - } - - - - - // Path Params - const localVarPath = '/api/personenkontext-workflow/schulstrukturknoten'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (rolleId !== undefined) { - requestContext.setQueryParam("rolleId", ObjectSerializer.serialize(rolleId, "string", "")); - } - - // Query Params - if (sskName !== undefined) { - requestContext.setQueryParam("sskName", ObjectSerializer.serialize(sskName, "string", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param organisationId ID of the organisation to filter the rollen later - * @param rolleId ID of the rolle. - * @param rolleName Rolle name used to filter for rollen in personenkontext. - * @param organisationName Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param limit The limit of items for the request. - */ - public async dbiamPersonenkontextWorkflowControllerProcessStep(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - - - - - // Path Params - const localVarPath = '/api/personenkontext-workflow/step'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (organisationId !== undefined) { - requestContext.setQueryParam("organisationId", ObjectSerializer.serialize(organisationId, "string", "")); - } - - // Query Params - if (rolleId !== undefined) { - requestContext.setQueryParam("rolleId", ObjectSerializer.serialize(rolleId, "string", "")); - } + return requestContext; + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param sskName Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param limit The limit of items for the request. + */ + public async dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + rolleId: string, + sskName?: string, + limit?: number, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "PersonenkontextApi", + "dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten", + "rolleId", + ); + } + + // Path Params + const localVarPath = "/api/personenkontext-workflow/schulstrukturknoten"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (rolleId !== undefined) { + requestContext.setQueryParam( + "rolleId", + ObjectSerializer.serialize(rolleId, "string", ""), + ); + } + + // Query Params + if (sskName !== undefined) { + requestContext.setQueryParam( + "sskName", + ObjectSerializer.serialize(sskName, "string", ""), + ); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId ID of the organisation to filter the rollen later + * @param rolleId ID of the rolle. + * @param rolleName Rolle name used to filter for rollen in personenkontext. + * @param organisationName Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param limit The limit of items for the request. + */ + public async dbiamPersonenkontextWorkflowControllerProcessStep( + organisationId?: string, + rolleId?: string, + rolleName?: string, + organisationName?: string, + limit?: number, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/personenkontext-workflow/step"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (organisationId !== undefined) { + requestContext.setQueryParam( + "organisationId", + ObjectSerializer.serialize(organisationId, "string", ""), + ); + } + + // Query Params + if (rolleId !== undefined) { + requestContext.setQueryParam( + "rolleId", + ObjectSerializer.serialize(rolleId, "string", ""), + ); + } - // Query Params - if (rolleName !== undefined) { - requestContext.setQueryParam("rolleName", ObjectSerializer.serialize(rolleName, "string", "")); - } + // Query Params + if (rolleName !== undefined) { + requestContext.setQueryParam( + "rolleName", + ObjectSerializer.serialize(rolleName, "string", ""), + ); + } - // Query Params - if (organisationName !== undefined) { - requestContext.setQueryParam("organisationName", ObjectSerializer.serialize(organisationName, "string", "")); - } + // Query Params + if (organisationName !== undefined) { + requestContext.setQueryParam( + "organisationName", + ObjectSerializer.serialize(organisationName, "string", ""), + ); + } - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class PersonenkontextApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerCommit + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonenkontexteUpdateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontexteUpdateResponse", + "", + ) as PersonenkontexteUpdateResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonenkontexteUpdateError = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonenkontexteUpdateError", + "", + ) as DbiamPersonenkontexteUpdateError; + throw new ApiException( + response.httpStatusCode, + "The personenkontexte could not be updated, may due to unsatisfied specifications.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to update personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to update personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("409", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Changes are conflicting with current state of personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while updating personenkontexte.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonenkontexteUpdateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontexteUpdateResponse", + "", + ) as PersonenkontexteUpdateResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: DBiamPersonResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonResponse", + "", + ) as DBiamPersonResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonenkontextError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonenkontextError", + "", + ) as DbiamPersonenkontextError; + throw new ApiException( + response.httpStatusCode, + "The person and the personenkontext could not be created, may due to unsatisfied specifications.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create person with personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to create person with personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating person with personenkontext.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonResponse", + "", + ) as DBiamPersonResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: FindSchulstrukturknotenResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindSchulstrukturknotenResponse", + "", + ) as FindSchulstrukturknotenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get available schulstrukturknoten for personenkontexte.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get schulstrukturknoten for personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting schulstrukturknoten for personenkontexte.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: FindSchulstrukturknotenResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindSchulstrukturknotenResponse", + "", + ) as FindSchulstrukturknotenResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerProcessStep + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonenkontextWorkflowResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextWorkflowResponse", + "", + ) as PersonenkontextWorkflowResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get available data for personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get data for personenkontext.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting data for personenkontext.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerCommit - * @throws ApiException if the response code was not in [200, 299] - */ - public async dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonenkontexteUpdateResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonenkontexteUpdateResponse", "" - ) as PersonenkontexteUpdateResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamPersonenkontexteUpdateError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamPersonenkontexteUpdateError", "" - ) as DbiamPersonenkontexteUpdateError; - throw new ApiException(response.httpStatusCode, "The personenkontexte could not be updated, may due to unsatisfied specifications.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to update personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to update personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("409", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Changes are conflicting with current state of personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while updating personenkontexte.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonenkontexteUpdateResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonenkontexteUpdateResponse", "" - ) as PersonenkontexteUpdateResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte - * @throws ApiException if the response code was not in [200, 299] - */ - public async dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: DBiamPersonResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonResponse", "" - ) as DBiamPersonResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamPersonenkontextError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamPersonenkontextError", "" - ) as DbiamPersonenkontextError; - throw new ApiException(response.httpStatusCode, "The person and the personenkontext could not be created, may due to unsatisfied specifications.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create person with personenkontext.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to create person with personenkontext.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating person with personenkontext.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: DBiamPersonResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DBiamPersonResponse", "" - ) as DBiamPersonResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten - * @throws ApiException if the response code was not in [200, 299] - */ - public async dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: FindSchulstrukturknotenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "FindSchulstrukturknotenResponse", "" - ) as FindSchulstrukturknotenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get available schulstrukturknoten for personenkontexte.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get schulstrukturknoten for personenkontext.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting schulstrukturknoten for personenkontexte.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: FindSchulstrukturknotenResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "FindSchulstrukturknotenResponse", "" - ) as FindSchulstrukturknotenResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerProcessStep - * @throws ApiException if the response code was not in [200, 299] - */ - public async dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonenkontextWorkflowResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonenkontextWorkflowResponse", "" - ) as PersonenkontextWorkflowResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get available data for personenkontext.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get data for personenkontext.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting data for personenkontext.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonenkontextWorkflowResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonenkontextWorkflowResponse", "" - ) as PersonenkontextWorkflowResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonenkontextWorkflowResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextWorkflowResponse", + "", + ) as PersonenkontextWorkflowResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/PersonenkontexteApi.ts b/loadtest/api-client/generated/apis/PersonenkontexteApi.ts index cafb585..5922374 100644 --- a/loadtest/api-client/generated/apis/PersonenkontexteApi.ts +++ b/loadtest/api-client/generated/apis/PersonenkontexteApi.ts @@ -1,512 +1,824 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; -import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; -import { Personenstatus } from '../models/Personenstatus.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; -import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { DeleteRevisionBodyParams } from "../models/DeleteRevisionBodyParams.ts"; +import { PersonendatensatzResponseAutomapper } from "../models/PersonendatensatzResponseAutomapper.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { PersonenkontextdatensatzResponse } from "../models/PersonenkontextdatensatzResponse.ts"; +import { Personenstatus } from "../models/Personenstatus.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { Sichtfreigabe } from "../models/Sichtfreigabe.ts"; +import { SystemrechtResponse } from "../models/SystemrechtResponse.ts"; /** * no description */ export class PersonenkontexteApiRequestFactory extends BaseAPIRequestFactory { + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public async personenkontextControllerDeletePersonenkontextById( + personenkontextId: string, + deleteRevisionBodyParams: DeleteRevisionBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenkontextId' is not null or undefined + if (personenkontextId === null || personenkontextId === undefined) { + throw new RequiredError( + "PersonenkontexteApi", + "personenkontextControllerDeletePersonenkontextById", + "personenkontextId", + ); + } + + // verify required parameter 'deleteRevisionBodyParams' is not null or undefined + if ( + deleteRevisionBodyParams === null || + deleteRevisionBodyParams === undefined + ) { + throw new RequiredError( + "PersonenkontexteApi", + "personenkontextControllerDeletePersonenkontextById", + "deleteRevisionBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/personenkontexte/{personenkontextId}".replace( + "{" + "personenkontextId" + "}", + encodeURIComponent(String(personenkontextId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.DELETE, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + deleteRevisionBodyParams, + "DeleteRevisionBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public async personenkontextControllerFindPersonenkontextById( + personenkontextId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenkontextId' is not null or undefined + if (personenkontextId === null || personenkontextId === undefined) { + throw new RequiredError( + "PersonenkontexteApi", + "personenkontextControllerFindPersonenkontextById", + "personenkontextId", + ); + } + + // Path Params + const localVarPath = "/api/personenkontexte/{personenkontextId}".replace( + "{" + "personenkontextId" + "}", + encodeURIComponent(String(personenkontextId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param personId + * @param referrer + * @param personenstatus + * @param sichtfreigabe + */ + public async personenkontextControllerFindPersonenkontexte( + offset?: number, + limit?: number, + personId?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/personenkontexte"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } - /** - * @param personenkontextId The id for the personenkontext. - * @param deleteRevisionBodyParams - */ - public async personenkontextControllerDeletePersonenkontextById(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personenkontextId' is not null or undefined - if (personenkontextId === null || personenkontextId === undefined) { - throw new RequiredError("PersonenkontexteApi", "personenkontextControllerDeletePersonenkontextById", "personenkontextId"); - } - - - // verify required parameter 'deleteRevisionBodyParams' is not null or undefined - if (deleteRevisionBodyParams === null || deleteRevisionBodyParams === undefined) { - throw new RequiredError("PersonenkontexteApi", "personenkontextControllerDeletePersonenkontextById", "deleteRevisionBodyParams"); - } + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam( + "personId", + ObjectSerializer.serialize(personId, "string", ""), + ); + } + + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam( + "referrer", + ObjectSerializer.serialize(referrer, "string", ""), + ); + } - - // Path Params - const localVarPath = '/api/personenkontexte/{personenkontextId}' - .replace('{' + 'personenkontextId' + '}', encodeURIComponent(String(personenkontextId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(deleteRevisionBodyParams, "DeleteRevisionBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personenkontextId The id for the personenkontext. - */ - public async personenkontextControllerFindPersonenkontextById(personenkontextId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personenkontextId' is not null or undefined - if (personenkontextId === null || personenkontextId === undefined) { - throw new RequiredError("PersonenkontexteApi", "personenkontextControllerFindPersonenkontextById", "personenkontextId"); - } - - - // Path Params - const localVarPath = '/api/personenkontexte/{personenkontextId}' - .replace('{' + 'personenkontextId' + '}', encodeURIComponent(String(personenkontextId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param personId - * @param referrer - * @param personenstatus - * @param sichtfreigabe - */ - public async personenkontextControllerFindPersonenkontexte(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - - - - - - // Path Params - const localVarPath = '/api/personenkontexte'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - // Query Params - if (personId !== undefined) { - requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); - } - - // Query Params - if (referrer !== undefined) { - requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); - } - - // Query Params - if (personenstatus !== undefined) { - const serializedParams = ObjectSerializer.serialize(personenstatus, "Personenstatus", ""); - for (const key of Object.keys(serializedParams)) { - requestContext.setQueryParam(key, serializedParams[key]); - } - } - - // Query Params - if (sichtfreigabe !== undefined) { - const serializedParams = ObjectSerializer.serialize(sichtfreigabe, "Sichtfreigabe", ""); - for (const key of Object.keys(serializedParams)) { - requestContext.setQueryParam(key, serializedParams[key]); - } - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param personId The id for the account. - * @param systemRecht - */ - public async personenkontextControllerHatSystemRecht(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personId' is not null or undefined - if (personId === null || personId === undefined) { - throw new RequiredError("PersonenkontexteApi", "personenkontextControllerHatSystemRecht", "personId"); - } - - - // verify required parameter 'systemRecht' is not null or undefined - if (systemRecht === null || systemRecht === undefined) { - throw new RequiredError("PersonenkontexteApi", "personenkontextControllerHatSystemRecht", "systemRecht"); - } - - - // Path Params - const localVarPath = '/api/personenkontexte/{personId}/hatSystemrecht' - .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (systemRecht !== undefined) { - const serializedParams = ObjectSerializer.serialize(systemRecht, "RollenSystemRecht", ""); - for (const key of Object.keys(serializedParams)) { - requestContext.setQueryParam(key, serializedParams[key]); - } - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * - * @param personenkontextId - */ - public async personenkontextControllerUpdatePersonenkontextWithId(personenkontextId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'personenkontextId' is not null or undefined - if (personenkontextId === null || personenkontextId === undefined) { - throw new RequiredError("PersonenkontexteApi", "personenkontextControllerUpdatePersonenkontextWithId", "personenkontextId"); - } - - - // Path Params - const localVarPath = '/api/personenkontexte/{personenkontextId}' - .replace('{' + 'personenkontextId' + '}', encodeURIComponent(String(personenkontextId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + // Query Params + if (personenstatus !== undefined) { + const serializedParams = ObjectSerializer.serialize( + personenstatus, + "Personenstatus", + "", + ); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } } + // Query Params + if (sichtfreigabe !== undefined) { + const serializedParams = ObjectSerializer.serialize( + sichtfreigabe, + "Sichtfreigabe", + "", + ); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public async personenkontextControllerHatSystemRecht( + personId: string, + systemRecht: RollenSystemRecht, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError( + "PersonenkontexteApi", + "personenkontextControllerHatSystemRecht", + "personId", + ); + } + + // verify required parameter 'systemRecht' is not null or undefined + if (systemRecht === null || systemRecht === undefined) { + throw new RequiredError( + "PersonenkontexteApi", + "personenkontextControllerHatSystemRecht", + "systemRecht", + ); + } + + // Path Params + const localVarPath = + "/api/personenkontexte/{personId}/hatSystemrecht".replace( + "{" + "personId" + "}", + encodeURIComponent(String(personId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (systemRecht !== undefined) { + const serializedParams = ObjectSerializer.serialize( + systemRecht, + "RollenSystemRecht", + "", + ); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * + * @param personenkontextId + */ + public async personenkontextControllerUpdatePersonenkontextWithId( + personenkontextId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenkontextId' is not null or undefined + if (personenkontextId === null || personenkontextId === undefined) { + throw new RequiredError( + "PersonenkontexteApi", + "personenkontextControllerUpdatePersonenkontextWithId", + "personenkontextId", + ); + } + + // Path Params + const localVarPath = "/api/personenkontexte/{personenkontextId}".replace( + "{" + "personenkontextId" + "}", + encodeURIComponent(String(personenkontextId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class PersonenkontexteApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerDeletePersonenkontextById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The personenkontext was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerFindPersonenkontextById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponseAutomapper = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponseAutomapper", + "", + ) as PersonendatensatzResponseAutomapper; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The personenkontext was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponseAutomapper = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponseAutomapper", + "", + ) as PersonendatensatzResponseAutomapper; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerFindPersonenkontexte + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerFindPersonenkontexteWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The personenkontexte were not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerHatSystemRecht + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerHatSystemRechtWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: SystemrechtResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "SystemrechtResponse", + "", + ) as SystemrechtResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The systemrecht could not be found (does not exist as type of systemrecht).", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: SystemrechtResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "SystemrechtResponse", + "", + ) as SystemrechtResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerUpdatePersonenkontextWithId + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextResponse", + "", + ) as PersonenkontextResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request has wrong format.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Request is not authorized.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to perform operation.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The personenkontext was not found.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "An internal server error occurred.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personenkontextControllerDeletePersonenkontextById - * @throws ApiException if the response code was not in [200, 299] - */ - public async personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("204", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The personenkontext was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personenkontextControllerFindPersonenkontextById - * @throws ApiException if the response code was not in [200, 299] - */ - public async personenkontextControllerFindPersonenkontextByIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonendatensatzResponseAutomapper = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponseAutomapper", "" - ) as PersonendatensatzResponseAutomapper; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The personenkontext was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonendatensatzResponseAutomapper = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonendatensatzResponseAutomapper", "" - ) as PersonendatensatzResponseAutomapper; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personenkontextControllerFindPersonenkontexte - * @throws ApiException if the response code was not in [200, 299] - */ - public async personenkontextControllerFindPersonenkontexteWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The personenkontexte were not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personenkontextControllerHatSystemRecht - * @throws ApiException if the response code was not in [200, 299] - */ - public async personenkontextControllerHatSystemRechtWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: SystemrechtResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "SystemrechtResponse", "" - ) as SystemrechtResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The systemrecht could not be found (does not exist as type of systemrecht).", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: SystemrechtResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "SystemrechtResponse", "" - ) as SystemrechtResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to personenkontextControllerUpdatePersonenkontextWithId - * @throws ApiException if the response code was not in [200, 299] - */ - public async personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: PersonenkontextResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonenkontextResponse", "" - ) as PersonenkontextResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The personenkontext was not found.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: PersonenkontextResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "PersonenkontextResponse", "" - ) as PersonenkontextResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextResponse", + "", + ) as PersonenkontextResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/ProviderApi.ts b/loadtest/api-client/generated/apis/ProviderApi.ts index fe7d4b9..1d80539 100644 --- a/loadtest/api-client/generated/apis/ProviderApi.ts +++ b/loadtest/api-client/generated/apis/ProviderApi.ts @@ -1,253 +1,400 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { ServiceProviderResponse } from "../models/ServiceProviderResponse.ts"; /** * no description */ export class ProviderApiRequestFactory extends BaseAPIRequestFactory { + /** + * Get all service-providers. + * + */ + public async providerControllerGetAllServiceProviders( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/provider/all"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Get service-providers available for logged-in user. + * + */ + public async providerControllerGetAvailableServiceProviders( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/provider"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } - /** - * Get all service-providers. - * - */ - public async providerControllerGetAllServiceProviders(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/provider/all'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Get service-providers available for logged-in user. - * - */ - public async providerControllerGetAvailableServiceProviders(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/provider'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * @param angebotId The id of the service provider - */ - public async providerControllerGetServiceProviderLogo(angebotId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'angebotId' is not null or undefined - if (angebotId === null || angebotId === undefined) { - throw new RequiredError("ProviderApi", "providerControllerGetServiceProviderLogo", "angebotId"); - } - - - // Path Params - const localVarPath = '/api/provider/{angebotId}/logo' - .replace('{' + 'angebotId' + '}', encodeURIComponent(String(angebotId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } + + /** + * @param angebotId The id of the service provider + */ + public async providerControllerGetServiceProviderLogo( + angebotId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'angebotId' is not null or undefined + if (angebotId === null || angebotId === undefined) { + throw new RequiredError( + "ProviderApi", + "providerControllerGetServiceProviderLogo", + "angebotId", + ); + } + + // Path Params + const localVarPath = "/api/provider/{angebotId}/logo".replace( + "{" + "angebotId" + "}", + encodeURIComponent(String(angebotId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class ProviderApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to providerControllerGetAllServiceProviders + * @throws ApiException if the response code was not in [200, 299] + */ + public async providerControllerGetAllServiceProvidersWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get available service providers.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get service-providers.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all service-providers.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to providerControllerGetAvailableServiceProviders + * @throws ApiException if the response code was not in [200, 299] + */ + public async providerControllerGetAvailableServiceProvidersWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get available service providers.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get service-providers.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all service-providers.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to providerControllerGetServiceProviderLogo + * @throws ApiException if the response code was not in [200, 299] + */ + public async providerControllerGetServiceProviderLogoWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: any = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "any", + "binary", + ) as any; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Angebot ID is required.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get service provider logo.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get the logo.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The service-provider does not exist or has no logo.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting the logo.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to providerControllerGetAllServiceProviders - * @throws ApiException if the response code was not in [200, 299] - */ - public async providerControllerGetAllServiceProvidersWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get available service providers.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get service-providers.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all service-providers.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to providerControllerGetAvailableServiceProviders - * @throws ApiException if the response code was not in [200, 299] - */ - public async providerControllerGetAvailableServiceProvidersWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get available service providers.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get service-providers.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all service-providers.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to providerControllerGetServiceProviderLogo - * @throws ApiException if the response code was not in [200, 299] - */ - public async providerControllerGetServiceProviderLogoWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: any = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "any", "binary" - ) as any; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Angebot ID is required.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get service provider logo.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the logo.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The service-provider does not exist or has no logo.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting the logo.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: any = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "any", "binary" - ) as any; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: any = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "any", + "binary", + ) as any; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/RolleApi.ts b/loadtest/api-client/generated/apis/RolleApi.ts index 5cdf96f..0069856 100644 --- a/loadtest/api-client/generated/apis/RolleApi.ts +++ b/loadtest/api-client/generated/apis/RolleApi.ts @@ -1,860 +1,1359 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - -import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; -import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; -import { DbiamRolleError } from '../models/DbiamRolleError.ts'; -import { RolleResponse } from '../models/RolleResponse.ts'; -import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; -import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; -import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; -import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; -import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; + +import { AddSystemrechtBodyParams } from "../models/AddSystemrechtBodyParams.ts"; +import { CreateRolleBodyParams } from "../models/CreateRolleBodyParams.ts"; +import { DbiamRolleError } from "../models/DbiamRolleError.ts"; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { RolleServiceProviderBodyParams } from "../models/RolleServiceProviderBodyParams.ts"; +import { RolleServiceProviderResponse } from "../models/RolleServiceProviderResponse.ts"; +import { RolleWithServiceProvidersResponse } from "../models/RolleWithServiceProvidersResponse.ts"; +import { ServiceProviderResponse } from "../models/ServiceProviderResponse.ts"; +import { UpdateRolleBodyParams } from "../models/UpdateRolleBodyParams.ts"; /** * no description */ export class RolleApiRequestFactory extends BaseAPIRequestFactory { + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public async rolleControllerAddSystemRecht( + rolleId: string, + addSystemrechtBodyParams: AddSystemrechtBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerAddSystemRecht", + "rolleId", + ); + } + + // verify required parameter 'addSystemrechtBodyParams' is not null or undefined + if ( + addSystemrechtBodyParams === null || + addSystemrechtBodyParams === undefined + ) { + throw new RequiredError( + "RolleApi", + "rolleControllerAddSystemRecht", + "addSystemrechtBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/rolle/{rolleId}".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PATCH, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + addSystemrechtBodyParams, + "AddSystemrechtBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public async rolleControllerCreateRolle( + createRolleBodyParams: CreateRolleBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'createRolleBodyParams' is not null or undefined + if (createRolleBodyParams === null || createRolleBodyParams === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerCreateRolle", + "createRolleBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/rolle"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.POST, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + createRolleBodyParams, + "CreateRolleBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public async rolleControllerDeleteRolle( + rolleId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerDeleteRolle", + "rolleId", + ); + } + + // Path Params + const localVarPath = "/api/rolle/{rolleId}".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.DELETE, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public async rolleControllerFindRolleByIdWithServiceProviders( + rolleId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerFindRolleByIdWithServiceProviders", + "rolleId", + ); + } + + // Path Params + const localVarPath = "/api/rolle/{rolleId}".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * List all rollen. + * + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param searchStr The name for the role. + */ + public async rolleControllerFindRollen( + offset?: number, + limit?: number, + searchStr?: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = "/api/rolle"; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam( + "offset", + ObjectSerializer.serialize(offset, "number", ""), + ); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam( + "limit", + ObjectSerializer.serialize(limit, "number", ""), + ); + } + + // Query Params + if (searchStr !== undefined) { + requestContext.setQueryParam( + "searchStr", + ObjectSerializer.serialize(searchStr, "string", ""), + ); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public async rolleControllerGetRolleServiceProviderIds( + rolleId: string, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerGetRolleServiceProviderIds", + "rolleId", + ); + } + + // Path Params + const localVarPath = "/api/rolle/{rolleId}/serviceProviders".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public async rolleControllerRemoveServiceProviderById( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerRemoveServiceProviderById", + "rolleId", + ); + } + + // verify required parameter 'rolleServiceProviderBodyParams' is not null or undefined + if ( + rolleServiceProviderBodyParams === null || + rolleServiceProviderBodyParams === undefined + ) { + throw new RequiredError( + "RolleApi", + "rolleControllerRemoveServiceProviderById", + "rolleServiceProviderBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/rolle/{rolleId}/serviceProviders".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.DELETE, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + rolleServiceProviderBodyParams, + "RolleServiceProviderBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public async rolleControllerUpdateRolle( + rolleId: string, + updateRolleBodyParams: UpdateRolleBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerUpdateRolle", + "rolleId", + ); + } + + // verify required parameter 'updateRolleBodyParams' is not null or undefined + if (updateRolleBodyParams === null || updateRolleBodyParams === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerUpdateRolle", + "updateRolleBodyParams", + ); + } + + // Path Params + const localVarPath = "/api/rolle/{rolleId}".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + updateRolleBodyParams, + "UpdateRolleBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public async rolleControllerUpdateServiceProvidersById( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError( + "RolleApi", + "rolleControllerUpdateServiceProvidersById", + "rolleId", + ); + } - /** - * Add systemrecht to a rolle. - * - * @param rolleId The id for the rolle. - * @param addSystemrechtBodyParams - */ - public async rolleControllerAddSystemRecht(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerAddSystemRecht", "rolleId"); - } - - - // verify required parameter 'addSystemrechtBodyParams' is not null or undefined - if (addSystemrechtBodyParams === null || addSystemrechtBodyParams === undefined) { - throw new RequiredError("RolleApi", "rolleControllerAddSystemRecht", "addSystemrechtBodyParams"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(addSystemrechtBodyParams, "AddSystemrechtBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Create a new rolle. - * - * @param createRolleBodyParams - */ - public async rolleControllerCreateRolle(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'createRolleBodyParams' is not null or undefined - if (createRolleBodyParams === null || createRolleBodyParams === undefined) { - throw new RequiredError("RolleApi", "rolleControllerCreateRolle", "createRolleBodyParams"); - } - - - // Path Params - const localVarPath = '/api/rolle'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(createRolleBodyParams, "CreateRolleBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Delete a role by id. - * - * @param rolleId The id for the rolle. - */ - public async rolleControllerDeleteRolle(rolleId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerDeleteRolle", "rolleId"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Get rolle by id. - * - * @param rolleId The id for the rolle. - */ - public async rolleControllerFindRolleByIdWithServiceProviders(rolleId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerFindRolleByIdWithServiceProviders", "rolleId"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * List all rollen. - * - * @param offset The offset of the paginated list. - * @param limit The requested limit for the page size. - * @param searchStr The name for the role. - */ - public async rolleControllerFindRollen(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - - - - // Path Params - const localVarPath = '/api/rolle'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - // Query Params - if (offset !== undefined) { - requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); - } - - // Query Params - if (limit !== undefined) { - requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); - } - - // Query Params - if (searchStr !== undefined) { - requestContext.setQueryParam("searchStr", ObjectSerializer.serialize(searchStr, "string", "")); - } - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Get service-providers for a rolle by its id. - * - * @param rolleId The id for the rolle. - */ - public async rolleControllerGetRolleServiceProviderIds(rolleId: string, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerGetRolleServiceProviderIds", "rolleId"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}/serviceProviders' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public async rolleControllerRemoveServiceProviderById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerRemoveServiceProviderById", "rolleId"); - } - - - // verify required parameter 'rolleServiceProviderBodyParams' is not null or undefined - if (rolleServiceProviderBodyParams === null || rolleServiceProviderBodyParams === undefined) { - throw new RequiredError("RolleApi", "rolleControllerRemoveServiceProviderById", "rolleServiceProviderBodyParams"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}/serviceProviders' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(rolleServiceProviderBodyParams, "RolleServiceProviderBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Update rolle. - * - * @param rolleId The id for the rolle. - * @param updateRolleBodyParams - */ - public async rolleControllerUpdateRolle(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerUpdateRolle", "rolleId"); - } - - - // verify required parameter 'updateRolleBodyParams' is not null or undefined - if (updateRolleBodyParams === null || updateRolleBodyParams === undefined) { - throw new RequiredError("RolleApi", "rolleControllerUpdateRolle", "updateRolleBodyParams"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(updateRolleBodyParams, "UpdateRolleBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; - } - - /** - * Add a service-provider to a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public async rolleControllerUpdateServiceProvidersById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise { - let _config = _options || this.configuration; - - // verify required parameter 'rolleId' is not null or undefined - if (rolleId === null || rolleId === undefined) { - throw new RequiredError("RolleApi", "rolleControllerUpdateServiceProvidersById", "rolleId"); - } - - - // verify required parameter 'rolleServiceProviderBodyParams' is not null or undefined - if (rolleServiceProviderBodyParams === null || rolleServiceProviderBodyParams === undefined) { - throw new RequiredError("RolleApi", "rolleControllerUpdateServiceProvidersById", "rolleServiceProviderBodyParams"); - } - - - // Path Params - const localVarPath = '/api/rolle/{rolleId}/serviceProviders' - .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") - - - // Body Params - const contentType = ObjectSerializer.getPreferredMediaType([ - "application/json" - ]); - requestContext.setHeaderParam("Content-Type", contentType); - const serializedBody = ObjectSerializer.stringify( - ObjectSerializer.serialize(rolleServiceProviderBodyParams, "RolleServiceProviderBodyParams", ""), - contentType - ); - requestContext.setBody(serializedBody); - - let authMethod: SecurityAuthentication | undefined; - // Apply auth methods - authMethod = _config.authMethods["bearer"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - // Apply auth methods - authMethod = _config.authMethods["oauth2"] - if (authMethod?.applySecurityAuthentication) { - await authMethod?.applySecurityAuthentication(requestContext); - } - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + // verify required parameter 'rolleServiceProviderBodyParams' is not null or undefined + if ( + rolleServiceProviderBodyParams === null || + rolleServiceProviderBodyParams === undefined + ) { + throw new RequiredError( + "RolleApi", + "rolleControllerUpdateServiceProvidersById", + "rolleServiceProviderBodyParams", + ); } + // Path Params + const localVarPath = "/api/rolle/{rolleId}/serviceProviders".replace( + "{" + "rolleId" + "}", + encodeURIComponent(String(rolleId)), + ); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.PUT, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json", + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize( + rolleServiceProviderBodyParams, + "RolleServiceProviderBodyParams", + "", + ), + contentType, + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"]; + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } } export class RolleApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerAddSystemRecht + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerAddSystemRechtWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The input was not valid.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create the rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create the rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while adding systemrecht to rolle.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerCreateRolle + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerCreateRolleWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: RolleResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleResponse", + "", + ) as RolleResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamRolleError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamRolleError", + "", + ) as DbiamRolleError; + throw new ApiException( + response.httpStatusCode, + "The input was not valid.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to create the rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to create the rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while creating the rolle.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleResponse", + "", + ) as RolleResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerDeleteRolle + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerDeleteRolleWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamRolleError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamRolleError", + "", + ) as DbiamRolleError; + throw new ApiException( + response.httpStatusCode, + "The input was not valid.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to delete the role.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The rolle that should be deleted does not exist.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerFindRolleByIdWithServiceProviders + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: RolleWithServiceProvidersResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", + "", + ) as RolleWithServiceProvidersResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get rolle by id.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permission to get rolle by id.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting rolle by id.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleWithServiceProvidersResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", + "", + ) as RolleWithServiceProvidersResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerFindRollen + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerFindRollenWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to get rollen.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to get rollen.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while getting all rollen.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerGetRolleServiceProviderIds + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: RolleServiceProviderResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleServiceProviderResponse", + "", + ) as RolleServiceProviderResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to retrieve service-providers for rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The rolle does not exist.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleServiceProviderResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleServiceProviderResponse", + "", + ) as RolleServiceProviderResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerRemoveServiceProviderById + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerRemoveServiceProviderByIdWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to retrieve service-providers for rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The rolle or the service-provider that should be removed does not exist.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerUpdateRolle + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerUpdateRolleWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: RolleWithServiceProvidersResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", + "", + ) as RolleWithServiceProvidersResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamRolleError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamRolleError", + "", + ) as DbiamRolleError; + throw new ApiException( + response.httpStatusCode, + "The input was not valid.", + body, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to update the rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Insufficient permissions to update the rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error while updating the rolle.", + undefined, + response.headers, + ); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleWithServiceProvidersResponse = + ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", + "", + ) as RolleWithServiceProvidersResponse; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerUpdateServiceProvidersById + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + response: ResponseContext, + ): Promise>> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The service-provider is already attached to rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Not authorized to retrieve service-providers for rolle.", + undefined, + response.headers, + ); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "The rolle or the service-provider to add does not exist.", + undefined, + response.headers, + ); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException( + response.httpStatusCode, + "Internal server error, the service-provider may could not be found after attaching to rolle.", + undefined, + response.headers, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerAddSystemRecht - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerAddSystemRechtWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The input was not valid.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create the rolle.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the rolle.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while adding systemrecht to rolle.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerCreateRolle - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerCreateRolleWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("201", response.httpStatusCode)) { - const body: RolleResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleResponse", "" - ) as RolleResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamRolleError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamRolleError", "" - ) as DbiamRolleError; - throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to create the rolle.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the rolle.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while creating the rolle.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: RolleResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleResponse", "" - ) as RolleResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerDeleteRolle - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerDeleteRolleWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("204", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamRolleError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamRolleError", "" - ) as DbiamRolleError; - throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to delete the role.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The rolle that should be deleted does not exist.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerFindRolleByIdWithServiceProviders - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleWithServiceProvidersResponse", "" - ) as RolleWithServiceProvidersResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get rolle by id.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permission to get rolle by id.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting rolle by id.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleWithServiceProvidersResponse", "" - ) as RolleWithServiceProvidersResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerFindRollen - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerFindRollenWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to get rollen.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to get rollen.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while getting all rollen.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerGetRolleServiceProviderIds - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerGetRolleServiceProviderIdsWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: RolleServiceProviderResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleServiceProviderResponse", "" - ) as RolleServiceProviderResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to retrieve service-providers for rolle.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The rolle does not exist.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: RolleServiceProviderResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleServiceProviderResponse", "" - ) as RolleServiceProviderResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerRemoveServiceProviderById - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerRemoveServiceProviderByIdWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to retrieve service-providers for rolle.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The rolle or the service-provider that should be removed does not exist.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerUpdateRolle - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerUpdateRolleWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleWithServiceProvidersResponse", "" - ) as RolleWithServiceProvidersResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - const body: DbiamRolleError = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "DbiamRolleError", "" - ) as DbiamRolleError; - throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to update the rolle.", undefined, response.headers); - } - if (isCodeInRange("403", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Insufficient permissions to update the rolle.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error while updating the rolle.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "RolleWithServiceProvidersResponse", "" - ) as RolleWithServiceProvidersResponse; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); - } - - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to rolleControllerUpdateServiceProvidersById - * @throws ApiException if the response code was not in [200, 299] - */ - public async rolleControllerUpdateServiceProvidersByIdWithHttpInfo(response: ResponseContext): Promise >> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - if (isCodeInRange("400", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The service-provider is already attached to rolle.", undefined, response.headers); - } - if (isCodeInRange("401", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Not authorized to retrieve service-providers for rolle.", undefined, response.headers); - } - if (isCodeInRange("404", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "The rolle or the service-provider to add does not exist.", undefined, response.headers); - } - if (isCodeInRange("500", response.httpStatusCode)) { - throw new ApiException(response.httpStatusCode, "Internal server error, the service-provider may could not be found after attaching to rolle.", undefined, response.headers); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: Array = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "Array", "" - ) as Array; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", + "", + ) as Array; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/StatusApi.ts b/loadtest/api-client/generated/apis/StatusApi.ts index 29fc775..2aa6339 100644 --- a/loadtest/api-client/generated/apis/StatusApi.ts +++ b/loadtest/api-client/generated/apis/StatusApi.ts @@ -1,68 +1,97 @@ // TODO: better import syntax? -import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; -import {Configuration} from '../configuration.ts'; -import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; -import {ObjectSerializer} from '../models/ObjectSerializer.ts'; -import {ApiException} from './exception.ts'; -import {canConsumeForm, isCodeInRange} from '../util.ts'; -import {SecurityAuthentication} from '../auth/auth.ts'; - - +import { + BaseAPIRequestFactory, + RequiredError, + COLLECTION_FORMATS, +} from "./baseapi.ts"; +import { Configuration } from "../configuration.ts"; +import { + RequestContext, + HttpMethod, + ResponseContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { ObjectSerializer } from "../models/ObjectSerializer.ts"; +import { ApiException } from "./exception.ts"; +import { canConsumeForm, isCodeInRange } from "../util.ts"; +import { SecurityAuthentication } from "../auth/auth.ts"; /** * no description */ export class StatusApiRequestFactory extends BaseAPIRequestFactory { + /** + */ + public async statusControllerGetStatus( + _options?: Configuration, + ): Promise { + let _config = _options || this.configuration; - /** - */ - public async statusControllerGetStatus(_options?: Configuration): Promise { - let _config = _options || this.configuration; - - // Path Params - const localVarPath = '/api/status'; - - // Make Request Context - const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); - requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + // Path Params + const localVarPath = "/api/status"; + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext( + localVarPath, + HttpMethod.GET, + ); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8"); - - const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default - if (defaultAuth?.applySecurityAuthentication) { - await defaultAuth?.applySecurityAuthentication(requestContext); - } - - return requestContext; + const defaultAuth: SecurityAuthentication | undefined = + _options?.authMethods?.default || + this.configuration?.authMethods?.default; + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); } + return requestContext; + } } export class StatusApiResponseProcessor { + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to statusControllerGetStatus + * @throws ApiException if the response code was not in [200, 299] + */ + public async statusControllerGetStatusWithHttpInfo( + response: ResponseContext, + ): Promise> { + const contentType = ObjectSerializer.normalizeMediaType( + response.headers["content-type"], + ); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + undefined, + ); + } - /** - * Unwraps the actual response sent by the server from the response context and deserializes the response content - * to the expected objects - * - * @params response Response returned by the server for a request to statusControllerGetStatus - * @throws ApiException if the response code was not in [200, 299] - */ - public async statusControllerGetStatusWithHttpInfo(response: ResponseContext): Promise> { - const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); - if (isCodeInRange("200", response.httpStatusCode)) { - return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); - } - - // Work around for missing responses in specification, e.g. for petstore.yaml - if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { - const body: void = ObjectSerializer.deserialize( - ObjectSerializer.parse(await response.body.text(), contentType), - "void", "" - ) as void; - return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); - } - - throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", + "", + ) as void; + return new HttpInfo( + response.httpStatusCode, + response.headers, + response.body, + body, + ); } + throw new ApiException( + response.httpStatusCode, + "Unknown API Status Code!", + await response.getBodyAsAny(), + response.headers, + ); + } } diff --git a/loadtest/api-client/generated/apis/baseapi.ts b/loadtest/api-client/generated/apis/baseapi.ts index 46ed74b..e89cb9d 100644 --- a/loadtest/api-client/generated/apis/baseapi.ts +++ b/loadtest/api-client/generated/apis/baseapi.ts @@ -1,27 +1,24 @@ -import { Configuration } from '../configuration.ts' +import { Configuration } from "../configuration.ts"; /** * * @export */ export const COLLECTION_FORMATS = { - csv: ",", - ssv: " ", - tsv: "\t", - pipes: "|", + csv: ",", + ssv: " ", + tsv: "\t", + pipes: "|", }; - /** * * @export * @class BaseAPI */ export class BaseAPIRequestFactory { - - constructor(protected configuration: Configuration) { - } -}; + constructor(protected configuration: Configuration) {} +} /** * @@ -30,8 +27,20 @@ export class BaseAPIRequestFactory { * @extends {Error} */ export class RequiredError extends Error { - name: "RequiredError" = "RequiredError"; - constructor(public api: string, public method: string, public field: string) { - super("Required parameter " + field + " was null or undefined when calling " + api + "." + method + "."); - } + name: "RequiredError" = "RequiredError"; + constructor( + public api: string, + public method: string, + public field: string, + ) { + super( + "Required parameter " + + field + + " was null or undefined when calling " + + api + + "." + + method + + ".", + ); + } } diff --git a/loadtest/api-client/generated/apis/exception.ts b/loadtest/api-client/generated/apis/exception.ts index 9365d33..f77afa0 100644 --- a/loadtest/api-client/generated/apis/exception.ts +++ b/loadtest/api-client/generated/apis/exception.ts @@ -8,8 +8,21 @@ * */ export class ApiException extends Error { - public constructor(public code: number, message: string, public body: T, public headers: { [key: string]: string; }) { - super("HTTP-Code: " + code + "\nMessage: " + message + "\nBody: " + JSON.stringify(body) + "\nHeaders: " + - JSON.stringify(headers)) - } + public constructor( + public code: number, + message: string, + public body: T, + public headers: { [key: string]: string }, + ) { + super( + "HTTP-Code: " + + code + + "\nMessage: " + + message + + "\nBody: " + + JSON.stringify(body) + + "\nHeaders: " + + JSON.stringify(headers), + ); + } } diff --git a/loadtest/api-client/generated/auth/auth.ts b/loadtest/api-client/generated/auth/auth.ts index bb62c02..24084e1 100644 --- a/loadtest/api-client/generated/auth/auth.ts +++ b/loadtest/api-client/generated/auth/auth.ts @@ -4,17 +4,17 @@ import { RequestContext } from "../http/http.ts"; * Interface authentication schemes. */ export interface SecurityAuthentication { - /* - * @return returns the name of the security authentication as specified in OAI - */ - getName(): string; - - /** - * Applies the authentication scheme to the request context - * - * @params context the request context which should use this authentication scheme - */ - applySecurityAuthentication(context: RequestContext): void | Promise; + /* + * @return returns the name of the security authentication as specified in OAI + */ + getName(): string; + + /** + * Applies the authentication scheme to the request context + * + * @params context the request context which should use this authentication scheme + */ + applySecurityAuthentication(context: RequestContext): void | Promise; } export interface TokenProvider { @@ -25,83 +25,87 @@ export interface TokenProvider { * Applies oauth2 authentication to the request context. */ export class Oauth2Authentication implements SecurityAuthentication { - /** - * Configures OAuth2 with the necessary properties - * - * @param accessToken: The access token to be used for every request - */ - public constructor(private accessToken: string) {} - - public getName(): string { - return "oauth2"; - } - - public applySecurityAuthentication(context: RequestContext) { - context.setHeaderParam("Authorization", "Bearer " + this.accessToken); - } + /** + * Configures OAuth2 with the necessary properties + * + * @param accessToken: The access token to be used for every request + */ + public constructor(private accessToken: string) {} + + public getName(): string { + return "oauth2"; + } + + public applySecurityAuthentication(context: RequestContext) { + context.setHeaderParam("Authorization", "Bearer " + this.accessToken); + } } /** * Applies http authentication to the request context. */ export class BearerAuthentication implements SecurityAuthentication { - /** - * Configures the http authentication with the required details. - * - * @param tokenProvider service that can provide the up-to-date token when needed - */ - public constructor(private tokenProvider: TokenProvider) {} - - public getName(): string { - return "bearer"; - } - - public async applySecurityAuthentication(context: RequestContext) { - context.setHeaderParam("Authorization", "Bearer " + await this.tokenProvider.getToken()); - } + /** + * Configures the http authentication with the required details. + * + * @param tokenProvider service that can provide the up-to-date token when needed + */ + public constructor(private tokenProvider: TokenProvider) {} + + public getName(): string { + return "bearer"; + } + + public async applySecurityAuthentication(context: RequestContext) { + context.setHeaderParam( + "Authorization", + "Bearer " + (await this.tokenProvider.getToken()), + ); + } } - export type AuthMethods = { - "default"?: SecurityAuthentication, - "oauth2"?: SecurityAuthentication, - "bearer"?: SecurityAuthentication -} + default?: SecurityAuthentication; + oauth2?: SecurityAuthentication; + bearer?: SecurityAuthentication; +}; export type ApiKeyConfiguration = string; -export type HttpBasicConfiguration = { "username": string, "password": string }; +export type HttpBasicConfiguration = { username: string; password: string }; export type HttpBearerConfiguration = { tokenProvider: TokenProvider }; export type OAuth2Configuration = { accessToken: string }; export type AuthMethodsConfiguration = { - "default"?: SecurityAuthentication, - "oauth2"?: OAuth2Configuration, - "bearer"?: HttpBearerConfiguration -} + default?: SecurityAuthentication; + oauth2?: OAuth2Configuration; + bearer?: HttpBearerConfiguration; +}; /** * Creates the authentication methods from a swagger description. * */ -export function configureAuthMethods(config: AuthMethodsConfiguration | undefined): AuthMethods { - let authMethods: AuthMethods = {} - - if (!config) { - return authMethods; - } - authMethods["default"] = config["default"] - - if (config["oauth2"]) { - authMethods["oauth2"] = new Oauth2Authentication( - config["oauth2"]["accessToken"] - ); - } - - if (config["bearer"]) { - authMethods["bearer"] = new BearerAuthentication( - config["bearer"]["tokenProvider"] - ); - } +export function configureAuthMethods( + config: AuthMethodsConfiguration | undefined, +): AuthMethods { + let authMethods: AuthMethods = {}; + if (!config) { return authMethods; -} \ No newline at end of file + } + authMethods["default"] = config["default"]; + + if (config["oauth2"]) { + authMethods["oauth2"] = new Oauth2Authentication( + config["oauth2"]["accessToken"], + ); + } + + if (config["bearer"]) { + authMethods["bearer"] = new BearerAuthentication( + config["bearer"]["tokenProvider"], + ); + } + + return authMethods; +} diff --git a/loadtest/api-client/generated/configuration.ts b/loadtest/api-client/generated/configuration.ts index 0a170f0..e09c05e 100644 --- a/loadtest/api-client/generated/configuration.ts +++ b/loadtest/api-client/generated/configuration.ts @@ -1,60 +1,67 @@ import { HttpLibrary } from "./http/http.ts"; -import { Middleware, PromiseMiddleware, PromiseMiddlewareWrapper } from "./middleware.ts"; +import { + Middleware, + PromiseMiddleware, + PromiseMiddlewareWrapper, +} from "./middleware.ts"; import { IsomorphicFetchHttpLibrary as DefaultHttpLibrary } from "./http/isomorphic-fetch.ts"; import { BaseServerConfiguration, server1 } from "./servers.ts"; -import { configureAuthMethods, AuthMethods, AuthMethodsConfiguration } from "./auth/auth.ts"; +import { + configureAuthMethods, + AuthMethods, + AuthMethodsConfiguration, +} from "./auth/auth.ts"; export interface Configuration { - readonly baseServer: BaseServerConfiguration; - readonly httpApi: HttpLibrary; - readonly middleware: Middleware[]; - readonly authMethods: AuthMethods; + readonly baseServer: BaseServerConfiguration; + readonly httpApi: HttpLibrary; + readonly middleware: Middleware[]; + readonly authMethods: AuthMethods; } - /** * Interface with which a configuration object can be configured. */ export interface ConfigurationParameters { - /** - * Default server to use - a list of available servers (according to the - * OpenAPI yaml definition) is included in the `servers` const in `./servers`. You can also - * create your own server with the `ServerConfiguration` class from the same - * file. - */ - baseServer?: BaseServerConfiguration; - /** - * HTTP library to use e.g. IsomorphicFetch. This can usually be skipped as - * all generators come with a default library. - * If available, additional libraries can be imported from `./http/*` - */ - httpApi?: HttpLibrary; + /** + * Default server to use - a list of available servers (according to the + * OpenAPI yaml definition) is included in the `servers` const in `./servers`. You can also + * create your own server with the `ServerConfiguration` class from the same + * file. + */ + baseServer?: BaseServerConfiguration; + /** + * HTTP library to use e.g. IsomorphicFetch. This can usually be skipped as + * all generators come with a default library. + * If available, additional libraries can be imported from `./http/*` + */ + httpApi?: HttpLibrary; - /** - * The middlewares which will be applied to requests and responses. You can - * add any number of middleware components to modify requests before they - * are sent or before they are deserialized by implementing the `Middleware` - * interface defined in `./middleware` - */ - middleware?: Middleware[]; - /** - * Configures middleware functions that return promises instead of - * Observables (which are used by `middleware`). Otherwise allows for the - * same functionality as `middleware`, i.e., modifying requests before they - * are sent and before they are deserialized. - */ - promiseMiddleware?: PromiseMiddleware[]; - /** - * Configuration for the available authentication methods (e.g., api keys) - * according to the OpenAPI yaml definition. For the definition, please refer to - * `./auth/auth` - */ - authMethods?: AuthMethodsConfiguration + /** + * The middlewares which will be applied to requests and responses. You can + * add any number of middleware components to modify requests before they + * are sent or before they are deserialized by implementing the `Middleware` + * interface defined in `./middleware` + */ + middleware?: Middleware[]; + /** + * Configures middleware functions that return promises instead of + * Observables (which are used by `middleware`). Otherwise allows for the + * same functionality as `middleware`, i.e., modifying requests before they + * are sent and before they are deserialized. + */ + promiseMiddleware?: PromiseMiddleware[]; + /** + * Configuration for the available authentication methods (e.g., api keys) + * according to the OpenAPI yaml definition. For the definition, please refer to + * `./auth/auth` + */ + authMethods?: AuthMethodsConfiguration; } /** * Provide your `ConfigurationParameters` to this function to get a `Configuration` - * object that can be used to configure your APIs (in the constructor or + * object that can be used to configure your APIs (in the constructor or * for each request individually). * * If a property is not included in conf, a default is used: @@ -66,17 +73,19 @@ export interface ConfigurationParameters { * * @param conf partial configuration */ -export function createConfiguration(conf: ConfigurationParameters = {}): Configuration { - const configuration: Configuration = { - baseServer: conf.baseServer !== undefined ? conf.baseServer : server1, - httpApi: conf.httpApi || new DefaultHttpLibrary(), - middleware: conf.middleware || [], - authMethods: configureAuthMethods(conf.authMethods) - }; - if (conf.promiseMiddleware) { - conf.promiseMiddleware.forEach( - m => configuration.middleware.push(new PromiseMiddlewareWrapper(m)) - ); - } - return configuration; -} \ No newline at end of file +export function createConfiguration( + conf: ConfigurationParameters = {}, +): Configuration { + const configuration: Configuration = { + baseServer: conf.baseServer !== undefined ? conf.baseServer : server1, + httpApi: conf.httpApi || new DefaultHttpLibrary(), + middleware: conf.middleware || [], + authMethods: configureAuthMethods(conf.authMethods), + }; + if (conf.promiseMiddleware) { + conf.promiseMiddleware.forEach((m) => + configuration.middleware.push(new PromiseMiddlewareWrapper(m)), + ); + } + return configuration; +} diff --git a/loadtest/api-client/generated/http/http.ts b/loadtest/api-client/generated/http/http.ts index 80218c7..daa68bc 100644 --- a/loadtest/api-client/generated/http/http.ts +++ b/loadtest/api-client/generated/http/http.ts @@ -1,20 +1,20 @@ -import { Observable, from } from '../rxjsStub.ts'; +import { Observable, from } from "../rxjsStub.ts"; -export * from './isomorphic-fetch.ts'; +export * from "./isomorphic-fetch.ts"; /** * Represents an HTTP method. */ export enum HttpMethod { - GET = "GET", - HEAD = "HEAD", - POST = "POST", - PUT = "PUT", - DELETE = "DELETE", - CONNECT = "CONNECT", - OPTIONS = "OPTIONS", - TRACE = "TRACE", - PATCH = "PATCH" + GET = "GET", + HEAD = "HEAD", + POST = "POST", + PUT = "PUT", + DELETE = "DELETE", + CONNECT = "CONNECT", + OPTIONS = "OPTIONS", + TRACE = "TRACE", + PATCH = "PATCH", } /** @@ -23,9 +23,9 @@ export enum HttpMethod { export type HttpFile = Blob & { readonly name: string }; export class HttpException extends Error { - public constructor(msg: string) { - super(msg); - } + public constructor(msg: string) { + super(msg); + } } /** @@ -36,221 +36,227 @@ export type RequestBody = undefined | string | FormData | URLSearchParams; type Headers = Record; function ensureAbsoluteUrl(url: string) { - if (url.startsWith("http://") || url.startsWith("https://")) { - return url; - } - return window.location.origin + url; + if (url.startsWith("http://") || url.startsWith("https://")) { + return url; + } + return window.location.origin + url; } /** * Represents an HTTP request context */ export class RequestContext { - private headers: Headers = {}; - private body: RequestBody = undefined; - private url: URL; - - /** - * Creates the request context using a http method and request resource url - * - * @param url url of the requested resource - * @param httpMethod http method - */ - public constructor(url: string, private httpMethod: HttpMethod) { - this.url = new URL(ensureAbsoluteUrl(url)); - } + private headers: Headers = {}; + private body: RequestBody = undefined; + private url: URL; + + /** + * Creates the request context using a http method and request resource url + * + * @param url url of the requested resource + * @param httpMethod http method + */ + public constructor( + url: string, + private httpMethod: HttpMethod, + ) { + this.url = new URL(ensureAbsoluteUrl(url)); + } - /* - * Returns the url set in the constructor including the query string - * - */ - public getUrl(): string { - return this.url.toString().endsWith("/") ? - this.url.toString().slice(0, -1) - : this.url.toString(); - } + /* + * Returns the url set in the constructor including the query string + * + */ + public getUrl(): string { + return this.url.toString().endsWith("/") + ? this.url.toString().slice(0, -1) + : this.url.toString(); + } - /** - * Replaces the url set in the constructor with this url. - * - */ - public setUrl(url: string) { - this.url = new URL(ensureAbsoluteUrl(url)); - } + /** + * Replaces the url set in the constructor with this url. + * + */ + public setUrl(url: string) { + this.url = new URL(ensureAbsoluteUrl(url)); + } - /** - * Sets the body of the http request either as a string or FormData - * - * Note that setting a body on a HTTP GET, HEAD, DELETE, CONNECT or TRACE - * request is discouraged. - * https://httpwg.org/http-core/draft-ietf-httpbis-semantics-latest.html#rfc.section.7.3.1 - * - * @param body the body of the request - */ - public setBody(body: RequestBody) { - this.body = body; - } + /** + * Sets the body of the http request either as a string or FormData + * + * Note that setting a body on a HTTP GET, HEAD, DELETE, CONNECT or TRACE + * request is discouraged. + * https://httpwg.org/http-core/draft-ietf-httpbis-semantics-latest.html#rfc.section.7.3.1 + * + * @param body the body of the request + */ + public setBody(body: RequestBody) { + this.body = body; + } - public getHttpMethod(): HttpMethod { - return this.httpMethod; - } + public getHttpMethod(): HttpMethod { + return this.httpMethod; + } - public getHeaders(): Headers { - return this.headers; - } + public getHeaders(): Headers { + return this.headers; + } - public getBody(): RequestBody { - return this.body; - } + public getBody(): RequestBody { + return this.body; + } - public setQueryParam(name: string, value: string) { - this.url.searchParams.set(name, value); - } + public setQueryParam(name: string, value: string) { + this.url.searchParams.set(name, value); + } - public appendQueryParam(name: string, value: string) { - this.url.searchParams.append(name, value); - } + public appendQueryParam(name: string, value: string) { + this.url.searchParams.append(name, value); + } - /** - * Sets a cookie with the name and value. NO check for duplicate cookies is performed - * - */ - public addCookie(name: string, value: string): void { - if (!this.headers["Cookie"]) { - this.headers["Cookie"] = ""; - } - this.headers["Cookie"] += name + "=" + value + "; "; + /** + * Sets a cookie with the name and value. NO check for duplicate cookies is performed + * + */ + public addCookie(name: string, value: string): void { + if (!this.headers["Cookie"]) { + this.headers["Cookie"] = ""; } + this.headers["Cookie"] += name + "=" + value + "; "; + } - public setHeaderParam(key: string, value: string): void { - this.headers[key] = value; - } + public setHeaderParam(key: string, value: string): void { + this.headers[key] = value; + } } export interface ResponseBody { - text(): Promise; - binary(): Promise; + text(): Promise; + binary(): Promise; } /** * Helper class to generate a `ResponseBody` from binary data */ export class SelfDecodingBody implements ResponseBody { - constructor(private dataSource: Promise) {} - - binary(): Promise { - return this.dataSource; - } + constructor(private dataSource: Promise) {} - async text(): Promise { - const data: Blob = await this.dataSource; - // @ts-ignore - if (data.text) { - // @ts-ignore - return data.text(); - } + binary(): Promise { + return this.dataSource; + } - return new Promise((resolve, reject) => { - const reader = new FileReader(); - reader.addEventListener("load", () => resolve(reader.result as string)); - reader.addEventListener("error", () => reject(reader.error)); - reader.readAsText(data); - }); + async text(): Promise { + const data: Blob = await this.dataSource; + // @ts-ignore + if (data.text) { + // @ts-ignore + return data.text(); } + + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.addEventListener("load", () => resolve(reader.result as string)); + reader.addEventListener("error", () => reject(reader.error)); + reader.readAsText(data); + }); + } } export class ResponseContext { - public constructor( - public httpStatusCode: number, - public headers: Headers, - public body: ResponseBody - ) {} - - /** - * Parse header value in the form `value; param1="value1"` - * - * E.g. for Content-Type or Content-Disposition - * Parameter names are converted to lower case - * The first parameter is returned with the key `""` - */ - public getParsedHeader(headerName: string): Headers { - const result: Headers = {}; - if (!this.headers[headerName]) { - return result; - } + public constructor( + public httpStatusCode: number, + public headers: Headers, + public body: ResponseBody, + ) {} + + /** + * Parse header value in the form `value; param1="value1"` + * + * E.g. for Content-Type or Content-Disposition + * Parameter names are converted to lower case + * The first parameter is returned with the key `""` + */ + public getParsedHeader(headerName: string): Headers { + const result: Headers = {}; + if (!this.headers[headerName]) { + return result; + } - const parameters = this.headers[headerName].split(";"); - for (const parameter of parameters) { - let [key, value] = parameter.split("=", 2); - key = key.toLowerCase().trim(); - if (value === undefined) { - result[""] = key; - } else { - value = value.trim(); - if (value.startsWith('"') && value.endsWith('"')) { - value = value.substring(1, value.length - 1); - } - result[key] = value; - } + const parameters = this.headers[headerName].split(";"); + for (const parameter of parameters) { + let [key, value] = parameter.split("=", 2); + key = key.toLowerCase().trim(); + if (value === undefined) { + result[""] = key; + } else { + value = value.trim(); + if (value.startsWith('"') && value.endsWith('"')) { + value = value.substring(1, value.length - 1); } - return result; + result[key] = value; + } } + return result; + } - public async getBodyAsFile(): Promise { - const data = await this.body.binary(); - const fileName = this.getParsedHeader("content-disposition")["filename"] || ""; - const contentType = this.headers["content-type"] || ""; - try { - return new File([data], fileName, { type: contentType }); - } catch (error) { - /** Fallback for when the File constructor is not available */ - return Object.assign(data, { - name: fileName, - type: contentType - }); - } + public async getBodyAsFile(): Promise { + const data = await this.body.binary(); + const fileName = + this.getParsedHeader("content-disposition")["filename"] || ""; + const contentType = this.headers["content-type"] || ""; + try { + return new File([data], fileName, { type: contentType }); + } catch (error) { + /** Fallback for when the File constructor is not available */ + return Object.assign(data, { + name: fileName, + type: contentType, + }); } + } - /** - * Use a heuristic to get a body of unknown data structure. - * Return as string if possible, otherwise as binary. - */ - public getBodyAsAny(): Promise { - try { - return this.body.text(); - } catch {} + /** + * Use a heuristic to get a body of unknown data structure. + * Return as string if possible, otherwise as binary. + */ + public getBodyAsAny(): Promise { + try { + return this.body.text(); + } catch {} - try { - return this.body.binary(); - } catch {} + try { + return this.body.binary(); + } catch {} - return Promise.resolve(undefined); - } + return Promise.resolve(undefined); + } } export interface HttpLibrary { - send(request: RequestContext): Observable; + send(request: RequestContext): Observable; } export interface PromiseHttpLibrary { - send(request: RequestContext): Promise; + send(request: RequestContext): Promise; } -export function wrapHttpLibrary(promiseHttpLibrary: PromiseHttpLibrary): HttpLibrary { +export function wrapHttpLibrary( + promiseHttpLibrary: PromiseHttpLibrary, +): HttpLibrary { return { send(request: RequestContext): Observable { return from(promiseHttpLibrary.send(request)); - } - } + }, + }; } export class HttpInfo extends ResponseContext { - public constructor( - public httpStatusCode: number, - public headers: Headers, - public body: ResponseBody, - public data: T, - ) { - super(httpStatusCode, headers, body); - } + public constructor( + public httpStatusCode: number, + public headers: Headers, + public body: ResponseBody, + public data: T, + ) { + super(httpStatusCode, headers, body); + } } diff --git a/loadtest/api-client/generated/http/isomorphic-fetch.ts b/loadtest/api-client/generated/http/isomorphic-fetch.ts index b2b5093..09b3929 100644 --- a/loadtest/api-client/generated/http/isomorphic-fetch.ts +++ b/loadtest/api-client/generated/http/isomorphic-fetch.ts @@ -1,31 +1,29 @@ -import {HttpLibrary, RequestContext, ResponseContext} from './http.ts'; -import { from, Observable } from '../rxjsStub.ts'; +import { HttpLibrary, RequestContext, ResponseContext } from "./http.ts"; +import { from, Observable } from "../rxjsStub.ts"; export class IsomorphicFetchHttpLibrary implements HttpLibrary { + public send(request: RequestContext): Observable { + let method = request.getHttpMethod().toString(); + let body = request.getBody(); - public send(request: RequestContext): Observable { - let method = request.getHttpMethod().toString(); - let body = request.getBody(); + const resultPromise = fetch(request.getUrl(), { + method: method, + body: body as any, + headers: request.getHeaders(), + credentials: "same-origin", + }).then((resp: any) => { + const headers: { [name: string]: string } = {}; + resp.headers.forEach((value: string, name: string) => { + headers[name] = value; + }); - const resultPromise = fetch(request.getUrl(), { - method: method, - body: body as any, - headers: request.getHeaders(), - credentials: "same-origin" - }).then((resp: any) => { - const headers: { [name: string]: string } = {}; - resp.headers.forEach((value: string, name: string) => { - headers[name] = value; - }); + const body = { + text: () => resp.text(), + binary: () => resp.blob(), + }; + return new ResponseContext(resp.status, headers, body); + }); - const body = { - text: () => resp.text(), - binary: () => resp.blob() - }; - return new ResponseContext(resp.status, headers, body); - }); - - return from>(resultPromise); - - } + return from>(resultPromise); + } } diff --git a/loadtest/api-client/generated/index.ts b/loadtest/api-client/generated/index.ts index 0749ebc..66b23be 100644 --- a/loadtest/api-client/generated/index.ts +++ b/loadtest/api-client/generated/index.ts @@ -1,12 +1,28 @@ export * from "./http/http.ts"; export * from "./auth/auth.ts"; export * from "./models/all.ts"; -export { createConfiguration } from "./configuration.ts" -export type { Configuration } from "./configuration.ts" +export { createConfiguration } from "./configuration.ts"; +export type { Configuration } from "./configuration.ts"; export * from "./apis/exception.ts"; export * from "./servers.ts"; export { RequiredError } from "./apis/baseapi.ts"; -export type { PromiseMiddleware as Middleware } from './middleware.ts'; -export { PromiseAuthApi as AuthApi, PromiseClass2FAApi as Class2FAApi, PromiseCronApi as CronApi, PromiseDbiamPersonenkontexteApi as DbiamPersonenkontexteApi, PromiseDbiamPersonenuebersichtApi as DbiamPersonenuebersichtApi, PromiseImportApi as ImportApi, PromiseOrganisationenApi as OrganisationenApi, PromisePersonAdministrationApi as PersonAdministrationApi, PromisePersonInfoApi as PersonInfoApi, PromisePersonenApi as PersonenApi, PromisePersonenFrontendApi as PersonenFrontendApi, PromisePersonenkontextApi as PersonenkontextApi, PromisePersonenkontexteApi as PersonenkontexteApi, PromiseProviderApi as ProviderApi, PromiseRolleApi as RolleApi, PromiseStatusApi as StatusApi } from './types/PromiseAPI.ts'; - +export type { PromiseMiddleware as Middleware } from "./middleware.ts"; +export { + PromiseAuthApi as AuthApi, + PromiseClass2FAApi as Class2FAApi, + PromiseCronApi as CronApi, + PromiseDbiamPersonenkontexteApi as DbiamPersonenkontexteApi, + PromiseDbiamPersonenuebersichtApi as DbiamPersonenuebersichtApi, + PromiseImportApi as ImportApi, + PromiseOrganisationenApi as OrganisationenApi, + PromisePersonAdministrationApi as PersonAdministrationApi, + PromisePersonInfoApi as PersonInfoApi, + PromisePersonenApi as PersonenApi, + PromisePersonenFrontendApi as PersonenFrontendApi, + PromisePersonenkontextApi as PersonenkontextApi, + PromisePersonenkontexteApi as PersonenkontexteApi, + PromiseProviderApi as ProviderApi, + PromiseRolleApi as RolleApi, + PromiseStatusApi as StatusApi, +} from "./types/PromiseAPI.ts"; diff --git a/loadtest/api-client/generated/middleware.ts b/loadtest/api-client/generated/middleware.ts index ae36e6c..d686692 100644 --- a/loadtest/api-client/generated/middleware.ts +++ b/loadtest/api-client/generated/middleware.ts @@ -1,5 +1,5 @@ -import {RequestContext, ResponseContext} from './http/http.ts'; -import { Observable, from } from './rxjsStub.ts'; +import { RequestContext, ResponseContext } from "./http/http.ts"; +import { Observable, from } from "./rxjsStub.ts"; /** * Defines the contract for a middleware intercepting requests before @@ -8,37 +8,33 @@ import { Observable, from } from './rxjsStub.ts'; * */ export interface Middleware { - /** - * Modifies the request before the request is sent. - * - * @param context RequestContext of a request which is about to be sent to the server - * @returns an observable of the updated request context - * - */ - pre(context: RequestContext): Observable; - /** - * Modifies the returned response before it is deserialized. - * - * @param context ResponseContext of a sent request - * @returns an observable of the modified response context - */ - post(context: ResponseContext): Observable; + /** + * Modifies the request before the request is sent. + * + * @param context RequestContext of a request which is about to be sent to the server + * @returns an observable of the updated request context + * + */ + pre(context: RequestContext): Observable; + /** + * Modifies the returned response before it is deserialized. + * + * @param context ResponseContext of a sent request + * @returns an observable of the modified response context + */ + post(context: ResponseContext): Observable; } export class PromiseMiddlewareWrapper implements Middleware { + public constructor(private middleware: PromiseMiddleware) {} - public constructor(private middleware: PromiseMiddleware) { - - } - - pre(context: RequestContext): Observable { - return from(this.middleware.pre(context)); - } - - post(context: ResponseContext): Observable { - return from(this.middleware.post(context)); - } + pre(context: RequestContext): Observable { + return from(this.middleware.pre(context)); + } + post(context: ResponseContext): Observable { + return from(this.middleware.post(context)); + } } /** @@ -48,19 +44,19 @@ export class PromiseMiddlewareWrapper implements Middleware { * */ export interface PromiseMiddleware { - /** - * Modifies the request before the request is sent. - * - * @param context RequestContext of a request which is about to be sent to the server - * @returns an observable of the updated request context - * - */ - pre(context: RequestContext): Promise; - /** - * Modifies the returned response before it is deserialized. - * - * @param context ResponseContext of a sent request - * @returns an observable of the modified response context - */ - post(context: ResponseContext): Promise; + /** + * Modifies the request before the request is sent. + * + * @param context RequestContext of a request which is about to be sent to the server + * @returns an observable of the updated request context + * + */ + pre(context: RequestContext): Promise; + /** + * Modifies the returned response before it is deserialized. + * + * @param context ResponseContext of a sent request + * @returns an observable of the modified response context + */ + post(context: ResponseContext): Promise; } diff --git a/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts b/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts index bf589ba..7d28a1c 100644 --- a/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts +++ b/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts @@ -3,37 +3,40 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { HttpFile } from '../http/http.ts'; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { HttpFile } from "../http/http.ts"; export class AddSystemrechtBodyParams { - 'systemRecht': RollenSystemRecht; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "systemRecht", - "baseName": "systemRecht", - "type": "RollenSystemRecht", - "format": "" - } ]; - - static getAttributeTypeMap() { - return AddSystemrechtBodyParams.attributeTypeMap; - } - - public constructor() { - } + "systemRecht": RollenSystemRecht; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "systemRecht", + baseName: "systemRecht", + type: "RollenSystemRecht", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return AddSystemrechtBodyParams.attributeTypeMap; + } + + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts b/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts index 67a5ad4..5ca5424 100644 --- a/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts +++ b/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts @@ -3,55 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class AssignHardwareTokenBodyParams { - 'serial': string; - 'otp': string; - 'referrer': string; - 'userId': string; + "serial": string; + "otp": string; + "referrer": string; + "userId": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "serial", - "baseName": "serial", - "type": "string", - "format": "" - }, - { - "name": "otp", - "baseName": "otp", - "type": "string", - "format": "" - }, - { - "name": "referrer", - "baseName": "referrer", - "type": "string", - "format": "" - }, - { - "name": "userId", - "baseName": "userId", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "serial", + baseName: "serial", + type: "string", + format: "", + }, + { + name: "otp", + baseName: "otp", + type: "string", + format: "", + }, + { + name: "referrer", + baseName: "referrer", + type: "string", + format: "", + }, + { + name: "userId", + baseName: "userId", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return AssignHardwareTokenBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return AssignHardwareTokenBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts b/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts index 6ae0b28..ec0b071 100644 --- a/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts +++ b/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts @@ -3,76 +3,81 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class AssignHardwareTokenResponse { - 'id': number; - 'jsonrpc': string; - 'time': number; - 'version': string; - 'versionnumber': string; - 'signature': string; - 'dialogText': string; + "id": number; + "jsonrpc": string; + "time": number; + "version": string; + "versionnumber": string; + "signature": string; + "dialogText": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "number", - "format": "" - }, - { - "name": "jsonrpc", - "baseName": "jsonrpc", - "type": "string", - "format": "" - }, - { - "name": "time", - "baseName": "time", - "type": "number", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "string", - "format": "" - }, - { - "name": "versionnumber", - "baseName": "versionnumber", - "type": "string", - "format": "" - }, - { - "name": "signature", - "baseName": "signature", - "type": "string", - "format": "" - }, - { - "name": "dialogText", - "baseName": "dialogText", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "number", + format: "", + }, + { + name: "jsonrpc", + baseName: "jsonrpc", + type: "string", + format: "", + }, + { + name: "time", + baseName: "time", + type: "number", + format: "", + }, + { + name: "version", + baseName: "version", + type: "string", + format: "", + }, + { + name: "versionnumber", + baseName: "versionnumber", + type: "string", + format: "", + }, + { + name: "signature", + baseName: "signature", + type: "string", + format: "", + }, + { + name: "dialogText", + baseName: "dialogText", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return AssignHardwareTokenResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return AssignHardwareTokenResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts b/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts index 7ae3262..03add91 100644 --- a/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts +++ b/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts @@ -3,97 +3,100 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { HttpFile } from "../http/http.ts"; export class CreateOrganisationBodyParams { - 'administriertVon'?: string; - 'zugehoerigZu'?: string; - /** - * Required, if `typ` is equal to `SCHULE` - */ - 'kennung'?: string; - 'name': string; - 'namensergaenzung'?: string; - 'kuerzel'?: string; - 'typ': OrganisationsTyp; - 'traegerschaft'?: TraegerschaftTyp; - 'emailAdress'?: string; + "administriertVon"?: string; + "zugehoerigZu"?: string; + /** + * Required, if `typ` is equal to `SCHULE` + */ + "kennung"?: string; + "name": string; + "namensergaenzung"?: string; + "kuerzel"?: string; + "typ": OrganisationsTyp; + "traegerschaft"?: TraegerschaftTyp; + "emailAdress"?: string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "administriertVon", - "baseName": "administriertVon", - "type": "string", - "format": "" - }, - { - "name": "zugehoerigZu", - "baseName": "zugehoerigZu", - "type": "string", - "format": "" - }, - { - "name": "kennung", - "baseName": "kennung", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "namensergaenzung", - "baseName": "namensergaenzung", - "type": "string", - "format": "" - }, - { - "name": "kuerzel", - "baseName": "kuerzel", - "type": "string", - "format": "" - }, - { - "name": "typ", - "baseName": "typ", - "type": "OrganisationsTyp", - "format": "" - }, - { - "name": "traegerschaft", - "baseName": "traegerschaft", - "type": "TraegerschaftTyp", - "format": "" - }, - { - "name": "emailAdress", - "baseName": "emailAdress", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "administriertVon", + baseName: "administriertVon", + type: "string", + format: "", + }, + { + name: "zugehoerigZu", + baseName: "zugehoerigZu", + type: "string", + format: "", + }, + { + name: "kennung", + baseName: "kennung", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "namensergaenzung", + baseName: "namensergaenzung", + type: "string", + format: "", + }, + { + name: "kuerzel", + baseName: "kuerzel", + type: "string", + format: "", + }, + { + name: "typ", + baseName: "typ", + type: "OrganisationsTyp", + format: "", + }, + { + name: "traegerschaft", + baseName: "traegerschaft", + type: "TraegerschaftTyp", + format: "", + }, + { + name: "emailAdress", + baseName: "emailAdress", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return CreateOrganisationBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return CreateOrganisationBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts b/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts index 41b61f4..4462183 100644 --- a/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts +++ b/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts @@ -3,69 +3,74 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class CreatePersonMigrationBodyParams { - 'personId': string; - 'familienname': string; - 'vorname': string; - 'hashedPassword'?: string; - 'username'?: string; - 'personalnummer'?: string; + "personId": string; + "familienname": string; + "vorname": string; + "hashedPassword"?: string; + "username"?: string; + "personalnummer"?: string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "familienname", - "baseName": "familienname", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "hashedPassword", - "baseName": "hashedPassword", - "type": "string", - "format": "" - }, - { - "name": "username", - "baseName": "username", - "type": "string", - "format": "" - }, - { - "name": "personalnummer", - "baseName": "personalnummer", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "familienname", + baseName: "familienname", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "hashedPassword", + baseName: "hashedPassword", + type: "string", + format: "", + }, + { + name: "username", + baseName: "username", + type: "string", + format: "", + }, + { + name: "personalnummer", + baseName: "personalnummer", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return CreatePersonMigrationBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return CreatePersonMigrationBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/CreateRolleBodyParams.ts b/loadtest/api-client/generated/models/CreateRolleBodyParams.ts index 0d9ffb7..d54aec6 100644 --- a/loadtest/api-client/generated/models/CreateRolleBodyParams.ts +++ b/loadtest/api-client/generated/models/CreateRolleBodyParams.ts @@ -3,67 +3,70 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { HttpFile } from '../http/http.ts'; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { HttpFile } from "../http/http.ts"; export class CreateRolleBodyParams { - 'name': string; - 'administeredBySchulstrukturknoten': string; - 'rollenart': RollenArt; - 'merkmale': Set; - 'systemrechte': Set; + "name": string; + "administeredBySchulstrukturknoten": string; + "rollenart": RollenArt; + "merkmale": Set; + "systemrechte": Set; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "administeredBySchulstrukturknoten", - "baseName": "administeredBySchulstrukturknoten", - "type": "string", - "format": "" - }, - { - "name": "rollenart", - "baseName": "rollenart", - "type": "RollenArt", - "format": "" - }, - { - "name": "merkmale", - "baseName": "merkmale", - "type": "Set", - "format": "" - }, - { - "name": "systemrechte", - "baseName": "systemrechte", - "type": "Set", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "administeredBySchulstrukturknoten", + baseName: "administeredBySchulstrukturknoten", + type: "string", + format: "", + }, + { + name: "rollenart", + baseName: "rollenart", + type: "RollenArt", + format: "", + }, + { + name: "merkmale", + baseName: "merkmale", + type: "Set", + format: "", + }, + { + name: "systemrechte", + baseName: "systemrechte", + type: "Set", + format: "", + }, + ]; - static getAttributeTypeMap() { - return CreateRolleBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return CreateRolleBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/DBiamPersonResponse.ts b/loadtest/api-client/generated/models/DBiamPersonResponse.ts index a023af1..9dff057 100644 --- a/loadtest/api-client/generated/models/DBiamPersonResponse.ts +++ b/loadtest/api-client/generated/models/DBiamPersonResponse.ts @@ -3,43 +3,48 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { PersonResponse } from '../models/PersonResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { PersonResponse } from "../models/PersonResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class DBiamPersonResponse { - 'person': PersonResponse; - 'dBiamPersonenkontextResponses': Array; + "person": PersonResponse; + "dBiamPersonenkontextResponses": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "person", - "baseName": "person", - "type": "PersonResponse", - "format": "" - }, - { - "name": "dBiamPersonenkontextResponses", - "baseName": "dBiamPersonenkontextResponses", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "person", + baseName: "person", + type: "PersonResponse", + format: "", + }, + { + name: "dBiamPersonenkontextResponses", + baseName: "dBiamPersonenkontextResponses", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DBiamPersonResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return DBiamPersonResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts b/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts index fe669a6..8b42762 100644 --- a/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts +++ b/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts @@ -3,55 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DBiamPersonenkontextResponse { - 'personId': string; - 'organisationId': string; - 'rolleId': string; - 'befristung': string; + "personId": string; + "organisationId": string; + "rolleId": string; + "befristung": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "organisationId", - "baseName": "organisationId", - "type": "string", - "format": "" - }, - { - "name": "rolleId", - "baseName": "rolleId", - "type": "string", - "format": "" - }, - { - "name": "befristung", - "baseName": "befristung", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "organisationId", + baseName: "organisationId", + type: "string", + format: "", + }, + { + name: "rolleId", + baseName: "rolleId", + type: "string", + format: "", + }, + { + name: "befristung", + baseName: "befristung", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DBiamPersonenkontextResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return DBiamPersonenkontextResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts b/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts index 7b7d203..746570b 100644 --- a/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts +++ b/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts @@ -3,56 +3,61 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { DBiamPersonenuebersichtResponse } from "../models/DBiamPersonenuebersichtResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response { - 'total': number; - 'offset': number; - 'limit': number; - 'items': Array; + "total": number; + "offset": number; + "limit": number; + "items": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "total", - "baseName": "total", - "type": "number", - "format": "" - }, - { - "name": "offset", - "baseName": "offset", - "type": "number", - "format": "" - }, - { - "name": "limit", - "baseName": "limit", - "type": "number", - "format": "" - }, - { - "name": "items", - "baseName": "items", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "total", + baseName: "total", + type: "number", + format: "", + }, + { + name: "offset", + baseName: "offset", + type: "number", + format: "", + }, + { + name: "limit", + baseName: "limit", + type: "number", + format: "", + }, + { + name: "items", + baseName: "items", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.attributeTypeMap; - } + static getAttributeTypeMap() { + return DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts b/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts index 568c873..d17b192 100644 --- a/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts +++ b/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts @@ -3,73 +3,78 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { DBiamPersonenzuordnungResponse } from "../models/DBiamPersonenzuordnungResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class DBiamPersonenuebersichtResponse { - 'personId': string; - 'vorname': string; - 'nachname': string; - 'benutzername': string; - /** - * Date of the most recent changed personenkontext in the Zuordnungen - */ - 'lastModifiedZuordnungen': Date | null; - 'zuordnungen': Array; + "personId": string; + "vorname": string; + "nachname": string; + "benutzername": string; + /** + * Date of the most recent changed personenkontext in the Zuordnungen + */ + "lastModifiedZuordnungen": Date | null; + "zuordnungen": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "nachname", - "baseName": "nachname", - "type": "string", - "format": "" - }, - { - "name": "benutzername", - "baseName": "benutzername", - "type": "string", - "format": "" - }, - { - "name": "lastModifiedZuordnungen", - "baseName": "lastModifiedZuordnungen", - "type": "Date", - "format": "date-time" - }, - { - "name": "zuordnungen", - "baseName": "zuordnungen", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "nachname", + baseName: "nachname", + type: "string", + format: "", + }, + { + name: "benutzername", + baseName: "benutzername", + type: "string", + format: "", + }, + { + name: "lastModifiedZuordnungen", + baseName: "lastModifiedZuordnungen", + type: "Date", + format: "date-time", + }, + { + name: "zuordnungen", + baseName: "zuordnungen", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DBiamPersonenuebersichtResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return DBiamPersonenuebersichtResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts b/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts index c47eebd..c6b360a 100644 --- a/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts +++ b/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts @@ -3,101 +3,104 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { HttpFile } from "../http/http.ts"; export class DBiamPersonenzuordnungResponse { - 'sskId': string; - 'rolleId': string; - 'sskName': string; - 'sskDstNr': string; - 'rolle': string; - 'administriertVon': string; - 'typ': OrganisationsTyp; - 'editable': boolean; - 'befristung': Date; - 'merkmale': RollenMerkmal; + "sskId": string; + "rolleId": string; + "sskName": string; + "sskDstNr": string; + "rolle": string; + "administriertVon": string; + "typ": OrganisationsTyp; + "editable": boolean; + "befristung": Date; + "merkmale": RollenMerkmal; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "sskId", - "baseName": "sskId", - "type": "string", - "format": "" - }, - { - "name": "rolleId", - "baseName": "rolleId", - "type": "string", - "format": "" - }, - { - "name": "sskName", - "baseName": "sskName", - "type": "string", - "format": "" - }, - { - "name": "sskDstNr", - "baseName": "sskDstNr", - "type": "string", - "format": "" - }, - { - "name": "rolle", - "baseName": "rolle", - "type": "string", - "format": "" - }, - { - "name": "administriertVon", - "baseName": "administriertVon", - "type": "string", - "format": "" - }, - { - "name": "typ", - "baseName": "typ", - "type": "OrganisationsTyp", - "format": "" - }, - { - "name": "editable", - "baseName": "editable", - "type": "boolean", - "format": "" - }, - { - "name": "befristung", - "baseName": "befristung", - "type": "Date", - "format": "date-time" - }, - { - "name": "merkmale", - "baseName": "merkmale", - "type": "RollenMerkmal", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "sskId", + baseName: "sskId", + type: "string", + format: "", + }, + { + name: "rolleId", + baseName: "rolleId", + type: "string", + format: "", + }, + { + name: "sskName", + baseName: "sskName", + type: "string", + format: "", + }, + { + name: "sskDstNr", + baseName: "sskDstNr", + type: "string", + format: "", + }, + { + name: "rolle", + baseName: "rolle", + type: "string", + format: "", + }, + { + name: "administriertVon", + baseName: "administriertVon", + type: "string", + format: "", + }, + { + name: "typ", + baseName: "typ", + type: "OrganisationsTyp", + format: "", + }, + { + name: "editable", + baseName: "editable", + type: "boolean", + format: "", + }, + { + name: "befristung", + baseName: "befristung", + type: "Date", + format: "date-time", + }, + { + name: "merkmale", + baseName: "merkmale", + type: "RollenMerkmal", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DBiamPersonenzuordnungResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return DBiamPersonenzuordnungResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts b/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts index 8782507..585ae99 100644 --- a/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts +++ b/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts @@ -3,63 +3,68 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; -import { HttpFile } from '../http/http.ts'; +import { DbiamCreatePersonenkontextBodyParams } from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +import { HttpFile } from "../http/http.ts"; export class DbiamCreatePersonWithPersonenkontexteBodyParams { - 'familienname': string; - 'vorname': string; - 'personalnummer'?: string; - 'befristung'?: Date; - 'createPersonenkontexte': Array; + "familienname": string; + "vorname": string; + "personalnummer"?: string; + "befristung"?: Date; + "createPersonenkontexte": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "familienname", - "baseName": "familienname", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "personalnummer", - "baseName": "personalnummer", - "type": "string", - "format": "" - }, - { - "name": "befristung", - "baseName": "befristung", - "type": "Date", - "format": "date-time" - }, - { - "name": "createPersonenkontexte", - "baseName": "createPersonenkontexte", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "familienname", + baseName: "familienname", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "personalnummer", + baseName: "personalnummer", + type: "string", + format: "", + }, + { + name: "befristung", + baseName: "befristung", + type: "Date", + format: "date-time", + }, + { + name: "createPersonenkontexte", + baseName: "createPersonenkontexte", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DbiamCreatePersonWithPersonenkontexteBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return DbiamCreatePersonWithPersonenkontexteBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts b/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts index 993c186..fcae80e 100644 --- a/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts +++ b/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts @@ -3,41 +3,46 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamCreatePersonenkontextBodyParams { - 'organisationId': string; - 'rolleId': string; + "organisationId": string; + "rolleId": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "organisationId", - "baseName": "organisationId", - "type": "string", - "format": "" - }, - { - "name": "rolleId", - "baseName": "rolleId", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "organisationId", + baseName: "organisationId", + type: "string", + format: "", + }, + { + name: "rolleId", + baseName: "rolleId", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DbiamCreatePersonenkontextBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return DbiamCreatePersonenkontextBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DbiamImportError.ts b/loadtest/api-client/generated/models/DbiamImportError.ts index bcc2c82..b5eafc4 100644 --- a/loadtest/api-client/generated/models/DbiamImportError.ts +++ b/loadtest/api-client/generated/models/DbiamImportError.ts @@ -3,54 +3,58 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamImportError { - 'i18nKey': DbiamImportErrorI18nKeyEnum; - /** - * Corresponds to HTTP Status code like 200, 404, 500 - */ - 'code': number; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "i18nKey", - "baseName": "i18nKey", - "type": "DbiamImportErrorI18nKeyEnum", - "format": "" - }, - { - "name": "code", - "baseName": "code", - "type": "number", - "format": "" - } ]; - - static getAttributeTypeMap() { - return DbiamImportError.attributeTypeMap; - } - - public constructor() { - } + "i18nKey": DbiamImportErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + "code": number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "i18nKey", + baseName: "i18nKey", + type: "DbiamImportErrorI18nKeyEnum", + format: "", + }, + { + name: "code", + baseName: "code", + type: "number", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return DbiamImportError.attributeTypeMap; + } + + public constructor() {} } export enum DbiamImportErrorI18nKeyEnum { - ImportError = 'IMPORT_ERROR', - CsvParsingError = 'CSV_PARSING_ERROR', - CsvFileEmptyError = 'CSV_FILE_EMPTY_ERROR', - ImportTextFileCreationError = 'IMPORT_TEXT_FILE_CREATION_ERROR', - ImportNurLernAnSchuleError = 'IMPORT_NUR_LERN_AN_SCHULE_ERROR', - CsvFileInvalidHeaderError = 'CSV_FILE_INVALID_HEADER_ERROR' + ImportError = "IMPORT_ERROR", + CsvParsingError = "CSV_PARSING_ERROR", + CsvFileEmptyError = "CSV_FILE_EMPTY_ERROR", + ImportTextFileCreationError = "IMPORT_TEXT_FILE_CREATION_ERROR", + ImportNurLernAnSchuleError = "IMPORT_NUR_LERN_AN_SCHULE_ERROR", + CsvFileInvalidHeaderError = "CSV_FILE_INVALID_HEADER_ERROR", } - diff --git a/loadtest/api-client/generated/models/DbiamOrganisationError.ts b/loadtest/api-client/generated/models/DbiamOrganisationError.ts index edbc3cc..0ca8462 100644 --- a/loadtest/api-client/generated/models/DbiamOrganisationError.ts +++ b/loadtest/api-client/generated/models/DbiamOrganisationError.ts @@ -3,65 +3,69 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamOrganisationError { - 'i18nKey': DbiamOrganisationErrorI18nKeyEnum; - /** - * Corresponds to HTTP Status code like 200, 404, 500 - */ - 'code': number; + "i18nKey": DbiamOrganisationErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + "code": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "i18nKey", - "baseName": "i18nKey", - "type": "DbiamOrganisationErrorI18nKeyEnum", - "format": "" - }, - { - "name": "code", - "baseName": "code", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "i18nKey", + baseName: "i18nKey", + type: "DbiamOrganisationErrorI18nKeyEnum", + format: "", + }, + { + name: "code", + baseName: "code", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DbiamOrganisationError.attributeTypeMap; - } + static getAttributeTypeMap() { + return DbiamOrganisationError.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } export enum DbiamOrganisationErrorI18nKeyEnum { - OrganisationSpecificationError = 'ORGANISATION_SPECIFICATION_ERROR', - KennungRequiredForSchule = 'KENNUNG_REQUIRED_FOR_SCHULE', - NameRequiredForSchule = 'NAME_REQUIRED_FOR_SCHULE', - SchuleKennungEindeutig = 'SCHULE_KENNUNG_EINDEUTIG', - SchuleUnterTraeger = 'SCHULE_UNTER_TRAEGER', - TraegerInTraeger = 'TRAEGER_IN_TRAEGER', - NurKlasseUnterSchule = 'NUR_KLASSE_UNTER_SCHULE', - ZyklusInOrganisation = 'ZYKLUS_IN_ORGANISATION', - RootOrganisationImmutable = 'ROOT_ORGANISATION_IMMUTABLE', - KlasseNurVonSchuleAdministriert = 'KLASSE_NUR_VON_SCHULE_ADMINISTRIERT', - KlassennameAnSchuleEindeutig = 'KLASSENNAME_AN_SCHULE_EINDEUTIG', - OrganisationIstBereitsZugewiesenError = 'ORGANISATION_IST_BEREITS_ZUGEWIESEN_ERROR', - NameRequiredForKlasse = 'NAME_REQUIRED_FOR_KLASSE', - NameEnthaeltLeerzeichen = 'NAME_ENTHAELT_LEERZEICHEN', - KennungEnthaeltLeerzeichen = 'KENNUNG_ENTHAELT_LEERZEICHEN', - EmailAdressOnOrganisationTyp = 'EMAIL_ADRESS_ON_ORGANISATION_TYP', - NewerVersionOrganisation = 'NEWER_VERSION_ORGANISATION' + OrganisationSpecificationError = "ORGANISATION_SPECIFICATION_ERROR", + KennungRequiredForSchule = "KENNUNG_REQUIRED_FOR_SCHULE", + NameRequiredForSchule = "NAME_REQUIRED_FOR_SCHULE", + SchuleKennungEindeutig = "SCHULE_KENNUNG_EINDEUTIG", + SchuleUnterTraeger = "SCHULE_UNTER_TRAEGER", + TraegerInTraeger = "TRAEGER_IN_TRAEGER", + NurKlasseUnterSchule = "NUR_KLASSE_UNTER_SCHULE", + ZyklusInOrganisation = "ZYKLUS_IN_ORGANISATION", + RootOrganisationImmutable = "ROOT_ORGANISATION_IMMUTABLE", + KlasseNurVonSchuleAdministriert = "KLASSE_NUR_VON_SCHULE_ADMINISTRIERT", + KlassennameAnSchuleEindeutig = "KLASSENNAME_AN_SCHULE_EINDEUTIG", + OrganisationIstBereitsZugewiesenError = "ORGANISATION_IST_BEREITS_ZUGEWIESEN_ERROR", + NameRequiredForKlasse = "NAME_REQUIRED_FOR_KLASSE", + NameEnthaeltLeerzeichen = "NAME_ENTHAELT_LEERZEICHEN", + KennungEnthaeltLeerzeichen = "KENNUNG_ENTHAELT_LEERZEICHEN", + EmailAdressOnOrganisationTyp = "EMAIL_ADRESS_ON_ORGANISATION_TYP", + NewerVersionOrganisation = "NEWER_VERSION_ORGANISATION", } - diff --git a/loadtest/api-client/generated/models/DbiamPersonError.ts b/loadtest/api-client/generated/models/DbiamPersonError.ts index 661d36c..766f939 100644 --- a/loadtest/api-client/generated/models/DbiamPersonError.ts +++ b/loadtest/api-client/generated/models/DbiamPersonError.ts @@ -3,56 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamPersonError { - 'i18nKey': DbiamPersonErrorI18nKeyEnum; - /** - * Corresponds to HTTP Status code like 200, 404, 500 - */ - 'code': number; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "i18nKey", - "baseName": "i18nKey", - "type": "DbiamPersonErrorI18nKeyEnum", - "format": "" - }, - { - "name": "code", - "baseName": "code", - "type": "number", - "format": "" - } ]; - - static getAttributeTypeMap() { - return DbiamPersonError.attributeTypeMap; - } - - public constructor() { - } + "i18nKey": DbiamPersonErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + "code": number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "i18nKey", + baseName: "i18nKey", + type: "DbiamPersonErrorI18nKeyEnum", + format: "", + }, + { + name: "code", + baseName: "code", + type: "number", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return DbiamPersonError.attributeTypeMap; + } + + public constructor() {} } export enum DbiamPersonErrorI18nKeyEnum { - PersonError = 'PERSON_ERROR', - VornameEnthaeltLeerzeichen = 'VORNAME_ENTHAELT_LEERZEICHEN', - FamiliennameEnthaeltLeerzeichen = 'FAMILIENNAME_ENTHAELT_LEERZEICHEN', - PersonNotFound = 'PERSON_NOT_FOUND', - DownstreamUnreachable = 'DOWNSTREAM_UNREACHABLE', - PersonalnummerRequired = 'PERSONALNUMMER_REQUIRED', - NewerVersionOfPersonAvailable = 'NEWER_VERSION_OF_PERSON_AVAILABLE', - PersonalnummerNichtEindeutig = 'PERSONALNUMMER_NICHT_EINDEUTIG' + PersonError = "PERSON_ERROR", + VornameEnthaeltLeerzeichen = "VORNAME_ENTHAELT_LEERZEICHEN", + FamiliennameEnthaeltLeerzeichen = "FAMILIENNAME_ENTHAELT_LEERZEICHEN", + PersonNotFound = "PERSON_NOT_FOUND", + DownstreamUnreachable = "DOWNSTREAM_UNREACHABLE", + PersonalnummerRequired = "PERSONALNUMMER_REQUIRED", + NewerVersionOfPersonAvailable = "NEWER_VERSION_OF_PERSON_AVAILABLE", + PersonalnummerNichtEindeutig = "PERSONALNUMMER_NICHT_EINDEUTIG", } - diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts b/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts index b1997ba..8c8f564 100644 --- a/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts +++ b/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts @@ -3,55 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamPersonenkontextBodyParams { - 'personId': string; - 'organisationId': string; - 'rolleId': string; - 'befristung'?: Date; + "personId": string; + "organisationId": string; + "rolleId": string; + "befristung"?: Date; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "organisationId", - "baseName": "organisationId", - "type": "string", - "format": "" - }, - { - "name": "rolleId", - "baseName": "rolleId", - "type": "string", - "format": "" - }, - { - "name": "befristung", - "baseName": "befristung", - "type": "Date", - "format": "date-time" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "organisationId", + baseName: "organisationId", + type: "string", + format: "", + }, + { + name: "rolleId", + baseName: "rolleId", + type: "string", + format: "", + }, + { + name: "befristung", + baseName: "befristung", + type: "Date", + format: "date-time", + }, + ]; - static getAttributeTypeMap() { - return DbiamPersonenkontextBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return DbiamPersonenkontextBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts b/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts index 5aaed12..e3af091 100644 --- a/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts +++ b/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts @@ -3,55 +3,59 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamPersonenkontextError { - 'i18nKey': DbiamPersonenkontextErrorI18nKeyEnum; - /** - * Corresponds to HTTP Status code like 200, 404, 500 - */ - 'code': number; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "i18nKey", - "baseName": "i18nKey", - "type": "DbiamPersonenkontextErrorI18nKeyEnum", - "format": "" - }, - { - "name": "code", - "baseName": "code", - "type": "number", - "format": "" - } ]; - - static getAttributeTypeMap() { - return DbiamPersonenkontextError.attributeTypeMap; - } - - public constructor() { - } + "i18nKey": DbiamPersonenkontextErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + "code": number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "i18nKey", + baseName: "i18nKey", + type: "DbiamPersonenkontextErrorI18nKeyEnum", + format: "", + }, + { + name: "code", + baseName: "code", + type: "number", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return DbiamPersonenkontextError.attributeTypeMap; + } + + public constructor() {} } export enum DbiamPersonenkontextErrorI18nKeyEnum { - PersonenkontextSpecificationError = 'PERSONENKONTEXT_SPECIFICATION_ERROR', - NurLehrUndLernAnKlasse = 'NUR_LEHR_UND_LERN_AN_KLASSE', - GleicheRolleAnKlasseWieSchule = 'GLEICHE_ROLLE_AN_KLASSE_WIE_SCHULE', - OrganisationMatchesRollenart = 'ORGANISATION_MATCHES_ROLLENART', - PersonenkontextAnlageError = 'PERSONENKONTEXT_ANLAGE_ERROR', - RolleNurAnPassendeOrganisation = 'ROLLE_NUR_AN_PASSENDE_ORGANISATION', - PersonalnummerNichtEindeutig = 'PERSONALNUMMER_NICHT_EINDEUTIG' + PersonenkontextSpecificationError = "PERSONENKONTEXT_SPECIFICATION_ERROR", + NurLehrUndLernAnKlasse = "NUR_LEHR_UND_LERN_AN_KLASSE", + GleicheRolleAnKlasseWieSchule = "GLEICHE_ROLLE_AN_KLASSE_WIE_SCHULE", + OrganisationMatchesRollenart = "ORGANISATION_MATCHES_ROLLENART", + PersonenkontextAnlageError = "PERSONENKONTEXT_ANLAGE_ERROR", + RolleNurAnPassendeOrganisation = "ROLLE_NUR_AN_PASSENDE_ORGANISATION", + PersonalnummerNichtEindeutig = "PERSONALNUMMER_NICHT_EINDEUTIG", } - diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts b/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts index 0fff251..ce845a5 100644 --- a/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts +++ b/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts @@ -3,79 +3,82 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonenkontextMigrationRuntype } from "../models/PersonenkontextMigrationRuntype.ts"; +import { HttpFile } from "../http/http.ts"; export class DbiamPersonenkontextMigrationBodyParams { - 'personId': string; - 'username'?: string; - 'organisationId': string; - 'rolleId': string; - 'befristung'?: Date; - 'email'?: string; - 'migrationRunType': PersonenkontextMigrationRuntype; + "personId": string; + "username"?: string; + "organisationId": string; + "rolleId": string; + "befristung"?: Date; + "email"?: string; + "migrationRunType": PersonenkontextMigrationRuntype; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "username", - "baseName": "username", - "type": "string", - "format": "" - }, - { - "name": "organisationId", - "baseName": "organisationId", - "type": "string", - "format": "" - }, - { - "name": "rolleId", - "baseName": "rolleId", - "type": "string", - "format": "" - }, - { - "name": "befristung", - "baseName": "befristung", - "type": "Date", - "format": "date-time" - }, - { - "name": "email", - "baseName": "email", - "type": "string", - "format": "" - }, - { - "name": "migrationRunType", - "baseName": "migrationRunType", - "type": "PersonenkontextMigrationRuntype", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "username", + baseName: "username", + type: "string", + format: "", + }, + { + name: "organisationId", + baseName: "organisationId", + type: "string", + format: "", + }, + { + name: "rolleId", + baseName: "rolleId", + type: "string", + format: "", + }, + { + name: "befristung", + baseName: "befristung", + type: "Date", + format: "date-time", + }, + { + name: "email", + baseName: "email", + type: "string", + format: "", + }, + { + name: "migrationRunType", + baseName: "migrationRunType", + type: "PersonenkontextMigrationRuntype", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DbiamPersonenkontextMigrationBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return DbiamPersonenkontextMigrationBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts b/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts index 9058f21..20df173 100644 --- a/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts +++ b/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts @@ -3,57 +3,61 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamPersonenkontexteUpdateError { - 'i18nKey': DbiamPersonenkontexteUpdateErrorI18nKeyEnum; - /** - * Corresponds to HTTP Status code like 200, 404, 500 - */ - 'code': number; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "i18nKey", - "baseName": "i18nKey", - "type": "DbiamPersonenkontexteUpdateErrorI18nKeyEnum", - "format": "" - }, - { - "name": "code", - "baseName": "code", - "type": "number", - "format": "" - } ]; - - static getAttributeTypeMap() { - return DbiamPersonenkontexteUpdateError.attributeTypeMap; - } - - public constructor() { - } + "i18nKey": DbiamPersonenkontexteUpdateErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + "code": number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "i18nKey", + baseName: "i18nKey", + type: "DbiamPersonenkontexteUpdateErrorI18nKeyEnum", + format: "", + }, + { + name: "code", + baseName: "code", + type: "number", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return DbiamPersonenkontexteUpdateError.attributeTypeMap; + } + + public constructor() {} } export enum DbiamPersonenkontexteUpdateErrorI18nKeyEnum { - PersonenkontexteUpdateError = 'PERSONENKONTEXTE_UPDATE_ERROR', - PersonenkontextNotFound = 'PERSONENKONTEXT_NOT_FOUND', - CountMismatching = 'COUNT_MISMATCHING', - NewerVersionOfPersonenkontexteAvailable = 'NEWER_VERSION_OF_PERSONENKONTEXTE_AVAILABLE', - InvalidLastModifiedValue = 'INVALID_LAST_MODIFIED_VALUE', - PersonIdMismatch = 'PERSON_ID_MISMATCH', - PersonNotFound = 'PERSON_NOT_FOUND', - InvalidPersonenkontextForPersonWithRollenartLern = 'INVALID_PERSONENKONTEXT_FOR_PERSON_WITH_ROLLENART_LERN', - BefristungRequiredForPersonenkontext = ' BEFRISTUNG_REQUIRED_FOR_PERSONENKONTEXT' + PersonenkontexteUpdateError = "PERSONENKONTEXTE_UPDATE_ERROR", + PersonenkontextNotFound = "PERSONENKONTEXT_NOT_FOUND", + CountMismatching = "COUNT_MISMATCHING", + NewerVersionOfPersonenkontexteAvailable = "NEWER_VERSION_OF_PERSONENKONTEXTE_AVAILABLE", + InvalidLastModifiedValue = "INVALID_LAST_MODIFIED_VALUE", + PersonIdMismatch = "PERSON_ID_MISMATCH", + PersonNotFound = "PERSON_NOT_FOUND", + InvalidPersonenkontextForPersonWithRollenartLern = "INVALID_PERSONENKONTEXT_FOR_PERSON_WITH_ROLLENART_LERN", + BefristungRequiredForPersonenkontext = " BEFRISTUNG_REQUIRED_FOR_PERSONENKONTEXT", } - diff --git a/loadtest/api-client/generated/models/DbiamRolleError.ts b/loadtest/api-client/generated/models/DbiamRolleError.ts index 773caff..ef87b23 100644 --- a/loadtest/api-client/generated/models/DbiamRolleError.ts +++ b/loadtest/api-client/generated/models/DbiamRolleError.ts @@ -3,55 +3,59 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DbiamRolleError { - 'i18nKey': DbiamRolleErrorI18nKeyEnum; - /** - * Corresponds to HTTP Status code like 200, 404, 500 - */ - 'code': number; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "i18nKey", - "baseName": "i18nKey", - "type": "DbiamRolleErrorI18nKeyEnum", - "format": "" - }, - { - "name": "code", - "baseName": "code", - "type": "number", - "format": "" - } ]; - - static getAttributeTypeMap() { - return DbiamRolleError.attributeTypeMap; - } - - public constructor() { - } + "i18nKey": DbiamRolleErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + "code": number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "i18nKey", + baseName: "i18nKey", + type: "DbiamRolleErrorI18nKeyEnum", + format: "", + }, + { + name: "code", + baseName: "code", + type: "number", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return DbiamRolleError.attributeTypeMap; + } + + public constructor() {} } export enum DbiamRolleErrorI18nKeyEnum { - RolleError = 'ROLLE_ERROR', - AddSystemrechtError = 'ADD_SYSTEMRECHT_ERROR', - RolleHatPersonenkontexteError = 'ROLLE_HAT_PERSONENKONTEXTE_ERROR', - UpdateMerkmaleError = 'UPDATE_MERKMALE_ERROR', - RollennameEnthaeltLeerzeichen = 'ROLLENNAME_ENTHAELT_LEERZEICHEN', - NewerVersionOfRolleAvailable = 'NEWER_VERSION_OF_ROLLE_AVAILABLE', - RolleNameUniqueOnSsk = 'ROLLE_NAME_UNIQUE_ON_SSK' + RolleError = "ROLLE_ERROR", + AddSystemrechtError = "ADD_SYSTEMRECHT_ERROR", + RolleHatPersonenkontexteError = "ROLLE_HAT_PERSONENKONTEXTE_ERROR", + UpdateMerkmaleError = "UPDATE_MERKMALE_ERROR", + RollennameEnthaeltLeerzeichen = "ROLLENNAME_ENTHAELT_LEERZEICHEN", + NewerVersionOfRolleAvailable = "NEWER_VERSION_OF_ROLLE_AVAILABLE", + RolleNameUniqueOnSsk = "ROLLE_NAME_UNIQUE_ON_SSK", } - diff --git a/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts b/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts index e8e25c2..eab305d 100644 --- a/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts +++ b/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts @@ -3,55 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; -import { HttpFile } from '../http/http.ts'; +import { DbiamPersonenkontextBodyParams } from "../models/DbiamPersonenkontextBodyParams.ts"; +import { HttpFile } from "../http/http.ts"; export class DbiamUpdatePersonenkontexteBodyParams { - /** - * Date of the most recent changed personenkontext - */ - 'lastModified'?: Date | null; - /** - * The amount of personenkontexte - */ - 'count': number; - 'personenkontexte': Array; + /** + * Date of the most recent changed personenkontext + */ + "lastModified"?: Date | null; + /** + * The amount of personenkontexte + */ + "count": number; + "personenkontexte": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "lastModified", - "baseName": "lastModified", - "type": "Date", - "format": "date-time" - }, - { - "name": "count", - "baseName": "count", - "type": "number", - "format": "" - }, - { - "name": "personenkontexte", - "baseName": "personenkontexte", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "lastModified", + baseName: "lastModified", + type: "Date", + format: "date-time", + }, + { + name: "count", + baseName: "count", + type: "number", + format: "", + }, + { + name: "personenkontexte", + baseName: "personenkontexte", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DbiamUpdatePersonenkontexteBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return DbiamUpdatePersonenkontexteBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts b/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts index 5fecde7..d1e5b1d 100644 --- a/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts +++ b/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts @@ -3,37 +3,42 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class DeleteRevisionBodyParams { - /** - * The revision of a personenkontext. - */ - 'revision': string; + /** + * The revision of a personenkontext. + */ + "revision": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return DeleteRevisionBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return DeleteRevisionBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/EmailAddressStatus.ts b/loadtest/api-client/generated/models/EmailAddressStatus.ts index ff42bad..037f9a3 100644 --- a/loadtest/api-client/generated/models/EmailAddressStatus.ts +++ b/loadtest/api-client/generated/models/EmailAddressStatus.ts @@ -3,18 +3,18 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum EmailAddressStatus { - Enabled = 'ENABLED', - Disabled = 'DISABLED', - Requested = 'REQUESTED', - Failed = 'FAILED' + Enabled = "ENABLED", + Disabled = "DISABLED", + Requested = "REQUESTED", + Failed = "FAILED", } diff --git a/loadtest/api-client/generated/models/FindRollenResponse.ts b/loadtest/api-client/generated/models/FindRollenResponse.ts index c4bd1b3..3b1a28b 100644 --- a/loadtest/api-client/generated/models/FindRollenResponse.ts +++ b/loadtest/api-client/generated/models/FindRollenResponse.ts @@ -3,42 +3,47 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RolleResponse } from '../models/RolleResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class FindRollenResponse { - 'moeglicheRollen': Array; - 'total': number; + "moeglicheRollen": Array; + "total": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "moeglicheRollen", - "baseName": "moeglicheRollen", - "type": "Array", - "format": "" - }, - { - "name": "total", - "baseName": "total", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "moeglicheRollen", + baseName: "moeglicheRollen", + type: "Array", + format: "", + }, + { + name: "total", + baseName: "total", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return FindRollenResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return FindRollenResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts b/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts index 66c3e7f..81babd1 100644 --- a/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts +++ b/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts @@ -3,42 +3,47 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { HttpFile } from "../http/http.ts"; export class FindSchulstrukturknotenResponse { - 'moeglicheSsks': Array; - 'total': number; + "moeglicheSsks": Array; + "total": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "moeglicheSsks", - "baseName": "moeglicheSsks", - "type": "Array", - "format": "" - }, - { - "name": "total", - "baseName": "total", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "moeglicheSsks", + baseName: "moeglicheSsks", + type: "Array", + format: "", + }, + { + name: "total", + baseName: "total", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return FindSchulstrukturknotenResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return FindSchulstrukturknotenResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/Geschlecht.ts b/loadtest/api-client/generated/models/Geschlecht.ts index 88a428f..fa9ae95 100644 --- a/loadtest/api-client/generated/models/Geschlecht.ts +++ b/loadtest/api-client/generated/models/Geschlecht.ts @@ -3,18 +3,18 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum Geschlecht { - M = 'm', - W = 'w', - D = 'd', - X = 'x' + M = "m", + W = "w", + D = "d", + X = "x", } diff --git a/loadtest/api-client/generated/models/ImportDataItemResponse.ts b/loadtest/api-client/generated/models/ImportDataItemResponse.ts index d993a1e..edc3e17 100644 --- a/loadtest/api-client/generated/models/ImportDataItemResponse.ts +++ b/loadtest/api-client/generated/models/ImportDataItemResponse.ts @@ -3,55 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class ImportDataItemResponse { - 'nachname': string; - 'vorname': string; - 'klasse': string | null; - 'validationErrors': Array; + "nachname": string; + "vorname": string; + "klasse": string | null; + "validationErrors": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "nachname", - "baseName": "nachname", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "klasse", - "baseName": "klasse", - "type": "string", - "format": "" - }, - { - "name": "validationErrors", - "baseName": "validationErrors", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "nachname", + baseName: "nachname", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "klasse", + baseName: "klasse", + type: "string", + format: "", + }, + { + name: "validationErrors", + baseName: "validationErrors", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ImportDataItemResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return ImportDataItemResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/ImportUploadResponse.ts b/loadtest/api-client/generated/models/ImportUploadResponse.ts index cf79299..e0bb650 100644 --- a/loadtest/api-client/generated/models/ImportUploadResponse.ts +++ b/loadtest/api-client/generated/models/ImportUploadResponse.ts @@ -3,75 +3,80 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { ImportDataItemResponse } from "../models/ImportDataItemResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class ImportUploadResponse { - /** - * The import transaction number. it will be needed to execute the import and download the result - */ - 'importvorgangId': string; - /** - * It states if the import transaction contain errors. - */ - 'isValid': boolean; - /** - * The total number of data items in the CSV file. - */ - 'totalImportDataItems': number; - /** - * The total number of data items in the CSV file that are invalid. - */ - 'totalInvalidImportDataItems': number; - 'invalidImportDataItems': Array; + /** + * The import transaction number. it will be needed to execute the import and download the result + */ + "importvorgangId": string; + /** + * It states if the import transaction contain errors. + */ + "isValid": boolean; + /** + * The total number of data items in the CSV file. + */ + "totalImportDataItems": number; + /** + * The total number of data items in the CSV file that are invalid. + */ + "totalInvalidImportDataItems": number; + "invalidImportDataItems": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "importvorgangId", - "baseName": "importvorgangId", - "type": "string", - "format": "" - }, - { - "name": "isValid", - "baseName": "isValid", - "type": "boolean", - "format": "" - }, - { - "name": "totalImportDataItems", - "baseName": "totalImportDataItems", - "type": "number", - "format": "" - }, - { - "name": "totalInvalidImportDataItems", - "baseName": "totalInvalidImportDataItems", - "type": "number", - "format": "" - }, - { - "name": "invalidImportDataItems", - "baseName": "invalidImportDataItems", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "importvorgangId", + baseName: "importvorgangId", + type: "string", + format: "", + }, + { + name: "isValid", + baseName: "isValid", + type: "boolean", + format: "", + }, + { + name: "totalImportDataItems", + baseName: "totalImportDataItems", + type: "number", + format: "", + }, + { + name: "totalInvalidImportDataItems", + baseName: "totalInvalidImportDataItems", + type: "number", + format: "", + }, + { + name: "invalidImportDataItems", + baseName: "invalidImportDataItems", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ImportUploadResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return ImportUploadResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts b/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts index b758b13..2d258a9 100644 --- a/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts +++ b/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts @@ -3,51 +3,56 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class ImportvorgangByIdBodyParams { - /** - * The id of an import transaction - */ - 'importvorgangId': string; - 'organisationId': string; - 'rolleId': string; + /** + * The id of an import transaction + */ + "importvorgangId": string; + "organisationId": string; + "rolleId": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "importvorgangId", - "baseName": "importvorgangId", - "type": "string", - "format": "" - }, - { - "name": "organisationId", - "baseName": "organisationId", - "type": "string", - "format": "" - }, - { - "name": "rolleId", - "baseName": "rolleId", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "importvorgangId", + baseName: "importvorgangId", + type: "string", + format: "", + }, + { + name: "organisationId", + baseName: "organisationId", + type: "string", + format: "", + }, + { + name: "rolleId", + baseName: "rolleId", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ImportvorgangByIdBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return ImportvorgangByIdBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/LockUserBodyParams.ts b/loadtest/api-client/generated/models/LockUserBodyParams.ts index 2d59712..d553207 100644 --- a/loadtest/api-client/generated/models/LockUserBodyParams.ts +++ b/loadtest/api-client/generated/models/LockUserBodyParams.ts @@ -3,51 +3,56 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class LockUserBodyParams { - 'lock': boolean; - 'lockedBy': string; - /** - * Required if Befristung is set - */ - 'lockedUntil'?: Date; + "lock": boolean; + "lockedBy": string; + /** + * Required if Befristung is set + */ + "lockedUntil"?: Date; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "lock", - "baseName": "lock", - "type": "boolean", - "format": "" - }, - { - "name": "lockedBy", - "baseName": "locked_by", - "type": "string", - "format": "" - }, - { - "name": "lockedUntil", - "baseName": "locked_until", - "type": "Date", - "format": "date-time" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "lock", + baseName: "lock", + type: "boolean", + format: "", + }, + { + name: "lockedBy", + baseName: "locked_by", + type: "string", + format: "", + }, + { + name: "lockedUntil", + baseName: "locked_until", + type: "Date", + format: "date-time", + }, + ]; - static getAttributeTypeMap() { - return LockUserBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return LockUserBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/LoeschungResponse.ts b/loadtest/api-client/generated/models/LoeschungResponse.ts index f3bb012..1399943 100644 --- a/loadtest/api-client/generated/models/LoeschungResponse.ts +++ b/loadtest/api-client/generated/models/LoeschungResponse.ts @@ -3,34 +3,39 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class LoeschungResponse { - 'zeitpunkt': Date; + "zeitpunkt": Date; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "zeitpunkt", - "baseName": "zeitpunkt", - "type": "Date", - "format": "date-time" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "zeitpunkt", + baseName: "zeitpunkt", + type: "Date", + format: "date-time", + }, + ]; - static getAttributeTypeMap() { - return LoeschungResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return LoeschungResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/ObjectSerializer.ts b/loadtest/api-client/generated/models/ObjectSerializer.ts index a71f068..14765ab 100644 --- a/loadtest/api-client/generated/models/ObjectSerializer.ts +++ b/loadtest/api-client/generated/models/ObjectSerializer.ts @@ -1,306 +1,335 @@ -export * from '../models/AddSystemrechtBodyParams.ts'; -export * from '../models/AssignHardwareTokenBodyParams.ts'; -export * from '../models/AssignHardwareTokenResponse.ts'; -export * from '../models/CreateOrganisationBodyParams.ts'; -export * from '../models/CreatePersonMigrationBodyParams.ts'; -export * from '../models/CreateRolleBodyParams.ts'; -export * from '../models/DBiamPersonResponse.ts'; -export * from '../models/DBiamPersonenkontextResponse.ts'; -export * from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; -export * from '../models/DBiamPersonenuebersichtResponse.ts'; -export * from '../models/DBiamPersonenzuordnungResponse.ts'; -export * from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; -export * from '../models/DbiamCreatePersonenkontextBodyParams.ts'; -export * from '../models/DbiamImportError.ts'; -export * from '../models/DbiamOrganisationError.ts'; -export * from '../models/DbiamPersonError.ts'; -export * from '../models/DbiamPersonenkontextBodyParams.ts'; -export * from '../models/DbiamPersonenkontextError.ts'; -export * from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; -export * from '../models/DbiamPersonenkontexteUpdateError.ts'; -export * from '../models/DbiamRolleError.ts'; -export * from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; -export * from '../models/DeleteRevisionBodyParams.ts'; -export * from '../models/EmailAddressStatus.ts'; -export * from '../models/FindRollenResponse.ts'; -export * from '../models/FindSchulstrukturknotenResponse.ts'; -export * from '../models/Geschlecht.ts'; -export * from '../models/ImportDataItemResponse.ts'; -export * from '../models/ImportUploadResponse.ts'; -export * from '../models/ImportvorgangByIdBodyParams.ts'; -export * from '../models/LockUserBodyParams.ts'; -export * from '../models/LoeschungResponse.ts'; -export * from '../models/OrganisationByIdBodyParams.ts'; -export * from '../models/OrganisationByNameBodyParams.ts'; -export * from '../models/OrganisationResponse.ts'; -export * from '../models/OrganisationResponseLegacy.ts'; -export * from '../models/OrganisationRootChildrenResponse.ts'; -export * from '../models/OrganisationsTyp.ts'; -export * from '../models/ParentOrganisationenResponse.ts'; -export * from '../models/ParentOrganisationsByIdsBodyParams.ts'; -export * from '../models/Person.ts'; -export * from '../models/PersonBirthParams.ts'; -export * from '../models/PersonBirthResponse.ts'; -export * from '../models/PersonControllerFindPersonenkontexte200Response.ts'; -export * from '../models/PersonEmailResponse.ts'; -export * from '../models/PersonFrontendControllerFindPersons200Response.ts'; -export * from '../models/PersonIdResponse.ts'; -export * from '../models/PersonInfoResponse.ts'; -export * from '../models/PersonLockResponse.ts'; -export * from '../models/PersonMetadataBodyParams.ts'; -export * from '../models/PersonNameParams.ts'; -export * from '../models/PersonNameResponse.ts'; -export * from '../models/PersonResponse.ts'; -export * from '../models/PersonResponseAutomapper.ts'; -export * from '../models/PersonendatensatzResponse.ts'; -export * from '../models/PersonendatensatzResponseAutomapper.ts'; -export * from '../models/PersonenkontextMigrationRuntype.ts'; -export * from '../models/PersonenkontextResponse.ts'; -export * from '../models/PersonenkontextRolleFieldsResponse.ts'; -export * from '../models/PersonenkontextWorkflowResponse.ts'; -export * from '../models/PersonenkontextdatensatzResponse.ts'; -export * from '../models/PersonenkontexteUpdateResponse.ts'; -export * from '../models/Personenstatus.ts'; -export * from '../models/PersonenuebersichtBodyParams.ts'; -export * from '../models/RawPagedResponse.ts'; -export * from '../models/RolleResponse.ts'; -export * from '../models/RolleServiceProviderBodyParams.ts'; -export * from '../models/RolleServiceProviderResponse.ts'; -export * from '../models/RolleWithServiceProvidersResponse.ts'; -export * from '../models/RollenArt.ts'; -export * from '../models/RollenMerkmal.ts'; -export * from '../models/RollenSystemRecht.ts'; -export * from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; -export * from '../models/ServiceProviderIdNameResponse.ts'; -export * from '../models/ServiceProviderKategorie.ts'; -export * from '../models/ServiceProviderResponse.ts'; -export * from '../models/ServiceProviderTarget.ts'; -export * from '../models/Sichtfreigabe.ts'; -export * from '../models/SystemrechtResponse.ts'; -export * from '../models/TokenInitBodyParams.ts'; -export * from '../models/TokenRequiredResponse.ts'; -export * from '../models/TokenStateResponse.ts'; -export * from '../models/TokenVerifyBodyParams.ts'; -export * from '../models/TraegerschaftTyp.ts'; -export * from '../models/UpdateOrganisationBodyParams.ts'; -export * from '../models/UpdatePersonBodyParams.ts'; -export * from '../models/UpdateRolleBodyParams.ts'; -export * from '../models/UserLockParams.ts'; -export * from '../models/UserinfoResponse.ts'; -export * from '../models/Vertrauensstufe.ts'; - -import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; -import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; -import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; -import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; -import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; -import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; -import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; -import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; -import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; -import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; -import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; -import { DbiamImportError, DbiamImportErrorI18nKeyEnum } from '../models/DbiamImportError.ts'; -import { DbiamOrganisationError, DbiamOrganisationErrorI18nKeyEnum } from '../models/DbiamOrganisationError.ts'; -import { DbiamPersonError, DbiamPersonErrorI18nKeyEnum } from '../models/DbiamPersonError.ts'; -import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; -import { DbiamPersonenkontextError, DbiamPersonenkontextErrorI18nKeyEnum } from '../models/DbiamPersonenkontextError.ts'; -import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; -import { DbiamPersonenkontexteUpdateError, DbiamPersonenkontexteUpdateErrorI18nKeyEnum } from '../models/DbiamPersonenkontexteUpdateError.ts'; -import { DbiamRolleError, DbiamRolleErrorI18nKeyEnum } from '../models/DbiamRolleError.ts'; -import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; -import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; -import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; -import { FindRollenResponse } from '../models/FindRollenResponse.ts'; -import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; -import { Geschlecht } from '../models/Geschlecht.ts'; -import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; -import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; -import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; -import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; -import { LoeschungResponse } from '../models/LoeschungResponse.ts'; -import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; -import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; -import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; -import { Person } from '../models/Person.ts'; -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; -import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; -import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; -import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; -import { PersonIdResponse } from '../models/PersonIdResponse.ts'; -import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; -import { PersonLockResponse } from '../models/PersonLockResponse.ts'; -import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { PersonNameResponse } from '../models/PersonNameResponse.ts'; -import { PersonResponse } from '../models/PersonResponse.ts'; -import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; -import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; -import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; -import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; -import { PersonenkontextResponse , PersonenkontextResponsePersonenstatusEnum , PersonenkontextResponseJahrgangsstufeEnum , PersonenkontextResponseSichtfreigabeEnum } from '../models/PersonenkontextResponse.ts'; -import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; -import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; -import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; -import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; -import { Personenstatus } from '../models/Personenstatus.ts'; -import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; -import { RawPagedResponse } from '../models/RawPagedResponse.ts'; -import { RolleResponse } from '../models/RolleResponse.ts'; -import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; -import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; -import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; -import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; -import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; -import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; -import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; -import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; -import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; -import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; -import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; -import { TokenStateResponse } from '../models/TokenStateResponse.ts'; -import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; -import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; -import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; -import { UserLockParams } from '../models/UserLockParams.ts'; -import { UserinfoResponse } from '../models/UserinfoResponse.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +export * from "../models/AddSystemrechtBodyParams.ts"; +export * from "../models/AssignHardwareTokenBodyParams.ts"; +export * from "../models/AssignHardwareTokenResponse.ts"; +export * from "../models/CreateOrganisationBodyParams.ts"; +export * from "../models/CreatePersonMigrationBodyParams.ts"; +export * from "../models/CreateRolleBodyParams.ts"; +export * from "../models/DBiamPersonResponse.ts"; +export * from "../models/DBiamPersonenkontextResponse.ts"; +export * from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +export * from "../models/DBiamPersonenuebersichtResponse.ts"; +export * from "../models/DBiamPersonenzuordnungResponse.ts"; +export * from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +export * from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +export * from "../models/DbiamImportError.ts"; +export * from "../models/DbiamOrganisationError.ts"; +export * from "../models/DbiamPersonError.ts"; +export * from "../models/DbiamPersonenkontextBodyParams.ts"; +export * from "../models/DbiamPersonenkontextError.ts"; +export * from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; +export * from "../models/DbiamPersonenkontexteUpdateError.ts"; +export * from "../models/DbiamRolleError.ts"; +export * from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +export * from "../models/DeleteRevisionBodyParams.ts"; +export * from "../models/EmailAddressStatus.ts"; +export * from "../models/FindRollenResponse.ts"; +export * from "../models/FindSchulstrukturknotenResponse.ts"; +export * from "../models/Geschlecht.ts"; +export * from "../models/ImportDataItemResponse.ts"; +export * from "../models/ImportUploadResponse.ts"; +export * from "../models/ImportvorgangByIdBodyParams.ts"; +export * from "../models/LockUserBodyParams.ts"; +export * from "../models/LoeschungResponse.ts"; +export * from "../models/OrganisationByIdBodyParams.ts"; +export * from "../models/OrganisationByNameBodyParams.ts"; +export * from "../models/OrganisationResponse.ts"; +export * from "../models/OrganisationResponseLegacy.ts"; +export * from "../models/OrganisationRootChildrenResponse.ts"; +export * from "../models/OrganisationsTyp.ts"; +export * from "../models/ParentOrganisationenResponse.ts"; +export * from "../models/ParentOrganisationsByIdsBodyParams.ts"; +export * from "../models/Person.ts"; +export * from "../models/PersonBirthParams.ts"; +export * from "../models/PersonBirthResponse.ts"; +export * from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +export * from "../models/PersonEmailResponse.ts"; +export * from "../models/PersonFrontendControllerFindPersons200Response.ts"; +export * from "../models/PersonIdResponse.ts"; +export * from "../models/PersonInfoResponse.ts"; +export * from "../models/PersonLockResponse.ts"; +export * from "../models/PersonMetadataBodyParams.ts"; +export * from "../models/PersonNameParams.ts"; +export * from "../models/PersonNameResponse.ts"; +export * from "../models/PersonResponse.ts"; +export * from "../models/PersonResponseAutomapper.ts"; +export * from "../models/PersonendatensatzResponse.ts"; +export * from "../models/PersonendatensatzResponseAutomapper.ts"; +export * from "../models/PersonenkontextMigrationRuntype.ts"; +export * from "../models/PersonenkontextResponse.ts"; +export * from "../models/PersonenkontextRolleFieldsResponse.ts"; +export * from "../models/PersonenkontextWorkflowResponse.ts"; +export * from "../models/PersonenkontextdatensatzResponse.ts"; +export * from "../models/PersonenkontexteUpdateResponse.ts"; +export * from "../models/Personenstatus.ts"; +export * from "../models/PersonenuebersichtBodyParams.ts"; +export * from "../models/RawPagedResponse.ts"; +export * from "../models/RolleResponse.ts"; +export * from "../models/RolleServiceProviderBodyParams.ts"; +export * from "../models/RolleServiceProviderResponse.ts"; +export * from "../models/RolleWithServiceProvidersResponse.ts"; +export * from "../models/RollenArt.ts"; +export * from "../models/RollenMerkmal.ts"; +export * from "../models/RollenSystemRecht.ts"; +export * from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +export * from "../models/ServiceProviderIdNameResponse.ts"; +export * from "../models/ServiceProviderKategorie.ts"; +export * from "../models/ServiceProviderResponse.ts"; +export * from "../models/ServiceProviderTarget.ts"; +export * from "../models/Sichtfreigabe.ts"; +export * from "../models/SystemrechtResponse.ts"; +export * from "../models/TokenInitBodyParams.ts"; +export * from "../models/TokenRequiredResponse.ts"; +export * from "../models/TokenStateResponse.ts"; +export * from "../models/TokenVerifyBodyParams.ts"; +export * from "../models/TraegerschaftTyp.ts"; +export * from "../models/UpdateOrganisationBodyParams.ts"; +export * from "../models/UpdatePersonBodyParams.ts"; +export * from "../models/UpdateRolleBodyParams.ts"; +export * from "../models/UserLockParams.ts"; +export * from "../models/UserinfoResponse.ts"; +export * from "../models/Vertrauensstufe.ts"; + +import { AddSystemrechtBodyParams } from "../models/AddSystemrechtBodyParams.ts"; +import { AssignHardwareTokenBodyParams } from "../models/AssignHardwareTokenBodyParams.ts"; +import { AssignHardwareTokenResponse } from "../models/AssignHardwareTokenResponse.ts"; +import { CreateOrganisationBodyParams } from "../models/CreateOrganisationBodyParams.ts"; +import { CreatePersonMigrationBodyParams } from "../models/CreatePersonMigrationBodyParams.ts"; +import { CreateRolleBodyParams } from "../models/CreateRolleBodyParams.ts"; +import { DBiamPersonResponse } from "../models/DBiamPersonResponse.ts"; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +import { DBiamPersonenuebersichtResponse } from "../models/DBiamPersonenuebersichtResponse.ts"; +import { DBiamPersonenzuordnungResponse } from "../models/DBiamPersonenzuordnungResponse.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DbiamCreatePersonenkontextBodyParams } from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +import { + DbiamImportError, + DbiamImportErrorI18nKeyEnum, +} from "../models/DbiamImportError.ts"; +import { + DbiamOrganisationError, + DbiamOrganisationErrorI18nKeyEnum, +} from "../models/DbiamOrganisationError.ts"; +import { + DbiamPersonError, + DbiamPersonErrorI18nKeyEnum, +} from "../models/DbiamPersonError.ts"; +import { DbiamPersonenkontextBodyParams } from "../models/DbiamPersonenkontextBodyParams.ts"; +import { + DbiamPersonenkontextError, + DbiamPersonenkontextErrorI18nKeyEnum, +} from "../models/DbiamPersonenkontextError.ts"; +import { DbiamPersonenkontextMigrationBodyParams } from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; +import { + DbiamPersonenkontexteUpdateError, + DbiamPersonenkontexteUpdateErrorI18nKeyEnum, +} from "../models/DbiamPersonenkontexteUpdateError.ts"; +import { + DbiamRolleError, + DbiamRolleErrorI18nKeyEnum, +} from "../models/DbiamRolleError.ts"; +import { DbiamUpdatePersonenkontexteBodyParams } from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +import { DeleteRevisionBodyParams } from "../models/DeleteRevisionBodyParams.ts"; +import { EmailAddressStatus } from "../models/EmailAddressStatus.ts"; +import { FindRollenResponse } from "../models/FindRollenResponse.ts"; +import { FindSchulstrukturknotenResponse } from "../models/FindSchulstrukturknotenResponse.ts"; +import { Geschlecht } from "../models/Geschlecht.ts"; +import { ImportDataItemResponse } from "../models/ImportDataItemResponse.ts"; +import { ImportUploadResponse } from "../models/ImportUploadResponse.ts"; +import { ImportvorgangByIdBodyParams } from "../models/ImportvorgangByIdBodyParams.ts"; +import { LockUserBodyParams } from "../models/LockUserBodyParams.ts"; +import { LoeschungResponse } from "../models/LoeschungResponse.ts"; +import { OrganisationByIdBodyParams } from "../models/OrganisationByIdBodyParams.ts"; +import { OrganisationByNameBodyParams } from "../models/OrganisationByNameBodyParams.ts"; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { OrganisationRootChildrenResponse } from "../models/OrganisationRootChildrenResponse.ts"; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { ParentOrganisationenResponse } from "../models/ParentOrganisationenResponse.ts"; +import { ParentOrganisationsByIdsBodyParams } from "../models/ParentOrganisationsByIdsBodyParams.ts"; +import { Person } from "../models/Person.ts"; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonBirthResponse } from "../models/PersonBirthResponse.ts"; +import { PersonControllerFindPersonenkontexte200Response } from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +import { PersonEmailResponse } from "../models/PersonEmailResponse.ts"; +import { PersonFrontendControllerFindPersons200Response } from "../models/PersonFrontendControllerFindPersons200Response.ts"; +import { PersonIdResponse } from "../models/PersonIdResponse.ts"; +import { PersonInfoResponse } from "../models/PersonInfoResponse.ts"; +import { PersonLockResponse } from "../models/PersonLockResponse.ts"; +import { PersonMetadataBodyParams } from "../models/PersonMetadataBodyParams.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { PersonNameResponse } from "../models/PersonNameResponse.ts"; +import { PersonResponse } from "../models/PersonResponse.ts"; +import { PersonResponseAutomapper } from "../models/PersonResponseAutomapper.ts"; +import { PersonendatensatzResponse } from "../models/PersonendatensatzResponse.ts"; +import { PersonendatensatzResponseAutomapper } from "../models/PersonendatensatzResponseAutomapper.ts"; +import { PersonenkontextMigrationRuntype } from "../models/PersonenkontextMigrationRuntype.ts"; +import { + PersonenkontextResponse, + PersonenkontextResponsePersonenstatusEnum, + PersonenkontextResponseJahrgangsstufeEnum, + PersonenkontextResponseSichtfreigabeEnum, +} from "../models/PersonenkontextResponse.ts"; +import { PersonenkontextRolleFieldsResponse } from "../models/PersonenkontextRolleFieldsResponse.ts"; +import { PersonenkontextWorkflowResponse } from "../models/PersonenkontextWorkflowResponse.ts"; +import { PersonenkontextdatensatzResponse } from "../models/PersonenkontextdatensatzResponse.ts"; +import { PersonenkontexteUpdateResponse } from "../models/PersonenkontexteUpdateResponse.ts"; +import { Personenstatus } from "../models/Personenstatus.ts"; +import { PersonenuebersichtBodyParams } from "../models/PersonenuebersichtBodyParams.ts"; +import { RawPagedResponse } from "../models/RawPagedResponse.ts"; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { RolleServiceProviderBodyParams } from "../models/RolleServiceProviderBodyParams.ts"; +import { RolleServiceProviderResponse } from "../models/RolleServiceProviderResponse.ts"; +import { RolleWithServiceProvidersResponse } from "../models/RolleWithServiceProvidersResponse.ts"; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { RollenSystemRechtServiceProviderIDResponse } from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +import { ServiceProviderIdNameResponse } from "../models/ServiceProviderIdNameResponse.ts"; +import { ServiceProviderKategorie } from "../models/ServiceProviderKategorie.ts"; +import { ServiceProviderResponse } from "../models/ServiceProviderResponse.ts"; +import { ServiceProviderTarget } from "../models/ServiceProviderTarget.ts"; +import { Sichtfreigabe } from "../models/Sichtfreigabe.ts"; +import { SystemrechtResponse } from "../models/SystemrechtResponse.ts"; +import { TokenInitBodyParams } from "../models/TokenInitBodyParams.ts"; +import { TokenRequiredResponse } from "../models/TokenRequiredResponse.ts"; +import { TokenStateResponse } from "../models/TokenStateResponse.ts"; +import { TokenVerifyBodyParams } from "../models/TokenVerifyBodyParams.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { UpdateOrganisationBodyParams } from "../models/UpdateOrganisationBodyParams.ts"; +import { UpdatePersonBodyParams } from "../models/UpdatePersonBodyParams.ts"; +import { UpdateRolleBodyParams } from "../models/UpdateRolleBodyParams.ts"; +import { UserLockParams } from "../models/UserLockParams.ts"; +import { UserinfoResponse } from "../models/UserinfoResponse.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; /* tslint:disable:no-unused-variable */ let primitives = [ - "string", - "boolean", - "double", - "integer", - "long", - "float", - "number", - "any" - ]; + "string", + "boolean", + "double", + "integer", + "long", + "float", + "number", + "any", +]; let enumsMap: Set = new Set([ - "DbiamImportErrorI18nKeyEnum", - "DbiamOrganisationErrorI18nKeyEnum", - "DbiamPersonErrorI18nKeyEnum", - "DbiamPersonenkontextErrorI18nKeyEnum", - "DbiamPersonenkontexteUpdateErrorI18nKeyEnum", - "DbiamRolleErrorI18nKeyEnum", - "EmailAddressStatus", - "Geschlecht", - "OrganisationsTyp", - "PersonenkontextMigrationRuntype", - "PersonenkontextResponsePersonenstatusEnum", - "PersonenkontextResponseJahrgangsstufeEnum", - "PersonenkontextResponseSichtfreigabeEnum", - "Personenstatus", - "RollenArt", - "RollenMerkmal", - "RollenSystemRecht", - "ServiceProviderKategorie", - "ServiceProviderTarget", - "Sichtfreigabe", - "TraegerschaftTyp", - "Vertrauensstufe", + "DbiamImportErrorI18nKeyEnum", + "DbiamOrganisationErrorI18nKeyEnum", + "DbiamPersonErrorI18nKeyEnum", + "DbiamPersonenkontextErrorI18nKeyEnum", + "DbiamPersonenkontexteUpdateErrorI18nKeyEnum", + "DbiamRolleErrorI18nKeyEnum", + "EmailAddressStatus", + "Geschlecht", + "OrganisationsTyp", + "PersonenkontextMigrationRuntype", + "PersonenkontextResponsePersonenstatusEnum", + "PersonenkontextResponseJahrgangsstufeEnum", + "PersonenkontextResponseSichtfreigabeEnum", + "Personenstatus", + "RollenArt", + "RollenMerkmal", + "RollenSystemRecht", + "ServiceProviderKategorie", + "ServiceProviderTarget", + "Sichtfreigabe", + "TraegerschaftTyp", + "Vertrauensstufe", ]); -let typeMap: {[index: string]: any} = { - "AddSystemrechtBodyParams": AddSystemrechtBodyParams, - "AssignHardwareTokenBodyParams": AssignHardwareTokenBodyParams, - "AssignHardwareTokenResponse": AssignHardwareTokenResponse, - "CreateOrganisationBodyParams": CreateOrganisationBodyParams, - "CreatePersonMigrationBodyParams": CreatePersonMigrationBodyParams, - "CreateRolleBodyParams": CreateRolleBodyParams, - "DBiamPersonResponse": DBiamPersonResponse, - "DBiamPersonenkontextResponse": DBiamPersonenkontextResponse, - "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response": DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response, - "DBiamPersonenuebersichtResponse": DBiamPersonenuebersichtResponse, - "DBiamPersonenzuordnungResponse": DBiamPersonenzuordnungResponse, - "DbiamCreatePersonWithPersonenkontexteBodyParams": DbiamCreatePersonWithPersonenkontexteBodyParams, - "DbiamCreatePersonenkontextBodyParams": DbiamCreatePersonenkontextBodyParams, - "DbiamImportError": DbiamImportError, - "DbiamOrganisationError": DbiamOrganisationError, - "DbiamPersonError": DbiamPersonError, - "DbiamPersonenkontextBodyParams": DbiamPersonenkontextBodyParams, - "DbiamPersonenkontextError": DbiamPersonenkontextError, - "DbiamPersonenkontextMigrationBodyParams": DbiamPersonenkontextMigrationBodyParams, - "DbiamPersonenkontexteUpdateError": DbiamPersonenkontexteUpdateError, - "DbiamRolleError": DbiamRolleError, - "DbiamUpdatePersonenkontexteBodyParams": DbiamUpdatePersonenkontexteBodyParams, - "DeleteRevisionBodyParams": DeleteRevisionBodyParams, - "FindRollenResponse": FindRollenResponse, - "FindSchulstrukturknotenResponse": FindSchulstrukturknotenResponse, - "ImportDataItemResponse": ImportDataItemResponse, - "ImportUploadResponse": ImportUploadResponse, - "ImportvorgangByIdBodyParams": ImportvorgangByIdBodyParams, - "LockUserBodyParams": LockUserBodyParams, - "LoeschungResponse": LoeschungResponse, - "OrganisationByIdBodyParams": OrganisationByIdBodyParams, - "OrganisationByNameBodyParams": OrganisationByNameBodyParams, - "OrganisationResponse": OrganisationResponse, - "OrganisationResponseLegacy": OrganisationResponseLegacy, - "OrganisationRootChildrenResponse": OrganisationRootChildrenResponse, - "ParentOrganisationenResponse": ParentOrganisationenResponse, - "ParentOrganisationsByIdsBodyParams": ParentOrganisationsByIdsBodyParams, - "Person": Person, - "PersonBirthParams": PersonBirthParams, - "PersonBirthResponse": PersonBirthResponse, - "PersonControllerFindPersonenkontexte200Response": PersonControllerFindPersonenkontexte200Response, - "PersonEmailResponse": PersonEmailResponse, - "PersonFrontendControllerFindPersons200Response": PersonFrontendControllerFindPersons200Response, - "PersonIdResponse": PersonIdResponse, - "PersonInfoResponse": PersonInfoResponse, - "PersonLockResponse": PersonLockResponse, - "PersonMetadataBodyParams": PersonMetadataBodyParams, - "PersonNameParams": PersonNameParams, - "PersonNameResponse": PersonNameResponse, - "PersonResponse": PersonResponse, - "PersonResponseAutomapper": PersonResponseAutomapper, - "PersonendatensatzResponse": PersonendatensatzResponse, - "PersonendatensatzResponseAutomapper": PersonendatensatzResponseAutomapper, - "PersonenkontextResponse": PersonenkontextResponse, - "PersonenkontextRolleFieldsResponse": PersonenkontextRolleFieldsResponse, - "PersonenkontextWorkflowResponse": PersonenkontextWorkflowResponse, - "PersonenkontextdatensatzResponse": PersonenkontextdatensatzResponse, - "PersonenkontexteUpdateResponse": PersonenkontexteUpdateResponse, - "PersonenuebersichtBodyParams": PersonenuebersichtBodyParams, - "RawPagedResponse": RawPagedResponse, - "RolleResponse": RolleResponse, - "RolleServiceProviderBodyParams": RolleServiceProviderBodyParams, - "RolleServiceProviderResponse": RolleServiceProviderResponse, - "RolleWithServiceProvidersResponse": RolleWithServiceProvidersResponse, - "RollenSystemRechtServiceProviderIDResponse": RollenSystemRechtServiceProviderIDResponse, - "ServiceProviderIdNameResponse": ServiceProviderIdNameResponse, - "ServiceProviderResponse": ServiceProviderResponse, - "SystemrechtResponse": SystemrechtResponse, - "TokenInitBodyParams": TokenInitBodyParams, - "TokenRequiredResponse": TokenRequiredResponse, - "TokenStateResponse": TokenStateResponse, - "TokenVerifyBodyParams": TokenVerifyBodyParams, - "UpdateOrganisationBodyParams": UpdateOrganisationBodyParams, - "UpdatePersonBodyParams": UpdatePersonBodyParams, - "UpdateRolleBodyParams": UpdateRolleBodyParams, - "UserLockParams": UserLockParams, - "UserinfoResponse": UserinfoResponse, -} +let typeMap: { [index: string]: any } = { + AddSystemrechtBodyParams: AddSystemrechtBodyParams, + AssignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, + AssignHardwareTokenResponse: AssignHardwareTokenResponse, + CreateOrganisationBodyParams: CreateOrganisationBodyParams, + CreatePersonMigrationBodyParams: CreatePersonMigrationBodyParams, + CreateRolleBodyParams: CreateRolleBodyParams, + DBiamPersonResponse: DBiamPersonResponse, + DBiamPersonenkontextResponse: DBiamPersonenkontextResponse, + DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response: + DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response, + DBiamPersonenuebersichtResponse: DBiamPersonenuebersichtResponse, + DBiamPersonenzuordnungResponse: DBiamPersonenzuordnungResponse, + DbiamCreatePersonWithPersonenkontexteBodyParams: + DbiamCreatePersonWithPersonenkontexteBodyParams, + DbiamCreatePersonenkontextBodyParams: DbiamCreatePersonenkontextBodyParams, + DbiamImportError: DbiamImportError, + DbiamOrganisationError: DbiamOrganisationError, + DbiamPersonError: DbiamPersonError, + DbiamPersonenkontextBodyParams: DbiamPersonenkontextBodyParams, + DbiamPersonenkontextError: DbiamPersonenkontextError, + DbiamPersonenkontextMigrationBodyParams: + DbiamPersonenkontextMigrationBodyParams, + DbiamPersonenkontexteUpdateError: DbiamPersonenkontexteUpdateError, + DbiamRolleError: DbiamRolleError, + DbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, + DeleteRevisionBodyParams: DeleteRevisionBodyParams, + FindRollenResponse: FindRollenResponse, + FindSchulstrukturknotenResponse: FindSchulstrukturknotenResponse, + ImportDataItemResponse: ImportDataItemResponse, + ImportUploadResponse: ImportUploadResponse, + ImportvorgangByIdBodyParams: ImportvorgangByIdBodyParams, + LockUserBodyParams: LockUserBodyParams, + LoeschungResponse: LoeschungResponse, + OrganisationByIdBodyParams: OrganisationByIdBodyParams, + OrganisationByNameBodyParams: OrganisationByNameBodyParams, + OrganisationResponse: OrganisationResponse, + OrganisationResponseLegacy: OrganisationResponseLegacy, + OrganisationRootChildrenResponse: OrganisationRootChildrenResponse, + ParentOrganisationenResponse: ParentOrganisationenResponse, + ParentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, + Person: Person, + PersonBirthParams: PersonBirthParams, + PersonBirthResponse: PersonBirthResponse, + PersonControllerFindPersonenkontexte200Response: + PersonControllerFindPersonenkontexte200Response, + PersonEmailResponse: PersonEmailResponse, + PersonFrontendControllerFindPersons200Response: + PersonFrontendControllerFindPersons200Response, + PersonIdResponse: PersonIdResponse, + PersonInfoResponse: PersonInfoResponse, + PersonLockResponse: PersonLockResponse, + PersonMetadataBodyParams: PersonMetadataBodyParams, + PersonNameParams: PersonNameParams, + PersonNameResponse: PersonNameResponse, + PersonResponse: PersonResponse, + PersonResponseAutomapper: PersonResponseAutomapper, + PersonendatensatzResponse: PersonendatensatzResponse, + PersonendatensatzResponseAutomapper: PersonendatensatzResponseAutomapper, + PersonenkontextResponse: PersonenkontextResponse, + PersonenkontextRolleFieldsResponse: PersonenkontextRolleFieldsResponse, + PersonenkontextWorkflowResponse: PersonenkontextWorkflowResponse, + PersonenkontextdatensatzResponse: PersonenkontextdatensatzResponse, + PersonenkontexteUpdateResponse: PersonenkontexteUpdateResponse, + PersonenuebersichtBodyParams: PersonenuebersichtBodyParams, + RawPagedResponse: RawPagedResponse, + RolleResponse: RolleResponse, + RolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + RolleServiceProviderResponse: RolleServiceProviderResponse, + RolleWithServiceProvidersResponse: RolleWithServiceProvidersResponse, + RollenSystemRechtServiceProviderIDResponse: + RollenSystemRechtServiceProviderIDResponse, + ServiceProviderIdNameResponse: ServiceProviderIdNameResponse, + ServiceProviderResponse: ServiceProviderResponse, + SystemrechtResponse: SystemrechtResponse, + TokenInitBodyParams: TokenInitBodyParams, + TokenRequiredResponse: TokenRequiredResponse, + TokenStateResponse: TokenStateResponse, + TokenVerifyBodyParams: TokenVerifyBodyParams, + UpdateOrganisationBodyParams: UpdateOrganisationBodyParams, + UpdatePersonBodyParams: UpdatePersonBodyParams, + UpdateRolleBodyParams: UpdateRolleBodyParams, + UserLockParams: UserLockParams, + UserinfoResponse: UserinfoResponse, +}; type MimeTypeDescriptor = { - type: string; - subtype: string; - subtypeTokens: string[]; + type: string; + subtype: string; + subtypeTokens: string[]; }; /** @@ -313,40 +342,57 @@ type MimeTypeDescriptor = { * the payload. */ const parseMimeType = (mimeType: string): MimeTypeDescriptor => { - const [type, subtype] = mimeType.split('/'); - return { - type, - subtype, - subtypeTokens: subtype.split('+'), - }; + const [type, subtype] = mimeType.split("/"); + return { + type, + subtype, + subtypeTokens: subtype.split("+"), + }; }; type MimeTypePredicate = (mimeType: string) => boolean; // This factory creates a predicate function that checks a string mime-type against defined rules. -const mimeTypePredicateFactory = (predicate: (descriptor: MimeTypeDescriptor) => boolean): MimeTypePredicate => (mimeType) => predicate(parseMimeType(mimeType)); +const mimeTypePredicateFactory = + (predicate: (descriptor: MimeTypeDescriptor) => boolean): MimeTypePredicate => + (mimeType) => + predicate(parseMimeType(mimeType)); // Use this factory when you need to define a simple predicate based only on type and, if applicable, subtype. -const mimeTypeSimplePredicateFactory = (type: string, subtype?: string): MimeTypePredicate => mimeTypePredicateFactory((descriptor) => { +const mimeTypeSimplePredicateFactory = ( + type: string, + subtype?: string, +): MimeTypePredicate => + mimeTypePredicateFactory((descriptor) => { if (descriptor.type !== type) return false; if (subtype != null && descriptor.subtype !== subtype) return false; return true; -}); + }); // Creating a set of named predicates that will help us determine how to handle different mime-types -const isTextLikeMimeType = mimeTypeSimplePredicateFactory('text'); -const isJsonMimeType = mimeTypeSimplePredicateFactory('application', 'json'); -const isJsonLikeMimeType = mimeTypePredicateFactory((descriptor) => descriptor.type === 'application' && descriptor.subtypeTokens.some((item) => item === 'json')); -const isOctetStreamMimeType = mimeTypeSimplePredicateFactory('application', 'octet-stream'); -const isFormUrlencodedMimeType = mimeTypeSimplePredicateFactory('application', 'x-www-form-urlencoded'); +const isTextLikeMimeType = mimeTypeSimplePredicateFactory("text"); +const isJsonMimeType = mimeTypeSimplePredicateFactory("application", "json"); +const isJsonLikeMimeType = mimeTypePredicateFactory( + (descriptor) => + descriptor.type === "application" && + descriptor.subtypeTokens.some((item) => item === "json"), +); +const isOctetStreamMimeType = mimeTypeSimplePredicateFactory( + "application", + "octet-stream", +); +const isFormUrlencodedMimeType = mimeTypeSimplePredicateFactory( + "application", + "x-www-form-urlencoded", +); // Defining a list of mime-types in the order of prioritization for handling. const supportedMimeTypePredicatesWithPriority: MimeTypePredicate[] = [ - isJsonMimeType, - isJsonLikeMimeType, - isTextLikeMimeType, - isOctetStreamMimeType, - isFormUrlencodedMimeType, + isJsonMimeType, + isJsonLikeMimeType, + isTextLikeMimeType, + isOctetStreamMimeType, + isFormUrlencodedMimeType, ]; const nullableSuffix = " | null"; @@ -357,228 +403,252 @@ const mapPrefix = "{ [key: string]: "; const mapSuffix = "; }"; export class ObjectSerializer { - public static findCorrectType(data: any, expectedType: string) { - if (data == undefined) { - return expectedType; - } else if (primitives.indexOf(expectedType.toLowerCase()) !== -1) { - return expectedType; - } else if (expectedType === "Date") { - return expectedType; + public static findCorrectType(data: any, expectedType: string) { + if (data == undefined) { + return expectedType; + } else if (primitives.indexOf(expectedType.toLowerCase()) !== -1) { + return expectedType; + } else if (expectedType === "Date") { + return expectedType; + } else { + if (enumsMap.has(expectedType)) { + return expectedType; + } + + if (!typeMap[expectedType]) { + return expectedType; // w/e we don't know the type + } + + // Check the discriminator + let discriminatorProperty = typeMap[expectedType].discriminator; + if (discriminatorProperty == null) { + return expectedType; // the type does not have a discriminator. use it. + } else { + if (data[discriminatorProperty]) { + var discriminatorType = data[discriminatorProperty]; + let mapping = typeMap[expectedType].mapping; + if (mapping != undefined && mapping[discriminatorType]) { + return mapping[discriminatorType]; // use the type given in the discriminator + } else if (typeMap[discriminatorType]) { + return discriminatorType; + } else { + return expectedType; // discriminator did not map to a type + } } else { - if (enumsMap.has(expectedType)) { - return expectedType; - } - - if (!typeMap[expectedType]) { - return expectedType; // w/e we don't know the type - } - - // Check the discriminator - let discriminatorProperty = typeMap[expectedType].discriminator; - if (discriminatorProperty == null) { - return expectedType; // the type does not have a discriminator. use it. - } else { - if (data[discriminatorProperty]) { - var discriminatorType = data[discriminatorProperty]; - let mapping = typeMap[expectedType].mapping; - if (mapping != undefined && mapping[discriminatorType]) { - return mapping[discriminatorType]; // use the type given in the discriminator - } else if(typeMap[discriminatorType]) { - return discriminatorType; - } else { - return expectedType; // discriminator did not map to a type - } - } else { - return expectedType; // discriminator was not present (or an empty string) - } - } + return expectedType; // discriminator was not present (or an empty string) } + } } - - public static serialize(data: any, type: string, format: string): any { - if (data == undefined) { - return data; - } else if (primitives.indexOf(type.toLowerCase()) !== -1) { - return data; - } else if (type.endsWith(nullableSuffix)) { - let subType: string = type.slice(0, -nullableSuffix.length); // Type | null => Type - return ObjectSerializer.serialize(data, subType, format); - } else if (type.endsWith(optionalSuffix)) { - let subType: string = type.slice(0, -optionalSuffix.length); // Type | undefined => Type - return ObjectSerializer.serialize(data, subType, format); - } else if (type.startsWith(arrayPrefix)) { - let subType: string = type.slice(arrayPrefix.length, -arraySuffix.length); // Array => Type - let transformedData: any[] = []; - for (let date of data) { - transformedData.push(ObjectSerializer.serialize(date, subType, format)); - } - return transformedData; - } else if (type.startsWith(mapPrefix)) { - let subType: string = type.slice(mapPrefix.length, -mapSuffix.length); // { [key: string]: Type; } => Type - let transformedData: { [key: string]: any } = {}; - for (let key in data) { - transformedData[key] = ObjectSerializer.serialize( - data[key], - subType, - format, - ); - } - return transformedData; - } else if (type === "Date") { - if (format == "date") { - let month = data.getMonth()+1 - month = month < 10 ? "0" + month.toString() : month.toString() - let day = data.getDate(); - day = day < 10 ? "0" + day.toString() : day.toString(); - - return data.getFullYear() + "-" + month + "-" + day; - } else { - return data.toISOString(); - } - } else { - if (enumsMap.has(type)) { - return data; - } - if (!typeMap[type]) { // in case we dont know the type - return data; - } - - // Get the actual type of this object - type = this.findCorrectType(data, type); - - // get the map for the correct type. - let attributeTypes = typeMap[type].getAttributeTypeMap(); - let instance: {[index: string]: any} = {}; - for (let attributeType of attributeTypes) { - instance[attributeType.baseName] = ObjectSerializer.serialize(data[attributeType.name], attributeType.type, attributeType.format); - } - return instance; - } + } + + public static serialize(data: any, type: string, format: string): any { + if (data == undefined) { + return data; + } else if (primitives.indexOf(type.toLowerCase()) !== -1) { + return data; + } else if (type.endsWith(nullableSuffix)) { + let subType: string = type.slice(0, -nullableSuffix.length); // Type | null => Type + return ObjectSerializer.serialize(data, subType, format); + } else if (type.endsWith(optionalSuffix)) { + let subType: string = type.slice(0, -optionalSuffix.length); // Type | undefined => Type + return ObjectSerializer.serialize(data, subType, format); + } else if (type.startsWith(arrayPrefix)) { + let subType: string = type.slice(arrayPrefix.length, -arraySuffix.length); // Array => Type + let transformedData: any[] = []; + for (let date of data) { + transformedData.push(ObjectSerializer.serialize(date, subType, format)); + } + return transformedData; + } else if (type.startsWith(mapPrefix)) { + let subType: string = type.slice(mapPrefix.length, -mapSuffix.length); // { [key: string]: Type; } => Type + let transformedData: { [key: string]: any } = {}; + for (let key in data) { + transformedData[key] = ObjectSerializer.serialize( + data[key], + subType, + format, + ); + } + return transformedData; + } else if (type === "Date") { + if (format == "date") { + let month = data.getMonth() + 1; + month = month < 10 ? "0" + month.toString() : month.toString(); + let day = data.getDate(); + day = day < 10 ? "0" + day.toString() : day.toString(); + + return data.getFullYear() + "-" + month + "-" + day; + } else { + return data.toISOString(); + } + } else { + if (enumsMap.has(type)) { + return data; + } + if (!typeMap[type]) { + // in case we dont know the type + return data; + } + + // Get the actual type of this object + type = this.findCorrectType(data, type); + + // get the map for the correct type. + let attributeTypes = typeMap[type].getAttributeTypeMap(); + let instance: { [index: string]: any } = {}; + for (let attributeType of attributeTypes) { + instance[attributeType.baseName] = ObjectSerializer.serialize( + data[attributeType.name], + attributeType.type, + attributeType.format, + ); + } + return instance; } - - public static deserialize(data: any, type: string, format: string): any { - // polymorphism may change the actual type. - type = ObjectSerializer.findCorrectType(data, type); - if (data == undefined) { - return data; - } else if (primitives.indexOf(type.toLowerCase()) !== -1) { - return data; - } else if (type.endsWith(nullableSuffix)) { - let subType: string = type.slice(0, -nullableSuffix.length); // Type | null => Type - return ObjectSerializer.deserialize(data, subType, format); - } else if (type.endsWith(optionalSuffix)) { - let subType: string = type.slice(0, -optionalSuffix.length); // Type | undefined => Type - return ObjectSerializer.deserialize(data, subType, format); - } else if (type.startsWith(arrayPrefix)) { - let subType: string = type.slice(arrayPrefix.length, -arraySuffix.length); // Array => Type - let transformedData: any[] = []; - for (let date of data) { - transformedData.push(ObjectSerializer.deserialize(date, subType, format)); - } - return transformedData; - } else if (type.startsWith(mapPrefix)) { - let subType: string = type.slice(mapPrefix.length, -mapSuffix.length); // { [key: string]: Type; } => Type - let transformedData: { [key: string]: any } = {}; - for (let key in data) { - transformedData[key] = ObjectSerializer.deserialize( - data[key], - subType, - format, - ); - } - return transformedData; - } else if (type === "Date") { - return new Date(data); - } else { - if (enumsMap.has(type)) {// is Enum - return data; - } - - if (!typeMap[type]) { // dont know the type - return data; - } - let instance = new typeMap[type](); - let attributeTypes = typeMap[type].getAttributeTypeMap(); - for (let attributeType of attributeTypes) { - let value = ObjectSerializer.deserialize(data[attributeType.baseName], attributeType.type, attributeType.format); - if (value !== undefined) { - instance[attributeType.name] = value; - } - } - return instance; + } + + public static deserialize(data: any, type: string, format: string): any { + // polymorphism may change the actual type. + type = ObjectSerializer.findCorrectType(data, type); + if (data == undefined) { + return data; + } else if (primitives.indexOf(type.toLowerCase()) !== -1) { + return data; + } else if (type.endsWith(nullableSuffix)) { + let subType: string = type.slice(0, -nullableSuffix.length); // Type | null => Type + return ObjectSerializer.deserialize(data, subType, format); + } else if (type.endsWith(optionalSuffix)) { + let subType: string = type.slice(0, -optionalSuffix.length); // Type | undefined => Type + return ObjectSerializer.deserialize(data, subType, format); + } else if (type.startsWith(arrayPrefix)) { + let subType: string = type.slice(arrayPrefix.length, -arraySuffix.length); // Array => Type + let transformedData: any[] = []; + for (let date of data) { + transformedData.push( + ObjectSerializer.deserialize(date, subType, format), + ); + } + return transformedData; + } else if (type.startsWith(mapPrefix)) { + let subType: string = type.slice(mapPrefix.length, -mapSuffix.length); // { [key: string]: Type; } => Type + let transformedData: { [key: string]: any } = {}; + for (let key in data) { + transformedData[key] = ObjectSerializer.deserialize( + data[key], + subType, + format, + ); + } + return transformedData; + } else if (type === "Date") { + return new Date(data); + } else { + if (enumsMap.has(type)) { + // is Enum + return data; + } + + if (!typeMap[type]) { + // dont know the type + return data; + } + let instance = new typeMap[type](); + let attributeTypes = typeMap[type].getAttributeTypeMap(); + for (let attributeType of attributeTypes) { + let value = ObjectSerializer.deserialize( + data[attributeType.baseName], + attributeType.type, + attributeType.format, + ); + if (value !== undefined) { + instance[attributeType.name] = value; } + } + return instance; } - - - /** - * Normalize media type - * - * We currently do not handle any media types attributes, i.e. anything - * after a semicolon. All content is assumed to be UTF-8 compatible. - */ - public static normalizeMediaType(mediaType: string | undefined): string | undefined { - if (mediaType === undefined) { - return undefined; - } - return mediaType.split(";")[0].trim().toLowerCase(); + } + + /** + * Normalize media type + * + * We currently do not handle any media types attributes, i.e. anything + * after a semicolon. All content is assumed to be UTF-8 compatible. + */ + public static normalizeMediaType( + mediaType: string | undefined, + ): string | undefined { + if (mediaType === undefined) { + return undefined; } - - /** - * From a list of possible media types, choose the one we can handle best. - * - * The order of the given media types does not have any impact on the choice - * made. - */ - public static getPreferredMediaType(mediaTypes: Array): string { - /** According to OAS 3 we should default to json */ - if (mediaTypes.length === 0) { - return "application/json"; - } - - const normalMediaTypes = mediaTypes.map(this.normalizeMediaType); - - for (const predicate of supportedMimeTypePredicatesWithPriority) { - for (const mediaType of normalMediaTypes) { - if (mediaType != null && predicate(mediaType)) { - return mediaType; - } - } - } - - throw new Error("None of the given media types are supported: " + mediaTypes.join(", ")); + return mediaType.split(";")[0].trim().toLowerCase(); + } + + /** + * From a list of possible media types, choose the one we can handle best. + * + * The order of the given media types does not have any impact on the choice + * made. + */ + public static getPreferredMediaType(mediaTypes: Array): string { + /** According to OAS 3 we should default to json */ + if (mediaTypes.length === 0) { + return "application/json"; } - /** - * Convert data to a string according the given media type - */ - public static stringify(data: any, mediaType: string): string { - if (isTextLikeMimeType(mediaType)) { - return String(data); - } + const normalMediaTypes = mediaTypes.map(this.normalizeMediaType); - if (isJsonLikeMimeType(mediaType)) { - return JSON.stringify(data); + for (const predicate of supportedMimeTypePredicatesWithPriority) { + for (const mediaType of normalMediaTypes) { + if (mediaType != null && predicate(mediaType)) { + return mediaType; } + } + } - throw new Error("The mediaType " + mediaType + " is not supported by ObjectSerializer.stringify."); + throw new Error( + "None of the given media types are supported: " + mediaTypes.join(", "), + ); + } + + /** + * Convert data to a string according the given media type + */ + public static stringify(data: any, mediaType: string): string { + if (isTextLikeMimeType(mediaType)) { + return String(data); } - /** - * Parse data from a string according to the given media type - */ - public static parse(rawData: string, mediaType: string | undefined) { - if (mediaType === undefined) { - throw new Error("Cannot parse content. No Content-Type defined."); - } + if (isJsonLikeMimeType(mediaType)) { + return JSON.stringify(data); + } - if (isTextLikeMimeType(mediaType)) { - return rawData; - } + throw new Error( + "The mediaType " + + mediaType + + " is not supported by ObjectSerializer.stringify.", + ); + } + + /** + * Parse data from a string according to the given media type + */ + public static parse(rawData: string, mediaType: string | undefined) { + if (mediaType === undefined) { + throw new Error("Cannot parse content. No Content-Type defined."); + } - if (isJsonLikeMimeType(mediaType)) { - return JSON.parse(rawData); - } + if (isTextLikeMimeType(mediaType)) { + return rawData; + } - throw new Error("The mediaType " + mediaType + " is not supported by ObjectSerializer.parse."); + if (isJsonLikeMimeType(mediaType)) { + return JSON.parse(rawData); } + + throw new Error( + "The mediaType " + + mediaType + + " is not supported by ObjectSerializer.parse.", + ); + } } diff --git a/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts b/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts index d8af300..a65ccde 100644 --- a/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts +++ b/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts @@ -3,37 +3,42 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class OrganisationByIdBodyParams { - /** - * The id of an organization - */ - 'organisationId': string; + /** + * The id of an organization + */ + "organisationId": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "organisationId", - "baseName": "organisationId", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "organisationId", + baseName: "organisationId", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return OrganisationByIdBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return OrganisationByIdBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts b/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts index ca1ecff..5715c4e 100644 --- a/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts +++ b/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts @@ -3,44 +3,49 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class OrganisationByNameBodyParams { - 'name': string; - /** - * The version for the organisation. - */ - 'version': number; + "name": string; + /** + * The version for the organisation. + */ + "version": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "version", + baseName: "version", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return OrganisationByNameBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return OrganisationByNameBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/OrganisationResponse.ts b/loadtest/api-client/generated/models/OrganisationResponse.ts index a2d9140..95e666d 100644 --- a/loadtest/api-client/generated/models/OrganisationResponse.ts +++ b/loadtest/api-client/generated/models/OrganisationResponse.ts @@ -3,101 +3,104 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { HttpFile } from "../http/http.ts"; export class OrganisationResponse { - 'id': string; - 'administriertVon': string | null; - 'kennung': string | null; - 'name': string; - 'namensergaenzung': string | null; - 'kuerzel': string; - 'typ': OrganisationsTyp; - 'traegerschaft': TraegerschaftTyp; - 'itslearningEnabled': boolean; - 'version': number; + "id": string; + "administriertVon": string | null; + "kennung": string | null; + "name": string; + "namensergaenzung": string | null; + "kuerzel": string; + "typ": OrganisationsTyp; + "traegerschaft": TraegerschaftTyp; + "itslearningEnabled": boolean; + "version": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "administriertVon", - "baseName": "administriertVon", - "type": "string", - "format": "" - }, - { - "name": "kennung", - "baseName": "kennung", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "namensergaenzung", - "baseName": "namensergaenzung", - "type": "string", - "format": "" - }, - { - "name": "kuerzel", - "baseName": "kuerzel", - "type": "string", - "format": "" - }, - { - "name": "typ", - "baseName": "typ", - "type": "OrganisationsTyp", - "format": "" - }, - { - "name": "traegerschaft", - "baseName": "traegerschaft", - "type": "TraegerschaftTyp", - "format": "" - }, - { - "name": "itslearningEnabled", - "baseName": "itslearningEnabled", - "type": "boolean", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "administriertVon", + baseName: "administriertVon", + type: "string", + format: "", + }, + { + name: "kennung", + baseName: "kennung", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "namensergaenzung", + baseName: "namensergaenzung", + type: "string", + format: "", + }, + { + name: "kuerzel", + baseName: "kuerzel", + type: "string", + format: "", + }, + { + name: "typ", + baseName: "typ", + type: "OrganisationsTyp", + format: "", + }, + { + name: "traegerschaft", + baseName: "traegerschaft", + type: "TraegerschaftTyp", + format: "", + }, + { + name: "itslearningEnabled", + baseName: "itslearningEnabled", + type: "boolean", + format: "", + }, + { + name: "version", + baseName: "version", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return OrganisationResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return OrganisationResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts b/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts index ee80d2d..6fd3d64 100644 --- a/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts +++ b/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts @@ -3,79 +3,82 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { HttpFile } from "../http/http.ts"; export class OrganisationResponseLegacy { - 'id': string; - 'administriertVon': string | null; - 'kennung': string | null; - 'name': string; - 'namensergaenzung': string | null; - 'kuerzel': string; - 'typ': OrganisationsTyp; + "id": string; + "administriertVon": string | null; + "kennung": string | null; + "name": string; + "namensergaenzung": string | null; + "kuerzel": string; + "typ": OrganisationsTyp; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "administriertVon", - "baseName": "administriertVon", - "type": "string", - "format": "" - }, - { - "name": "kennung", - "baseName": "kennung", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "namensergaenzung", - "baseName": "namensergaenzung", - "type": "string", - "format": "" - }, - { - "name": "kuerzel", - "baseName": "kuerzel", - "type": "string", - "format": "" - }, - { - "name": "typ", - "baseName": "typ", - "type": "OrganisationsTyp", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "administriertVon", + baseName: "administriertVon", + type: "string", + format: "", + }, + { + name: "kennung", + baseName: "kennung", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "namensergaenzung", + baseName: "namensergaenzung", + type: "string", + format: "", + }, + { + name: "kuerzel", + baseName: "kuerzel", + type: "string", + format: "", + }, + { + name: "typ", + baseName: "typ", + type: "OrganisationsTyp", + format: "", + }, + ]; - static getAttributeTypeMap() { - return OrganisationResponseLegacy.attributeTypeMap; - } + static getAttributeTypeMap() { + return OrganisationResponseLegacy.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts b/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts index cac4d36..04efe2d 100644 --- a/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts +++ b/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts @@ -3,42 +3,47 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class OrganisationRootChildrenResponse { - 'oeffentlich': OrganisationResponse; - 'ersatz': OrganisationResponse; + "oeffentlich": OrganisationResponse; + "ersatz": OrganisationResponse; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "oeffentlich", - "baseName": "oeffentlich", - "type": "OrganisationResponse", - "format": "" - }, - { - "name": "ersatz", - "baseName": "ersatz", - "type": "OrganisationResponse", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "oeffentlich", + baseName: "oeffentlich", + type: "OrganisationResponse", + format: "", + }, + { + name: "ersatz", + baseName: "ersatz", + type: "OrganisationResponse", + format: "", + }, + ]; - static getAttributeTypeMap() { - return OrganisationRootChildrenResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return OrganisationRootChildrenResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/OrganisationsTyp.ts b/loadtest/api-client/generated/models/OrganisationsTyp.ts index da9e454..da07d56 100644 --- a/loadtest/api-client/generated/models/OrganisationsTyp.ts +++ b/loadtest/api-client/generated/models/OrganisationsTyp.ts @@ -3,22 +3,22 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum OrganisationsTyp { - Root = 'ROOT', - Land = 'LAND', - Traeger = 'TRAEGER', - Schule = 'SCHULE', - Klasse = 'KLASSE', - Anbieter = 'ANBIETER', - SonstigeOrganisationEinrichtung = 'SONSTIGE ORGANISATION / EINRICHTUNG', - Unbestaetigt = 'UNBESTAETIGT' + Root = "ROOT", + Land = "LAND", + Traeger = "TRAEGER", + Schule = "SCHULE", + Klasse = "KLASSE", + Anbieter = "ANBIETER", + SonstigeOrganisationEinrichtung = "SONSTIGE ORGANISATION / EINRICHTUNG", + Unbestaetigt = "UNBESTAETIGT", } diff --git a/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts b/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts index 41f2418..26d7af4 100644 --- a/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts +++ b/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts @@ -3,35 +3,40 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class ParentOrganisationenResponse { - 'parents': Array; + "parents": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "parents", - "baseName": "parents", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "parents", + baseName: "parents", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ParentOrganisationenResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return ParentOrganisationenResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts b/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts index ac84a65..3518da5 100644 --- a/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts +++ b/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts @@ -3,37 +3,42 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class ParentOrganisationsByIdsBodyParams { - /** - * The ids of organizations - */ - 'organisationIds': Array; + /** + * The ids of organizations + */ + "organisationIds": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "organisationIds", - "baseName": "organisationIds", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "organisationIds", + baseName: "organisationIds", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ParentOrganisationsByIdsBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return ParentOrganisationsByIdsBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/Person.ts b/loadtest/api-client/generated/models/Person.ts index 29779a4..5d488e8 100644 --- a/loadtest/api-client/generated/models/Person.ts +++ b/loadtest/api-client/generated/models/Person.ts @@ -3,116 +3,119 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; -import { PersonNameResponse } from '../models/PersonNameResponse.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonBirthResponse } from "../models/PersonBirthResponse.ts"; +import { PersonNameResponse } from "../models/PersonNameResponse.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; +import { HttpFile } from "../http/http.ts"; export class Person { - 'id': string; - 'referrer': string | null; - 'mandant': string; - 'name': PersonNameResponse; - 'geburt': PersonBirthResponse | null; - 'stammorganisation': string | null; - 'geschlecht': string | null; - 'lokalisierung': string | null; - 'vertrauensstufe': Vertrauensstufe; - 'revision': string; - 'personalnummer': string | null; - 'dienststellen': Array | null; + "id": string; + "referrer": string | null; + "mandant": string; + "name": PersonNameResponse; + "geburt": PersonBirthResponse | null; + "stammorganisation": string | null; + "geschlecht": string | null; + "lokalisierung": string | null; + "vertrauensstufe": Vertrauensstufe; + "revision": string; + "personalnummer": string | null; + "dienststellen": Array | null; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "referrer", - "baseName": "referrer", - "type": "string", - "format": "" - }, - { - "name": "mandant", - "baseName": "mandant", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "PersonNameResponse", - "format": "" - }, - { - "name": "geburt", - "baseName": "geburt", - "type": "PersonBirthResponse", - "format": "" - }, - { - "name": "stammorganisation", - "baseName": "stammorganisation", - "type": "string", - "format": "" - }, - { - "name": "geschlecht", - "baseName": "geschlecht", - "type": "string", - "format": "" - }, - { - "name": "lokalisierung", - "baseName": "lokalisierung", - "type": "string", - "format": "" - }, - { - "name": "vertrauensstufe", - "baseName": "vertrauensstufe", - "type": "Vertrauensstufe", - "format": "" - }, - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - }, - { - "name": "personalnummer", - "baseName": "personalnummer", - "type": "string", - "format": "" - }, - { - "name": "dienststellen", - "baseName": "dienststellen", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "referrer", + baseName: "referrer", + type: "string", + format: "", + }, + { + name: "mandant", + baseName: "mandant", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "PersonNameResponse", + format: "", + }, + { + name: "geburt", + baseName: "geburt", + type: "PersonBirthResponse", + format: "", + }, + { + name: "stammorganisation", + baseName: "stammorganisation", + type: "string", + format: "", + }, + { + name: "geschlecht", + baseName: "geschlecht", + type: "string", + format: "", + }, + { + name: "lokalisierung", + baseName: "lokalisierung", + type: "string", + format: "", + }, + { + name: "vertrauensstufe", + baseName: "vertrauensstufe", + type: "Vertrauensstufe", + format: "", + }, + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + { + name: "personalnummer", + baseName: "personalnummer", + type: "string", + format: "", + }, + { + name: "dienststellen", + baseName: "dienststellen", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return Person.attributeTypeMap; - } + static getAttributeTypeMap() { + return Person.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/PersonBirthParams.ts b/loadtest/api-client/generated/models/PersonBirthParams.ts index ce9c18a..a52c149 100644 --- a/loadtest/api-client/generated/models/PersonBirthParams.ts +++ b/loadtest/api-client/generated/models/PersonBirthParams.ts @@ -3,41 +3,46 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonBirthParams { - 'datum'?: Date; - 'geburtsort'?: string; + "datum"?: Date; + "geburtsort"?: string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "datum", - "baseName": "datum", - "type": "Date", - "format": "date-time" - }, - { - "name": "geburtsort", - "baseName": "geburtsort", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "datum", + baseName: "datum", + type: "Date", + format: "date-time", + }, + { + name: "geburtsort", + baseName: "geburtsort", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonBirthParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonBirthParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonBirthResponse.ts b/loadtest/api-client/generated/models/PersonBirthResponse.ts index bc5459c..3e4d906 100644 --- a/loadtest/api-client/generated/models/PersonBirthResponse.ts +++ b/loadtest/api-client/generated/models/PersonBirthResponse.ts @@ -3,41 +3,46 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonBirthResponse { - 'datum': Date | null; - 'geburtsort': string | null; + "datum": Date | null; + "geburtsort": string | null; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "datum", - "baseName": "datum", - "type": "Date", - "format": "date-time" - }, - { - "name": "geburtsort", - "baseName": "geburtsort", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "datum", + baseName: "datum", + type: "Date", + format: "date-time", + }, + { + name: "geburtsort", + baseName: "geburtsort", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonBirthResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonBirthResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts b/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts index 5835c06..914b6cd 100644 --- a/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts +++ b/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts @@ -3,56 +3,61 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonControllerFindPersonenkontexte200Response { - 'total': number; - 'offset': number; - 'limit': number; - 'items': Array; + "total": number; + "offset": number; + "limit": number; + "items": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "total", - "baseName": "total", - "type": "number", - "format": "" - }, - { - "name": "offset", - "baseName": "offset", - "type": "number", - "format": "" - }, - { - "name": "limit", - "baseName": "limit", - "type": "number", - "format": "" - }, - { - "name": "items", - "baseName": "items", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "total", + baseName: "total", + type: "number", + format: "", + }, + { + name: "offset", + baseName: "offset", + type: "number", + format: "", + }, + { + name: "limit", + baseName: "limit", + type: "number", + format: "", + }, + { + name: "items", + baseName: "items", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonControllerFindPersonenkontexte200Response.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonControllerFindPersonenkontexte200Response.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonEmailResponse.ts b/loadtest/api-client/generated/models/PersonEmailResponse.ts index b73c4da..d723815 100644 --- a/loadtest/api-client/generated/models/PersonEmailResponse.ts +++ b/loadtest/api-client/generated/models/PersonEmailResponse.ts @@ -3,44 +3,47 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; -import { HttpFile } from '../http/http.ts'; +import { EmailAddressStatus } from "../models/EmailAddressStatus.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonEmailResponse { - 'status': EmailAddressStatus; - 'address': string; - - static readonly discriminator: string | undefined = undefined; - - static readonly mapping: {[index: string]: string} | undefined = undefined; - - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "status", - "baseName": "status", - "type": "EmailAddressStatus", - "format": "" - }, - { - "name": "address", - "baseName": "address", - "type": "string", - "format": "" - } ]; - - static getAttributeTypeMap() { - return PersonEmailResponse.attributeTypeMap; - } - - public constructor() { - } + "status": EmailAddressStatus; + "address": string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: { [index: string]: string } | undefined = undefined; + + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "status", + baseName: "status", + type: "EmailAddressStatus", + format: "", + }, + { + name: "address", + baseName: "address", + type: "string", + format: "", + }, + ]; + + static getAttributeTypeMap() { + return PersonEmailResponse.attributeTypeMap; + } + + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts b/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts index f97b36a..4fa1387 100644 --- a/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts +++ b/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts @@ -3,56 +3,61 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonendatensatzResponse } from "../models/PersonendatensatzResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonFrontendControllerFindPersons200Response { - 'total': number; - 'offset': number; - 'limit': number; - 'items': Array; + "total": number; + "offset": number; + "limit": number; + "items": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "total", - "baseName": "total", - "type": "number", - "format": "" - }, - { - "name": "offset", - "baseName": "offset", - "type": "number", - "format": "" - }, - { - "name": "limit", - "baseName": "limit", - "type": "number", - "format": "" - }, - { - "name": "items", - "baseName": "items", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "total", + baseName: "total", + type: "number", + format: "", + }, + { + name: "offset", + baseName: "offset", + type: "number", + format: "", + }, + { + name: "limit", + baseName: "limit", + type: "number", + format: "", + }, + { + name: "items", + baseName: "items", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonFrontendControllerFindPersons200Response.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonFrontendControllerFindPersons200Response.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonIdResponse.ts b/loadtest/api-client/generated/models/PersonIdResponse.ts index 1637605..883c605 100644 --- a/loadtest/api-client/generated/models/PersonIdResponse.ts +++ b/loadtest/api-client/generated/models/PersonIdResponse.ts @@ -3,34 +3,39 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonIdResponse { - 'id': string; + "id": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonIdResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonIdResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonInfoResponse.ts b/loadtest/api-client/generated/models/PersonInfoResponse.ts index e33872d..d906bf9 100644 --- a/loadtest/api-client/generated/models/PersonInfoResponse.ts +++ b/loadtest/api-client/generated/models/PersonInfoResponse.ts @@ -3,68 +3,73 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { Person } from '../models/Person.ts'; -import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { Person } from "../models/Person.ts"; +import { PersonEmailResponse } from "../models/PersonEmailResponse.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonInfoResponse { - 'pid': string; - 'person': Person; - 'personenkontexte': Array; - 'gruppen': Array; - /** - * Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status) - */ - 'email': PersonEmailResponse | null; + "pid": string; + "person": Person; + "personenkontexte": Array; + "gruppen": Array; + /** + * Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status) + */ + "email": PersonEmailResponse | null; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "pid", - "baseName": "pid", - "type": "string", - "format": "" - }, - { - "name": "person", - "baseName": "person", - "type": "Person", - "format": "" - }, - { - "name": "personenkontexte", - "baseName": "personenkontexte", - "type": "Array", - "format": "" - }, - { - "name": "gruppen", - "baseName": "gruppen", - "type": "Array", - "format": "" - }, - { - "name": "email", - "baseName": "email", - "type": "PersonEmailResponse", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "pid", + baseName: "pid", + type: "string", + format: "", + }, + { + name: "person", + baseName: "person", + type: "Person", + format: "", + }, + { + name: "personenkontexte", + baseName: "personenkontexte", + type: "Array", + format: "", + }, + { + name: "gruppen", + baseName: "gruppen", + type: "Array", + format: "", + }, + { + name: "email", + baseName: "email", + type: "PersonEmailResponse", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonInfoResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonInfoResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonLockResponse.ts b/loadtest/api-client/generated/models/PersonLockResponse.ts index feaa1bd..ba90be8 100644 --- a/loadtest/api-client/generated/models/PersonLockResponse.ts +++ b/loadtest/api-client/generated/models/PersonLockResponse.ts @@ -3,34 +3,39 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonLockResponse { - 'message': string; + "message": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "message", - "baseName": "message", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "message", + baseName: "message", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonLockResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonLockResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts b/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts index 4aea17e..b513414 100644 --- a/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts +++ b/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts @@ -3,65 +3,70 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonMetadataBodyParams { - 'familienname': string; - 'vorname': string; - 'personalnummer'?: string; - /** - * Date of the most recent changed Personalnummer - */ - 'lastModified': Date; - 'revision': string; + "familienname": string; + "vorname": string; + "personalnummer"?: string; + /** + * Date of the most recent changed Personalnummer + */ + "lastModified": Date; + "revision": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "familienname", - "baseName": "familienname", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "personalnummer", - "baseName": "personalnummer", - "type": "string", - "format": "" - }, - { - "name": "lastModified", - "baseName": "lastModified", - "type": "Date", - "format": "date-time" - }, - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "familienname", + baseName: "familienname", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "personalnummer", + baseName: "personalnummer", + type: "string", + format: "", + }, + { + name: "lastModified", + baseName: "lastModified", + type: "Date", + format: "date-time", + }, + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonMetadataBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonMetadataBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonNameParams.ts b/loadtest/api-client/generated/models/PersonNameParams.ts index 3d33126..9f3b377 100644 --- a/loadtest/api-client/generated/models/PersonNameParams.ts +++ b/loadtest/api-client/generated/models/PersonNameParams.ts @@ -3,97 +3,102 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonNameParams { - 'familienname': string; - 'vorname': string; - 'initialenfamilienname'?: string; - 'initialenvorname'?: string; - 'rufname'?: string; - 'titel'?: string; - 'anrede'?: Array; - 'namenssuffix'?: Array; - 'namenspraefix'?: Array; - 'sortierindex'?: string; + "familienname": string; + "vorname": string; + "initialenfamilienname"?: string; + "initialenvorname"?: string; + "rufname"?: string; + "titel"?: string; + "anrede"?: Array; + "namenssuffix"?: Array; + "namenspraefix"?: Array; + "sortierindex"?: string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "familienname", - "baseName": "familienname", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "initialenfamilienname", - "baseName": "initialenfamilienname", - "type": "string", - "format": "" - }, - { - "name": "initialenvorname", - "baseName": "initialenvorname", - "type": "string", - "format": "" - }, - { - "name": "rufname", - "baseName": "rufname", - "type": "string", - "format": "" - }, - { - "name": "titel", - "baseName": "titel", - "type": "string", - "format": "" - }, - { - "name": "anrede", - "baseName": "anrede", - "type": "Array", - "format": "" - }, - { - "name": "namenssuffix", - "baseName": "namenssuffix", - "type": "Array", - "format": "" - }, - { - "name": "namenspraefix", - "baseName": "namenspraefix", - "type": "Array", - "format": "" - }, - { - "name": "sortierindex", - "baseName": "sortierindex", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "familienname", + baseName: "familienname", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "initialenfamilienname", + baseName: "initialenfamilienname", + type: "string", + format: "", + }, + { + name: "initialenvorname", + baseName: "initialenvorname", + type: "string", + format: "", + }, + { + name: "rufname", + baseName: "rufname", + type: "string", + format: "", + }, + { + name: "titel", + baseName: "titel", + type: "string", + format: "", + }, + { + name: "anrede", + baseName: "anrede", + type: "Array", + format: "", + }, + { + name: "namenssuffix", + baseName: "namenssuffix", + type: "Array", + format: "", + }, + { + name: "namenspraefix", + baseName: "namenspraefix", + type: "Array", + format: "", + }, + { + name: "sortierindex", + baseName: "sortierindex", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonNameParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonNameParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonNameResponse.ts b/loadtest/api-client/generated/models/PersonNameResponse.ts index 41a2413..0bac326 100644 --- a/loadtest/api-client/generated/models/PersonNameResponse.ts +++ b/loadtest/api-client/generated/models/PersonNameResponse.ts @@ -3,97 +3,102 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonNameResponse { - 'familiennamen': string; - 'vorname': string; - 'initialenfamilienname': string | null; - 'initialenvorname': string | null; - 'rufname': string | null; - 'titel': string | null; - 'anrede': Array | null; - 'namenspraefix': Array | null; - 'namenssuffix': Array | null; - 'sortierindex': string | null; + "familiennamen": string; + "vorname": string; + "initialenfamilienname": string | null; + "initialenvorname": string | null; + "rufname": string | null; + "titel": string | null; + "anrede": Array | null; + "namenspraefix": Array | null; + "namenssuffix": Array | null; + "sortierindex": string | null; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "familiennamen", - "baseName": "familiennamen", - "type": "string", - "format": "" - }, - { - "name": "vorname", - "baseName": "vorname", - "type": "string", - "format": "" - }, - { - "name": "initialenfamilienname", - "baseName": "initialenfamilienname", - "type": "string", - "format": "" - }, - { - "name": "initialenvorname", - "baseName": "initialenvorname", - "type": "string", - "format": "" - }, - { - "name": "rufname", - "baseName": "rufname", - "type": "string", - "format": "" - }, - { - "name": "titel", - "baseName": "titel", - "type": "string", - "format": "" - }, - { - "name": "anrede", - "baseName": "anrede", - "type": "Array", - "format": "" - }, - { - "name": "namenspraefix", - "baseName": "namenspraefix", - "type": "Array", - "format": "" - }, - { - "name": "namenssuffix", - "baseName": "namenssuffix", - "type": "Array", - "format": "" - }, - { - "name": "sortierindex", - "baseName": "sortierindex", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "familiennamen", + baseName: "familiennamen", + type: "string", + format: "", + }, + { + name: "vorname", + baseName: "vorname", + type: "string", + format: "", + }, + { + name: "initialenfamilienname", + baseName: "initialenfamilienname", + type: "string", + format: "", + }, + { + name: "initialenvorname", + baseName: "initialenvorname", + type: "string", + format: "", + }, + { + name: "rufname", + baseName: "rufname", + type: "string", + format: "", + }, + { + name: "titel", + baseName: "titel", + type: "string", + format: "", + }, + { + name: "anrede", + baseName: "anrede", + type: "Array", + format: "", + }, + { + name: "namenspraefix", + baseName: "namenspraefix", + type: "Array", + format: "", + }, + { + name: "namenssuffix", + baseName: "namenssuffix", + type: "Array", + format: "", + }, + { + name: "sortierindex", + baseName: "sortierindex", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonNameResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonNameResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonResponse.ts b/loadtest/api-client/generated/models/PersonResponse.ts index fbe0f57..e491d44 100644 --- a/loadtest/api-client/generated/models/PersonResponse.ts +++ b/loadtest/api-client/generated/models/PersonResponse.ts @@ -3,155 +3,158 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { UserLockParams } from '../models/UserLockParams.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonEmailResponse } from "../models/PersonEmailResponse.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { UserLockParams } from "../models/UserLockParams.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonResponse { - 'id': string; - 'referrer': string | null; - 'mandant': string; - 'name': PersonNameParams; - 'geburt': PersonBirthParams | null; - 'stammorganisation': string | null; - 'geschlecht': string | null; - 'lokalisierung': string | null; - 'vertrauensstufe': Vertrauensstufe; - 'revision': string; - /** - * Initiales Benutzerpasswort, muss nach der ersten Anmeldung geändert werden - */ - 'startpasswort': string; - 'personalnummer': string | null; - 'isLocked': boolean | null; - 'userLock': Array | null; - /** - * Date of the most recent changes for the person - */ - 'lastModified': Date; - /** - * Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status) - */ - 'email': PersonEmailResponse | null; + "id": string; + "referrer": string | null; + "mandant": string; + "name": PersonNameParams; + "geburt": PersonBirthParams | null; + "stammorganisation": string | null; + "geschlecht": string | null; + "lokalisierung": string | null; + "vertrauensstufe": Vertrauensstufe; + "revision": string; + /** + * Initiales Benutzerpasswort, muss nach der ersten Anmeldung geändert werden + */ + "startpasswort": string; + "personalnummer": string | null; + "isLocked": boolean | null; + "userLock": Array | null; + /** + * Date of the most recent changes for the person + */ + "lastModified": Date; + /** + * Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status) + */ + "email": PersonEmailResponse | null; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "referrer", - "baseName": "referrer", - "type": "string", - "format": "" - }, - { - "name": "mandant", - "baseName": "mandant", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "PersonNameParams", - "format": "" - }, - { - "name": "geburt", - "baseName": "geburt", - "type": "PersonBirthParams", - "format": "" - }, - { - "name": "stammorganisation", - "baseName": "stammorganisation", - "type": "string", - "format": "" - }, - { - "name": "geschlecht", - "baseName": "geschlecht", - "type": "string", - "format": "" - }, - { - "name": "lokalisierung", - "baseName": "lokalisierung", - "type": "string", - "format": "" - }, - { - "name": "vertrauensstufe", - "baseName": "vertrauensstufe", - "type": "Vertrauensstufe", - "format": "" - }, - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - }, - { - "name": "startpasswort", - "baseName": "startpasswort", - "type": "string", - "format": "" - }, - { - "name": "personalnummer", - "baseName": "personalnummer", - "type": "string", - "format": "" - }, - { - "name": "isLocked", - "baseName": "isLocked", - "type": "boolean", - "format": "" - }, - { - "name": "userLock", - "baseName": "userLock", - "type": "Array", - "format": "" - }, - { - "name": "lastModified", - "baseName": "lastModified", - "type": "Date", - "format": "date-time" - }, - { - "name": "email", - "baseName": "email", - "type": "PersonEmailResponse", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "referrer", + baseName: "referrer", + type: "string", + format: "", + }, + { + name: "mandant", + baseName: "mandant", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "PersonNameParams", + format: "", + }, + { + name: "geburt", + baseName: "geburt", + type: "PersonBirthParams", + format: "", + }, + { + name: "stammorganisation", + baseName: "stammorganisation", + type: "string", + format: "", + }, + { + name: "geschlecht", + baseName: "geschlecht", + type: "string", + format: "", + }, + { + name: "lokalisierung", + baseName: "lokalisierung", + type: "string", + format: "", + }, + { + name: "vertrauensstufe", + baseName: "vertrauensstufe", + type: "Vertrauensstufe", + format: "", + }, + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + { + name: "startpasswort", + baseName: "startpasswort", + type: "string", + format: "", + }, + { + name: "personalnummer", + baseName: "personalnummer", + type: "string", + format: "", + }, + { + name: "isLocked", + baseName: "isLocked", + type: "boolean", + format: "", + }, + { + name: "userLock", + baseName: "userLock", + type: "Array", + format: "", + }, + { + name: "lastModified", + baseName: "lastModified", + type: "Date", + format: "date-time", + }, + { + name: "email", + baseName: "email", + type: "PersonEmailResponse", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/PersonResponseAutomapper.ts b/loadtest/api-client/generated/models/PersonResponseAutomapper.ts index 8d51627..5d636dc 100644 --- a/loadtest/api-client/generated/models/PersonResponseAutomapper.ts +++ b/loadtest/api-client/generated/models/PersonResponseAutomapper.ts @@ -3,119 +3,122 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonResponseAutomapper { - 'id': string; - 'referrer': string; - 'mandant': string; - 'name': PersonNameParams; - 'geburt': PersonBirthParams; - 'stammorganisation': string; - 'geschlecht': string; - 'lokalisierung': string; - 'vertrauensstufe': Vertrauensstufe; - 'revision': string; - /** - * Initiales Benutzerpasswort, muss nach der ersten Anmeldung geändert werden - */ - 'startpasswort': string; - 'personalnummer': string; + "id": string; + "referrer": string; + "mandant": string; + "name": PersonNameParams; + "geburt": PersonBirthParams; + "stammorganisation": string; + "geschlecht": string; + "lokalisierung": string; + "vertrauensstufe": Vertrauensstufe; + "revision": string; + /** + * Initiales Benutzerpasswort, muss nach der ersten Anmeldung geändert werden + */ + "startpasswort": string; + "personalnummer": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "referrer", - "baseName": "referrer", - "type": "string", - "format": "" - }, - { - "name": "mandant", - "baseName": "mandant", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "PersonNameParams", - "format": "" - }, - { - "name": "geburt", - "baseName": "geburt", - "type": "PersonBirthParams", - "format": "" - }, - { - "name": "stammorganisation", - "baseName": "stammorganisation", - "type": "string", - "format": "" - }, - { - "name": "geschlecht", - "baseName": "geschlecht", - "type": "string", - "format": "" - }, - { - "name": "lokalisierung", - "baseName": "lokalisierung", - "type": "string", - "format": "" - }, - { - "name": "vertrauensstufe", - "baseName": "vertrauensstufe", - "type": "Vertrauensstufe", - "format": "" - }, - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - }, - { - "name": "startpasswort", - "baseName": "startpasswort", - "type": "string", - "format": "" - }, - { - "name": "personalnummer", - "baseName": "personalnummer", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "referrer", + baseName: "referrer", + type: "string", + format: "", + }, + { + name: "mandant", + baseName: "mandant", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "PersonNameParams", + format: "", + }, + { + name: "geburt", + baseName: "geburt", + type: "PersonBirthParams", + format: "", + }, + { + name: "stammorganisation", + baseName: "stammorganisation", + type: "string", + format: "", + }, + { + name: "geschlecht", + baseName: "geschlecht", + type: "string", + format: "", + }, + { + name: "lokalisierung", + baseName: "lokalisierung", + type: "string", + format: "", + }, + { + name: "vertrauensstufe", + baseName: "vertrauensstufe", + type: "Vertrauensstufe", + format: "", + }, + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + { + name: "startpasswort", + baseName: "startpasswort", + type: "string", + format: "", + }, + { + name: "personalnummer", + baseName: "personalnummer", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonResponseAutomapper.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonResponseAutomapper.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/PersonendatensatzResponse.ts b/loadtest/api-client/generated/models/PersonendatensatzResponse.ts index 372bcf2..28fca7f 100644 --- a/loadtest/api-client/generated/models/PersonendatensatzResponse.ts +++ b/loadtest/api-client/generated/models/PersonendatensatzResponse.ts @@ -3,35 +3,40 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonResponse } from '../models/PersonResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonResponse } from "../models/PersonResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonendatensatzResponse { - 'person': PersonResponse; + "person": PersonResponse; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "person", - "baseName": "person", - "type": "PersonResponse", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "person", + baseName: "person", + type: "PersonResponse", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonendatensatzResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonendatensatzResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts b/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts index a41ca39..6bfb4df 100644 --- a/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts +++ b/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts @@ -3,43 +3,48 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonResponseAutomapper } from "../models/PersonResponseAutomapper.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonendatensatzResponseAutomapper { - 'person': PersonResponseAutomapper; - 'personenkontexte': Array; + "person": PersonResponseAutomapper; + "personenkontexte": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "person", - "baseName": "person", - "type": "PersonResponseAutomapper", - "format": "" - }, - { - "name": "personenkontexte", - "baseName": "personenkontexte", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "person", + baseName: "person", + type: "PersonResponseAutomapper", + format: "", + }, + { + name: "personenkontexte", + baseName: "personenkontexte", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonendatensatzResponseAutomapper.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonendatensatzResponseAutomapper.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts b/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts index 99d2ef9..655eb1c 100644 --- a/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts +++ b/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts @@ -3,16 +3,16 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum PersonenkontextMigrationRuntype { - Itslearning = 'ITSLEARNING', - Standard = 'STANDARD' + Itslearning = "ITSLEARNING", + Standard = "STANDARD", } diff --git a/loadtest/api-client/generated/models/PersonenkontextResponse.ts b/loadtest/api-client/generated/models/PersonenkontextResponse.ts index 1a8d9eb..fecf325 100644 --- a/loadtest/api-client/generated/models/PersonenkontextResponse.ts +++ b/loadtest/api-client/generated/models/PersonenkontextResponse.ts @@ -3,126 +3,130 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { LoeschungResponse } from '../models/LoeschungResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { LoeschungResponse } from "../models/LoeschungResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonenkontextResponse { - 'id': string; - 'referrer': string | null; - 'mandant': string; - 'organisation': any; - 'rollenart': string | null; - 'rollenname': string | null; - 'personenstatus': PersonenkontextResponsePersonenstatusEnum | null; - 'jahrgangsstufe': PersonenkontextResponseJahrgangsstufeEnum | null; - 'sichtfreigabe': PersonenkontextResponseSichtfreigabeEnum | null; - 'loeschung': LoeschungResponse | null; - 'revision': string; + "id": string; + "referrer": string | null; + "mandant": string; + "organisation": any; + "rollenart": string | null; + "rollenname": string | null; + "personenstatus": PersonenkontextResponsePersonenstatusEnum | null; + "jahrgangsstufe": PersonenkontextResponseJahrgangsstufeEnum | null; + "sichtfreigabe": PersonenkontextResponseSichtfreigabeEnum | null; + "loeschung": LoeschungResponse | null; + "revision": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "referrer", - "baseName": "referrer", - "type": "string", - "format": "" - }, - { - "name": "mandant", - "baseName": "mandant", - "type": "string", - "format": "" - }, - { - "name": "organisation", - "baseName": "organisation", - "type": "any", - "format": "" - }, - { - "name": "rollenart", - "baseName": "rollenart", - "type": "string", - "format": "" - }, - { - "name": "rollenname", - "baseName": "rollenname", - "type": "string", - "format": "" - }, - { - "name": "personenstatus", - "baseName": "personenstatus", - "type": "PersonenkontextResponsePersonenstatusEnum", - "format": "" - }, - { - "name": "jahrgangsstufe", - "baseName": "jahrgangsstufe", - "type": "PersonenkontextResponseJahrgangsstufeEnum", - "format": "" - }, - { - "name": "sichtfreigabe", - "baseName": "sichtfreigabe", - "type": "PersonenkontextResponseSichtfreigabeEnum", - "format": "" - }, - { - "name": "loeschung", - "baseName": "loeschung", - "type": "LoeschungResponse", - "format": "" - }, - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "referrer", + baseName: "referrer", + type: "string", + format: "", + }, + { + name: "mandant", + baseName: "mandant", + type: "string", + format: "", + }, + { + name: "organisation", + baseName: "organisation", + type: "any", + format: "", + }, + { + name: "rollenart", + baseName: "rollenart", + type: "string", + format: "", + }, + { + name: "rollenname", + baseName: "rollenname", + type: "string", + format: "", + }, + { + name: "personenstatus", + baseName: "personenstatus", + type: "PersonenkontextResponsePersonenstatusEnum", + format: "", + }, + { + name: "jahrgangsstufe", + baseName: "jahrgangsstufe", + type: "PersonenkontextResponseJahrgangsstufeEnum", + format: "", + }, + { + name: "sichtfreigabe", + baseName: "sichtfreigabe", + type: "PersonenkontextResponseSichtfreigabeEnum", + format: "", + }, + { + name: "loeschung", + baseName: "loeschung", + type: "LoeschungResponse", + format: "", + }, + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonenkontextResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonenkontextResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } export enum PersonenkontextResponsePersonenstatusEnum { - Aktiv = 'AKTIV' + Aktiv = "AKTIV", } export enum PersonenkontextResponseJahrgangsstufeEnum { - _01 = '01', - _02 = '02', - _03 = '03', - _04 = '04', - _05 = '05', - _06 = '06', - _07 = '07', - _08 = '08', - _09 = '09', - _10 = '10' + _01 = "01", + _02 = "02", + _03 = "03", + _04 = "04", + _05 = "05", + _06 = "06", + _07 = "07", + _08 = "08", + _09 = "09", + _10 = "10", } export enum PersonenkontextResponseSichtfreigabeEnum { - Ja = 'ja', - Nein = 'nein' + Ja = "ja", + Nein = "nein", } - diff --git a/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts b/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts index fbf7b79..d90f81f 100644 --- a/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts +++ b/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts @@ -3,42 +3,47 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { RollenSystemRechtServiceProviderIDResponse } from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonenkontextRolleFieldsResponse { - 'organisationsId': string; - 'rolle': RollenSystemRechtServiceProviderIDResponse; + "organisationsId": string; + "rolle": RollenSystemRechtServiceProviderIDResponse; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "organisationsId", - "baseName": "organisationsId", - "type": "string", - "format": "" - }, - { - "name": "rolle", - "baseName": "rolle", - "type": "RollenSystemRechtServiceProviderIDResponse", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "organisationsId", + baseName: "organisationsId", + type: "string", + format: "", + }, + { + name: "rolle", + baseName: "rolle", + type: "RollenSystemRechtServiceProviderIDResponse", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonenkontextRolleFieldsResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonenkontextRolleFieldsResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts b/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts index df75056..1addc12 100644 --- a/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts +++ b/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts @@ -3,79 +3,84 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { RolleResponse } from '../models/RolleResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonenkontextWorkflowResponse { - /** - * List of available organisations. - */ - 'organisations': Array; - /** - * List of available roles. - */ - 'rollen': Array; - /** - * Selected organisation. - */ - 'selectedOrganisation': string | null; - /** - * Selected rolle. - */ - 'selectedRolle': string | null; - /** - * Indicates whether the commit action can be performed. - */ - 'canCommit': boolean; + /** + * List of available organisations. + */ + "organisations": Array; + /** + * List of available roles. + */ + "rollen": Array; + /** + * Selected organisation. + */ + "selectedOrganisation": string | null; + /** + * Selected rolle. + */ + "selectedRolle": string | null; + /** + * Indicates whether the commit action can be performed. + */ + "canCommit": boolean; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "organisations", - "baseName": "organisations", - "type": "Array", - "format": "" - }, - { - "name": "rollen", - "baseName": "rollen", - "type": "Array", - "format": "" - }, - { - "name": "selectedOrganisation", - "baseName": "selectedOrganisation", - "type": "string", - "format": "" - }, - { - "name": "selectedRolle", - "baseName": "selectedRolle", - "type": "string", - "format": "" - }, - { - "name": "canCommit", - "baseName": "canCommit", - "type": "boolean", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "organisations", + baseName: "organisations", + type: "Array", + format: "", + }, + { + name: "rollen", + baseName: "rollen", + type: "Array", + format: "", + }, + { + name: "selectedOrganisation", + baseName: "selectedOrganisation", + type: "string", + format: "", + }, + { + name: "selectedRolle", + baseName: "selectedRolle", + type: "string", + format: "", + }, + { + name: "canCommit", + baseName: "canCommit", + type: "boolean", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonenkontextWorkflowResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonenkontextWorkflowResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts b/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts index b9a66b7..fabab00 100644 --- a/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts +++ b/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts @@ -3,43 +3,48 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonIdResponse } from '../models/PersonIdResponse.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonIdResponse } from "../models/PersonIdResponse.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonenkontextdatensatzResponse { - 'person': PersonIdResponse; - 'personenkontexte': Array; + "person": PersonIdResponse; + "personenkontexte": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "person", - "baseName": "person", - "type": "PersonIdResponse", - "format": "" - }, - { - "name": "personenkontexte", - "baseName": "personenkontexte", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "person", + baseName: "person", + type: "PersonIdResponse", + format: "", + }, + { + name: "personenkontexte", + baseName: "personenkontexte", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonenkontextdatensatzResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonenkontextdatensatzResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts b/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts index 99c05a1..f1012b3 100644 --- a/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts +++ b/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts @@ -3,35 +3,40 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class PersonenkontexteUpdateResponse { - 'dBiamPersonenkontextResponses': Array; + "dBiamPersonenkontextResponses": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "dBiamPersonenkontextResponses", - "baseName": "dBiamPersonenkontextResponses", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "dBiamPersonenkontextResponses", + baseName: "dBiamPersonenkontextResponses", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonenkontexteUpdateResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonenkontexteUpdateResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/Personenstatus.ts b/loadtest/api-client/generated/models/Personenstatus.ts index e72330e..f8201be 100644 --- a/loadtest/api-client/generated/models/Personenstatus.ts +++ b/loadtest/api-client/generated/models/Personenstatus.ts @@ -3,15 +3,15 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum Personenstatus { - Aktiv = 'AKTIV' + Aktiv = "AKTIV", } diff --git a/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts b/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts index 41e36db..466a820 100644 --- a/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts +++ b/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts @@ -3,37 +3,42 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class PersonenuebersichtBodyParams { - /** - * An array of IDs for the persons. - */ - 'personIds': Array; + /** + * An array of IDs for the persons. + */ + "personIds": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personIds", - "baseName": "personIds", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personIds", + baseName: "personIds", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return PersonenuebersichtBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return PersonenuebersichtBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/RawPagedResponse.ts b/loadtest/api-client/generated/models/RawPagedResponse.ts index 507a79c..00a558a 100644 --- a/loadtest/api-client/generated/models/RawPagedResponse.ts +++ b/loadtest/api-client/generated/models/RawPagedResponse.ts @@ -3,55 +3,60 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class RawPagedResponse { - 'total': number; - 'offset': number; - 'limit': number; - 'items': Array; + "total": number; + "offset": number; + "limit": number; + "items": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "total", - "baseName": "total", - "type": "number", - "format": "" - }, - { - "name": "offset", - "baseName": "offset", - "type": "number", - "format": "" - }, - { - "name": "limit", - "baseName": "limit", - "type": "number", - "format": "" - }, - { - "name": "items", - "baseName": "items", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "total", + baseName: "total", + type: "number", + format: "", + }, + { + name: "offset", + baseName: "offset", + type: "number", + format: "", + }, + { + name: "limit", + baseName: "limit", + type: "number", + format: "", + }, + { + name: "items", + baseName: "items", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RawPagedResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return RawPagedResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/RolleResponse.ts b/loadtest/api-client/generated/models/RolleResponse.ts index 5dcda6b..72524fa 100644 --- a/loadtest/api-client/generated/models/RolleResponse.ts +++ b/loadtest/api-client/generated/models/RolleResponse.ts @@ -3,109 +3,112 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { HttpFile } from '../http/http.ts'; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { HttpFile } from "../http/http.ts"; export class RolleResponse { - 'id': string; - 'createdAt': Date; - 'updatedAt': Date; - 'name': string; - 'administeredBySchulstrukturknoten': string; - 'rollenart': RollenArt; - 'merkmale': Set; - 'systemrechte': Set; - 'administeredBySchulstrukturknotenName': string | null; - 'administeredBySchulstrukturknotenKennung': string | null; - 'version': number; + "id": string; + "createdAt": Date; + "updatedAt": Date; + "name": string; + "administeredBySchulstrukturknoten": string; + "rollenart": RollenArt; + "merkmale": Set; + "systemrechte": Set; + "administeredBySchulstrukturknotenName": string | null; + "administeredBySchulstrukturknotenKennung": string | null; + "version": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "createdAt", - "baseName": "createdAt", - "type": "Date", - "format": "date-time" - }, - { - "name": "updatedAt", - "baseName": "updatedAt", - "type": "Date", - "format": "date-time" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "administeredBySchulstrukturknoten", - "baseName": "administeredBySchulstrukturknoten", - "type": "string", - "format": "" - }, - { - "name": "rollenart", - "baseName": "rollenart", - "type": "RollenArt", - "format": "" - }, - { - "name": "merkmale", - "baseName": "merkmale", - "type": "Set", - "format": "" - }, - { - "name": "systemrechte", - "baseName": "systemrechte", - "type": "Set", - "format": "" - }, - { - "name": "administeredBySchulstrukturknotenName", - "baseName": "administeredBySchulstrukturknotenName", - "type": "string", - "format": "" - }, - { - "name": "administeredBySchulstrukturknotenKennung", - "baseName": "administeredBySchulstrukturknotenKennung", - "type": "string", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "createdAt", + baseName: "createdAt", + type: "Date", + format: "date-time", + }, + { + name: "updatedAt", + baseName: "updatedAt", + type: "Date", + format: "date-time", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "administeredBySchulstrukturknoten", + baseName: "administeredBySchulstrukturknoten", + type: "string", + format: "", + }, + { + name: "rollenart", + baseName: "rollenart", + type: "RollenArt", + format: "", + }, + { + name: "merkmale", + baseName: "merkmale", + type: "Set", + format: "", + }, + { + name: "systemrechte", + baseName: "systemrechte", + type: "Set", + format: "", + }, + { + name: "administeredBySchulstrukturknotenName", + baseName: "administeredBySchulstrukturknotenName", + type: "string", + format: "", + }, + { + name: "administeredBySchulstrukturknotenKennung", + baseName: "administeredBySchulstrukturknotenKennung", + type: "string", + format: "", + }, + { + name: "version", + baseName: "version", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RolleResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return RolleResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts b/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts index 2ca1b10..32f560f 100644 --- a/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts +++ b/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts @@ -3,47 +3,52 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class RolleServiceProviderBodyParams { - /** - * An array of ids for the service providers. - */ - 'serviceProviderIds': Array; - /** - * The version for the rolle. - */ - 'version': number; + /** + * An array of ids for the service providers. + */ + "serviceProviderIds": Array; + /** + * The version for the rolle. + */ + "version": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "serviceProviderIds", - "baseName": "serviceProviderIds", - "type": "Array", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "serviceProviderIds", + baseName: "serviceProviderIds", + type: "Array", + format: "", + }, + { + name: "version", + baseName: "version", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RolleServiceProviderBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return RolleServiceProviderBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts b/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts index 9644206..493f191 100644 --- a/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts +++ b/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts @@ -3,37 +3,42 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http'; +import { HttpFile } from "../http/http"; export class RolleServiceProviderQueryParams { - /** - * An array of ids for the service providers. - */ - 'serviceProviderIds': Array; + /** + * An array of ids for the service providers. + */ + "serviceProviderIds": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "serviceProviderIds", - "baseName": "serviceProviderIds", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "serviceProviderIds", + baseName: "serviceProviderIds", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RolleServiceProviderQueryParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return RolleServiceProviderQueryParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts b/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts index d0cf053..f510770 100644 --- a/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts +++ b/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts @@ -3,34 +3,39 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class RolleServiceProviderResponse { - 'serviceProviderIds': Array; + "serviceProviderIds": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "serviceProviderIds", - "baseName": "serviceProviderIds", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "serviceProviderIds", + baseName: "serviceProviderIds", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RolleServiceProviderResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return RolleServiceProviderResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts b/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts index e69a09b..97774bf 100644 --- a/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts +++ b/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts @@ -3,117 +3,120 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { ServiceProviderIdNameResponse } from "../models/ServiceProviderIdNameResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class RolleWithServiceProvidersResponse { - 'id': string; - 'createdAt': Date; - 'updatedAt': Date; - 'name': string; - 'administeredBySchulstrukturknoten': string; - 'rollenart': RollenArt; - 'merkmale': Set; - 'systemrechte': Set; - 'administeredBySchulstrukturknotenName': string | null; - 'administeredBySchulstrukturknotenKennung': string | null; - 'version': number; - 'serviceProviders': Array; + "id": string; + "createdAt": Date; + "updatedAt": Date; + "name": string; + "administeredBySchulstrukturknoten": string; + "rollenart": RollenArt; + "merkmale": Set; + "systemrechte": Set; + "administeredBySchulstrukturknotenName": string | null; + "administeredBySchulstrukturknotenKennung": string | null; + "version": number; + "serviceProviders": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "createdAt", - "baseName": "createdAt", - "type": "Date", - "format": "date-time" - }, - { - "name": "updatedAt", - "baseName": "updatedAt", - "type": "Date", - "format": "date-time" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "administeredBySchulstrukturknoten", - "baseName": "administeredBySchulstrukturknoten", - "type": "string", - "format": "" - }, - { - "name": "rollenart", - "baseName": "rollenart", - "type": "RollenArt", - "format": "" - }, - { - "name": "merkmale", - "baseName": "merkmale", - "type": "Set", - "format": "" - }, - { - "name": "systemrechte", - "baseName": "systemrechte", - "type": "Set", - "format": "" - }, - { - "name": "administeredBySchulstrukturknotenName", - "baseName": "administeredBySchulstrukturknotenName", - "type": "string", - "format": "" - }, - { - "name": "administeredBySchulstrukturknotenKennung", - "baseName": "administeredBySchulstrukturknotenKennung", - "type": "string", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "number", - "format": "" - }, - { - "name": "serviceProviders", - "baseName": "serviceProviders", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "createdAt", + baseName: "createdAt", + type: "Date", + format: "date-time", + }, + { + name: "updatedAt", + baseName: "updatedAt", + type: "Date", + format: "date-time", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "administeredBySchulstrukturknoten", + baseName: "administeredBySchulstrukturknoten", + type: "string", + format: "", + }, + { + name: "rollenart", + baseName: "rollenart", + type: "RollenArt", + format: "", + }, + { + name: "merkmale", + baseName: "merkmale", + type: "Set", + format: "", + }, + { + name: "systemrechte", + baseName: "systemrechte", + type: "Set", + format: "", + }, + { + name: "administeredBySchulstrukturknotenName", + baseName: "administeredBySchulstrukturknotenName", + type: "string", + format: "", + }, + { + name: "administeredBySchulstrukturknotenKennung", + baseName: "administeredBySchulstrukturknotenKennung", + type: "string", + format: "", + }, + { + name: "version", + baseName: "version", + type: "number", + format: "", + }, + { + name: "serviceProviders", + baseName: "serviceProviders", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RolleWithServiceProvidersResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return RolleWithServiceProvidersResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/RollenArt.ts b/loadtest/api-client/generated/models/RollenArt.ts index 3f0c4fe..22f27d9 100644 --- a/loadtest/api-client/generated/models/RollenArt.ts +++ b/loadtest/api-client/generated/models/RollenArt.ts @@ -3,20 +3,20 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum RollenArt { - Lern = 'LERN', - Lehr = 'LEHR', - Extern = 'EXTERN', - Orgadmin = 'ORGADMIN', - Leit = 'LEIT', - Sysadmin = 'SYSADMIN' + Lern = "LERN", + Lehr = "LEHR", + Extern = "EXTERN", + Orgadmin = "ORGADMIN", + Leit = "LEIT", + Sysadmin = "SYSADMIN", } diff --git a/loadtest/api-client/generated/models/RollenMerkmal.ts b/loadtest/api-client/generated/models/RollenMerkmal.ts index 3ef8425..eaa910b 100644 --- a/loadtest/api-client/generated/models/RollenMerkmal.ts +++ b/loadtest/api-client/generated/models/RollenMerkmal.ts @@ -3,16 +3,16 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum RollenMerkmal { - BefristungPflicht = 'BEFRISTUNG_PFLICHT', - KopersPflicht = 'KOPERS_PFLICHT' + BefristungPflicht = "BEFRISTUNG_PFLICHT", + KopersPflicht = "KOPERS_PFLICHT", } diff --git a/loadtest/api-client/generated/models/RollenSystemRecht.ts b/loadtest/api-client/generated/models/RollenSystemRecht.ts index bf77883..d4ea408 100644 --- a/loadtest/api-client/generated/models/RollenSystemRecht.ts +++ b/loadtest/api-client/generated/models/RollenSystemRecht.ts @@ -3,25 +3,25 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum RollenSystemRecht { - RollenVerwalten = 'ROLLEN_VERWALTEN', - PersonenSofortLoeschen = 'PERSONEN_SOFORT_LOESCHEN', - PersonenVerwalten = 'PERSONEN_VERWALTEN', - SchulenVerwalten = 'SCHULEN_VERWALTEN', - KlassenVerwalten = 'KLASSEN_VERWALTEN', - SchultraegerVerwalten = 'SCHULTRAEGER_VERWALTEN', - MigrationDurchfuehren = 'MIGRATION_DURCHFUEHREN', - PersonSynchronisieren = 'PERSON_SYNCHRONISIEREN', - CronDurchfuehren = 'CRON_DURCHFUEHREN', - PersonenAnlegen = 'PERSONEN_ANLEGEN', - ImportDurchfuehren = 'IMPORT_DURCHFUEHREN' + RollenVerwalten = "ROLLEN_VERWALTEN", + PersonenSofortLoeschen = "PERSONEN_SOFORT_LOESCHEN", + PersonenVerwalten = "PERSONEN_VERWALTEN", + SchulenVerwalten = "SCHULEN_VERWALTEN", + KlassenVerwalten = "KLASSEN_VERWALTEN", + SchultraegerVerwalten = "SCHULTRAEGER_VERWALTEN", + MigrationDurchfuehren = "MIGRATION_DURCHFUEHREN", + PersonSynchronisieren = "PERSON_SYNCHRONISIEREN", + CronDurchfuehren = "CRON_DURCHFUEHREN", + PersonenAnlegen = "PERSONEN_ANLEGEN", + ImportDurchfuehren = "IMPORT_DURCHFUEHREN", } diff --git a/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts b/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts index 1a7691f..f3289e1 100644 --- a/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts +++ b/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts @@ -3,41 +3,46 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class RollenSystemRechtServiceProviderIDResponse { - 'systemrechte': Array; - 'serviceProviderIds': Array; + "systemrechte": Array; + "serviceProviderIds": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "systemrechte", - "baseName": "systemrechte", - "type": "Array", - "format": "" - }, - { - "name": "serviceProviderIds", - "baseName": "serviceProviderIds", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "systemrechte", + baseName: "systemrechte", + type: "Array", + format: "", + }, + { + name: "serviceProviderIds", + baseName: "serviceProviderIds", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return RollenSystemRechtServiceProviderIDResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return RollenSystemRechtServiceProviderIDResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts b/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts index 22d551d..ea90834 100644 --- a/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts +++ b/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts @@ -3,41 +3,46 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class ServiceProviderIdNameResponse { - 'id': string; - 'name': string; + "id": string; + "name": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ServiceProviderIdNameResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return ServiceProviderIdNameResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/ServiceProviderKategorie.ts b/loadtest/api-client/generated/models/ServiceProviderKategorie.ts index e8ba017..aedc5d8 100644 --- a/loadtest/api-client/generated/models/ServiceProviderKategorie.ts +++ b/loadtest/api-client/generated/models/ServiceProviderKategorie.ts @@ -3,19 +3,19 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum ServiceProviderKategorie { - Email = 'EMAIL', - Unterricht = 'UNTERRICHT', - Verwaltung = 'VERWALTUNG', - Hinweise = 'HINWEISE', - Angebote = 'ANGEBOTE' + Email = "EMAIL", + Unterricht = "UNTERRICHT", + Verwaltung = "VERWALTUNG", + Hinweise = "HINWEISE", + Angebote = "ANGEBOTE", } diff --git a/loadtest/api-client/generated/models/ServiceProviderResponse.ts b/loadtest/api-client/generated/models/ServiceProviderResponse.ts index 1886b78..f1fe8d5 100644 --- a/loadtest/api-client/generated/models/ServiceProviderResponse.ts +++ b/loadtest/api-client/generated/models/ServiceProviderResponse.ts @@ -3,83 +3,86 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; -import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; -import { HttpFile } from '../http/http.ts'; +import { ServiceProviderKategorie } from "../models/ServiceProviderKategorie.ts"; +import { ServiceProviderTarget } from "../models/ServiceProviderTarget.ts"; +import { HttpFile } from "../http/http.ts"; export class ServiceProviderResponse { - 'id': string; - 'name': string; - 'target': ServiceProviderTarget; - /** - * Can be undefined, if `target` is not equal to `URL` - */ - 'url': string; - 'kategorie': ServiceProviderKategorie; - 'hasLogo': boolean; - 'requires2fa': boolean; + "id": string; + "name": string; + "target": ServiceProviderTarget; + /** + * Can be undefined, if `target` is not equal to `URL` + */ + "url": string; + "kategorie": ServiceProviderKategorie; + "hasLogo": boolean; + "requires2fa": boolean; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "id", - "baseName": "id", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "target", - "baseName": "target", - "type": "ServiceProviderTarget", - "format": "" - }, - { - "name": "url", - "baseName": "url", - "type": "string", - "format": "" - }, - { - "name": "kategorie", - "baseName": "kategorie", - "type": "ServiceProviderKategorie", - "format": "" - }, - { - "name": "hasLogo", - "baseName": "hasLogo", - "type": "boolean", - "format": "" - }, - { - "name": "requires2fa", - "baseName": "requires2fa", - "type": "boolean", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "id", + baseName: "id", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "target", + baseName: "target", + type: "ServiceProviderTarget", + format: "", + }, + { + name: "url", + baseName: "url", + type: "string", + format: "", + }, + { + name: "kategorie", + baseName: "kategorie", + type: "ServiceProviderKategorie", + format: "", + }, + { + name: "hasLogo", + baseName: "hasLogo", + type: "boolean", + format: "", + }, + { + name: "requires2fa", + baseName: "requires2fa", + type: "boolean", + format: "", + }, + ]; - static getAttributeTypeMap() { - return ServiceProviderResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return ServiceProviderResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/ServiceProviderTarget.ts b/loadtest/api-client/generated/models/ServiceProviderTarget.ts index ffb8911..e4a80a9 100644 --- a/loadtest/api-client/generated/models/ServiceProviderTarget.ts +++ b/loadtest/api-client/generated/models/ServiceProviderTarget.ts @@ -3,17 +3,17 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum ServiceProviderTarget { - Url = 'URL', - Email = 'EMAIL', - SchulportalAdministration = 'SCHULPORTAL_ADMINISTRATION' + Url = "URL", + Email = "EMAIL", + SchulportalAdministration = "SCHULPORTAL_ADMINISTRATION", } diff --git a/loadtest/api-client/generated/models/Sichtfreigabe.ts b/loadtest/api-client/generated/models/Sichtfreigabe.ts index 54f3ca3..1c8984c 100644 --- a/loadtest/api-client/generated/models/Sichtfreigabe.ts +++ b/loadtest/api-client/generated/models/Sichtfreigabe.ts @@ -3,16 +3,16 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum Sichtfreigabe { - Ja = 'ja', - Nein = 'nein' + Ja = "ja", + Nein = "nein", } diff --git a/loadtest/api-client/generated/models/SystemrechtResponse.ts b/loadtest/api-client/generated/models/SystemrechtResponse.ts index 655bef0..17eccd7 100644 --- a/loadtest/api-client/generated/models/SystemrechtResponse.ts +++ b/loadtest/api-client/generated/models/SystemrechtResponse.ts @@ -3,63 +3,68 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { HttpFile } from "../http/http.ts"; export class SystemrechtResponse { - 'ROLLEN_VERWALTEN': Array; - 'KLASSEN_VERWALTEN': Array; - 'SCHULEN_VERWALTEN': Array; - 'PERSONEN_VERWALTEN': Array; - 'SCHULTRAEGER_VERWALTEN': Array; + "ROLLEN_VERWALTEN": Array; + "KLASSEN_VERWALTEN": Array; + "SCHULEN_VERWALTEN": Array; + "PERSONEN_VERWALTEN": Array; + "SCHULTRAEGER_VERWALTEN": Array; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "ROLLEN_VERWALTEN", - "baseName": "ROLLEN_VERWALTEN", - "type": "Array", - "format": "" - }, - { - "name": "KLASSEN_VERWALTEN", - "baseName": "KLASSEN_VERWALTEN", - "type": "Array", - "format": "" - }, - { - "name": "SCHULEN_VERWALTEN", - "baseName": "SCHULEN_VERWALTEN", - "type": "Array", - "format": "" - }, - { - "name": "PERSONEN_VERWALTEN", - "baseName": "PERSONEN_VERWALTEN", - "type": "Array", - "format": "" - }, - { - "name": "SCHULTRAEGER_VERWALTEN", - "baseName": "SCHULTRAEGER_VERWALTEN", - "type": "Array", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "ROLLEN_VERWALTEN", + baseName: "ROLLEN_VERWALTEN", + type: "Array", + format: "", + }, + { + name: "KLASSEN_VERWALTEN", + baseName: "KLASSEN_VERWALTEN", + type: "Array", + format: "", + }, + { + name: "SCHULEN_VERWALTEN", + baseName: "SCHULEN_VERWALTEN", + type: "Array", + format: "", + }, + { + name: "PERSONEN_VERWALTEN", + baseName: "PERSONEN_VERWALTEN", + type: "Array", + format: "", + }, + { + name: "SCHULTRAEGER_VERWALTEN", + baseName: "SCHULTRAEGER_VERWALTEN", + type: "Array", + format: "", + }, + ]; - static getAttributeTypeMap() { - return SystemrechtResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return SystemrechtResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/TokenInitBodyParams.ts b/loadtest/api-client/generated/models/TokenInitBodyParams.ts index 6e7d05a..410177e 100644 --- a/loadtest/api-client/generated/models/TokenInitBodyParams.ts +++ b/loadtest/api-client/generated/models/TokenInitBodyParams.ts @@ -3,34 +3,39 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class TokenInitBodyParams { - 'personId': string; + "personId": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return TokenInitBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return TokenInitBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/TokenRequiredResponse.ts b/loadtest/api-client/generated/models/TokenRequiredResponse.ts index 9c5326c..e1918a0 100644 --- a/loadtest/api-client/generated/models/TokenRequiredResponse.ts +++ b/loadtest/api-client/generated/models/TokenRequiredResponse.ts @@ -3,34 +3,39 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class TokenRequiredResponse { - 'required': boolean; + "required": boolean; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "required", - "baseName": "required", - "type": "boolean", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "required", + baseName: "required", + type: "boolean", + format: "", + }, + ]; - static getAttributeTypeMap() { - return TokenRequiredResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return TokenRequiredResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/TokenStateResponse.ts b/loadtest/api-client/generated/models/TokenStateResponse.ts index 5c8d000..08a59f8 100644 --- a/loadtest/api-client/generated/models/TokenStateResponse.ts +++ b/loadtest/api-client/generated/models/TokenStateResponse.ts @@ -3,48 +3,53 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class TokenStateResponse { - 'hasToken': boolean; - 'tokenKind': string; - 'serial': string; + "hasToken": boolean; + "tokenKind": string; + "serial": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "hasToken", - "baseName": "hasToken", - "type": "boolean", - "format": "" - }, - { - "name": "tokenKind", - "baseName": "tokenKind", - "type": "string", - "format": "" - }, - { - "name": "serial", - "baseName": "serial", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "hasToken", + baseName: "hasToken", + type: "boolean", + format: "", + }, + { + name: "tokenKind", + baseName: "tokenKind", + type: "string", + format: "", + }, + { + name: "serial", + baseName: "serial", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return TokenStateResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return TokenStateResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts b/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts index 9b9c188..1d21e79 100644 --- a/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts +++ b/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts @@ -3,41 +3,46 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class TokenVerifyBodyParams { - 'personId': string; - 'otp': string; + "personId": string; + "otp": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "otp", - "baseName": "otp", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "otp", + baseName: "otp", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return TokenVerifyBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return TokenVerifyBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/TraegerschaftTyp.ts b/loadtest/api-client/generated/models/TraegerschaftTyp.ts index cbf6ed9..284875e 100644 --- a/loadtest/api-client/generated/models/TraegerschaftTyp.ts +++ b/loadtest/api-client/generated/models/TraegerschaftTyp.ts @@ -3,20 +3,20 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum TraegerschaftTyp { - _01 = '01', - _02 = '02', - _03 = '03', - _04 = '04', - _05 = '05', - _06 = '06' + _01 = "01", + _02 = "02", + _03 = "03", + _04 = "04", + _05 = "05", + _06 = "06", } diff --git a/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts b/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts index 153d33a..e81b83d 100644 --- a/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts +++ b/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts @@ -3,97 +3,100 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { HttpFile } from '../http/http.ts'; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { HttpFile } from "../http/http.ts"; export class UpdateOrganisationBodyParams { - 'administriertVon'?: string; - 'zugehoerigZu'?: string; - /** - * Required, if `typ` is equal to `SCHULE` - */ - 'kennung'?: string; - 'name': string; - 'namensergaenzung'?: string; - 'kuerzel'?: string; - 'typ': OrganisationsTyp; - 'traegerschaft'?: TraegerschaftTyp; - 'emailAdress'?: string; + "administriertVon"?: string; + "zugehoerigZu"?: string; + /** + * Required, if `typ` is equal to `SCHULE` + */ + "kennung"?: string; + "name": string; + "namensergaenzung"?: string; + "kuerzel"?: string; + "typ": OrganisationsTyp; + "traegerschaft"?: TraegerschaftTyp; + "emailAdress"?: string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "administriertVon", - "baseName": "administriertVon", - "type": "string", - "format": "" - }, - { - "name": "zugehoerigZu", - "baseName": "zugehoerigZu", - "type": "string", - "format": "" - }, - { - "name": "kennung", - "baseName": "kennung", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "namensergaenzung", - "baseName": "namensergaenzung", - "type": "string", - "format": "" - }, - { - "name": "kuerzel", - "baseName": "kuerzel", - "type": "string", - "format": "" - }, - { - "name": "typ", - "baseName": "typ", - "type": "OrganisationsTyp", - "format": "" - }, - { - "name": "traegerschaft", - "baseName": "traegerschaft", - "type": "TraegerschaftTyp", - "format": "" - }, - { - "name": "emailAdress", - "baseName": "emailAdress", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "administriertVon", + baseName: "administriertVon", + type: "string", + format: "", + }, + { + name: "zugehoerigZu", + baseName: "zugehoerigZu", + type: "string", + format: "", + }, + { + name: "kennung", + baseName: "kennung", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "namensergaenzung", + baseName: "namensergaenzung", + type: "string", + format: "", + }, + { + name: "kuerzel", + baseName: "kuerzel", + type: "string", + format: "", + }, + { + name: "typ", + baseName: "typ", + type: "OrganisationsTyp", + format: "", + }, + { + name: "traegerschaft", + baseName: "traegerschaft", + type: "TraegerschaftTyp", + format: "", + }, + { + name: "emailAdress", + baseName: "emailAdress", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return UpdateOrganisationBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return UpdateOrganisationBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts b/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts index e4b7f9c..cb9f179 100644 --- a/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts +++ b/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts @@ -3,96 +3,99 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { Geschlecht } from '../models/Geschlecht.ts'; -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; -import { HttpFile } from '../http/http.ts'; +import { Geschlecht } from "../models/Geschlecht.ts"; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; +import { HttpFile } from "../http/http.ts"; export class UpdatePersonBodyParams { - 'referrer'?: string; - 'stammorganisation'?: string; - 'name': PersonNameParams; - 'geburt'?: PersonBirthParams; - 'geschlecht'?: Geschlecht; - 'lokalisierung'?: string; - 'vertrauensstufe'?: Vertrauensstufe; - 'auskunftssperre'?: boolean; - 'revision': string; + "referrer"?: string; + "stammorganisation"?: string; + "name": PersonNameParams; + "geburt"?: PersonBirthParams; + "geschlecht"?: Geschlecht; + "lokalisierung"?: string; + "vertrauensstufe"?: Vertrauensstufe; + "auskunftssperre"?: boolean; + "revision": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "referrer", - "baseName": "referrer", - "type": "string", - "format": "" - }, - { - "name": "stammorganisation", - "baseName": "stammorganisation", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "PersonNameParams", - "format": "" - }, - { - "name": "geburt", - "baseName": "geburt", - "type": "PersonBirthParams", - "format": "" - }, - { - "name": "geschlecht", - "baseName": "geschlecht", - "type": "Geschlecht", - "format": "" - }, - { - "name": "lokalisierung", - "baseName": "lokalisierung", - "type": "string", - "format": "" - }, - { - "name": "vertrauensstufe", - "baseName": "vertrauensstufe", - "type": "Vertrauensstufe", - "format": "" - }, - { - "name": "auskunftssperre", - "baseName": "auskunftssperre", - "type": "boolean", - "format": "" - }, - { - "name": "revision", - "baseName": "revision", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "referrer", + baseName: "referrer", + type: "string", + format: "", + }, + { + name: "stammorganisation", + baseName: "stammorganisation", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "PersonNameParams", + format: "", + }, + { + name: "geburt", + baseName: "geburt", + type: "PersonBirthParams", + format: "", + }, + { + name: "geschlecht", + baseName: "geschlecht", + type: "Geschlecht", + format: "", + }, + { + name: "lokalisierung", + baseName: "lokalisierung", + type: "string", + format: "", + }, + { + name: "vertrauensstufe", + baseName: "vertrauensstufe", + type: "Vertrauensstufe", + format: "", + }, + { + name: "auskunftssperre", + baseName: "auskunftssperre", + type: "boolean", + format: "", + }, + { + name: "revision", + baseName: "revision", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return UpdatePersonBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return UpdatePersonBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } - - diff --git a/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts b/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts index 365e5ee..05eb913 100644 --- a/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts +++ b/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts @@ -3,64 +3,69 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { HttpFile } from '../http/http.ts'; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { HttpFile } from "../http/http.ts"; export class UpdateRolleBodyParams { - 'name': string; - 'merkmale': Set; - 'systemrechte': Set; - 'serviceProviderIds': Set; - 'version': number; + "name": string; + "merkmale": Set; + "systemrechte": Set; + "serviceProviderIds": Set; + "version": number; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "merkmale", - "baseName": "merkmale", - "type": "Set", - "format": "" - }, - { - "name": "systemrechte", - "baseName": "systemrechte", - "type": "Set", - "format": "" - }, - { - "name": "serviceProviderIds", - "baseName": "serviceProviderIds", - "type": "Set", - "format": "" - }, - { - "name": "version", - "baseName": "version", - "type": "number", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "merkmale", + baseName: "merkmale", + type: "Set", + format: "", + }, + { + name: "systemrechte", + baseName: "systemrechte", + type: "Set", + format: "", + }, + { + name: "serviceProviderIds", + baseName: "serviceProviderIds", + type: "Set", + format: "", + }, + { + name: "version", + baseName: "version", + type: "number", + format: "", + }, + ]; - static getAttributeTypeMap() { - return UpdateRolleBodyParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return UpdateRolleBodyParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/UserLockParams.ts b/loadtest/api-client/generated/models/UserLockParams.ts index 3baf533..28263b2 100644 --- a/loadtest/api-client/generated/models/UserLockParams.ts +++ b/loadtest/api-client/generated/models/UserLockParams.ts @@ -3,62 +3,67 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export class UserLockParams { - 'personId': string | null; - 'lockedBy': string | null; - 'createdAt': string | null; - 'lockedUntil': string | null; - 'lockOccasion': string | null; + "personId": string | null; + "lockedBy": string | null; + "createdAt": string | null; + "lockedUntil": string | null; + "lockOccasion": string | null; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "lockedBy", - "baseName": "locked_by", - "type": "string", - "format": "" - }, - { - "name": "createdAt", - "baseName": "created_at", - "type": "string", - "format": "" - }, - { - "name": "lockedUntil", - "baseName": "locked_until", - "type": "string", - "format": "" - }, - { - "name": "lockOccasion", - "baseName": "lock_occasion", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "lockedBy", + baseName: "locked_by", + type: "string", + format: "", + }, + { + name: "createdAt", + baseName: "created_at", + type: "string", + format: "", + }, + { + name: "lockedUntil", + baseName: "locked_until", + type: "string", + format: "", + }, + { + name: "lockOccasion", + baseName: "lock_occasion", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return UserLockParams.attributeTypeMap; - } + static getAttributeTypeMap() { + return UserLockParams.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/UserinfoResponse.ts b/loadtest/api-client/generated/models/UserinfoResponse.ts index 50da4fb..67f7c6f 100644 --- a/loadtest/api-client/generated/models/UserinfoResponse.ts +++ b/loadtest/api-client/generated/models/UserinfoResponse.ts @@ -3,182 +3,187 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; -import { HttpFile } from '../http/http.ts'; +import { PersonenkontextRolleFieldsResponse } from "../models/PersonenkontextRolleFieldsResponse.ts"; +import { HttpFile } from "../http/http.ts"; export class UserinfoResponse { - 'sub': string; - 'personId': string | null; - 'name': string | null; - 'givenName': string | null; - 'familyName': string | null; - 'middleName': string | null; - 'nickname': string | null; - 'preferredUsername': string | null; - 'profile': string | null; - 'picture': string | null; - 'website': string | null; - 'email': string | null; - 'emailVerified': boolean | null; - 'gender': string | null; - 'birthdate': string | null; - 'zoneinfo': string | null; - 'locale': string | null; - 'phoneNumber': string | null; - 'updatedAt': string | null; - 'passwordUpdatedAt': string | null; - 'personenkontexte': Array; - 'acr': string; + "sub": string; + "personId": string | null; + "name": string | null; + "givenName": string | null; + "familyName": string | null; + "middleName": string | null; + "nickname": string | null; + "preferredUsername": string | null; + "profile": string | null; + "picture": string | null; + "website": string | null; + "email": string | null; + "emailVerified": boolean | null; + "gender": string | null; + "birthdate": string | null; + "zoneinfo": string | null; + "locale": string | null; + "phoneNumber": string | null; + "updatedAt": string | null; + "passwordUpdatedAt": string | null; + "personenkontexte": Array; + "acr": string; - static readonly discriminator: string | undefined = undefined; + static readonly discriminator: string | undefined = undefined; - static readonly mapping: {[index: string]: string} | undefined = undefined; + static readonly mapping: { [index: string]: string } | undefined = undefined; - static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ - { - "name": "sub", - "baseName": "sub", - "type": "string", - "format": "" - }, - { - "name": "personId", - "baseName": "personId", - "type": "string", - "format": "" - }, - { - "name": "name", - "baseName": "name", - "type": "string", - "format": "" - }, - { - "name": "givenName", - "baseName": "given_name", - "type": "string", - "format": "" - }, - { - "name": "familyName", - "baseName": "family_name", - "type": "string", - "format": "" - }, - { - "name": "middleName", - "baseName": "middle_name", - "type": "string", - "format": "" - }, - { - "name": "nickname", - "baseName": "nickname", - "type": "string", - "format": "" - }, - { - "name": "preferredUsername", - "baseName": "preferred_username", - "type": "string", - "format": "" - }, - { - "name": "profile", - "baseName": "profile", - "type": "string", - "format": "" - }, - { - "name": "picture", - "baseName": "picture", - "type": "string", - "format": "" - }, - { - "name": "website", - "baseName": "website", - "type": "string", - "format": "" - }, - { - "name": "email", - "baseName": "email", - "type": "string", - "format": "" - }, - { - "name": "emailVerified", - "baseName": "email_verified", - "type": "boolean", - "format": "" - }, - { - "name": "gender", - "baseName": "gender", - "type": "string", - "format": "" - }, - { - "name": "birthdate", - "baseName": "birthdate", - "type": "string", - "format": "" - }, - { - "name": "zoneinfo", - "baseName": "zoneinfo", - "type": "string", - "format": "" - }, - { - "name": "locale", - "baseName": "locale", - "type": "string", - "format": "" - }, - { - "name": "phoneNumber", - "baseName": "phone_number", - "type": "string", - "format": "" - }, - { - "name": "updatedAt", - "baseName": "updated_at", - "type": "string", - "format": "" - }, - { - "name": "passwordUpdatedAt", - "baseName": "password_updated_at", - "type": "string", - "format": "" - }, - { - "name": "personenkontexte", - "baseName": "personenkontexte", - "type": "Array", - "format": "" - }, - { - "name": "acr", - "baseName": "acr", - "type": "string", - "format": "" - } ]; + static readonly attributeTypeMap: Array<{ + name: string; + baseName: string; + type: string; + format: string; + }> = [ + { + name: "sub", + baseName: "sub", + type: "string", + format: "", + }, + { + name: "personId", + baseName: "personId", + type: "string", + format: "", + }, + { + name: "name", + baseName: "name", + type: "string", + format: "", + }, + { + name: "givenName", + baseName: "given_name", + type: "string", + format: "", + }, + { + name: "familyName", + baseName: "family_name", + type: "string", + format: "", + }, + { + name: "middleName", + baseName: "middle_name", + type: "string", + format: "", + }, + { + name: "nickname", + baseName: "nickname", + type: "string", + format: "", + }, + { + name: "preferredUsername", + baseName: "preferred_username", + type: "string", + format: "", + }, + { + name: "profile", + baseName: "profile", + type: "string", + format: "", + }, + { + name: "picture", + baseName: "picture", + type: "string", + format: "", + }, + { + name: "website", + baseName: "website", + type: "string", + format: "", + }, + { + name: "email", + baseName: "email", + type: "string", + format: "", + }, + { + name: "emailVerified", + baseName: "email_verified", + type: "boolean", + format: "", + }, + { + name: "gender", + baseName: "gender", + type: "string", + format: "", + }, + { + name: "birthdate", + baseName: "birthdate", + type: "string", + format: "", + }, + { + name: "zoneinfo", + baseName: "zoneinfo", + type: "string", + format: "", + }, + { + name: "locale", + baseName: "locale", + type: "string", + format: "", + }, + { + name: "phoneNumber", + baseName: "phone_number", + type: "string", + format: "", + }, + { + name: "updatedAt", + baseName: "updated_at", + type: "string", + format: "", + }, + { + name: "passwordUpdatedAt", + baseName: "password_updated_at", + type: "string", + format: "", + }, + { + name: "personenkontexte", + baseName: "personenkontexte", + type: "Array", + format: "", + }, + { + name: "acr", + baseName: "acr", + type: "string", + format: "", + }, + ]; - static getAttributeTypeMap() { - return UserinfoResponse.attributeTypeMap; - } + static getAttributeTypeMap() { + return UserinfoResponse.attributeTypeMap; + } - public constructor() { - } + public constructor() {} } diff --git a/loadtest/api-client/generated/models/Vertrauensstufe.ts b/loadtest/api-client/generated/models/Vertrauensstufe.ts index 6000809..d280846 100644 --- a/loadtest/api-client/generated/models/Vertrauensstufe.ts +++ b/loadtest/api-client/generated/models/Vertrauensstufe.ts @@ -3,18 +3,18 @@ * The dBildungs IAM server API description * * OpenAPI spec version: 1.0 - * + * * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ -import { HttpFile } from '../http/http.ts'; +import { HttpFile } from "../http/http.ts"; export enum Vertrauensstufe { - Kein = 'KEIN', - Unbe = 'UNBE', - Teil = 'TEIL', - Voll = 'VOLL' + Kein = "KEIN", + Unbe = "UNBE", + Teil = "TEIL", + Voll = "VOLL", } diff --git a/loadtest/api-client/generated/models/all.ts b/loadtest/api-client/generated/models/all.ts index 7274dca..7bae87d 100644 --- a/loadtest/api-client/generated/models/all.ts +++ b/loadtest/api-client/generated/models/all.ts @@ -1,90 +1,90 @@ -export * from '../models/AddSystemrechtBodyParams.ts' -export * from '../models/AssignHardwareTokenBodyParams.ts' -export * from '../models/AssignHardwareTokenResponse.ts' -export * from '../models/CreateOrganisationBodyParams.ts' -export * from '../models/CreatePersonMigrationBodyParams.ts' -export * from '../models/CreateRolleBodyParams.ts' -export * from '../models/DBiamPersonResponse.ts' -export * from '../models/DBiamPersonenkontextResponse.ts' -export * from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts' -export * from '../models/DBiamPersonenuebersichtResponse.ts' -export * from '../models/DBiamPersonenzuordnungResponse.ts' -export * from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts' -export * from '../models/DbiamCreatePersonenkontextBodyParams.ts' -export * from '../models/DbiamImportError.ts' -export * from '../models/DbiamOrganisationError.ts' -export * from '../models/DbiamPersonError.ts' -export * from '../models/DbiamPersonenkontextBodyParams.ts' -export * from '../models/DbiamPersonenkontextError.ts' -export * from '../models/DbiamPersonenkontextMigrationBodyParams.ts' -export * from '../models/DbiamPersonenkontexteUpdateError.ts' -export * from '../models/DbiamRolleError.ts' -export * from '../models/DbiamUpdatePersonenkontexteBodyParams.ts' -export * from '../models/DeleteRevisionBodyParams.ts' -export * from '../models/EmailAddressStatus.ts' -export * from '../models/FindRollenResponse.ts' -export * from '../models/FindSchulstrukturknotenResponse.ts' -export * from '../models/Geschlecht.ts' -export * from '../models/ImportDataItemResponse.ts' -export * from '../models/ImportUploadResponse.ts' -export * from '../models/ImportvorgangByIdBodyParams.ts' -export * from '../models/LockUserBodyParams.ts' -export * from '../models/LoeschungResponse.ts' -export * from '../models/OrganisationByIdBodyParams.ts' -export * from '../models/OrganisationByNameBodyParams.ts' -export * from '../models/OrganisationResponse.ts' -export * from '../models/OrganisationResponseLegacy.ts' -export * from '../models/OrganisationRootChildrenResponse.ts' -export * from '../models/OrganisationsTyp.ts' -export * from '../models/ParentOrganisationenResponse.ts' -export * from '../models/ParentOrganisationsByIdsBodyParams.ts' -export * from '../models/Person.ts' -export * from '../models/PersonBirthParams.ts' -export * from '../models/PersonBirthResponse.ts' -export * from '../models/PersonControllerFindPersonenkontexte200Response.ts' -export * from '../models/PersonEmailResponse.ts' -export * from '../models/PersonFrontendControllerFindPersons200Response.ts' -export * from '../models/PersonIdResponse.ts' -export * from '../models/PersonInfoResponse.ts' -export * from '../models/PersonLockResponse.ts' -export * from '../models/PersonMetadataBodyParams.ts' -export * from '../models/PersonNameParams.ts' -export * from '../models/PersonNameResponse.ts' -export * from '../models/PersonResponse.ts' -export * from '../models/PersonResponseAutomapper.ts' -export * from '../models/PersonendatensatzResponse.ts' -export * from '../models/PersonendatensatzResponseAutomapper.ts' -export * from '../models/PersonenkontextMigrationRuntype.ts' -export * from '../models/PersonenkontextResponse.ts' -export * from '../models/PersonenkontextRolleFieldsResponse.ts' -export * from '../models/PersonenkontextWorkflowResponse.ts' -export * from '../models/PersonenkontextdatensatzResponse.ts' -export * from '../models/PersonenkontexteUpdateResponse.ts' -export * from '../models/Personenstatus.ts' -export * from '../models/PersonenuebersichtBodyParams.ts' -export * from '../models/RawPagedResponse.ts' -export * from '../models/RolleResponse.ts' -export * from '../models/RolleServiceProviderBodyParams.ts' -export * from '../models/RolleServiceProviderResponse.ts' -export * from '../models/RolleWithServiceProvidersResponse.ts' -export * from '../models/RollenArt.ts' -export * from '../models/RollenMerkmal.ts' -export * from '../models/RollenSystemRecht.ts' -export * from '../models/RollenSystemRechtServiceProviderIDResponse.ts' -export * from '../models/ServiceProviderIdNameResponse.ts' -export * from '../models/ServiceProviderKategorie.ts' -export * from '../models/ServiceProviderResponse.ts' -export * from '../models/ServiceProviderTarget.ts' -export * from '../models/Sichtfreigabe.ts' -export * from '../models/SystemrechtResponse.ts' -export * from '../models/TokenInitBodyParams.ts' -export * from '../models/TokenRequiredResponse.ts' -export * from '../models/TokenStateResponse.ts' -export * from '../models/TokenVerifyBodyParams.ts' -export * from '../models/TraegerschaftTyp.ts' -export * from '../models/UpdateOrganisationBodyParams.ts' -export * from '../models/UpdatePersonBodyParams.ts' -export * from '../models/UpdateRolleBodyParams.ts' -export * from '../models/UserLockParams.ts' -export * from '../models/UserinfoResponse.ts' -export * from '../models/Vertrauensstufe.ts' +export * from "../models/AddSystemrechtBodyParams.ts"; +export * from "../models/AssignHardwareTokenBodyParams.ts"; +export * from "../models/AssignHardwareTokenResponse.ts"; +export * from "../models/CreateOrganisationBodyParams.ts"; +export * from "../models/CreatePersonMigrationBodyParams.ts"; +export * from "../models/CreateRolleBodyParams.ts"; +export * from "../models/DBiamPersonResponse.ts"; +export * from "../models/DBiamPersonenkontextResponse.ts"; +export * from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +export * from "../models/DBiamPersonenuebersichtResponse.ts"; +export * from "../models/DBiamPersonenzuordnungResponse.ts"; +export * from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +export * from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +export * from "../models/DbiamImportError.ts"; +export * from "../models/DbiamOrganisationError.ts"; +export * from "../models/DbiamPersonError.ts"; +export * from "../models/DbiamPersonenkontextBodyParams.ts"; +export * from "../models/DbiamPersonenkontextError.ts"; +export * from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; +export * from "../models/DbiamPersonenkontexteUpdateError.ts"; +export * from "../models/DbiamRolleError.ts"; +export * from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +export * from "../models/DeleteRevisionBodyParams.ts"; +export * from "../models/EmailAddressStatus.ts"; +export * from "../models/FindRollenResponse.ts"; +export * from "../models/FindSchulstrukturknotenResponse.ts"; +export * from "../models/Geschlecht.ts"; +export * from "../models/ImportDataItemResponse.ts"; +export * from "../models/ImportUploadResponse.ts"; +export * from "../models/ImportvorgangByIdBodyParams.ts"; +export * from "../models/LockUserBodyParams.ts"; +export * from "../models/LoeschungResponse.ts"; +export * from "../models/OrganisationByIdBodyParams.ts"; +export * from "../models/OrganisationByNameBodyParams.ts"; +export * from "../models/OrganisationResponse.ts"; +export * from "../models/OrganisationResponseLegacy.ts"; +export * from "../models/OrganisationRootChildrenResponse.ts"; +export * from "../models/OrganisationsTyp.ts"; +export * from "../models/ParentOrganisationenResponse.ts"; +export * from "../models/ParentOrganisationsByIdsBodyParams.ts"; +export * from "../models/Person.ts"; +export * from "../models/PersonBirthParams.ts"; +export * from "../models/PersonBirthResponse.ts"; +export * from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +export * from "../models/PersonEmailResponse.ts"; +export * from "../models/PersonFrontendControllerFindPersons200Response.ts"; +export * from "../models/PersonIdResponse.ts"; +export * from "../models/PersonInfoResponse.ts"; +export * from "../models/PersonLockResponse.ts"; +export * from "../models/PersonMetadataBodyParams.ts"; +export * from "../models/PersonNameParams.ts"; +export * from "../models/PersonNameResponse.ts"; +export * from "../models/PersonResponse.ts"; +export * from "../models/PersonResponseAutomapper.ts"; +export * from "../models/PersonendatensatzResponse.ts"; +export * from "../models/PersonendatensatzResponseAutomapper.ts"; +export * from "../models/PersonenkontextMigrationRuntype.ts"; +export * from "../models/PersonenkontextResponse.ts"; +export * from "../models/PersonenkontextRolleFieldsResponse.ts"; +export * from "../models/PersonenkontextWorkflowResponse.ts"; +export * from "../models/PersonenkontextdatensatzResponse.ts"; +export * from "../models/PersonenkontexteUpdateResponse.ts"; +export * from "../models/Personenstatus.ts"; +export * from "../models/PersonenuebersichtBodyParams.ts"; +export * from "../models/RawPagedResponse.ts"; +export * from "../models/RolleResponse.ts"; +export * from "../models/RolleServiceProviderBodyParams.ts"; +export * from "../models/RolleServiceProviderResponse.ts"; +export * from "../models/RolleWithServiceProvidersResponse.ts"; +export * from "../models/RollenArt.ts"; +export * from "../models/RollenMerkmal.ts"; +export * from "../models/RollenSystemRecht.ts"; +export * from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +export * from "../models/ServiceProviderIdNameResponse.ts"; +export * from "../models/ServiceProviderKategorie.ts"; +export * from "../models/ServiceProviderResponse.ts"; +export * from "../models/ServiceProviderTarget.ts"; +export * from "../models/Sichtfreigabe.ts"; +export * from "../models/SystemrechtResponse.ts"; +export * from "../models/TokenInitBodyParams.ts"; +export * from "../models/TokenRequiredResponse.ts"; +export * from "../models/TokenStateResponse.ts"; +export * from "../models/TokenVerifyBodyParams.ts"; +export * from "../models/TraegerschaftTyp.ts"; +export * from "../models/UpdateOrganisationBodyParams.ts"; +export * from "../models/UpdatePersonBodyParams.ts"; +export * from "../models/UpdateRolleBodyParams.ts"; +export * from "../models/UserLockParams.ts"; +export * from "../models/UserinfoResponse.ts"; +export * from "../models/Vertrauensstufe.ts"; diff --git a/loadtest/api-client/generated/servers.ts b/loadtest/api-client/generated/servers.ts index f47dbd7..12f2988 100644 --- a/loadtest/api-client/generated/servers.ts +++ b/loadtest/api-client/generated/servers.ts @@ -1,7 +1,7 @@ import { RequestContext, HttpMethod } from "./http/http.ts"; export interface BaseServerConfiguration { - makeRequestContext(endpoint: string, httpMethod: HttpMethod): RequestContext; + makeRequestContext(endpoint: string, httpMethod: HttpMethod): RequestContext; } /** @@ -10,46 +10,54 @@ export interface BaseServerConfiguration { * url template and variable configuration based on the url. * */ -export class ServerConfiguration implements BaseServerConfiguration { - public constructor(private url: string, private variableConfiguration: T) {} - - /** - * Sets the value of the variables of this server. Variables are included in - * the `url` of this ServerConfiguration in the form `{variableName}` - * - * @param variableConfiguration a partial variable configuration for the - * variables contained in the url - */ - public setVariables(variableConfiguration: Partial) { - Object.assign(this.variableConfiguration, variableConfiguration); - } - - public getConfiguration(): T { - return this.variableConfiguration - } - - private getUrl() { - let replacedUrl = this.url; - for (const key in this.variableConfiguration) { - var re = new RegExp("{" + key + "}","g"); - replacedUrl = replacedUrl.replace(re, this.variableConfiguration[key]); - } - return replacedUrl - } - - /** - * Creates a new request context for this server using the url with variables - * replaced with their respective values and the endpoint of the request appended. - * - * @param endpoint the endpoint to be queried on the server - * @param httpMethod httpMethod to be used - * - */ - public makeRequestContext(endpoint: string, httpMethod: HttpMethod): RequestContext { - return new RequestContext(this.getUrl() + endpoint, httpMethod); +export class ServerConfiguration + implements BaseServerConfiguration +{ + public constructor( + private url: string, + private variableConfiguration: T, + ) {} + + /** + * Sets the value of the variables of this server. Variables are included in + * the `url` of this ServerConfiguration in the form `{variableName}` + * + * @param variableConfiguration a partial variable configuration for the + * variables contained in the url + */ + public setVariables(variableConfiguration: Partial) { + Object.assign(this.variableConfiguration, variableConfiguration); + } + + public getConfiguration(): T { + return this.variableConfiguration; + } + + private getUrl() { + let replacedUrl = this.url; + for (const key in this.variableConfiguration) { + var re = new RegExp("{" + key + "}", "g"); + replacedUrl = replacedUrl.replace(re, this.variableConfiguration[key]); } + return replacedUrl; + } + + /** + * Creates a new request context for this server using the url with variables + * replaced with their respective values and the endpoint of the request appended. + * + * @param endpoint the endpoint to be queried on the server + * @param httpMethod httpMethod to be used + * + */ + public makeRequestContext( + endpoint: string, + httpMethod: HttpMethod, + ): RequestContext { + return new RequestContext(this.getUrl() + endpoint, httpMethod); + } } -export const server1 = new ServerConfiguration<{ }>("", { }) +export const server1 = new ServerConfiguration<{}>("", {}); export const servers = [server1]; diff --git a/loadtest/api-client/generated/tsconfig.json b/loadtest/api-client/generated/tsconfig.json index aa173eb..b240068 100644 --- a/loadtest/api-client/generated/tsconfig.json +++ b/loadtest/api-client/generated/tsconfig.json @@ -7,22 +7,17 @@ "declaration": true, /* Additional Checks */ - "noUnusedLocals": false, /* Report errors on unused locals. */ // TODO: reenable (unused imports!) - "noUnusedParameters": false, /* Report errors on unused parameters. */ // TODO: set to true again - "noImplicitReturns": true, /* Report error when not all code paths in function return a value. */ - "noFallthroughCasesInSwitch": true, /* Report errors for fallthrough cases in switch statement. */ + "noUnusedLocals": false /* Report errors on unused locals. */, // TODO: reenable (unused imports!) + "noUnusedParameters": false /* Report errors on unused parameters. */, // TODO: set to true again + "noImplicitReturns": true /* Report error when not all code paths in function return a value. */, + "noFallthroughCasesInSwitch": true /* Report errors for fallthrough cases in switch statement. */, "removeComments": true, "sourceMap": true, "outDir": "./dist", "noLib": false, - "lib": [ "es6", "dom" ], + "lib": ["es6", "dom"] }, - "exclude": [ - "dist", - "node_modules" - ], - "filesGlob": [ - "./**/*.ts", - ] + "exclude": ["dist", "node_modules"], + "filesGlob": ["./**/*.ts"] } diff --git a/loadtest/api-client/generated/types/ObjectParamAPI.ts b/loadtest/api-client/generated/types/ObjectParamAPI.ts index 6cd77a5..c0c875d 100644 --- a/loadtest/api-client/generated/types/ObjectParamAPI.ts +++ b/loadtest/api-client/generated/types/ObjectParamAPI.ts @@ -1,2437 +1,3716 @@ -import { ResponseContext, RequestContext, HttpFile, HttpInfo } from '../http/http.ts'; -import { Configuration} from '../configuration.ts' - -import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; -import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; -import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; -import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; -import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; -import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; -import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; -import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; -import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; -import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; -import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; -import { DbiamImportError } from '../models/DbiamImportError.ts'; -import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; -import { DbiamPersonError } from '../models/DbiamPersonError.ts'; -import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; -import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; -import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; -import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; -import { DbiamRolleError } from '../models/DbiamRolleError.ts'; -import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; -import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; -import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; -import { FindRollenResponse } from '../models/FindRollenResponse.ts'; -import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; -import { Geschlecht } from '../models/Geschlecht.ts'; -import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; -import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; -import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; -import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; -import { LoeschungResponse } from '../models/LoeschungResponse.ts'; -import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; -import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; -import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; -import { Person } from '../models/Person.ts'; -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; -import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; -import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; -import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; -import { PersonIdResponse } from '../models/PersonIdResponse.ts'; -import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; -import { PersonLockResponse } from '../models/PersonLockResponse.ts'; -import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { PersonNameResponse } from '../models/PersonNameResponse.ts'; -import { PersonResponse } from '../models/PersonResponse.ts'; -import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; -import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; -import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; -import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; -import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; -import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; -import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; -import { Personenstatus } from '../models/Personenstatus.ts'; -import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; -import { RawPagedResponse } from '../models/RawPagedResponse.ts'; -import { RolleResponse } from '../models/RolleResponse.ts'; -import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; -import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; -import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; -import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; -import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; -import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; -import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; -import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; -import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; -import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; -import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; -import { TokenStateResponse } from '../models/TokenStateResponse.ts'; -import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; -import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; -import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; -import { UserLockParams } from '../models/UserLockParams.ts'; -import { UserinfoResponse } from '../models/UserinfoResponse.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +import { + ResponseContext, + RequestContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { Configuration } from "../configuration.ts"; + +import { AddSystemrechtBodyParams } from "../models/AddSystemrechtBodyParams.ts"; +import { AssignHardwareTokenBodyParams } from "../models/AssignHardwareTokenBodyParams.ts"; +import { AssignHardwareTokenResponse } from "../models/AssignHardwareTokenResponse.ts"; +import { CreateOrganisationBodyParams } from "../models/CreateOrganisationBodyParams.ts"; +import { CreatePersonMigrationBodyParams } from "../models/CreatePersonMigrationBodyParams.ts"; +import { CreateRolleBodyParams } from "../models/CreateRolleBodyParams.ts"; +import { DBiamPersonResponse } from "../models/DBiamPersonResponse.ts"; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +import { DBiamPersonenuebersichtResponse } from "../models/DBiamPersonenuebersichtResponse.ts"; +import { DBiamPersonenzuordnungResponse } from "../models/DBiamPersonenzuordnungResponse.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DbiamCreatePersonenkontextBodyParams } from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +import { DbiamImportError } from "../models/DbiamImportError.ts"; +import { DbiamOrganisationError } from "../models/DbiamOrganisationError.ts"; +import { DbiamPersonError } from "../models/DbiamPersonError.ts"; +import { DbiamPersonenkontextBodyParams } from "../models/DbiamPersonenkontextBodyParams.ts"; +import { DbiamPersonenkontextError } from "../models/DbiamPersonenkontextError.ts"; +import { DbiamPersonenkontextMigrationBodyParams } from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; +import { DbiamPersonenkontexteUpdateError } from "../models/DbiamPersonenkontexteUpdateError.ts"; +import { DbiamRolleError } from "../models/DbiamRolleError.ts"; +import { DbiamUpdatePersonenkontexteBodyParams } from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +import { DeleteRevisionBodyParams } from "../models/DeleteRevisionBodyParams.ts"; +import { EmailAddressStatus } from "../models/EmailAddressStatus.ts"; +import { FindRollenResponse } from "../models/FindRollenResponse.ts"; +import { FindSchulstrukturknotenResponse } from "../models/FindSchulstrukturknotenResponse.ts"; +import { Geschlecht } from "../models/Geschlecht.ts"; +import { ImportDataItemResponse } from "../models/ImportDataItemResponse.ts"; +import { ImportUploadResponse } from "../models/ImportUploadResponse.ts"; +import { ImportvorgangByIdBodyParams } from "../models/ImportvorgangByIdBodyParams.ts"; +import { LockUserBodyParams } from "../models/LockUserBodyParams.ts"; +import { LoeschungResponse } from "../models/LoeschungResponse.ts"; +import { OrganisationByIdBodyParams } from "../models/OrganisationByIdBodyParams.ts"; +import { OrganisationByNameBodyParams } from "../models/OrganisationByNameBodyParams.ts"; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { OrganisationRootChildrenResponse } from "../models/OrganisationRootChildrenResponse.ts"; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { ParentOrganisationenResponse } from "../models/ParentOrganisationenResponse.ts"; +import { ParentOrganisationsByIdsBodyParams } from "../models/ParentOrganisationsByIdsBodyParams.ts"; +import { Person } from "../models/Person.ts"; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonBirthResponse } from "../models/PersonBirthResponse.ts"; +import { PersonControllerFindPersonenkontexte200Response } from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +import { PersonEmailResponse } from "../models/PersonEmailResponse.ts"; +import { PersonFrontendControllerFindPersons200Response } from "../models/PersonFrontendControllerFindPersons200Response.ts"; +import { PersonIdResponse } from "../models/PersonIdResponse.ts"; +import { PersonInfoResponse } from "../models/PersonInfoResponse.ts"; +import { PersonLockResponse } from "../models/PersonLockResponse.ts"; +import { PersonMetadataBodyParams } from "../models/PersonMetadataBodyParams.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { PersonNameResponse } from "../models/PersonNameResponse.ts"; +import { PersonResponse } from "../models/PersonResponse.ts"; +import { PersonResponseAutomapper } from "../models/PersonResponseAutomapper.ts"; +import { PersonendatensatzResponse } from "../models/PersonendatensatzResponse.ts"; +import { PersonendatensatzResponseAutomapper } from "../models/PersonendatensatzResponseAutomapper.ts"; +import { PersonenkontextMigrationRuntype } from "../models/PersonenkontextMigrationRuntype.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { PersonenkontextRolleFieldsResponse } from "../models/PersonenkontextRolleFieldsResponse.ts"; +import { PersonenkontextWorkflowResponse } from "../models/PersonenkontextWorkflowResponse.ts"; +import { PersonenkontextdatensatzResponse } from "../models/PersonenkontextdatensatzResponse.ts"; +import { PersonenkontexteUpdateResponse } from "../models/PersonenkontexteUpdateResponse.ts"; +import { Personenstatus } from "../models/Personenstatus.ts"; +import { PersonenuebersichtBodyParams } from "../models/PersonenuebersichtBodyParams.ts"; +import { RawPagedResponse } from "../models/RawPagedResponse.ts"; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { RolleServiceProviderBodyParams } from "../models/RolleServiceProviderBodyParams.ts"; +import { RolleServiceProviderResponse } from "../models/RolleServiceProviderResponse.ts"; +import { RolleWithServiceProvidersResponse } from "../models/RolleWithServiceProvidersResponse.ts"; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { RollenSystemRechtServiceProviderIDResponse } from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +import { ServiceProviderIdNameResponse } from "../models/ServiceProviderIdNameResponse.ts"; +import { ServiceProviderKategorie } from "../models/ServiceProviderKategorie.ts"; +import { ServiceProviderResponse } from "../models/ServiceProviderResponse.ts"; +import { ServiceProviderTarget } from "../models/ServiceProviderTarget.ts"; +import { Sichtfreigabe } from "../models/Sichtfreigabe.ts"; +import { SystemrechtResponse } from "../models/SystemrechtResponse.ts"; +import { TokenInitBodyParams } from "../models/TokenInitBodyParams.ts"; +import { TokenRequiredResponse } from "../models/TokenRequiredResponse.ts"; +import { TokenStateResponse } from "../models/TokenStateResponse.ts"; +import { TokenVerifyBodyParams } from "../models/TokenVerifyBodyParams.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { UpdateOrganisationBodyParams } from "../models/UpdateOrganisationBodyParams.ts"; +import { UpdatePersonBodyParams } from "../models/UpdatePersonBodyParams.ts"; +import { UpdateRolleBodyParams } from "../models/UpdateRolleBodyParams.ts"; +import { UserLockParams } from "../models/UserLockParams.ts"; +import { UserinfoResponse } from "../models/UserinfoResponse.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; import { ObservableAuthApi } from "./ObservableAPI.ts"; -import { AuthApiRequestFactory, AuthApiResponseProcessor} from "../apis/AuthApi.ts"; +import { + AuthApiRequestFactory, + AuthApiResponseProcessor, +} from "../apis/AuthApi.ts"; -export interface AuthApiAuthenticationControllerInfoRequest { -} +export interface AuthApiAuthenticationControllerInfoRequest {} export interface AuthApiAuthenticationControllerLoginRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof AuthApiauthenticationControllerLogin - */ - redirectUrl?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof AuthApiauthenticationControllerLogin + */ + redirectUrl?: string; } -export interface AuthApiAuthenticationControllerLogoutRequest { -} +export interface AuthApiAuthenticationControllerLogoutRequest {} export interface AuthApiAuthenticationControllerResetPasswordRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof AuthApiauthenticationControllerResetPassword - */ - redirectUrl: string - /** - * - * Defaults to: undefined - * @type string - * @memberof AuthApiauthenticationControllerResetPassword - */ - loginHint: string + /** + * + * Defaults to: undefined + * @type string + * @memberof AuthApiauthenticationControllerResetPassword + */ + redirectUrl: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof AuthApiauthenticationControllerResetPassword + */ + loginHint: string; } export class ObjectAuthApi { - private api: ObservableAuthApi - - public constructor(configuration: Configuration, requestFactory?: AuthApiRequestFactory, responseProcessor?: AuthApiResponseProcessor) { - this.api = new ObservableAuthApi(configuration, requestFactory, responseProcessor); - } - - /** - * Info about logged in user. - * @param param the request object - */ - public authenticationControllerInfoWithHttpInfo(param: AuthApiAuthenticationControllerInfoRequest = {}, options?: Configuration): Promise> { - return this.api.authenticationControllerInfoWithHttpInfo( options).toPromise(); - } - - /** - * Info about logged in user. - * @param param the request object - */ - public authenticationControllerInfo(param: AuthApiAuthenticationControllerInfoRequest = {}, options?: Configuration): Promise { - return this.api.authenticationControllerInfo( options).toPromise(); - } - - /** - * Used to start OIDC authentication. - * @param param the request object - */ - public authenticationControllerLoginWithHttpInfo(param: AuthApiAuthenticationControllerLoginRequest = {}, options?: Configuration): Promise> { - return this.api.authenticationControllerLoginWithHttpInfo(param.redirectUrl, options).toPromise(); - } - - /** - * Used to start OIDC authentication. - * @param param the request object - */ - public authenticationControllerLogin(param: AuthApiAuthenticationControllerLoginRequest = {}, options?: Configuration): Promise { - return this.api.authenticationControllerLogin(param.redirectUrl, options).toPromise(); - } - - /** - * Used to log out the current user. - * @param param the request object - */ - public authenticationControllerLogoutWithHttpInfo(param: AuthApiAuthenticationControllerLogoutRequest = {}, options?: Configuration): Promise> { - return this.api.authenticationControllerLogoutWithHttpInfo( options).toPromise(); - } - - /** - * Used to log out the current user. - * @param param the request object - */ - public authenticationControllerLogout(param: AuthApiAuthenticationControllerLogoutRequest = {}, options?: Configuration): Promise { - return this.api.authenticationControllerLogout( options).toPromise(); - } - - /** - * Redirect to Keycloak password reset. - * @param param the request object - */ - public authenticationControllerResetPasswordWithHttpInfo(param: AuthApiAuthenticationControllerResetPasswordRequest, options?: Configuration): Promise> { - return this.api.authenticationControllerResetPasswordWithHttpInfo(param.redirectUrl, param.loginHint, options).toPromise(); - } - - /** - * Redirect to Keycloak password reset. - * @param param the request object - */ - public authenticationControllerResetPassword(param: AuthApiAuthenticationControllerResetPasswordRequest, options?: Configuration): Promise { - return this.api.authenticationControllerResetPassword(param.redirectUrl, param.loginHint, options).toPromise(); - } - + private api: ObservableAuthApi; + + public constructor( + configuration: Configuration, + requestFactory?: AuthApiRequestFactory, + responseProcessor?: AuthApiResponseProcessor, + ) { + this.api = new ObservableAuthApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Info about logged in user. + * @param param the request object + */ + public authenticationControllerInfoWithHttpInfo( + param: AuthApiAuthenticationControllerInfoRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .authenticationControllerInfoWithHttpInfo(options) + .toPromise(); + } + + /** + * Info about logged in user. + * @param param the request object + */ + public authenticationControllerInfo( + param: AuthApiAuthenticationControllerInfoRequest = {}, + options?: Configuration, + ): Promise { + return this.api.authenticationControllerInfo(options).toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param param the request object + */ + public authenticationControllerLoginWithHttpInfo( + param: AuthApiAuthenticationControllerLoginRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .authenticationControllerLoginWithHttpInfo(param.redirectUrl, options) + .toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param param the request object + */ + public authenticationControllerLogin( + param: AuthApiAuthenticationControllerLoginRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .authenticationControllerLogin(param.redirectUrl, options) + .toPromise(); + } + + /** + * Used to log out the current user. + * @param param the request object + */ + public authenticationControllerLogoutWithHttpInfo( + param: AuthApiAuthenticationControllerLogoutRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .authenticationControllerLogoutWithHttpInfo(options) + .toPromise(); + } + + /** + * Used to log out the current user. + * @param param the request object + */ + public authenticationControllerLogout( + param: AuthApiAuthenticationControllerLogoutRequest = {}, + options?: Configuration, + ): Promise { + return this.api.authenticationControllerLogout(options).toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param param the request object + */ + public authenticationControllerResetPasswordWithHttpInfo( + param: AuthApiAuthenticationControllerResetPasswordRequest, + options?: Configuration, + ): Promise> { + return this.api + .authenticationControllerResetPasswordWithHttpInfo( + param.redirectUrl, + param.loginHint, + options, + ) + .toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param param the request object + */ + public authenticationControllerResetPassword( + param: AuthApiAuthenticationControllerResetPasswordRequest, + options?: Configuration, + ): Promise { + return this.api + .authenticationControllerResetPassword( + param.redirectUrl, + param.loginHint, + options, + ) + .toPromise(); + } } import { ObservableClass2FAApi } from "./ObservableAPI.ts"; -import { Class2FAApiRequestFactory, Class2FAApiResponseProcessor} from "../apis/Class2FAApi.ts"; +import { + Class2FAApiRequestFactory, + Class2FAApiResponseProcessor, +} from "../apis/Class2FAApi.ts"; export interface Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest { - /** - * - * @type AssignHardwareTokenBodyParams - * @memberof Class2FAApiprivacyIdeaAdministrationControllerAssignHardwareToken - */ - assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams + /** + * + * @type AssignHardwareTokenBodyParams + * @memberof Class2FAApiprivacyIdeaAdministrationControllerAssignHardwareToken + */ + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams; } export interface Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof Class2FAApiprivacyIdeaAdministrationControllerGetTwoAuthState - */ - personId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof Class2FAApiprivacyIdeaAdministrationControllerGetTwoAuthState + */ + personId: string; } export interface Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest { - /** - * - * @type TokenInitBodyParams - * @memberof Class2FAApiprivacyIdeaAdministrationControllerInitializeSoftwareToken - */ - tokenInitBodyParams: TokenInitBodyParams + /** + * + * @type TokenInitBodyParams + * @memberof Class2FAApiprivacyIdeaAdministrationControllerInitializeSoftwareToken + */ + tokenInitBodyParams: TokenInitBodyParams; } export interface Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof Class2FAApiprivacyIdeaAdministrationControllerRequiresTwoFactorAuthentication - */ - personId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof Class2FAApiprivacyIdeaAdministrationControllerRequiresTwoFactorAuthentication + */ + personId: string; } export interface Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof Class2FAApiprivacyIdeaAdministrationControllerResetToken - */ - personId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof Class2FAApiprivacyIdeaAdministrationControllerResetToken + */ + personId: string; } export interface Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest { - /** - * - * @type TokenVerifyBodyParams - * @memberof Class2FAApiprivacyIdeaAdministrationControllerVerifyToken - */ - tokenVerifyBodyParams: TokenVerifyBodyParams + /** + * + * @type TokenVerifyBodyParams + * @memberof Class2FAApiprivacyIdeaAdministrationControllerVerifyToken + */ + tokenVerifyBodyParams: TokenVerifyBodyParams; } export class ObjectClass2FAApi { - private api: ObservableClass2FAApi - - public constructor(configuration: Configuration, requestFactory?: Class2FAApiRequestFactory, responseProcessor?: Class2FAApiResponseProcessor) { - this.api = new ObservableClass2FAApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest, options?: Configuration): Promise> { - return this.api.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(param.assignHardwareTokenBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerAssignHardwareToken(param: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest, options?: Configuration): Promise { - return this.api.privacyIdeaAdministrationControllerAssignHardwareToken(param.assignHardwareTokenBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest, options?: Configuration): Promise> { - return this.api.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerGetTwoAuthState(param: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest, options?: Configuration): Promise { - return this.api.privacyIdeaAdministrationControllerGetTwoAuthState(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest, options?: Configuration): Promise> { - return this.api.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(param.tokenInitBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerInitializeSoftwareToken(param: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest, options?: Configuration): Promise { - return this.api.privacyIdeaAdministrationControllerInitializeSoftwareToken(param.tokenInitBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest, options?: Configuration): Promise> { - return this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(param: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest, options?: Configuration): Promise { - return this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerResetTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest, options?: Configuration): Promise> { - return this.api.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerResetToken(param: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest, options?: Configuration): Promise { - return this.api.privacyIdeaAdministrationControllerResetToken(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest, options?: Configuration): Promise> { - return this.api.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(param.tokenVerifyBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public privacyIdeaAdministrationControllerVerifyToken(param: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest, options?: Configuration): Promise { - return this.api.privacyIdeaAdministrationControllerVerifyToken(param.tokenVerifyBodyParams, options).toPromise(); - } - + private api: ObservableClass2FAApi; + + public constructor( + configuration: Configuration, + requestFactory?: Class2FAApiRequestFactory, + responseProcessor?: Class2FAApiResponseProcessor, + ) { + this.api = new ObservableClass2FAApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + param: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest, + options?: Configuration, + ): Promise> { + return this.api + .privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + param.assignHardwareTokenBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerAssignHardwareToken( + param: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest, + options?: Configuration, + ): Promise { + return this.api + .privacyIdeaAdministrationControllerAssignHardwareToken( + param.assignHardwareTokenBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + param: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest, + options?: Configuration, + ): Promise> { + return this.api + .privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerGetTwoAuthState( + param: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest, + options?: Configuration, + ): Promise { + return this.api + .privacyIdeaAdministrationControllerGetTwoAuthState( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + param: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest, + options?: Configuration, + ): Promise> { + return this.api + .privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + param.tokenInitBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerInitializeSoftwareToken( + param: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest, + options?: Configuration, + ): Promise { + return this.api + .privacyIdeaAdministrationControllerInitializeSoftwareToken( + param.tokenInitBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + param: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest, + options?: Configuration, + ): Promise> { + return this.api + .privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + param: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest, + options?: Configuration, + ): Promise { + return this.api + .privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + param: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest, + options?: Configuration, + ): Promise> { + return this.api + .privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerResetToken( + param: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest, + options?: Configuration, + ): Promise { + return this.api + .privacyIdeaAdministrationControllerResetToken(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + param: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest, + options?: Configuration, + ): Promise> { + return this.api + .privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + param.tokenVerifyBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerVerifyToken( + param: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest, + options?: Configuration, + ): Promise { + return this.api + .privacyIdeaAdministrationControllerVerifyToken( + param.tokenVerifyBodyParams, + options, + ) + .toPromise(); + } } import { ObservableCronApi } from "./ObservableAPI.ts"; -import { CronApiRequestFactory, CronApiResponseProcessor} from "../apis/CronApi.ts"; +import { + CronApiRequestFactory, + CronApiResponseProcessor, +} from "../apis/CronApi.ts"; -export interface CronApiCronControllerKoPersUserLockRequest { -} +export interface CronApiCronControllerKoPersUserLockRequest {} -export interface CronApiCronControllerPersonWithoutOrgDeleteRequest { -} +export interface CronApiCronControllerPersonWithoutOrgDeleteRequest {} -export interface CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest { -} +export interface CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest {} -export interface CronApiCronControllerUnlockUsersWithExpiredLocksRequest { -} +export interface CronApiCronControllerUnlockUsersWithExpiredLocksRequest {} export class ObjectCronApi { - private api: ObservableCronApi - - public constructor(configuration: Configuration, requestFactory?: CronApiRequestFactory, responseProcessor?: CronApiResponseProcessor) { - this.api = new ObservableCronApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public cronControllerKoPersUserLockWithHttpInfo(param: CronApiCronControllerKoPersUserLockRequest = {}, options?: Configuration): Promise> { - return this.api.cronControllerKoPersUserLockWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerKoPersUserLock(param: CronApiCronControllerKoPersUserLockRequest = {}, options?: Configuration): Promise { - return this.api.cronControllerKoPersUserLock( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerPersonWithoutOrgDeleteWithHttpInfo(param: CronApiCronControllerPersonWithoutOrgDeleteRequest = {}, options?: Configuration): Promise> { - return this.api.cronControllerPersonWithoutOrgDeleteWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerPersonWithoutOrgDelete(param: CronApiCronControllerPersonWithoutOrgDeleteRequest = {}, options?: Configuration): Promise { - return this.api.cronControllerPersonWithoutOrgDelete( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(param: CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest = {}, options?: Configuration): Promise> { - return this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(param: CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest = {}, options?: Configuration): Promise { - return this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(param: CronApiCronControllerUnlockUsersWithExpiredLocksRequest = {}, options?: Configuration): Promise> { - return this.api.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public cronControllerUnlockUsersWithExpiredLocks(param: CronApiCronControllerUnlockUsersWithExpiredLocksRequest = {}, options?: Configuration): Promise { - return this.api.cronControllerUnlockUsersWithExpiredLocks( options).toPromise(); - } - + private api: ObservableCronApi; + + public constructor( + configuration: Configuration, + requestFactory?: CronApiRequestFactory, + responseProcessor?: CronApiResponseProcessor, + ) { + this.api = new ObservableCronApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public cronControllerKoPersUserLockWithHttpInfo( + param: CronApiCronControllerKoPersUserLockRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .cronControllerKoPersUserLockWithHttpInfo(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerKoPersUserLock( + param: CronApiCronControllerKoPersUserLockRequest = {}, + options?: Configuration, + ): Promise { + return this.api.cronControllerKoPersUserLock(options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerPersonWithoutOrgDeleteWithHttpInfo( + param: CronApiCronControllerPersonWithoutOrgDeleteRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .cronControllerPersonWithoutOrgDeleteWithHttpInfo(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerPersonWithoutOrgDelete( + param: CronApiCronControllerPersonWithoutOrgDeleteRequest = {}, + options?: Configuration, + ): Promise { + return this.api.cronControllerPersonWithoutOrgDelete(options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + param: CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + param: CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( + param: CronApiCronControllerUnlockUsersWithExpiredLocksRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerUnlockUsersWithExpiredLocks( + param: CronApiCronControllerUnlockUsersWithExpiredLocksRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .cronControllerUnlockUsersWithExpiredLocks(options) + .toPromise(); + } } import { ObservableDbiamPersonenkontexteApi } from "./ObservableAPI.ts"; -import { DbiamPersonenkontexteApiRequestFactory, DbiamPersonenkontexteApiResponseProcessor} from "../apis/DbiamPersonenkontexteApi.ts"; +import { + DbiamPersonenkontexteApiRequestFactory, + DbiamPersonenkontexteApiResponseProcessor, +} from "../apis/DbiamPersonenkontexteApi.ts"; export interface DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest { - /** - * - * @type DbiamPersonenkontextMigrationBodyParams - * @memberof DbiamPersonenkontexteApidBiamPersonenkontextControllerCreatePersonenkontextMigration - */ - dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams + /** + * + * @type DbiamPersonenkontextMigrationBodyParams + * @memberof DbiamPersonenkontexteApidBiamPersonenkontextControllerCreatePersonenkontextMigration + */ + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams; } export interface DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest { - /** - * The ID for the person. - * Defaults to: undefined - * @type string - * @memberof DbiamPersonenkontexteApidBiamPersonenkontextControllerFindPersonenkontextsByPerson - */ - personId: string + /** + * The ID for the person. + * Defaults to: undefined + * @type string + * @memberof DbiamPersonenkontexteApidBiamPersonenkontextControllerFindPersonenkontextsByPerson + */ + personId: string; } export class ObjectDbiamPersonenkontexteApi { - private api: ObservableDbiamPersonenkontexteApi - - public constructor(configuration: Configuration, requestFactory?: DbiamPersonenkontexteApiRequestFactory, responseProcessor?: DbiamPersonenkontexteApiResponseProcessor) { - this.api = new ObservableDbiamPersonenkontexteApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest, options?: Configuration): Promise> { - return this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(param.dbiamPersonenkontextMigrationBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public dBiamPersonenkontextControllerCreatePersonenkontextMigration(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest, options?: Configuration): Promise { - return this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigration(param.dbiamPersonenkontextMigrationBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest, options?: Configuration): Promise>> { - return this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public dBiamPersonenkontextControllerFindPersonenkontextsByPerson(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest, options?: Configuration): Promise> { - return this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(param.personId, options).toPromise(); - } - + private api: ObservableDbiamPersonenkontexteApi; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenkontexteApiRequestFactory, + responseProcessor?: DbiamPersonenkontexteApiResponseProcessor, + ) { + this.api = new ObservableDbiamPersonenkontexteApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest, + options?: Configuration, + ): Promise> { + return this.api + .dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + param.dbiamPersonenkontextMigrationBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigration( + param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest, + options?: Configuration, + ): Promise { + return this.api + .dBiamPersonenkontextControllerCreatePersonenkontextMigration( + param.dbiamPersonenkontextMigrationBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest, + options?: Configuration, + ): Promise>> { + return this.api + .dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest, + options?: Configuration, + ): Promise> { + return this.api + .dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + param.personId, + options, + ) + .toPromise(); + } } import { ObservableDbiamPersonenuebersichtApi } from "./ObservableAPI.ts"; -import { DbiamPersonenuebersichtApiRequestFactory, DbiamPersonenuebersichtApiResponseProcessor} from "../apis/DbiamPersonenuebersichtApi.ts"; +import { + DbiamPersonenuebersichtApiRequestFactory, + DbiamPersonenuebersichtApiResponseProcessor, +} from "../apis/DbiamPersonenuebersichtApi.ts"; export interface DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest { - /** - * - * @type PersonenuebersichtBodyParams - * @memberof DbiamPersonenuebersichtApidBiamPersonenuebersichtControllerFindPersonenuebersichten - */ - personenuebersichtBodyParams: PersonenuebersichtBodyParams + /** + * + * @type PersonenuebersichtBodyParams + * @memberof DbiamPersonenuebersichtApidBiamPersonenuebersichtControllerFindPersonenuebersichten + */ + personenuebersichtBodyParams: PersonenuebersichtBodyParams; } export interface DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest { - /** - * The ID for the person. - * Defaults to: undefined - * @type string - * @memberof DbiamPersonenuebersichtApidBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson - */ - personId: string + /** + * The ID for the person. + * Defaults to: undefined + * @type string + * @memberof DbiamPersonenuebersichtApidBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson + */ + personId: string; } export class ObjectDbiamPersonenuebersichtApi { - private api: ObservableDbiamPersonenuebersichtApi - - public constructor(configuration: Configuration, requestFactory?: DbiamPersonenuebersichtApiRequestFactory, responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor) { - this.api = new ObservableDbiamPersonenuebersichtApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest, options?: Configuration): Promise> { - return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(param.personenuebersichtBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichten(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest, options?: Configuration): Promise { - return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichten(param.personenuebersichtBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest, options?: Configuration): Promise> { - return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest, options?: Configuration): Promise { - return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(param.personId, options).toPromise(); - } - + private api: ObservableDbiamPersonenuebersichtApi; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenuebersichtApiRequestFactory, + responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor, + ) { + this.api = new ObservableDbiamPersonenuebersichtApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest, + options?: Configuration, + ): Promise< + HttpInfo + > { + return this.api + .dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + param.personenuebersichtBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichten( + param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest, + options?: Configuration, + ): Promise { + return this.api + .dBiamPersonenuebersichtControllerFindPersonenuebersichten( + param.personenuebersichtBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest, + options?: Configuration, + ): Promise> { + return this.api + .dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest, + options?: Configuration, + ): Promise { + return this.api + .dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + param.personId, + options, + ) + .toPromise(); + } } import { ObservableImportApi } from "./ObservableAPI.ts"; -import { ImportApiRequestFactory, ImportApiResponseProcessor} from "../apis/ImportApi.ts"; +import { + ImportApiRequestFactory, + ImportApiResponseProcessor, +} from "../apis/ImportApi.ts"; export interface ImportApiImportControllerDeleteImportTransactionRequest { - /** - * The id of an import transaction - * Defaults to: undefined - * @type string - * @memberof ImportApiimportControllerDeleteImportTransaction - */ - importvorgangId: string + /** + * The id of an import transaction + * Defaults to: undefined + * @type string + * @memberof ImportApiimportControllerDeleteImportTransaction + */ + importvorgangId: string; } export interface ImportApiImportControllerExecuteImportRequest { - /** - * - * @type ImportvorgangByIdBodyParams - * @memberof ImportApiimportControllerExecuteImport - */ - importvorgangByIdBodyParams: ImportvorgangByIdBodyParams + /** + * + * @type ImportvorgangByIdBodyParams + * @memberof ImportApiimportControllerExecuteImport + */ + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams; } export interface ImportApiImportControllerUploadFileRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof ImportApiimportControllerUploadFile - */ - organisationId: string - /** - * - * Defaults to: undefined - * @type string - * @memberof ImportApiimportControllerUploadFile - */ - rolleId: string - /** - * - * Defaults to: undefined - * @type HttpFile - * @memberof ImportApiimportControllerUploadFile - */ - file: HttpFile + /** + * + * Defaults to: undefined + * @type string + * @memberof ImportApiimportControllerUploadFile + */ + organisationId: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof ImportApiimportControllerUploadFile + */ + rolleId: string; + /** + * + * Defaults to: undefined + * @type HttpFile + * @memberof ImportApiimportControllerUploadFile + */ + file: HttpFile; } export class ObjectImportApi { - private api: ObservableImportApi - - public constructor(configuration: Configuration, requestFactory?: ImportApiRequestFactory, responseProcessor?: ImportApiResponseProcessor) { - this.api = new ObservableImportApi(configuration, requestFactory, responseProcessor); - } - - /** - * Delete a role by id. - * - * @param param the request object - */ - public importControllerDeleteImportTransactionWithHttpInfo(param: ImportApiImportControllerDeleteImportTransactionRequest, options?: Configuration): Promise> { - return this.api.importControllerDeleteImportTransactionWithHttpInfo(param.importvorgangId, options).toPromise(); - } - - /** - * Delete a role by id. - * - * @param param the request object - */ - public importControllerDeleteImportTransaction(param: ImportApiImportControllerDeleteImportTransactionRequest, options?: Configuration): Promise { - return this.api.importControllerDeleteImportTransaction(param.importvorgangId, options).toPromise(); - } - - /** - * @param param the request object - */ - public importControllerExecuteImportWithHttpInfo(param: ImportApiImportControllerExecuteImportRequest, options?: Configuration): Promise> { - return this.api.importControllerExecuteImportWithHttpInfo(param.importvorgangByIdBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public importControllerExecuteImport(param: ImportApiImportControllerExecuteImportRequest, options?: Configuration): Promise { - return this.api.importControllerExecuteImport(param.importvorgangByIdBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public importControllerUploadFileWithHttpInfo(param: ImportApiImportControllerUploadFileRequest, options?: Configuration): Promise> { - return this.api.importControllerUploadFileWithHttpInfo(param.organisationId, param.rolleId, param.file, options).toPromise(); - } - - /** - * @param param the request object - */ - public importControllerUploadFile(param: ImportApiImportControllerUploadFileRequest, options?: Configuration): Promise { - return this.api.importControllerUploadFile(param.organisationId, param.rolleId, param.file, options).toPromise(); - } - + private api: ObservableImportApi; + + public constructor( + configuration: Configuration, + requestFactory?: ImportApiRequestFactory, + responseProcessor?: ImportApiResponseProcessor, + ) { + this.api = new ObservableImportApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public importControllerDeleteImportTransactionWithHttpInfo( + param: ImportApiImportControllerDeleteImportTransactionRequest, + options?: Configuration, + ): Promise> { + return this.api + .importControllerDeleteImportTransactionWithHttpInfo( + param.importvorgangId, + options, + ) + .toPromise(); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public importControllerDeleteImportTransaction( + param: ImportApiImportControllerDeleteImportTransactionRequest, + options?: Configuration, + ): Promise { + return this.api + .importControllerDeleteImportTransaction(param.importvorgangId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public importControllerExecuteImportWithHttpInfo( + param: ImportApiImportControllerExecuteImportRequest, + options?: Configuration, + ): Promise> { + return this.api + .importControllerExecuteImportWithHttpInfo( + param.importvorgangByIdBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public importControllerExecuteImport( + param: ImportApiImportControllerExecuteImportRequest, + options?: Configuration, + ): Promise { + return this.api + .importControllerExecuteImport(param.importvorgangByIdBodyParams, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public importControllerUploadFileWithHttpInfo( + param: ImportApiImportControllerUploadFileRequest, + options?: Configuration, + ): Promise> { + return this.api + .importControllerUploadFileWithHttpInfo( + param.organisationId, + param.rolleId, + param.file, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public importControllerUploadFile( + param: ImportApiImportControllerUploadFileRequest, + options?: Configuration, + ): Promise { + return this.api + .importControllerUploadFile( + param.organisationId, + param.rolleId, + param.file, + options, + ) + .toPromise(); + } } import { ObservableOrganisationenApi } from "./ObservableAPI.ts"; -import { OrganisationenApiRequestFactory, OrganisationenApiResponseProcessor} from "../apis/OrganisationenApi.ts"; +import { + OrganisationenApiRequestFactory, + OrganisationenApiResponseProcessor, +} from "../apis/OrganisationenApi.ts"; export interface OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerAddAdministrierteOrganisation - */ - organisationId: string - /** - * - * @type OrganisationByIdBodyParams - * @memberof OrganisationenApiorganisationControllerAddAdministrierteOrganisation - */ - organisationByIdBodyParams: OrganisationByIdBodyParams + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerAddAdministrierteOrganisation + */ + organisationId: string; + /** + * + * @type OrganisationByIdBodyParams + * @memberof OrganisationenApiorganisationControllerAddAdministrierteOrganisation + */ + organisationByIdBodyParams: OrganisationByIdBodyParams; } export interface OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerAddZugehoerigeOrganisation - */ - organisationId: string - /** - * - * @type OrganisationByIdBodyParams - * @memberof OrganisationenApiorganisationControllerAddZugehoerigeOrganisation - */ - organisationByIdBodyParams: OrganisationByIdBodyParams + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerAddZugehoerigeOrganisation + */ + organisationId: string; + /** + * + * @type OrganisationByIdBodyParams + * @memberof OrganisationenApiorganisationControllerAddZugehoerigeOrganisation + */ + organisationByIdBodyParams: OrganisationByIdBodyParams; } export interface OrganisationenApiOrganisationControllerCreateOrganisationRequest { - /** - * - * @type CreateOrganisationBodyParams - * @memberof OrganisationenApiorganisationControllerCreateOrganisation - */ - createOrganisationBodyParams: CreateOrganisationBodyParams + /** + * + * @type CreateOrganisationBodyParams + * @memberof OrganisationenApiorganisationControllerCreateOrganisation + */ + createOrganisationBodyParams: CreateOrganisationBodyParams; } export interface OrganisationenApiOrganisationControllerDeleteKlasseRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerDeleteKlasse - */ - organisationId: string + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerDeleteKlasse + */ + organisationId: string; } export interface OrganisationenApiOrganisationControllerEnableForitslearningRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerEnableForitslearning - */ - organisationId: string + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerEnableForitslearning + */ + organisationId: string; } export interface OrganisationenApiOrganisationControllerFindOrganisationByIdRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerFindOrganisationById - */ - organisationId: string + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganisationById + */ + organisationId: string; } export interface OrganisationenApiOrganisationControllerFindOrganizationsRequest { - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - limit?: number - /** - * - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - kennung?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - name?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - searchString?: string - /** - * - * Defaults to: undefined - * @type OrganisationsTyp - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - typ?: OrganisationsTyp - /** - * - * Defaults to: undefined - * @type Array<RollenSystemRecht> - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - systemrechte?: Array - /** - * - * Defaults to: undefined - * @type Array<OrganisationsTyp> - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - excludeTyp?: Array - /** - * - * Defaults to: undefined - * @type Array<string> - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - administriertVon?: Array - /** - * Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). - * Defaults to: undefined - * @type Array<string> - * @memberof OrganisationenApiorganisationControllerFindOrganizations - */ - organisationIds?: Array + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + limit?: number; + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + kennung?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + name?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + searchString?: string; + /** + * + * Defaults to: undefined + * @type OrganisationsTyp + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + typ?: OrganisationsTyp; + /** + * + * Defaults to: undefined + * @type Array<RollenSystemRecht> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + systemrechte?: Array; + /** + * + * Defaults to: undefined + * @type Array<OrganisationsTyp> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + excludeTyp?: Array; + /** + * + * Defaults to: undefined + * @type Array<string> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + administriertVon?: Array; + /** + * Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + * Defaults to: undefined + * @type Array<string> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + organisationIds?: Array; } export interface OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen - */ - organisationId: string - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen - */ - limit?: number - /** - * - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen - */ - searchFilter?: string + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + organisationId: string; + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + limit?: number; + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + searchFilter?: string; } export interface OrganisationenApiOrganisationControllerGetParentsByIdsRequest { - /** - * - * @type ParentOrganisationsByIdsBodyParams - * @memberof OrganisationenApiorganisationControllerGetParentsByIds - */ - parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams + /** + * + * @type ParentOrganisationsByIdsBodyParams + * @memberof OrganisationenApiorganisationControllerGetParentsByIds + */ + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams; } -export interface OrganisationenApiOrganisationControllerGetRootChildrenRequest { -} +export interface OrganisationenApiOrganisationControllerGetRootChildrenRequest {} -export interface OrganisationenApiOrganisationControllerGetRootOrganisationRequest { -} +export interface OrganisationenApiOrganisationControllerGetRootOrganisationRequest {} export interface OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerGetZugehoerigeOrganisationen - */ - organisationId: string + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerGetZugehoerigeOrganisationen + */ + organisationId: string; } export interface OrganisationenApiOrganisationControllerUpdateOrganisationRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerUpdateOrganisation - */ - organisationId: string - /** - * - * @type UpdateOrganisationBodyParams - * @memberof OrganisationenApiorganisationControllerUpdateOrganisation - */ - updateOrganisationBodyParams: UpdateOrganisationBodyParams + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerUpdateOrganisation + */ + organisationId: string; + /** + * + * @type UpdateOrganisationBodyParams + * @memberof OrganisationenApiorganisationControllerUpdateOrganisation + */ + updateOrganisationBodyParams: UpdateOrganisationBodyParams; } export interface OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest { - /** - * The id of an organization - * Defaults to: undefined - * @type string - * @memberof OrganisationenApiorganisationControllerUpdateOrganisationName - */ - organisationId: string - /** - * - * @type OrganisationByNameBodyParams - * @memberof OrganisationenApiorganisationControllerUpdateOrganisationName - */ - organisationByNameBodyParams: OrganisationByNameBodyParams + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerUpdateOrganisationName + */ + organisationId: string; + /** + * + * @type OrganisationByNameBodyParams + * @memberof OrganisationenApiorganisationControllerUpdateOrganisationName + */ + organisationByNameBodyParams: OrganisationByNameBodyParams; } export class ObjectOrganisationenApi { - private api: ObservableOrganisationenApi - - public constructor(configuration: Configuration, requestFactory?: OrganisationenApiRequestFactory, responseProcessor?: OrganisationenApiResponseProcessor) { - this.api = new ObservableOrganisationenApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public organisationControllerAddAdministrierteOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest, options?: Configuration): Promise> { - return this.api.organisationControllerAddAdministrierteOrganisationWithHttpInfo(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerAddAdministrierteOrganisation(param: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest, options?: Configuration): Promise { - return this.api.organisationControllerAddAdministrierteOrganisation(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerAddZugehoerigeOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest, options?: Configuration): Promise> { - return this.api.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerAddZugehoerigeOrganisation(param: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest, options?: Configuration): Promise { - return this.api.organisationControllerAddZugehoerigeOrganisation(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerCreateOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerCreateOrganisationRequest, options?: Configuration): Promise> { - return this.api.organisationControllerCreateOrganisationWithHttpInfo(param.createOrganisationBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerCreateOrganisation(param: OrganisationenApiOrganisationControllerCreateOrganisationRequest, options?: Configuration): Promise { - return this.api.organisationControllerCreateOrganisation(param.createOrganisationBodyParams, options).toPromise(); - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param param the request object - */ - public organisationControllerDeleteKlasseWithHttpInfo(param: OrganisationenApiOrganisationControllerDeleteKlasseRequest, options?: Configuration): Promise> { - return this.api.organisationControllerDeleteKlasseWithHttpInfo(param.organisationId, options).toPromise(); - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param param the request object - */ - public organisationControllerDeleteKlasse(param: OrganisationenApiOrganisationControllerDeleteKlasseRequest, options?: Configuration): Promise { - return this.api.organisationControllerDeleteKlasse(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerEnableForitslearningWithHttpInfo(param: OrganisationenApiOrganisationControllerEnableForitslearningRequest, options?: Configuration): Promise> { - return this.api.organisationControllerEnableForitslearningWithHttpInfo(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerEnableForitslearning(param: OrganisationenApiOrganisationControllerEnableForitslearningRequest, options?: Configuration): Promise { - return this.api.organisationControllerEnableForitslearning(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerFindOrganisationByIdWithHttpInfo(param: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest, options?: Configuration): Promise> { - return this.api.organisationControllerFindOrganisationByIdWithHttpInfo(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerFindOrganisationById(param: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest, options?: Configuration): Promise { - return this.api.organisationControllerFindOrganisationById(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerFindOrganizationsWithHttpInfo(param: OrganisationenApiOrganisationControllerFindOrganizationsRequest = {}, options?: Configuration): Promise>> { - return this.api.organisationControllerFindOrganizationsWithHttpInfo(param.offset, param.limit, param.kennung, param.name, param.searchString, param.typ, param.systemrechte, param.excludeTyp, param.administriertVon, param.organisationIds, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerFindOrganizations(param: OrganisationenApiOrganisationControllerFindOrganizationsRequest = {}, options?: Configuration): Promise> { - return this.api.organisationControllerFindOrganizations(param.offset, param.limit, param.kennung, param.name, param.searchString, param.typ, param.systemrechte, param.excludeTyp, param.administriertVon, param.organisationIds, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetAdministrierteOrganisationenWithHttpInfo(param: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest, options?: Configuration): Promise>> { - return this.api.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(param.organisationId, param.offset, param.limit, param.searchFilter, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetAdministrierteOrganisationen(param: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest, options?: Configuration): Promise> { - return this.api.organisationControllerGetAdministrierteOrganisationen(param.organisationId, param.offset, param.limit, param.searchFilter, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetParentsByIdsWithHttpInfo(param: OrganisationenApiOrganisationControllerGetParentsByIdsRequest, options?: Configuration): Promise> { - return this.api.organisationControllerGetParentsByIdsWithHttpInfo(param.parentOrganisationsByIdsBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetParentsByIds(param: OrganisationenApiOrganisationControllerGetParentsByIdsRequest, options?: Configuration): Promise { - return this.api.organisationControllerGetParentsByIds(param.parentOrganisationsByIdsBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetRootChildrenWithHttpInfo(param: OrganisationenApiOrganisationControllerGetRootChildrenRequest = {}, options?: Configuration): Promise> { - return this.api.organisationControllerGetRootChildrenWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetRootChildren(param: OrganisationenApiOrganisationControllerGetRootChildrenRequest = {}, options?: Configuration): Promise { - return this.api.organisationControllerGetRootChildren( options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetRootOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerGetRootOrganisationRequest = {}, options?: Configuration): Promise> { - return this.api.organisationControllerGetRootOrganisationWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetRootOrganisation(param: OrganisationenApiOrganisationControllerGetRootOrganisationRequest = {}, options?: Configuration): Promise { - return this.api.organisationControllerGetRootOrganisation( options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(param: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest, options?: Configuration): Promise>> { - return this.api.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerGetZugehoerigeOrganisationen(param: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest, options?: Configuration): Promise> { - return this.api.organisationControllerGetZugehoerigeOrganisationen(param.organisationId, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerUpdateOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerUpdateOrganisationRequest, options?: Configuration): Promise> { - return this.api.organisationControllerUpdateOrganisationWithHttpInfo(param.organisationId, param.updateOrganisationBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerUpdateOrganisation(param: OrganisationenApiOrganisationControllerUpdateOrganisationRequest, options?: Configuration): Promise { - return this.api.organisationControllerUpdateOrganisation(param.organisationId, param.updateOrganisationBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerUpdateOrganisationNameWithHttpInfo(param: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest, options?: Configuration): Promise> { - return this.api.organisationControllerUpdateOrganisationNameWithHttpInfo(param.organisationId, param.organisationByNameBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public organisationControllerUpdateOrganisationName(param: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest, options?: Configuration): Promise { - return this.api.organisationControllerUpdateOrganisationName(param.organisationId, param.organisationByNameBodyParams, options).toPromise(); - } - + private api: ObservableOrganisationenApi; + + public constructor( + configuration: Configuration, + requestFactory?: OrganisationenApiRequestFactory, + responseProcessor?: OrganisationenApiResponseProcessor, + ) { + this.api = new ObservableOrganisationenApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public organisationControllerAddAdministrierteOrganisationWithHttpInfo( + param: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerAddAdministrierteOrganisationWithHttpInfo( + param.organisationId, + param.organisationByIdBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerAddAdministrierteOrganisation( + param: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerAddAdministrierteOrganisation( + param.organisationId, + param.organisationByIdBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + param: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + param.organisationId, + param.organisationByIdBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerAddZugehoerigeOrganisation( + param: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerAddZugehoerigeOrganisation( + param.organisationId, + param.organisationByIdBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerCreateOrganisationWithHttpInfo( + param: OrganisationenApiOrganisationControllerCreateOrganisationRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerCreateOrganisationWithHttpInfo( + param.createOrganisationBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerCreateOrganisation( + param: OrganisationenApiOrganisationControllerCreateOrganisationRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerCreateOrganisation( + param.createOrganisationBodyParams, + options, + ) + .toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param param the request object + */ + public organisationControllerDeleteKlasseWithHttpInfo( + param: OrganisationenApiOrganisationControllerDeleteKlasseRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerDeleteKlasseWithHttpInfo( + param.organisationId, + options, + ) + .toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param param the request object + */ + public organisationControllerDeleteKlasse( + param: OrganisationenApiOrganisationControllerDeleteKlasseRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerDeleteKlasse(param.organisationId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerEnableForitslearningWithHttpInfo( + param: OrganisationenApiOrganisationControllerEnableForitslearningRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerEnableForitslearningWithHttpInfo( + param.organisationId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerEnableForitslearning( + param: OrganisationenApiOrganisationControllerEnableForitslearningRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerEnableForitslearning(param.organisationId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganisationByIdWithHttpInfo( + param: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerFindOrganisationByIdWithHttpInfo( + param.organisationId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganisationById( + param: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerFindOrganisationById(param.organisationId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganizationsWithHttpInfo( + param: OrganisationenApiOrganisationControllerFindOrganizationsRequest = {}, + options?: Configuration, + ): Promise>> { + return this.api + .organisationControllerFindOrganizationsWithHttpInfo( + param.offset, + param.limit, + param.kennung, + param.name, + param.searchString, + param.typ, + param.systemrechte, + param.excludeTyp, + param.administriertVon, + param.organisationIds, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganizations( + param: OrganisationenApiOrganisationControllerFindOrganizationsRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerFindOrganizations( + param.offset, + param.limit, + param.kennung, + param.name, + param.searchString, + param.typ, + param.systemrechte, + param.excludeTyp, + param.administriertVon, + param.organisationIds, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + param: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest, + options?: Configuration, + ): Promise>> { + return this.api + .organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + param.organisationId, + param.offset, + param.limit, + param.searchFilter, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetAdministrierteOrganisationen( + param: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerGetAdministrierteOrganisationen( + param.organisationId, + param.offset, + param.limit, + param.searchFilter, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetParentsByIdsWithHttpInfo( + param: OrganisationenApiOrganisationControllerGetParentsByIdsRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerGetParentsByIdsWithHttpInfo( + param.parentOrganisationsByIdsBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetParentsByIds( + param: OrganisationenApiOrganisationControllerGetParentsByIdsRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerGetParentsByIds( + param.parentOrganisationsByIdsBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootChildrenWithHttpInfo( + param: OrganisationenApiOrganisationControllerGetRootChildrenRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerGetRootChildrenWithHttpInfo(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootChildren( + param: OrganisationenApiOrganisationControllerGetRootChildrenRequest = {}, + options?: Configuration, + ): Promise { + return this.api.organisationControllerGetRootChildren(options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootOrganisationWithHttpInfo( + param: OrganisationenApiOrganisationControllerGetRootOrganisationRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerGetRootOrganisationWithHttpInfo(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootOrganisation( + param: OrganisationenApiOrganisationControllerGetRootOrganisationRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerGetRootOrganisation(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + param: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest, + options?: Configuration, + ): Promise>> { + return this.api + .organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + param.organisationId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetZugehoerigeOrganisationen( + param: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerGetZugehoerigeOrganisationen( + param.organisationId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisationWithHttpInfo( + param: OrganisationenApiOrganisationControllerUpdateOrganisationRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerUpdateOrganisationWithHttpInfo( + param.organisationId, + param.updateOrganisationBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisation( + param: OrganisationenApiOrganisationControllerUpdateOrganisationRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerUpdateOrganisation( + param.organisationId, + param.updateOrganisationBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisationNameWithHttpInfo( + param: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest, + options?: Configuration, + ): Promise> { + return this.api + .organisationControllerUpdateOrganisationNameWithHttpInfo( + param.organisationId, + param.organisationByNameBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisationName( + param: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest, + options?: Configuration, + ): Promise { + return this.api + .organisationControllerUpdateOrganisationName( + param.organisationId, + param.organisationByNameBodyParams, + options, + ) + .toPromise(); + } } import { ObservablePersonAdministrationApi } from "./ObservableAPI.ts"; -import { PersonAdministrationApiRequestFactory, PersonAdministrationApiResponseProcessor} from "../apis/PersonAdministrationApi.ts"; +import { + PersonAdministrationApiRequestFactory, + PersonAdministrationApiResponseProcessor, +} from "../apis/PersonAdministrationApi.ts"; export interface PersonAdministrationApiPersonAdministrationControllerFindRollenRequest { - /** - * Rolle name used to filter for rollen in personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonAdministrationApipersonAdministrationControllerFindRollen - */ - rolleName?: string - /** - * The limit of items for the request. - * Defaults to: undefined - * @type number - * @memberof PersonAdministrationApipersonAdministrationControllerFindRollen - */ - limit?: number + /** + * Rolle name used to filter for rollen in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonAdministrationApipersonAdministrationControllerFindRollen + */ + rolleName?: string; + /** + * The limit of items for the request. + * Defaults to: undefined + * @type number + * @memberof PersonAdministrationApipersonAdministrationControllerFindRollen + */ + limit?: number; } export class ObjectPersonAdministrationApi { - private api: ObservablePersonAdministrationApi - - public constructor(configuration: Configuration, requestFactory?: PersonAdministrationApiRequestFactory, responseProcessor?: PersonAdministrationApiResponseProcessor) { - this.api = new ObservablePersonAdministrationApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public personAdministrationControllerFindRollenWithHttpInfo(param: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = {}, options?: Configuration): Promise> { - return this.api.personAdministrationControllerFindRollenWithHttpInfo(param.rolleName, param.limit, options).toPromise(); - } - - /** - * @param param the request object - */ - public personAdministrationControllerFindRollen(param: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = {}, options?: Configuration): Promise { - return this.api.personAdministrationControllerFindRollen(param.rolleName, param.limit, options).toPromise(); - } - + private api: ObservablePersonAdministrationApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonAdministrationApiRequestFactory, + responseProcessor?: PersonAdministrationApiResponseProcessor, + ) { + this.api = new ObservablePersonAdministrationApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public personAdministrationControllerFindRollenWithHttpInfo( + param: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .personAdministrationControllerFindRollenWithHttpInfo( + param.rolleName, + param.limit, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personAdministrationControllerFindRollen( + param: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .personAdministrationControllerFindRollen( + param.rolleName, + param.limit, + options, + ) + .toPromise(); + } } import { ObservablePersonInfoApi } from "./ObservableAPI.ts"; -import { PersonInfoApiRequestFactory, PersonInfoApiResponseProcessor} from "../apis/PersonInfoApi.ts"; +import { + PersonInfoApiRequestFactory, + PersonInfoApiResponseProcessor, +} from "../apis/PersonInfoApi.ts"; -export interface PersonInfoApiPersonInfoControllerInfoRequest { -} +export interface PersonInfoApiPersonInfoControllerInfoRequest {} export class ObjectPersonInfoApi { - private api: ObservablePersonInfoApi - - public constructor(configuration: Configuration, requestFactory?: PersonInfoApiRequestFactory, responseProcessor?: PersonInfoApiResponseProcessor) { - this.api = new ObservablePersonInfoApi(configuration, requestFactory, responseProcessor); - } - - /** - * Info about logged in person. - * @param param the request object - */ - public personInfoControllerInfoWithHttpInfo(param: PersonInfoApiPersonInfoControllerInfoRequest = {}, options?: Configuration): Promise> { - return this.api.personInfoControllerInfoWithHttpInfo( options).toPromise(); - } - - /** - * Info about logged in person. - * @param param the request object - */ - public personInfoControllerInfo(param: PersonInfoApiPersonInfoControllerInfoRequest = {}, options?: Configuration): Promise { - return this.api.personInfoControllerInfo( options).toPromise(); - } - + private api: ObservablePersonInfoApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonInfoApiRequestFactory, + responseProcessor?: PersonInfoApiResponseProcessor, + ) { + this.api = new ObservablePersonInfoApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Info about logged in person. + * @param param the request object + */ + public personInfoControllerInfoWithHttpInfo( + param: PersonInfoApiPersonInfoControllerInfoRequest = {}, + options?: Configuration, + ): Promise> { + return this.api.personInfoControllerInfoWithHttpInfo(options).toPromise(); + } + + /** + * Info about logged in person. + * @param param the request object + */ + public personInfoControllerInfo( + param: PersonInfoApiPersonInfoControllerInfoRequest = {}, + options?: Configuration, + ): Promise { + return this.api.personInfoControllerInfo(options).toPromise(); + } } import { ObservablePersonenApi } from "./ObservableAPI.ts"; -import { PersonenApiRequestFactory, PersonenApiResponseProcessor} from "../apis/PersonenApi.ts"; +import { + PersonenApiRequestFactory, + PersonenApiResponseProcessor, +} from "../apis/PersonenApi.ts"; export interface PersonenApiPersonControllerCreatePersonMigrationRequest { - /** - * - * @type CreatePersonMigrationBodyParams - * @memberof PersonenApipersonControllerCreatePersonMigration - */ - createPersonMigrationBodyParams: CreatePersonMigrationBodyParams + /** + * + * @type CreatePersonMigrationBodyParams + * @memberof PersonenApipersonControllerCreatePersonMigration + */ + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams; } export interface PersonenApiPersonControllerCreatePersonenkontextRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerCreatePersonenkontext - */ - personId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerCreatePersonenkontext + */ + personId: string; } export interface PersonenApiPersonControllerDeletePersonByIdRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerDeletePersonById - */ - personId: string + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerDeletePersonById + */ + personId: string; } export interface PersonenApiPersonControllerFindPersonByIdRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersonById - */ - personId: string + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonById + */ + personId: string; } export interface PersonenApiPersonControllerFindPersonenkontexteRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - personId: string - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - limit?: number - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - personId2?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - referrer?: string - /** - * - * Defaults to: undefined - * @type Personenstatus - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - personenstatus?: Personenstatus - /** - * - * Defaults to: undefined - * @type Sichtfreigabe - * @memberof PersonenApipersonControllerFindPersonenkontexte - */ - sichtfreigabe?: Sichtfreigabe + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + personId: string; + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + limit?: number; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + personId2?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + referrer?: string; + /** + * + * Defaults to: undefined + * @type Personenstatus + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + personenstatus?: Personenstatus; + /** + * + * Defaults to: undefined + * @type Sichtfreigabe + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + sichtfreigabe?: Sichtfreigabe; } export interface PersonenApiPersonControllerFindPersonsRequest { - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof PersonenApipersonControllerFindPersons - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof PersonenApipersonControllerFindPersons - */ - limit?: number - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersons - */ - referrer?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersons - */ - familienname?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersons - */ - vorname?: string - /** - * - * Defaults to: 'nein' - * @type 'ja' | 'nein' - * @memberof PersonenApipersonControllerFindPersons - */ - sichtfreigabe?: 'ja' | 'nein' - /** - * List of Organisation ID used to filter for Persons. - * Defaults to: undefined - * @type Array<string> - * @memberof PersonenApipersonControllerFindPersons - */ - organisationIDs?: Array - /** - * List of Role ID used to filter for Persons. - * Defaults to: undefined - * @type Array<string> - * @memberof PersonenApipersonControllerFindPersons - */ - rolleIDs?: Array - /** - * Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerFindPersons - */ - suchFilter?: string - /** - * Order to sort by. - * Defaults to: undefined - * @type 'asc' | 'desc' - * @memberof PersonenApipersonControllerFindPersons - */ - sortOrder?: 'asc' | 'desc' - /** - * Field to sort by. - * Defaults to: undefined - * @type 'familienname' | 'vorname' | 'personalnummer' | 'referrer' - * @memberof PersonenApipersonControllerFindPersons - */ - sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer' + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersons + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersons + */ + limit?: number; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + referrer?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + familienname?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + vorname?: string; + /** + * + * Defaults to: 'nein' + * @type 'ja' | 'nein' + * @memberof PersonenApipersonControllerFindPersons + */ + sichtfreigabe?: "ja" | "nein"; + /** + * List of Organisation ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenApipersonControllerFindPersons + */ + organisationIDs?: Array; + /** + * List of Role ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenApipersonControllerFindPersons + */ + rolleIDs?: Array; + /** + * Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + suchFilter?: string; + /** + * Order to sort by. + * Defaults to: undefined + * @type 'asc' | 'desc' + * @memberof PersonenApipersonControllerFindPersons + */ + sortOrder?: "asc" | "desc"; + /** + * Field to sort by. + * Defaults to: undefined + * @type 'familienname' | 'vorname' | 'personalnummer' | 'referrer' + * @memberof PersonenApipersonControllerFindPersons + */ + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer"; } export interface PersonenApiPersonControllerLockPersonRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerLockPerson - */ - personId: string - /** - * - * @type LockUserBodyParams - * @memberof PersonenApipersonControllerLockPerson - */ - lockUserBodyParams: LockUserBodyParams + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerLockPerson + */ + personId: string; + /** + * + * @type LockUserBodyParams + * @memberof PersonenApipersonControllerLockPerson + */ + lockUserBodyParams: LockUserBodyParams; } export interface PersonenApiPersonControllerResetPasswordByPersonIdRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerResetPasswordByPersonId - */ - personId: string + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerResetPasswordByPersonId + */ + personId: string; } export interface PersonenApiPersonControllerSyncPersonRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerSyncPerson - */ - personId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerSyncPerson + */ + personId: string; } export interface PersonenApiPersonControllerUpdateMetadataRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerUpdateMetadata - */ - personId: string - /** - * - * @type PersonMetadataBodyParams - * @memberof PersonenApipersonControllerUpdateMetadata - */ - personMetadataBodyParams: PersonMetadataBodyParams + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerUpdateMetadata + */ + personId: string; + /** + * + * @type PersonMetadataBodyParams + * @memberof PersonenApipersonControllerUpdateMetadata + */ + personMetadataBodyParams: PersonMetadataBodyParams; } export interface PersonenApiPersonControllerUpdatePersonRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenApipersonControllerUpdatePerson - */ - personId: string - /** - * - * @type UpdatePersonBodyParams - * @memberof PersonenApipersonControllerUpdatePerson - */ - updatePersonBodyParams: UpdatePersonBodyParams + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerUpdatePerson + */ + personId: string; + /** + * + * @type UpdatePersonBodyParams + * @memberof PersonenApipersonControllerUpdatePerson + */ + updatePersonBodyParams: UpdatePersonBodyParams; } export class ObjectPersonenApi { - private api: ObservablePersonenApi - - public constructor(configuration: Configuration, requestFactory?: PersonenApiRequestFactory, responseProcessor?: PersonenApiResponseProcessor) { - this.api = new ObservablePersonenApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public personControllerCreatePersonMigrationWithHttpInfo(param: PersonenApiPersonControllerCreatePersonMigrationRequest, options?: Configuration): Promise> { - return this.api.personControllerCreatePersonMigrationWithHttpInfo(param.createPersonMigrationBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerCreatePersonMigration(param: PersonenApiPersonControllerCreatePersonMigrationRequest, options?: Configuration): Promise { - return this.api.personControllerCreatePersonMigration(param.createPersonMigrationBodyParams, options).toPromise(); - } - - /** - * - * @param param the request object - */ - public personControllerCreatePersonenkontextWithHttpInfo(param: PersonenApiPersonControllerCreatePersonenkontextRequest, options?: Configuration): Promise> { - return this.api.personControllerCreatePersonenkontextWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * - * @param param the request object - */ - public personControllerCreatePersonenkontext(param: PersonenApiPersonControllerCreatePersonenkontextRequest, options?: Configuration): Promise { - return this.api.personControllerCreatePersonenkontext(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerDeletePersonByIdWithHttpInfo(param: PersonenApiPersonControllerDeletePersonByIdRequest, options?: Configuration): Promise> { - return this.api.personControllerDeletePersonByIdWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerDeletePersonById(param: PersonenApiPersonControllerDeletePersonByIdRequest, options?: Configuration): Promise { - return this.api.personControllerDeletePersonById(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerFindPersonByIdWithHttpInfo(param: PersonenApiPersonControllerFindPersonByIdRequest, options?: Configuration): Promise> { - return this.api.personControllerFindPersonByIdWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerFindPersonById(param: PersonenApiPersonControllerFindPersonByIdRequest, options?: Configuration): Promise { - return this.api.personControllerFindPersonById(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerFindPersonenkontexteWithHttpInfo(param: PersonenApiPersonControllerFindPersonenkontexteRequest, options?: Configuration): Promise> { - return this.api.personControllerFindPersonenkontexteWithHttpInfo(param.personId, param.offset, param.limit, param.personId2, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerFindPersonenkontexte(param: PersonenApiPersonControllerFindPersonenkontexteRequest, options?: Configuration): Promise { - return this.api.personControllerFindPersonenkontexte(param.personId, param.offset, param.limit, param.personId2, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerFindPersonsWithHttpInfo(param: PersonenApiPersonControllerFindPersonsRequest = {}, options?: Configuration): Promise>> { - return this.api.personControllerFindPersonsWithHttpInfo(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerFindPersons(param: PersonenApiPersonControllerFindPersonsRequest = {}, options?: Configuration): Promise> { - return this.api.personControllerFindPersons(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerLockPersonWithHttpInfo(param: PersonenApiPersonControllerLockPersonRequest, options?: Configuration): Promise> { - return this.api.personControllerLockPersonWithHttpInfo(param.personId, param.lockUserBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerLockPerson(param: PersonenApiPersonControllerLockPersonRequest, options?: Configuration): Promise { - return this.api.personControllerLockPerson(param.personId, param.lockUserBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerResetPasswordByPersonIdWithHttpInfo(param: PersonenApiPersonControllerResetPasswordByPersonIdRequest, options?: Configuration): Promise> { - return this.api.personControllerResetPasswordByPersonIdWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerResetPasswordByPersonId(param: PersonenApiPersonControllerResetPasswordByPersonIdRequest, options?: Configuration): Promise { - return this.api.personControllerResetPasswordByPersonId(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerSyncPersonWithHttpInfo(param: PersonenApiPersonControllerSyncPersonRequest, options?: Configuration): Promise> { - return this.api.personControllerSyncPersonWithHttpInfo(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerSyncPerson(param: PersonenApiPersonControllerSyncPersonRequest, options?: Configuration): Promise { - return this.api.personControllerSyncPerson(param.personId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerUpdateMetadataWithHttpInfo(param: PersonenApiPersonControllerUpdateMetadataRequest, options?: Configuration): Promise> { - return this.api.personControllerUpdateMetadataWithHttpInfo(param.personId, param.personMetadataBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerUpdateMetadata(param: PersonenApiPersonControllerUpdateMetadataRequest, options?: Configuration): Promise { - return this.api.personControllerUpdateMetadata(param.personId, param.personMetadataBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerUpdatePersonWithHttpInfo(param: PersonenApiPersonControllerUpdatePersonRequest, options?: Configuration): Promise> { - return this.api.personControllerUpdatePersonWithHttpInfo(param.personId, param.updatePersonBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personControllerUpdatePerson(param: PersonenApiPersonControllerUpdatePersonRequest, options?: Configuration): Promise { - return this.api.personControllerUpdatePerson(param.personId, param.updatePersonBodyParams, options).toPromise(); - } - + private api: ObservablePersonenApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenApiRequestFactory, + responseProcessor?: PersonenApiResponseProcessor, + ) { + this.api = new ObservablePersonenApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public personControllerCreatePersonMigrationWithHttpInfo( + param: PersonenApiPersonControllerCreatePersonMigrationRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerCreatePersonMigrationWithHttpInfo( + param.createPersonMigrationBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerCreatePersonMigration( + param: PersonenApiPersonControllerCreatePersonMigrationRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerCreatePersonMigration( + param.createPersonMigrationBodyParams, + options, + ) + .toPromise(); + } + + /** + * + * @param param the request object + */ + public personControllerCreatePersonenkontextWithHttpInfo( + param: PersonenApiPersonControllerCreatePersonenkontextRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerCreatePersonenkontextWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * + * @param param the request object + */ + public personControllerCreatePersonenkontext( + param: PersonenApiPersonControllerCreatePersonenkontextRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerCreatePersonenkontext(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerDeletePersonByIdWithHttpInfo( + param: PersonenApiPersonControllerDeletePersonByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerDeletePersonByIdWithHttpInfo(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerDeletePersonById( + param: PersonenApiPersonControllerDeletePersonByIdRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerDeletePersonById(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonByIdWithHttpInfo( + param: PersonenApiPersonControllerFindPersonByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerFindPersonByIdWithHttpInfo(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonById( + param: PersonenApiPersonControllerFindPersonByIdRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerFindPersonById(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonenkontexteWithHttpInfo( + param: PersonenApiPersonControllerFindPersonenkontexteRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerFindPersonenkontexteWithHttpInfo( + param.personId, + param.offset, + param.limit, + param.personId2, + param.referrer, + param.personenstatus, + param.sichtfreigabe, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonenkontexte( + param: PersonenApiPersonControllerFindPersonenkontexteRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerFindPersonenkontexte( + param.personId, + param.offset, + param.limit, + param.personId2, + param.referrer, + param.personenstatus, + param.sichtfreigabe, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonsWithHttpInfo( + param: PersonenApiPersonControllerFindPersonsRequest = {}, + options?: Configuration, + ): Promise>> { + return this.api + .personControllerFindPersonsWithHttpInfo( + param.offset, + param.limit, + param.referrer, + param.familienname, + param.vorname, + param.sichtfreigabe, + param.organisationIDs, + param.rolleIDs, + param.suchFilter, + param.sortOrder, + param.sortField, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersons( + param: PersonenApiPersonControllerFindPersonsRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .personControllerFindPersons( + param.offset, + param.limit, + param.referrer, + param.familienname, + param.vorname, + param.sichtfreigabe, + param.organisationIDs, + param.rolleIDs, + param.suchFilter, + param.sortOrder, + param.sortField, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerLockPersonWithHttpInfo( + param: PersonenApiPersonControllerLockPersonRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerLockPersonWithHttpInfo( + param.personId, + param.lockUserBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerLockPerson( + param: PersonenApiPersonControllerLockPersonRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerLockPerson( + param.personId, + param.lockUserBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerResetPasswordByPersonIdWithHttpInfo( + param: PersonenApiPersonControllerResetPasswordByPersonIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerResetPasswordByPersonIdWithHttpInfo( + param.personId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerResetPasswordByPersonId( + param: PersonenApiPersonControllerResetPasswordByPersonIdRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerResetPasswordByPersonId(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerSyncPersonWithHttpInfo( + param: PersonenApiPersonControllerSyncPersonRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerSyncPersonWithHttpInfo(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerSyncPerson( + param: PersonenApiPersonControllerSyncPersonRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerSyncPerson(param.personId, options) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdateMetadataWithHttpInfo( + param: PersonenApiPersonControllerUpdateMetadataRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerUpdateMetadataWithHttpInfo( + param.personId, + param.personMetadataBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdateMetadata( + param: PersonenApiPersonControllerUpdateMetadataRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerUpdateMetadata( + param.personId, + param.personMetadataBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdatePersonWithHttpInfo( + param: PersonenApiPersonControllerUpdatePersonRequest, + options?: Configuration, + ): Promise> { + return this.api + .personControllerUpdatePersonWithHttpInfo( + param.personId, + param.updatePersonBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdatePerson( + param: PersonenApiPersonControllerUpdatePersonRequest, + options?: Configuration, + ): Promise { + return this.api + .personControllerUpdatePerson( + param.personId, + param.updatePersonBodyParams, + options, + ) + .toPromise(); + } } import { ObservablePersonenFrontendApi } from "./ObservableAPI.ts"; -import { PersonenFrontendApiRequestFactory, PersonenFrontendApiResponseProcessor} from "../apis/PersonenFrontendApi.ts"; +import { + PersonenFrontendApiRequestFactory, + PersonenFrontendApiResponseProcessor, +} from "../apis/PersonenFrontendApi.ts"; export interface PersonenFrontendApiPersonFrontendControllerFindPersonsRequest { - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - limit?: number - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - referrer?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - familienname?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - vorname?: string - /** - * - * Defaults to: 'nein' - * @type 'ja' | 'nein' - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - sichtfreigabe?: 'ja' | 'nein' - /** - * List of Organisation ID used to filter for Persons. - * Defaults to: undefined - * @type Array<string> - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - organisationIDs?: Array - /** - * List of Role ID used to filter for Persons. - * Defaults to: undefined - * @type Array<string> - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - rolleIDs?: Array - /** - * Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * Defaults to: undefined - * @type string - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - suchFilter?: string - /** - * Order to sort by. - * Defaults to: undefined - * @type 'asc' | 'desc' - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - sortOrder?: 'asc' | 'desc' - /** - * Field to sort by. - * Defaults to: undefined - * @type 'familienname' | 'vorname' | 'personalnummer' | 'referrer' - * @memberof PersonenFrontendApipersonFrontendControllerFindPersons - */ - sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer' + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + limit?: number; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + referrer?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + familienname?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + vorname?: string; + /** + * + * Defaults to: 'nein' + * @type 'ja' | 'nein' + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + sichtfreigabe?: "ja" | "nein"; + /** + * List of Organisation ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + organisationIDs?: Array; + /** + * List of Role ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + rolleIDs?: Array; + /** + * Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + suchFilter?: string; + /** + * Order to sort by. + * Defaults to: undefined + * @type 'asc' | 'desc' + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + sortOrder?: "asc" | "desc"; + /** + * Field to sort by. + * Defaults to: undefined + * @type 'familienname' | 'vorname' | 'personalnummer' | 'referrer' + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer"; } export class ObjectPersonenFrontendApi { - private api: ObservablePersonenFrontendApi - - public constructor(configuration: Configuration, requestFactory?: PersonenFrontendApiRequestFactory, responseProcessor?: PersonenFrontendApiResponseProcessor) { - this.api = new ObservablePersonenFrontendApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public personFrontendControllerFindPersonsWithHttpInfo(param: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = {}, options?: Configuration): Promise> { - return this.api.personFrontendControllerFindPersonsWithHttpInfo(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); - } - - /** - * @param param the request object - */ - public personFrontendControllerFindPersons(param: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = {}, options?: Configuration): Promise { - return this.api.personFrontendControllerFindPersons(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); - } - + private api: ObservablePersonenFrontendApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenFrontendApiRequestFactory, + responseProcessor?: PersonenFrontendApiResponseProcessor, + ) { + this.api = new ObservablePersonenFrontendApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public personFrontendControllerFindPersonsWithHttpInfo( + param: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .personFrontendControllerFindPersonsWithHttpInfo( + param.offset, + param.limit, + param.referrer, + param.familienname, + param.vorname, + param.sichtfreigabe, + param.organisationIDs, + param.rolleIDs, + param.suchFilter, + param.sortOrder, + param.sortField, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personFrontendControllerFindPersons( + param: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .personFrontendControllerFindPersons( + param.offset, + param.limit, + param.referrer, + param.familienname, + param.vorname, + param.sichtfreigabe, + param.organisationIDs, + param.rolleIDs, + param.suchFilter, + param.sortOrder, + param.sortField, + options, + ) + .toPromise(); + } } import { ObservablePersonenkontextApi } from "./ObservableAPI.ts"; -import { PersonenkontextApiRequestFactory, PersonenkontextApiResponseProcessor} from "../apis/PersonenkontextApi.ts"; +import { + PersonenkontextApiRequestFactory, + PersonenkontextApiResponseProcessor, +} from "../apis/PersonenkontextApi.ts"; export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest { - /** - * The ID for the person. - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit - */ - personId: string - /** - * - * @type DbiamUpdatePersonenkontexteBodyParams - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit - */ - dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit - */ - personalnummer?: string + /** + * The ID for the person. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit + */ + personId: string; + /** + * + * @type DbiamUpdatePersonenkontexteBodyParams + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit + */ + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit + */ + personalnummer?: string; } export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest { - /** - * - * @type DbiamCreatePersonWithPersonenkontexteBodyParams - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte - */ - dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams + /** + * + * @type DbiamCreatePersonWithPersonenkontexteBodyParams + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte + */ + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams; } export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest { - /** - * RolleId used to filter for schulstrukturknoten in personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten - */ - rolleId: string - /** - * Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten - */ - sskName?: string - /** - * The limit of items for the request. - * Defaults to: undefined - * @type number - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten - */ - limit?: number + /** + * RolleId used to filter for schulstrukturknoten in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + */ + rolleId: string; + /** + * Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + */ + sskName?: string; + /** + * The limit of items for the request. + * Defaults to: undefined + * @type number + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + */ + limit?: number; } export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest { - /** - * ID of the organisation to filter the rollen later - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep - */ - organisationId?: string - /** - * ID of the rolle. - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep - */ - rolleId?: string - /** - * Rolle name used to filter for rollen in personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep - */ - rolleName?: string - /** - * Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep - */ - organisationName?: string - /** - * The limit of items for the request. - * Defaults to: undefined - * @type number - * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep - */ - limit?: number + /** + * ID of the organisation to filter the rollen later + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + organisationId?: string; + /** + * ID of the rolle. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + rolleId?: string; + /** + * Rolle name used to filter for rollen in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + rolleName?: string; + /** + * Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + organisationName?: string; + /** + * The limit of items for the request. + * Defaults to: undefined + * @type number + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + limit?: number; } export class ObjectPersonenkontextApi { - private api: ObservablePersonenkontextApi - - public constructor(configuration: Configuration, requestFactory?: PersonenkontextApiRequestFactory, responseProcessor?: PersonenkontextApiResponseProcessor) { - this.api = new ObservablePersonenkontextApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest, options?: Configuration): Promise> { - return this.api.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(param.personId, param.dbiamUpdatePersonenkontexteBodyParams, param.personalnummer, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerCommit(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest, options?: Configuration): Promise { - return this.api.dbiamPersonenkontextWorkflowControllerCommit(param.personId, param.dbiamUpdatePersonenkontexteBodyParams, param.personalnummer, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest, options?: Configuration): Promise> { - return this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(param.dbiamCreatePersonWithPersonenkontexteBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest, options?: Configuration): Promise { - return this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(param.dbiamCreatePersonWithPersonenkontexteBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest, options?: Configuration): Promise> { - return this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(param.rolleId, param.sskName, param.limit, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest, options?: Configuration): Promise { - return this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(param.rolleId, param.sskName, param.limit, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = {}, options?: Configuration): Promise> { - return this.api.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(param.organisationId, param.rolleId, param.rolleName, param.organisationName, param.limit, options).toPromise(); - } - - /** - * @param param the request object - */ - public dbiamPersonenkontextWorkflowControllerProcessStep(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = {}, options?: Configuration): Promise { - return this.api.dbiamPersonenkontextWorkflowControllerProcessStep(param.organisationId, param.rolleId, param.rolleName, param.organisationName, param.limit, options).toPromise(); - } - + private api: ObservablePersonenkontextApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontextApiRequestFactory, + responseProcessor?: PersonenkontextApiResponseProcessor, + ) { + this.api = new ObservablePersonenkontextApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest, + options?: Configuration, + ): Promise> { + return this.api + .dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + param.personId, + param.dbiamUpdatePersonenkontexteBodyParams, + param.personalnummer, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCommit( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest, + options?: Configuration, + ): Promise { + return this.api + .dbiamPersonenkontextWorkflowControllerCommit( + param.personId, + param.dbiamUpdatePersonenkontexteBodyParams, + param.personalnummer, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest, + options?: Configuration, + ): Promise> { + return this.api + .dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + param.dbiamCreatePersonWithPersonenkontexteBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest, + options?: Configuration, + ): Promise { + return this.api + .dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + param.dbiamCreatePersonWithPersonenkontexteBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest, + options?: Configuration, + ): Promise> { + return this.api + .dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + param.rolleId, + param.sskName, + param.limit, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest, + options?: Configuration, + ): Promise { + return this.api + .dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + param.rolleId, + param.sskName, + param.limit, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + param.organisationId, + param.rolleId, + param.rolleName, + param.organisationName, + param.limit, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerProcessStep( + param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = {}, + options?: Configuration, + ): Promise { + return this.api + .dbiamPersonenkontextWorkflowControllerProcessStep( + param.organisationId, + param.rolleId, + param.rolleName, + param.organisationName, + param.limit, + options, + ) + .toPromise(); + } } import { ObservablePersonenkontexteApi } from "./ObservableAPI.ts"; -import { PersonenkontexteApiRequestFactory, PersonenkontexteApiResponseProcessor} from "../apis/PersonenkontexteApi.ts"; +import { + PersonenkontexteApiRequestFactory, + PersonenkontexteApiResponseProcessor, +} from "../apis/PersonenkontexteApi.ts"; export interface PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest { - /** - * The id for the personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonenkontexteApipersonenkontextControllerDeletePersonenkontextById - */ - personenkontextId: string - /** - * - * @type DeleteRevisionBodyParams - * @memberof PersonenkontexteApipersonenkontextControllerDeletePersonenkontextById - */ - deleteRevisionBodyParams: DeleteRevisionBodyParams + /** + * The id for the personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerDeletePersonenkontextById + */ + personenkontextId: string; + /** + * + * @type DeleteRevisionBodyParams + * @memberof PersonenkontexteApipersonenkontextControllerDeletePersonenkontextById + */ + deleteRevisionBodyParams: DeleteRevisionBodyParams; } export interface PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest { - /** - * The id for the personenkontext. - * Defaults to: undefined - * @type string - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontextById - */ - personenkontextId: string + /** + * The id for the personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontextById + */ + personenkontextId: string; } export interface PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest { - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte - */ - limit?: number - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte - */ - personId?: string - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte - */ - referrer?: string - /** - * - * Defaults to: undefined - * @type Personenstatus - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte - */ - personenstatus?: Personenstatus - /** - * - * Defaults to: undefined - * @type Sichtfreigabe - * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte - */ - sichtfreigabe?: Sichtfreigabe + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + limit?: number; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + personId?: string; + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + referrer?: string; + /** + * + * Defaults to: undefined + * @type Personenstatus + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + personenstatus?: Personenstatus; + /** + * + * Defaults to: undefined + * @type Sichtfreigabe + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + sichtfreigabe?: Sichtfreigabe; } export interface PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest { - /** - * The id for the account. - * Defaults to: undefined - * @type string - * @memberof PersonenkontexteApipersonenkontextControllerHatSystemRecht - */ - personId: string - /** - * - * Defaults to: undefined - * @type RollenSystemRecht - * @memberof PersonenkontexteApipersonenkontextControllerHatSystemRecht - */ - systemRecht: RollenSystemRecht + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerHatSystemRecht + */ + personId: string; + /** + * + * Defaults to: undefined + * @type RollenSystemRecht + * @memberof PersonenkontexteApipersonenkontextControllerHatSystemRecht + */ + systemRecht: RollenSystemRecht; } export interface PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest { - /** - * - * Defaults to: undefined - * @type string - * @memberof PersonenkontexteApipersonenkontextControllerUpdatePersonenkontextWithId - */ - personenkontextId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerUpdatePersonenkontextWithId + */ + personenkontextId: string; } export class ObjectPersonenkontexteApi { - private api: ObservablePersonenkontexteApi - - public constructor(configuration: Configuration, requestFactory?: PersonenkontexteApiRequestFactory, responseProcessor?: PersonenkontexteApiResponseProcessor) { - this.api = new ObservablePersonenkontexteApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest, options?: Configuration): Promise> { - return this.api.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(param.personenkontextId, param.deleteRevisionBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerDeletePersonenkontextById(param: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest, options?: Configuration): Promise { - return this.api.personenkontextControllerDeletePersonenkontextById(param.personenkontextId, param.deleteRevisionBodyParams, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerFindPersonenkontextByIdWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest, options?: Configuration): Promise> { - return this.api.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(param.personenkontextId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerFindPersonenkontextById(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest, options?: Configuration): Promise { - return this.api.personenkontextControllerFindPersonenkontextById(param.personenkontextId, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerFindPersonenkontexteWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = {}, options?: Configuration): Promise>> { - return this.api.personenkontextControllerFindPersonenkontexteWithHttpInfo(param.offset, param.limit, param.personId, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerFindPersonenkontexte(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = {}, options?: Configuration): Promise> { - return this.api.personenkontextControllerFindPersonenkontexte(param.offset, param.limit, param.personId, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerHatSystemRechtWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest, options?: Configuration): Promise> { - return this.api.personenkontextControllerHatSystemRechtWithHttpInfo(param.personId, param.systemRecht, options).toPromise(); - } - - /** - * @param param the request object - */ - public personenkontextControllerHatSystemRecht(param: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest, options?: Configuration): Promise { - return this.api.personenkontextControllerHatSystemRecht(param.personId, param.systemRecht, options).toPromise(); - } - - /** - * - * @param param the request object - */ - public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest, options?: Configuration): Promise> { - return this.api.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(param.personenkontextId, options).toPromise(); - } - - /** - * - * @param param the request object - */ - public personenkontextControllerUpdatePersonenkontextWithId(param: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest, options?: Configuration): Promise { - return this.api.personenkontextControllerUpdatePersonenkontextWithId(param.personenkontextId, options).toPromise(); - } - + private api: ObservablePersonenkontexteApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontexteApiRequestFactory, + responseProcessor?: PersonenkontexteApiResponseProcessor, + ) { + this.api = new ObservablePersonenkontexteApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + param: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + param.personenkontextId, + param.deleteRevisionBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerDeletePersonenkontextById( + param: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest, + options?: Configuration, + ): Promise { + return this.api + .personenkontextControllerDeletePersonenkontextById( + param.personenkontextId, + param.deleteRevisionBodyParams, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + param.personenkontextId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontextById( + param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest, + options?: Configuration, + ): Promise { + return this.api + .personenkontextControllerFindPersonenkontextById( + param.personenkontextId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontexteWithHttpInfo( + param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = {}, + options?: Configuration, + ): Promise>> { + return this.api + .personenkontextControllerFindPersonenkontexteWithHttpInfo( + param.offset, + param.limit, + param.personId, + param.referrer, + param.personenstatus, + param.sichtfreigabe, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontexte( + param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .personenkontextControllerFindPersonenkontexte( + param.offset, + param.limit, + param.personId, + param.referrer, + param.personenstatus, + param.sichtfreigabe, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerHatSystemRechtWithHttpInfo( + param: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest, + options?: Configuration, + ): Promise> { + return this.api + .personenkontextControllerHatSystemRechtWithHttpInfo( + param.personId, + param.systemRecht, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerHatSystemRecht( + param: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest, + options?: Configuration, + ): Promise { + return this.api + .personenkontextControllerHatSystemRecht( + param.personId, + param.systemRecht, + options, + ) + .toPromise(); + } + + /** + * + * @param param the request object + */ + public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + param: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + param.personenkontextId, + options, + ) + .toPromise(); + } + + /** + * + * @param param the request object + */ + public personenkontextControllerUpdatePersonenkontextWithId( + param: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest, + options?: Configuration, + ): Promise { + return this.api + .personenkontextControllerUpdatePersonenkontextWithId( + param.personenkontextId, + options, + ) + .toPromise(); + } } import { ObservableProviderApi } from "./ObservableAPI.ts"; -import { ProviderApiRequestFactory, ProviderApiResponseProcessor} from "../apis/ProviderApi.ts"; +import { + ProviderApiRequestFactory, + ProviderApiResponseProcessor, +} from "../apis/ProviderApi.ts"; -export interface ProviderApiProviderControllerGetAllServiceProvidersRequest { -} +export interface ProviderApiProviderControllerGetAllServiceProvidersRequest {} -export interface ProviderApiProviderControllerGetAvailableServiceProvidersRequest { -} +export interface ProviderApiProviderControllerGetAvailableServiceProvidersRequest {} export interface ProviderApiProviderControllerGetServiceProviderLogoRequest { - /** - * The id of the service provider - * Defaults to: undefined - * @type string - * @memberof ProviderApiproviderControllerGetServiceProviderLogo - */ - angebotId: string + /** + * The id of the service provider + * Defaults to: undefined + * @type string + * @memberof ProviderApiproviderControllerGetServiceProviderLogo + */ + angebotId: string; } export class ObjectProviderApi { - private api: ObservableProviderApi - - public constructor(configuration: Configuration, requestFactory?: ProviderApiRequestFactory, responseProcessor?: ProviderApiResponseProcessor) { - this.api = new ObservableProviderApi(configuration, requestFactory, responseProcessor); - } - - /** - * Get all service-providers. - * - * @param param the request object - */ - public providerControllerGetAllServiceProvidersWithHttpInfo(param: ProviderApiProviderControllerGetAllServiceProvidersRequest = {}, options?: Configuration): Promise>> { - return this.api.providerControllerGetAllServiceProvidersWithHttpInfo( options).toPromise(); - } - - /** - * Get all service-providers. - * - * @param param the request object - */ - public providerControllerGetAllServiceProviders(param: ProviderApiProviderControllerGetAllServiceProvidersRequest = {}, options?: Configuration): Promise> { - return this.api.providerControllerGetAllServiceProviders( options).toPromise(); - } - - /** - * Get service-providers available for logged-in user. - * - * @param param the request object - */ - public providerControllerGetAvailableServiceProvidersWithHttpInfo(param: ProviderApiProviderControllerGetAvailableServiceProvidersRequest = {}, options?: Configuration): Promise>> { - return this.api.providerControllerGetAvailableServiceProvidersWithHttpInfo( options).toPromise(); - } - - /** - * Get service-providers available for logged-in user. - * - * @param param the request object - */ - public providerControllerGetAvailableServiceProviders(param: ProviderApiProviderControllerGetAvailableServiceProvidersRequest = {}, options?: Configuration): Promise> { - return this.api.providerControllerGetAvailableServiceProviders( options).toPromise(); - } - - /** - * @param param the request object - */ - public providerControllerGetServiceProviderLogoWithHttpInfo(param: ProviderApiProviderControllerGetServiceProviderLogoRequest, options?: Configuration): Promise> { - return this.api.providerControllerGetServiceProviderLogoWithHttpInfo(param.angebotId, options).toPromise(); - } - - /** - * @param param the request object - */ - public providerControllerGetServiceProviderLogo(param: ProviderApiProviderControllerGetServiceProviderLogoRequest, options?: Configuration): Promise { - return this.api.providerControllerGetServiceProviderLogo(param.angebotId, options).toPromise(); - } - + private api: ObservableProviderApi; + + public constructor( + configuration: Configuration, + requestFactory?: ProviderApiRequestFactory, + responseProcessor?: ProviderApiResponseProcessor, + ) { + this.api = new ObservableProviderApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Get all service-providers. + * + * @param param the request object + */ + public providerControllerGetAllServiceProvidersWithHttpInfo( + param: ProviderApiProviderControllerGetAllServiceProvidersRequest = {}, + options?: Configuration, + ): Promise>> { + return this.api + .providerControllerGetAllServiceProvidersWithHttpInfo(options) + .toPromise(); + } + + /** + * Get all service-providers. + * + * @param param the request object + */ + public providerControllerGetAllServiceProviders( + param: ProviderApiProviderControllerGetAllServiceProvidersRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .providerControllerGetAllServiceProviders(options) + .toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + * @param param the request object + */ + public providerControllerGetAvailableServiceProvidersWithHttpInfo( + param: ProviderApiProviderControllerGetAvailableServiceProvidersRequest = {}, + options?: Configuration, + ): Promise>> { + return this.api + .providerControllerGetAvailableServiceProvidersWithHttpInfo(options) + .toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + * @param param the request object + */ + public providerControllerGetAvailableServiceProviders( + param: ProviderApiProviderControllerGetAvailableServiceProvidersRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .providerControllerGetAvailableServiceProviders(options) + .toPromise(); + } + + /** + * @param param the request object + */ + public providerControllerGetServiceProviderLogoWithHttpInfo( + param: ProviderApiProviderControllerGetServiceProviderLogoRequest, + options?: Configuration, + ): Promise> { + return this.api + .providerControllerGetServiceProviderLogoWithHttpInfo( + param.angebotId, + options, + ) + .toPromise(); + } + + /** + * @param param the request object + */ + public providerControllerGetServiceProviderLogo( + param: ProviderApiProviderControllerGetServiceProviderLogoRequest, + options?: Configuration, + ): Promise { + return this.api + .providerControllerGetServiceProviderLogo(param.angebotId, options) + .toPromise(); + } } import { ObservableRolleApi } from "./ObservableAPI.ts"; -import { RolleApiRequestFactory, RolleApiResponseProcessor} from "../apis/RolleApi.ts"; +import { + RolleApiRequestFactory, + RolleApiResponseProcessor, +} from "../apis/RolleApi.ts"; export interface RolleApiRolleControllerAddSystemRechtRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerAddSystemRecht - */ - rolleId: string - /** - * - * @type AddSystemrechtBodyParams - * @memberof RolleApirolleControllerAddSystemRecht - */ - addSystemrechtBodyParams: AddSystemrechtBodyParams + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerAddSystemRecht + */ + rolleId: string; + /** + * + * @type AddSystemrechtBodyParams + * @memberof RolleApirolleControllerAddSystemRecht + */ + addSystemrechtBodyParams: AddSystemrechtBodyParams; } export interface RolleApiRolleControllerCreateRolleRequest { - /** - * - * @type CreateRolleBodyParams - * @memberof RolleApirolleControllerCreateRolle - */ - createRolleBodyParams: CreateRolleBodyParams + /** + * + * @type CreateRolleBodyParams + * @memberof RolleApirolleControllerCreateRolle + */ + createRolleBodyParams: CreateRolleBodyParams; } export interface RolleApiRolleControllerDeleteRolleRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerDeleteRolle - */ - rolleId: string + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerDeleteRolle + */ + rolleId: string; } export interface RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerFindRolleByIdWithServiceProviders - */ - rolleId: string + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerFindRolleByIdWithServiceProviders + */ + rolleId: string; } export interface RolleApiRolleControllerFindRollenRequest { - /** - * The offset of the paginated list. - * Defaults to: undefined - * @type number - * @memberof RolleApirolleControllerFindRollen - */ - offset?: number - /** - * The requested limit for the page size. - * Defaults to: undefined - * @type number - * @memberof RolleApirolleControllerFindRollen - */ - limit?: number - /** - * The name for the role. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerFindRollen - */ - searchStr?: string + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof RolleApirolleControllerFindRollen + */ + offset?: number; + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof RolleApirolleControllerFindRollen + */ + limit?: number; + /** + * The name for the role. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerFindRollen + */ + searchStr?: string; } export interface RolleApiRolleControllerGetRolleServiceProviderIdsRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerGetRolleServiceProviderIds - */ - rolleId: string + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerGetRolleServiceProviderIds + */ + rolleId: string; } export interface RolleApiRolleControllerRemoveServiceProviderByIdRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerRemoveServiceProviderById - */ - rolleId: string - /** - * - * @type RolleServiceProviderBodyParams - * @memberof RolleApirolleControllerRemoveServiceProviderById - */ - rolleServiceProviderBodyParams: RolleServiceProviderBodyParams + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerRemoveServiceProviderById + */ + rolleId: string; + /** + * + * @type RolleServiceProviderBodyParams + * @memberof RolleApirolleControllerRemoveServiceProviderById + */ + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams; } export interface RolleApiRolleControllerUpdateRolleRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerUpdateRolle - */ - rolleId: string - /** - * - * @type UpdateRolleBodyParams - * @memberof RolleApirolleControllerUpdateRolle - */ - updateRolleBodyParams: UpdateRolleBodyParams + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerUpdateRolle + */ + rolleId: string; + /** + * + * @type UpdateRolleBodyParams + * @memberof RolleApirolleControllerUpdateRolle + */ + updateRolleBodyParams: UpdateRolleBodyParams; } export interface RolleApiRolleControllerUpdateServiceProvidersByIdRequest { - /** - * The id for the rolle. - * Defaults to: undefined - * @type string - * @memberof RolleApirolleControllerUpdateServiceProvidersById - */ - rolleId: string - /** - * - * @type RolleServiceProviderBodyParams - * @memberof RolleApirolleControllerUpdateServiceProvidersById - */ - rolleServiceProviderBodyParams: RolleServiceProviderBodyParams + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerUpdateServiceProvidersById + */ + rolleId: string; + /** + * + * @type RolleServiceProviderBodyParams + * @memberof RolleApirolleControllerUpdateServiceProvidersById + */ + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams; } export class ObjectRolleApi { - private api: ObservableRolleApi - - public constructor(configuration: Configuration, requestFactory?: RolleApiRequestFactory, responseProcessor?: RolleApiResponseProcessor) { - this.api = new ObservableRolleApi(configuration, requestFactory, responseProcessor); - } - - /** - * Add systemrecht to a rolle. - * - * @param param the request object - */ - public rolleControllerAddSystemRechtWithHttpInfo(param: RolleApiRolleControllerAddSystemRechtRequest, options?: Configuration): Promise> { - return this.api.rolleControllerAddSystemRechtWithHttpInfo(param.rolleId, param.addSystemrechtBodyParams, options).toPromise(); - } - - /** - * Add systemrecht to a rolle. - * - * @param param the request object - */ - public rolleControllerAddSystemRecht(param: RolleApiRolleControllerAddSystemRechtRequest, options?: Configuration): Promise { - return this.api.rolleControllerAddSystemRecht(param.rolleId, param.addSystemrechtBodyParams, options).toPromise(); - } - - /** - * Create a new rolle. - * - * @param param the request object - */ - public rolleControllerCreateRolleWithHttpInfo(param: RolleApiRolleControllerCreateRolleRequest, options?: Configuration): Promise> { - return this.api.rolleControllerCreateRolleWithHttpInfo(param.createRolleBodyParams, options).toPromise(); - } - - /** - * Create a new rolle. - * - * @param param the request object - */ - public rolleControllerCreateRolle(param: RolleApiRolleControllerCreateRolleRequest, options?: Configuration): Promise { - return this.api.rolleControllerCreateRolle(param.createRolleBodyParams, options).toPromise(); - } - - /** - * Delete a role by id. - * - * @param param the request object - */ - public rolleControllerDeleteRolleWithHttpInfo(param: RolleApiRolleControllerDeleteRolleRequest, options?: Configuration): Promise> { - return this.api.rolleControllerDeleteRolleWithHttpInfo(param.rolleId, options).toPromise(); - } - - /** - * Delete a role by id. - * - * @param param the request object - */ - public rolleControllerDeleteRolle(param: RolleApiRolleControllerDeleteRolleRequest, options?: Configuration): Promise { - return this.api.rolleControllerDeleteRolle(param.rolleId, options).toPromise(); - } - - /** - * Get rolle by id. - * - * @param param the request object - */ - public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(param: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest, options?: Configuration): Promise> { - return this.api.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(param.rolleId, options).toPromise(); - } - - /** - * Get rolle by id. - * - * @param param the request object - */ - public rolleControllerFindRolleByIdWithServiceProviders(param: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest, options?: Configuration): Promise { - return this.api.rolleControllerFindRolleByIdWithServiceProviders(param.rolleId, options).toPromise(); - } - - /** - * List all rollen. - * - * @param param the request object - */ - public rolleControllerFindRollenWithHttpInfo(param: RolleApiRolleControllerFindRollenRequest = {}, options?: Configuration): Promise>> { - return this.api.rolleControllerFindRollenWithHttpInfo(param.offset, param.limit, param.searchStr, options).toPromise(); - } - - /** - * List all rollen. - * - * @param param the request object - */ - public rolleControllerFindRollen(param: RolleApiRolleControllerFindRollenRequest = {}, options?: Configuration): Promise> { - return this.api.rolleControllerFindRollen(param.offset, param.limit, param.searchStr, options).toPromise(); - } - - /** - * Get service-providers for a rolle by its id. - * - * @param param the request object - */ - public rolleControllerGetRolleServiceProviderIdsWithHttpInfo(param: RolleApiRolleControllerGetRolleServiceProviderIdsRequest, options?: Configuration): Promise> { - return this.api.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(param.rolleId, options).toPromise(); - } - - /** - * Get service-providers for a rolle by its id. - * - * @param param the request object - */ - public rolleControllerGetRolleServiceProviderIds(param: RolleApiRolleControllerGetRolleServiceProviderIdsRequest, options?: Configuration): Promise { - return this.api.rolleControllerGetRolleServiceProviderIds(param.rolleId, options).toPromise(); - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param param the request object - */ - public rolleControllerRemoveServiceProviderByIdWithHttpInfo(param: RolleApiRolleControllerRemoveServiceProviderByIdRequest, options?: Configuration): Promise> { - return this.api.rolleControllerRemoveServiceProviderByIdWithHttpInfo(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param param the request object - */ - public rolleControllerRemoveServiceProviderById(param: RolleApiRolleControllerRemoveServiceProviderByIdRequest, options?: Configuration): Promise { - return this.api.rolleControllerRemoveServiceProviderById(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); - } - - /** - * Update rolle. - * - * @param param the request object - */ - public rolleControllerUpdateRolleWithHttpInfo(param: RolleApiRolleControllerUpdateRolleRequest, options?: Configuration): Promise> { - return this.api.rolleControllerUpdateRolleWithHttpInfo(param.rolleId, param.updateRolleBodyParams, options).toPromise(); - } - - /** - * Update rolle. - * - * @param param the request object - */ - public rolleControllerUpdateRolle(param: RolleApiRolleControllerUpdateRolleRequest, options?: Configuration): Promise { - return this.api.rolleControllerUpdateRolle(param.rolleId, param.updateRolleBodyParams, options).toPromise(); - } - - /** - * Add a service-provider to a rolle by id. - * - * @param param the request object - */ - public rolleControllerUpdateServiceProvidersByIdWithHttpInfo(param: RolleApiRolleControllerUpdateServiceProvidersByIdRequest, options?: Configuration): Promise>> { - return this.api.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); - } - - /** - * Add a service-provider to a rolle by id. - * - * @param param the request object - */ - public rolleControllerUpdateServiceProvidersById(param: RolleApiRolleControllerUpdateServiceProvidersByIdRequest, options?: Configuration): Promise> { - return this.api.rolleControllerUpdateServiceProvidersById(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); - } - + private api: ObservableRolleApi; + + public constructor( + configuration: Configuration, + requestFactory?: RolleApiRequestFactory, + responseProcessor?: RolleApiResponseProcessor, + ) { + this.api = new ObservableRolleApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Add systemrecht to a rolle. + * + * @param param the request object + */ + public rolleControllerAddSystemRechtWithHttpInfo( + param: RolleApiRolleControllerAddSystemRechtRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerAddSystemRechtWithHttpInfo( + param.rolleId, + param.addSystemrechtBodyParams, + options, + ) + .toPromise(); + } + + /** + * Add systemrecht to a rolle. + * + * @param param the request object + */ + public rolleControllerAddSystemRecht( + param: RolleApiRolleControllerAddSystemRechtRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerAddSystemRecht( + param.rolleId, + param.addSystemrechtBodyParams, + options, + ) + .toPromise(); + } + + /** + * Create a new rolle. + * + * @param param the request object + */ + public rolleControllerCreateRolleWithHttpInfo( + param: RolleApiRolleControllerCreateRolleRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerCreateRolleWithHttpInfo( + param.createRolleBodyParams, + options, + ) + .toPromise(); + } + + /** + * Create a new rolle. + * + * @param param the request object + */ + public rolleControllerCreateRolle( + param: RolleApiRolleControllerCreateRolleRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerCreateRolle(param.createRolleBodyParams, options) + .toPromise(); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public rolleControllerDeleteRolleWithHttpInfo( + param: RolleApiRolleControllerDeleteRolleRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerDeleteRolleWithHttpInfo(param.rolleId, options) + .toPromise(); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public rolleControllerDeleteRolle( + param: RolleApiRolleControllerDeleteRolleRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerDeleteRolle(param.rolleId, options) + .toPromise(); + } + + /** + * Get rolle by id. + * + * @param param the request object + */ + public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + param: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + param.rolleId, + options, + ) + .toPromise(); + } + + /** + * Get rolle by id. + * + * @param param the request object + */ + public rolleControllerFindRolleByIdWithServiceProviders( + param: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerFindRolleByIdWithServiceProviders(param.rolleId, options) + .toPromise(); + } + + /** + * List all rollen. + * + * @param param the request object + */ + public rolleControllerFindRollenWithHttpInfo( + param: RolleApiRolleControllerFindRollenRequest = {}, + options?: Configuration, + ): Promise>> { + return this.api + .rolleControllerFindRollenWithHttpInfo( + param.offset, + param.limit, + param.searchStr, + options, + ) + .toPromise(); + } + + /** + * List all rollen. + * + * @param param the request object + */ + public rolleControllerFindRollen( + param: RolleApiRolleControllerFindRollenRequest = {}, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerFindRollen( + param.offset, + param.limit, + param.searchStr, + options, + ) + .toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param param the request object + */ + public rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + param: RolleApiRolleControllerGetRolleServiceProviderIdsRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + param.rolleId, + options, + ) + .toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param param the request object + */ + public rolleControllerGetRolleServiceProviderIds( + param: RolleApiRolleControllerGetRolleServiceProviderIdsRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerGetRolleServiceProviderIds(param.rolleId, options) + .toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param param the request object + */ + public rolleControllerRemoveServiceProviderByIdWithHttpInfo( + param: RolleApiRolleControllerRemoveServiceProviderByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerRemoveServiceProviderByIdWithHttpInfo( + param.rolleId, + param.rolleServiceProviderBodyParams, + options, + ) + .toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param param the request object + */ + public rolleControllerRemoveServiceProviderById( + param: RolleApiRolleControllerRemoveServiceProviderByIdRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerRemoveServiceProviderById( + param.rolleId, + param.rolleServiceProviderBodyParams, + options, + ) + .toPromise(); + } + + /** + * Update rolle. + * + * @param param the request object + */ + public rolleControllerUpdateRolleWithHttpInfo( + param: RolleApiRolleControllerUpdateRolleRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerUpdateRolleWithHttpInfo( + param.rolleId, + param.updateRolleBodyParams, + options, + ) + .toPromise(); + } + + /** + * Update rolle. + * + * @param param the request object + */ + public rolleControllerUpdateRolle( + param: RolleApiRolleControllerUpdateRolleRequest, + options?: Configuration, + ): Promise { + return this.api + .rolleControllerUpdateRolle( + param.rolleId, + param.updateRolleBodyParams, + options, + ) + .toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param param the request object + */ + public rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + param: RolleApiRolleControllerUpdateServiceProvidersByIdRequest, + options?: Configuration, + ): Promise>> { + return this.api + .rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + param.rolleId, + param.rolleServiceProviderBodyParams, + options, + ) + .toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param param the request object + */ + public rolleControllerUpdateServiceProvidersById( + param: RolleApiRolleControllerUpdateServiceProvidersByIdRequest, + options?: Configuration, + ): Promise> { + return this.api + .rolleControllerUpdateServiceProvidersById( + param.rolleId, + param.rolleServiceProviderBodyParams, + options, + ) + .toPromise(); + } } import { ObservableStatusApi } from "./ObservableAPI.ts"; -import { StatusApiRequestFactory, StatusApiResponseProcessor} from "../apis/StatusApi.ts"; +import { + StatusApiRequestFactory, + StatusApiResponseProcessor, +} from "../apis/StatusApi.ts"; -export interface StatusApiStatusControllerGetStatusRequest { -} +export interface StatusApiStatusControllerGetStatusRequest {} export class ObjectStatusApi { - private api: ObservableStatusApi - - public constructor(configuration: Configuration, requestFactory?: StatusApiRequestFactory, responseProcessor?: StatusApiResponseProcessor) { - this.api = new ObservableStatusApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param param the request object - */ - public statusControllerGetStatusWithHttpInfo(param: StatusApiStatusControllerGetStatusRequest = {}, options?: Configuration): Promise> { - return this.api.statusControllerGetStatusWithHttpInfo( options).toPromise(); - } - - /** - * @param param the request object - */ - public statusControllerGetStatus(param: StatusApiStatusControllerGetStatusRequest = {}, options?: Configuration): Promise { - return this.api.statusControllerGetStatus( options).toPromise(); - } - + private api: ObservableStatusApi; + + public constructor( + configuration: Configuration, + requestFactory?: StatusApiRequestFactory, + responseProcessor?: StatusApiResponseProcessor, + ) { + this.api = new ObservableStatusApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param param the request object + */ + public statusControllerGetStatusWithHttpInfo( + param: StatusApiStatusControllerGetStatusRequest = {}, + options?: Configuration, + ): Promise> { + return this.api.statusControllerGetStatusWithHttpInfo(options).toPromise(); + } + + /** + * @param param the request object + */ + public statusControllerGetStatus( + param: StatusApiStatusControllerGetStatusRequest = {}, + options?: Configuration, + ): Promise { + return this.api.statusControllerGetStatus(options).toPromise(); + } } diff --git a/loadtest/api-client/generated/types/ObservableAPI.ts b/loadtest/api-client/generated/types/ObservableAPI.ts index 906831c..a1e5261 100644 --- a/loadtest/api-client/generated/types/ObservableAPI.ts +++ b/loadtest/api-client/generated/types/ObservableAPI.ts @@ -1,2623 +1,5047 @@ -import { ResponseContext, RequestContext, HttpFile, HttpInfo } from '../http/http.ts'; -import { Configuration} from '../configuration.ts' -import { Observable, of, from } from '../rxjsStub.ts'; -import {mergeMap, map} from '../rxjsStub.ts'; -import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; -import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; -import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; -import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; -import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; -import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; -import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; -import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; -import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; -import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; -import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; -import { DbiamImportError } from '../models/DbiamImportError.ts'; -import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; -import { DbiamPersonError } from '../models/DbiamPersonError.ts'; -import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; -import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; -import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; -import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; -import { DbiamRolleError } from '../models/DbiamRolleError.ts'; -import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; -import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; -import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; -import { FindRollenResponse } from '../models/FindRollenResponse.ts'; -import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; -import { Geschlecht } from '../models/Geschlecht.ts'; -import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; -import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; -import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; -import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; -import { LoeschungResponse } from '../models/LoeschungResponse.ts'; -import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; -import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; -import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; -import { Person } from '../models/Person.ts'; -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; -import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; -import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; -import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; -import { PersonIdResponse } from '../models/PersonIdResponse.ts'; -import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; -import { PersonLockResponse } from '../models/PersonLockResponse.ts'; -import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { PersonNameResponse } from '../models/PersonNameResponse.ts'; -import { PersonResponse } from '../models/PersonResponse.ts'; -import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; -import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; -import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; -import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; -import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; -import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; -import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; -import { Personenstatus } from '../models/Personenstatus.ts'; -import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; -import { RawPagedResponse } from '../models/RawPagedResponse.ts'; -import { RolleResponse } from '../models/RolleResponse.ts'; -import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; -import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; -import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; -import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; -import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; -import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; -import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; -import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; -import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; -import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; -import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; -import { TokenStateResponse } from '../models/TokenStateResponse.ts'; -import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; -import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; -import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; -import { UserLockParams } from '../models/UserLockParams.ts'; -import { UserinfoResponse } from '../models/UserinfoResponse.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; - -import { AuthApiRequestFactory, AuthApiResponseProcessor} from "../apis/AuthApi.ts"; +import { + ResponseContext, + RequestContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { Configuration } from "../configuration.ts"; +import { Observable, of, from } from "../rxjsStub.ts"; +import { mergeMap, map } from "../rxjsStub.ts"; +import { AddSystemrechtBodyParams } from "../models/AddSystemrechtBodyParams.ts"; +import { AssignHardwareTokenBodyParams } from "../models/AssignHardwareTokenBodyParams.ts"; +import { AssignHardwareTokenResponse } from "../models/AssignHardwareTokenResponse.ts"; +import { CreateOrganisationBodyParams } from "../models/CreateOrganisationBodyParams.ts"; +import { CreatePersonMigrationBodyParams } from "../models/CreatePersonMigrationBodyParams.ts"; +import { CreateRolleBodyParams } from "../models/CreateRolleBodyParams.ts"; +import { DBiamPersonResponse } from "../models/DBiamPersonResponse.ts"; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +import { DBiamPersonenuebersichtResponse } from "../models/DBiamPersonenuebersichtResponse.ts"; +import { DBiamPersonenzuordnungResponse } from "../models/DBiamPersonenzuordnungResponse.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DbiamCreatePersonenkontextBodyParams } from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +import { DbiamImportError } from "../models/DbiamImportError.ts"; +import { DbiamOrganisationError } from "../models/DbiamOrganisationError.ts"; +import { DbiamPersonError } from "../models/DbiamPersonError.ts"; +import { DbiamPersonenkontextBodyParams } from "../models/DbiamPersonenkontextBodyParams.ts"; +import { DbiamPersonenkontextError } from "../models/DbiamPersonenkontextError.ts"; +import { DbiamPersonenkontextMigrationBodyParams } from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; +import { DbiamPersonenkontexteUpdateError } from "../models/DbiamPersonenkontexteUpdateError.ts"; +import { DbiamRolleError } from "../models/DbiamRolleError.ts"; +import { DbiamUpdatePersonenkontexteBodyParams } from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +import { DeleteRevisionBodyParams } from "../models/DeleteRevisionBodyParams.ts"; +import { EmailAddressStatus } from "../models/EmailAddressStatus.ts"; +import { FindRollenResponse } from "../models/FindRollenResponse.ts"; +import { FindSchulstrukturknotenResponse } from "../models/FindSchulstrukturknotenResponse.ts"; +import { Geschlecht } from "../models/Geschlecht.ts"; +import { ImportDataItemResponse } from "../models/ImportDataItemResponse.ts"; +import { ImportUploadResponse } from "../models/ImportUploadResponse.ts"; +import { ImportvorgangByIdBodyParams } from "../models/ImportvorgangByIdBodyParams.ts"; +import { LockUserBodyParams } from "../models/LockUserBodyParams.ts"; +import { LoeschungResponse } from "../models/LoeschungResponse.ts"; +import { OrganisationByIdBodyParams } from "../models/OrganisationByIdBodyParams.ts"; +import { OrganisationByNameBodyParams } from "../models/OrganisationByNameBodyParams.ts"; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { OrganisationRootChildrenResponse } from "../models/OrganisationRootChildrenResponse.ts"; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { ParentOrganisationenResponse } from "../models/ParentOrganisationenResponse.ts"; +import { ParentOrganisationsByIdsBodyParams } from "../models/ParentOrganisationsByIdsBodyParams.ts"; +import { Person } from "../models/Person.ts"; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonBirthResponse } from "../models/PersonBirthResponse.ts"; +import { PersonControllerFindPersonenkontexte200Response } from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +import { PersonEmailResponse } from "../models/PersonEmailResponse.ts"; +import { PersonFrontendControllerFindPersons200Response } from "../models/PersonFrontendControllerFindPersons200Response.ts"; +import { PersonIdResponse } from "../models/PersonIdResponse.ts"; +import { PersonInfoResponse } from "../models/PersonInfoResponse.ts"; +import { PersonLockResponse } from "../models/PersonLockResponse.ts"; +import { PersonMetadataBodyParams } from "../models/PersonMetadataBodyParams.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { PersonNameResponse } from "../models/PersonNameResponse.ts"; +import { PersonResponse } from "../models/PersonResponse.ts"; +import { PersonResponseAutomapper } from "../models/PersonResponseAutomapper.ts"; +import { PersonendatensatzResponse } from "../models/PersonendatensatzResponse.ts"; +import { PersonendatensatzResponseAutomapper } from "../models/PersonendatensatzResponseAutomapper.ts"; +import { PersonenkontextMigrationRuntype } from "../models/PersonenkontextMigrationRuntype.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { PersonenkontextRolleFieldsResponse } from "../models/PersonenkontextRolleFieldsResponse.ts"; +import { PersonenkontextWorkflowResponse } from "../models/PersonenkontextWorkflowResponse.ts"; +import { PersonenkontextdatensatzResponse } from "../models/PersonenkontextdatensatzResponse.ts"; +import { PersonenkontexteUpdateResponse } from "../models/PersonenkontexteUpdateResponse.ts"; +import { Personenstatus } from "../models/Personenstatus.ts"; +import { PersonenuebersichtBodyParams } from "../models/PersonenuebersichtBodyParams.ts"; +import { RawPagedResponse } from "../models/RawPagedResponse.ts"; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { RolleServiceProviderBodyParams } from "../models/RolleServiceProviderBodyParams.ts"; +import { RolleServiceProviderResponse } from "../models/RolleServiceProviderResponse.ts"; +import { RolleWithServiceProvidersResponse } from "../models/RolleWithServiceProvidersResponse.ts"; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { RollenSystemRechtServiceProviderIDResponse } from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +import { ServiceProviderIdNameResponse } from "../models/ServiceProviderIdNameResponse.ts"; +import { ServiceProviderKategorie } from "../models/ServiceProviderKategorie.ts"; +import { ServiceProviderResponse } from "../models/ServiceProviderResponse.ts"; +import { ServiceProviderTarget } from "../models/ServiceProviderTarget.ts"; +import { Sichtfreigabe } from "../models/Sichtfreigabe.ts"; +import { SystemrechtResponse } from "../models/SystemrechtResponse.ts"; +import { TokenInitBodyParams } from "../models/TokenInitBodyParams.ts"; +import { TokenRequiredResponse } from "../models/TokenRequiredResponse.ts"; +import { TokenStateResponse } from "../models/TokenStateResponse.ts"; +import { TokenVerifyBodyParams } from "../models/TokenVerifyBodyParams.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { UpdateOrganisationBodyParams } from "../models/UpdateOrganisationBodyParams.ts"; +import { UpdatePersonBodyParams } from "../models/UpdatePersonBodyParams.ts"; +import { UpdateRolleBodyParams } from "../models/UpdateRolleBodyParams.ts"; +import { UserLockParams } from "../models/UserLockParams.ts"; +import { UserinfoResponse } from "../models/UserinfoResponse.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; + +import { + AuthApiRequestFactory, + AuthApiResponseProcessor, +} from "../apis/AuthApi.ts"; export class ObservableAuthApi { - private requestFactory: AuthApiRequestFactory; - private responseProcessor: AuthApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: AuthApiRequestFactory, - responseProcessor?: AuthApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new AuthApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new AuthApiResponseProcessor(); - } - - /** - * Info about logged in user. - */ - public authenticationControllerInfoWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.authenticationControllerInfo(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerInfoWithHttpInfo(rsp))); - })); - } - - /** - * Info about logged in user. - */ - public authenticationControllerInfo(_options?: Configuration): Observable { - return this.authenticationControllerInfoWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Used to start OIDC authentication. - * @param [redirectUrl] - */ - public authenticationControllerLoginWithHttpInfo(redirectUrl?: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.authenticationControllerLogin(redirectUrl, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerLoginWithHttpInfo(rsp))); - })); - } - - /** - * Used to start OIDC authentication. - * @param [redirectUrl] - */ - public authenticationControllerLogin(redirectUrl?: string, _options?: Configuration): Observable { - return this.authenticationControllerLoginWithHttpInfo(redirectUrl, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Used to log out the current user. - */ - public authenticationControllerLogoutWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.authenticationControllerLogout(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerLogoutWithHttpInfo(rsp))); - })); - } - - /** - * Used to log out the current user. - */ - public authenticationControllerLogout(_options?: Configuration): Observable { - return this.authenticationControllerLogoutWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Redirect to Keycloak password reset. - * @param redirectUrl - * @param loginHint - */ - public authenticationControllerResetPasswordWithHttpInfo(redirectUrl: string, loginHint: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.authenticationControllerResetPassword(redirectUrl, loginHint, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerResetPasswordWithHttpInfo(rsp))); - })); - } - - /** - * Redirect to Keycloak password reset. - * @param redirectUrl - * @param loginHint - */ - public authenticationControllerResetPassword(redirectUrl: string, loginHint: string, _options?: Configuration): Observable { - return this.authenticationControllerResetPasswordWithHttpInfo(redirectUrl, loginHint, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: AuthApiRequestFactory; + private responseProcessor: AuthApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: AuthApiRequestFactory, + responseProcessor?: AuthApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new AuthApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new AuthApiResponseProcessor(); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfoWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.authenticationControllerInfo(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.authenticationControllerInfoWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfo( + _options?: Configuration, + ): Observable { + return this.authenticationControllerInfoWithHttpInfo(_options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLoginWithHttpInfo( + redirectUrl?: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.authenticationControllerLogin(redirectUrl, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.authenticationControllerLoginWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLogin( + redirectUrl?: string, + _options?: Configuration, + ): Observable { + return this.authenticationControllerLoginWithHttpInfo( + redirectUrl, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogoutWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.authenticationControllerLogout(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.authenticationControllerLogoutWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogout( + _options?: Configuration, + ): Observable { + return this.authenticationControllerLogoutWithHttpInfo(_options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPasswordWithHttpInfo( + redirectUrl: string, + loginHint: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.authenticationControllerResetPassword( + redirectUrl, + loginHint, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.authenticationControllerResetPasswordWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPassword( + redirectUrl: string, + loginHint: string, + _options?: Configuration, + ): Observable { + return this.authenticationControllerResetPasswordWithHttpInfo( + redirectUrl, + loginHint, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } } -import { Class2FAApiRequestFactory, Class2FAApiResponseProcessor} from "../apis/Class2FAApi.ts"; +import { + Class2FAApiRequestFactory, + Class2FAApiResponseProcessor, +} from "../apis/Class2FAApi.ts"; export class ObservableClass2FAApi { - private requestFactory: Class2FAApiRequestFactory; - private responseProcessor: Class2FAApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: Class2FAApiRequestFactory, - responseProcessor?: Class2FAApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new Class2FAApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new Class2FAApiResponseProcessor(); - } - - /** - * @param assignHardwareTokenBodyParams - */ - public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(rsp))); - })); - } - - /** - * @param assignHardwareTokenBodyParams - */ - public privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Observable { - return this.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerGetTwoAuthState(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(rsp))); - })); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerGetTwoAuthState(personId: string, _options?: Configuration): Observable { - return this.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param tokenInitBodyParams - */ - public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(rsp))); - })); - } - - /** - * @param tokenInitBodyParams - */ - public privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Observable { - return this.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(rsp))); - })); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId: string, _options?: Configuration): Observable { - return this.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerResetToken(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(rsp))); - })); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerResetToken(personId: string, _options?: Configuration): Observable { - return this.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param tokenVerifyBodyParams - */ - public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(rsp))); - })); - } - - /** - * @param tokenVerifyBodyParams - */ - public privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Observable { - return this.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: Class2FAApiRequestFactory; + private responseProcessor: Class2FAApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: Class2FAApiRequestFactory, + responseProcessor?: Class2FAApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new Class2FAApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new Class2FAApiResponseProcessor(); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.privacyIdeaAdministrationControllerAssignHardwareToken( + assignHardwareTokenBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareToken( + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, + _options?: Configuration, + ): Observable { + return this.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + assignHardwareTokenBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.privacyIdeaAdministrationControllerGetTwoAuthState( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthState( + personId: string, + _options?: Configuration, + ): Observable { + return this.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + personId, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + tokenInitBodyParams: TokenInitBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.privacyIdeaAdministrationControllerInitializeSoftwareToken( + tokenInitBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareToken( + tokenInitBodyParams: TokenInitBodyParams, + _options?: Configuration, + ): Observable { + return this.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + tokenInitBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + personId: string, + _options?: Configuration, + ): Observable { + return this.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + personId, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.privacyIdeaAdministrationControllerResetToken( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetToken( + personId: string, + _options?: Configuration, + ): Observable { + return this.privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + personId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + tokenVerifyBodyParams: TokenVerifyBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.privacyIdeaAdministrationControllerVerifyToken( + tokenVerifyBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyToken( + tokenVerifyBodyParams: TokenVerifyBodyParams, + _options?: Configuration, + ): Observable { + return this.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + tokenVerifyBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } } -import { CronApiRequestFactory, CronApiResponseProcessor} from "../apis/CronApi.ts"; +import { + CronApiRequestFactory, + CronApiResponseProcessor, +} from "../apis/CronApi.ts"; export class ObservableCronApi { - private requestFactory: CronApiRequestFactory; - private responseProcessor: CronApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: CronApiRequestFactory, - responseProcessor?: CronApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new CronApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new CronApiResponseProcessor(); - } - - /** - */ - public cronControllerKoPersUserLockWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.cronControllerKoPersUserLock(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerKoPersUserLockWithHttpInfo(rsp))); - })); - } - - /** - */ - public cronControllerKoPersUserLock(_options?: Configuration): Observable { - return this.cronControllerKoPersUserLockWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - */ - public cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.cronControllerPersonWithoutOrgDelete(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerPersonWithoutOrgDeleteWithHttpInfo(rsp))); - })); - } - - /** - */ - public cronControllerPersonWithoutOrgDelete(_options?: Configuration): Observable { - return this.cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - */ - public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(rsp))); - })); - } - - /** - */ - public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options?: Configuration): Observable { - return this.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - */ - public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.cronControllerUnlockUsersWithExpiredLocks(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(rsp))); - })); - } - - /** - */ - public cronControllerUnlockUsersWithExpiredLocks(_options?: Configuration): Observable { - return this.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: CronApiRequestFactory; + private responseProcessor: CronApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: CronApiRequestFactory, + responseProcessor?: CronApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new CronApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new CronApiResponseProcessor(); + } + + /** + */ + public cronControllerKoPersUserLockWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.cronControllerKoPersUserLock(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.cronControllerKoPersUserLockWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + */ + public cronControllerKoPersUserLock( + _options?: Configuration, + ): Observable { + return this.cronControllerKoPersUserLockWithHttpInfo(_options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + */ + public cronControllerPersonWithoutOrgDeleteWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.cronControllerPersonWithoutOrgDelete(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.cronControllerPersonWithoutOrgDeleteWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + */ + public cronControllerPersonWithoutOrgDelete( + _options?: Configuration, + ): Observable { + return this.cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + _options?: Configuration, + ): Observable { + return this.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.cronControllerUnlockUsersWithExpiredLocks(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocks( + _options?: Configuration, + ): Observable { + return this.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } } -import { DbiamPersonenkontexteApiRequestFactory, DbiamPersonenkontexteApiResponseProcessor} from "../apis/DbiamPersonenkontexteApi.ts"; +import { + DbiamPersonenkontexteApiRequestFactory, + DbiamPersonenkontexteApiResponseProcessor, +} from "../apis/DbiamPersonenkontexteApi.ts"; export class ObservableDbiamPersonenkontexteApi { - private requestFactory: DbiamPersonenkontexteApiRequestFactory; - private responseProcessor: DbiamPersonenkontexteApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: DbiamPersonenkontexteApiRequestFactory, - responseProcessor?: DbiamPersonenkontexteApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new DbiamPersonenkontexteApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new DbiamPersonenkontexteApiResponseProcessor(); - } - - /** - * @param dbiamPersonenkontextMigrationBodyParams - */ - public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(rsp))); - })); - } - - /** - * @param dbiamPersonenkontextMigrationBodyParams - */ - public dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Observable { - return this.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId: string, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId: string, _options?: Configuration): Observable> { - return this.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - + private requestFactory: DbiamPersonenkontexteApiRequestFactory; + private responseProcessor: DbiamPersonenkontexteApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenkontexteApiRequestFactory, + responseProcessor?: DbiamPersonenkontexteApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || + new DbiamPersonenkontexteApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new DbiamPersonenkontexteApiResponseProcessor(); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.dBiamPersonenkontextControllerCreatePersonenkontextMigration( + dbiamPersonenkontextMigrationBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigration( + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, + _options?: Configuration, + ): Observable { + return this.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + dbiamPersonenkontextMigrationBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + personId: string, + _options?: Configuration, + ): Observable> { + return this.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + personId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } } -import { DbiamPersonenuebersichtApiRequestFactory, DbiamPersonenuebersichtApiResponseProcessor} from "../apis/DbiamPersonenuebersichtApi.ts"; +import { + DbiamPersonenuebersichtApiRequestFactory, + DbiamPersonenuebersichtApiResponseProcessor, +} from "../apis/DbiamPersonenuebersichtApi.ts"; export class ObservableDbiamPersonenuebersichtApi { - private requestFactory: DbiamPersonenuebersichtApiRequestFactory; - private responseProcessor: DbiamPersonenuebersichtApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: DbiamPersonenuebersichtApiRequestFactory, - responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new DbiamPersonenuebersichtApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new DbiamPersonenuebersichtApiResponseProcessor(); - } - - /** - * @param personenuebersichtBodyParams - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(rsp))); - })); - } - - /** - * @param personenuebersichtBodyParams - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Observable { - return this.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId: string, _options?: Configuration): Observable { - return this.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: DbiamPersonenuebersichtApiRequestFactory; + private responseProcessor: DbiamPersonenuebersichtApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenuebersichtApiRequestFactory, + responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || + new DbiamPersonenuebersichtApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new DbiamPersonenuebersichtApiResponseProcessor(); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + personenuebersichtBodyParams: PersonenuebersichtBodyParams, + _options?: Configuration, + ): Observable< + HttpInfo + > { + const requestContextPromise = + this.requestFactory.dBiamPersonenuebersichtControllerFindPersonenuebersichten( + personenuebersichtBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichten( + personenuebersichtBodyParams: PersonenuebersichtBodyParams, + _options?: Configuration, + ): Observable { + return this.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + personenuebersichtBodyParams, + _options, + ).pipe( + map( + ( + apiResponse: HttpInfo, + ) => apiResponse.data, + ), + ); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + personId: string, + _options?: Configuration, + ): Observable { + return this.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + personId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } } -import { ImportApiRequestFactory, ImportApiResponseProcessor} from "../apis/ImportApi.ts"; +import { + ImportApiRequestFactory, + ImportApiResponseProcessor, +} from "../apis/ImportApi.ts"; export class ObservableImportApi { - private requestFactory: ImportApiRequestFactory; - private responseProcessor: ImportApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: ImportApiRequestFactory, - responseProcessor?: ImportApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new ImportApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new ImportApiResponseProcessor(); - } - - /** - * Delete a role by id. - * - * @param importvorgangId The id of an import transaction - */ - public importControllerDeleteImportTransactionWithHttpInfo(importvorgangId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.importControllerDeleteImportTransaction(importvorgangId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.importControllerDeleteImportTransactionWithHttpInfo(rsp))); - })); - } - - /** - * Delete a role by id. - * - * @param importvorgangId The id of an import transaction - */ - public importControllerDeleteImportTransaction(importvorgangId: string, _options?: Configuration): Observable { - return this.importControllerDeleteImportTransactionWithHttpInfo(importvorgangId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param importvorgangByIdBodyParams - */ - public importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.importControllerExecuteImport(importvorgangByIdBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.importControllerExecuteImportWithHttpInfo(rsp))); - })); - } - - /** - * @param importvorgangByIdBodyParams - */ - public importControllerExecuteImport(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Observable { - return this.importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param organisationId - * @param rolleId - * @param file - */ - public importControllerUploadFileWithHttpInfo(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.importControllerUploadFile(organisationId, rolleId, file, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.importControllerUploadFileWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId - * @param rolleId - * @param file - */ - public importControllerUploadFile(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Observable { - return this.importControllerUploadFileWithHttpInfo(organisationId, rolleId, file, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: ImportApiRequestFactory; + private responseProcessor: ImportApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: ImportApiRequestFactory, + responseProcessor?: ImportApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new ImportApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new ImportApiResponseProcessor(); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransactionWithHttpInfo( + importvorgangId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.importControllerDeleteImportTransaction( + importvorgangId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.importControllerDeleteImportTransactionWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransaction( + importvorgangId: string, + _options?: Configuration, + ): Observable { + return this.importControllerDeleteImportTransactionWithHttpInfo( + importvorgangId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImportWithHttpInfo( + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.importControllerExecuteImport( + importvorgangByIdBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.importControllerExecuteImportWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImport( + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, + _options?: Configuration, + ): Observable { + return this.importControllerExecuteImportWithHttpInfo( + importvorgangByIdBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFileWithHttpInfo( + organisationId: string, + rolleId: string, + file: HttpFile, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.importControllerUploadFile( + organisationId, + rolleId, + file, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.importControllerUploadFileWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFile( + organisationId: string, + rolleId: string, + file: HttpFile, + _options?: Configuration, + ): Observable { + return this.importControllerUploadFileWithHttpInfo( + organisationId, + rolleId, + file, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } } -import { OrganisationenApiRequestFactory, OrganisationenApiResponseProcessor} from "../apis/OrganisationenApi.ts"; +import { + OrganisationenApiRequestFactory, + OrganisationenApiResponseProcessor, +} from "../apis/OrganisationenApi.ts"; export class ObservableOrganisationenApi { - private requestFactory: OrganisationenApiRequestFactory; - private responseProcessor: OrganisationenApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: OrganisationenApiRequestFactory, - responseProcessor?: OrganisationenApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new OrganisationenApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new OrganisationenApiResponseProcessor(); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerAddAdministrierteOrganisation(organisationId, organisationByIdBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerAddAdministrierteOrganisationWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddAdministrierteOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable { - return this.organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerAddZugehoerigeOrganisation(organisationId, organisationByIdBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddZugehoerigeOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable { - return this.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param createOrganisationBodyParams - */ - public organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerCreateOrganisation(createOrganisationBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerCreateOrganisationWithHttpInfo(rsp))); - })); - } - - /** - * @param createOrganisationBodyParams - */ - public organisationControllerCreateOrganisation(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Observable { - return this.organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param organisationId The id of an organization - */ - public organisationControllerDeleteKlasseWithHttpInfo(organisationId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerDeleteKlasse(organisationId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerDeleteKlasseWithHttpInfo(rsp))); - })); - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param organisationId The id of an organization - */ - public organisationControllerDeleteKlasse(organisationId: string, _options?: Configuration): Observable { - return this.organisationControllerDeleteKlasseWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerEnableForitslearningWithHttpInfo(organisationId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerEnableForitslearning(organisationId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerEnableForitslearningWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerEnableForitslearning(organisationId: string, _options?: Configuration): Observable { - return this.organisationControllerEnableForitslearningWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerFindOrganisationByIdWithHttpInfo(organisationId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerFindOrganisationById(organisationId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerFindOrganisationByIdWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerFindOrganisationById(organisationId: string, _options?: Configuration): Observable { - return this.organisationControllerFindOrganisationByIdWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [kennung] - * @param [name] - * @param [searchString] - * @param [typ] - * @param [systemrechte] - * @param [excludeTyp] - * @param [administriertVon] - * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). - */ - public organisationControllerFindOrganizationsWithHttpInfo(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.organisationControllerFindOrganizations(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerFindOrganizationsWithHttpInfo(rsp))); - })); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [kennung] - * @param [name] - * @param [searchString] - * @param [typ] - * @param [systemrechte] - * @param [excludeTyp] - * @param [administriertVon] - * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). - */ - public organisationControllerFindOrganizations(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Observable> { - return this.organisationControllerFindOrganizationsWithHttpInfo(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchFilter] - */ - public organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.organisationControllerGetAdministrierteOrganisationen(organisationId, offset, limit, searchFilter, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchFilter] - */ - public organisationControllerGetAdministrierteOrganisationen(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Observable> { - return this.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId, offset, limit, searchFilter, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * @param parentOrganisationsByIdsBodyParams - */ - public organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetParentsByIdsWithHttpInfo(rsp))); - })); - } - - /** - * @param parentOrganisationsByIdsBodyParams - */ - public organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Observable { - return this.organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - */ - public organisationControllerGetRootChildrenWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerGetRootChildren(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetRootChildrenWithHttpInfo(rsp))); - })); - } - - /** - */ - public organisationControllerGetRootChildren(_options?: Configuration): Observable { - return this.organisationControllerGetRootChildrenWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - */ - public organisationControllerGetRootOrganisationWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerGetRootOrganisation(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetRootOrganisationWithHttpInfo(rsp))); - })); - } - - /** - */ - public organisationControllerGetRootOrganisation(_options?: Configuration): Observable { - return this.organisationControllerGetRootOrganisationWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId: string, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.organisationControllerGetZugehoerigeOrganisationen(organisationId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerGetZugehoerigeOrganisationen(organisationId: string, _options?: Configuration): Observable> { - return this.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - * @param updateOrganisationBodyParams - */ - public organisationControllerUpdateOrganisationWithHttpInfo(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerUpdateOrganisation(organisationId, updateOrganisationBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerUpdateOrganisationWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - * @param updateOrganisationBodyParams - */ - public organisationControllerUpdateOrganisation(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Observable { - return this.organisationControllerUpdateOrganisationWithHttpInfo(organisationId, updateOrganisationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param organisationId The id of an organization - * @param organisationByNameBodyParams - */ - public organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.organisationControllerUpdateOrganisationName(organisationId, organisationByNameBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerUpdateOrganisationNameWithHttpInfo(rsp))); - })); - } - - /** - * @param organisationId The id of an organization - * @param organisationByNameBodyParams - */ - public organisationControllerUpdateOrganisationName(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Observable { - return this.organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId, organisationByNameBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: OrganisationenApiRequestFactory; + private responseProcessor: OrganisationenApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: OrganisationenApiRequestFactory, + responseProcessor?: OrganisationenApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new OrganisationenApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new OrganisationenApiResponseProcessor(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisationWithHttpInfo( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerAddAdministrierteOrganisation( + organisationId, + organisationByIdBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerAddAdministrierteOrganisationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisation( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Observable { + return this.organisationControllerAddAdministrierteOrganisationWithHttpInfo( + organisationId, + organisationByIdBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerAddZugehoerigeOrganisation( + organisationId, + organisationByIdBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisation( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Observable { + return this.organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + organisationId, + organisationByIdBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisationWithHttpInfo( + createOrganisationBodyParams: CreateOrganisationBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerCreateOrganisation( + createOrganisationBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerCreateOrganisationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisation( + createOrganisationBodyParams: CreateOrganisationBodyParams, + _options?: Configuration, + ): Observable { + return this.organisationControllerCreateOrganisationWithHttpInfo( + createOrganisationBodyParams, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasseWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerDeleteKlasse( + organisationId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerDeleteKlasseWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasse( + organisationId: string, + _options?: Configuration, + ): Observable { + return this.organisationControllerDeleteKlasseWithHttpInfo( + organisationId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearningWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerEnableForitslearning( + organisationId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerEnableForitslearningWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearning( + organisationId: string, + _options?: Configuration, + ): Observable { + return this.organisationControllerEnableForitslearningWithHttpInfo( + organisationId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => apiResponse.data, + ), + ); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationByIdWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerFindOrganisationById( + organisationId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerFindOrganisationByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationById( + organisationId: string, + _options?: Configuration, + ): Observable { + return this.organisationControllerFindOrganisationByIdWithHttpInfo( + organisationId, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizationsWithHttpInfo( + offset?: number, + limit?: number, + kennung?: string, + name?: string, + searchString?: string, + typ?: OrganisationsTyp, + systemrechte?: Array, + excludeTyp?: Array, + administriertVon?: Array, + organisationIds?: Array, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.organisationControllerFindOrganizations( + offset, + limit, + kennung, + name, + searchString, + typ, + systemrechte, + excludeTyp, + administriertVon, + organisationIds, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerFindOrganizationsWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizations( + offset?: number, + limit?: number, + kennung?: string, + name?: string, + searchString?: string, + typ?: OrganisationsTyp, + systemrechte?: Array, + excludeTyp?: Array, + administriertVon?: Array, + organisationIds?: Array, + _options?: Configuration, + ): Observable> { + return this.organisationControllerFindOrganizationsWithHttpInfo( + offset, + limit, + kennung, + name, + searchString, + typ, + systemrechte, + excludeTyp, + administriertVon, + organisationIds, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + organisationId: string, + offset?: number, + limit?: number, + searchFilter?: string, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.organisationControllerGetAdministrierteOrganisationen( + organisationId, + offset, + limit, + searchFilter, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationen( + organisationId: string, + offset?: number, + limit?: number, + searchFilter?: string, + _options?: Configuration, + ): Observable> { + return this.organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + organisationId, + offset, + limit, + searchFilter, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIdsWithHttpInfo( + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerGetParentsByIds( + parentOrganisationsByIdsBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerGetParentsByIdsWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIds( + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, + _options?: Configuration, + ): Observable { + return this.organisationControllerGetParentsByIdsWithHttpInfo( + parentOrganisationsByIdsBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + */ + public organisationControllerGetRootChildrenWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerGetRootChildren(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerGetRootChildrenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + */ + public organisationControllerGetRootChildren( + _options?: Configuration, + ): Observable { + return this.organisationControllerGetRootChildrenWithHttpInfo( + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + */ + public organisationControllerGetRootOrganisationWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerGetRootOrganisation(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerGetRootOrganisationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + */ + public organisationControllerGetRootOrganisation( + _options?: Configuration, + ): Observable { + return this.organisationControllerGetRootOrganisationWithHttpInfo( + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.organisationControllerGetZugehoerigeOrganisationen( + organisationId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationen( + organisationId: string, + _options?: Configuration, + ): Observable> { + return this.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + organisationId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisationWithHttpInfo( + organisationId: string, + updateOrganisationBodyParams: UpdateOrganisationBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerUpdateOrganisation( + organisationId, + updateOrganisationBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerUpdateOrganisationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisation( + organisationId: string, + updateOrganisationBodyParams: UpdateOrganisationBodyParams, + _options?: Configuration, + ): Observable { + return this.organisationControllerUpdateOrganisationWithHttpInfo( + organisationId, + updateOrganisationBodyParams, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationNameWithHttpInfo( + organisationId: string, + organisationByNameBodyParams: OrganisationByNameBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.organisationControllerUpdateOrganisationName( + organisationId, + organisationByNameBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.organisationControllerUpdateOrganisationNameWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationName( + organisationId: string, + organisationByNameBodyParams: OrganisationByNameBodyParams, + _options?: Configuration, + ): Observable { + return this.organisationControllerUpdateOrganisationNameWithHttpInfo( + organisationId, + organisationByNameBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => apiResponse.data, + ), + ); + } } -import { PersonAdministrationApiRequestFactory, PersonAdministrationApiResponseProcessor} from "../apis/PersonAdministrationApi.ts"; +import { + PersonAdministrationApiRequestFactory, + PersonAdministrationApiResponseProcessor, +} from "../apis/PersonAdministrationApi.ts"; export class ObservablePersonAdministrationApi { - private requestFactory: PersonAdministrationApiRequestFactory; - private responseProcessor: PersonAdministrationApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: PersonAdministrationApiRequestFactory, - responseProcessor?: PersonAdministrationApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new PersonAdministrationApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new PersonAdministrationApiResponseProcessor(); - } - - /** - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [limit] The limit of items for the request. - */ - public personAdministrationControllerFindRollenWithHttpInfo(rolleName?: string, limit?: number, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personAdministrationControllerFindRollen(rolleName, limit, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personAdministrationControllerFindRollenWithHttpInfo(rsp))); - })); - } - - /** - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [limit] The limit of items for the request. - */ - public personAdministrationControllerFindRollen(rolleName?: string, limit?: number, _options?: Configuration): Observable { - return this.personAdministrationControllerFindRollenWithHttpInfo(rolleName, limit, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: PersonAdministrationApiRequestFactory; + private responseProcessor: PersonAdministrationApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonAdministrationApiRequestFactory, + responseProcessor?: PersonAdministrationApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || + new PersonAdministrationApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new PersonAdministrationApiResponseProcessor(); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollenWithHttpInfo( + rolleName?: string, + limit?: number, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personAdministrationControllerFindRollen( + rolleName, + limit, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personAdministrationControllerFindRollenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollen( + rolleName?: string, + limit?: number, + _options?: Configuration, + ): Observable { + return this.personAdministrationControllerFindRollenWithHttpInfo( + rolleName, + limit, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } } -import { PersonInfoApiRequestFactory, PersonInfoApiResponseProcessor} from "../apis/PersonInfoApi.ts"; +import { + PersonInfoApiRequestFactory, + PersonInfoApiResponseProcessor, +} from "../apis/PersonInfoApi.ts"; export class ObservablePersonInfoApi { - private requestFactory: PersonInfoApiRequestFactory; - private responseProcessor: PersonInfoApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: PersonInfoApiRequestFactory, - responseProcessor?: PersonInfoApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new PersonInfoApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new PersonInfoApiResponseProcessor(); - } - - /** - * Info about logged in person. - */ - public personInfoControllerInfoWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personInfoControllerInfo(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personInfoControllerInfoWithHttpInfo(rsp))); - })); - } - - /** - * Info about logged in person. - */ - public personInfoControllerInfo(_options?: Configuration): Observable { - return this.personInfoControllerInfoWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: PersonInfoApiRequestFactory; + private responseProcessor: PersonInfoApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonInfoApiRequestFactory, + responseProcessor?: PersonInfoApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new PersonInfoApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new PersonInfoApiResponseProcessor(); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfoWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personInfoControllerInfo(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personInfoControllerInfoWithHttpInfo(rsp), + ), + ); + }), + ); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfo( + _options?: Configuration, + ): Observable { + return this.personInfoControllerInfoWithHttpInfo(_options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } } -import { PersonenApiRequestFactory, PersonenApiResponseProcessor} from "../apis/PersonenApi.ts"; +import { + PersonenApiRequestFactory, + PersonenApiResponseProcessor, +} from "../apis/PersonenApi.ts"; export class ObservablePersonenApi { - private requestFactory: PersonenApiRequestFactory; - private responseProcessor: PersonenApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: PersonenApiRequestFactory, - responseProcessor?: PersonenApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new PersonenApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new PersonenApiResponseProcessor(); - } - - /** - * @param createPersonMigrationBodyParams - */ - public personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerCreatePersonMigration(createPersonMigrationBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerCreatePersonMigrationWithHttpInfo(rsp))); - })); - } - - /** - * @param createPersonMigrationBodyParams - */ - public personControllerCreatePersonMigration(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Observable { - return this.personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * - * @param personId - */ - public personControllerCreatePersonenkontextWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerCreatePersonenkontext(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerCreatePersonenkontextWithHttpInfo(rsp))); - })); - } - - /** - * - * @param personId - */ - public personControllerCreatePersonenkontext(personId: string, _options?: Configuration): Observable { - return this.personControllerCreatePersonenkontextWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - */ - public personControllerDeletePersonByIdWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerDeletePersonById(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerDeletePersonByIdWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - */ - public personControllerDeletePersonById(personId: string, _options?: Configuration): Observable { - return this.personControllerDeletePersonByIdWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - */ - public personControllerFindPersonByIdWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerFindPersonById(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerFindPersonByIdWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - */ - public personControllerFindPersonById(personId: string, _options?: Configuration): Observable { - return this.personControllerFindPersonByIdWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId2] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personControllerFindPersonenkontexteWithHttpInfo(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerFindPersonenkontexte(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerFindPersonenkontexteWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId2] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personControllerFindPersonenkontexte(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable { - return this.personControllerFindPersonenkontexteWithHttpInfo(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.personControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerFindPersonsWithHttpInfo(rsp))); - })); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable> { - return this.personControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * @param personId - * @param lockUserBodyParams - */ - public personControllerLockPersonWithHttpInfo(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerLockPerson(personId, lockUserBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerLockPersonWithHttpInfo(rsp))); - })); - } - - /** - * @param personId - * @param lockUserBodyParams - */ - public personControllerLockPerson(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Observable { - return this.personControllerLockPersonWithHttpInfo(personId, lockUserBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - */ - public personControllerResetPasswordByPersonIdWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerResetPasswordByPersonId(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerResetPasswordByPersonIdWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - */ - public personControllerResetPasswordByPersonId(personId: string, _options?: Configuration): Observable { - return this.personControllerResetPasswordByPersonIdWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId - */ - public personControllerSyncPersonWithHttpInfo(personId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerSyncPerson(personId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerSyncPersonWithHttpInfo(rsp))); - })); - } - - /** - * @param personId - */ - public personControllerSyncPerson(personId: string, _options?: Configuration): Observable { - return this.personControllerSyncPersonWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - * @param personMetadataBodyParams - */ - public personControllerUpdateMetadataWithHttpInfo(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerUpdateMetadata(personId, personMetadataBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerUpdateMetadataWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - * @param personMetadataBodyParams - */ - public personControllerUpdateMetadata(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Observable { - return this.personControllerUpdateMetadataWithHttpInfo(personId, personMetadataBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - * @param updatePersonBodyParams - */ - public personControllerUpdatePersonWithHttpInfo(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personControllerUpdatePerson(personId, updatePersonBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerUpdatePersonWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - * @param updatePersonBodyParams - */ - public personControllerUpdatePerson(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Observable { - return this.personControllerUpdatePersonWithHttpInfo(personId, updatePersonBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: PersonenApiRequestFactory; + private responseProcessor: PersonenApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenApiRequestFactory, + responseProcessor?: PersonenApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new PersonenApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new PersonenApiResponseProcessor(); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigrationWithHttpInfo( + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerCreatePersonMigration( + createPersonMigrationBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerCreatePersonMigrationWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigration( + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, + _options?: Configuration, + ): Observable { + return this.personControllerCreatePersonMigrationWithHttpInfo( + createPersonMigrationBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => apiResponse.data, + ), + ); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontextWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerCreatePersonenkontext( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerCreatePersonenkontextWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontext( + personId: string, + _options?: Configuration, + ): Observable { + return this.personControllerCreatePersonenkontextWithHttpInfo( + personId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonByIdWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerDeletePersonById(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerDeletePersonByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonById( + personId: string, + _options?: Configuration, + ): Observable { + return this.personControllerDeletePersonByIdWithHttpInfo( + personId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonByIdWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerFindPersonById(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerFindPersonByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonById( + personId: string, + _options?: Configuration, + ): Observable { + return this.personControllerFindPersonByIdWithHttpInfo( + personId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => apiResponse.data, + ), + ); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexteWithHttpInfo( + personId: string, + offset?: number, + limit?: number, + personId2?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerFindPersonenkontexte( + personId, + offset, + limit, + personId2, + referrer, + personenstatus, + sichtfreigabe, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerFindPersonenkontexteWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexte( + personId: string, + offset?: number, + limit?: number, + personId2?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Observable { + return this.personControllerFindPersonenkontexteWithHttpInfo( + personId, + offset, + limit, + personId2, + referrer, + personenstatus, + sichtfreigabe, + _options, + ).pipe( + map( + ( + apiResponse: HttpInfo, + ) => apiResponse.data, + ), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersonsWithHttpInfo( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.personControllerFindPersons( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerFindPersonsWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersons( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Observable> { + return this.personControllerFindPersonsWithHttpInfo( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPersonWithHttpInfo( + personId: string, + lockUserBodyParams: LockUserBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerLockPerson( + personId, + lockUserBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerLockPersonWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPerson( + personId: string, + lockUserBodyParams: LockUserBodyParams, + _options?: Configuration, + ): Observable { + return this.personControllerLockPersonWithHttpInfo( + personId, + lockUserBodyParams, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonIdWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerResetPasswordByPersonId( + personId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerResetPasswordByPersonIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonId( + personId: string, + _options?: Configuration, + ): Observable { + return this.personControllerResetPasswordByPersonIdWithHttpInfo( + personId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId + */ + public personControllerSyncPersonWithHttpInfo( + personId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerSyncPerson(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerSyncPersonWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId + */ + public personControllerSyncPerson( + personId: string, + _options?: Configuration, + ): Observable { + return this.personControllerSyncPersonWithHttpInfo(personId, _options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadataWithHttpInfo( + personId: string, + personMetadataBodyParams: PersonMetadataBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerUpdateMetadata( + personId, + personMetadataBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerUpdateMetadataWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadata( + personId: string, + personMetadataBodyParams: PersonMetadataBodyParams, + _options?: Configuration, + ): Observable { + return this.personControllerUpdateMetadataWithHttpInfo( + personId, + personMetadataBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => apiResponse.data, + ), + ); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePersonWithHttpInfo( + personId: string, + updatePersonBodyParams: UpdatePersonBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personControllerUpdatePerson( + personId, + updatePersonBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personControllerUpdatePersonWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePerson( + personId: string, + updatePersonBodyParams: UpdatePersonBodyParams, + _options?: Configuration, + ): Observable { + return this.personControllerUpdatePersonWithHttpInfo( + personId, + updatePersonBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => apiResponse.data, + ), + ); + } } -import { PersonenFrontendApiRequestFactory, PersonenFrontendApiResponseProcessor} from "../apis/PersonenFrontendApi.ts"; +import { + PersonenFrontendApiRequestFactory, + PersonenFrontendApiResponseProcessor, +} from "../apis/PersonenFrontendApi.ts"; export class ObservablePersonenFrontendApi { - private requestFactory: PersonenFrontendApiRequestFactory; - private responseProcessor: PersonenFrontendApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: PersonenFrontendApiRequestFactory, - responseProcessor?: PersonenFrontendApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new PersonenFrontendApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new PersonenFrontendApiResponseProcessor(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personFrontendControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personFrontendControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personFrontendControllerFindPersonsWithHttpInfo(rsp))); - })); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personFrontendControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable { - return this.personFrontendControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: PersonenFrontendApiRequestFactory; + private responseProcessor: PersonenFrontendApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenFrontendApiRequestFactory, + responseProcessor?: PersonenFrontendApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new PersonenFrontendApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new PersonenFrontendApiResponseProcessor(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersonsWithHttpInfo( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personFrontendControllerFindPersons( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personFrontendControllerFindPersonsWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersons( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Observable { + return this.personFrontendControllerFindPersonsWithHttpInfo( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ).pipe( + map( + ( + apiResponse: HttpInfo, + ) => apiResponse.data, + ), + ); + } } -import { PersonenkontextApiRequestFactory, PersonenkontextApiResponseProcessor} from "../apis/PersonenkontextApi.ts"; +import { + PersonenkontextApiRequestFactory, + PersonenkontextApiResponseProcessor, +} from "../apis/PersonenkontextApi.ts"; export class ObservablePersonenkontextApi { - private requestFactory: PersonenkontextApiRequestFactory; - private responseProcessor: PersonenkontextApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: PersonenkontextApiRequestFactory, - responseProcessor?: PersonenkontextApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new PersonenkontextApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new PersonenkontextApiResponseProcessor(); - } - - /** - * @param personId The ID for the person. - * @param dbiamUpdatePersonenkontexteBodyParams - * @param [personalnummer] - */ - public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerCommit(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The ID for the person. - * @param dbiamUpdatePersonenkontexteBodyParams - * @param [personalnummer] - */ - public dbiamPersonenkontextWorkflowControllerCommit(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Observable { - return this.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param dbiamCreatePersonWithPersonenkontexteBodyParams - */ - public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(rsp))); - })); - } - - /** - * @param dbiamCreatePersonWithPersonenkontexteBodyParams - */ - public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Observable { - return this.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. - * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId, sskName, limit, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rsp))); - })); - } - - /** - * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. - * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Observable { - return this.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId, sskName, limit, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param [organisationId] ID of the organisation to filter the rollen later - * @param [rolleId] ID of the rolle. - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerProcessStep(organisationId, rolleId, rolleName, organisationName, limit, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(rsp))); - })); - } - - /** - * @param [organisationId] ID of the organisation to filter the rollen later - * @param [rolleId] ID of the rolle. - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerProcessStep(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Observable { - return this.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId, rolleId, rolleName, organisationName, limit, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: PersonenkontextApiRequestFactory; + private responseProcessor: PersonenkontextApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontextApiRequestFactory, + responseProcessor?: PersonenkontextApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new PersonenkontextApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new PersonenkontextApiResponseProcessor(); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + personId: string, + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, + personalnummer?: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.dbiamPersonenkontextWorkflowControllerCommit( + personId, + dbiamUpdatePersonenkontexteBodyParams, + personalnummer, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommit( + personId: string, + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, + personalnummer?: string, + _options?: Configuration, + ): Observable { + return this.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + personId, + dbiamUpdatePersonenkontexteBodyParams, + personalnummer, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + dbiamCreatePersonWithPersonenkontexteBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, + _options?: Configuration, + ): Observable { + return this.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + dbiamCreatePersonWithPersonenkontexteBodyParams, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + rolleId: string, + sskName?: string, + limit?: number, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + rolleId, + sskName, + limit, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + rolleId: string, + sskName?: string, + limit?: number, + _options?: Configuration, + ): Observable { + return this.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + rolleId, + sskName, + limit, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + organisationId?: string, + rolleId?: string, + rolleName?: string, + organisationName?: string, + limit?: number, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.dbiamPersonenkontextWorkflowControllerProcessStep( + organisationId, + rolleId, + rolleName, + organisationName, + limit, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStep( + organisationId?: string, + rolleId?: string, + rolleName?: string, + organisationName?: string, + limit?: number, + _options?: Configuration, + ): Observable { + return this.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + organisationId, + rolleId, + rolleName, + organisationName, + limit, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } } -import { PersonenkontexteApiRequestFactory, PersonenkontexteApiResponseProcessor} from "../apis/PersonenkontexteApi.ts"; +import { + PersonenkontexteApiRequestFactory, + PersonenkontexteApiResponseProcessor, +} from "../apis/PersonenkontexteApi.ts"; export class ObservablePersonenkontexteApi { - private requestFactory: PersonenkontexteApiRequestFactory; - private responseProcessor: PersonenkontexteApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: PersonenkontexteApiRequestFactory, - responseProcessor?: PersonenkontexteApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new PersonenkontexteApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new PersonenkontexteApiResponseProcessor(); - } - - /** - * @param personenkontextId The id for the personenkontext. - * @param deleteRevisionBodyParams - */ - public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personenkontextControllerDeletePersonenkontextById(personenkontextId, deleteRevisionBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(rsp))); - })); - } - - /** - * @param personenkontextId The id for the personenkontext. - * @param deleteRevisionBodyParams - */ - public personenkontextControllerDeletePersonenkontextById(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Observable { - return this.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId, deleteRevisionBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param personenkontextId The id for the personenkontext. - */ - public personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personenkontextControllerFindPersonenkontextById(personenkontextId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(rsp))); - })); - } - - /** - * @param personenkontextId The id for the personenkontext. - */ - public personenkontextControllerFindPersonenkontextById(personenkontextId: string, _options?: Configuration): Observable { - return this.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personenkontextControllerFindPersonenkontexteWithHttpInfo(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.personenkontextControllerFindPersonenkontexte(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerFindPersonenkontexteWithHttpInfo(rsp))); - })); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personenkontextControllerFindPersonenkontexte(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable> { - return this.personenkontextControllerFindPersonenkontexteWithHttpInfo(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * @param personId The id for the account. - * @param systemRecht - */ - public personenkontextControllerHatSystemRechtWithHttpInfo(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personenkontextControllerHatSystemRecht(personId, systemRecht, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerHatSystemRechtWithHttpInfo(rsp))); - })); - } - - /** - * @param personId The id for the account. - * @param systemRecht - */ - public personenkontextControllerHatSystemRecht(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Observable { - return this.personenkontextControllerHatSystemRechtWithHttpInfo(personId, systemRecht, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * - * @param personenkontextId - */ - public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.personenkontextControllerUpdatePersonenkontextWithId(personenkontextId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(rsp))); - })); - } - - /** - * - * @param personenkontextId - */ - public personenkontextControllerUpdatePersonenkontextWithId(personenkontextId: string, _options?: Configuration): Observable { - return this.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: PersonenkontexteApiRequestFactory; + private responseProcessor: PersonenkontexteApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontexteApiRequestFactory, + responseProcessor?: PersonenkontexteApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new PersonenkontexteApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new PersonenkontexteApiResponseProcessor(); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + personenkontextId: string, + deleteRevisionBodyParams: DeleteRevisionBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personenkontextControllerDeletePersonenkontextById( + personenkontextId, + deleteRevisionBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextById( + personenkontextId: string, + deleteRevisionBodyParams: DeleteRevisionBodyParams, + _options?: Configuration, + ): Observable { + return this.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + personenkontextId, + deleteRevisionBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + personenkontextId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personenkontextControllerFindPersonenkontextById( + personenkontextId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextById( + personenkontextId: string, + _options?: Configuration, + ): Observable { + return this.personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + personenkontextId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexteWithHttpInfo( + offset?: number, + limit?: number, + personId?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.personenkontextControllerFindPersonenkontexte( + offset, + limit, + personId, + referrer, + personenstatus, + sichtfreigabe, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personenkontextControllerFindPersonenkontexteWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexte( + offset?: number, + limit?: number, + personId?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Observable> { + return this.personenkontextControllerFindPersonenkontexteWithHttpInfo( + offset, + limit, + personId, + referrer, + personenstatus, + sichtfreigabe, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRechtWithHttpInfo( + personId: string, + systemRecht: RollenSystemRecht, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personenkontextControllerHatSystemRecht( + personId, + systemRecht, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personenkontextControllerHatSystemRechtWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRecht( + personId: string, + systemRecht: RollenSystemRecht, + _options?: Configuration, + ): Observable { + return this.personenkontextControllerHatSystemRechtWithHttpInfo( + personId, + systemRecht, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + personenkontextId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.personenkontextControllerUpdatePersonenkontextWithId( + personenkontextId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithId( + personenkontextId: string, + _options?: Configuration, + ): Observable { + return this.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + personenkontextId, + _options, + ).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } } -import { ProviderApiRequestFactory, ProviderApiResponseProcessor} from "../apis/ProviderApi.ts"; +import { + ProviderApiRequestFactory, + ProviderApiResponseProcessor, +} from "../apis/ProviderApi.ts"; export class ObservableProviderApi { - private requestFactory: ProviderApiRequestFactory; - private responseProcessor: ProviderApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: ProviderApiRequestFactory, - responseProcessor?: ProviderApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new ProviderApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new ProviderApiResponseProcessor(); - } - - /** - * Get all service-providers. - * - */ - public providerControllerGetAllServiceProvidersWithHttpInfo(_options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.providerControllerGetAllServiceProviders(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.providerControllerGetAllServiceProvidersWithHttpInfo(rsp))); - })); - } - - /** - * Get all service-providers. - * - */ - public providerControllerGetAllServiceProviders(_options?: Configuration): Observable> { - return this.providerControllerGetAllServiceProvidersWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * Get service-providers available for logged-in user. - * - */ - public providerControllerGetAvailableServiceProvidersWithHttpInfo(_options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.providerControllerGetAvailableServiceProviders(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.providerControllerGetAvailableServiceProvidersWithHttpInfo(rsp))); - })); - } - - /** - * Get service-providers available for logged-in user. - * - */ - public providerControllerGetAvailableServiceProviders(_options?: Configuration): Observable> { - return this.providerControllerGetAvailableServiceProvidersWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * @param angebotId The id of the service provider - */ - public providerControllerGetServiceProviderLogoWithHttpInfo(angebotId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.providerControllerGetServiceProviderLogo(angebotId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.providerControllerGetServiceProviderLogoWithHttpInfo(rsp))); - })); - } - - /** - * @param angebotId The id of the service provider - */ - public providerControllerGetServiceProviderLogo(angebotId: string, _options?: Configuration): Observable { - return this.providerControllerGetServiceProviderLogoWithHttpInfo(angebotId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: ProviderApiRequestFactory; + private responseProcessor: ProviderApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: ProviderApiRequestFactory, + responseProcessor?: ProviderApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new ProviderApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new ProviderApiResponseProcessor(); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProvidersWithHttpInfo( + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.providerControllerGetAllServiceProviders(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.providerControllerGetAllServiceProvidersWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProviders( + _options?: Configuration, + ): Observable> { + return this.providerControllerGetAllServiceProvidersWithHttpInfo( + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProvidersWithHttpInfo( + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.providerControllerGetAvailableServiceProviders( + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.providerControllerGetAvailableServiceProvidersWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProviders( + _options?: Configuration, + ): Observable> { + return this.providerControllerGetAvailableServiceProvidersWithHttpInfo( + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogoWithHttpInfo( + angebotId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.providerControllerGetServiceProviderLogo( + angebotId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.providerControllerGetServiceProviderLogoWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogo( + angebotId: string, + _options?: Configuration, + ): Observable { + return this.providerControllerGetServiceProviderLogoWithHttpInfo( + angebotId, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } } -import { RolleApiRequestFactory, RolleApiResponseProcessor} from "../apis/RolleApi.ts"; +import { + RolleApiRequestFactory, + RolleApiResponseProcessor, +} from "../apis/RolleApi.ts"; export class ObservableRolleApi { - private requestFactory: RolleApiRequestFactory; - private responseProcessor: RolleApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: RolleApiRequestFactory, - responseProcessor?: RolleApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new RolleApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new RolleApiResponseProcessor(); - } - - /** - * Add systemrecht to a rolle. - * - * @param rolleId The id for the rolle. - * @param addSystemrechtBodyParams - */ - public rolleControllerAddSystemRechtWithHttpInfo(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerAddSystemRecht(rolleId, addSystemrechtBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerAddSystemRechtWithHttpInfo(rsp))); - })); - } - - /** - * Add systemrecht to a rolle. - * - * @param rolleId The id for the rolle. - * @param addSystemrechtBodyParams - */ - public rolleControllerAddSystemRecht(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Observable { - return this.rolleControllerAddSystemRechtWithHttpInfo(rolleId, addSystemrechtBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Create a new rolle. - * - * @param createRolleBodyParams - */ - public rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerCreateRolle(createRolleBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerCreateRolleWithHttpInfo(rsp))); - })); - } - - /** - * Create a new rolle. - * - * @param createRolleBodyParams - */ - public rolleControllerCreateRolle(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Observable { - return this.rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Delete a role by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerDeleteRolleWithHttpInfo(rolleId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerDeleteRolle(rolleId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerDeleteRolleWithHttpInfo(rsp))); - })); - } - - /** - * Delete a role by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerDeleteRolle(rolleId: string, _options?: Configuration): Observable { - return this.rolleControllerDeleteRolleWithHttpInfo(rolleId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Get rolle by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerFindRolleByIdWithServiceProviders(rolleId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rsp))); - })); - } - - /** - * Get rolle by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerFindRolleByIdWithServiceProviders(rolleId: string, _options?: Configuration): Observable { - return this.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * List all rollen. - * - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchStr] The name for the role. - */ - public rolleControllerFindRollenWithHttpInfo(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.rolleControllerFindRollen(offset, limit, searchStr, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerFindRollenWithHttpInfo(rsp))); - })); - } - - /** - * List all rollen. - * - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchStr] The name for the role. - */ - public rolleControllerFindRollen(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Observable> { - return this.rolleControllerFindRollenWithHttpInfo(offset, limit, searchStr, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - - /** - * Get service-providers for a rolle by its id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId: string, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerGetRolleServiceProviderIds(rolleId, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rsp))); - })); - } - - /** - * Get service-providers for a rolle by its id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerGetRolleServiceProviderIds(rolleId: string, _options?: Configuration): Observable { - return this.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerRemoveServiceProviderById(rolleId, rolleServiceProviderBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerRemoveServiceProviderByIdWithHttpInfo(rsp))); - })); - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerRemoveServiceProviderById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable { - return this.rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Update rolle. - * - * @param rolleId The id for the rolle. - * @param updateRolleBodyParams - */ - public rolleControllerUpdateRolleWithHttpInfo(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.rolleControllerUpdateRolle(rolleId, updateRolleBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerUpdateRolleWithHttpInfo(rsp))); - })); - } - - /** - * Update rolle. - * - * @param rolleId The id for the rolle. - * @param updateRolleBodyParams - */ - public rolleControllerUpdateRolle(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Observable { - return this.rolleControllerUpdateRolleWithHttpInfo(rolleId, updateRolleBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - - /** - * Add a service-provider to a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable>> { - const requestContextPromise = this.requestFactory.rolleControllerUpdateServiceProvidersById(rolleId, rolleServiceProviderBodyParams, _options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rsp))); - })); - } - - /** - * Add a service-provider to a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerUpdateServiceProvidersById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable> { - return this.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); - } - + private requestFactory: RolleApiRequestFactory; + private responseProcessor: RolleApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: RolleApiRequestFactory, + responseProcessor?: RolleApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new RolleApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new RolleApiResponseProcessor(); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRechtWithHttpInfo( + rolleId: string, + addSystemrechtBodyParams: AddSystemrechtBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerAddSystemRecht( + rolleId, + addSystemrechtBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerAddSystemRechtWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRecht( + rolleId: string, + addSystemrechtBodyParams: AddSystemrechtBodyParams, + _options?: Configuration, + ): Observable { + return this.rolleControllerAddSystemRechtWithHttpInfo( + rolleId, + addSystemrechtBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolleWithHttpInfo( + createRolleBodyParams: CreateRolleBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerCreateRolle( + createRolleBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerCreateRolleWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolle( + createRolleBodyParams: CreateRolleBodyParams, + _options?: Configuration, + ): Observable { + return this.rolleControllerCreateRolleWithHttpInfo( + createRolleBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolleWithHttpInfo( + rolleId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerDeleteRolle(rolleId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerDeleteRolleWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolle( + rolleId: string, + _options?: Configuration, + ): Observable { + return this.rolleControllerDeleteRolleWithHttpInfo(rolleId, _options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + rolleId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerFindRolleByIdWithServiceProviders( + rolleId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProviders( + rolleId: string, + _options?: Configuration, + ): Observable { + return this.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + rolleId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollenWithHttpInfo( + offset?: number, + limit?: number, + searchStr?: string, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = this.requestFactory.rolleControllerFindRollen( + offset, + limit, + searchStr, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerFindRollenWithHttpInfo(rsp), + ), + ); + }), + ); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollen( + offset?: number, + limit?: number, + searchStr?: string, + _options?: Configuration, + ): Observable> { + return this.rolleControllerFindRollenWithHttpInfo( + offset, + limit, + searchStr, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + rolleId: string, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerGetRolleServiceProviderIds( + rolleId, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIds( + rolleId: string, + _options?: Configuration, + ): Observable { + return this.rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + rolleId, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderByIdWithHttpInfo( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerRemoveServiceProviderById( + rolleId, + rolleServiceProviderBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerRemoveServiceProviderByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderById( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Observable { + return this.rolleControllerRemoveServiceProviderByIdWithHttpInfo( + rolleId, + rolleServiceProviderBodyParams, + _options, + ).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolleWithHttpInfo( + rolleId: string, + updateRolleBodyParams: UpdateRolleBodyParams, + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.rolleControllerUpdateRolle( + rolleId, + updateRolleBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerUpdateRolleWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolle( + rolleId: string, + updateRolleBodyParams: UpdateRolleBodyParams, + _options?: Configuration, + ): Observable { + return this.rolleControllerUpdateRolleWithHttpInfo( + rolleId, + updateRolleBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo) => + apiResponse.data, + ), + ); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Observable>> { + const requestContextPromise = + this.requestFactory.rolleControllerUpdateServiceProvidersById( + rolleId, + rolleServiceProviderBodyParams, + _options, + ); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + rsp, + ), + ), + ); + }), + ); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersById( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Observable> { + return this.rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + rolleId, + rolleServiceProviderBodyParams, + _options, + ).pipe( + map( + (apiResponse: HttpInfo>) => + apiResponse.data, + ), + ); + } } -import { StatusApiRequestFactory, StatusApiResponseProcessor} from "../apis/StatusApi.ts"; +import { + StatusApiRequestFactory, + StatusApiResponseProcessor, +} from "../apis/StatusApi.ts"; export class ObservableStatusApi { - private requestFactory: StatusApiRequestFactory; - private responseProcessor: StatusApiResponseProcessor; - private configuration: Configuration; - - public constructor( - configuration: Configuration, - requestFactory?: StatusApiRequestFactory, - responseProcessor?: StatusApiResponseProcessor - ) { - this.configuration = configuration; - this.requestFactory = requestFactory || new StatusApiRequestFactory(configuration); - this.responseProcessor = responseProcessor || new StatusApiResponseProcessor(); - } - - /** - */ - public statusControllerGetStatusWithHttpInfo(_options?: Configuration): Observable> { - const requestContextPromise = this.requestFactory.statusControllerGetStatus(_options); - - // build promise chain - let middlewarePreObservable = from(requestContextPromise); - for (const middleware of this.configuration.middleware) { - middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); - } - - return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). - pipe(mergeMap((response: ResponseContext) => { - let middlewarePostObservable = of(response); - for (const middleware of this.configuration.middleware) { - middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); - } - return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.statusControllerGetStatusWithHttpInfo(rsp))); - })); - } - - /** - */ - public statusControllerGetStatus(_options?: Configuration): Observable { - return this.statusControllerGetStatusWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); - } - + private requestFactory: StatusApiRequestFactory; + private responseProcessor: StatusApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: StatusApiRequestFactory, + responseProcessor?: StatusApiResponseProcessor, + ) { + this.configuration = configuration; + this.requestFactory = + requestFactory || new StatusApiRequestFactory(configuration); + this.responseProcessor = + responseProcessor || new StatusApiResponseProcessor(); + } + + /** + */ + public statusControllerGetStatusWithHttpInfo( + _options?: Configuration, + ): Observable> { + const requestContextPromise = + this.requestFactory.statusControllerGetStatus(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe( + mergeMap((ctx: RequestContext) => middleware.pre(ctx)), + ); + } + + return middlewarePreObservable + .pipe( + mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx)), + ) + .pipe( + mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe( + mergeMap((rsp: ResponseContext) => middleware.post(rsp)), + ); + } + return middlewarePostObservable.pipe( + map((rsp: ResponseContext) => + this.responseProcessor.statusControllerGetStatusWithHttpInfo(rsp), + ), + ); + }), + ); + } + + /** + */ + public statusControllerGetStatus(_options?: Configuration): Observable { + return this.statusControllerGetStatusWithHttpInfo(_options).pipe( + map((apiResponse: HttpInfo) => apiResponse.data), + ); + } } diff --git a/loadtest/api-client/generated/types/PromiseAPI.ts b/loadtest/api-client/generated/types/PromiseAPI.ts index 9978c90..53e822c 100644 --- a/loadtest/api-client/generated/types/PromiseAPI.ts +++ b/loadtest/api-client/generated/types/PromiseAPI.ts @@ -1,1715 +1,2854 @@ -import { ResponseContext, RequestContext, HttpFile, HttpInfo } from '../http/http.ts'; -import { Configuration} from '../configuration.ts' - -import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; -import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; -import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; -import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; -import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; -import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; -import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; -import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; -import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; -import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; -import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; -import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; -import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; -import { DbiamImportError } from '../models/DbiamImportError.ts'; -import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; -import { DbiamPersonError } from '../models/DbiamPersonError.ts'; -import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; -import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; -import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; -import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; -import { DbiamRolleError } from '../models/DbiamRolleError.ts'; -import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; -import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; -import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; -import { FindRollenResponse } from '../models/FindRollenResponse.ts'; -import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; -import { Geschlecht } from '../models/Geschlecht.ts'; -import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; -import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; -import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; -import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; -import { LoeschungResponse } from '../models/LoeschungResponse.ts'; -import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; -import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; -import { OrganisationResponse } from '../models/OrganisationResponse.ts'; -import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; -import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; -import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; -import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; -import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; -import { Person } from '../models/Person.ts'; -import { PersonBirthParams } from '../models/PersonBirthParams.ts'; -import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; -import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; -import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; -import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; -import { PersonIdResponse } from '../models/PersonIdResponse.ts'; -import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; -import { PersonLockResponse } from '../models/PersonLockResponse.ts'; -import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; -import { PersonNameParams } from '../models/PersonNameParams.ts'; -import { PersonNameResponse } from '../models/PersonNameResponse.ts'; -import { PersonResponse } from '../models/PersonResponse.ts'; -import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; -import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; -import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; -import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; -import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; -import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; -import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; -import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; -import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; -import { Personenstatus } from '../models/Personenstatus.ts'; -import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; -import { RawPagedResponse } from '../models/RawPagedResponse.ts'; -import { RolleResponse } from '../models/RolleResponse.ts'; -import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; -import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; -import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; -import { RollenArt } from '../models/RollenArt.ts'; -import { RollenMerkmal } from '../models/RollenMerkmal.ts'; -import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; -import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; -import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; -import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; -import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; -import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; -import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; -import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; -import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; -import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; -import { TokenStateResponse } from '../models/TokenStateResponse.ts'; -import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; -import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; -import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; -import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; -import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; -import { UserLockParams } from '../models/UserLockParams.ts'; -import { UserinfoResponse } from '../models/UserinfoResponse.ts'; -import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; -import { ObservableAuthApi } from './ObservableAPI.ts'; - -import { AuthApiRequestFactory, AuthApiResponseProcessor} from "../apis/AuthApi.ts"; +import { + ResponseContext, + RequestContext, + HttpFile, + HttpInfo, +} from "../http/http.ts"; +import { Configuration } from "../configuration.ts"; + +import { AddSystemrechtBodyParams } from "../models/AddSystemrechtBodyParams.ts"; +import { AssignHardwareTokenBodyParams } from "../models/AssignHardwareTokenBodyParams.ts"; +import { AssignHardwareTokenResponse } from "../models/AssignHardwareTokenResponse.ts"; +import { CreateOrganisationBodyParams } from "../models/CreateOrganisationBodyParams.ts"; +import { CreatePersonMigrationBodyParams } from "../models/CreatePersonMigrationBodyParams.ts"; +import { CreateRolleBodyParams } from "../models/CreateRolleBodyParams.ts"; +import { DBiamPersonResponse } from "../models/DBiamPersonResponse.ts"; +import { DBiamPersonenkontextResponse } from "../models/DBiamPersonenkontextResponse.ts"; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +import { DBiamPersonenuebersichtResponse } from "../models/DBiamPersonenuebersichtResponse.ts"; +import { DBiamPersonenzuordnungResponse } from "../models/DBiamPersonenzuordnungResponse.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DbiamCreatePersonenkontextBodyParams } from "../models/DbiamCreatePersonenkontextBodyParams.ts"; +import { DbiamImportError } from "../models/DbiamImportError.ts"; +import { DbiamOrganisationError } from "../models/DbiamOrganisationError.ts"; +import { DbiamPersonError } from "../models/DbiamPersonError.ts"; +import { DbiamPersonenkontextBodyParams } from "../models/DbiamPersonenkontextBodyParams.ts"; +import { DbiamPersonenkontextError } from "../models/DbiamPersonenkontextError.ts"; +import { DbiamPersonenkontextMigrationBodyParams } from "../models/DbiamPersonenkontextMigrationBodyParams.ts"; +import { DbiamPersonenkontexteUpdateError } from "../models/DbiamPersonenkontexteUpdateError.ts"; +import { DbiamRolleError } from "../models/DbiamRolleError.ts"; +import { DbiamUpdatePersonenkontexteBodyParams } from "../models/DbiamUpdatePersonenkontexteBodyParams.ts"; +import { DeleteRevisionBodyParams } from "../models/DeleteRevisionBodyParams.ts"; +import { EmailAddressStatus } from "../models/EmailAddressStatus.ts"; +import { FindRollenResponse } from "../models/FindRollenResponse.ts"; +import { FindSchulstrukturknotenResponse } from "../models/FindSchulstrukturknotenResponse.ts"; +import { Geschlecht } from "../models/Geschlecht.ts"; +import { ImportDataItemResponse } from "../models/ImportDataItemResponse.ts"; +import { ImportUploadResponse } from "../models/ImportUploadResponse.ts"; +import { ImportvorgangByIdBodyParams } from "../models/ImportvorgangByIdBodyParams.ts"; +import { LockUserBodyParams } from "../models/LockUserBodyParams.ts"; +import { LoeschungResponse } from "../models/LoeschungResponse.ts"; +import { OrganisationByIdBodyParams } from "../models/OrganisationByIdBodyParams.ts"; +import { OrganisationByNameBodyParams } from "../models/OrganisationByNameBodyParams.ts"; +import { OrganisationResponse } from "../models/OrganisationResponse.ts"; +import { OrganisationResponseLegacy } from "../models/OrganisationResponseLegacy.ts"; +import { OrganisationRootChildrenResponse } from "../models/OrganisationRootChildrenResponse.ts"; +import { OrganisationsTyp } from "../models/OrganisationsTyp.ts"; +import { ParentOrganisationenResponse } from "../models/ParentOrganisationenResponse.ts"; +import { ParentOrganisationsByIdsBodyParams } from "../models/ParentOrganisationsByIdsBodyParams.ts"; +import { Person } from "../models/Person.ts"; +import { PersonBirthParams } from "../models/PersonBirthParams.ts"; +import { PersonBirthResponse } from "../models/PersonBirthResponse.ts"; +import { PersonControllerFindPersonenkontexte200Response } from "../models/PersonControllerFindPersonenkontexte200Response.ts"; +import { PersonEmailResponse } from "../models/PersonEmailResponse.ts"; +import { PersonFrontendControllerFindPersons200Response } from "../models/PersonFrontendControllerFindPersons200Response.ts"; +import { PersonIdResponse } from "../models/PersonIdResponse.ts"; +import { PersonInfoResponse } from "../models/PersonInfoResponse.ts"; +import { PersonLockResponse } from "../models/PersonLockResponse.ts"; +import { PersonMetadataBodyParams } from "../models/PersonMetadataBodyParams.ts"; +import { PersonNameParams } from "../models/PersonNameParams.ts"; +import { PersonNameResponse } from "../models/PersonNameResponse.ts"; +import { PersonResponse } from "../models/PersonResponse.ts"; +import { PersonResponseAutomapper } from "../models/PersonResponseAutomapper.ts"; +import { PersonendatensatzResponse } from "../models/PersonendatensatzResponse.ts"; +import { PersonendatensatzResponseAutomapper } from "../models/PersonendatensatzResponseAutomapper.ts"; +import { PersonenkontextMigrationRuntype } from "../models/PersonenkontextMigrationRuntype.ts"; +import { PersonenkontextResponse } from "../models/PersonenkontextResponse.ts"; +import { PersonenkontextRolleFieldsResponse } from "../models/PersonenkontextRolleFieldsResponse.ts"; +import { PersonenkontextWorkflowResponse } from "../models/PersonenkontextWorkflowResponse.ts"; +import { PersonenkontextdatensatzResponse } from "../models/PersonenkontextdatensatzResponse.ts"; +import { PersonenkontexteUpdateResponse } from "../models/PersonenkontexteUpdateResponse.ts"; +import { Personenstatus } from "../models/Personenstatus.ts"; +import { PersonenuebersichtBodyParams } from "../models/PersonenuebersichtBodyParams.ts"; +import { RawPagedResponse } from "../models/RawPagedResponse.ts"; +import { RolleResponse } from "../models/RolleResponse.ts"; +import { RolleServiceProviderBodyParams } from "../models/RolleServiceProviderBodyParams.ts"; +import { RolleServiceProviderResponse } from "../models/RolleServiceProviderResponse.ts"; +import { RolleWithServiceProvidersResponse } from "../models/RolleWithServiceProvidersResponse.ts"; +import { RollenArt } from "../models/RollenArt.ts"; +import { RollenMerkmal } from "../models/RollenMerkmal.ts"; +import { RollenSystemRecht } from "../models/RollenSystemRecht.ts"; +import { RollenSystemRechtServiceProviderIDResponse } from "../models/RollenSystemRechtServiceProviderIDResponse.ts"; +import { ServiceProviderIdNameResponse } from "../models/ServiceProviderIdNameResponse.ts"; +import { ServiceProviderKategorie } from "../models/ServiceProviderKategorie.ts"; +import { ServiceProviderResponse } from "../models/ServiceProviderResponse.ts"; +import { ServiceProviderTarget } from "../models/ServiceProviderTarget.ts"; +import { Sichtfreigabe } from "../models/Sichtfreigabe.ts"; +import { SystemrechtResponse } from "../models/SystemrechtResponse.ts"; +import { TokenInitBodyParams } from "../models/TokenInitBodyParams.ts"; +import { TokenRequiredResponse } from "../models/TokenRequiredResponse.ts"; +import { TokenStateResponse } from "../models/TokenStateResponse.ts"; +import { TokenVerifyBodyParams } from "../models/TokenVerifyBodyParams.ts"; +import { TraegerschaftTyp } from "../models/TraegerschaftTyp.ts"; +import { UpdateOrganisationBodyParams } from "../models/UpdateOrganisationBodyParams.ts"; +import { UpdatePersonBodyParams } from "../models/UpdatePersonBodyParams.ts"; +import { UpdateRolleBodyParams } from "../models/UpdateRolleBodyParams.ts"; +import { UserLockParams } from "../models/UserLockParams.ts"; +import { UserinfoResponse } from "../models/UserinfoResponse.ts"; +import { Vertrauensstufe } from "../models/Vertrauensstufe.ts"; +import { ObservableAuthApi } from "./ObservableAPI.ts"; + +import { + AuthApiRequestFactory, + AuthApiResponseProcessor, +} from "../apis/AuthApi.ts"; export class PromiseAuthApi { - private api: ObservableAuthApi - - public constructor( - configuration: Configuration, - requestFactory?: AuthApiRequestFactory, - responseProcessor?: AuthApiResponseProcessor - ) { - this.api = new ObservableAuthApi(configuration, requestFactory, responseProcessor); - } - - /** - * Info about logged in user. - */ - public authenticationControllerInfoWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.authenticationControllerInfoWithHttpInfo(_options); - return result.toPromise(); - } - - /** - * Info about logged in user. - */ - public authenticationControllerInfo(_options?: Configuration): Promise { - const result = this.api.authenticationControllerInfo(_options); - return result.toPromise(); - } - - /** - * Used to start OIDC authentication. - * @param [redirectUrl] - */ - public authenticationControllerLoginWithHttpInfo(redirectUrl?: string, _options?: Configuration): Promise> { - const result = this.api.authenticationControllerLoginWithHttpInfo(redirectUrl, _options); - return result.toPromise(); - } - - /** - * Used to start OIDC authentication. - * @param [redirectUrl] - */ - public authenticationControllerLogin(redirectUrl?: string, _options?: Configuration): Promise { - const result = this.api.authenticationControllerLogin(redirectUrl, _options); - return result.toPromise(); - } - - /** - * Used to log out the current user. - */ - public authenticationControllerLogoutWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.authenticationControllerLogoutWithHttpInfo(_options); - return result.toPromise(); - } - - /** - * Used to log out the current user. - */ - public authenticationControllerLogout(_options?: Configuration): Promise { - const result = this.api.authenticationControllerLogout(_options); - return result.toPromise(); - } - - /** - * Redirect to Keycloak password reset. - * @param redirectUrl - * @param loginHint - */ - public authenticationControllerResetPasswordWithHttpInfo(redirectUrl: string, loginHint: string, _options?: Configuration): Promise> { - const result = this.api.authenticationControllerResetPasswordWithHttpInfo(redirectUrl, loginHint, _options); - return result.toPromise(); - } - - /** - * Redirect to Keycloak password reset. - * @param redirectUrl - * @param loginHint - */ - public authenticationControllerResetPassword(redirectUrl: string, loginHint: string, _options?: Configuration): Promise { - const result = this.api.authenticationControllerResetPassword(redirectUrl, loginHint, _options); - return result.toPromise(); - } - - + private api: ObservableAuthApi; + + public constructor( + configuration: Configuration, + requestFactory?: AuthApiRequestFactory, + responseProcessor?: AuthApiResponseProcessor, + ) { + this.api = new ObservableAuthApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfoWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = this.api.authenticationControllerInfoWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfo( + _options?: Configuration, + ): Promise { + const result = this.api.authenticationControllerInfo(_options); + return result.toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLoginWithHttpInfo( + redirectUrl?: string, + _options?: Configuration, + ): Promise> { + const result = this.api.authenticationControllerLoginWithHttpInfo( + redirectUrl, + _options, + ); + return result.toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLogin( + redirectUrl?: string, + _options?: Configuration, + ): Promise { + const result = this.api.authenticationControllerLogin( + redirectUrl, + _options, + ); + return result.toPromise(); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogoutWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = + this.api.authenticationControllerLogoutWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogout( + _options?: Configuration, + ): Promise { + const result = this.api.authenticationControllerLogout(_options); + return result.toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPasswordWithHttpInfo( + redirectUrl: string, + loginHint: string, + _options?: Configuration, + ): Promise> { + const result = this.api.authenticationControllerResetPasswordWithHttpInfo( + redirectUrl, + loginHint, + _options, + ); + return result.toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPassword( + redirectUrl: string, + loginHint: string, + _options?: Configuration, + ): Promise { + const result = this.api.authenticationControllerResetPassword( + redirectUrl, + loginHint, + _options, + ); + return result.toPromise(); + } } +import { ObservableClass2FAApi } from "./ObservableAPI.ts"; - -import { ObservableClass2FAApi } from './ObservableAPI.ts'; - -import { Class2FAApiRequestFactory, Class2FAApiResponseProcessor} from "../apis/Class2FAApi.ts"; +import { + Class2FAApiRequestFactory, + Class2FAApiResponseProcessor, +} from "../apis/Class2FAApi.ts"; export class PromiseClass2FAApi { - private api: ObservableClass2FAApi - - public constructor( - configuration: Configuration, - requestFactory?: Class2FAApiRequestFactory, - responseProcessor?: Class2FAApiResponseProcessor - ) { - this.api = new ObservableClass2FAApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param assignHardwareTokenBodyParams - */ - public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Promise> { - const result = this.api.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams, _options); - return result.toPromise(); - } - - /** - * @param assignHardwareTokenBodyParams - */ - public privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Promise { - const result = this.api.privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerGetTwoAuthState(personId: string, _options?: Configuration): Promise { - const result = this.api.privacyIdeaAdministrationControllerGetTwoAuthState(personId, _options); - return result.toPromise(); - } - - /** - * @param tokenInitBodyParams - */ - public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Promise> { - const result = this.api.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams, _options); - return result.toPromise(); - } - - /** - * @param tokenInitBodyParams - */ - public privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Promise { - const result = this.api.privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId: string, _options?: Configuration): Promise { - const result = this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public privacyIdeaAdministrationControllerResetToken(personId: string, _options?: Configuration): Promise { - const result = this.api.privacyIdeaAdministrationControllerResetToken(personId, _options); - return result.toPromise(); - } - - /** - * @param tokenVerifyBodyParams - */ - public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Promise> { - const result = this.api.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams, _options); - return result.toPromise(); - } - - /** - * @param tokenVerifyBodyParams - */ - public privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Promise { - const result = this.api.privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams, _options); - return result.toPromise(); - } - - + private api: ObservableClass2FAApi; + + public constructor( + configuration: Configuration, + requestFactory?: Class2FAApiRequestFactory, + responseProcessor?: Class2FAApiResponseProcessor, + ) { + this.api = new ObservableClass2FAApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo( + assignHardwareTokenBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareToken( + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, + _options?: Configuration, + ): Promise { + const result = + this.api.privacyIdeaAdministrationControllerAssignHardwareToken( + assignHardwareTokenBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthState( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.privacyIdeaAdministrationControllerGetTwoAuthState( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + tokenInitBodyParams: TokenInitBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo( + tokenInitBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareToken( + tokenInitBodyParams: TokenInitBodyParams, + _options?: Configuration, + ): Promise { + const result = + this.api.privacyIdeaAdministrationControllerInitializeSoftwareToken( + tokenInitBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + personId: string, + _options?: Configuration, + ): Promise { + const result = + this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.privacyIdeaAdministrationControllerResetTokenWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetToken( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.privacyIdeaAdministrationControllerResetToken( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + tokenVerifyBodyParams: TokenVerifyBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo( + tokenVerifyBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyToken( + tokenVerifyBodyParams: TokenVerifyBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.privacyIdeaAdministrationControllerVerifyToken( + tokenVerifyBodyParams, + _options, + ); + return result.toPromise(); + } } +import { ObservableCronApi } from "./ObservableAPI.ts"; - -import { ObservableCronApi } from './ObservableAPI.ts'; - -import { CronApiRequestFactory, CronApiResponseProcessor} from "../apis/CronApi.ts"; +import { + CronApiRequestFactory, + CronApiResponseProcessor, +} from "../apis/CronApi.ts"; export class PromiseCronApi { - private api: ObservableCronApi - - public constructor( - configuration: Configuration, - requestFactory?: CronApiRequestFactory, - responseProcessor?: CronApiResponseProcessor - ) { - this.api = new ObservableCronApi(configuration, requestFactory, responseProcessor); - } - - /** - */ - public cronControllerKoPersUserLockWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.cronControllerKoPersUserLockWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerKoPersUserLock(_options?: Configuration): Promise { - const result = this.api.cronControllerKoPersUserLock(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerPersonWithoutOrgDelete(_options?: Configuration): Promise { - const result = this.api.cronControllerPersonWithoutOrgDelete(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options?: Configuration): Promise { - const result = this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public cronControllerUnlockUsersWithExpiredLocks(_options?: Configuration): Promise { - const result = this.api.cronControllerUnlockUsersWithExpiredLocks(_options); - return result.toPromise(); - } - - + private api: ObservableCronApi; + + public constructor( + configuration: Configuration, + requestFactory?: CronApiRequestFactory, + responseProcessor?: CronApiResponseProcessor, + ) { + this.api = new ObservableCronApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + */ + public cronControllerKoPersUserLockWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = this.api.cronControllerKoPersUserLockWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerKoPersUserLock( + _options?: Configuration, + ): Promise { + const result = this.api.cronControllerKoPersUserLock(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerPersonWithoutOrgDeleteWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = + this.api.cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerPersonWithoutOrgDelete( + _options?: Configuration, + ): Promise { + const result = this.api.cronControllerPersonWithoutOrgDelete(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = + this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( + _options, + ); + return result.toPromise(); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + _options?: Configuration, + ): Promise { + const result = + this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( + _options, + ); + return result.toPromise(); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = + this.api.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocks( + _options?: Configuration, + ): Promise { + const result = this.api.cronControllerUnlockUsersWithExpiredLocks(_options); + return result.toPromise(); + } } +import { ObservableDbiamPersonenkontexteApi } from "./ObservableAPI.ts"; - -import { ObservableDbiamPersonenkontexteApi } from './ObservableAPI.ts'; - -import { DbiamPersonenkontexteApiRequestFactory, DbiamPersonenkontexteApiResponseProcessor} from "../apis/DbiamPersonenkontexteApi.ts"; +import { + DbiamPersonenkontexteApiRequestFactory, + DbiamPersonenkontexteApiResponseProcessor, +} from "../apis/DbiamPersonenkontexteApi.ts"; export class PromiseDbiamPersonenkontexteApi { - private api: ObservableDbiamPersonenkontexteApi - - public constructor( - configuration: Configuration, - requestFactory?: DbiamPersonenkontexteApiRequestFactory, - responseProcessor?: DbiamPersonenkontexteApiResponseProcessor - ) { - this.api = new ObservableDbiamPersonenkontexteApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param dbiamPersonenkontextMigrationBodyParams - */ - public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Promise> { - const result = this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams, _options); - return result.toPromise(); - } - - /** - * @param dbiamPersonenkontextMigrationBodyParams - */ - public dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Promise { - const result = this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId: string, _options?: Configuration): Promise>> { - const result = this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId: string, _options?: Configuration): Promise> { - const result = this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId, _options); - return result.toPromise(); - } - - + private api: ObservableDbiamPersonenkontexteApi; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenkontexteApiRequestFactory, + responseProcessor?: DbiamPersonenkontexteApiResponseProcessor, + ) { + this.api = new ObservableDbiamPersonenkontexteApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo( + dbiamPersonenkontextMigrationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigration( + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, + _options?: Configuration, + ): Promise { + const result = + this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigration( + dbiamPersonenkontextMigrationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise>> { + const result = + this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + personId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPerson( + personId, + _options, + ); + return result.toPromise(); + } } +import { ObservableDbiamPersonenuebersichtApi } from "./ObservableAPI.ts"; - -import { ObservableDbiamPersonenuebersichtApi } from './ObservableAPI.ts'; - -import { DbiamPersonenuebersichtApiRequestFactory, DbiamPersonenuebersichtApiResponseProcessor} from "../apis/DbiamPersonenuebersichtApi.ts"; +import { + DbiamPersonenuebersichtApiRequestFactory, + DbiamPersonenuebersichtApiResponseProcessor, +} from "../apis/DbiamPersonenuebersichtApi.ts"; export class PromiseDbiamPersonenuebersichtApi { - private api: ObservableDbiamPersonenuebersichtApi - - public constructor( - configuration: Configuration, - requestFactory?: DbiamPersonenuebersichtApiRequestFactory, - responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor - ) { - this.api = new ObservableDbiamPersonenuebersichtApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param personenuebersichtBodyParams - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Promise> { - const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personenuebersichtBodyParams - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Promise { - const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The ID for the person. - */ - public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId: string, _options?: Configuration): Promise { - const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId, _options); - return result.toPromise(); - } - - + private api: ObservableDbiamPersonenuebersichtApi; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenuebersichtApiRequestFactory, + responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor, + ) { + this.api = new ObservableDbiamPersonenuebersichtApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + personenuebersichtBodyParams: PersonenuebersichtBodyParams, + _options?: Configuration, + ): Promise< + HttpInfo + > { + const result = + this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo( + personenuebersichtBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichten( + personenuebersichtBodyParams: PersonenuebersichtBodyParams, + _options?: Configuration, + ): Promise { + const result = + this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichten( + personenuebersichtBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + personId: string, + _options?: Configuration, + ): Promise { + const result = + this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson( + personId, + _options, + ); + return result.toPromise(); + } } +import { ObservableImportApi } from "./ObservableAPI.ts"; - -import { ObservableImportApi } from './ObservableAPI.ts'; - -import { ImportApiRequestFactory, ImportApiResponseProcessor} from "../apis/ImportApi.ts"; +import { + ImportApiRequestFactory, + ImportApiResponseProcessor, +} from "../apis/ImportApi.ts"; export class PromiseImportApi { - private api: ObservableImportApi - - public constructor( - configuration: Configuration, - requestFactory?: ImportApiRequestFactory, - responseProcessor?: ImportApiResponseProcessor - ) { - this.api = new ObservableImportApi(configuration, requestFactory, responseProcessor); - } - - /** - * Delete a role by id. - * - * @param importvorgangId The id of an import transaction - */ - public importControllerDeleteImportTransactionWithHttpInfo(importvorgangId: string, _options?: Configuration): Promise> { - const result = this.api.importControllerDeleteImportTransactionWithHttpInfo(importvorgangId, _options); - return result.toPromise(); - } - - /** - * Delete a role by id. - * - * @param importvorgangId The id of an import transaction - */ - public importControllerDeleteImportTransaction(importvorgangId: string, _options?: Configuration): Promise { - const result = this.api.importControllerDeleteImportTransaction(importvorgangId, _options); - return result.toPromise(); - } - - /** - * @param importvorgangByIdBodyParams - */ - public importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Promise> { - const result = this.api.importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams, _options); - return result.toPromise(); - } - - /** - * @param importvorgangByIdBodyParams - */ - public importControllerExecuteImport(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Promise { - const result = this.api.importControllerExecuteImport(importvorgangByIdBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId - * @param rolleId - * @param file - */ - public importControllerUploadFileWithHttpInfo(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Promise> { - const result = this.api.importControllerUploadFileWithHttpInfo(organisationId, rolleId, file, _options); - return result.toPromise(); - } - - /** - * @param organisationId - * @param rolleId - * @param file - */ - public importControllerUploadFile(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Promise { - const result = this.api.importControllerUploadFile(organisationId, rolleId, file, _options); - return result.toPromise(); - } - - + private api: ObservableImportApi; + + public constructor( + configuration: Configuration, + requestFactory?: ImportApiRequestFactory, + responseProcessor?: ImportApiResponseProcessor, + ) { + this.api = new ObservableImportApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransactionWithHttpInfo( + importvorgangId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.importControllerDeleteImportTransactionWithHttpInfo( + importvorgangId, + _options, + ); + return result.toPromise(); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransaction( + importvorgangId: string, + _options?: Configuration, + ): Promise { + const result = this.api.importControllerDeleteImportTransaction( + importvorgangId, + _options, + ); + return result.toPromise(); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImportWithHttpInfo( + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.importControllerExecuteImportWithHttpInfo( + importvorgangByIdBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImport( + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.importControllerExecuteImport( + importvorgangByIdBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFileWithHttpInfo( + organisationId: string, + rolleId: string, + file: HttpFile, + _options?: Configuration, + ): Promise> { + const result = this.api.importControllerUploadFileWithHttpInfo( + organisationId, + rolleId, + file, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFile( + organisationId: string, + rolleId: string, + file: HttpFile, + _options?: Configuration, + ): Promise { + const result = this.api.importControllerUploadFile( + organisationId, + rolleId, + file, + _options, + ); + return result.toPromise(); + } } +import { ObservableOrganisationenApi } from "./ObservableAPI.ts"; - -import { ObservableOrganisationenApi } from './ObservableAPI.ts'; - -import { OrganisationenApiRequestFactory, OrganisationenApiResponseProcessor} from "../apis/OrganisationenApi.ts"; +import { + OrganisationenApiRequestFactory, + OrganisationenApiResponseProcessor, +} from "../apis/OrganisationenApi.ts"; export class PromiseOrganisationenApi { - private api: ObservableOrganisationenApi - - public constructor( - configuration: Configuration, - requestFactory?: OrganisationenApiRequestFactory, - responseProcessor?: OrganisationenApiResponseProcessor - ) { - this.api = new ObservableOrganisationenApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise> { - const result = this.api.organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddAdministrierteOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { - const result = this.api.organisationControllerAddAdministrierteOrganisation(organisationId, organisationByIdBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise> { - const result = this.api.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param organisationByIdBodyParams - */ - public organisationControllerAddZugehoerigeOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { - const result = this.api.organisationControllerAddZugehoerigeOrganisation(organisationId, organisationByIdBodyParams, _options); - return result.toPromise(); - } - - /** - * @param createOrganisationBodyParams - */ - public organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Promise> { - const result = this.api.organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams, _options); - return result.toPromise(); - } - - /** - * @param createOrganisationBodyParams - */ - public organisationControllerCreateOrganisation(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Promise { - const result = this.api.organisationControllerCreateOrganisation(createOrganisationBodyParams, _options); - return result.toPromise(); - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param organisationId The id of an organization - */ - public organisationControllerDeleteKlasseWithHttpInfo(organisationId: string, _options?: Configuration): Promise> { - const result = this.api.organisationControllerDeleteKlasseWithHttpInfo(organisationId, _options); - return result.toPromise(); - } - - /** - * Delete an organisation of type Klasse by id. - * - * @param organisationId The id of an organization - */ - public organisationControllerDeleteKlasse(organisationId: string, _options?: Configuration): Promise { - const result = this.api.organisationControllerDeleteKlasse(organisationId, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerEnableForitslearningWithHttpInfo(organisationId: string, _options?: Configuration): Promise> { - const result = this.api.organisationControllerEnableForitslearningWithHttpInfo(organisationId, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerEnableForitslearning(organisationId: string, _options?: Configuration): Promise { - const result = this.api.organisationControllerEnableForitslearning(organisationId, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerFindOrganisationByIdWithHttpInfo(organisationId: string, _options?: Configuration): Promise> { - const result = this.api.organisationControllerFindOrganisationByIdWithHttpInfo(organisationId, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerFindOrganisationById(organisationId: string, _options?: Configuration): Promise { - const result = this.api.organisationControllerFindOrganisationById(organisationId, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [kennung] - * @param [name] - * @param [searchString] - * @param [typ] - * @param [systemrechte] - * @param [excludeTyp] - * @param [administriertVon] - * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). - */ - public organisationControllerFindOrganizationsWithHttpInfo(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Promise>> { - const result = this.api.organisationControllerFindOrganizationsWithHttpInfo(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [kennung] - * @param [name] - * @param [searchString] - * @param [typ] - * @param [systemrechte] - * @param [excludeTyp] - * @param [administriertVon] - * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). - */ - public organisationControllerFindOrganizations(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Promise> { - const result = this.api.organisationControllerFindOrganizations(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchFilter] - */ - public organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Promise>> { - const result = this.api.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId, offset, limit, searchFilter, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchFilter] - */ - public organisationControllerGetAdministrierteOrganisationen(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Promise> { - const result = this.api.organisationControllerGetAdministrierteOrganisationen(organisationId, offset, limit, searchFilter, _options); - return result.toPromise(); - } - - /** - * @param parentOrganisationsByIdsBodyParams - */ - public organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Promise> { - const result = this.api.organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams, _options); - return result.toPromise(); - } - - /** - * @param parentOrganisationsByIdsBodyParams - */ - public organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Promise { - const result = this.api.organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams, _options); - return result.toPromise(); - } - - /** - */ - public organisationControllerGetRootChildrenWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.organisationControllerGetRootChildrenWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public organisationControllerGetRootChildren(_options?: Configuration): Promise { - const result = this.api.organisationControllerGetRootChildren(_options); - return result.toPromise(); - } - - /** - */ - public organisationControllerGetRootOrganisationWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.organisationControllerGetRootOrganisationWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public organisationControllerGetRootOrganisation(_options?: Configuration): Promise { - const result = this.api.organisationControllerGetRootOrganisation(_options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId: string, _options?: Configuration): Promise>> { - const result = this.api.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - */ - public organisationControllerGetZugehoerigeOrganisationen(organisationId: string, _options?: Configuration): Promise> { - const result = this.api.organisationControllerGetZugehoerigeOrganisationen(organisationId, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param updateOrganisationBodyParams - */ - public organisationControllerUpdateOrganisationWithHttpInfo(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Promise> { - const result = this.api.organisationControllerUpdateOrganisationWithHttpInfo(organisationId, updateOrganisationBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param updateOrganisationBodyParams - */ - public organisationControllerUpdateOrganisation(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Promise { - const result = this.api.organisationControllerUpdateOrganisation(organisationId, updateOrganisationBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param organisationByNameBodyParams - */ - public organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Promise> { - const result = this.api.organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId, organisationByNameBodyParams, _options); - return result.toPromise(); - } - - /** - * @param organisationId The id of an organization - * @param organisationByNameBodyParams - */ - public organisationControllerUpdateOrganisationName(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Promise { - const result = this.api.organisationControllerUpdateOrganisationName(organisationId, organisationByNameBodyParams, _options); - return result.toPromise(); - } - - + private api: ObservableOrganisationenApi; + + public constructor( + configuration: Configuration, + requestFactory?: OrganisationenApiRequestFactory, + responseProcessor?: OrganisationenApiResponseProcessor, + ) { + this.api = new ObservableOrganisationenApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisationWithHttpInfo( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerAddAdministrierteOrganisationWithHttpInfo( + organisationId, + organisationByIdBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisation( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerAddAdministrierteOrganisation( + organisationId, + organisationByIdBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerAddZugehoerigeOrganisationWithHttpInfo( + organisationId, + organisationByIdBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisation( + organisationId: string, + organisationByIdBodyParams: OrganisationByIdBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerAddZugehoerigeOrganisation( + organisationId, + organisationByIdBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisationWithHttpInfo( + createOrganisationBodyParams: CreateOrganisationBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerCreateOrganisationWithHttpInfo( + createOrganisationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisation( + createOrganisationBodyParams: CreateOrganisationBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerCreateOrganisation( + createOrganisationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasseWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.organisationControllerDeleteKlasseWithHttpInfo( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasse( + organisationId: string, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerDeleteKlasse( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearningWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerEnableForitslearningWithHttpInfo( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearning( + organisationId: string, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerEnableForitslearning( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationByIdWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerFindOrganisationByIdWithHttpInfo( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationById( + organisationId: string, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerFindOrganisationById( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizationsWithHttpInfo( + offset?: number, + limit?: number, + kennung?: string, + name?: string, + searchString?: string, + typ?: OrganisationsTyp, + systemrechte?: Array, + excludeTyp?: Array, + administriertVon?: Array, + organisationIds?: Array, + _options?: Configuration, + ): Promise>> { + const result = this.api.organisationControllerFindOrganizationsWithHttpInfo( + offset, + limit, + kennung, + name, + searchString, + typ, + systemrechte, + excludeTyp, + administriertVon, + organisationIds, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizations( + offset?: number, + limit?: number, + kennung?: string, + name?: string, + searchString?: string, + typ?: OrganisationsTyp, + systemrechte?: Array, + excludeTyp?: Array, + administriertVon?: Array, + organisationIds?: Array, + _options?: Configuration, + ): Promise> { + const result = this.api.organisationControllerFindOrganizations( + offset, + limit, + kennung, + name, + searchString, + typ, + systemrechte, + excludeTyp, + administriertVon, + organisationIds, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + organisationId: string, + offset?: number, + limit?: number, + searchFilter?: string, + _options?: Configuration, + ): Promise>> { + const result = + this.api.organisationControllerGetAdministrierteOrganisationenWithHttpInfo( + organisationId, + offset, + limit, + searchFilter, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationen( + organisationId: string, + offset?: number, + limit?: number, + searchFilter?: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerGetAdministrierteOrganisationen( + organisationId, + offset, + limit, + searchFilter, + _options, + ); + return result.toPromise(); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIdsWithHttpInfo( + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.organisationControllerGetParentsByIdsWithHttpInfo( + parentOrganisationsByIdsBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIds( + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerGetParentsByIds( + parentOrganisationsByIdsBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootChildrenWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerGetRootChildrenWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootChildren( + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerGetRootChildren(_options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootOrganisationWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerGetRootOrganisationWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootOrganisation( + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerGetRootOrganisation(_options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + organisationId: string, + _options?: Configuration, + ): Promise>> { + const result = + this.api.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationen( + organisationId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.organisationControllerGetZugehoerigeOrganisationen( + organisationId, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisationWithHttpInfo( + organisationId: string, + updateOrganisationBodyParams: UpdateOrganisationBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerUpdateOrganisationWithHttpInfo( + organisationId, + updateOrganisationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisation( + organisationId: string, + updateOrganisationBodyParams: UpdateOrganisationBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerUpdateOrganisation( + organisationId, + updateOrganisationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationNameWithHttpInfo( + organisationId: string, + organisationByNameBodyParams: OrganisationByNameBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.organisationControllerUpdateOrganisationNameWithHttpInfo( + organisationId, + organisationByNameBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationName( + organisationId: string, + organisationByNameBodyParams: OrganisationByNameBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.organisationControllerUpdateOrganisationName( + organisationId, + organisationByNameBodyParams, + _options, + ); + return result.toPromise(); + } } +import { ObservablePersonAdministrationApi } from "./ObservableAPI.ts"; - -import { ObservablePersonAdministrationApi } from './ObservableAPI.ts'; - -import { PersonAdministrationApiRequestFactory, PersonAdministrationApiResponseProcessor} from "../apis/PersonAdministrationApi.ts"; +import { + PersonAdministrationApiRequestFactory, + PersonAdministrationApiResponseProcessor, +} from "../apis/PersonAdministrationApi.ts"; export class PromisePersonAdministrationApi { - private api: ObservablePersonAdministrationApi - - public constructor( - configuration: Configuration, - requestFactory?: PersonAdministrationApiRequestFactory, - responseProcessor?: PersonAdministrationApiResponseProcessor - ) { - this.api = new ObservablePersonAdministrationApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [limit] The limit of items for the request. - */ - public personAdministrationControllerFindRollenWithHttpInfo(rolleName?: string, limit?: number, _options?: Configuration): Promise> { - const result = this.api.personAdministrationControllerFindRollenWithHttpInfo(rolleName, limit, _options); - return result.toPromise(); - } - - /** - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [limit] The limit of items for the request. - */ - public personAdministrationControllerFindRollen(rolleName?: string, limit?: number, _options?: Configuration): Promise { - const result = this.api.personAdministrationControllerFindRollen(rolleName, limit, _options); - return result.toPromise(); - } - - + private api: ObservablePersonAdministrationApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonAdministrationApiRequestFactory, + responseProcessor?: PersonAdministrationApiResponseProcessor, + ) { + this.api = new ObservablePersonAdministrationApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollenWithHttpInfo( + rolleName?: string, + limit?: number, + _options?: Configuration, + ): Promise> { + const result = + this.api.personAdministrationControllerFindRollenWithHttpInfo( + rolleName, + limit, + _options, + ); + return result.toPromise(); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollen( + rolleName?: string, + limit?: number, + _options?: Configuration, + ): Promise { + const result = this.api.personAdministrationControllerFindRollen( + rolleName, + limit, + _options, + ); + return result.toPromise(); + } } +import { ObservablePersonInfoApi } from "./ObservableAPI.ts"; - -import { ObservablePersonInfoApi } from './ObservableAPI.ts'; - -import { PersonInfoApiRequestFactory, PersonInfoApiResponseProcessor} from "../apis/PersonInfoApi.ts"; +import { + PersonInfoApiRequestFactory, + PersonInfoApiResponseProcessor, +} from "../apis/PersonInfoApi.ts"; export class PromisePersonInfoApi { - private api: ObservablePersonInfoApi - - public constructor( - configuration: Configuration, - requestFactory?: PersonInfoApiRequestFactory, - responseProcessor?: PersonInfoApiResponseProcessor - ) { - this.api = new ObservablePersonInfoApi(configuration, requestFactory, responseProcessor); - } - - /** - * Info about logged in person. - */ - public personInfoControllerInfoWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.personInfoControllerInfoWithHttpInfo(_options); - return result.toPromise(); - } - - /** - * Info about logged in person. - */ - public personInfoControllerInfo(_options?: Configuration): Promise { - const result = this.api.personInfoControllerInfo(_options); - return result.toPromise(); - } - - + private api: ObservablePersonInfoApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonInfoApiRequestFactory, + responseProcessor?: PersonInfoApiResponseProcessor, + ) { + this.api = new ObservablePersonInfoApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfoWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = this.api.personInfoControllerInfoWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfo( + _options?: Configuration, + ): Promise { + const result = this.api.personInfoControllerInfo(_options); + return result.toPromise(); + } } +import { ObservablePersonenApi } from "./ObservableAPI.ts"; - -import { ObservablePersonenApi } from './ObservableAPI.ts'; - -import { PersonenApiRequestFactory, PersonenApiResponseProcessor} from "../apis/PersonenApi.ts"; +import { + PersonenApiRequestFactory, + PersonenApiResponseProcessor, +} from "../apis/PersonenApi.ts"; export class PromisePersonenApi { - private api: ObservablePersonenApi - - public constructor( - configuration: Configuration, - requestFactory?: PersonenApiRequestFactory, - responseProcessor?: PersonenApiResponseProcessor - ) { - this.api = new ObservablePersonenApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param createPersonMigrationBodyParams - */ - public personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Promise> { - const result = this.api.personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams, _options); - return result.toPromise(); - } - - /** - * @param createPersonMigrationBodyParams - */ - public personControllerCreatePersonMigration(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Promise { - const result = this.api.personControllerCreatePersonMigration(createPersonMigrationBodyParams, _options); - return result.toPromise(); - } - - /** - * - * @param personId - */ - public personControllerCreatePersonenkontextWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.personControllerCreatePersonenkontextWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * - * @param personId - */ - public personControllerCreatePersonenkontext(personId: string, _options?: Configuration): Promise { - const result = this.api.personControllerCreatePersonenkontext(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - */ - public personControllerDeletePersonByIdWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.personControllerDeletePersonByIdWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - */ - public personControllerDeletePersonById(personId: string, _options?: Configuration): Promise { - const result = this.api.personControllerDeletePersonById(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - */ - public personControllerFindPersonByIdWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.personControllerFindPersonByIdWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - */ - public personControllerFindPersonById(personId: string, _options?: Configuration): Promise { - const result = this.api.personControllerFindPersonById(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId2] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personControllerFindPersonenkontexteWithHttpInfo(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise> { - const result = this.api.personControllerFindPersonenkontexteWithHttpInfo(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId2] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personControllerFindPersonenkontexte(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise { - const result = this.api.personControllerFindPersonenkontexte(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise>> { - const result = this.api.personControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise> { - const result = this.api.personControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); - return result.toPromise(); - } - - /** - * @param personId - * @param lockUserBodyParams - */ - public personControllerLockPersonWithHttpInfo(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Promise> { - const result = this.api.personControllerLockPersonWithHttpInfo(personId, lockUserBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId - * @param lockUserBodyParams - */ - public personControllerLockPerson(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Promise { - const result = this.api.personControllerLockPerson(personId, lockUserBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - */ - public personControllerResetPasswordByPersonIdWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.personControllerResetPasswordByPersonIdWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - */ - public personControllerResetPasswordByPersonId(personId: string, _options?: Configuration): Promise { - const result = this.api.personControllerResetPasswordByPersonId(personId, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public personControllerSyncPersonWithHttpInfo(personId: string, _options?: Configuration): Promise> { - const result = this.api.personControllerSyncPersonWithHttpInfo(personId, _options); - return result.toPromise(); - } - - /** - * @param personId - */ - public personControllerSyncPerson(personId: string, _options?: Configuration): Promise { - const result = this.api.personControllerSyncPerson(personId, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param personMetadataBodyParams - */ - public personControllerUpdateMetadataWithHttpInfo(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Promise> { - const result = this.api.personControllerUpdateMetadataWithHttpInfo(personId, personMetadataBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param personMetadataBodyParams - */ - public personControllerUpdateMetadata(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Promise { - const result = this.api.personControllerUpdateMetadata(personId, personMetadataBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param updatePersonBodyParams - */ - public personControllerUpdatePersonWithHttpInfo(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Promise> { - const result = this.api.personControllerUpdatePersonWithHttpInfo(personId, updatePersonBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param updatePersonBodyParams - */ - public personControllerUpdatePerson(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Promise { - const result = this.api.personControllerUpdatePerson(personId, updatePersonBodyParams, _options); - return result.toPromise(); - } - - + private api: ObservablePersonenApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenApiRequestFactory, + responseProcessor?: PersonenApiResponseProcessor, + ) { + this.api = new ObservablePersonenApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigrationWithHttpInfo( + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerCreatePersonMigrationWithHttpInfo( + createPersonMigrationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigration( + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerCreatePersonMigration( + createPersonMigrationBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontextWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerCreatePersonenkontextWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontext( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerCreatePersonenkontext( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonByIdWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerDeletePersonByIdWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonById( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerDeletePersonById( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonByIdWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerFindPersonByIdWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonById( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerFindPersonById(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexteWithHttpInfo( + personId: string, + offset?: number, + limit?: number, + personId2?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerFindPersonenkontexteWithHttpInfo( + personId, + offset, + limit, + personId2, + referrer, + personenstatus, + sichtfreigabe, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexte( + personId: string, + offset?: number, + limit?: number, + personId2?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerFindPersonenkontexte( + personId, + offset, + limit, + personId2, + referrer, + personenstatus, + sichtfreigabe, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersonsWithHttpInfo( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Promise>> { + const result = this.api.personControllerFindPersonsWithHttpInfo( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersons( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerFindPersons( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPersonWithHttpInfo( + personId: string, + lockUserBodyParams: LockUserBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerLockPersonWithHttpInfo( + personId, + lockUserBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPerson( + personId: string, + lockUserBodyParams: LockUserBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerLockPerson( + personId, + lockUserBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonIdWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerResetPasswordByPersonIdWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonId( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerResetPasswordByPersonId( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public personControllerSyncPersonWithHttpInfo( + personId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerSyncPersonWithHttpInfo( + personId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId + */ + public personControllerSyncPerson( + personId: string, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerSyncPerson(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadataWithHttpInfo( + personId: string, + personMetadataBodyParams: PersonMetadataBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerUpdateMetadataWithHttpInfo( + personId, + personMetadataBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadata( + personId: string, + personMetadataBodyParams: PersonMetadataBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerUpdateMetadata( + personId, + personMetadataBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePersonWithHttpInfo( + personId: string, + updatePersonBodyParams: UpdatePersonBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.personControllerUpdatePersonWithHttpInfo( + personId, + updatePersonBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePerson( + personId: string, + updatePersonBodyParams: UpdatePersonBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.personControllerUpdatePerson( + personId, + updatePersonBodyParams, + _options, + ); + return result.toPromise(); + } } +import { ObservablePersonenFrontendApi } from "./ObservableAPI.ts"; - -import { ObservablePersonenFrontendApi } from './ObservableAPI.ts'; - -import { PersonenFrontendApiRequestFactory, PersonenFrontendApiResponseProcessor} from "../apis/PersonenFrontendApi.ts"; +import { + PersonenFrontendApiRequestFactory, + PersonenFrontendApiResponseProcessor, +} from "../apis/PersonenFrontendApi.ts"; export class PromisePersonenFrontendApi { - private api: ObservablePersonenFrontendApi - - public constructor( - configuration: Configuration, - requestFactory?: PersonenFrontendApiRequestFactory, - responseProcessor?: PersonenFrontendApiResponseProcessor - ) { - this.api = new ObservablePersonenFrontendApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personFrontendControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise> { - const result = this.api.personFrontendControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [referrer] - * @param [familienname] - * @param [vorname] - * @param [sichtfreigabe] - * @param [organisationIDs] List of Organisation ID used to filter for Persons. - * @param [rolleIDs] List of Role ID used to filter for Persons. - * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. - * @param [sortOrder] Order to sort by. - * @param [sortField] Field to sort by. - */ - public personFrontendControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise { - const result = this.api.personFrontendControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); - return result.toPromise(); - } - - + private api: ObservablePersonenFrontendApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenFrontendApiRequestFactory, + responseProcessor?: PersonenFrontendApiResponseProcessor, + ) { + this.api = new ObservablePersonenFrontendApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersonsWithHttpInfo( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Promise> { + const result = this.api.personFrontendControllerFindPersonsWithHttpInfo( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersons( + offset?: number, + limit?: number, + referrer?: string, + familienname?: string, + vorname?: string, + sichtfreigabe?: "ja" | "nein", + organisationIDs?: Array, + rolleIDs?: Array, + suchFilter?: string, + sortOrder?: "asc" | "desc", + sortField?: "familienname" | "vorname" | "personalnummer" | "referrer", + _options?: Configuration, + ): Promise { + const result = this.api.personFrontendControllerFindPersons( + offset, + limit, + referrer, + familienname, + vorname, + sichtfreigabe, + organisationIDs, + rolleIDs, + suchFilter, + sortOrder, + sortField, + _options, + ); + return result.toPromise(); + } } +import { ObservablePersonenkontextApi } from "./ObservableAPI.ts"; - -import { ObservablePersonenkontextApi } from './ObservableAPI.ts'; - -import { PersonenkontextApiRequestFactory, PersonenkontextApiResponseProcessor} from "../apis/PersonenkontextApi.ts"; +import { + PersonenkontextApiRequestFactory, + PersonenkontextApiResponseProcessor, +} from "../apis/PersonenkontextApi.ts"; export class PromisePersonenkontextApi { - private api: ObservablePersonenkontextApi - - public constructor( - configuration: Configuration, - requestFactory?: PersonenkontextApiRequestFactory, - responseProcessor?: PersonenkontextApiResponseProcessor - ) { - this.api = new ObservablePersonenkontextApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param personId The ID for the person. - * @param dbiamUpdatePersonenkontexteBodyParams - * @param [personalnummer] - */ - public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Promise> { - const result = this.api.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options); - return result.toPromise(); - } - - /** - * @param personId The ID for the person. - * @param dbiamUpdatePersonenkontexteBodyParams - * @param [personalnummer] - */ - public dbiamPersonenkontextWorkflowControllerCommit(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Promise { - const result = this.api.dbiamPersonenkontextWorkflowControllerCommit(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options); - return result.toPromise(); - } - - /** - * @param dbiamCreatePersonWithPersonenkontexteBodyParams - */ - public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Promise> { - const result = this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams, _options); - return result.toPromise(); - } - - /** - * @param dbiamCreatePersonWithPersonenkontexteBodyParams - */ - public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Promise { - const result = this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams, _options); - return result.toPromise(); - } - - /** - * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. - * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Promise> { - const result = this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId, sskName, limit, _options); - return result.toPromise(); - } - - /** - * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. - * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Promise { - const result = this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId, sskName, limit, _options); - return result.toPromise(); - } - - /** - * @param [organisationId] ID of the organisation to filter the rollen later - * @param [rolleId] ID of the rolle. - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Promise> { - const result = this.api.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId, rolleId, rolleName, organisationName, limit, _options); - return result.toPromise(); - } - - /** - * @param [organisationId] ID of the organisation to filter the rollen later - * @param [rolleId] ID of the rolle. - * @param [rolleName] Rolle name used to filter for rollen in personenkontext. - * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. - * @param [limit] The limit of items for the request. - */ - public dbiamPersonenkontextWorkflowControllerProcessStep(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Promise { - const result = this.api.dbiamPersonenkontextWorkflowControllerProcessStep(organisationId, rolleId, rolleName, organisationName, limit, _options); - return result.toPromise(); - } - - + private api: ObservablePersonenkontextApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontextApiRequestFactory, + responseProcessor?: PersonenkontextApiResponseProcessor, + ) { + this.api = new ObservablePersonenkontextApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + personId: string, + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, + personalnummer?: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo( + personId, + dbiamUpdatePersonenkontexteBodyParams, + personalnummer, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommit( + personId: string, + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, + personalnummer?: string, + _options?: Configuration, + ): Promise { + const result = this.api.dbiamPersonenkontextWorkflowControllerCommit( + personId, + dbiamUpdatePersonenkontexteBodyParams, + personalnummer, + _options, + ); + return result.toPromise(); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo( + dbiamCreatePersonWithPersonenkontexteBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, + _options?: Configuration, + ): Promise { + const result = + this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte( + dbiamCreatePersonWithPersonenkontexteBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + rolleId: string, + sskName?: string, + limit?: number, + _options?: Configuration, + ): Promise> { + const result = + this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo( + rolleId, + sskName, + limit, + _options, + ); + return result.toPromise(); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + rolleId: string, + sskName?: string, + limit?: number, + _options?: Configuration, + ): Promise { + const result = + this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten( + rolleId, + sskName, + limit, + _options, + ); + return result.toPromise(); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + organisationId?: string, + rolleId?: string, + rolleName?: string, + organisationName?: string, + limit?: number, + _options?: Configuration, + ): Promise> { + const result = + this.api.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo( + organisationId, + rolleId, + rolleName, + organisationName, + limit, + _options, + ); + return result.toPromise(); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStep( + organisationId?: string, + rolleId?: string, + rolleName?: string, + organisationName?: string, + limit?: number, + _options?: Configuration, + ): Promise { + const result = this.api.dbiamPersonenkontextWorkflowControllerProcessStep( + organisationId, + rolleId, + rolleName, + organisationName, + limit, + _options, + ); + return result.toPromise(); + } } +import { ObservablePersonenkontexteApi } from "./ObservableAPI.ts"; - -import { ObservablePersonenkontexteApi } from './ObservableAPI.ts'; - -import { PersonenkontexteApiRequestFactory, PersonenkontexteApiResponseProcessor} from "../apis/PersonenkontexteApi.ts"; +import { + PersonenkontexteApiRequestFactory, + PersonenkontexteApiResponseProcessor, +} from "../apis/PersonenkontexteApi.ts"; export class PromisePersonenkontexteApi { - private api: ObservablePersonenkontexteApi - - public constructor( - configuration: Configuration, - requestFactory?: PersonenkontexteApiRequestFactory, - responseProcessor?: PersonenkontexteApiResponseProcessor - ) { - this.api = new ObservablePersonenkontexteApi(configuration, requestFactory, responseProcessor); - } - - /** - * @param personenkontextId The id for the personenkontext. - * @param deleteRevisionBodyParams - */ - public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Promise> { - const result = this.api.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId, deleteRevisionBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personenkontextId The id for the personenkontext. - * @param deleteRevisionBodyParams - */ - public personenkontextControllerDeletePersonenkontextById(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Promise { - const result = this.api.personenkontextControllerDeletePersonenkontextById(personenkontextId, deleteRevisionBodyParams, _options); - return result.toPromise(); - } - - /** - * @param personenkontextId The id for the personenkontext. - */ - public personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Promise> { - const result = this.api.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId, _options); - return result.toPromise(); - } - - /** - * @param personenkontextId The id for the personenkontext. - */ - public personenkontextControllerFindPersonenkontextById(personenkontextId: string, _options?: Configuration): Promise { - const result = this.api.personenkontextControllerFindPersonenkontextById(personenkontextId, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personenkontextControllerFindPersonenkontexteWithHttpInfo(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise>> { - const result = this.api.personenkontextControllerFindPersonenkontexteWithHttpInfo(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options); - return result.toPromise(); - } - - /** - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [personId] - * @param [referrer] - * @param [personenstatus] - * @param [sichtfreigabe] - */ - public personenkontextControllerFindPersonenkontexte(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise> { - const result = this.api.personenkontextControllerFindPersonenkontexte(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param systemRecht - */ - public personenkontextControllerHatSystemRechtWithHttpInfo(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Promise> { - const result = this.api.personenkontextControllerHatSystemRechtWithHttpInfo(personId, systemRecht, _options); - return result.toPromise(); - } - - /** - * @param personId The id for the account. - * @param systemRecht - */ - public personenkontextControllerHatSystemRecht(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Promise { - const result = this.api.personenkontextControllerHatSystemRecht(personId, systemRecht, _options); - return result.toPromise(); - } - - /** - * - * @param personenkontextId - */ - public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Promise> { - const result = this.api.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId, _options); - return result.toPromise(); - } - - /** - * - * @param personenkontextId - */ - public personenkontextControllerUpdatePersonenkontextWithId(personenkontextId: string, _options?: Configuration): Promise { - const result = this.api.personenkontextControllerUpdatePersonenkontextWithId(personenkontextId, _options); - return result.toPromise(); - } - - + private api: ObservablePersonenkontexteApi; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontexteApiRequestFactory, + responseProcessor?: PersonenkontexteApiResponseProcessor, + ) { + this.api = new ObservablePersonenkontexteApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + personenkontextId: string, + deleteRevisionBodyParams: DeleteRevisionBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo( + personenkontextId, + deleteRevisionBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextById( + personenkontextId: string, + deleteRevisionBodyParams: DeleteRevisionBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.personenkontextControllerDeletePersonenkontextById( + personenkontextId, + deleteRevisionBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + personenkontextId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.personenkontextControllerFindPersonenkontextByIdWithHttpInfo( + personenkontextId, + _options, + ); + return result.toPromise(); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextById( + personenkontextId: string, + _options?: Configuration, + ): Promise { + const result = this.api.personenkontextControllerFindPersonenkontextById( + personenkontextId, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexteWithHttpInfo( + offset?: number, + limit?: number, + personId?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Promise>> { + const result = + this.api.personenkontextControllerFindPersonenkontexteWithHttpInfo( + offset, + limit, + personId, + referrer, + personenstatus, + sichtfreigabe, + _options, + ); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexte( + offset?: number, + limit?: number, + personId?: string, + referrer?: string, + personenstatus?: Personenstatus, + sichtfreigabe?: Sichtfreigabe, + _options?: Configuration, + ): Promise> { + const result = this.api.personenkontextControllerFindPersonenkontexte( + offset, + limit, + personId, + referrer, + personenstatus, + sichtfreigabe, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRechtWithHttpInfo( + personId: string, + systemRecht: RollenSystemRecht, + _options?: Configuration, + ): Promise> { + const result = this.api.personenkontextControllerHatSystemRechtWithHttpInfo( + personId, + systemRecht, + _options, + ); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRecht( + personId: string, + systemRecht: RollenSystemRecht, + _options?: Configuration, + ): Promise { + const result = this.api.personenkontextControllerHatSystemRecht( + personId, + systemRecht, + _options, + ); + return result.toPromise(); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + personenkontextId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo( + personenkontextId, + _options, + ); + return result.toPromise(); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithId( + personenkontextId: string, + _options?: Configuration, + ): Promise { + const result = + this.api.personenkontextControllerUpdatePersonenkontextWithId( + personenkontextId, + _options, + ); + return result.toPromise(); + } } +import { ObservableProviderApi } from "./ObservableAPI.ts"; - -import { ObservableProviderApi } from './ObservableAPI.ts'; - -import { ProviderApiRequestFactory, ProviderApiResponseProcessor} from "../apis/ProviderApi.ts"; +import { + ProviderApiRequestFactory, + ProviderApiResponseProcessor, +} from "../apis/ProviderApi.ts"; export class PromiseProviderApi { - private api: ObservableProviderApi - - public constructor( - configuration: Configuration, - requestFactory?: ProviderApiRequestFactory, - responseProcessor?: ProviderApiResponseProcessor - ) { - this.api = new ObservableProviderApi(configuration, requestFactory, responseProcessor); - } - - /** - * Get all service-providers. - * - */ - public providerControllerGetAllServiceProvidersWithHttpInfo(_options?: Configuration): Promise>> { - const result = this.api.providerControllerGetAllServiceProvidersWithHttpInfo(_options); - return result.toPromise(); - } - - /** - * Get all service-providers. - * - */ - public providerControllerGetAllServiceProviders(_options?: Configuration): Promise> { - const result = this.api.providerControllerGetAllServiceProviders(_options); - return result.toPromise(); - } - - /** - * Get service-providers available for logged-in user. - * - */ - public providerControllerGetAvailableServiceProvidersWithHttpInfo(_options?: Configuration): Promise>> { - const result = this.api.providerControllerGetAvailableServiceProvidersWithHttpInfo(_options); - return result.toPromise(); - } - - /** - * Get service-providers available for logged-in user. - * - */ - public providerControllerGetAvailableServiceProviders(_options?: Configuration): Promise> { - const result = this.api.providerControllerGetAvailableServiceProviders(_options); - return result.toPromise(); - } - - /** - * @param angebotId The id of the service provider - */ - public providerControllerGetServiceProviderLogoWithHttpInfo(angebotId: string, _options?: Configuration): Promise> { - const result = this.api.providerControllerGetServiceProviderLogoWithHttpInfo(angebotId, _options); - return result.toPromise(); - } - - /** - * @param angebotId The id of the service provider - */ - public providerControllerGetServiceProviderLogo(angebotId: string, _options?: Configuration): Promise { - const result = this.api.providerControllerGetServiceProviderLogo(angebotId, _options); - return result.toPromise(); - } - - + private api: ObservableProviderApi; + + public constructor( + configuration: Configuration, + requestFactory?: ProviderApiRequestFactory, + responseProcessor?: ProviderApiResponseProcessor, + ) { + this.api = new ObservableProviderApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProvidersWithHttpInfo( + _options?: Configuration, + ): Promise>> { + const result = + this.api.providerControllerGetAllServiceProvidersWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProviders( + _options?: Configuration, + ): Promise> { + const result = this.api.providerControllerGetAllServiceProviders(_options); + return result.toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProvidersWithHttpInfo( + _options?: Configuration, + ): Promise>> { + const result = + this.api.providerControllerGetAvailableServiceProvidersWithHttpInfo( + _options, + ); + return result.toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProviders( + _options?: Configuration, + ): Promise> { + const result = + this.api.providerControllerGetAvailableServiceProviders(_options); + return result.toPromise(); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogoWithHttpInfo( + angebotId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.providerControllerGetServiceProviderLogoWithHttpInfo( + angebotId, + _options, + ); + return result.toPromise(); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogo( + angebotId: string, + _options?: Configuration, + ): Promise { + const result = this.api.providerControllerGetServiceProviderLogo( + angebotId, + _options, + ); + return result.toPromise(); + } } +import { ObservableRolleApi } from "./ObservableAPI.ts"; - -import { ObservableRolleApi } from './ObservableAPI.ts'; - -import { RolleApiRequestFactory, RolleApiResponseProcessor} from "../apis/RolleApi.ts"; +import { + RolleApiRequestFactory, + RolleApiResponseProcessor, +} from "../apis/RolleApi.ts"; export class PromiseRolleApi { - private api: ObservableRolleApi - - public constructor( - configuration: Configuration, - requestFactory?: RolleApiRequestFactory, - responseProcessor?: RolleApiResponseProcessor - ) { - this.api = new ObservableRolleApi(configuration, requestFactory, responseProcessor); - } - - /** - * Add systemrecht to a rolle. - * - * @param rolleId The id for the rolle. - * @param addSystemrechtBodyParams - */ - public rolleControllerAddSystemRechtWithHttpInfo(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Promise> { - const result = this.api.rolleControllerAddSystemRechtWithHttpInfo(rolleId, addSystemrechtBodyParams, _options); - return result.toPromise(); - } - - /** - * Add systemrecht to a rolle. - * - * @param rolleId The id for the rolle. - * @param addSystemrechtBodyParams - */ - public rolleControllerAddSystemRecht(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Promise { - const result = this.api.rolleControllerAddSystemRecht(rolleId, addSystemrechtBodyParams, _options); - return result.toPromise(); - } - - /** - * Create a new rolle. - * - * @param createRolleBodyParams - */ - public rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Promise> { - const result = this.api.rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams, _options); - return result.toPromise(); - } - - /** - * Create a new rolle. - * - * @param createRolleBodyParams - */ - public rolleControllerCreateRolle(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Promise { - const result = this.api.rolleControllerCreateRolle(createRolleBodyParams, _options); - return result.toPromise(); - } - - /** - * Delete a role by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerDeleteRolleWithHttpInfo(rolleId: string, _options?: Configuration): Promise> { - const result = this.api.rolleControllerDeleteRolleWithHttpInfo(rolleId, _options); - return result.toPromise(); - } - - /** - * Delete a role by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerDeleteRolle(rolleId: string, _options?: Configuration): Promise { - const result = this.api.rolleControllerDeleteRolle(rolleId, _options); - return result.toPromise(); - } - - /** - * Get rolle by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId: string, _options?: Configuration): Promise> { - const result = this.api.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId, _options); - return result.toPromise(); - } - - /** - * Get rolle by id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerFindRolleByIdWithServiceProviders(rolleId: string, _options?: Configuration): Promise { - const result = this.api.rolleControllerFindRolleByIdWithServiceProviders(rolleId, _options); - return result.toPromise(); - } - - /** - * List all rollen. - * - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchStr] The name for the role. - */ - public rolleControllerFindRollenWithHttpInfo(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Promise>> { - const result = this.api.rolleControllerFindRollenWithHttpInfo(offset, limit, searchStr, _options); - return result.toPromise(); - } - - /** - * List all rollen. - * - * @param [offset] The offset of the paginated list. - * @param [limit] The requested limit for the page size. - * @param [searchStr] The name for the role. - */ - public rolleControllerFindRollen(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Promise> { - const result = this.api.rolleControllerFindRollen(offset, limit, searchStr, _options); - return result.toPromise(); - } - - /** - * Get service-providers for a rolle by its id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId: string, _options?: Configuration): Promise> { - const result = this.api.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId, _options); - return result.toPromise(); - } - - /** - * Get service-providers for a rolle by its id. - * - * @param rolleId The id for the rolle. - */ - public rolleControllerGetRolleServiceProviderIds(rolleId: string, _options?: Configuration): Promise { - const result = this.api.rolleControllerGetRolleServiceProviderIds(rolleId, _options); - return result.toPromise(); - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise> { - const result = this.api.rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options); - return result.toPromise(); - } - - /** - * Remove a service-provider from a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerRemoveServiceProviderById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise { - const result = this.api.rolleControllerRemoveServiceProviderById(rolleId, rolleServiceProviderBodyParams, _options); - return result.toPromise(); - } - - /** - * Update rolle. - * - * @param rolleId The id for the rolle. - * @param updateRolleBodyParams - */ - public rolleControllerUpdateRolleWithHttpInfo(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Promise> { - const result = this.api.rolleControllerUpdateRolleWithHttpInfo(rolleId, updateRolleBodyParams, _options); - return result.toPromise(); - } - - /** - * Update rolle. - * - * @param rolleId The id for the rolle. - * @param updateRolleBodyParams - */ - public rolleControllerUpdateRolle(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Promise { - const result = this.api.rolleControllerUpdateRolle(rolleId, updateRolleBodyParams, _options); - return result.toPromise(); - } - - /** - * Add a service-provider to a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise>> { - const result = this.api.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options); - return result.toPromise(); - } - - /** - * Add a service-provider to a rolle by id. - * - * @param rolleId The id for the rolle. - * @param rolleServiceProviderBodyParams - */ - public rolleControllerUpdateServiceProvidersById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise> { - const result = this.api.rolleControllerUpdateServiceProvidersById(rolleId, rolleServiceProviderBodyParams, _options); - return result.toPromise(); - } - - + private api: ObservableRolleApi; + + public constructor( + configuration: Configuration, + requestFactory?: RolleApiRequestFactory, + responseProcessor?: RolleApiResponseProcessor, + ) { + this.api = new ObservableRolleApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRechtWithHttpInfo( + rolleId: string, + addSystemrechtBodyParams: AddSystemrechtBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.rolleControllerAddSystemRechtWithHttpInfo( + rolleId, + addSystemrechtBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRecht( + rolleId: string, + addSystemrechtBodyParams: AddSystemrechtBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerAddSystemRecht( + rolleId, + addSystemrechtBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolleWithHttpInfo( + createRolleBodyParams: CreateRolleBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.rolleControllerCreateRolleWithHttpInfo( + createRolleBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolle( + createRolleBodyParams: CreateRolleBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerCreateRolle( + createRolleBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolleWithHttpInfo( + rolleId: string, + _options?: Configuration, + ): Promise> { + const result = this.api.rolleControllerDeleteRolleWithHttpInfo( + rolleId, + _options, + ); + return result.toPromise(); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolle( + rolleId: string, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerDeleteRolle(rolleId, _options); + return result.toPromise(); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + rolleId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo( + rolleId, + _options, + ); + return result.toPromise(); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProviders( + rolleId: string, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerFindRolleByIdWithServiceProviders( + rolleId, + _options, + ); + return result.toPromise(); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollenWithHttpInfo( + offset?: number, + limit?: number, + searchStr?: string, + _options?: Configuration, + ): Promise>> { + const result = this.api.rolleControllerFindRollenWithHttpInfo( + offset, + limit, + searchStr, + _options, + ); + return result.toPromise(); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollen( + offset?: number, + limit?: number, + searchStr?: string, + _options?: Configuration, + ): Promise> { + const result = this.api.rolleControllerFindRollen( + offset, + limit, + searchStr, + _options, + ); + return result.toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + rolleId: string, + _options?: Configuration, + ): Promise> { + const result = + this.api.rolleControllerGetRolleServiceProviderIdsWithHttpInfo( + rolleId, + _options, + ); + return result.toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIds( + rolleId: string, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerGetRolleServiceProviderIds( + rolleId, + _options, + ); + return result.toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderByIdWithHttpInfo( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Promise> { + const result = + this.api.rolleControllerRemoveServiceProviderByIdWithHttpInfo( + rolleId, + rolleServiceProviderBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderById( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerRemoveServiceProviderById( + rolleId, + rolleServiceProviderBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolleWithHttpInfo( + rolleId: string, + updateRolleBodyParams: UpdateRolleBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.rolleControllerUpdateRolleWithHttpInfo( + rolleId, + updateRolleBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolle( + rolleId: string, + updateRolleBodyParams: UpdateRolleBodyParams, + _options?: Configuration, + ): Promise { + const result = this.api.rolleControllerUpdateRolle( + rolleId, + updateRolleBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Promise>> { + const result = + this.api.rolleControllerUpdateServiceProvidersByIdWithHttpInfo( + rolleId, + rolleServiceProviderBodyParams, + _options, + ); + return result.toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersById( + rolleId: string, + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, + _options?: Configuration, + ): Promise> { + const result = this.api.rolleControllerUpdateServiceProvidersById( + rolleId, + rolleServiceProviderBodyParams, + _options, + ); + return result.toPromise(); + } } +import { ObservableStatusApi } from "./ObservableAPI.ts"; - -import { ObservableStatusApi } from './ObservableAPI.ts'; - -import { StatusApiRequestFactory, StatusApiResponseProcessor} from "../apis/StatusApi.ts"; +import { + StatusApiRequestFactory, + StatusApiResponseProcessor, +} from "../apis/StatusApi.ts"; export class PromiseStatusApi { - private api: ObservableStatusApi - - public constructor( - configuration: Configuration, - requestFactory?: StatusApiRequestFactory, - responseProcessor?: StatusApiResponseProcessor - ) { - this.api = new ObservableStatusApi(configuration, requestFactory, responseProcessor); - } - - /** - */ - public statusControllerGetStatusWithHttpInfo(_options?: Configuration): Promise> { - const result = this.api.statusControllerGetStatusWithHttpInfo(_options); - return result.toPromise(); - } - - /** - */ - public statusControllerGetStatus(_options?: Configuration): Promise { - const result = this.api.statusControllerGetStatus(_options); - return result.toPromise(); - } - - + private api: ObservableStatusApi; + + public constructor( + configuration: Configuration, + requestFactory?: StatusApiRequestFactory, + responseProcessor?: StatusApiResponseProcessor, + ) { + this.api = new ObservableStatusApi( + configuration, + requestFactory, + responseProcessor, + ); + } + + /** + */ + public statusControllerGetStatusWithHttpInfo( + _options?: Configuration, + ): Promise> { + const result = this.api.statusControllerGetStatusWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public statusControllerGetStatus(_options?: Configuration): Promise { + const result = this.api.statusControllerGetStatus(_options); + return result.toPromise(); + } } - - - diff --git a/loadtest/api-client/generated/util.ts b/loadtest/api-client/generated/util.ts index 96ea3df..f74fd1f 100644 --- a/loadtest/api-client/generated/util.ts +++ b/loadtest/api-client/generated/util.ts @@ -7,31 +7,34 @@ * @param code the http status code to be checked against the code range */ export function isCodeInRange(codeRange: string, code: number): boolean { - // This is how the default value is encoded in OAG - if (codeRange === "0") { - return true; + // This is how the default value is encoded in OAG + if (codeRange === "0") { + return true; + } + if (codeRange == code.toString()) { + return true; + } else { + const codeString = code.toString(); + if (codeString.length != codeRange.length) { + return false; } - if (codeRange == code.toString()) { - return true; - } else { - const codeString = code.toString(); - if (codeString.length != codeRange.length) { - return false; - } - for (let i = 0; i < codeString.length; i++) { - if (codeRange.charAt(i) != "X" && codeRange.charAt(i) != codeString.charAt(i)) { - return false; - } - } - return true; + for (let i = 0; i < codeString.length; i++) { + if ( + codeRange.charAt(i) != "X" && + codeRange.charAt(i) != codeString.charAt(i) + ) { + return false; + } } + return true; + } } /** -* Returns if it can consume form -* -* @param consumes array -*/ + * Returns if it can consume form + * + * @param consumes array + */ export function canConsumeForm(contentTypes: string[]): boolean { - return contentTypes.indexOf('multipart/form-data') !== -1 + return contentTypes.indexOf("multipart/form-data") !== -1; } diff --git a/loadtest/pages/login.ts b/loadtest/pages/login.ts index a3fcfaf..0a5ddf4 100644 --- a/loadtest/pages/login.ts +++ b/loadtest/pages/login.ts @@ -54,6 +54,13 @@ class LoginPage implements PageObject { "password-new": newPassword, "password-confirm": newPassword, }, + params: { + tags: { + name: removeQueryString( + response.html("form").attr("action") ?? "submit login form", + ), + }, + }, }); if (response.status !== 200 && response.status !== 302) { fail("login failed"); diff --git a/loadtest/pages/user-details.ts b/loadtest/pages/user-details.ts index fe16aab..52c96d0 100644 --- a/loadtest/pages/user-details.ts +++ b/loadtest/pages/user-details.ts @@ -1,5 +1,5 @@ import { group } from "k6"; -import { DBiamPersonenzuordnungResponse } from "../api-client/generated/models/DBiamPersonenzuordnungResponse"; +import { DBiamPersonenzuordnungResponse } from "../api-client/generated/models/DBiamPersonenzuordnungResponse.ts"; import { getLoginInfo, getParentOrganisationenByIds, diff --git a/loadtest/pages/user-list.ts b/loadtest/pages/user-list.ts index e895fd3..62967c1 100644 --- a/loadtest/pages/user-list.ts +++ b/loadtest/pages/user-list.ts @@ -1,6 +1,6 @@ -import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse"; -import { FindRollenResponse } from "../api-client/generated/models/FindRollenResponse"; -import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse.ts"; +import { FindRollenResponse } from "../api-client/generated/models/FindRollenResponse.ts"; +import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse.ts"; import { getLoginInfo, getOrganisationen, diff --git a/loadtest/usecases/1_login.ts b/loadtest/usecases/1_login.ts index 7b41268..bc5dd68 100644 --- a/loadtest/usecases/1_login.ts +++ b/loadtest/usecases/1_login.ts @@ -1,40 +1,22 @@ import { check, group } from "k6"; import { RefinedResponse, ResponseType } from "k6/http"; import { Counter, Trend } from "k6/metrics"; -import { logout } from "../pages/index.ts"; import { loginPage } from "../pages/login.ts"; import { defaultHttpCheck, defaultTimingCheck } from "../util/checks.ts"; import { getDefaultOptions } from "../util/config.ts"; -import { login } from "../util/page.ts"; -import { createLogins, deleteAllTestUsers } from "../util/resource-helper.ts"; import { wrapTestFunction } from "../util/usecase-wrapper.ts"; -import { LoginData, UserMix } from "../util/users.ts"; +import { UserMix } from "../util/users.ts"; const successfulLoginCounter = new Counter("successful_logins_counter"); const successfulLoginDuration = new Trend("successful_logins_duration", true); -type TestData = { - users: Array; -}; - export const options = { ...getDefaultOptions(), }; const admin = new UserMix({ SYSADMIN: 1 }); -export function setup() { - login(admin.getLogin()); - deleteAllTestUsers(); - const users = createLogins({ LEHR: 100 }); - logout(); - return { users }; -} -export function teardown() { - login(admin.getLogin()); - deleteAllTestUsers(); - logout(); -} +const user = admin.getLogin(); export default wrapTestFunction(main); -function main({ users }: TestData) { +function main() { /** * URL for final login, which we obtain from keycloak during oidc-login */ @@ -51,7 +33,6 @@ function main({ users }: TestData) { group("submit form", () => { // submit form - const user = users[__VU - 1]; keycloakFormResponse = loginPage.submitForm(loginPageResponse, user); check(keycloakFormResponse, { "submitting login form to kc succeeded": () => diff --git a/loadtest/usecases/1_show-user-list.ts b/loadtest/usecases/1_show-user-list.ts index 7de3943..d8e5097 100644 --- a/loadtest/usecases/1_show-user-list.ts +++ b/loadtest/usecases/1_show-user-list.ts @@ -1,5 +1,5 @@ import { group } from "k6"; -import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse.ts"; import { userListPage } from "../pages/user-list.ts"; import { getLoginInfo, @@ -12,16 +12,18 @@ import { getDefaultOptions } from "../util/config.ts"; import { pickRandomItem } from "../util/data.ts"; import { login } from "../util/page.ts"; import { wrapTestFunction } from "../util/usecase-wrapper.ts"; -import { getDefaultAdminMix } from "../util/users.ts"; +import { UserMix } from "../util/users.ts"; export const options = { ...getDefaultOptions(), }; +const admin = new UserMix({ SYSADMIN: 1 }); +const user = admin.getLogin(); export default wrapTestFunction(main); -function main(users = getDefaultAdminMix()) { - login(users.getLogin()); +function main() { + login(user); // these are used to test the filters let orgId = ""; let rolleId = ""; diff --git a/loadtest/usecases/2_goto-sp-saml.ts b/loadtest/usecases/2_goto-sp-saml.ts index dad36da..d7e69d1 100644 --- a/loadtest/usecases/2_goto-sp-saml.ts +++ b/loadtest/usecases/2_goto-sp-saml.ts @@ -1,20 +1,40 @@ import { check, fail, group } from "k6"; import { get } from "k6/http"; +import { logout } from "../pages/index.ts"; import { getDefaultOptions } from "../util/config.ts"; import { loadPage, login } from "../util/page.ts"; +import { createLogins, deleteAllTestUsers } from "../util/resource-helper.ts"; import { wrapTestFunction } from "../util/usecase-wrapper.ts"; -import { UserMix } from "../util/users.ts"; +import { LoginData, UserMix } from "../util/users.ts"; + +type TestData = { + users: Array; +}; export const options = { ...getDefaultOptions(), + setupTimeout: "180s", }; +const admin = new UserMix({ SYSADMIN: 1 }); +export function setup() { + login(admin.getLogin()); + deleteAllTestUsers(); + const users = createLogins({ LEHR: 100 }); + logout(); + return { users }; +} +export function teardown() { + login(admin.getLogin()); + deleteAllTestUsers(); + logout(); +} const serviceProviderName = "School-SH"; export default wrapTestFunction(main); -function main(users = new UserMix({ LEHR: 1000 })) { - const { providers } = login(users.getLogin()); +function main({ users }: TestData) { + const { providers } = login(users[__VU - 1]); const response = group("follow link", () => { const target = providers.find((p) => p.name == serviceProviderName); @@ -23,13 +43,17 @@ function main(users = new UserMix({ LEHR: 1000 })) { }); group("finish saml", () => { - let submissionResponse = response.submitForm(); + let submissionResponse = response.submitForm({ + params: { tags: { name: "post to kc" } }, + }); check(submissionResponse, { "post to kc succeeded": (r) => r.status == 200, }); - submissionResponse = submissionResponse.submitForm(); + submissionResponse = submissionResponse.submitForm({ + params: { tags: { name: "post to gateway" } }, + }); check(submissionResponse, { - "post to school-sh succeeded": (r) => r.status == 200, + "post to gateway succeeded": (r) => r.status == 200, }); const stringifiedBody = submissionResponse.body?.toString(); diff --git a/loadtest/util/api.ts b/loadtest/util/api.ts index 7490f10..edbe243 100644 --- a/loadtest/util/api.ts +++ b/loadtest/util/api.ts @@ -11,23 +11,23 @@ import { ResponseType, url, } from "k6/http"; -import { CreateOrganisationBodyParams } from "../api-client/generated/models/CreateOrganisationBodyParams"; -import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams"; -import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response"; -import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse"; -import { DBiamPersonResponse } from "../api-client/generated/models/DBiamPersonResponse"; -import { FindRollenResponse } from "../api-client/generated/models/FindRollenResponse"; -import { LockUserBodyParams } from "../api-client/generated/models/LockUserBodyParams"; -import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse"; -import { ParentOrganisationenResponse } from "../api-client/generated/models/ParentOrganisationenResponse"; -import { PersonendatensatzResponse } from "../api-client/generated/models/PersonendatensatzResponse"; -import { PersonenkontextWorkflowResponse } from "../api-client/generated/models/PersonenkontextWorkflowResponse"; -import { PersonFrontendControllerFindPersons200Response } from "../api-client/generated/models/PersonFrontendControllerFindPersons200Response"; -import { PersonInfoResponse } from "../api-client/generated/models/PersonInfoResponse"; -import { ServiceProviderResponse } from "../api-client/generated/models/ServiceProviderResponse"; -import { TokenRequiredResponse } from "../api-client/generated/models/TokenRequiredResponse"; -import { TokenStateResponse } from "../api-client/generated/models/TokenStateResponse"; -import { UserinfoResponse } from "../api-client/generated/models/UserinfoResponse"; +import { CreateOrganisationBodyParams } from "../api-client/generated/models/CreateOrganisationBodyParams.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse.ts"; +import { DBiamPersonResponse } from "../api-client/generated/models/DBiamPersonResponse.ts"; +import { FindRollenResponse } from "../api-client/generated/models/FindRollenResponse.ts"; +import { LockUserBodyParams } from "../api-client/generated/models/LockUserBodyParams.ts"; +import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse.ts"; +import { ParentOrganisationenResponse } from "../api-client/generated/models/ParentOrganisationenResponse.ts"; +import { PersonendatensatzResponse } from "../api-client/generated/models/PersonendatensatzResponse.ts"; +import { PersonenkontextWorkflowResponse } from "../api-client/generated/models/PersonenkontextWorkflowResponse.ts"; +import { PersonFrontendControllerFindPersons200Response } from "../api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts"; +import { PersonInfoResponse } from "../api-client/generated/models/PersonInfoResponse.ts"; +import { ServiceProviderResponse } from "../api-client/generated/models/ServiceProviderResponse.ts"; +import { TokenRequiredResponse } from "../api-client/generated/models/TokenRequiredResponse.ts"; +import { TokenStateResponse } from "../api-client/generated/models/TokenStateResponse.ts"; +import { UserinfoResponse } from "../api-client/generated/models/UserinfoResponse.ts"; import { defaultHttpCheck, defaultTimingCheck, diff --git a/loadtest/util/config.ts b/loadtest/util/config.ts index 1be5af7..8913600 100644 --- a/loadtest/util/config.ts +++ b/loadtest/util/config.ts @@ -4,14 +4,15 @@ export const MAX_VUS = Number.parseInt(__ENV["MAX_VUS"]); export enum CONFIG { SPIKE = "spike", STRESS = "stress", - BREAKPOINT = "breakpoint", PLATEAU = "plateau", + BREAKPOINT = "breakpoint", DEBUG = "debug", } export function getConfig(): CONFIG { const config = __ENV["CONFIG"]; if (config == CONFIG.SPIKE.toString()) return CONFIG.SPIKE; if (config == CONFIG.STRESS.toString()) return CONFIG.STRESS; + if (config == CONFIG.PLATEAU.toString()) return CONFIG.PLATEAU; if (config == CONFIG.BREAKPOINT.toString()) return CONFIG.BREAKPOINT; if (config == CONFIG.PLATEAU.toString()) return CONFIG.PLATEAU; if (config == CONFIG.DEBUG.toString()) return CONFIG.DEBUG; @@ -42,14 +43,6 @@ export function getDefaultOptions() { { duration: "1m", target: 0 }, // ramp down 3 ], }; - case CONFIG.BREAKPOINT: - return { - stages: [{ duration: "10m", target: maxVUs }], - thresholds: { - http_req_failed: [{ threshold: "rate<0.10", abortOnFail: true }], - http_req_duration: [{ threshold: "p(95)<5000", abortOnFail: true }], - }, - }; case CONFIG.PLATEAU: return { stages: [ @@ -61,6 +54,14 @@ export function getDefaultOptions() { { duration: "1m", target: 0 }, ], }; + case CONFIG.BREAKPOINT: + return { + stages: [{ duration: "10m", target: maxVUs }], + thresholds: { + http_req_failed: [{ threshold: "rate<0.10", abortOnFail: true }], + http_req_duration: [{ threshold: "p(95)<5000", abortOnFail: true }], + }, + }; case CONFIG.DEBUG: return { stages: [{ duration: "1s", target: maxVUs }], diff --git a/loadtest/util/resource-helper.ts b/loadtest/util/resource-helper.ts index 721da22..48301a0 100644 --- a/loadtest/util/resource-helper.ts +++ b/loadtest/util/resource-helper.ts @@ -1,5 +1,5 @@ import { fail } from "k6"; -import { batch, BatchRequest } from "k6/http"; +import { batch, BatchRequest, url } from "k6/http"; import { CreateOrganisationBodyParams } from "../api-client/generated/models/CreateOrganisationBodyParams.ts"; import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; import { DBiamPersonResponse } from "../api-client/generated/models/DBiamPersonResponse.ts"; @@ -161,7 +161,7 @@ export function deleteTestUsers(ids: Array) { batch( ids.map((id) => ({ method: "DELETE", - url: `${getBackendUrl()}personen/${id}`, + url: url`${getBackendUrl()}personen/${id}`, })), ); } catch {