From 8d7744e82303968e64c2255c3cbc5a54d5380a78 Mon Sep 17 00:00:00 2001 From: clauyan Date: Fri, 29 Nov 2024 13:28:27 +0100 Subject: [PATCH] Spsh 1390 (#19) * setup * clean up + updates * add missing config case * add queries as tag * only include set values in query-tag * remove qs from log * dbg: increase timeout * only use normal admins * add more time checks * disable string filter test * reenable suchString+SYSADMINs * add user creation in setup * formatting * update spec * try different import * make imports specific * commit generated client * add check * reduce to 1 timing check * add null safety to check * make uc more robust * simplify urls in metrics * revert gha for merge --- .github/workflows/trigger-loadtest.yml | 4 +- .gitignore | 1 - charts/schulportal-load-tests/values.yaml | 8 +- loadtest/api-client/generated/.gitattributes | 8 + loadtest/api-client/generated/.gitignore | 1 + .../generated/.openapi-generator-ignore | 23 + .../generated/.openapi-generator/FILES | 144 + .../generated/.openapi-generator/VERSION | 1 + loadtest/api-client/generated/AuthApi.md | 212 ++ loadtest/api-client/generated/Class2FAApi.md | 367 +++ loadtest/api-client/generated/CronApi.md | 212 ++ .../generated/DbiamPersonenkontexteApi.md | 130 + .../generated/DbiamPersonenuebersichtApi.md | 125 + loadtest/api-client/generated/ImportApi.md | 191 ++ .../api-client/generated/OrganisationenApi.md | 877 ++++++ .../generated/PersonAdministrationApi.md | 68 + .../api-client/generated/PersonInfoApi.md | 56 + loadtest/api-client/generated/PersonenApi.md | 746 +++++ .../generated/PersonenFrontendApi.md | 99 + .../generated/PersonenkontextApi.md | 282 ++ .../generated/PersonenkontexteApi.md | 318 ++ loadtest/api-client/generated/ProviderApi.md | 167 ++ loadtest/api-client/generated/README.md | 80 + loadtest/api-client/generated/RolleApi.md | 576 ++++ loadtest/api-client/generated/StatusApi.md | 55 + loadtest/api-client/generated/apis/AuthApi.ts | 265 ++ .../api-client/generated/apis/Class2FAApi.ts | 575 ++++ loadtest/api-client/generated/apis/CronApi.ts | 326 ++ .../apis/DbiamPersonenkontexteApi.ts | 199 ++ .../apis/DbiamPersonenuebersichtApi.ts | 192 ++ .../api-client/generated/apis/ImportApi.ts | 331 +++ .../generated/apis/OrganisationenApi.ts | 1361 +++++++++ .../generated/apis/PersonAdministrationApi.ts | 107 + .../generated/apis/PersonInfoApi.ts | 88 + .../api-client/generated/apis/PersonenApi.ts | 1119 +++++++ .../generated/apis/PersonenFrontendApi.ts | 176 ++ .../generated/apis/PersonenkontextApi.ts | 442 +++ .../generated/apis/PersonenkontexteApi.ts | 512 ++++ .../api-client/generated/apis/ProviderApi.ts | 253 ++ .../api-client/generated/apis/RolleApi.ts | 860 ++++++ .../api-client/generated/apis/StatusApi.ts | 68 + loadtest/api-client/generated/apis/baseapi.ts | 37 + .../api-client/generated/apis/exception.ts | 15 + loadtest/api-client/generated/auth/auth.ts | 107 + .../api-client/generated/configuration.ts | 82 + loadtest/api-client/generated/git_push.sh | 51 + loadtest/api-client/generated/http/http.ts | 256 ++ .../generated/http/isomorphic-fetch.ts | 31 + loadtest/api-client/generated/index.ts | 12 + loadtest/api-client/generated/middleware.ts | 66 + .../models/AddSystemrechtBodyParams.ts | 39 + .../models/AssignHardwareTokenBodyParams.ts | 57 + .../models/AssignHardwareTokenResponse.ts | 78 + .../models/CreateOrganisationBodyParams.ts | 99 + .../models/CreatePersonMigrationBodyParams.ts | 71 + .../generated/models/CreateRolleBodyParams.ts | 69 + .../generated/models/DBiamPersonResponse.ts | 45 + .../models/DBiamPersonenkontextResponse.ts | 57 + ...llerFindPersonenuebersichten200Response.ts | 58 + .../models/DBiamPersonenuebersichtResponse.ts | 75 + .../models/DBiamPersonenzuordnungResponse.ts | 103 + ...atePersonWithPersonenkontexteBodyParams.ts | 65 + .../DbiamCreatePersonenkontextBodyParams.ts | 43 + .../generated/models/DbiamImportError.ts | 56 + .../models/DbiamOrganisationError.ts | 67 + .../generated/models/DbiamPersonError.ts | 58 + .../models/DbiamPersonenkontextBodyParams.ts | 57 + .../models/DbiamPersonenkontextError.ts | 57 + ...DbiamPersonenkontextMigrationBodyParams.ts | 81 + .../DbiamPersonenkontexteUpdateError.ts | 59 + .../generated/models/DbiamRolleError.ts | 57 + .../DbiamUpdatePersonenkontexteBodyParams.ts | 57 + .../models/DeleteRevisionBodyParams.ts | 39 + .../generated/models/EmailAddressStatus.ts | 20 + .../generated/models/FindRollenResponse.ts | 44 + .../models/FindSchulstrukturknotenResponse.ts | 44 + .../api-client/generated/models/Geschlecht.ts | 20 + .../models/ImportDataItemResponse.ts | 57 + .../generated/models/ImportUploadResponse.ts | 77 + .../models/ImportvorgangByIdBodyParams.ts | 53 + .../generated/models/LockUserBodyParams.ts | 53 + .../generated/models/LoeschungResponse.ts | 36 + .../generated/models/ObjectSerializer.ts | 584 ++++ .../models/OrganisationByIdBodyParams.ts | 39 + .../models/OrganisationByNameBodyParams.ts | 46 + .../generated/models/OrganisationResponse.ts | 103 + .../models/OrganisationResponseLegacy.ts | 81 + .../OrganisationRootChildrenResponse.ts | 44 + .../generated/models/OrganisationsTyp.ts | 24 + .../models/ParentOrganisationenResponse.ts | 37 + .../ParentOrganisationsByIdsBodyParams.ts | 39 + .../api-client/generated/models/Person.ts | 118 + .../generated/models/PersonBirthParams.ts | 43 + .../generated/models/PersonBirthResponse.ts | 43 + ...ntrollerFindPersonenkontexte200Response.ts | 58 + .../generated/models/PersonEmailResponse.ts | 46 + ...rontendControllerFindPersons200Response.ts | 58 + .../generated/models/PersonIdResponse.ts | 36 + .../generated/models/PersonInfoResponse.ts | 70 + .../generated/models/PersonLockResponse.ts | 36 + .../models/PersonMetadataBodyParams.ts | 67 + .../generated/models/PersonNameParams.ts | 99 + .../generated/models/PersonNameResponse.ts | 99 + .../generated/models/PersonResponse.ts | 157 + .../models/PersonResponseAutomapper.ts | 121 + .../models/PersonendatensatzResponse.ts | 37 + .../PersonendatensatzResponseAutomapper.ts | 45 + .../models/PersonenkontextMigrationRuntype.ts | 18 + .../models/PersonenkontextResponse.ts | 128 + .../PersonenkontextRolleFieldsResponse.ts | 44 + .../models/PersonenkontextWorkflowResponse.ts | 81 + .../PersonenkontextdatensatzResponse.ts | 45 + .../models/PersonenkontexteUpdateResponse.ts | 37 + .../generated/models/Personenstatus.ts | 17 + .../models/PersonenuebersichtBodyParams.ts | 39 + .../generated/models/RawPagedResponse.ts | 57 + .../generated/models/RolleResponse.ts | 111 + .../models/RolleServiceProviderBodyParams.ts | 49 + .../models/RolleServiceProviderQueryParams.ts | 39 + .../models/RolleServiceProviderResponse.ts | 36 + .../RolleWithServiceProvidersResponse.ts | 119 + .../api-client/generated/models/RollenArt.ts | 22 + .../generated/models/RollenMerkmal.ts | 18 + .../generated/models/RollenSystemRecht.ts | 27 + ...lenSystemRechtServiceProviderIDResponse.ts | 43 + .../models/ServiceProviderIdNameResponse.ts | 43 + .../models/ServiceProviderKategorie.ts | 21 + .../models/ServiceProviderResponse.ts | 85 + .../generated/models/ServiceProviderTarget.ts | 19 + .../generated/models/Sichtfreigabe.ts | 18 + .../generated/models/SystemrechtResponse.ts | 65 + .../generated/models/TokenInitBodyParams.ts | 36 + .../generated/models/TokenRequiredResponse.ts | 36 + .../generated/models/TokenStateResponse.ts | 50 + .../generated/models/TokenVerifyBodyParams.ts | 43 + .../generated/models/TraegerschaftTyp.ts | 22 + .../models/UpdateOrganisationBodyParams.ts | 99 + .../models/UpdatePersonBodyParams.ts | 98 + .../generated/models/UpdateRolleBodyParams.ts | 66 + .../generated/models/UserLockParams.ts | 64 + .../generated/models/UserinfoResponse.ts | 184 ++ .../generated/models/Vertrauensstufe.ts | 20 + loadtest/api-client/generated/models/all.ts | 90 + loadtest/api-client/generated/package.json | 42 + loadtest/api-client/generated/rxjsStub.ts | 27 + loadtest/api-client/generated/servers.ts | 55 + loadtest/api-client/generated/tsconfig.json | 28 + .../generated/types/ObjectParamAPI.ts | 2437 +++++++++++++++ .../generated/types/ObservableAPI.ts | 2623 +++++++++++++++++ .../api-client/generated/types/PromiseAPI.ts | 1715 +++++++++++ loadtest/api-client/generated/util.ts | 37 + loadtest/api-client/openapispec.json | 205 +- loadtest/global.d.ts | 3 + loadtest/pages/login.ts | 24 + loadtest/pages/user-details.ts | 2 +- loadtest/pages/user-list.ts | 10 +- loadtest/usecases/1_login.ts | 27 +- loadtest/usecases/1_show-start.ts | 6 +- loadtest/usecases/1_show-user-list.ts | 6 +- loadtest/usecases/2_create-delete-new-user.ts | 73 +- loadtest/usecases/3_create-class.ts | 6 +- loadtest/usecases/3_lock_unlock_user.ts | 2 +- loadtest/usecases/3_reset-password.ts | 2 +- loadtest/util/api.ts | 62 +- loadtest/util/checks.ts | 3 +- loadtest/util/config.ts | 15 +- loadtest/util/resource-helper.ts | 72 +- loadtest/util/users.ts | 70 +- 168 files changed, 25640 insertions(+), 164 deletions(-) create mode 100644 loadtest/api-client/generated/.gitattributes create mode 100644 loadtest/api-client/generated/.gitignore create mode 100644 loadtest/api-client/generated/.openapi-generator-ignore create mode 100644 loadtest/api-client/generated/.openapi-generator/FILES create mode 100644 loadtest/api-client/generated/.openapi-generator/VERSION create mode 100644 loadtest/api-client/generated/AuthApi.md create mode 100644 loadtest/api-client/generated/Class2FAApi.md create mode 100644 loadtest/api-client/generated/CronApi.md create mode 100644 loadtest/api-client/generated/DbiamPersonenkontexteApi.md create mode 100644 loadtest/api-client/generated/DbiamPersonenuebersichtApi.md create mode 100644 loadtest/api-client/generated/ImportApi.md create mode 100644 loadtest/api-client/generated/OrganisationenApi.md create mode 100644 loadtest/api-client/generated/PersonAdministrationApi.md create mode 100644 loadtest/api-client/generated/PersonInfoApi.md create mode 100644 loadtest/api-client/generated/PersonenApi.md create mode 100644 loadtest/api-client/generated/PersonenFrontendApi.md create mode 100644 loadtest/api-client/generated/PersonenkontextApi.md create mode 100644 loadtest/api-client/generated/PersonenkontexteApi.md create mode 100644 loadtest/api-client/generated/ProviderApi.md create mode 100644 loadtest/api-client/generated/README.md create mode 100644 loadtest/api-client/generated/RolleApi.md create mode 100644 loadtest/api-client/generated/StatusApi.md create mode 100644 loadtest/api-client/generated/apis/AuthApi.ts create mode 100644 loadtest/api-client/generated/apis/Class2FAApi.ts create mode 100644 loadtest/api-client/generated/apis/CronApi.ts create mode 100644 loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts create mode 100644 loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts create mode 100644 loadtest/api-client/generated/apis/ImportApi.ts create mode 100644 loadtest/api-client/generated/apis/OrganisationenApi.ts create mode 100644 loadtest/api-client/generated/apis/PersonAdministrationApi.ts create mode 100644 loadtest/api-client/generated/apis/PersonInfoApi.ts create mode 100644 loadtest/api-client/generated/apis/PersonenApi.ts create mode 100644 loadtest/api-client/generated/apis/PersonenFrontendApi.ts create mode 100644 loadtest/api-client/generated/apis/PersonenkontextApi.ts create mode 100644 loadtest/api-client/generated/apis/PersonenkontexteApi.ts create mode 100644 loadtest/api-client/generated/apis/ProviderApi.ts create mode 100644 loadtest/api-client/generated/apis/RolleApi.ts create mode 100644 loadtest/api-client/generated/apis/StatusApi.ts create mode 100644 loadtest/api-client/generated/apis/baseapi.ts create mode 100644 loadtest/api-client/generated/apis/exception.ts create mode 100644 loadtest/api-client/generated/auth/auth.ts create mode 100644 loadtest/api-client/generated/configuration.ts create mode 100644 loadtest/api-client/generated/git_push.sh create mode 100644 loadtest/api-client/generated/http/http.ts create mode 100644 loadtest/api-client/generated/http/isomorphic-fetch.ts create mode 100644 loadtest/api-client/generated/index.ts create mode 100644 loadtest/api-client/generated/middleware.ts create mode 100644 loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts create mode 100644 loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts create mode 100644 loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts create mode 100644 loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts create mode 100644 loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts create mode 100644 loadtest/api-client/generated/models/CreateRolleBodyParams.ts create mode 100644 loadtest/api-client/generated/models/DBiamPersonResponse.ts create mode 100644 loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts create mode 100644 loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts create mode 100644 loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts create mode 100644 loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts create mode 100644 loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts create mode 100644 loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts create mode 100644 loadtest/api-client/generated/models/DbiamImportError.ts create mode 100644 loadtest/api-client/generated/models/DbiamOrganisationError.ts create mode 100644 loadtest/api-client/generated/models/DbiamPersonError.ts create mode 100644 loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts create mode 100644 loadtest/api-client/generated/models/DbiamPersonenkontextError.ts create mode 100644 loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts create mode 100644 loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts create mode 100644 loadtest/api-client/generated/models/DbiamRolleError.ts create mode 100644 loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts create mode 100644 loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts create mode 100644 loadtest/api-client/generated/models/EmailAddressStatus.ts create mode 100644 loadtest/api-client/generated/models/FindRollenResponse.ts create mode 100644 loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts create mode 100644 loadtest/api-client/generated/models/Geschlecht.ts create mode 100644 loadtest/api-client/generated/models/ImportDataItemResponse.ts create mode 100644 loadtest/api-client/generated/models/ImportUploadResponse.ts create mode 100644 loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts create mode 100644 loadtest/api-client/generated/models/LockUserBodyParams.ts create mode 100644 loadtest/api-client/generated/models/LoeschungResponse.ts create mode 100644 loadtest/api-client/generated/models/ObjectSerializer.ts create mode 100644 loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts create mode 100644 loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts create mode 100644 loadtest/api-client/generated/models/OrganisationResponse.ts create mode 100644 loadtest/api-client/generated/models/OrganisationResponseLegacy.ts create mode 100644 loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts create mode 100644 loadtest/api-client/generated/models/OrganisationsTyp.ts create mode 100644 loadtest/api-client/generated/models/ParentOrganisationenResponse.ts create mode 100644 loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts create mode 100644 loadtest/api-client/generated/models/Person.ts create mode 100644 loadtest/api-client/generated/models/PersonBirthParams.ts create mode 100644 loadtest/api-client/generated/models/PersonBirthResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts create mode 100644 loadtest/api-client/generated/models/PersonEmailResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts create mode 100644 loadtest/api-client/generated/models/PersonIdResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonInfoResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonLockResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonMetadataBodyParams.ts create mode 100644 loadtest/api-client/generated/models/PersonNameParams.ts create mode 100644 loadtest/api-client/generated/models/PersonNameResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonResponseAutomapper.ts create mode 100644 loadtest/api-client/generated/models/PersonendatensatzResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts create mode 100644 loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts create mode 100644 loadtest/api-client/generated/models/PersonenkontextResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts create mode 100644 loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts create mode 100644 loadtest/api-client/generated/models/Personenstatus.ts create mode 100644 loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts create mode 100644 loadtest/api-client/generated/models/RawPagedResponse.ts create mode 100644 loadtest/api-client/generated/models/RolleResponse.ts create mode 100644 loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts create mode 100644 loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts create mode 100644 loadtest/api-client/generated/models/RolleServiceProviderResponse.ts create mode 100644 loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts create mode 100644 loadtest/api-client/generated/models/RollenArt.ts create mode 100644 loadtest/api-client/generated/models/RollenMerkmal.ts create mode 100644 loadtest/api-client/generated/models/RollenSystemRecht.ts create mode 100644 loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts create mode 100644 loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts create mode 100644 loadtest/api-client/generated/models/ServiceProviderKategorie.ts create mode 100644 loadtest/api-client/generated/models/ServiceProviderResponse.ts create mode 100644 loadtest/api-client/generated/models/ServiceProviderTarget.ts create mode 100644 loadtest/api-client/generated/models/Sichtfreigabe.ts create mode 100644 loadtest/api-client/generated/models/SystemrechtResponse.ts create mode 100644 loadtest/api-client/generated/models/TokenInitBodyParams.ts create mode 100644 loadtest/api-client/generated/models/TokenRequiredResponse.ts create mode 100644 loadtest/api-client/generated/models/TokenStateResponse.ts create mode 100644 loadtest/api-client/generated/models/TokenVerifyBodyParams.ts create mode 100644 loadtest/api-client/generated/models/TraegerschaftTyp.ts create mode 100644 loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts create mode 100644 loadtest/api-client/generated/models/UpdatePersonBodyParams.ts create mode 100644 loadtest/api-client/generated/models/UpdateRolleBodyParams.ts create mode 100644 loadtest/api-client/generated/models/UserLockParams.ts create mode 100644 loadtest/api-client/generated/models/UserinfoResponse.ts create mode 100644 loadtest/api-client/generated/models/Vertrauensstufe.ts create mode 100644 loadtest/api-client/generated/models/all.ts create mode 100644 loadtest/api-client/generated/package.json create mode 100644 loadtest/api-client/generated/rxjsStub.ts create mode 100644 loadtest/api-client/generated/servers.ts create mode 100644 loadtest/api-client/generated/tsconfig.json create mode 100644 loadtest/api-client/generated/types/ObjectParamAPI.ts create mode 100644 loadtest/api-client/generated/types/ObservableAPI.ts create mode 100644 loadtest/api-client/generated/types/PromiseAPI.ts create mode 100644 loadtest/api-client/generated/util.ts create mode 100644 loadtest/global.d.ts diff --git a/.github/workflows/trigger-loadtest.yml b/.github/workflows/trigger-loadtest.yml index c4ff338..9321af2 100644 --- a/.github/workflows/trigger-loadtest.yml +++ b/.github/workflows/trigger-loadtest.yml @@ -8,7 +8,7 @@ on: description: "Branch to take test code and helm/cron setup from" required: false type: string - default: main + default: "main" branch_img: description: "Branch to take Dockerfile/img from" required: false @@ -23,7 +23,7 @@ on: description: "sets CONFIG env var used as k6 input" required: false type: string - default: "debug" + default: "plateau" max_vus: description: "sets the maximum number of virtual users" required: false diff --git a/.gitignore b/.gitignore index 29fd2c5..82ef784 100644 --- a/.gitignore +++ b/.gitignore @@ -130,5 +130,4 @@ dist .pnp.* loadtest/data/users.json -loadtest/api-client/generated/ output/ \ No newline at end of file diff --git a/charts/schulportal-load-tests/values.yaml b/charts/schulportal-load-tests/values.yaml index d1b8949..a3b9be1 100644 --- a/charts/schulportal-load-tests/values.yaml +++ b/charts/schulportal-load-tests/values.yaml @@ -11,12 +11,10 @@ cronjobs: serviceName: dev-scenario spsh_base: "https://main.dev.spsh.dbildungsplattform.de" kc_base: "kc_base" - # jobsParallelism: not used yet but available? test it staging-scenario: serviceName: staging-scenario spsh_base: "https://spsh.staging.spsh.dbildungsplattform.de" kc_base: "https://keycloak.staging.spsh.dbildungsplattform.de" - # prod-scenario: - # serviceName: prod-scenario - # image: ghcr.io/dbildungsplattform/schulportal-load-tests:latest - # environment: spsh.dbildungsplattform.de + prod-scenario: + serviceName: prod-scenario + spsh_base: "https://spsh.dbildungsplattform.de" diff --git a/loadtest/api-client/generated/.gitattributes b/loadtest/api-client/generated/.gitattributes new file mode 100644 index 0000000..7bf5a17 --- /dev/null +++ b/loadtest/api-client/generated/.gitattributes @@ -0,0 +1,8 @@ +**/* linguist-generated +*.md linguist-documentation + +.gitattributes text +.gitattributes export-ignore + +.gitignore text +.gitignore export-ignore diff --git a/loadtest/api-client/generated/.gitignore b/loadtest/api-client/generated/.gitignore new file mode 100644 index 0000000..1521c8b --- /dev/null +++ b/loadtest/api-client/generated/.gitignore @@ -0,0 +1 @@ +dist diff --git a/loadtest/api-client/generated/.openapi-generator-ignore b/loadtest/api-client/generated/.openapi-generator-ignore new file mode 100644 index 0000000..7484ee5 --- /dev/null +++ b/loadtest/api-client/generated/.openapi-generator-ignore @@ -0,0 +1,23 @@ +# OpenAPI Generator Ignore +# Generated by openapi-generator https://github.com/openapitools/openapi-generator + +# Use this file to prevent files from being overwritten by the generator. +# The patterns follow closely to .gitignore or .dockerignore. + +# As an example, the C# client generator defines ApiClient.cs. +# You can make changes and tell OpenAPI Generator to ignore just this file by uncommenting the following line: +#ApiClient.cs + +# You can match any string of characters against a directory, file or extension with a single asterisk (*): +#foo/*/qux +# The above matches foo/bar/qux and foo/baz/qux, but not foo/bar/baz/qux + +# You can recursively match patterns against a directory, file or extension with a double asterisk (**): +#foo/**/qux +# This matches foo/bar/qux, foo/baz/qux, and foo/bar/baz/qux + +# You can also negate patterns with an exclamation (!). +# For example, you can ignore all files in a docs folder with the file extension .md: +#docs/*.md +# Then explicitly reverse the ignore rule for a single file: +#!docs/README.md diff --git a/loadtest/api-client/generated/.openapi-generator/FILES b/loadtest/api-client/generated/.openapi-generator/FILES new file mode 100644 index 0000000..cf508dc --- /dev/null +++ b/loadtest/api-client/generated/.openapi-generator/FILES @@ -0,0 +1,144 @@ +.gitattributes +.gitignore +AuthApi.md +Class2FAApi.md +CronApi.md +DbiamPersonenkontexteApi.md +DbiamPersonenuebersichtApi.md +ImportApi.md +OrganisationenApi.md +PersonAdministrationApi.md +PersonInfoApi.md +PersonenApi.md +PersonenFrontendApi.md +PersonenkontextApi.md +PersonenkontexteApi.md +ProviderApi.md +README.md +RolleApi.md +StatusApi.md +apis/AuthApi.ts +apis/Class2FAApi.ts +apis/CronApi.ts +apis/DbiamPersonenkontexteApi.ts +apis/DbiamPersonenuebersichtApi.ts +apis/ImportApi.ts +apis/OrganisationenApi.ts +apis/PersonAdministrationApi.ts +apis/PersonInfoApi.ts +apis/PersonenApi.ts +apis/PersonenFrontendApi.ts +apis/PersonenkontextApi.ts +apis/PersonenkontexteApi.ts +apis/ProviderApi.ts +apis/RolleApi.ts +apis/StatusApi.ts +apis/baseapi.ts +apis/exception.ts +auth/auth.ts +configuration.ts +git_push.sh +http/http.ts +http/isomorphic-fetch.ts +index.ts +middleware.ts +models/AddSystemrechtBodyParams.ts +models/AssignHardwareTokenBodyParams.ts +models/AssignHardwareTokenResponse.ts +models/CreateOrganisationBodyParams.ts +models/CreatePersonMigrationBodyParams.ts +models/CreateRolleBodyParams.ts +models/DBiamPersonResponse.ts +models/DBiamPersonenkontextResponse.ts +models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts +models/DBiamPersonenuebersichtResponse.ts +models/DBiamPersonenzuordnungResponse.ts +models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts +models/DbiamCreatePersonenkontextBodyParams.ts +models/DbiamImportError.ts +models/DbiamOrganisationError.ts +models/DbiamPersonError.ts +models/DbiamPersonenkontextBodyParams.ts +models/DbiamPersonenkontextError.ts +models/DbiamPersonenkontextMigrationBodyParams.ts +models/DbiamPersonenkontexteUpdateError.ts +models/DbiamRolleError.ts +models/DbiamUpdatePersonenkontexteBodyParams.ts +models/DeleteRevisionBodyParams.ts +models/EmailAddressStatus.ts +models/FindRollenResponse.ts +models/FindSchulstrukturknotenResponse.ts +models/Geschlecht.ts +models/ImportDataItemResponse.ts +models/ImportUploadResponse.ts +models/ImportvorgangByIdBodyParams.ts +models/LockUserBodyParams.ts +models/LoeschungResponse.ts +models/ObjectSerializer.ts +models/OrganisationByIdBodyParams.ts +models/OrganisationByNameBodyParams.ts +models/OrganisationResponse.ts +models/OrganisationResponseLegacy.ts +models/OrganisationRootChildrenResponse.ts +models/OrganisationsTyp.ts +models/ParentOrganisationenResponse.ts +models/ParentOrganisationsByIdsBodyParams.ts +models/Person.ts +models/PersonBirthParams.ts +models/PersonBirthResponse.ts +models/PersonControllerFindPersonenkontexte200Response.ts +models/PersonEmailResponse.ts +models/PersonFrontendControllerFindPersons200Response.ts +models/PersonIdResponse.ts +models/PersonInfoResponse.ts +models/PersonLockResponse.ts +models/PersonMetadataBodyParams.ts +models/PersonNameParams.ts +models/PersonNameResponse.ts +models/PersonResponse.ts +models/PersonResponseAutomapper.ts +models/PersonendatensatzResponse.ts +models/PersonendatensatzResponseAutomapper.ts +models/PersonenkontextMigrationRuntype.ts +models/PersonenkontextResponse.ts +models/PersonenkontextRolleFieldsResponse.ts +models/PersonenkontextWorkflowResponse.ts +models/PersonenkontextdatensatzResponse.ts +models/PersonenkontexteUpdateResponse.ts +models/Personenstatus.ts +models/PersonenuebersichtBodyParams.ts +models/RawPagedResponse.ts +models/RolleResponse.ts +models/RolleServiceProviderBodyParams.ts +models/RolleServiceProviderResponse.ts +models/RolleWithServiceProvidersResponse.ts +models/RollenArt.ts +models/RollenMerkmal.ts +models/RollenSystemRecht.ts +models/RollenSystemRechtServiceProviderIDResponse.ts +models/ServiceProviderIdNameResponse.ts +models/ServiceProviderKategorie.ts +models/ServiceProviderResponse.ts +models/ServiceProviderTarget.ts +models/Sichtfreigabe.ts +models/SystemrechtResponse.ts +models/TokenInitBodyParams.ts +models/TokenRequiredResponse.ts +models/TokenStateResponse.ts +models/TokenVerifyBodyParams.ts +models/TraegerschaftTyp.ts +models/UpdateOrganisationBodyParams.ts +models/UpdatePersonBodyParams.ts +models/UpdateRolleBodyParams.ts +models/UserLockParams.ts +models/UserinfoResponse.ts +models/Vertrauensstufe.ts +models/all.ts +package.json +rxjsStub.ts +servers.ts +tsconfig.json +types/ObjectParamAPI.ts +types/ObservableAPI.ts +types/PromiseAPI.ts +util.ts diff --git a/loadtest/api-client/generated/.openapi-generator/VERSION b/loadtest/api-client/generated/.openapi-generator/VERSION new file mode 100644 index 0000000..4bc5d61 --- /dev/null +++ b/loadtest/api-client/generated/.openapi-generator/VERSION @@ -0,0 +1 @@ +7.9.0 diff --git a/loadtest/api-client/generated/AuthApi.md b/loadtest/api-client/generated/AuthApi.md new file mode 100644 index 0000000..45426b7 --- /dev/null +++ b/loadtest/api-client/generated/AuthApi.md @@ -0,0 +1,212 @@ +# .AuthApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**authenticationControllerInfo**](AuthApi.md#authenticationControllerInfo) | **GET** /api/auth/logininfo | Info about logged in user. +[**authenticationControllerLogin**](AuthApi.md#authenticationControllerLogin) | **GET** /api/auth/login | Used to start OIDC authentication. +[**authenticationControllerLogout**](AuthApi.md#authenticationControllerLogout) | **GET** /api/auth/logout | Used to log out the current user. +[**authenticationControllerResetPassword**](AuthApi.md#authenticationControllerResetPassword) | **GET** /api/auth/reset-password | Redirect to Keycloak password reset. + + +# **authenticationControllerInfo** +> UserinfoResponse authenticationControllerInfo() + + +### Example + + +```typescript +import { createConfiguration, AuthApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new AuthApi(configuration); + +const request = {}; + +const data = await apiInstance.authenticationControllerInfo(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**UserinfoResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Returns info about the logged in user. | - | +**401** | User is not logged in. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **authenticationControllerLogin** +> authenticationControllerLogin() + + +### Example + + +```typescript +import { createConfiguration, AuthApi } from ''; +import type { AuthApiAuthenticationControllerLoginRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new AuthApi(configuration); + +const request: AuthApiAuthenticationControllerLoginRequest = { + + redirectUrl: "redirectUrl_example", +}; + +const data = await apiInstance.authenticationControllerLogin(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **redirectUrl** | [**string**] | | (optional) defaults to undefined + + +### Return type + +void (empty response body) + +### Authorization + +No authorization required + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**302** | Redirection to orchestrate OIDC flow. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **authenticationControllerLogout** +> authenticationControllerLogout() + + +### Example + + +```typescript +import { createConfiguration, AuthApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new AuthApi(configuration); + +const request = {}; + +const data = await apiInstance.authenticationControllerLogout(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +void (empty response body) + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**302** | Redirect to logout. | - | +**500** | Internal server error while trying to log out. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **authenticationControllerResetPassword** +> authenticationControllerResetPassword() + + +### Example + + +```typescript +import { createConfiguration, AuthApi } from ''; +import type { AuthApiAuthenticationControllerResetPasswordRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new AuthApi(configuration); + +const request: AuthApiAuthenticationControllerResetPasswordRequest = { + + redirectUrl: "redirectUrl_example", + + loginHint: "login_hint_example", +}; + +const data = await apiInstance.authenticationControllerResetPassword(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **redirectUrl** | [**string**] | | defaults to undefined + **loginHint** | [**string**] | | defaults to undefined + + +### Return type + +void (empty response body) + +### Authorization + +No authorization required + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**302** | Redirect to Keycloak password reset page. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/Class2FAApi.md b/loadtest/api-client/generated/Class2FAApi.md new file mode 100644 index 0000000..9e5ec3d --- /dev/null +++ b/loadtest/api-client/generated/Class2FAApi.md @@ -0,0 +1,367 @@ +# .Class2FAApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**privacyIdeaAdministrationControllerAssignHardwareToken**](Class2FAApi.md#privacyIdeaAdministrationControllerAssignHardwareToken) | **POST** /api/2fa-token/assign/hardwareToken | +[**privacyIdeaAdministrationControllerGetTwoAuthState**](Class2FAApi.md#privacyIdeaAdministrationControllerGetTwoAuthState) | **GET** /api/2fa-token/state | +[**privacyIdeaAdministrationControllerInitializeSoftwareToken**](Class2FAApi.md#privacyIdeaAdministrationControllerInitializeSoftwareToken) | **POST** /api/2fa-token/init | +[**privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication**](Class2FAApi.md#privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication) | **GET** /api/2fa-token/required | +[**privacyIdeaAdministrationControllerResetToken**](Class2FAApi.md#privacyIdeaAdministrationControllerResetToken) | **PUT** /api/2fa-token/reset | +[**privacyIdeaAdministrationControllerVerifyToken**](Class2FAApi.md#privacyIdeaAdministrationControllerVerifyToken) | **POST** /api/2fa-token/verify | + + +# **privacyIdeaAdministrationControllerAssignHardwareToken** +> AssignHardwareTokenResponse privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams) + + +### Example + + +```typescript +import { createConfiguration, Class2FAApi } from ''; +import type { Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new Class2FAApi(configuration); + +const request: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest = { + + assignHardwareTokenBodyParams: { + serial: "serial_example", + otp: "otp_example", + referrer: "referrer_example", + userId: "userId_example", + }, +}; + +const data = await apiInstance.privacyIdeaAdministrationControllerAssignHardwareToken(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **assignHardwareTokenBodyParams** | **AssignHardwareTokenBodyParams**| | + + +### Return type + +**AssignHardwareTokenResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The hardware token was successfully assigned. | - | +**400** | Not found. | - | +**401** | Not authorized to assign hardware token. | - | +**403** | Insufficient permissions to reset token. | - | +**404** | Insufficient permissions to assign hardware token. | - | +**500** | Internal server error while assigning a hardware token. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **privacyIdeaAdministrationControllerGetTwoAuthState** +> TokenStateResponse privacyIdeaAdministrationControllerGetTwoAuthState() + + +### Example + + +```typescript +import { createConfiguration, Class2FAApi } from ''; +import type { Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new Class2FAApi(configuration); + +const request: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest = { + + personId: "personId_example", +}; + +const data = await apiInstance.privacyIdeaAdministrationControllerGetTwoAuthState(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | | defaults to undefined + + +### Return type + +**TokenStateResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The token state was successfully returned. | - | +**400** | A username was not given or not found. | - | +**401** | Not authorized to get token state. | - | +**403** | Insufficient permissions to get token state. | - | +**404** | Insufficient permissions to get token state. | - | +**500** | Internal server error while retrieving token state. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **privacyIdeaAdministrationControllerInitializeSoftwareToken** +> string privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams) + + +### Example + + +```typescript +import { createConfiguration, Class2FAApi } from ''; +import type { Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new Class2FAApi(configuration); + +const request: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest = { + + tokenInitBodyParams: { + personId: "personId_example", + }, +}; + +const data = await apiInstance.privacyIdeaAdministrationControllerInitializeSoftwareToken(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **tokenInitBodyParams** | **TokenInitBodyParams**| | + + +### Return type + +**string** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The token was successfully created. | - | +**400** | A username was not given or not found. | - | +**401** | Not authorized to create token. | - | +**403** | Insufficient permissions to create token. | - | +**404** | Insufficient permissions to create token. | - | +**500** | Internal server error while creating a token. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication** +> TokenRequiredResponse privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication() + + +### Example + + +```typescript +import { createConfiguration, Class2FAApi } from ''; +import type { Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new Class2FAApi(configuration); + +const request: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest = { + + personId: "personId_example", +}; + +const data = await apiInstance.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | | defaults to undefined + + +### Return type + +**TokenRequiredResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The requirement was successfully returned. | - | +**400** | A username was not given or not found. | - | +**401** | Not authorized to get requirement information. | - | +**403** | Insufficient permissions to get requirement information. | - | +**404** | Insufficient permissions to get requirement information. | - | +**500** | Internal server error while getting requirement information. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **privacyIdeaAdministrationControllerResetToken** +> boolean privacyIdeaAdministrationControllerResetToken() + + +### Example + + +```typescript +import { createConfiguration, Class2FAApi } from ''; +import type { Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new Class2FAApi(configuration); + +const request: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest = { + + personId: "personId_example", +}; + +const data = await apiInstance.privacyIdeaAdministrationControllerResetToken(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | | defaults to undefined + + +### Return type + +**boolean** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The token was successfully reset. | - | +**400** | A username was not given or not found. | - | +**401** | Not authorized to reset token. | - | +**403** | Insufficient permissions to reset token. | - | +**404** | Insufficient permissions to reset token. | - | +**500** | Internal server error while reseting a token. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **privacyIdeaAdministrationControllerVerifyToken** +> void privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams) + + +### Example + + +```typescript +import { createConfiguration, Class2FAApi } from ''; +import type { Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new Class2FAApi(configuration); + +const request: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest = { + + tokenVerifyBodyParams: { + personId: "personId_example", + otp: "otp_example", + }, +}; + +const data = await apiInstance.privacyIdeaAdministrationControllerVerifyToken(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **tokenVerifyBodyParams** | **TokenVerifyBodyParams**| | + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The token was successfully verified. | - | +**400** | A username was not given or not found. | - | +**401** | Not authorized to verify token. | - | +**403** | Insufficient permissions to verify token. | - | +**404** | Insufficient permissions to verify token. | - | +**500** | Internal server error while verifying a token. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/CronApi.md b/loadtest/api-client/generated/CronApi.md new file mode 100644 index 0000000..43fa0cb --- /dev/null +++ b/loadtest/api-client/generated/CronApi.md @@ -0,0 +1,212 @@ +# .CronApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**cronControllerKoPersUserLock**](CronApi.md#cronControllerKoPersUserLock) | **PUT** /api/cron/kopers-lock | +[**cronControllerPersonWithoutOrgDelete**](CronApi.md#cronControllerPersonWithoutOrgDelete) | **PUT** /api/cron/person-without-org | +[**cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers**](CronApi.md#cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers) | **PUT** /api/cron/kontext-expired | +[**cronControllerUnlockUsersWithExpiredLocks**](CronApi.md#cronControllerUnlockUsersWithExpiredLocks) | **PUT** /api/cron/unlock | + + +# **cronControllerKoPersUserLock** +> boolean cronControllerKoPersUserLock() + + +### Example + + +```typescript +import { createConfiguration, CronApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new CronApi(configuration); + +const request = {}; + +const data = await apiInstance.cronControllerKoPersUserLock(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**boolean** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | User were successfully locked. | - | +**400** | User are not given or not found | - | +**401** | Not authorized to lock user. | - | +**403** | Insufficient permissions to lock user. | - | +**404** | Insufficient permissions to lock user. | - | +**500** | Internal server error while trying to lock user. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **cronControllerPersonWithoutOrgDelete** +> boolean cronControllerPersonWithoutOrgDelete() + + +### Example + + +```typescript +import { createConfiguration, CronApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new CronApi(configuration); + +const request = {}; + +const data = await apiInstance.cronControllerPersonWithoutOrgDelete(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**boolean** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | User were successfully removed. | - | +**400** | User are not given or not found | - | +**401** | Not authorized to remove user. | - | +**403** | Insufficient permissions to delete user. | - | +**404** | Insufficient permissions to delete user. | - | +**500** | Internal server error while trying to remove user. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers** +> boolean cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers() + + +### Example + + +```typescript +import { createConfiguration, CronApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new CronApi(configuration); + +const request = {}; + +const data = await apiInstance.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**boolean** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | Personenkontexte were successfully removed from users. | - | +**400** | Personenkontexte are not given or not found. | - | +**401** | Not authorized to remove personenkontexte from users. | - | +**403** | Insufficient permissions to remove personenkontexte from users. | - | +**404** | Insufficient permissions to remove personenkontexte from users. | - | +**500** | Internal server error while trying to remove personenkontexte from users. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **cronControllerUnlockUsersWithExpiredLocks** +> boolean cronControllerUnlockUsersWithExpiredLocks() + + +### Example + + +```typescript +import { createConfiguration, CronApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new CronApi(configuration); + +const request = {}; + +const data = await apiInstance.cronControllerUnlockUsersWithExpiredLocks(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**boolean** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The users were successfully unlocked. | - | +**401** | Not authorized to unlock users. | - | +**403** | Insufficient permissions to unlock users. | - | +**404** | Insufficient permissions to unlock users. | - | +**500** | Internal server error while trying to unlock users. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/DbiamPersonenkontexteApi.md b/loadtest/api-client/generated/DbiamPersonenkontexteApi.md new file mode 100644 index 0000000..34f9cfb --- /dev/null +++ b/loadtest/api-client/generated/DbiamPersonenkontexteApi.md @@ -0,0 +1,130 @@ +# .DbiamPersonenkontexteApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**dBiamPersonenkontextControllerCreatePersonenkontextMigration**](DbiamPersonenkontexteApi.md#dBiamPersonenkontextControllerCreatePersonenkontextMigration) | **POST** /api/dbiam/personenkontext | +[**dBiamPersonenkontextControllerFindPersonenkontextsByPerson**](DbiamPersonenkontexteApi.md#dBiamPersonenkontextControllerFindPersonenkontextsByPerson) | **GET** /api/dbiam/personenkontext/{personId} | + + +# **dBiamPersonenkontextControllerCreatePersonenkontextMigration** +> DBiamPersonenkontextResponse dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams) + + +### Example + + +```typescript +import { createConfiguration, DbiamPersonenkontexteApi } from ''; +import type { DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new DbiamPersonenkontexteApi(configuration); + +const request: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest = { + + dbiamPersonenkontextMigrationBodyParams: { + personId: "personId_example", + username: "username_example", + organisationId: "organisationId_example", + rolleId: "rolleId_example", + befristung: new Date('1970-01-01T00:00:00.00Z'), + email: "email_example", + migrationRunType: "ITSLEARNING", + }, +}; + +const data = await apiInstance.dBiamPersonenkontextControllerCreatePersonenkontextMigration(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **dbiamPersonenkontextMigrationBodyParams** | **DbiamPersonenkontextMigrationBodyParams**| | + + +### Return type + +**DBiamPersonenkontextResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | Personenkontext was successfully created. | - | +**400** | The personenkontext could not be created, may due to unsatisfied specifications. | - | +**401** | Not authorized to create personenkontext. | - | +**403** | Insufficient permission to create personenkontext. | - | +**500** | Internal server error while creating personenkontext. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **dBiamPersonenkontextControllerFindPersonenkontextsByPerson** +> Array dBiamPersonenkontextControllerFindPersonenkontextsByPerson() + + +### Example + + +```typescript +import { createConfiguration, DbiamPersonenkontexteApi } from ''; +import type { DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new DbiamPersonenkontexteApi(configuration); + +const request: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest = { + // The ID for the person. + personId: "personId_example", +}; + +const data = await apiInstance.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The ID for the person. | defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenkontexte were successfully returned. | - | +**401** | Not authorized to get available personenkontexte. | - | +**403** | Insufficient permission to get personenkontexte for this user. | - | +**500** | Internal server error while getting personenkontexte. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md b/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md new file mode 100644 index 0000000..a082f5f --- /dev/null +++ b/loadtest/api-client/generated/DbiamPersonenuebersichtApi.md @@ -0,0 +1,125 @@ +# .DbiamPersonenuebersichtApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**dBiamPersonenuebersichtControllerFindPersonenuebersichten**](DbiamPersonenuebersichtApi.md#dBiamPersonenuebersichtControllerFindPersonenuebersichten) | **POST** /api/dbiam/personenuebersicht | +[**dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson**](DbiamPersonenuebersichtApi.md#dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson) | **GET** /api/dbiam/personenuebersicht/{personId} | + + +# **dBiamPersonenuebersichtControllerFindPersonenuebersichten** +> DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams) + + +### Example + + +```typescript +import { createConfiguration, DbiamPersonenuebersichtApi } from ''; +import type { DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new DbiamPersonenuebersichtApi(configuration); + +const request: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest = { + + personenuebersichtBodyParams: { + personIds: [ + "personIds_example", + ], + }, +}; + +const data = await apiInstance.dBiamPersonenuebersichtControllerFindPersonenuebersichten(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personenuebersichtBodyParams** | **PersonenuebersichtBodyParams**| | + + +### Return type + +**DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenuebersichten were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get personenuebersichten. | - | +**403** | Insufficient permission to get personenuebersichten. | - | +**500** | Internal server error while getting personenuebersichten. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson** +> DBiamPersonenuebersichtResponse dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson() + + +### Example + + +```typescript +import { createConfiguration, DbiamPersonenuebersichtApi } from ''; +import type { DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new DbiamPersonenuebersichtApi(configuration); + +const request: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest = { + // The ID for the person. + personId: "personId_example", +}; + +const data = await apiInstance.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The ID for the person. | defaults to undefined + + +### Return type + +**DBiamPersonenuebersichtResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenuebersichten were successfully returned. | - | +**401** | Not authorized to get personenuebersicht. | - | +**403** | Insufficient permission to get personenuebersicht. | - | +**500** | Internal server error while getting personenuebersicht. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/ImportApi.md b/loadtest/api-client/generated/ImportApi.md new file mode 100644 index 0000000..79b7e13 --- /dev/null +++ b/loadtest/api-client/generated/ImportApi.md @@ -0,0 +1,191 @@ +# .ImportApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**importControllerDeleteImportTransaction**](ImportApi.md#importControllerDeleteImportTransaction) | **DELETE** /api/import/{importvorgangId} | +[**importControllerExecuteImport**](ImportApi.md#importControllerExecuteImport) | **POST** /api/import/execute | +[**importControllerUploadFile**](ImportApi.md#importControllerUploadFile) | **POST** /api/import/upload | + + +# **importControllerDeleteImportTransaction** +> void importControllerDeleteImportTransaction() + +Delete a role by id. + +### Example + + +```typescript +import { createConfiguration, ImportApi } from ''; +import type { ImportApiImportControllerDeleteImportTransactionRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new ImportApi(configuration); + +const request: ImportApiImportControllerDeleteImportTransactionRequest = { + // The id of an import transaction + importvorgangId: "importvorgangId_example", +}; + +const data = await apiInstance.importControllerDeleteImportTransaction(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **importvorgangId** | [**string**] | The id of an import transaction | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**204** | Import transaction was deleted successfully. | - | +**400** | Something went wrong with the found import transaction. | - | +**401** | Not authorized to delete the import transaction. | - | +**404** | The import transaction that should be deleted does not exist. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **importControllerExecuteImport** +> HttpFile importControllerExecuteImport(importvorgangByIdBodyParams) + + +### Example + + +```typescript +import { createConfiguration, ImportApi } from ''; +import type { ImportApiImportControllerExecuteImportRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new ImportApi(configuration); + +const request: ImportApiImportControllerExecuteImportRequest = { + + importvorgangByIdBodyParams: { + importvorgangId: "importvorgangId_example", + organisationId: "organisationId_example", + rolleId: "rolleId_example", + }, +}; + +const data = await apiInstance.importControllerExecuteImport(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **importvorgangByIdBodyParams** | **ImportvorgangByIdBodyParams**| | + + +### Return type + +**HttpFile** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: text/plain + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Import transaction was executed successfully. The text file can be downloaded | - | +**400** | Something went wrong with the found import transaction. | - | +**401** | Not authorized to execute the import transaction. | - | +**403** | Insufficient permissions to execute the import transaction. | - | +**404** | The import transaction does not exist. | - | +**500** | Internal server error while executing the import transaction. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **importControllerUploadFile** +> ImportUploadResponse importControllerUploadFile() + + +### Example + + +```typescript +import { createConfiguration, ImportApi } from ''; +import type { ImportApiImportControllerUploadFileRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new ImportApi(configuration); + +const request: ImportApiImportControllerUploadFileRequest = { + + organisationId: "organisationId_example", + + rolleId: "rolleId_example", + + file: { data: Buffer.from(fs.readFileSync('/path/to/file', 'utf-8')), name: '/path/to/file' }, +}; + +const data = await apiInstance.importControllerUploadFile(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | | defaults to undefined + **rolleId** | [**string**] | | defaults to undefined + **file** | [**HttpFile**] | | defaults to undefined + + +### Return type + +**ImportUploadResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: multipart/form-data + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Returns an import upload response object. | - | +**400** | The CSV file was not valid. | - | +**401** | Not authorized to import data with a CSV file. | - | +**403** | Insufficient permissions to import data with a CSV file. | - | +**500** | Internal server error while importing data with a CSV file. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/OrganisationenApi.md b/loadtest/api-client/generated/OrganisationenApi.md new file mode 100644 index 0000000..8d72787 --- /dev/null +++ b/loadtest/api-client/generated/OrganisationenApi.md @@ -0,0 +1,877 @@ +# .OrganisationenApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**organisationControllerAddAdministrierteOrganisation**](OrganisationenApi.md#organisationControllerAddAdministrierteOrganisation) | **POST** /api/organisationen/{organisationId}/administriert | +[**organisationControllerAddZugehoerigeOrganisation**](OrganisationenApi.md#organisationControllerAddZugehoerigeOrganisation) | **POST** /api/organisationen/{organisationId}/zugehoerig | +[**organisationControllerCreateOrganisation**](OrganisationenApi.md#organisationControllerCreateOrganisation) | **POST** /api/organisationen | +[**organisationControllerDeleteKlasse**](OrganisationenApi.md#organisationControllerDeleteKlasse) | **DELETE** /api/organisationen/{organisationId}/klasse | +[**organisationControllerEnableForitslearning**](OrganisationenApi.md#organisationControllerEnableForitslearning) | **PUT** /api/organisationen/{organisationId}/enable-for-its-learning | +[**organisationControllerFindOrganisationById**](OrganisationenApi.md#organisationControllerFindOrganisationById) | **GET** /api/organisationen/{organisationId} | +[**organisationControllerFindOrganizations**](OrganisationenApi.md#organisationControllerFindOrganizations) | **GET** /api/organisationen | +[**organisationControllerGetAdministrierteOrganisationen**](OrganisationenApi.md#organisationControllerGetAdministrierteOrganisationen) | **GET** /api/organisationen/{organisationId}/administriert | +[**organisationControllerGetParentsByIds**](OrganisationenApi.md#organisationControllerGetParentsByIds) | **POST** /api/organisationen/parents-by-ids | +[**organisationControllerGetRootChildren**](OrganisationenApi.md#organisationControllerGetRootChildren) | **GET** /api/organisationen/root/children | +[**organisationControllerGetRootOrganisation**](OrganisationenApi.md#organisationControllerGetRootOrganisation) | **GET** /api/organisationen/root | +[**organisationControllerGetZugehoerigeOrganisationen**](OrganisationenApi.md#organisationControllerGetZugehoerigeOrganisationen) | **GET** /api/organisationen/{organisationId}/zugehoerig | +[**organisationControllerUpdateOrganisation**](OrganisationenApi.md#organisationControllerUpdateOrganisation) | **PUT** /api/organisationen/{organisationId} | +[**organisationControllerUpdateOrganisationName**](OrganisationenApi.md#organisationControllerUpdateOrganisationName) | **PATCH** /api/organisationen/{organisationId}/name | + + +# **organisationControllerAddAdministrierteOrganisation** +> void organisationControllerAddAdministrierteOrganisation(organisationByIdBodyParams) + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest = { + // The id of an organization + organisationId: "organisationId_example", + + organisationByIdBodyParams: { + organisationId: "organisationId_example", + }, +}; + +const data = await apiInstance.organisationControllerAddAdministrierteOrganisation(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationByIdBodyParams** | **OrganisationByIdBodyParams**| | + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The organisation was successfully updated. | - | +**400** | The organisation could not be modified. | - | +**401** | Not authorized to modify the organisation. | - | +**403** | Not permitted to modify the organisation. | - | +**500** | Internal server error while modifying the organisation. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerAddZugehoerigeOrganisation** +> void organisationControllerAddZugehoerigeOrganisation(organisationByIdBodyParams) + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest = { + // The id of an organization + organisationId: "organisationId_example", + + organisationByIdBodyParams: { + organisationId: "organisationId_example", + }, +}; + +const data = await apiInstance.organisationControllerAddZugehoerigeOrganisation(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationByIdBodyParams** | **OrganisationByIdBodyParams**| | + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The organisation was successfully updated. | - | +**400** | The organisation could not be modified. | - | +**401** | Not authorized to modify the organisation. | - | +**403** | Not permitted to modify the organisation. | - | +**500** | Internal server error while modifying the organisation. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerCreateOrganisation** +> OrganisationResponse organisationControllerCreateOrganisation(createOrganisationBodyParams) + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerCreateOrganisationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerCreateOrganisationRequest = { + + createOrganisationBodyParams: { + administriertVon: "administriertVon_example", + zugehoerigZu: "zugehoerigZu_example", + kennung: "kennung_example", + name: "name_example", + namensergaenzung: "namensergaenzung_example", + kuerzel: "kuerzel_example", + typ: "ROOT", + traegerschaft: "01", + emailAdress: "emailAdress_example", + }, +}; + +const data = await apiInstance.organisationControllerCreateOrganisation(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **createOrganisationBodyParams** | **CreateOrganisationBodyParams**| | + + +### Return type + +**OrganisationResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The organisation was successfully created. | - | +**400** | The organisation already exists. | - | +**401** | Not authorized to create the organisation. | - | +**403** | Not permitted to create the organisation. | - | +**500** | Internal server error while creating the organisation. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerDeleteKlasse** +> void organisationControllerDeleteKlasse() + +Delete an organisation of type Klasse by id. + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerDeleteKlasseRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerDeleteKlasseRequest = { + // The id of an organization + organisationId: "organisationId_example", +}; + +const data = await apiInstance.organisationControllerDeleteKlasse(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**204** | The organisation was deleted successfully. | - | +**400** | The input was not valid. | - | +**401** | Not authorized to delete the organisation. | - | +**404** | The organisation that should be deleted does not exist. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerEnableForitslearning** +> OrganisationResponseLegacy organisationControllerEnableForitslearning() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerEnableForitslearningRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerEnableForitslearningRequest = { + // The id of an organization + organisationId: "organisationId_example", +}; + +const data = await apiInstance.organisationControllerEnableForitslearning(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**OrganisationResponseLegacy** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organization was successfully enabled for itslearning. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**400** | The organisation could not be modified. | - | +**401** | Not authorized to modify the organisation. | - | +**403** | Not permitted to modify the organisation. | - | +**500** | Internal server error while modifying the organisation. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerFindOrganisationById** +> OrganisationResponse organisationControllerFindOrganisationById() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerFindOrganisationByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest = { + // The id of an organization + organisationId: "organisationId_example", +}; + +const data = await apiInstance.organisationControllerFindOrganisationById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**OrganisationResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organization was successfully pulled. | - | +**400** | Organization ID is required | - | +**401** | Not authorized to get the organization. | - | +**403** | Insufficient permissions to get the organization. | - | +**404** | The organization does not exist. | - | +**500** | Internal server error while getting the organization. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerFindOrganizations** +> Array organisationControllerFindOrganizations() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerFindOrganizationsRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerFindOrganizationsRequest = { + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + + kennung: "kennung_example", + + name: "name_example", + + searchString: "searchString_example", + + typ: "ROOT", + + systemrechte: [ + "ROLLEN_VERWALTEN", + ], + + excludeTyp: [ + "ROOT", + ], + + administriertVon: [ + "administriertVon_example", + ], + // Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). (optional) + organisationIds: [ + "organisationIds_example", + ], +}; + +const data = await apiInstance.organisationControllerFindOrganizations(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **kennung** | [**string**] | | (optional) defaults to undefined + **name** | [**string**] | | (optional) defaults to undefined + **searchString** | [**string**] | | (optional) defaults to undefined + **typ** | **OrganisationsTyp** | | (optional) defaults to undefined + **systemrechte** | **Array<RollenSystemRecht>** | | (optional) defaults to undefined + **excludeTyp** | **Array<OrganisationsTyp>** | | (optional) defaults to undefined + **administriertVon** | **Array<string>** | | (optional) defaults to undefined + **organisationIds** | **Array<string>** | Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). | (optional) defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organizations were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get organizations. | - | +**403** | Insufficient permissions to get organizations. | - | +**500** | Internal server error while getting all organizations. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerGetAdministrierteOrganisationen** +> Array organisationControllerGetAdministrierteOrganisationen() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest = { + // The id of an organization + organisationId: "organisationId_example", + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + + searchFilter: "searchFilter_example", +}; + +const data = await apiInstance.organisationControllerGetAdministrierteOrganisationen(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | The id of an organization | defaults to undefined + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **searchFilter** | [**string**] | | (optional) defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organizations were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get organizations. | - | +**403** | Insufficient permissions to get organizations. | - | +**500** | Internal server error while getting all organizations. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerGetParentsByIds** +> ParentOrganisationenResponse organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams) + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerGetParentsByIdsRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerGetParentsByIdsRequest = { + + parentOrganisationsByIdsBodyParams: { + organisationIds: [ + "organisationIds_example", + ], + }, +}; + +const data = await apiInstance.organisationControllerGetParentsByIds(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **parentOrganisationsByIdsBodyParams** | **ParentOrganisationsByIdsBodyParams**| | + + +### Return type + +**ParentOrganisationenResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The parent organizations were successfully pulled. | - | +**401** | Not authorized to get the organizations. | - | +**403** | Insufficient permissions to get the organizations. | - | +**500** | Internal server error while getting the organization. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerGetRootChildren** +> OrganisationRootChildrenResponse organisationControllerGetRootChildren() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request = {}; + +const data = await apiInstance.organisationControllerGetRootChildren(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**OrganisationRootChildrenResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The root organizations were successfully pulled. | - | +**401** | Not authorized to get the organizations. | - | +**403** | Insufficient permissions to get the organizations. | - | +**500** | Internal server error while getting the organization. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerGetRootOrganisation** +> OrganisationResponse organisationControllerGetRootOrganisation() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request = {}; + +const data = await apiInstance.organisationControllerGetRootOrganisation(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**OrganisationResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The root organization was successfully retrieved. | - | +**401** | Not authorized to get the root organization. | - | +**403** | Insufficient permissions to get the root organization. | - | +**404** | The root organization does not exist. | - | +**500** | Internal server error while getting the root organization. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerGetZugehoerigeOrganisationen** +> Array organisationControllerGetZugehoerigeOrganisationen() + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest = { + // The id of an organization + organisationId: "organisationId_example", +}; + +const data = await apiInstance.organisationControllerGetZugehoerigeOrganisationen(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organizations were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get organizations. | - | +**403** | Insufficient permissions to get organizations. | - | +**500** | Internal server error while getting all organizations. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerUpdateOrganisation** +> OrganisationResponse organisationControllerUpdateOrganisation(updateOrganisationBodyParams) + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerUpdateOrganisationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerUpdateOrganisationRequest = { + // The id of an organization + organisationId: "organisationId_example", + + updateOrganisationBodyParams: { + administriertVon: "administriertVon_example", + zugehoerigZu: "zugehoerigZu_example", + kennung: "kennung_example", + name: "name_example", + namensergaenzung: "namensergaenzung_example", + kuerzel: "kuerzel_example", + typ: "ROOT", + traegerschaft: "01", + emailAdress: "emailAdress_example", + }, +}; + +const data = await apiInstance.organisationControllerUpdateOrganisation(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **updateOrganisationBodyParams** | **UpdateOrganisationBodyParams**| | + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**OrganisationResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organisation was successfully updated. | - | +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The organisation was not found. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **organisationControllerUpdateOrganisationName** +> OrganisationResponseLegacy organisationControllerUpdateOrganisationName(organisationByNameBodyParams) + + +### Example + + +```typescript +import { createConfiguration, OrganisationenApi } from ''; +import type { OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new OrganisationenApi(configuration); + +const request: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest = { + // The id of an organization + organisationId: "organisationId_example", + + organisationByNameBodyParams: { + name: "name_example", + version: 3.14, + }, +}; + +const data = await apiInstance.organisationControllerUpdateOrganisationName(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationByNameBodyParams** | **OrganisationByNameBodyParams**| | + **organisationId** | [**string**] | The id of an organization | defaults to undefined + + +### Return type + +**OrganisationResponseLegacy** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The organizations were successfully updated. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**400** | The organisation could not be modified. | - | +**401** | Not authorized to modify the organisation. | - | +**403** | Not permitted to modify the organisation. | - | +**500** | Internal server error while modifying the organisation. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/PersonAdministrationApi.md b/loadtest/api-client/generated/PersonAdministrationApi.md new file mode 100644 index 0000000..be88651 --- /dev/null +++ b/loadtest/api-client/generated/PersonAdministrationApi.md @@ -0,0 +1,68 @@ +# .PersonAdministrationApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**personAdministrationControllerFindRollen**](PersonAdministrationApi.md#personAdministrationControllerFindRollen) | **GET** /api/person-administration/rollen | + + +# **personAdministrationControllerFindRollen** +> FindRollenResponse personAdministrationControllerFindRollen() + + +### Example + + +```typescript +import { createConfiguration, PersonAdministrationApi } from ''; +import type { PersonAdministrationApiPersonAdministrationControllerFindRollenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonAdministrationApi(configuration); + +const request: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = { + // Rolle name used to filter for rollen in personenkontext. (optional) + rolleName: "rolleName_example", + // The limit of items for the request. (optional) + limit: 3.14, +}; + +const data = await apiInstance.personAdministrationControllerFindRollen(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleName** | [**string**] | Rolle name used to filter for rollen in personenkontext. | (optional) defaults to undefined + **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined + + +### Return type + +**FindRollenResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The rollen for the logged-in user were successfully returned. | - | +**401** | Not authorized to get available rollen for the logged-in user. | - | +**403** | Insufficient permission to get rollen for the logged-in user. | - | +**500** | Internal server error while getting rollen for the logged-in user. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/PersonInfoApi.md b/loadtest/api-client/generated/PersonInfoApi.md new file mode 100644 index 0000000..80f3394 --- /dev/null +++ b/loadtest/api-client/generated/PersonInfoApi.md @@ -0,0 +1,56 @@ +# .PersonInfoApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**personInfoControllerInfo**](PersonInfoApi.md#personInfoControllerInfo) | **GET** /api/person-info | Info about logged in person. + + +# **personInfoControllerInfo** +> PersonInfoResponse personInfoControllerInfo() + + +### Example + + +```typescript +import { createConfiguration, PersonInfoApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonInfoApi(configuration); + +const request = {}; + +const data = await apiInstance.personInfoControllerInfo(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**PersonInfoResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Returns info about the person. | - | +**401** | person is not logged in. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/PersonenApi.md b/loadtest/api-client/generated/PersonenApi.md new file mode 100644 index 0000000..704f928 --- /dev/null +++ b/loadtest/api-client/generated/PersonenApi.md @@ -0,0 +1,746 @@ +# .PersonenApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**personControllerCreatePersonMigration**](PersonenApi.md#personControllerCreatePersonMigration) | **POST** /api/personen | +[**personControllerCreatePersonenkontext**](PersonenApi.md#personControllerCreatePersonenkontext) | **POST** /api/personen/{personId}/personenkontexte | +[**personControllerDeletePersonById**](PersonenApi.md#personControllerDeletePersonById) | **DELETE** /api/personen/{personId} | +[**personControllerFindPersonById**](PersonenApi.md#personControllerFindPersonById) | **GET** /api/personen/{personId} | +[**personControllerFindPersonenkontexte**](PersonenApi.md#personControllerFindPersonenkontexte) | **GET** /api/personen/{personId}/personenkontexte | +[**personControllerFindPersons**](PersonenApi.md#personControllerFindPersons) | **GET** /api/personen | +[**personControllerLockPerson**](PersonenApi.md#personControllerLockPerson) | **PUT** /api/personen/{personId}/lock-user | +[**personControllerResetPasswordByPersonId**](PersonenApi.md#personControllerResetPasswordByPersonId) | **PATCH** /api/personen/{personId}/password | +[**personControllerSyncPerson**](PersonenApi.md#personControllerSyncPerson) | **POST** /api/personen/{personId}/sync | +[**personControllerUpdateMetadata**](PersonenApi.md#personControllerUpdateMetadata) | **PATCH** /api/personen/{personId}/metadata | +[**personControllerUpdatePerson**](PersonenApi.md#personControllerUpdatePerson) | **PUT** /api/personen/{personId} | + + +# **personControllerCreatePersonMigration** +> PersonendatensatzResponse personControllerCreatePersonMigration(createPersonMigrationBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerCreatePersonMigrationRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerCreatePersonMigrationRequest = { + + createPersonMigrationBodyParams: { + personId: "personId_example", + familienname: "familienname_example", + vorname: "vorname_example", + hashedPassword: "hashedPassword_example", + username: "username_example", + personalnummer: "personalnummer_example", + }, +}; + +const data = await apiInstance.personControllerCreatePersonMigration(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **createPersonMigrationBodyParams** | **CreatePersonMigrationBodyParams**| | + + +### Return type + +**PersonendatensatzResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The person was successfully created. | - | +**400** | A username was given. Creation with username is not supported. | - | +**401** | Not authorized to create the person. | - | +**403** | Insufficient permissions to create the person. | - | +**404** | Insufficient permissions to create the person. | - | +**500** | Internal server error while creating the person. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerCreatePersonenkontext** +> void personControllerCreatePersonenkontext() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerCreatePersonenkontextRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerCreatePersonenkontextRequest = { + + personId: "personId_example", +}; + +const data = await apiInstance.personControllerCreatePersonenkontext(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenkontext was successfully created. | - | +**400** | The personenkontext already exists. | - | +**401** | Not authorized to create the personenkontext. | - | +**403** | Not permitted to create the personenkontext. | - | +**404** | Insufficient permissions to create personenkontext for person. | - | +**500** | Internal server error while creating the personenkontext. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerDeletePersonById** +> void personControllerDeletePersonById() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerDeletePersonByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerDeletePersonByIdRequest = { + // The id for the account. + personId: "personId_example", +}; + +const data = await apiInstance.personControllerDeletePersonById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The id for the account. | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**204** | The person and all their kontexte were successfully deleted. | - | +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The person was not found. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerFindPersonById** +> PersonendatensatzResponse personControllerFindPersonById() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerFindPersonByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerFindPersonByIdRequest = { + // The id for the account. + personId: "personId_example", +}; + +const data = await apiInstance.personControllerFindPersonById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The id for the account. | defaults to undefined + + +### Return type + +**PersonendatensatzResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The person was successfully returned. | - | +**400** | Person ID is required | - | +**401** | Not authorized to get the person. | - | +**403** | Insufficient permissions to get the person. | - | +**404** | The person does not exist or insufficient permissions. | - | +**500** | Internal server error while getting the person. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerFindPersonenkontexte** +> PersonControllerFindPersonenkontexte200Response personControllerFindPersonenkontexte() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerFindPersonenkontexteRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerFindPersonenkontexteRequest = { + // The id for the account. + personId: "personId_example", + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + + personId2: "personId_example", + + referrer: "referrer_example", + + personenstatus: "AKTIV", + + sichtfreigabe: "ja", +}; + +const data = await apiInstance.personControllerFindPersonenkontexte(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The id for the account. | defaults to undefined + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **personId2** | [**string**] | | (optional) defaults to undefined + **referrer** | [**string**] | | (optional) defaults to undefined + **personenstatus** | **Personenstatus** | | (optional) defaults to undefined + **sichtfreigabe** | **Sichtfreigabe** | | (optional) defaults to undefined + + +### Return type + +**PersonControllerFindPersonenkontexte200Response** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenkontexte were successfully pulled. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get personenkontexte. | - | +**403** | Insufficient permissions to get personenkontexte. | - | +**404** | No personenkontexte were found. | - | +**500** | Internal server error while getting all personenkontexte. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerFindPersons** +> Array personControllerFindPersons() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerFindPersonsRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerFindPersonsRequest = { + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + + referrer: "referrer_example", + + familienname: "familienname_example", + + vorname: "vorname_example", + + sichtfreigabe: "nein", + // List of Organisation ID used to filter for Persons. (optional) + organisationIDs: [ + "organisationIDs_example", + ], + // List of Role ID used to filter for Persons. (optional) + rolleIDs: [ + "rolleIDs_example", + ], + // Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. (optional) + suchFilter: "suchFilter_example", + // Order to sort by. (optional) + sortOrder: "asc", + // Field to sort by. (optional) + sortField: "familienname", +}; + +const data = await apiInstance.personControllerFindPersons(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **referrer** | [**string**] | | (optional) defaults to undefined + **familienname** | [**string**] | | (optional) defaults to undefined + **vorname** | [**string**] | | (optional) defaults to undefined + **sichtfreigabe** | [**'ja' | 'nein'**]**Array<'ja' | 'nein'>** | | (optional) defaults to 'nein' + **organisationIDs** | **Array<string>** | List of Organisation ID used to filter for Persons. | (optional) defaults to undefined + **rolleIDs** | **Array<string>** | List of Role ID used to filter for Persons. | (optional) defaults to undefined + **suchFilter** | [**string**] | Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. | (optional) defaults to undefined + **sortOrder** | [**'asc' | 'desc'**]**Array<'asc' | 'desc'>** | Order to sort by. | (optional) defaults to undefined + **sortField** | [**'familienname' | 'vorname' | 'personalnummer' | 'referrer'**]**Array<'familienname' | 'vorname' | 'personalnummer' | 'referrer'>** | Field to sort by. | (optional) defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The persons were successfully returned. WARNING: This endpoint returns all persons as default when no paging parameters were set. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get persons. | - | +**403** | Insufficient permissions to get persons. | - | +**500** | Internal server error while getting all persons. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerLockPerson** +> PersonLockResponse personControllerLockPerson(lockUserBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerLockPersonRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerLockPersonRequest = { + + personId: "personId_example", + + lockUserBodyParams: { + lock: true, + lockedBy: "lockedBy_example", + lockedUntil: new Date('1970-01-01T00:00:00.00Z'), + }, +}; + +const data = await apiInstance.personControllerLockPerson(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **lockUserBodyParams** | **LockUserBodyParams**| | + **personId** | [**string**] | | defaults to undefined + + +### Return type + +**PersonLockResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | User has been successfully updated. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The person was not found. | - | +**500** | An internal server error occurred. | - | +**502** | A downstream server returned an error. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerResetPasswordByPersonId** +> string personControllerResetPasswordByPersonId() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerResetPasswordByPersonIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerResetPasswordByPersonIdRequest = { + // The id for the account. + personId: "personId_example", +}; + +const data = await apiInstance.personControllerResetPasswordByPersonId(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The id for the account. | defaults to undefined + + +### Return type + +**string** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**202** | Password for person was successfully reset. | - | +**404** | The person does not exist or insufficient permissions to update person. | - | +**500** | Internal server error. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerSyncPerson** +> void personControllerSyncPerson() + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerSyncPersonRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerSyncPersonRequest = { + + personId: "personId_example", +}; + +const data = await apiInstance.personControllerSyncPerson(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | User will be synced. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The person was not found. | - | +**500** | An internal server error occurred. | - | +**502** | A downstream server returned an error. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerUpdateMetadata** +> PersonendatensatzResponse personControllerUpdateMetadata(personMetadataBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerUpdateMetadataRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerUpdateMetadataRequest = { + // The id for the account. + personId: "personId_example", + + personMetadataBodyParams: { + familienname: "familienname_example", + vorname: "vorname_example", + personalnummer: "personalnummer_example", + lastModified: new Date('1970-01-01T00:00:00.00Z'), + revision: "revision_example", + }, +}; + +const data = await apiInstance.personControllerUpdateMetadata(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personMetadataBodyParams** | **PersonMetadataBodyParams**| | + **personId** | [**string**] | The id for the account. | defaults to undefined + + +### Return type + +**PersonendatensatzResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The metadata for user was successfully updated. | - | +**400** | Request has a wrong format. | - | +**401** | Not authorized to update the metadata. | - | +**403** | Not permitted to update the metadata. | - | +**500** | Internal server error while updating the metadata for user. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personControllerUpdatePerson** +> PersonendatensatzResponse personControllerUpdatePerson(updatePersonBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenApi } from ''; +import type { PersonenApiPersonControllerUpdatePersonRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenApi(configuration); + +const request: PersonenApiPersonControllerUpdatePersonRequest = { + // The id for the account. + personId: "personId_example", + + updatePersonBodyParams: { + referrer: "referrer_example", + stammorganisation: "stammorganisation_example", + name: { + familienname: "familienname_example", + vorname: "vorname_example", + initialenfamilienname: "initialenfamilienname_example", + initialenvorname: "initialenvorname_example", + rufname: "rufname_example", + titel: "titel_example", + anrede: [ + "anrede_example", + ], + namenssuffix: [ + "namenssuffix_example", + ], + namenspraefix: [ + "namenspraefix_example", + ], + sortierindex: "sortierindex_example", + }, + geburt: { + datum: new Date('1970-01-01T00:00:00.00Z'), + geburtsort: "geburtsort_example", + }, + geschlecht: "m", + lokalisierung: "lokalisierung_example", + vertrauensstufe: "KEIN", + auskunftssperre: true, + revision: "revision_example", + }, +}; + +const data = await apiInstance.personControllerUpdatePerson(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **updatePersonBodyParams** | **UpdatePersonBodyParams**| | + **personId** | [**string**] | The id for the account. | defaults to undefined + + +### Return type + +**PersonendatensatzResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The person was successfully updated. | - | +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The person was not found or insufficient permissions to update person. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/PersonenFrontendApi.md b/loadtest/api-client/generated/PersonenFrontendApi.md new file mode 100644 index 0000000..48a0298 --- /dev/null +++ b/loadtest/api-client/generated/PersonenFrontendApi.md @@ -0,0 +1,99 @@ +# .PersonenFrontendApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**personFrontendControllerFindPersons**](PersonenFrontendApi.md#personFrontendControllerFindPersons) | **GET** /api/personen-frontend | + + +# **personFrontendControllerFindPersons** +> PersonFrontendControllerFindPersons200Response personFrontendControllerFindPersons() + + +### Example + + +```typescript +import { createConfiguration, PersonenFrontendApi } from ''; +import type { PersonenFrontendApiPersonFrontendControllerFindPersonsRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenFrontendApi(configuration); + +const request: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = { + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + + referrer: "referrer_example", + + familienname: "familienname_example", + + vorname: "vorname_example", + + sichtfreigabe: "nein", + // List of Organisation ID used to filter for Persons. (optional) + organisationIDs: [ + "organisationIDs_example", + ], + // List of Role ID used to filter for Persons. (optional) + rolleIDs: [ + "rolleIDs_example", + ], + // Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. (optional) + suchFilter: "suchFilter_example", + // Order to sort by. (optional) + sortOrder: "asc", + // Field to sort by. (optional) + sortField: "familienname", +}; + +const data = await apiInstance.personFrontendControllerFindPersons(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **referrer** | [**string**] | | (optional) defaults to undefined + **familienname** | [**string**] | | (optional) defaults to undefined + **vorname** | [**string**] | | (optional) defaults to undefined + **sichtfreigabe** | [**'ja' | 'nein'**]**Array<'ja' | 'nein'>** | | (optional) defaults to 'nein' + **organisationIDs** | **Array<string>** | List of Organisation ID used to filter for Persons. | (optional) defaults to undefined + **rolleIDs** | **Array<string>** | List of Role ID used to filter for Persons. | (optional) defaults to undefined + **suchFilter** | [**string**] | Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. | (optional) defaults to undefined + **sortOrder** | [**'asc' | 'desc'**]**Array<'asc' | 'desc'>** | Order to sort by. | (optional) defaults to undefined + **sortField** | [**'familienname' | 'vorname' | 'personalnummer' | 'referrer'**]**Array<'familienname' | 'vorname' | 'personalnummer' | 'referrer'>** | Field to sort by. | (optional) defaults to undefined + + +### Return type + +**PersonFrontendControllerFindPersons200Response** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The persons were successfully returned. WARNING: This endpoint returns all persons as default when no paging parameters were set. | - | +**401** | Not authorized to get persons. | - | +**403** | Insufficient permissions to get persons. | - | +**500** | Internal server error while getting all persons. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/PersonenkontextApi.md b/loadtest/api-client/generated/PersonenkontextApi.md new file mode 100644 index 0000000..1f0d05c --- /dev/null +++ b/loadtest/api-client/generated/PersonenkontextApi.md @@ -0,0 +1,282 @@ +# .PersonenkontextApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**dbiamPersonenkontextWorkflowControllerCommit**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerCommit) | **PUT** /api/personenkontext-workflow/{personId} | +[**dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte) | **POST** /api/personenkontext-workflow | +[**dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten) | **GET** /api/personenkontext-workflow/schulstrukturknoten | +[**dbiamPersonenkontextWorkflowControllerProcessStep**](PersonenkontextApi.md#dbiamPersonenkontextWorkflowControllerProcessStep) | **GET** /api/personenkontext-workflow/step | + + +# **dbiamPersonenkontextWorkflowControllerCommit** +> PersonenkontexteUpdateResponse dbiamPersonenkontextWorkflowControllerCommit(dbiamUpdatePersonenkontexteBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenkontextApi } from ''; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontextApi(configuration); + +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest = { + // The ID for the person. + personId: "personId_example", + + dbiamUpdatePersonenkontexteBodyParams: { + lastModified: new Date('1970-01-01T00:00:00.00Z'), + count: 3.14, + personenkontexte: [ + { + personId: "personId_example", + organisationId: "organisationId_example", + rolleId: "rolleId_example", + befristung: new Date('1970-01-01T00:00:00.00Z'), + }, + ], + }, + + personalnummer: "personalnummer_example", +}; + +const data = await apiInstance.dbiamPersonenkontextWorkflowControllerCommit(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **dbiamUpdatePersonenkontexteBodyParams** | **DbiamUpdatePersonenkontexteBodyParams**| | + **personId** | [**string**] | The ID for the person. | defaults to undefined + **personalnummer** | [**string**] | | (optional) defaults to undefined + + +### Return type + +**PersonenkontexteUpdateResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Add or remove personenkontexte as one operation. Returns the Personenkontexte existing after update. | - | +**400** | The personenkontexte could not be updated, may due to unsatisfied specifications. | - | +**401** | Not authorized to update personenkontexte. | - | +**403** | Insufficient permission to update personenkontexte. | - | +**409** | Changes are conflicting with current state of personenkontexte. | - | +**500** | Internal server error while updating personenkontexte. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte** +> DBiamPersonResponse dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenkontextApi } from ''; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontextApi(configuration); + +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest = { + + dbiamCreatePersonWithPersonenkontexteBodyParams: { + familienname: "familienname_example", + vorname: "vorname_example", + personalnummer: "personalnummer_example", + befristung: new Date('1970-01-01T00:00:00.00Z'), + createPersonenkontexte: [ + { + organisationId: "organisationId_example", + rolleId: "rolleId_example", + }, + ], + }, +}; + +const data = await apiInstance.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **dbiamCreatePersonWithPersonenkontexteBodyParams** | **DbiamCreatePersonWithPersonenkontexteBodyParams**| | + + +### Return type + +**DBiamPersonResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | Person with Personenkontext was successfully created. | - | +**400** | The person and the personenkontext could not be created, may due to unsatisfied specifications. | - | +**401** | Not authorized to create person with personenkontext. | - | +**403** | Insufficient permission to create person with personenkontext. | - | +**500** | Internal server error while creating person with personenkontext. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten** +> FindSchulstrukturknotenResponse dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten() + + +### Example + + +```typescript +import { createConfiguration, PersonenkontextApi } from ''; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontextApi(configuration); + +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest = { + // RolleId used to filter for schulstrukturknoten in personenkontext. + rolleId: "rolleId_example", + // Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. (optional) + sskName: "sskName_example", + // The limit of items for the request. (optional) + limit: 3.14, +}; + +const data = await apiInstance.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleId** | [**string**] | RolleId used to filter for schulstrukturknoten in personenkontext. | defaults to undefined + **sskName** | [**string**] | Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. | (optional) defaults to undefined + **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined + + +### Return type + +**FindSchulstrukturknotenResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The schulstrukturknoten for a personenkontext were successfully returned. | - | +**401** | Not authorized to get available schulstrukturknoten for personenkontexte. | - | +**403** | Insufficient permission to get schulstrukturknoten for personenkontext. | - | +**500** | Internal server error while getting schulstrukturknoten for personenkontexte. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **dbiamPersonenkontextWorkflowControllerProcessStep** +> PersonenkontextWorkflowResponse dbiamPersonenkontextWorkflowControllerProcessStep() + + +### Example + + +```typescript +import { createConfiguration, PersonenkontextApi } from ''; +import type { PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontextApi(configuration); + +const request: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = { + // ID of the organisation to filter the rollen later (optional) + organisationId: "organisationId_example", + // ID of the rolle. (optional) + rolleId: "rolleId_example", + // Rolle name used to filter for rollen in personenkontext. (optional) + rolleName: "rolleName_example", + // Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. (optional) + organisationName: "organisationName_example", + // The limit of items for the request. (optional) + limit: 3.14, +}; + +const data = await apiInstance.dbiamPersonenkontextWorkflowControllerProcessStep(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **organisationId** | [**string**] | ID of the organisation to filter the rollen later | (optional) defaults to undefined + **rolleId** | [**string**] | ID of the rolle. | (optional) defaults to undefined + **rolleName** | [**string**] | Rolle name used to filter for rollen in personenkontext. | (optional) defaults to undefined + **organisationName** | [**string**] | Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. | (optional) defaults to undefined + **limit** | [**number**] | The limit of items for the request. | (optional) defaults to undefined + + +### Return type + +**PersonenkontextWorkflowResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Initialize or process data from the person creation form. Valid combinations: - Both organisationId and rolleId are undefined: Fetch all possible organisations. - organisationId is provided, but rolleId is undefined: Fetch Rollen for the given organisation. - Both organisationId and rolleId are provided: Check if the Rolle can be committed for the organisation. Note: Providing rolleId without organisationId is invalid. | - | +**401** | Not authorized to get available data for personenkontext. | - | +**403** | Insufficient permission to get data for personenkontext. | - | +**500** | Internal server error while getting data for personenkontext. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/PersonenkontexteApi.md b/loadtest/api-client/generated/PersonenkontexteApi.md new file mode 100644 index 0000000..21d0161 --- /dev/null +++ b/loadtest/api-client/generated/PersonenkontexteApi.md @@ -0,0 +1,318 @@ +# .PersonenkontexteApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**personenkontextControllerDeletePersonenkontextById**](PersonenkontexteApi.md#personenkontextControllerDeletePersonenkontextById) | **DELETE** /api/personenkontexte/{personenkontextId} | +[**personenkontextControllerFindPersonenkontextById**](PersonenkontexteApi.md#personenkontextControllerFindPersonenkontextById) | **GET** /api/personenkontexte/{personenkontextId} | +[**personenkontextControllerFindPersonenkontexte**](PersonenkontexteApi.md#personenkontextControllerFindPersonenkontexte) | **GET** /api/personenkontexte | +[**personenkontextControllerHatSystemRecht**](PersonenkontexteApi.md#personenkontextControllerHatSystemRecht) | **GET** /api/personenkontexte/{personId}/hatSystemrecht | +[**personenkontextControllerUpdatePersonenkontextWithId**](PersonenkontexteApi.md#personenkontextControllerUpdatePersonenkontextWithId) | **PUT** /api/personenkontexte/{personenkontextId} | + + +# **personenkontextControllerDeletePersonenkontextById** +> void personenkontextControllerDeletePersonenkontextById(deleteRevisionBodyParams) + + +### Example + + +```typescript +import { createConfiguration, PersonenkontexteApi } from ''; +import type { PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontexteApi(configuration); + +const request: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest = { + // The id for the personenkontext. + personenkontextId: "personenkontextId_example", + + deleteRevisionBodyParams: { + revision: "revision_example", + }, +}; + +const data = await apiInstance.personenkontextControllerDeletePersonenkontextById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **deleteRevisionBodyParams** | **DeleteRevisionBodyParams**| | + **personenkontextId** | [**string**] | The id for the personenkontext. | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**204** | The personenkontext was successfully deleted. | - | +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The personenkontext was not found. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personenkontextControllerFindPersonenkontextById** +> PersonendatensatzResponseAutomapper personenkontextControllerFindPersonenkontextById() + + +### Example + + +```typescript +import { createConfiguration, PersonenkontexteApi } from ''; +import type { PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontexteApi(configuration); + +const request: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest = { + // The id for the personenkontext. + personenkontextId: "personenkontextId_example", +}; + +const data = await apiInstance.personenkontextControllerFindPersonenkontextById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personenkontextId** | [**string**] | The id for the personenkontext. | defaults to undefined + + +### Return type + +**PersonendatensatzResponseAutomapper** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenkontext was successfully returned. | - | +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The personenkontext was not found. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personenkontextControllerFindPersonenkontexte** +> Array personenkontextControllerFindPersonenkontexte() + + +### Example + + +```typescript +import { createConfiguration, PersonenkontexteApi } from ''; +import type { PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontexteApi(configuration); + +const request: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = { + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + + personId: "personId_example", + + referrer: "referrer_example", + + personenstatus: "AKTIV", + + sichtfreigabe: "ja", +}; + +const data = await apiInstance.personenkontextControllerFindPersonenkontexte(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **personId** | [**string**] | | (optional) defaults to undefined + **referrer** | [**string**] | | (optional) defaults to undefined + **personenstatus** | **Personenstatus** | | (optional) defaults to undefined + **sichtfreigabe** | **Sichtfreigabe** | | (optional) defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenkontexte were successfully returned. | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The personenkontexte were not found. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personenkontextControllerHatSystemRecht** +> SystemrechtResponse personenkontextControllerHatSystemRecht() + + +### Example + + +```typescript +import { createConfiguration, PersonenkontexteApi } from ''; +import type { PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontexteApi(configuration); + +const request: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest = { + // The id for the account. + personId: "personId_example", + + systemRecht: "ROLLEN_VERWALTEN", +}; + +const data = await apiInstance.personenkontextControllerHatSystemRecht(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personId** | [**string**] | The id for the account. | defaults to undefined + **systemRecht** | **RollenSystemRecht** | | defaults to undefined + + +### Return type + +**SystemrechtResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The SchulStrukturKnoten associated with this personId and systemrecht. Can return empty list | - | +**404** | The systemrecht could not be found (does not exist as type of systemrecht). | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **personenkontextControllerUpdatePersonenkontextWithId** +> PersonenkontextResponse personenkontextControllerUpdatePersonenkontextWithId() + + +### Example + + +```typescript +import { createConfiguration, PersonenkontexteApi } from ''; +import type { PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new PersonenkontexteApi(configuration); + +const request: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest = { + + personenkontextId: "personenkontextId_example", +}; + +const data = await apiInstance.personenkontextControllerUpdatePersonenkontextWithId(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **personenkontextId** | [**string**] | | defaults to undefined + + +### Return type + +**PersonenkontextResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The personenkontext was successfully updated. | - | +**400** | Request has wrong format. | - | +**401** | Request is not authorized. | - | +**403** | Insufficient permissions to perform operation. | - | +**404** | The personenkontext was not found. | - | +**500** | An internal server error occurred. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/ProviderApi.md b/loadtest/api-client/generated/ProviderApi.md new file mode 100644 index 0000000..5cb0ee1 --- /dev/null +++ b/loadtest/api-client/generated/ProviderApi.md @@ -0,0 +1,167 @@ +# .ProviderApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**providerControllerGetAllServiceProviders**](ProviderApi.md#providerControllerGetAllServiceProviders) | **GET** /api/provider/all | +[**providerControllerGetAvailableServiceProviders**](ProviderApi.md#providerControllerGetAvailableServiceProviders) | **GET** /api/provider | +[**providerControllerGetServiceProviderLogo**](ProviderApi.md#providerControllerGetServiceProviderLogo) | **GET** /api/provider/{angebotId}/logo | + + +# **providerControllerGetAllServiceProviders** +> Array providerControllerGetAllServiceProviders() + +Get all service-providers. + +### Example + + +```typescript +import { createConfiguration, ProviderApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new ProviderApi(configuration); + +const request = {}; + +const data = await apiInstance.providerControllerGetAllServiceProviders(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The service-providers were successfully returned. | - | +**401** | Not authorized to get available service providers. | - | +**403** | Insufficient permissions to get service-providers. | - | +**500** | Internal server error while getting all service-providers. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **providerControllerGetAvailableServiceProviders** +> Array providerControllerGetAvailableServiceProviders() + +Get service-providers available for logged-in user. + +### Example + + +```typescript +import { createConfiguration, ProviderApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new ProviderApi(configuration); + +const request = {}; + +const data = await apiInstance.providerControllerGetAvailableServiceProviders(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The service-providers were successfully returned. | - | +**401** | Not authorized to get available service providers. | - | +**403** | Insufficient permissions to get service-providers. | - | +**500** | Internal server error while getting all service-providers. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **providerControllerGetServiceProviderLogo** +> any providerControllerGetServiceProviderLogo() + + +### Example + + +```typescript +import { createConfiguration, ProviderApi } from ''; +import type { ProviderApiProviderControllerGetServiceProviderLogoRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new ProviderApi(configuration); + +const request: ProviderApiProviderControllerGetServiceProviderLogoRequest = { + // The id of the service provider + angebotId: "angebotId_example", +}; + +const data = await apiInstance.providerControllerGetServiceProviderLogo(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **angebotId** | [**string**] | The id of the service provider | defaults to undefined + + +### Return type + +**any** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: image/* + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The logo for the service provider was successfully returned. | - | +**400** | Angebot ID is required. | - | +**401** | Not authorized to get service provider logo. | - | +**403** | Insufficient permissions to get the logo. | - | +**404** | The service-provider does not exist or has no logo. | - | +**500** | Internal server error while getting the logo. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/README.md b/loadtest/api-client/generated/README.md new file mode 100644 index 0000000..f1f2196 --- /dev/null +++ b/loadtest/api-client/generated/README.md @@ -0,0 +1,80 @@ +## @ + +This generator creates TypeScript/JavaScript client that utilizes fetch-api. + +### Building + +To build and compile the typescript sources to javascript use: +``` +npm install +npm run build +``` + +### Publishing + +First build the package then run ```npm publish``` + +### Consuming + +Navigate to the folder of your consuming project and run one of the following commands. + +_published:_ + +``` +npm install @ --save +``` + +_unPublished (not recommended):_ + +``` +npm install PATH_TO_GENERATED_PACKAGE --save +``` + +### Usage + +Below code snippet shows exemplary usage of the configuration and the API based +on the typical `PetStore` example used for OpenAPI. + +``` +import * as your_api from 'your_api_package' + +// Covers all auth methods included in your OpenAPI yaml definition +const authConfig: your_api.AuthMethodsConfiguration = { + "api_key": "YOUR_API_KEY" +} + +// Implements a simple middleware to modify requests before (`pre`) they are sent +// and after (`post`) they have been received +class Test implements your_api.Middleware { + pre(context: your_api.RequestContext): Promise { + // Modify context here and return + return Promise.resolve(context); + } + + post(context: your_api.ResponseContext): Promise { + return Promise.resolve(context); + } + +} + +// Create configuration parameter object +const configurationParameters = { + httpApi: new your_api.JQueryHttpLibrary(), // Can also be ignored - default is usually fine + baseServer: your_api.servers[0], // First server is default + authMethods: authConfig, // No auth is default + promiseMiddleware: [new Test()], +} + +// Convert to actual configuration +const config = your_api.createConfiguration(configurationParameters); + +// Use configuration with your_api +const api = new your_api.PetApi(config); +your_api.Pet p = new your_api.Pet(); +p.name = "My new pet"; +p.photoUrls = []; +p.tags = []; +p.status = "available"; +Promise createdPet = api.addPet(p); + +``` diff --git a/loadtest/api-client/generated/RolleApi.md b/loadtest/api-client/generated/RolleApi.md new file mode 100644 index 0000000..703f922 --- /dev/null +++ b/loadtest/api-client/generated/RolleApi.md @@ -0,0 +1,576 @@ +# .RolleApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**rolleControllerAddSystemRecht**](RolleApi.md#rolleControllerAddSystemRecht) | **PATCH** /api/rolle/{rolleId} | +[**rolleControllerCreateRolle**](RolleApi.md#rolleControllerCreateRolle) | **POST** /api/rolle | +[**rolleControllerDeleteRolle**](RolleApi.md#rolleControllerDeleteRolle) | **DELETE** /api/rolle/{rolleId} | +[**rolleControllerFindRolleByIdWithServiceProviders**](RolleApi.md#rolleControllerFindRolleByIdWithServiceProviders) | **GET** /api/rolle/{rolleId} | +[**rolleControllerFindRollen**](RolleApi.md#rolleControllerFindRollen) | **GET** /api/rolle | +[**rolleControllerGetRolleServiceProviderIds**](RolleApi.md#rolleControllerGetRolleServiceProviderIds) | **GET** /api/rolle/{rolleId}/serviceProviders | +[**rolleControllerRemoveServiceProviderById**](RolleApi.md#rolleControllerRemoveServiceProviderById) | **DELETE** /api/rolle/{rolleId}/serviceProviders | +[**rolleControllerUpdateRolle**](RolleApi.md#rolleControllerUpdateRolle) | **PUT** /api/rolle/{rolleId} | +[**rolleControllerUpdateServiceProvidersById**](RolleApi.md#rolleControllerUpdateServiceProvidersById) | **PUT** /api/rolle/{rolleId}/serviceProviders | + + +# **rolleControllerAddSystemRecht** +> void rolleControllerAddSystemRecht(addSystemrechtBodyParams) + +Add systemrecht to a rolle. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerAddSystemRechtRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerAddSystemRechtRequest = { + // The id for the rolle. + rolleId: "rolleId_example", + + addSystemrechtBodyParams: { + systemRecht: "ROLLEN_VERWALTEN", + }, +}; + +const data = await apiInstance.rolleControllerAddSystemRecht(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **addSystemrechtBodyParams** | **AddSystemrechtBodyParams**| | + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The systemrecht was successfully added to rolle. | - | +**400** | The input was not valid. | - | +**401** | Not authorized to create the rolle. | - | +**403** | Insufficient permissions to create the rolle. | - | +**500** | Internal server error while adding systemrecht to rolle. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerCreateRolle** +> RolleResponse rolleControllerCreateRolle(createRolleBodyParams) + +Create a new rolle. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerCreateRolleRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerCreateRolleRequest = { + + createRolleBodyParams: { + name: "name_example", + administeredBySchulstrukturknoten: "administeredBySchulstrukturknoten_example", + rollenart: "LERN", + merkmale: [ + "BEFRISTUNG_PFLICHT", + ], + systemrechte: [ + "ROLLEN_VERWALTEN", + ], + }, +}; + +const data = await apiInstance.rolleControllerCreateRolle(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **createRolleBodyParams** | **CreateRolleBodyParams**| | + + +### Return type + +**RolleResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**201** | The rolle was successfully created. | - | +**400** | The input was not valid. | - | +**401** | Not authorized to create the rolle. | - | +**403** | Insufficient permissions to create the rolle. | - | +**500** | Internal server error while creating the rolle. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerDeleteRolle** +> void rolleControllerDeleteRolle() + +Delete a role by id. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerDeleteRolleRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerDeleteRolleRequest = { + // The id for the rolle. + rolleId: "rolleId_example", +}; + +const data = await apiInstance.rolleControllerDeleteRolle(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**204** | Role was deleted successfully. | - | +**400** | The input was not valid. | - | +**401** | Not authorized to delete the role. | - | +**404** | The rolle that should be deleted does not exist. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerFindRolleByIdWithServiceProviders** +> RolleWithServiceProvidersResponse rolleControllerFindRolleByIdWithServiceProviders() + +Get rolle by id. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest = { + // The id for the rolle. + rolleId: "rolleId_example", +}; + +const data = await apiInstance.rolleControllerFindRolleByIdWithServiceProviders(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**RolleWithServiceProvidersResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The rolle was successfully returned. | - | +**401** | Not authorized to get rolle by id. | - | +**403** | Insufficient permission to get rolle by id. | - | +**500** | Internal server error while getting rolle by id. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerFindRollen** +> Array rolleControllerFindRollen() + +List all rollen. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerFindRollenRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerFindRollenRequest = { + // The offset of the paginated list. (optional) + offset: 3.14, + // The requested limit for the page size. (optional) + limit: 3.14, + // The name for the role. (optional) + searchStr: "searchStr_example", +}; + +const data = await apiInstance.rolleControllerFindRollen(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **offset** | [**number**] | The offset of the paginated list. | (optional) defaults to undefined + **limit** | [**number**] | The requested limit for the page size. | (optional) defaults to undefined + **searchStr** | [**string**] | The name for the role. | (optional) defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The rollen were successfully returned | * X-Paging-Offset - The offset of the first item from the list. List starts with index 0.
* X-Paging-Limit - The maximum amount of items returned in one request.
* X-Paging-Total - The total amount of items in the list.
* X-Paging-pageTotal - The total amount of items in the paginated list.
| +**401** | Not authorized to get rollen. | - | +**403** | Insufficient permissions to get rollen. | - | +**500** | Internal server error while getting all rollen. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerGetRolleServiceProviderIds** +> RolleServiceProviderResponse rolleControllerGetRolleServiceProviderIds() + +Get service-providers for a rolle by its id. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerGetRolleServiceProviderIdsRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerGetRolleServiceProviderIdsRequest = { + // The id for the rolle. + rolleId: "rolleId_example", +}; + +const data = await apiInstance.rolleControllerGetRolleServiceProviderIds(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**RolleServiceProviderResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Returns a list of service-provider ids. | - | +**401** | Not authorized to retrieve service-providers for rolle. | - | +**404** | The rolle does not exist. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerRemoveServiceProviderById** +> void rolleControllerRemoveServiceProviderById(rolleServiceProviderBodyParams) + +Remove a service-provider from a rolle by id. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerRemoveServiceProviderByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerRemoveServiceProviderByIdRequest = { + // The id for the rolle. + rolleId: "rolleId_example", + + rolleServiceProviderBodyParams: { + serviceProviderIds: [ + "serviceProviderIds_example", + ], + version: 3.14, + }, +}; + +const data = await apiInstance.rolleControllerRemoveServiceProviderById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleServiceProviderBodyParams** | **RolleServiceProviderBodyParams**| | + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**void** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Removing service-provider finished successfully. | - | +**401** | Not authorized to retrieve service-providers for rolle. | - | +**404** | The rolle or the service-provider that should be removed does not exist. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerUpdateRolle** +> RolleWithServiceProvidersResponse rolleControllerUpdateRolle(updateRolleBodyParams) + +Update rolle. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerUpdateRolleRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerUpdateRolleRequest = { + // The id for the rolle. + rolleId: "rolleId_example", + + updateRolleBodyParams: { + name: "name_example", + merkmale: [ + "BEFRISTUNG_PFLICHT", + ], + systemrechte: [ + "ROLLEN_VERWALTEN", + ], + serviceProviderIds: [ + "serviceProviderIds_example", + ], + version: 3.14, + }, +}; + +const data = await apiInstance.rolleControllerUpdateRolle(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **updateRolleBodyParams** | **UpdateRolleBodyParams**| | + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**RolleWithServiceProvidersResponse** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | The rolle was successfully updated. | - | +**400** | The input was not valid. | - | +**401** | Not authorized to update the rolle. | - | +**403** | Insufficient permissions to update the rolle. | - | +**500** | Internal server error while updating the rolle. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + +# **rolleControllerUpdateServiceProvidersById** +> Array rolleControllerUpdateServiceProvidersById(rolleServiceProviderBodyParams) + +Add a service-provider to a rolle by id. + +### Example + + +```typescript +import { createConfiguration, RolleApi } from ''; +import type { RolleApiRolleControllerUpdateServiceProvidersByIdRequest } from ''; + +const configuration = createConfiguration(); +const apiInstance = new RolleApi(configuration); + +const request: RolleApiRolleControllerUpdateServiceProvidersByIdRequest = { + // The id for the rolle. + rolleId: "rolleId_example", + + rolleServiceProviderBodyParams: { + serviceProviderIds: [ + "serviceProviderIds_example", + ], + version: 3.14, + }, +}; + +const data = await apiInstance.rolleControllerUpdateServiceProvidersById(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters + +Name | Type | Description | Notes +------------- | ------------- | ------------- | ------------- + **rolleServiceProviderBodyParams** | **RolleServiceProviderBodyParams**| | + **rolleId** | [**string**] | The id for the rolle. | defaults to undefined + + +### Return type + +**Array** + +### Authorization + +[bearer](README.md#bearer), [oauth2](README.md#oauth2) + +### HTTP request headers + + - **Content-Type**: application/json + - **Accept**: application/json + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | Adding service-provider finished successfully. | - | +**400** | The service-provider is already attached to rolle. | - | +**401** | Not authorized to retrieve service-providers for rolle. | - | +**404** | The rolle or the service-provider to add does not exist. | - | +**500** | Internal server error, the service-provider may could not be found after attaching to rolle. | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/StatusApi.md b/loadtest/api-client/generated/StatusApi.md new file mode 100644 index 0000000..84011ac --- /dev/null +++ b/loadtest/api-client/generated/StatusApi.md @@ -0,0 +1,55 @@ +# .StatusApi + +All URIs are relative to *http://localhost* + +Method | HTTP request | Description +------------- | ------------- | ------------- +[**statusControllerGetStatus**](StatusApi.md#statusControllerGetStatus) | **GET** /api/status | + + +# **statusControllerGetStatus** +> void statusControllerGetStatus() + + +### Example + + +```typescript +import { createConfiguration, StatusApi } from ''; + +const configuration = createConfiguration(); +const apiInstance = new StatusApi(configuration); + +const request = {}; + +const data = await apiInstance.statusControllerGetStatus(request); +console.log('API called successfully. Returned data:', data); +``` + + +### Parameters +This endpoint does not need any parameter. + + +### Return type + +**void** + +### Authorization + +No authorization required + +### HTTP request headers + + - **Content-Type**: Not defined + - **Accept**: Not defined + + +### HTTP response details +| Status code | Description | Response headers | +|-------------|-------------|------------------| +**200** | | - | + +[[Back to top]](#) [[Back to API list]](README.md#documentation-for-api-endpoints) [[Back to Model list]](README.md#documentation-for-models) [[Back to README]](README.md) + + diff --git a/loadtest/api-client/generated/apis/AuthApi.ts b/loadtest/api-client/generated/apis/AuthApi.ts new file mode 100644 index 0000000..fccfd8c --- /dev/null +++ b/loadtest/api-client/generated/apis/AuthApi.ts @@ -0,0 +1,265 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { UserinfoResponse } from '../models/UserinfoResponse.ts'; + +/** + * no description + */ +export class AuthApiRequestFactory extends BaseAPIRequestFactory { + + /** + * Info about logged in user. + */ + public async authenticationControllerInfo(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/auth/logininfo'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Used to start OIDC authentication. + * @param redirectUrl + */ + public async authenticationControllerLogin(redirectUrl?: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + // Path Params + const localVarPath = '/api/auth/login'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (redirectUrl !== undefined) { + requestContext.setQueryParam("redirectUrl", ObjectSerializer.serialize(redirectUrl, "string", "")); + } + + + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Used to log out the current user. + */ + public async authenticationControllerLogout(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/auth/logout'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public async authenticationControllerResetPassword(redirectUrl: string, loginHint: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'redirectUrl' is not null or undefined + if (redirectUrl === null || redirectUrl === undefined) { + throw new RequiredError("AuthApi", "authenticationControllerResetPassword", "redirectUrl"); + } + + + // verify required parameter 'loginHint' is not null or undefined + if (loginHint === null || loginHint === undefined) { + throw new RequiredError("AuthApi", "authenticationControllerResetPassword", "loginHint"); + } + + + // Path Params + const localVarPath = '/api/auth/reset-password'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (redirectUrl !== undefined) { + requestContext.setQueryParam("redirectUrl", ObjectSerializer.serialize(redirectUrl, "string", "")); + } + + // Query Params + if (loginHint !== undefined) { + requestContext.setQueryParam("login_hint", ObjectSerializer.serialize(loginHint, "string", "")); + } + + + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class AuthApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerInfo + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerInfoWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: UserinfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "UserinfoResponse", "" + ) as UserinfoResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "User is not logged in.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: UserinfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "UserinfoResponse", "" + ) as UserinfoResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerLogin + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerLoginWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("302", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Redirection to orchestrate OIDC flow.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerLogout + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerLogoutWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("302", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Redirect to logout.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while trying to log out.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to authenticationControllerResetPassword + * @throws ApiException if the response code was not in [200, 299] + */ + public async authenticationControllerResetPasswordWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("302", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Redirect to Keycloak password reset page.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/Class2FAApi.ts b/loadtest/api-client/generated/apis/Class2FAApi.ts new file mode 100644 index 0000000..acc7c80 --- /dev/null +++ b/loadtest/api-client/generated/apis/Class2FAApi.ts @@ -0,0 +1,575 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; +import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; +import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; +import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; +import { TokenStateResponse } from '../models/TokenStateResponse.ts'; +import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; + +/** + * no description + */ +export class Class2FAApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param assignHardwareTokenBodyParams + */ + public async privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'assignHardwareTokenBodyParams' is not null or undefined + if (assignHardwareTokenBodyParams === null || assignHardwareTokenBodyParams === undefined) { + throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerAssignHardwareToken", "assignHardwareTokenBodyParams"); + } + + + // Path Params + const localVarPath = '/api/2fa-token/assign/hardwareToken'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(assignHardwareTokenBodyParams, "AssignHardwareTokenBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async privacyIdeaAdministrationControllerGetTwoAuthState(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerGetTwoAuthState", "personId"); + } + + + // Path Params + const localVarPath = '/api/2fa-token/state'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param tokenInitBodyParams + */ + public async privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'tokenInitBodyParams' is not null or undefined + if (tokenInitBodyParams === null || tokenInitBodyParams === undefined) { + throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerInitializeSoftwareToken", "tokenInitBodyParams"); + } + + + // Path Params + const localVarPath = '/api/2fa-token/init'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(tokenInitBodyParams, "TokenInitBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication", "personId"); + } + + + // Path Params + const localVarPath = '/api/2fa-token/required'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async privacyIdeaAdministrationControllerResetToken(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerResetToken", "personId"); + } + + + // Path Params + const localVarPath = '/api/2fa-token/reset'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param tokenVerifyBodyParams + */ + public async privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'tokenVerifyBodyParams' is not null or undefined + if (tokenVerifyBodyParams === null || tokenVerifyBodyParams === undefined) { + throw new RequiredError("Class2FAApi", "privacyIdeaAdministrationControllerVerifyToken", "tokenVerifyBodyParams"); + } + + + // Path Params + const localVarPath = '/api/2fa-token/verify'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(tokenVerifyBodyParams, "TokenVerifyBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class Class2FAApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerAssignHardwareToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: AssignHardwareTokenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "AssignHardwareTokenResponse", "" + ) as AssignHardwareTokenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to assign hardware token.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to reset token.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to assign hardware token.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while assigning a hardware token.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: AssignHardwareTokenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "AssignHardwareTokenResponse", "" + ) as AssignHardwareTokenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerGetTwoAuthState + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: TokenStateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenStateResponse", "" + ) as TokenStateResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get token state.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get token state.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get token state.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while retrieving token state.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: TokenStateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenStateResponse", "" + ) as TokenStateResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerInitializeSoftwareToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", "" + ) as string; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create token.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create token.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create token.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating a token.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", "" + ) as string; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: TokenRequiredResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenRequiredResponse", "" + ) as TokenRequiredResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get requirement information.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get requirement information.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get requirement information.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting requirement information.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: TokenRequiredResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "TokenRequiredResponse", "" + ) as TokenRequiredResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerResetToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerResetTokenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to reset token.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to reset token.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to reset token.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while reseting a token.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to privacyIdeaAdministrationControllerVerifyToken + * @throws ApiException if the response code was not in [200, 299] + */ + public async privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A username was not given or not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to verify token.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to verify token.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to verify token.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while verifying a token.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/CronApi.ts b/loadtest/api-client/generated/apis/CronApi.ts new file mode 100644 index 0000000..199c5f7 --- /dev/null +++ b/loadtest/api-client/generated/apis/CronApi.ts @@ -0,0 +1,326 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + + +/** + * no description + */ +export class CronApiRequestFactory extends BaseAPIRequestFactory { + + /** + */ + public async cronControllerKoPersUserLock(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/cron/kopers-lock'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async cronControllerPersonWithoutOrgDelete(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/cron/person-without-org'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/cron/kontext-expired'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async cronControllerUnlockUsersWithExpiredLocks(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/cron/unlock'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class CronApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerKoPersUserLock + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerKoPersUserLockWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "User are not given or not found", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to lock user.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to lock user.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to lock user.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while trying to lock user.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerPersonWithoutOrgDelete + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerPersonWithoutOrgDeleteWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "User are not given or not found", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to remove user.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to delete user.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to delete user.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while trying to remove user.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Personenkontexte are not given or not found.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to remove personenkontexte from users.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to remove personenkontexte from users.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to remove personenkontexte from users.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while trying to remove personenkontexte from users.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to cronControllerUnlockUsersWithExpiredLocks + * @throws ApiException if the response code was not in [200, 299] + */ + public async cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to unlock users.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to unlock users.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to unlock users.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while trying to unlock users.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: boolean = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "boolean", "" + ) as boolean; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts b/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts new file mode 100644 index 0000000..2671c93 --- /dev/null +++ b/loadtest/api-client/generated/apis/DbiamPersonenkontexteApi.ts @@ -0,0 +1,199 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; +import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; + +/** + * no description + */ +export class DbiamPersonenkontexteApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public async dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'dbiamPersonenkontextMigrationBodyParams' is not null or undefined + if (dbiamPersonenkontextMigrationBodyParams === null || dbiamPersonenkontextMigrationBodyParams === undefined) { + throw new RequiredError("DbiamPersonenkontexteApi", "dBiamPersonenkontextControllerCreatePersonenkontextMigration", "dbiamPersonenkontextMigrationBodyParams"); + } + + + // Path Params + const localVarPath = '/api/dbiam/personenkontext'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(dbiamPersonenkontextMigrationBodyParams, "DbiamPersonenkontextMigrationBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The ID for the person. + */ + public async dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("DbiamPersonenkontexteApi", "dBiamPersonenkontextControllerFindPersonenkontextsByPerson", "personId"); + } + + + // Path Params + const localVarPath = '/api/dbiam/personenkontext/{personId}' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class DbiamPersonenkontexteApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenkontextControllerCreatePersonenkontextMigration + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: DBiamPersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenkontextResponse", "" + ) as DBiamPersonenkontextResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonenkontextError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonenkontextError", "" + ) as DbiamPersonenkontextError; + throw new ApiException(response.httpStatusCode, "The personenkontext could not be created, may due to unsatisfied specifications.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create personenkontext.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to create personenkontext.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating personenkontext.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenkontextResponse", "" + ) as DBiamPersonenkontextResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenkontextControllerFindPersonenkontextsByPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get available personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get personenkontexte for this user.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting personenkontexte.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts b/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts new file mode 100644 index 0000000..b55103f --- /dev/null +++ b/loadtest/api-client/generated/apis/DbiamPersonenuebersichtApi.ts @@ -0,0 +1,192 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; +import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; +import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; + +/** + * no description + */ +export class DbiamPersonenuebersichtApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param personenuebersichtBodyParams + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenuebersichtBodyParams' is not null or undefined + if (personenuebersichtBodyParams === null || personenuebersichtBodyParams === undefined) { + throw new RequiredError("DbiamPersonenuebersichtApi", "dBiamPersonenuebersichtControllerFindPersonenuebersichten", "personenuebersichtBodyParams"); + } + + + // Path Params + const localVarPath = '/api/dbiam/personenuebersicht'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(personenuebersichtBodyParams, "PersonenuebersichtBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The ID for the person. + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("DbiamPersonenuebersichtApi", "dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson", "personId"); + } + + + // Path Params + const localVarPath = '/api/dbiam/personenuebersicht/{personId}' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class DbiamPersonenuebersichtApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenuebersichtControllerFindPersonenuebersichten + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response", "" + ) as DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get personenuebersichten.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get personenuebersichten.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting personenuebersichten.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response", "" + ) as DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: DBiamPersonenuebersichtResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtResponse", "" + ) as DBiamPersonenuebersichtResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get personenuebersicht.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get personenuebersicht.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting personenuebersicht.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonenuebersichtResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonenuebersichtResponse", "" + ) as DBiamPersonenuebersichtResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/ImportApi.ts b/loadtest/api-client/generated/apis/ImportApi.ts new file mode 100644 index 0000000..33c03ae --- /dev/null +++ b/loadtest/api-client/generated/apis/ImportApi.ts @@ -0,0 +1,331 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { DbiamImportError } from '../models/DbiamImportError.ts'; +import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; +import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; + +/** + * no description + */ +export class ImportApiRequestFactory extends BaseAPIRequestFactory { + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public async importControllerDeleteImportTransaction(importvorgangId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'importvorgangId' is not null or undefined + if (importvorgangId === null || importvorgangId === undefined) { + throw new RequiredError("ImportApi", "importControllerDeleteImportTransaction", "importvorgangId"); + } + + + // Path Params + const localVarPath = '/api/import/{importvorgangId}' + .replace('{' + 'importvorgangId' + '}', encodeURIComponent(String(importvorgangId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param importvorgangByIdBodyParams + */ + public async importControllerExecuteImport(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'importvorgangByIdBodyParams' is not null or undefined + if (importvorgangByIdBodyParams === null || importvorgangByIdBodyParams === undefined) { + throw new RequiredError("ImportApi", "importControllerExecuteImport", "importvorgangByIdBodyParams"); + } + + + // Path Params + const localVarPath = '/api/import/execute'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(importvorgangByIdBodyParams, "ImportvorgangByIdBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public async importControllerUploadFile(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("ImportApi", "importControllerUploadFile", "organisationId"); + } + + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("ImportApi", "importControllerUploadFile", "rolleId"); + } + + + // verify required parameter 'file' is not null or undefined + if (file === null || file === undefined) { + throw new RequiredError("ImportApi", "importControllerUploadFile", "file"); + } + + + // Path Params + const localVarPath = '/api/import/upload'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Form Params + const useForm = canConsumeForm([ + 'multipart/form-data', + ]); + + let localVarFormParams + if (useForm) { + localVarFormParams = new FormData(); + } else { + localVarFormParams = new URLSearchParams(); + } + + if (organisationId !== undefined) { + // TODO: replace .append with .set + localVarFormParams.append('organisationId', organisationId as any); + } + if (rolleId !== undefined) { + // TODO: replace .append with .set + localVarFormParams.append('rolleId', rolleId as any); + } + if (file !== undefined) { + // TODO: replace .append with .set + if (localVarFormParams instanceof FormData) { + localVarFormParams.append('file', file, file.name); + } + } + + requestContext.setBody(localVarFormParams); + + if(!useForm) { + const contentType = ObjectSerializer.getPreferredMediaType([ + "multipart/form-data" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + } + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class ImportApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to importControllerDeleteImportTransaction + * @throws ApiException if the response code was not in [200, 299] + */ + public async importControllerDeleteImportTransactionWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamImportError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamImportError", "" + ) as DbiamImportError; + throw new ApiException(response.httpStatusCode, "Something went wrong with the found import transaction.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to delete the import transaction.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The import transaction that should be deleted does not exist.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to importControllerExecuteImport + * @throws ApiException if the response code was not in [200, 299] + */ + public async importControllerExecuteImportWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: HttpFile = await response.getBodyAsFile() as any as HttpFile; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamImportError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamImportError", "binary" + ) as DbiamImportError; + throw new ApiException(response.httpStatusCode, "Something went wrong with the found import transaction.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to execute the import transaction.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to execute the import transaction.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The import transaction does not exist.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while executing the import transaction.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: HttpFile = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "HttpFile", "binary" + ) as HttpFile; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to importControllerUploadFile + * @throws ApiException if the response code was not in [200, 299] + */ + public async importControllerUploadFileWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: ImportUploadResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ImportUploadResponse", "" + ) as ImportUploadResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The CSV file was not valid.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to import data with a CSV file.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to import data with a CSV file.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while importing data with a CSV file.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: ImportUploadResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ImportUploadResponse", "" + ) as ImportUploadResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/OrganisationenApi.ts b/loadtest/api-client/generated/apis/OrganisationenApi.ts new file mode 100644 index 0000000..4cf1723 --- /dev/null +++ b/loadtest/api-client/generated/apis/OrganisationenApi.ts @@ -0,0 +1,1361 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; +import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; +import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; +import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; +import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; + +/** + * no description + */ +export class OrganisationenApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public async organisationControllerAddAdministrierteOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerAddAdministrierteOrganisation", "organisationId"); + } + + + // verify required parameter 'organisationByIdBodyParams' is not null or undefined + if (organisationByIdBodyParams === null || organisationByIdBodyParams === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerAddAdministrierteOrganisation", "organisationByIdBodyParams"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/administriert' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(organisationByIdBodyParams, "OrganisationByIdBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public async organisationControllerAddZugehoerigeOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerAddZugehoerigeOrganisation", "organisationId"); + } + + + // verify required parameter 'organisationByIdBodyParams' is not null or undefined + if (organisationByIdBodyParams === null || organisationByIdBodyParams === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerAddZugehoerigeOrganisation", "organisationByIdBodyParams"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/zugehoerig' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(organisationByIdBodyParams, "OrganisationByIdBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param createOrganisationBodyParams + */ + public async organisationControllerCreateOrganisation(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'createOrganisationBodyParams' is not null or undefined + if (createOrganisationBodyParams === null || createOrganisationBodyParams === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerCreateOrganisation", "createOrganisationBodyParams"); + } + + + // Path Params + const localVarPath = '/api/organisationen'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(createOrganisationBodyParams, "CreateOrganisationBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public async organisationControllerDeleteKlasse(organisationId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerDeleteKlasse", "organisationId"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/klasse' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + */ + public async organisationControllerEnableForitslearning(organisationId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerEnableForitslearning", "organisationId"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/enable-for-its-learning' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + */ + public async organisationControllerFindOrganisationById(organisationId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerFindOrganisationById", "organisationId"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param kennung + * @param name + * @param searchString + * @param typ + * @param systemrechte + * @param excludeTyp + * @param administriertVon + * @param organisationIds Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public async organisationControllerFindOrganizations(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + + + + + + + + + // Path Params + const localVarPath = '/api/organisationen'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (kennung !== undefined) { + requestContext.setQueryParam("kennung", ObjectSerializer.serialize(kennung, "string", "")); + } + + // Query Params + if (name !== undefined) { + requestContext.setQueryParam("name", ObjectSerializer.serialize(name, "string", "")); + } + + // Query Params + if (searchString !== undefined) { + requestContext.setQueryParam("searchString", ObjectSerializer.serialize(searchString, "string", "")); + } + + // Query Params + if (typ !== undefined) { + const serializedParams = ObjectSerializer.serialize(typ, "OrganisationsTyp", ""); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + // Query Params + if (systemrechte !== undefined) { + const serializedParams = ObjectSerializer.serialize(systemrechte, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("systemrechte", serializedParam); + } + } + + // Query Params + if (excludeTyp !== undefined) { + const serializedParams = ObjectSerializer.serialize(excludeTyp, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("excludeTyp", serializedParam); + } + } + + // Query Params + if (administriertVon !== undefined) { + const serializedParams = ObjectSerializer.serialize(administriertVon, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("administriertVon", serializedParam); + } + } + + // Query Params + if (organisationIds !== undefined) { + const serializedParams = ObjectSerializer.serialize(organisationIds, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("organisationIds", serializedParam); + } + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param searchFilter + */ + public async organisationControllerGetAdministrierteOrganisationen(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerGetAdministrierteOrganisationen", "organisationId"); + } + + + + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/administriert' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (searchFilter !== undefined) { + requestContext.setQueryParam("searchFilter", ObjectSerializer.serialize(searchFilter, "string", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public async organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'parentOrganisationsByIdsBodyParams' is not null or undefined + if (parentOrganisationsByIdsBodyParams === null || parentOrganisationsByIdsBodyParams === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerGetParentsByIds", "parentOrganisationsByIdsBodyParams"); + } + + + // Path Params + const localVarPath = '/api/organisationen/parents-by-ids'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(parentOrganisationsByIdsBodyParams, "ParentOrganisationsByIdsBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async organisationControllerGetRootChildren(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/organisationen/root/children'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + */ + public async organisationControllerGetRootOrganisation(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/organisationen/root'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + */ + public async organisationControllerGetZugehoerigeOrganisationen(organisationId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerGetZugehoerigeOrganisationen", "organisationId"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/zugehoerig' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public async organisationControllerUpdateOrganisation(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisation", "organisationId"); + } + + + // verify required parameter 'updateOrganisationBodyParams' is not null or undefined + if (updateOrganisationBodyParams === null || updateOrganisationBodyParams === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisation", "updateOrganisationBodyParams"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(updateOrganisationBodyParams, "UpdateOrganisationBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public async organisationControllerUpdateOrganisationName(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'organisationId' is not null or undefined + if (organisationId === null || organisationId === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisationName", "organisationId"); + } + + + // verify required parameter 'organisationByNameBodyParams' is not null or undefined + if (organisationByNameBodyParams === null || organisationByNameBodyParams === undefined) { + throw new RequiredError("OrganisationenApi", "organisationControllerUpdateOrganisationName", "organisationByNameBodyParams"); + } + + + // Path Params + const localVarPath = '/api/organisationen/{organisationId}/name' + .replace('{' + 'organisationId' + '}', encodeURIComponent(String(organisationId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(organisationByNameBodyParams, "OrganisationByNameBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class OrganisationenApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerAddAdministrierteOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerAddAdministrierteOrganisationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerAddZugehoerigeOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerAddZugehoerigeOrganisationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerCreateOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerCreateOrganisationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "The organisation already exists.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create the organisation.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to create the organisation.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating the organisation.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerDeleteKlasse + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerDeleteKlasseWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to delete the organisation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The organisation that should be deleted does not exist.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerEnableForitslearning + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerEnableForitslearningWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", "" + ) as OrganisationResponseLegacy; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", "" + ) as OrganisationResponseLegacy; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerFindOrganisationById + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerFindOrganisationByIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Organization ID is required", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get the organization.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the organization.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The organization does not exist.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting the organization.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerFindOrganizations + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerFindOrganizationsWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get organizations.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get organizations.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all organizations.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetAdministrierteOrganisationen + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetAdministrierteOrganisationenWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get organizations.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get organizations.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all organizations.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetParentsByIds + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetParentsByIdsWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: ParentOrganisationenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ParentOrganisationenResponse", "" + ) as ParentOrganisationenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get the organizations.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the organizations.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting the organization.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: ParentOrganisationenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "ParentOrganisationenResponse", "" + ) as ParentOrganisationenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetRootChildren + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetRootChildrenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationRootChildrenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationRootChildrenResponse", "" + ) as OrganisationRootChildrenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get the organizations.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the organizations.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting the organization.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationRootChildrenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationRootChildrenResponse", "" + ) as OrganisationRootChildrenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetRootOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetRootOrganisationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get the root organization.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the root organization.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The root organization does not exist.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting the root organization.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerGetZugehoerigeOrganisationen + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get organizations.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get organizations.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all organizations.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerUpdateOrganisation + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerUpdateOrganisationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "Request has wrong format.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The organisation was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponse", "" + ) as OrganisationResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to organisationControllerUpdateOrganisationName + * @throws ApiException if the response code was not in [200, 299] + */ + public async organisationControllerUpdateOrganisationNameWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", "" + ) as OrganisationResponseLegacy; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamOrganisationError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamOrganisationError", "" + ) as DbiamOrganisationError; + throw new ApiException(response.httpStatusCode, "The organisation could not be modified.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to modify the organisation.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while modifying the organisation.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: OrganisationResponseLegacy = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "OrganisationResponseLegacy", "" + ) as OrganisationResponseLegacy; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/PersonAdministrationApi.ts b/loadtest/api-client/generated/apis/PersonAdministrationApi.ts new file mode 100644 index 0000000..d646c03 --- /dev/null +++ b/loadtest/api-client/generated/apis/PersonAdministrationApi.ts @@ -0,0 +1,107 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { FindRollenResponse } from '../models/FindRollenResponse.ts'; + +/** + * no description + */ +export class PersonAdministrationApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param rolleName Rolle name used to filter for rollen in personenkontext. + * @param limit The limit of items for the request. + */ + public async personAdministrationControllerFindRollen(rolleName?: string, limit?: number, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + // Path Params + const localVarPath = '/api/person-administration/rollen'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (rolleName !== undefined) { + requestContext.setQueryParam("rolleName", ObjectSerializer.serialize(rolleName, "string", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class PersonAdministrationApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personAdministrationControllerFindRollen + * @throws ApiException if the response code was not in [200, 299] + */ + public async personAdministrationControllerFindRollenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: FindRollenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindRollenResponse", "" + ) as FindRollenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get available rollen for the logged-in user.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get rollen for the logged-in user.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting rollen for the logged-in user.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: FindRollenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindRollenResponse", "" + ) as FindRollenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/PersonInfoApi.ts b/loadtest/api-client/generated/apis/PersonInfoApi.ts new file mode 100644 index 0000000..158b2d0 --- /dev/null +++ b/loadtest/api-client/generated/apis/PersonInfoApi.ts @@ -0,0 +1,88 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; + +/** + * no description + */ +export class PersonInfoApiRequestFactory extends BaseAPIRequestFactory { + + /** + * Info about logged in person. + */ + public async personInfoControllerInfo(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/person-info'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class PersonInfoApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personInfoControllerInfo + * @throws ApiException if the response code was not in [200, 299] + */ + public async personInfoControllerInfoWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonInfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonInfoResponse", "" + ) as PersonInfoResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "person is not logged in.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonInfoResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonInfoResponse", "" + ) as PersonInfoResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/PersonenApi.ts b/loadtest/api-client/generated/apis/PersonenApi.ts new file mode 100644 index 0000000..b2c1dd6 --- /dev/null +++ b/loadtest/api-client/generated/apis/PersonenApi.ts @@ -0,0 +1,1119 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; +import { DbiamPersonError } from '../models/DbiamPersonError.ts'; +import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; +import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; +import { PersonLockResponse } from '../models/PersonLockResponse.ts'; +import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; +import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; +import { Personenstatus } from '../models/Personenstatus.ts'; +import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; +import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; + +/** + * no description + */ +export class PersonenApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param createPersonMigrationBodyParams + */ + public async personControllerCreatePersonMigration(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'createPersonMigrationBodyParams' is not null or undefined + if (createPersonMigrationBodyParams === null || createPersonMigrationBodyParams === undefined) { + throw new RequiredError("PersonenApi", "personControllerCreatePersonMigration", "createPersonMigrationBodyParams"); + } + + + // Path Params + const localVarPath = '/api/personen'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(createPersonMigrationBodyParams, "CreatePersonMigrationBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * + * @param personId + */ + public async personControllerCreatePersonenkontext(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerCreatePersonenkontext", "personId"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}/personenkontexte' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + */ + public async personControllerDeletePersonById(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerDeletePersonById", "personId"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + */ + public async personControllerFindPersonById(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerFindPersonById", "personId"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param personId2 + * @param referrer + * @param personenstatus + * @param sichtfreigabe + */ + public async personControllerFindPersonenkontexte(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerFindPersonenkontexte", "personId"); + } + + + + + + + + + // Path Params + const localVarPath = '/api/personen/{personId}/personenkontexte' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (personId2 !== undefined) { + requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId2, "string", "")); + } + + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); + } + + // Query Params + if (personenstatus !== undefined) { + const serializedParams = ObjectSerializer.serialize(personenstatus, "Personenstatus", ""); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + // Query Params + if (sichtfreigabe !== undefined) { + const serializedParams = ObjectSerializer.serialize(sichtfreigabe, "Sichtfreigabe", ""); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param referrer + * @param familienname + * @param vorname + * @param sichtfreigabe + * @param organisationIDs List of Organisation ID used to filter for Persons. + * @param rolleIDs List of Role ID used to filter for Persons. + * @param suchFilter Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param sortOrder Order to sort by. + * @param sortField Field to sort by. + */ + public async personControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + + + + + + + + + + // Path Params + const localVarPath = '/api/personen'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); + } + + // Query Params + if (familienname !== undefined) { + requestContext.setQueryParam("familienname", ObjectSerializer.serialize(familienname, "string", "")); + } + + // Query Params + if (vorname !== undefined) { + requestContext.setQueryParam("vorname", ObjectSerializer.serialize(vorname, "string", "")); + } + + // Query Params + if (sichtfreigabe !== undefined) { + requestContext.setQueryParam("sichtfreigabe", ObjectSerializer.serialize(sichtfreigabe, "'ja' | 'nein'", "")); + } + + // Query Params + if (organisationIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize(organisationIDs, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("organisationIDs", serializedParam); + } + } + + // Query Params + if (rolleIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize(rolleIDs, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("rolleIDs", serializedParam); + } + } + + // Query Params + if (suchFilter !== undefined) { + requestContext.setQueryParam("suchFilter", ObjectSerializer.serialize(suchFilter, "string", "")); + } + + // Query Params + if (sortOrder !== undefined) { + requestContext.setQueryParam("sortOrder", ObjectSerializer.serialize(sortOrder, "'asc' | 'desc'", "")); + } + + // Query Params + if (sortField !== undefined) { + requestContext.setQueryParam("sortField", ObjectSerializer.serialize(sortField, "'familienname' | 'vorname' | 'personalnummer' | 'referrer'", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public async personControllerLockPerson(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerLockPerson", "personId"); + } + + + // verify required parameter 'lockUserBodyParams' is not null or undefined + if (lockUserBodyParams === null || lockUserBodyParams === undefined) { + throw new RequiredError("PersonenApi", "personControllerLockPerson", "lockUserBodyParams"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}/lock-user' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(lockUserBodyParams, "LockUserBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + */ + public async personControllerResetPasswordByPersonId(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerResetPasswordByPersonId", "personId"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}/password' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId + */ + public async personControllerSyncPerson(personId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerSyncPerson", "personId"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}/sync' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public async personControllerUpdateMetadata(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerUpdateMetadata", "personId"); + } + + + // verify required parameter 'personMetadataBodyParams' is not null or undefined + if (personMetadataBodyParams === null || personMetadataBodyParams === undefined) { + throw new RequiredError("PersonenApi", "personControllerUpdateMetadata", "personMetadataBodyParams"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}/metadata' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(personMetadataBodyParams, "PersonMetadataBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public async personControllerUpdatePerson(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenApi", "personControllerUpdatePerson", "personId"); + } + + + // verify required parameter 'updatePersonBodyParams' is not null or undefined + if (updatePersonBodyParams === null || updatePersonBodyParams === undefined) { + throw new RequiredError("PersonenApi", "personControllerUpdatePerson", "updatePersonBodyParams"); + } + + + // Path Params + const localVarPath = '/api/personen/{personId}' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(updatePersonBodyParams, "UpdatePersonBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class PersonenApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerCreatePersonMigration + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerCreatePersonMigrationWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A username was given. Creation with username is not supported.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create the person.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the person.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the person.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating the person.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerCreatePersonenkontext + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerCreatePersonenkontextWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The personenkontext already exists.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create the personenkontext.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to create the personenkontext.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create personenkontext for person.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating the personenkontext.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerDeletePersonById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerDeletePersonByIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The person was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerFindPersonById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerFindPersonByIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Person ID is required", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get the person.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the person.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The person does not exist or insufficient permissions.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting the person.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerFindPersonenkontexte + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerFindPersonenkontexteWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonControllerFindPersonenkontexte200Response = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonControllerFindPersonenkontexte200Response", "" + ) as PersonControllerFindPersonenkontexte200Response; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "No personenkontexte were found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all personenkontexte.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonControllerFindPersonenkontexte200Response = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonControllerFindPersonenkontexte200Response", "" + ) as PersonControllerFindPersonenkontexte200Response; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerFindPersons + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerFindPersonsWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get persons.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get persons.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all persons.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerLockPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerLockPersonWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonLockResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonLockResponse", "" + ) as PersonLockResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The person was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + if (isCodeInRange("502", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A downstream server returned an error.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonLockResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonLockResponse", "" + ) as PersonLockResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerResetPasswordByPersonId + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerResetPasswordByPersonIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("202", response.httpStatusCode)) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", "" + ) as string; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The person does not exist or insufficient permissions to update person.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: string = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "string", "" + ) as string; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerSyncPerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerSyncPersonWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The person was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + if (isCodeInRange("502", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "A downstream server returned an error.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerUpdateMetadata + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerUpdateMetadataWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonError", "" + ) as DbiamPersonError; + throw new ApiException(response.httpStatusCode, "Request has a wrong format.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to update the metadata.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not permitted to update the metadata.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while updating the metadata for user.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personControllerUpdatePerson + * @throws ApiException if the response code was not in [200, 299] + */ + public async personControllerUpdatePersonWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The person was not found or insufficient permissions to update person.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponse", "" + ) as PersonendatensatzResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/PersonenFrontendApi.ts b/loadtest/api-client/generated/apis/PersonenFrontendApi.ts new file mode 100644 index 0000000..d68e7f3 --- /dev/null +++ b/loadtest/api-client/generated/apis/PersonenFrontendApi.ts @@ -0,0 +1,176 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; + +/** + * no description + */ +export class PersonenFrontendApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param referrer + * @param familienname + * @param vorname + * @param sichtfreigabe + * @param organisationIDs List of Organisation ID used to filter for Persons. + * @param rolleIDs List of Role ID used to filter for Persons. + * @param suchFilter Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param sortOrder Order to sort by. + * @param sortField Field to sort by. + */ + public async personFrontendControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + + + + + + + + + + // Path Params + const localVarPath = '/api/personen-frontend'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); + } + + // Query Params + if (familienname !== undefined) { + requestContext.setQueryParam("familienname", ObjectSerializer.serialize(familienname, "string", "")); + } + + // Query Params + if (vorname !== undefined) { + requestContext.setQueryParam("vorname", ObjectSerializer.serialize(vorname, "string", "")); + } + + // Query Params + if (sichtfreigabe !== undefined) { + requestContext.setQueryParam("sichtfreigabe", ObjectSerializer.serialize(sichtfreigabe, "'ja' | 'nein'", "")); + } + + // Query Params + if (organisationIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize(organisationIDs, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("organisationIDs", serializedParam); + } + } + + // Query Params + if (rolleIDs !== undefined) { + const serializedParams = ObjectSerializer.serialize(rolleIDs, "Array", ""); + for (const serializedParam of serializedParams) { + requestContext.appendQueryParam("rolleIDs", serializedParam); + } + } + + // Query Params + if (suchFilter !== undefined) { + requestContext.setQueryParam("suchFilter", ObjectSerializer.serialize(suchFilter, "string", "")); + } + + // Query Params + if (sortOrder !== undefined) { + requestContext.setQueryParam("sortOrder", ObjectSerializer.serialize(sortOrder, "'asc' | 'desc'", "")); + } + + // Query Params + if (sortField !== undefined) { + requestContext.setQueryParam("sortField", ObjectSerializer.serialize(sortField, "'familienname' | 'vorname' | 'personalnummer' | 'referrer'", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class PersonenFrontendApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personFrontendControllerFindPersons + * @throws ApiException if the response code was not in [200, 299] + */ + public async personFrontendControllerFindPersonsWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonFrontendControllerFindPersons200Response = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonFrontendControllerFindPersons200Response", "" + ) as PersonFrontendControllerFindPersons200Response; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get persons.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get persons.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all persons.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonFrontendControllerFindPersons200Response = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonFrontendControllerFindPersons200Response", "" + ) as PersonFrontendControllerFindPersons200Response; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/PersonenkontextApi.ts b/loadtest/api-client/generated/apis/PersonenkontextApi.ts new file mode 100644 index 0000000..98e15ce --- /dev/null +++ b/loadtest/api-client/generated/apis/PersonenkontextApi.ts @@ -0,0 +1,442 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; +import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; +import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; +import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; +import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; +import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; +import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; + +/** + * no description + */ +export class PersonenkontextApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param personalnummer + */ + public async dbiamPersonenkontextWorkflowControllerCommit(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerCommit", "personId"); + } + + + // verify required parameter 'dbiamUpdatePersonenkontexteBodyParams' is not null or undefined + if (dbiamUpdatePersonenkontexteBodyParams === null || dbiamUpdatePersonenkontexteBodyParams === undefined) { + throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerCommit", "dbiamUpdatePersonenkontexteBodyParams"); + } + + + + // Path Params + const localVarPath = '/api/personenkontext-workflow/{personId}' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (personalnummer !== undefined) { + requestContext.setQueryParam("personalnummer", ObjectSerializer.serialize(personalnummer, "string", "")); + } + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(dbiamUpdatePersonenkontexteBodyParams, "DbiamUpdatePersonenkontexteBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public async dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'dbiamCreatePersonWithPersonenkontexteBodyParams' is not null or undefined + if (dbiamCreatePersonWithPersonenkontexteBodyParams === null || dbiamCreatePersonWithPersonenkontexteBodyParams === undefined) { + throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte", "dbiamCreatePersonWithPersonenkontexteBodyParams"); + } + + + // Path Params + const localVarPath = '/api/personenkontext-workflow'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(dbiamCreatePersonWithPersonenkontexteBodyParams, "DbiamCreatePersonWithPersonenkontexteBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param sskName Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param limit The limit of items for the request. + */ + public async dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("PersonenkontextApi", "dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten", "rolleId"); + } + + + + + // Path Params + const localVarPath = '/api/personenkontext-workflow/schulstrukturknoten'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (rolleId !== undefined) { + requestContext.setQueryParam("rolleId", ObjectSerializer.serialize(rolleId, "string", "")); + } + + // Query Params + if (sskName !== undefined) { + requestContext.setQueryParam("sskName", ObjectSerializer.serialize(sskName, "string", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param organisationId ID of the organisation to filter the rollen later + * @param rolleId ID of the rolle. + * @param rolleName Rolle name used to filter for rollen in personenkontext. + * @param organisationName Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param limit The limit of items for the request. + */ + public async dbiamPersonenkontextWorkflowControllerProcessStep(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + + + + // Path Params + const localVarPath = '/api/personenkontext-workflow/step'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (organisationId !== undefined) { + requestContext.setQueryParam("organisationId", ObjectSerializer.serialize(organisationId, "string", "")); + } + + // Query Params + if (rolleId !== undefined) { + requestContext.setQueryParam("rolleId", ObjectSerializer.serialize(rolleId, "string", "")); + } + + // Query Params + if (rolleName !== undefined) { + requestContext.setQueryParam("rolleName", ObjectSerializer.serialize(rolleName, "string", "")); + } + + // Query Params + if (organisationName !== undefined) { + requestContext.setQueryParam("organisationName", ObjectSerializer.serialize(organisationName, "string", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class PersonenkontextApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerCommit + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonenkontexteUpdateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontexteUpdateResponse", "" + ) as PersonenkontexteUpdateResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonenkontexteUpdateError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonenkontexteUpdateError", "" + ) as DbiamPersonenkontexteUpdateError; + throw new ApiException(response.httpStatusCode, "The personenkontexte could not be updated, may due to unsatisfied specifications.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to update personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to update personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("409", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Changes are conflicting with current state of personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while updating personenkontexte.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonenkontexteUpdateResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontexteUpdateResponse", "" + ) as PersonenkontexteUpdateResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: DBiamPersonResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonResponse", "" + ) as DBiamPersonResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamPersonenkontextError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamPersonenkontextError", "" + ) as DbiamPersonenkontextError; + throw new ApiException(response.httpStatusCode, "The person and the personenkontext could not be created, may due to unsatisfied specifications.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create person with personenkontext.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to create person with personenkontext.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating person with personenkontext.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: DBiamPersonResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DBiamPersonResponse", "" + ) as DBiamPersonResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: FindSchulstrukturknotenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindSchulstrukturknotenResponse", "" + ) as FindSchulstrukturknotenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get available schulstrukturknoten for personenkontexte.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get schulstrukturknoten for personenkontext.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting schulstrukturknoten for personenkontexte.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: FindSchulstrukturknotenResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "FindSchulstrukturknotenResponse", "" + ) as FindSchulstrukturknotenResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to dbiamPersonenkontextWorkflowControllerProcessStep + * @throws ApiException if the response code was not in [200, 299] + */ + public async dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonenkontextWorkflowResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextWorkflowResponse", "" + ) as PersonenkontextWorkflowResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get available data for personenkontext.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get data for personenkontext.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting data for personenkontext.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonenkontextWorkflowResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextWorkflowResponse", "" + ) as PersonenkontextWorkflowResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/PersonenkontexteApi.ts b/loadtest/api-client/generated/apis/PersonenkontexteApi.ts new file mode 100644 index 0000000..cafb585 --- /dev/null +++ b/loadtest/api-client/generated/apis/PersonenkontexteApi.ts @@ -0,0 +1,512 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; +import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; +import { Personenstatus } from '../models/Personenstatus.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; +import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; + +/** + * no description + */ +export class PersonenkontexteApiRequestFactory extends BaseAPIRequestFactory { + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public async personenkontextControllerDeletePersonenkontextById(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenkontextId' is not null or undefined + if (personenkontextId === null || personenkontextId === undefined) { + throw new RequiredError("PersonenkontexteApi", "personenkontextControllerDeletePersonenkontextById", "personenkontextId"); + } + + + // verify required parameter 'deleteRevisionBodyParams' is not null or undefined + if (deleteRevisionBodyParams === null || deleteRevisionBodyParams === undefined) { + throw new RequiredError("PersonenkontexteApi", "personenkontextControllerDeletePersonenkontextById", "deleteRevisionBodyParams"); + } + + + // Path Params + const localVarPath = '/api/personenkontexte/{personenkontextId}' + .replace('{' + 'personenkontextId' + '}', encodeURIComponent(String(personenkontextId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(deleteRevisionBodyParams, "DeleteRevisionBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public async personenkontextControllerFindPersonenkontextById(personenkontextId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenkontextId' is not null or undefined + if (personenkontextId === null || personenkontextId === undefined) { + throw new RequiredError("PersonenkontexteApi", "personenkontextControllerFindPersonenkontextById", "personenkontextId"); + } + + + // Path Params + const localVarPath = '/api/personenkontexte/{personenkontextId}' + .replace('{' + 'personenkontextId' + '}', encodeURIComponent(String(personenkontextId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param personId + * @param referrer + * @param personenstatus + * @param sichtfreigabe + */ + public async personenkontextControllerFindPersonenkontexte(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + + + + + // Path Params + const localVarPath = '/api/personenkontexte'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (personId !== undefined) { + requestContext.setQueryParam("personId", ObjectSerializer.serialize(personId, "string", "")); + } + + // Query Params + if (referrer !== undefined) { + requestContext.setQueryParam("referrer", ObjectSerializer.serialize(referrer, "string", "")); + } + + // Query Params + if (personenstatus !== undefined) { + const serializedParams = ObjectSerializer.serialize(personenstatus, "Personenstatus", ""); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + // Query Params + if (sichtfreigabe !== undefined) { + const serializedParams = ObjectSerializer.serialize(sichtfreigabe, "Sichtfreigabe", ""); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public async personenkontextControllerHatSystemRecht(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personId' is not null or undefined + if (personId === null || personId === undefined) { + throw new RequiredError("PersonenkontexteApi", "personenkontextControllerHatSystemRecht", "personId"); + } + + + // verify required parameter 'systemRecht' is not null or undefined + if (systemRecht === null || systemRecht === undefined) { + throw new RequiredError("PersonenkontexteApi", "personenkontextControllerHatSystemRecht", "systemRecht"); + } + + + // Path Params + const localVarPath = '/api/personenkontexte/{personId}/hatSystemrecht' + .replace('{' + 'personId' + '}', encodeURIComponent(String(personId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (systemRecht !== undefined) { + const serializedParams = ObjectSerializer.serialize(systemRecht, "RollenSystemRecht", ""); + for (const key of Object.keys(serializedParams)) { + requestContext.setQueryParam(key, serializedParams[key]); + } + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * + * @param personenkontextId + */ + public async personenkontextControllerUpdatePersonenkontextWithId(personenkontextId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'personenkontextId' is not null or undefined + if (personenkontextId === null || personenkontextId === undefined) { + throw new RequiredError("PersonenkontexteApi", "personenkontextControllerUpdatePersonenkontextWithId", "personenkontextId"); + } + + + // Path Params + const localVarPath = '/api/personenkontexte/{personenkontextId}' + .replace('{' + 'personenkontextId' + '}', encodeURIComponent(String(personenkontextId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class PersonenkontexteApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerDeletePersonenkontextById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The personenkontext was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerFindPersonenkontextById + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerFindPersonenkontextByIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonendatensatzResponseAutomapper = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponseAutomapper", "" + ) as PersonendatensatzResponseAutomapper; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The personenkontext was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonendatensatzResponseAutomapper = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonendatensatzResponseAutomapper", "" + ) as PersonendatensatzResponseAutomapper; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerFindPersonenkontexte + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerFindPersonenkontexteWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The personenkontexte were not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerHatSystemRecht + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerHatSystemRechtWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: SystemrechtResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "SystemrechtResponse", "" + ) as SystemrechtResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The systemrecht could not be found (does not exist as type of systemrecht).", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: SystemrechtResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "SystemrechtResponse", "" + ) as SystemrechtResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to personenkontextControllerUpdatePersonenkontextWithId + * @throws ApiException if the response code was not in [200, 299] + */ + public async personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: PersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextResponse", "" + ) as PersonenkontextResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request has wrong format.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Request is not authorized.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to perform operation.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The personenkontext was not found.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "An internal server error occurred.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: PersonenkontextResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "PersonenkontextResponse", "" + ) as PersonenkontextResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/ProviderApi.ts b/loadtest/api-client/generated/apis/ProviderApi.ts new file mode 100644 index 0000000..fe7d4b9 --- /dev/null +++ b/loadtest/api-client/generated/apis/ProviderApi.ts @@ -0,0 +1,253 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; + +/** + * no description + */ +export class ProviderApiRequestFactory extends BaseAPIRequestFactory { + + /** + * Get all service-providers. + * + */ + public async providerControllerGetAllServiceProviders(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/provider/all'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Get service-providers available for logged-in user. + * + */ + public async providerControllerGetAvailableServiceProviders(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/provider'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * @param angebotId The id of the service provider + */ + public async providerControllerGetServiceProviderLogo(angebotId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'angebotId' is not null or undefined + if (angebotId === null || angebotId === undefined) { + throw new RequiredError("ProviderApi", "providerControllerGetServiceProviderLogo", "angebotId"); + } + + + // Path Params + const localVarPath = '/api/provider/{angebotId}/logo' + .replace('{' + 'angebotId' + '}', encodeURIComponent(String(angebotId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class ProviderApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to providerControllerGetAllServiceProviders + * @throws ApiException if the response code was not in [200, 299] + */ + public async providerControllerGetAllServiceProvidersWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get available service providers.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get service-providers.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all service-providers.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to providerControllerGetAvailableServiceProviders + * @throws ApiException if the response code was not in [200, 299] + */ + public async providerControllerGetAvailableServiceProvidersWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get available service providers.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get service-providers.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all service-providers.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to providerControllerGetServiceProviderLogo + * @throws ApiException if the response code was not in [200, 299] + */ + public async providerControllerGetServiceProviderLogoWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: any = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "any", "binary" + ) as any; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Angebot ID is required.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get service provider logo.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get the logo.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The service-provider does not exist or has no logo.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting the logo.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: any = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "any", "binary" + ) as any; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/RolleApi.ts b/loadtest/api-client/generated/apis/RolleApi.ts new file mode 100644 index 0000000..5cdf96f --- /dev/null +++ b/loadtest/api-client/generated/apis/RolleApi.ts @@ -0,0 +1,860 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + +import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; +import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; +import { DbiamRolleError } from '../models/DbiamRolleError.ts'; +import { RolleResponse } from '../models/RolleResponse.ts'; +import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; +import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; +import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; +import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; +import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; + +/** + * no description + */ +export class RolleApiRequestFactory extends BaseAPIRequestFactory { + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public async rolleControllerAddSystemRecht(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerAddSystemRecht", "rolleId"); + } + + + // verify required parameter 'addSystemrechtBodyParams' is not null or undefined + if (addSystemrechtBodyParams === null || addSystemrechtBodyParams === undefined) { + throw new RequiredError("RolleApi", "rolleControllerAddSystemRecht", "addSystemrechtBodyParams"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PATCH); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(addSystemrechtBodyParams, "AddSystemrechtBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public async rolleControllerCreateRolle(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'createRolleBodyParams' is not null or undefined + if (createRolleBodyParams === null || createRolleBodyParams === undefined) { + throw new RequiredError("RolleApi", "rolleControllerCreateRolle", "createRolleBodyParams"); + } + + + // Path Params + const localVarPath = '/api/rolle'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.POST); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(createRolleBodyParams, "CreateRolleBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public async rolleControllerDeleteRolle(rolleId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerDeleteRolle", "rolleId"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public async rolleControllerFindRolleByIdWithServiceProviders(rolleId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerFindRolleByIdWithServiceProviders", "rolleId"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * List all rollen. + * + * @param offset The offset of the paginated list. + * @param limit The requested limit for the page size. + * @param searchStr The name for the role. + */ + public async rolleControllerFindRollen(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + + + + // Path Params + const localVarPath = '/api/rolle'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + // Query Params + if (offset !== undefined) { + requestContext.setQueryParam("offset", ObjectSerializer.serialize(offset, "number", "")); + } + + // Query Params + if (limit !== undefined) { + requestContext.setQueryParam("limit", ObjectSerializer.serialize(limit, "number", "")); + } + + // Query Params + if (searchStr !== undefined) { + requestContext.setQueryParam("searchStr", ObjectSerializer.serialize(searchStr, "string", "")); + } + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public async rolleControllerGetRolleServiceProviderIds(rolleId: string, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerGetRolleServiceProviderIds", "rolleId"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}/serviceProviders' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public async rolleControllerRemoveServiceProviderById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerRemoveServiceProviderById", "rolleId"); + } + + + // verify required parameter 'rolleServiceProviderBodyParams' is not null or undefined + if (rolleServiceProviderBodyParams === null || rolleServiceProviderBodyParams === undefined) { + throw new RequiredError("RolleApi", "rolleControllerRemoveServiceProviderById", "rolleServiceProviderBodyParams"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}/serviceProviders' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.DELETE); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(rolleServiceProviderBodyParams, "RolleServiceProviderBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public async rolleControllerUpdateRolle(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerUpdateRolle", "rolleId"); + } + + + // verify required parameter 'updateRolleBodyParams' is not null or undefined + if (updateRolleBodyParams === null || updateRolleBodyParams === undefined) { + throw new RequiredError("RolleApi", "rolleControllerUpdateRolle", "updateRolleBodyParams"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(updateRolleBodyParams, "UpdateRolleBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public async rolleControllerUpdateServiceProvidersById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise { + let _config = _options || this.configuration; + + // verify required parameter 'rolleId' is not null or undefined + if (rolleId === null || rolleId === undefined) { + throw new RequiredError("RolleApi", "rolleControllerUpdateServiceProvidersById", "rolleId"); + } + + + // verify required parameter 'rolleServiceProviderBodyParams' is not null or undefined + if (rolleServiceProviderBodyParams === null || rolleServiceProviderBodyParams === undefined) { + throw new RequiredError("RolleApi", "rolleControllerUpdateServiceProvidersById", "rolleServiceProviderBodyParams"); + } + + + // Path Params + const localVarPath = '/api/rolle/{rolleId}/serviceProviders' + .replace('{' + 'rolleId' + '}', encodeURIComponent(String(rolleId))); + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.PUT); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + // Body Params + const contentType = ObjectSerializer.getPreferredMediaType([ + "application/json" + ]); + requestContext.setHeaderParam("Content-Type", contentType); + const serializedBody = ObjectSerializer.stringify( + ObjectSerializer.serialize(rolleServiceProviderBodyParams, "RolleServiceProviderBodyParams", ""), + contentType + ); + requestContext.setBody(serializedBody); + + let authMethod: SecurityAuthentication | undefined; + // Apply auth methods + authMethod = _config.authMethods["bearer"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + // Apply auth methods + authMethod = _config.authMethods["oauth2"] + if (authMethod?.applySecurityAuthentication) { + await authMethod?.applySecurityAuthentication(requestContext); + } + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class RolleApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerAddSystemRecht + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerAddSystemRechtWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The input was not valid.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create the rolle.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the rolle.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while adding systemrecht to rolle.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerCreateRolle + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerCreateRolleWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("201", response.httpStatusCode)) { + const body: RolleResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleResponse", "" + ) as RolleResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamRolleError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamRolleError", "" + ) as DbiamRolleError; + throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to create the rolle.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to create the rolle.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while creating the rolle.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleResponse", "" + ) as RolleResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerDeleteRolle + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerDeleteRolleWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("204", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamRolleError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamRolleError", "" + ) as DbiamRolleError; + throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to delete the role.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The rolle that should be deleted does not exist.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerFindRolleByIdWithServiceProviders + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", "" + ) as RolleWithServiceProvidersResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get rolle by id.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permission to get rolle by id.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting rolle by id.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", "" + ) as RolleWithServiceProvidersResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerFindRollen + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerFindRollenWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to get rollen.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to get rollen.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while getting all rollen.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerGetRolleServiceProviderIds + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerGetRolleServiceProviderIdsWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: RolleServiceProviderResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleServiceProviderResponse", "" + ) as RolleServiceProviderResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to retrieve service-providers for rolle.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The rolle does not exist.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleServiceProviderResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleServiceProviderResponse", "" + ) as RolleServiceProviderResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerRemoveServiceProviderById + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerRemoveServiceProviderByIdWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to retrieve service-providers for rolle.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The rolle or the service-provider that should be removed does not exist.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerUpdateRolle + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerUpdateRolleWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", "" + ) as RolleWithServiceProvidersResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + const body: DbiamRolleError = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "DbiamRolleError", "" + ) as DbiamRolleError; + throw new ApiException(response.httpStatusCode, "The input was not valid.", body, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to update the rolle.", undefined, response.headers); + } + if (isCodeInRange("403", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Insufficient permissions to update the rolle.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error while updating the rolle.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: RolleWithServiceProvidersResponse = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "RolleWithServiceProvidersResponse", "" + ) as RolleWithServiceProvidersResponse; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to rolleControllerUpdateServiceProvidersById + * @throws ApiException if the response code was not in [200, 299] + */ + public async rolleControllerUpdateServiceProvidersByIdWithHttpInfo(response: ResponseContext): Promise >> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + if (isCodeInRange("400", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The service-provider is already attached to rolle.", undefined, response.headers); + } + if (isCodeInRange("401", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Not authorized to retrieve service-providers for rolle.", undefined, response.headers); + } + if (isCodeInRange("404", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "The rolle or the service-provider to add does not exist.", undefined, response.headers); + } + if (isCodeInRange("500", response.httpStatusCode)) { + throw new ApiException(response.httpStatusCode, "Internal server error, the service-provider may could not be found after attaching to rolle.", undefined, response.headers); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: Array = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "Array", "" + ) as Array; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/StatusApi.ts b/loadtest/api-client/generated/apis/StatusApi.ts new file mode 100644 index 0000000..29fc775 --- /dev/null +++ b/loadtest/api-client/generated/apis/StatusApi.ts @@ -0,0 +1,68 @@ +// TODO: better import syntax? +import {BaseAPIRequestFactory, RequiredError, COLLECTION_FORMATS} from './baseapi.ts'; +import {Configuration} from '../configuration.ts'; +import {RequestContext, HttpMethod, ResponseContext, HttpFile, HttpInfo} from '../http/http.ts'; +import {ObjectSerializer} from '../models/ObjectSerializer.ts'; +import {ApiException} from './exception.ts'; +import {canConsumeForm, isCodeInRange} from '../util.ts'; +import {SecurityAuthentication} from '../auth/auth.ts'; + + + +/** + * no description + */ +export class StatusApiRequestFactory extends BaseAPIRequestFactory { + + /** + */ + public async statusControllerGetStatus(_options?: Configuration): Promise { + let _config = _options || this.configuration; + + // Path Params + const localVarPath = '/api/status'; + + // Make Request Context + const requestContext = _config.baseServer.makeRequestContext(localVarPath, HttpMethod.GET); + requestContext.setHeaderParam("Accept", "application/json, */*;q=0.8") + + + + const defaultAuth: SecurityAuthentication | undefined = _options?.authMethods?.default || this.configuration?.authMethods?.default + if (defaultAuth?.applySecurityAuthentication) { + await defaultAuth?.applySecurityAuthentication(requestContext); + } + + return requestContext; + } + +} + +export class StatusApiResponseProcessor { + + /** + * Unwraps the actual response sent by the server from the response context and deserializes the response content + * to the expected objects + * + * @params response Response returned by the server for a request to statusControllerGetStatus + * @throws ApiException if the response code was not in [200, 299] + */ + public async statusControllerGetStatusWithHttpInfo(response: ResponseContext): Promise> { + const contentType = ObjectSerializer.normalizeMediaType(response.headers["content-type"]); + if (isCodeInRange("200", response.httpStatusCode)) { + return new HttpInfo(response.httpStatusCode, response.headers, response.body, undefined); + } + + // Work around for missing responses in specification, e.g. for petstore.yaml + if (response.httpStatusCode >= 200 && response.httpStatusCode <= 299) { + const body: void = ObjectSerializer.deserialize( + ObjectSerializer.parse(await response.body.text(), contentType), + "void", "" + ) as void; + return new HttpInfo(response.httpStatusCode, response.headers, response.body, body); + } + + throw new ApiException(response.httpStatusCode, "Unknown API Status Code!", await response.getBodyAsAny(), response.headers); + } + +} diff --git a/loadtest/api-client/generated/apis/baseapi.ts b/loadtest/api-client/generated/apis/baseapi.ts new file mode 100644 index 0000000..46ed74b --- /dev/null +++ b/loadtest/api-client/generated/apis/baseapi.ts @@ -0,0 +1,37 @@ +import { Configuration } from '../configuration.ts' + +/** + * + * @export + */ +export const COLLECTION_FORMATS = { + csv: ",", + ssv: " ", + tsv: "\t", + pipes: "|", +}; + + +/** + * + * @export + * @class BaseAPI + */ +export class BaseAPIRequestFactory { + + constructor(protected configuration: Configuration) { + } +}; + +/** + * + * @export + * @class RequiredError + * @extends {Error} + */ +export class RequiredError extends Error { + name: "RequiredError" = "RequiredError"; + constructor(public api: string, public method: string, public field: string) { + super("Required parameter " + field + " was null or undefined when calling " + api + "." + method + "."); + } +} diff --git a/loadtest/api-client/generated/apis/exception.ts b/loadtest/api-client/generated/apis/exception.ts new file mode 100644 index 0000000..9365d33 --- /dev/null +++ b/loadtest/api-client/generated/apis/exception.ts @@ -0,0 +1,15 @@ +/** + * Represents an error caused by an api call i.e. it has attributes for a HTTP status code + * and the returned body object. + * + * Example + * API returns a ErrorMessageObject whenever HTTP status code is not in [200, 299] + * => ApiException(404, someErrorMessageObject) + * + */ +export class ApiException extends Error { + public constructor(public code: number, message: string, public body: T, public headers: { [key: string]: string; }) { + super("HTTP-Code: " + code + "\nMessage: " + message + "\nBody: " + JSON.stringify(body) + "\nHeaders: " + + JSON.stringify(headers)) + } +} diff --git a/loadtest/api-client/generated/auth/auth.ts b/loadtest/api-client/generated/auth/auth.ts new file mode 100644 index 0000000..bb62c02 --- /dev/null +++ b/loadtest/api-client/generated/auth/auth.ts @@ -0,0 +1,107 @@ +import { RequestContext } from "../http/http.ts"; + +/** + * Interface authentication schemes. + */ +export interface SecurityAuthentication { + /* + * @return returns the name of the security authentication as specified in OAI + */ + getName(): string; + + /** + * Applies the authentication scheme to the request context + * + * @params context the request context which should use this authentication scheme + */ + applySecurityAuthentication(context: RequestContext): void | Promise; +} + +export interface TokenProvider { + getToken(): Promise | string; +} + +/** + * Applies oauth2 authentication to the request context. + */ +export class Oauth2Authentication implements SecurityAuthentication { + /** + * Configures OAuth2 with the necessary properties + * + * @param accessToken: The access token to be used for every request + */ + public constructor(private accessToken: string) {} + + public getName(): string { + return "oauth2"; + } + + public applySecurityAuthentication(context: RequestContext) { + context.setHeaderParam("Authorization", "Bearer " + this.accessToken); + } +} + +/** + * Applies http authentication to the request context. + */ +export class BearerAuthentication implements SecurityAuthentication { + /** + * Configures the http authentication with the required details. + * + * @param tokenProvider service that can provide the up-to-date token when needed + */ + public constructor(private tokenProvider: TokenProvider) {} + + public getName(): string { + return "bearer"; + } + + public async applySecurityAuthentication(context: RequestContext) { + context.setHeaderParam("Authorization", "Bearer " + await this.tokenProvider.getToken()); + } +} + + +export type AuthMethods = { + "default"?: SecurityAuthentication, + "oauth2"?: SecurityAuthentication, + "bearer"?: SecurityAuthentication +} + +export type ApiKeyConfiguration = string; +export type HttpBasicConfiguration = { "username": string, "password": string }; +export type HttpBearerConfiguration = { tokenProvider: TokenProvider }; +export type OAuth2Configuration = { accessToken: string }; + +export type AuthMethodsConfiguration = { + "default"?: SecurityAuthentication, + "oauth2"?: OAuth2Configuration, + "bearer"?: HttpBearerConfiguration +} + +/** + * Creates the authentication methods from a swagger description. + * + */ +export function configureAuthMethods(config: AuthMethodsConfiguration | undefined): AuthMethods { + let authMethods: AuthMethods = {} + + if (!config) { + return authMethods; + } + authMethods["default"] = config["default"] + + if (config["oauth2"]) { + authMethods["oauth2"] = new Oauth2Authentication( + config["oauth2"]["accessToken"] + ); + } + + if (config["bearer"]) { + authMethods["bearer"] = new BearerAuthentication( + config["bearer"]["tokenProvider"] + ); + } + + return authMethods; +} \ No newline at end of file diff --git a/loadtest/api-client/generated/configuration.ts b/loadtest/api-client/generated/configuration.ts new file mode 100644 index 0000000..0a170f0 --- /dev/null +++ b/loadtest/api-client/generated/configuration.ts @@ -0,0 +1,82 @@ +import { HttpLibrary } from "./http/http.ts"; +import { Middleware, PromiseMiddleware, PromiseMiddlewareWrapper } from "./middleware.ts"; +import { IsomorphicFetchHttpLibrary as DefaultHttpLibrary } from "./http/isomorphic-fetch.ts"; +import { BaseServerConfiguration, server1 } from "./servers.ts"; +import { configureAuthMethods, AuthMethods, AuthMethodsConfiguration } from "./auth/auth.ts"; + +export interface Configuration { + readonly baseServer: BaseServerConfiguration; + readonly httpApi: HttpLibrary; + readonly middleware: Middleware[]; + readonly authMethods: AuthMethods; +} + + +/** + * Interface with which a configuration object can be configured. + */ +export interface ConfigurationParameters { + /** + * Default server to use - a list of available servers (according to the + * OpenAPI yaml definition) is included in the `servers` const in `./servers`. You can also + * create your own server with the `ServerConfiguration` class from the same + * file. + */ + baseServer?: BaseServerConfiguration; + /** + * HTTP library to use e.g. IsomorphicFetch. This can usually be skipped as + * all generators come with a default library. + * If available, additional libraries can be imported from `./http/*` + */ + httpApi?: HttpLibrary; + + /** + * The middlewares which will be applied to requests and responses. You can + * add any number of middleware components to modify requests before they + * are sent or before they are deserialized by implementing the `Middleware` + * interface defined in `./middleware` + */ + middleware?: Middleware[]; + /** + * Configures middleware functions that return promises instead of + * Observables (which are used by `middleware`). Otherwise allows for the + * same functionality as `middleware`, i.e., modifying requests before they + * are sent and before they are deserialized. + */ + promiseMiddleware?: PromiseMiddleware[]; + /** + * Configuration for the available authentication methods (e.g., api keys) + * according to the OpenAPI yaml definition. For the definition, please refer to + * `./auth/auth` + */ + authMethods?: AuthMethodsConfiguration +} + +/** + * Provide your `ConfigurationParameters` to this function to get a `Configuration` + * object that can be used to configure your APIs (in the constructor or + * for each request individually). + * + * If a property is not included in conf, a default is used: + * - baseServer: server1 + * - httpApi: IsomorphicFetchHttpLibrary + * - middleware: [] + * - promiseMiddleware: [] + * - authMethods: {} + * + * @param conf partial configuration + */ +export function createConfiguration(conf: ConfigurationParameters = {}): Configuration { + const configuration: Configuration = { + baseServer: conf.baseServer !== undefined ? conf.baseServer : server1, + httpApi: conf.httpApi || new DefaultHttpLibrary(), + middleware: conf.middleware || [], + authMethods: configureAuthMethods(conf.authMethods) + }; + if (conf.promiseMiddleware) { + conf.promiseMiddleware.forEach( + m => configuration.middleware.push(new PromiseMiddlewareWrapper(m)) + ); + } + return configuration; +} \ No newline at end of file diff --git a/loadtest/api-client/generated/git_push.sh b/loadtest/api-client/generated/git_push.sh new file mode 100644 index 0000000..b253029 --- /dev/null +++ b/loadtest/api-client/generated/git_push.sh @@ -0,0 +1,51 @@ +#!/bin/sh +# ref: https://help.github.com/articles/adding-an-existing-project-to-github-using-the-command-line/ +# +# Usage example: /bin/sh ./git_push.sh wing328 openapi-petstore-perl "minor update" + +git_user_id=$1 +git_repo_id=$2 +release_note=$3 + +if [ "$git_user_id" = "" ]; then + git_user_id="GIT_USER_ID" + echo "[INFO] No command line input provided. Set \$git_user_id to $git_user_id" +fi + +if [ "$git_repo_id" = "" ]; then + git_repo_id="GIT_REPO_ID" + echo "[INFO] No command line input provided. Set \$git_repo_id to $git_repo_id" +fi + +if [ "$release_note" = "" ]; then + release_note="Minor update" + echo "[INFO] No command line input provided. Set \$release_note to $release_note" +fi + +# Initialize the local directory as a Git repository +git init + +# Adds the files in the local repository and stages them for commit. +git add . + +# Commits the tracked changes and prepares them to be pushed to a remote repository. +git commit -m "$release_note" + +# Sets the new remote +git_remote=$(git remote) +if [ "$git_remote" = "" ]; then # git remote not defined + + if [ "$GIT_TOKEN" = "" ]; then + echo "[INFO] \$GIT_TOKEN (environment variable) is not set. Using the git credential in your environment." + git remote add origin https://github.com/${git_user_id}/${git_repo_id}.git + else + git remote add origin https://${git_user_id}:"${GIT_TOKEN}"@github.com/${git_user_id}/${git_repo_id}.git + fi + +fi + +git pull origin master + +# Pushes (Forces) the changes in the local repository up to the remote repository +echo "Git pushing to https://github.com/${git_user_id}/${git_repo_id}.git" +git push origin master 2>&1 | grep -v 'To https' diff --git a/loadtest/api-client/generated/http/http.ts b/loadtest/api-client/generated/http/http.ts new file mode 100644 index 0000000..80218c7 --- /dev/null +++ b/loadtest/api-client/generated/http/http.ts @@ -0,0 +1,256 @@ +import { Observable, from } from '../rxjsStub.ts'; + +export * from './isomorphic-fetch.ts'; + +/** + * Represents an HTTP method. + */ +export enum HttpMethod { + GET = "GET", + HEAD = "HEAD", + POST = "POST", + PUT = "PUT", + DELETE = "DELETE", + CONNECT = "CONNECT", + OPTIONS = "OPTIONS", + TRACE = "TRACE", + PATCH = "PATCH" +} + +/** + * Represents an HTTP file which will be transferred from or to a server. + */ +export type HttpFile = Blob & { readonly name: string }; + +export class HttpException extends Error { + public constructor(msg: string) { + super(msg); + } +} + +/** + * Represents the body of an outgoing HTTP request. + */ +export type RequestBody = undefined | string | FormData | URLSearchParams; + +type Headers = Record; + +function ensureAbsoluteUrl(url: string) { + if (url.startsWith("http://") || url.startsWith("https://")) { + return url; + } + return window.location.origin + url; +} + +/** + * Represents an HTTP request context + */ +export class RequestContext { + private headers: Headers = {}; + private body: RequestBody = undefined; + private url: URL; + + /** + * Creates the request context using a http method and request resource url + * + * @param url url of the requested resource + * @param httpMethod http method + */ + public constructor(url: string, private httpMethod: HttpMethod) { + this.url = new URL(ensureAbsoluteUrl(url)); + } + + /* + * Returns the url set in the constructor including the query string + * + */ + public getUrl(): string { + return this.url.toString().endsWith("/") ? + this.url.toString().slice(0, -1) + : this.url.toString(); + } + + /** + * Replaces the url set in the constructor with this url. + * + */ + public setUrl(url: string) { + this.url = new URL(ensureAbsoluteUrl(url)); + } + + /** + * Sets the body of the http request either as a string or FormData + * + * Note that setting a body on a HTTP GET, HEAD, DELETE, CONNECT or TRACE + * request is discouraged. + * https://httpwg.org/http-core/draft-ietf-httpbis-semantics-latest.html#rfc.section.7.3.1 + * + * @param body the body of the request + */ + public setBody(body: RequestBody) { + this.body = body; + } + + public getHttpMethod(): HttpMethod { + return this.httpMethod; + } + + public getHeaders(): Headers { + return this.headers; + } + + public getBody(): RequestBody { + return this.body; + } + + public setQueryParam(name: string, value: string) { + this.url.searchParams.set(name, value); + } + + public appendQueryParam(name: string, value: string) { + this.url.searchParams.append(name, value); + } + + /** + * Sets a cookie with the name and value. NO check for duplicate cookies is performed + * + */ + public addCookie(name: string, value: string): void { + if (!this.headers["Cookie"]) { + this.headers["Cookie"] = ""; + } + this.headers["Cookie"] += name + "=" + value + "; "; + } + + public setHeaderParam(key: string, value: string): void { + this.headers[key] = value; + } +} + +export interface ResponseBody { + text(): Promise; + binary(): Promise; +} + +/** + * Helper class to generate a `ResponseBody` from binary data + */ +export class SelfDecodingBody implements ResponseBody { + constructor(private dataSource: Promise) {} + + binary(): Promise { + return this.dataSource; + } + + async text(): Promise { + const data: Blob = await this.dataSource; + // @ts-ignore + if (data.text) { + // @ts-ignore + return data.text(); + } + + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.addEventListener("load", () => resolve(reader.result as string)); + reader.addEventListener("error", () => reject(reader.error)); + reader.readAsText(data); + }); + } +} + +export class ResponseContext { + public constructor( + public httpStatusCode: number, + public headers: Headers, + public body: ResponseBody + ) {} + + /** + * Parse header value in the form `value; param1="value1"` + * + * E.g. for Content-Type or Content-Disposition + * Parameter names are converted to lower case + * The first parameter is returned with the key `""` + */ + public getParsedHeader(headerName: string): Headers { + const result: Headers = {}; + if (!this.headers[headerName]) { + return result; + } + + const parameters = this.headers[headerName].split(";"); + for (const parameter of parameters) { + let [key, value] = parameter.split("=", 2); + key = key.toLowerCase().trim(); + if (value === undefined) { + result[""] = key; + } else { + value = value.trim(); + if (value.startsWith('"') && value.endsWith('"')) { + value = value.substring(1, value.length - 1); + } + result[key] = value; + } + } + return result; + } + + public async getBodyAsFile(): Promise { + const data = await this.body.binary(); + const fileName = this.getParsedHeader("content-disposition")["filename"] || ""; + const contentType = this.headers["content-type"] || ""; + try { + return new File([data], fileName, { type: contentType }); + } catch (error) { + /** Fallback for when the File constructor is not available */ + return Object.assign(data, { + name: fileName, + type: contentType + }); + } + } + + /** + * Use a heuristic to get a body of unknown data structure. + * Return as string if possible, otherwise as binary. + */ + public getBodyAsAny(): Promise { + try { + return this.body.text(); + } catch {} + + try { + return this.body.binary(); + } catch {} + + return Promise.resolve(undefined); + } +} + +export interface HttpLibrary { + send(request: RequestContext): Observable; +} + +export interface PromiseHttpLibrary { + send(request: RequestContext): Promise; +} + +export function wrapHttpLibrary(promiseHttpLibrary: PromiseHttpLibrary): HttpLibrary { + return { + send(request: RequestContext): Observable { + return from(promiseHttpLibrary.send(request)); + } + } +} + +export class HttpInfo extends ResponseContext { + public constructor( + public httpStatusCode: number, + public headers: Headers, + public body: ResponseBody, + public data: T, + ) { + super(httpStatusCode, headers, body); + } +} diff --git a/loadtest/api-client/generated/http/isomorphic-fetch.ts b/loadtest/api-client/generated/http/isomorphic-fetch.ts new file mode 100644 index 0000000..b2b5093 --- /dev/null +++ b/loadtest/api-client/generated/http/isomorphic-fetch.ts @@ -0,0 +1,31 @@ +import {HttpLibrary, RequestContext, ResponseContext} from './http.ts'; +import { from, Observable } from '../rxjsStub.ts'; + +export class IsomorphicFetchHttpLibrary implements HttpLibrary { + + public send(request: RequestContext): Observable { + let method = request.getHttpMethod().toString(); + let body = request.getBody(); + + const resultPromise = fetch(request.getUrl(), { + method: method, + body: body as any, + headers: request.getHeaders(), + credentials: "same-origin" + }).then((resp: any) => { + const headers: { [name: string]: string } = {}; + resp.headers.forEach((value: string, name: string) => { + headers[name] = value; + }); + + const body = { + text: () => resp.text(), + binary: () => resp.blob() + }; + return new ResponseContext(resp.status, headers, body); + }); + + return from>(resultPromise); + + } +} diff --git a/loadtest/api-client/generated/index.ts b/loadtest/api-client/generated/index.ts new file mode 100644 index 0000000..0749ebc --- /dev/null +++ b/loadtest/api-client/generated/index.ts @@ -0,0 +1,12 @@ +export * from "./http/http.ts"; +export * from "./auth/auth.ts"; +export * from "./models/all.ts"; +export { createConfiguration } from "./configuration.ts" +export type { Configuration } from "./configuration.ts" +export * from "./apis/exception.ts"; +export * from "./servers.ts"; +export { RequiredError } from "./apis/baseapi.ts"; + +export type { PromiseMiddleware as Middleware } from './middleware.ts'; +export { PromiseAuthApi as AuthApi, PromiseClass2FAApi as Class2FAApi, PromiseCronApi as CronApi, PromiseDbiamPersonenkontexteApi as DbiamPersonenkontexteApi, PromiseDbiamPersonenuebersichtApi as DbiamPersonenuebersichtApi, PromiseImportApi as ImportApi, PromiseOrganisationenApi as OrganisationenApi, PromisePersonAdministrationApi as PersonAdministrationApi, PromisePersonInfoApi as PersonInfoApi, PromisePersonenApi as PersonenApi, PromisePersonenFrontendApi as PersonenFrontendApi, PromisePersonenkontextApi as PersonenkontextApi, PromisePersonenkontexteApi as PersonenkontexteApi, PromiseProviderApi as ProviderApi, PromiseRolleApi as RolleApi, PromiseStatusApi as StatusApi } from './types/PromiseAPI.ts'; + diff --git a/loadtest/api-client/generated/middleware.ts b/loadtest/api-client/generated/middleware.ts new file mode 100644 index 0000000..ae36e6c --- /dev/null +++ b/loadtest/api-client/generated/middleware.ts @@ -0,0 +1,66 @@ +import {RequestContext, ResponseContext} from './http/http.ts'; +import { Observable, from } from './rxjsStub.ts'; + +/** + * Defines the contract for a middleware intercepting requests before + * they are sent (but after the RequestContext was created) + * and before the ResponseContext is unwrapped. + * + */ +export interface Middleware { + /** + * Modifies the request before the request is sent. + * + * @param context RequestContext of a request which is about to be sent to the server + * @returns an observable of the updated request context + * + */ + pre(context: RequestContext): Observable; + /** + * Modifies the returned response before it is deserialized. + * + * @param context ResponseContext of a sent request + * @returns an observable of the modified response context + */ + post(context: ResponseContext): Observable; +} + +export class PromiseMiddlewareWrapper implements Middleware { + + public constructor(private middleware: PromiseMiddleware) { + + } + + pre(context: RequestContext): Observable { + return from(this.middleware.pre(context)); + } + + post(context: ResponseContext): Observable { + return from(this.middleware.post(context)); + } + +} + +/** + * Defines the contract for a middleware intercepting requests before + * they are sent (but after the RequestContext was created) + * and before the ResponseContext is unwrapped. + * + */ +export interface PromiseMiddleware { + /** + * Modifies the request before the request is sent. + * + * @param context RequestContext of a request which is about to be sent to the server + * @returns an observable of the updated request context + * + */ + pre(context: RequestContext): Promise; + /** + * Modifies the returned response before it is deserialized. + * + * @param context ResponseContext of a sent request + * @returns an observable of the modified response context + */ + post(context: ResponseContext): Promise; +} diff --git a/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts b/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts new file mode 100644 index 0000000..bf589ba --- /dev/null +++ b/loadtest/api-client/generated/models/AddSystemrechtBodyParams.ts @@ -0,0 +1,39 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { HttpFile } from '../http/http.ts'; + +export class AddSystemrechtBodyParams { + 'systemRecht': RollenSystemRecht; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "systemRecht", + "baseName": "systemRecht", + "type": "RollenSystemRecht", + "format": "" + } ]; + + static getAttributeTypeMap() { + return AddSystemrechtBodyParams.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts b/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts new file mode 100644 index 0000000..67a5ad4 --- /dev/null +++ b/loadtest/api-client/generated/models/AssignHardwareTokenBodyParams.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class AssignHardwareTokenBodyParams { + 'serial': string; + 'otp': string; + 'referrer': string; + 'userId': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "serial", + "baseName": "serial", + "type": "string", + "format": "" + }, + { + "name": "otp", + "baseName": "otp", + "type": "string", + "format": "" + }, + { + "name": "referrer", + "baseName": "referrer", + "type": "string", + "format": "" + }, + { + "name": "userId", + "baseName": "userId", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return AssignHardwareTokenBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts b/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts new file mode 100644 index 0000000..6ae0b28 --- /dev/null +++ b/loadtest/api-client/generated/models/AssignHardwareTokenResponse.ts @@ -0,0 +1,78 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class AssignHardwareTokenResponse { + 'id': number; + 'jsonrpc': string; + 'time': number; + 'version': string; + 'versionnumber': string; + 'signature': string; + 'dialogText': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "number", + "format": "" + }, + { + "name": "jsonrpc", + "baseName": "jsonrpc", + "type": "string", + "format": "" + }, + { + "name": "time", + "baseName": "time", + "type": "number", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "string", + "format": "" + }, + { + "name": "versionnumber", + "baseName": "versionnumber", + "type": "string", + "format": "" + }, + { + "name": "signature", + "baseName": "signature", + "type": "string", + "format": "" + }, + { + "name": "dialogText", + "baseName": "dialogText", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return AssignHardwareTokenResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts b/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts new file mode 100644 index 0000000..7ae3262 --- /dev/null +++ b/loadtest/api-client/generated/models/CreateOrganisationBodyParams.ts @@ -0,0 +1,99 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { HttpFile } from '../http/http.ts'; + +export class CreateOrganisationBodyParams { + 'administriertVon'?: string; + 'zugehoerigZu'?: string; + /** + * Required, if `typ` is equal to `SCHULE` + */ + 'kennung'?: string; + 'name': string; + 'namensergaenzung'?: string; + 'kuerzel'?: string; + 'typ': OrganisationsTyp; + 'traegerschaft'?: TraegerschaftTyp; + 'emailAdress'?: string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "administriertVon", + "baseName": "administriertVon", + "type": "string", + "format": "" + }, + { + "name": "zugehoerigZu", + "baseName": "zugehoerigZu", + "type": "string", + "format": "" + }, + { + "name": "kennung", + "baseName": "kennung", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "namensergaenzung", + "baseName": "namensergaenzung", + "type": "string", + "format": "" + }, + { + "name": "kuerzel", + "baseName": "kuerzel", + "type": "string", + "format": "" + }, + { + "name": "typ", + "baseName": "typ", + "type": "OrganisationsTyp", + "format": "" + }, + { + "name": "traegerschaft", + "baseName": "traegerschaft", + "type": "TraegerschaftTyp", + "format": "" + }, + { + "name": "emailAdress", + "baseName": "emailAdress", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return CreateOrganisationBodyParams.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts b/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts new file mode 100644 index 0000000..41b61f4 --- /dev/null +++ b/loadtest/api-client/generated/models/CreatePersonMigrationBodyParams.ts @@ -0,0 +1,71 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class CreatePersonMigrationBodyParams { + 'personId': string; + 'familienname': string; + 'vorname': string; + 'hashedPassword'?: string; + 'username'?: string; + 'personalnummer'?: string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "familienname", + "baseName": "familienname", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "hashedPassword", + "baseName": "hashedPassword", + "type": "string", + "format": "" + }, + { + "name": "username", + "baseName": "username", + "type": "string", + "format": "" + }, + { + "name": "personalnummer", + "baseName": "personalnummer", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return CreatePersonMigrationBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/CreateRolleBodyParams.ts b/loadtest/api-client/generated/models/CreateRolleBodyParams.ts new file mode 100644 index 0000000..0d9ffb7 --- /dev/null +++ b/loadtest/api-client/generated/models/CreateRolleBodyParams.ts @@ -0,0 +1,69 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { HttpFile } from '../http/http.ts'; + +export class CreateRolleBodyParams { + 'name': string; + 'administeredBySchulstrukturknoten': string; + 'rollenart': RollenArt; + 'merkmale': Set; + 'systemrechte': Set; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "administeredBySchulstrukturknoten", + "baseName": "administeredBySchulstrukturknoten", + "type": "string", + "format": "" + }, + { + "name": "rollenart", + "baseName": "rollenart", + "type": "RollenArt", + "format": "" + }, + { + "name": "merkmale", + "baseName": "merkmale", + "type": "Set", + "format": "" + }, + { + "name": "systemrechte", + "baseName": "systemrechte", + "type": "Set", + "format": "" + } ]; + + static getAttributeTypeMap() { + return CreateRolleBodyParams.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/DBiamPersonResponse.ts b/loadtest/api-client/generated/models/DBiamPersonResponse.ts new file mode 100644 index 0000000..a023af1 --- /dev/null +++ b/loadtest/api-client/generated/models/DBiamPersonResponse.ts @@ -0,0 +1,45 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { PersonResponse } from '../models/PersonResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DBiamPersonResponse { + 'person': PersonResponse; + 'dBiamPersonenkontextResponses': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "person", + "baseName": "person", + "type": "PersonResponse", + "format": "" + }, + { + "name": "dBiamPersonenkontextResponses", + "baseName": "dBiamPersonenkontextResponses", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DBiamPersonResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts b/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts new file mode 100644 index 0000000..fe669a6 --- /dev/null +++ b/loadtest/api-client/generated/models/DBiamPersonenkontextResponse.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DBiamPersonenkontextResponse { + 'personId': string; + 'organisationId': string; + 'rolleId': string; + 'befristung': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "organisationId", + "baseName": "organisationId", + "type": "string", + "format": "" + }, + { + "name": "rolleId", + "baseName": "rolleId", + "type": "string", + "format": "" + }, + { + "name": "befristung", + "baseName": "befristung", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DBiamPersonenkontextResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts b/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts new file mode 100644 index 0000000..7b7d203 --- /dev/null +++ b/loadtest/api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts @@ -0,0 +1,58 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response { + 'total': number; + 'offset': number; + 'limit': number; + 'items': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "total", + "baseName": "total", + "type": "number", + "format": "" + }, + { + "name": "offset", + "baseName": "offset", + "type": "number", + "format": "" + }, + { + "name": "limit", + "baseName": "limit", + "type": "number", + "format": "" + }, + { + "name": "items", + "baseName": "items", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts b/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts new file mode 100644 index 0000000..568c873 --- /dev/null +++ b/loadtest/api-client/generated/models/DBiamPersonenuebersichtResponse.ts @@ -0,0 +1,75 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DBiamPersonenuebersichtResponse { + 'personId': string; + 'vorname': string; + 'nachname': string; + 'benutzername': string; + /** + * Date of the most recent changed personenkontext in the Zuordnungen + */ + 'lastModifiedZuordnungen': Date | null; + 'zuordnungen': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "nachname", + "baseName": "nachname", + "type": "string", + "format": "" + }, + { + "name": "benutzername", + "baseName": "benutzername", + "type": "string", + "format": "" + }, + { + "name": "lastModifiedZuordnungen", + "baseName": "lastModifiedZuordnungen", + "type": "Date", + "format": "date-time" + }, + { + "name": "zuordnungen", + "baseName": "zuordnungen", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DBiamPersonenuebersichtResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts b/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts new file mode 100644 index 0000000..c47eebd --- /dev/null +++ b/loadtest/api-client/generated/models/DBiamPersonenzuordnungResponse.ts @@ -0,0 +1,103 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DBiamPersonenzuordnungResponse { + 'sskId': string; + 'rolleId': string; + 'sskName': string; + 'sskDstNr': string; + 'rolle': string; + 'administriertVon': string; + 'typ': OrganisationsTyp; + 'editable': boolean; + 'befristung': Date; + 'merkmale': RollenMerkmal; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "sskId", + "baseName": "sskId", + "type": "string", + "format": "" + }, + { + "name": "rolleId", + "baseName": "rolleId", + "type": "string", + "format": "" + }, + { + "name": "sskName", + "baseName": "sskName", + "type": "string", + "format": "" + }, + { + "name": "sskDstNr", + "baseName": "sskDstNr", + "type": "string", + "format": "" + }, + { + "name": "rolle", + "baseName": "rolle", + "type": "string", + "format": "" + }, + { + "name": "administriertVon", + "baseName": "administriertVon", + "type": "string", + "format": "" + }, + { + "name": "typ", + "baseName": "typ", + "type": "OrganisationsTyp", + "format": "" + }, + { + "name": "editable", + "baseName": "editable", + "type": "boolean", + "format": "" + }, + { + "name": "befristung", + "baseName": "befristung", + "type": "Date", + "format": "date-time" + }, + { + "name": "merkmale", + "baseName": "merkmale", + "type": "RollenMerkmal", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DBiamPersonenzuordnungResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts b/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts new file mode 100644 index 0000000..8782507 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts @@ -0,0 +1,65 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DbiamCreatePersonWithPersonenkontexteBodyParams { + 'familienname': string; + 'vorname': string; + 'personalnummer'?: string; + 'befristung'?: Date; + 'createPersonenkontexte': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "familienname", + "baseName": "familienname", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "personalnummer", + "baseName": "personalnummer", + "type": "string", + "format": "" + }, + { + "name": "befristung", + "baseName": "befristung", + "type": "Date", + "format": "date-time" + }, + { + "name": "createPersonenkontexte", + "baseName": "createPersonenkontexte", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamCreatePersonWithPersonenkontexteBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts b/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts new file mode 100644 index 0000000..993c186 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamCreatePersonenkontextBodyParams.ts @@ -0,0 +1,43 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamCreatePersonenkontextBodyParams { + 'organisationId': string; + 'rolleId': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "organisationId", + "baseName": "organisationId", + "type": "string", + "format": "" + }, + { + "name": "rolleId", + "baseName": "rolleId", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamCreatePersonenkontextBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DbiamImportError.ts b/loadtest/api-client/generated/models/DbiamImportError.ts new file mode 100644 index 0000000..bcc2c82 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamImportError.ts @@ -0,0 +1,56 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamImportError { + 'i18nKey': DbiamImportErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + 'code': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "i18nKey", + "baseName": "i18nKey", + "type": "DbiamImportErrorI18nKeyEnum", + "format": "" + }, + { + "name": "code", + "baseName": "code", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamImportError.attributeTypeMap; + } + + public constructor() { + } +} + +export enum DbiamImportErrorI18nKeyEnum { + ImportError = 'IMPORT_ERROR', + CsvParsingError = 'CSV_PARSING_ERROR', + CsvFileEmptyError = 'CSV_FILE_EMPTY_ERROR', + ImportTextFileCreationError = 'IMPORT_TEXT_FILE_CREATION_ERROR', + ImportNurLernAnSchuleError = 'IMPORT_NUR_LERN_AN_SCHULE_ERROR', + CsvFileInvalidHeaderError = 'CSV_FILE_INVALID_HEADER_ERROR' +} + diff --git a/loadtest/api-client/generated/models/DbiamOrganisationError.ts b/loadtest/api-client/generated/models/DbiamOrganisationError.ts new file mode 100644 index 0000000..edbc3cc --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamOrganisationError.ts @@ -0,0 +1,67 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamOrganisationError { + 'i18nKey': DbiamOrganisationErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + 'code': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "i18nKey", + "baseName": "i18nKey", + "type": "DbiamOrganisationErrorI18nKeyEnum", + "format": "" + }, + { + "name": "code", + "baseName": "code", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamOrganisationError.attributeTypeMap; + } + + public constructor() { + } +} + +export enum DbiamOrganisationErrorI18nKeyEnum { + OrganisationSpecificationError = 'ORGANISATION_SPECIFICATION_ERROR', + KennungRequiredForSchule = 'KENNUNG_REQUIRED_FOR_SCHULE', + NameRequiredForSchule = 'NAME_REQUIRED_FOR_SCHULE', + SchuleKennungEindeutig = 'SCHULE_KENNUNG_EINDEUTIG', + SchuleUnterTraeger = 'SCHULE_UNTER_TRAEGER', + TraegerInTraeger = 'TRAEGER_IN_TRAEGER', + NurKlasseUnterSchule = 'NUR_KLASSE_UNTER_SCHULE', + ZyklusInOrganisation = 'ZYKLUS_IN_ORGANISATION', + RootOrganisationImmutable = 'ROOT_ORGANISATION_IMMUTABLE', + KlasseNurVonSchuleAdministriert = 'KLASSE_NUR_VON_SCHULE_ADMINISTRIERT', + KlassennameAnSchuleEindeutig = 'KLASSENNAME_AN_SCHULE_EINDEUTIG', + OrganisationIstBereitsZugewiesenError = 'ORGANISATION_IST_BEREITS_ZUGEWIESEN_ERROR', + NameRequiredForKlasse = 'NAME_REQUIRED_FOR_KLASSE', + NameEnthaeltLeerzeichen = 'NAME_ENTHAELT_LEERZEICHEN', + KennungEnthaeltLeerzeichen = 'KENNUNG_ENTHAELT_LEERZEICHEN', + EmailAdressOnOrganisationTyp = 'EMAIL_ADRESS_ON_ORGANISATION_TYP', + NewerVersionOrganisation = 'NEWER_VERSION_ORGANISATION' +} + diff --git a/loadtest/api-client/generated/models/DbiamPersonError.ts b/loadtest/api-client/generated/models/DbiamPersonError.ts new file mode 100644 index 0000000..661d36c --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamPersonError.ts @@ -0,0 +1,58 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamPersonError { + 'i18nKey': DbiamPersonErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + 'code': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "i18nKey", + "baseName": "i18nKey", + "type": "DbiamPersonErrorI18nKeyEnum", + "format": "" + }, + { + "name": "code", + "baseName": "code", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamPersonError.attributeTypeMap; + } + + public constructor() { + } +} + +export enum DbiamPersonErrorI18nKeyEnum { + PersonError = 'PERSON_ERROR', + VornameEnthaeltLeerzeichen = 'VORNAME_ENTHAELT_LEERZEICHEN', + FamiliennameEnthaeltLeerzeichen = 'FAMILIENNAME_ENTHAELT_LEERZEICHEN', + PersonNotFound = 'PERSON_NOT_FOUND', + DownstreamUnreachable = 'DOWNSTREAM_UNREACHABLE', + PersonalnummerRequired = 'PERSONALNUMMER_REQUIRED', + NewerVersionOfPersonAvailable = 'NEWER_VERSION_OF_PERSON_AVAILABLE', + PersonalnummerNichtEindeutig = 'PERSONALNUMMER_NICHT_EINDEUTIG' +} + diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts b/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts new file mode 100644 index 0000000..b1997ba --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamPersonenkontextBodyParams.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamPersonenkontextBodyParams { + 'personId': string; + 'organisationId': string; + 'rolleId': string; + 'befristung'?: Date; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "organisationId", + "baseName": "organisationId", + "type": "string", + "format": "" + }, + { + "name": "rolleId", + "baseName": "rolleId", + "type": "string", + "format": "" + }, + { + "name": "befristung", + "baseName": "befristung", + "type": "Date", + "format": "date-time" + } ]; + + static getAttributeTypeMap() { + return DbiamPersonenkontextBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts b/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts new file mode 100644 index 0000000..5aaed12 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamPersonenkontextError.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamPersonenkontextError { + 'i18nKey': DbiamPersonenkontextErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + 'code': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "i18nKey", + "baseName": "i18nKey", + "type": "DbiamPersonenkontextErrorI18nKeyEnum", + "format": "" + }, + { + "name": "code", + "baseName": "code", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamPersonenkontextError.attributeTypeMap; + } + + public constructor() { + } +} + +export enum DbiamPersonenkontextErrorI18nKeyEnum { + PersonenkontextSpecificationError = 'PERSONENKONTEXT_SPECIFICATION_ERROR', + NurLehrUndLernAnKlasse = 'NUR_LEHR_UND_LERN_AN_KLASSE', + GleicheRolleAnKlasseWieSchule = 'GLEICHE_ROLLE_AN_KLASSE_WIE_SCHULE', + OrganisationMatchesRollenart = 'ORGANISATION_MATCHES_ROLLENART', + PersonenkontextAnlageError = 'PERSONENKONTEXT_ANLAGE_ERROR', + RolleNurAnPassendeOrganisation = 'ROLLE_NUR_AN_PASSENDE_ORGANISATION', + PersonalnummerNichtEindeutig = 'PERSONALNUMMER_NICHT_EINDEUTIG' +} + diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts b/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts new file mode 100644 index 0000000..0fff251 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamPersonenkontextMigrationBodyParams.ts @@ -0,0 +1,81 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DbiamPersonenkontextMigrationBodyParams { + 'personId': string; + 'username'?: string; + 'organisationId': string; + 'rolleId': string; + 'befristung'?: Date; + 'email'?: string; + 'migrationRunType': PersonenkontextMigrationRuntype; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "username", + "baseName": "username", + "type": "string", + "format": "" + }, + { + "name": "organisationId", + "baseName": "organisationId", + "type": "string", + "format": "" + }, + { + "name": "rolleId", + "baseName": "rolleId", + "type": "string", + "format": "" + }, + { + "name": "befristung", + "baseName": "befristung", + "type": "Date", + "format": "date-time" + }, + { + "name": "email", + "baseName": "email", + "type": "string", + "format": "" + }, + { + "name": "migrationRunType", + "baseName": "migrationRunType", + "type": "PersonenkontextMigrationRuntype", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamPersonenkontextMigrationBodyParams.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts b/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts new file mode 100644 index 0000000..9058f21 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamPersonenkontexteUpdateError.ts @@ -0,0 +1,59 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamPersonenkontexteUpdateError { + 'i18nKey': DbiamPersonenkontexteUpdateErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + 'code': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "i18nKey", + "baseName": "i18nKey", + "type": "DbiamPersonenkontexteUpdateErrorI18nKeyEnum", + "format": "" + }, + { + "name": "code", + "baseName": "code", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamPersonenkontexteUpdateError.attributeTypeMap; + } + + public constructor() { + } +} + +export enum DbiamPersonenkontexteUpdateErrorI18nKeyEnum { + PersonenkontexteUpdateError = 'PERSONENKONTEXTE_UPDATE_ERROR', + PersonenkontextNotFound = 'PERSONENKONTEXT_NOT_FOUND', + CountMismatching = 'COUNT_MISMATCHING', + NewerVersionOfPersonenkontexteAvailable = 'NEWER_VERSION_OF_PERSONENKONTEXTE_AVAILABLE', + InvalidLastModifiedValue = 'INVALID_LAST_MODIFIED_VALUE', + PersonIdMismatch = 'PERSON_ID_MISMATCH', + PersonNotFound = 'PERSON_NOT_FOUND', + InvalidPersonenkontextForPersonWithRollenartLern = 'INVALID_PERSONENKONTEXT_FOR_PERSON_WITH_ROLLENART_LERN', + BefristungRequiredForPersonenkontext = ' BEFRISTUNG_REQUIRED_FOR_PERSONENKONTEXT' +} + diff --git a/loadtest/api-client/generated/models/DbiamRolleError.ts b/loadtest/api-client/generated/models/DbiamRolleError.ts new file mode 100644 index 0000000..773caff --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamRolleError.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DbiamRolleError { + 'i18nKey': DbiamRolleErrorI18nKeyEnum; + /** + * Corresponds to HTTP Status code like 200, 404, 500 + */ + 'code': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "i18nKey", + "baseName": "i18nKey", + "type": "DbiamRolleErrorI18nKeyEnum", + "format": "" + }, + { + "name": "code", + "baseName": "code", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamRolleError.attributeTypeMap; + } + + public constructor() { + } +} + +export enum DbiamRolleErrorI18nKeyEnum { + RolleError = 'ROLLE_ERROR', + AddSystemrechtError = 'ADD_SYSTEMRECHT_ERROR', + RolleHatPersonenkontexteError = 'ROLLE_HAT_PERSONENKONTEXTE_ERROR', + UpdateMerkmaleError = 'UPDATE_MERKMALE_ERROR', + RollennameEnthaeltLeerzeichen = 'ROLLENNAME_ENTHAELT_LEERZEICHEN', + NewerVersionOfRolleAvailable = 'NEWER_VERSION_OF_ROLLE_AVAILABLE', + RolleNameUniqueOnSsk = 'ROLLE_NAME_UNIQUE_ON_SSK' +} + diff --git a/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts b/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts new file mode 100644 index 0000000..e8e25c2 --- /dev/null +++ b/loadtest/api-client/generated/models/DbiamUpdatePersonenkontexteBodyParams.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; +import { HttpFile } from '../http/http.ts'; + +export class DbiamUpdatePersonenkontexteBodyParams { + /** + * Date of the most recent changed personenkontext + */ + 'lastModified'?: Date | null; + /** + * The amount of personenkontexte + */ + 'count': number; + 'personenkontexte': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "lastModified", + "baseName": "lastModified", + "type": "Date", + "format": "date-time" + }, + { + "name": "count", + "baseName": "count", + "type": "number", + "format": "" + }, + { + "name": "personenkontexte", + "baseName": "personenkontexte", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DbiamUpdatePersonenkontexteBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts b/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts new file mode 100644 index 0000000..5fecde7 --- /dev/null +++ b/loadtest/api-client/generated/models/DeleteRevisionBodyParams.ts @@ -0,0 +1,39 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class DeleteRevisionBodyParams { + /** + * The revision of a personenkontext. + */ + 'revision': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return DeleteRevisionBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/EmailAddressStatus.ts b/loadtest/api-client/generated/models/EmailAddressStatus.ts new file mode 100644 index 0000000..ff42bad --- /dev/null +++ b/loadtest/api-client/generated/models/EmailAddressStatus.ts @@ -0,0 +1,20 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum EmailAddressStatus { + Enabled = 'ENABLED', + Disabled = 'DISABLED', + Requested = 'REQUESTED', + Failed = 'FAILED' +} diff --git a/loadtest/api-client/generated/models/FindRollenResponse.ts b/loadtest/api-client/generated/models/FindRollenResponse.ts new file mode 100644 index 0000000..c4bd1b3 --- /dev/null +++ b/loadtest/api-client/generated/models/FindRollenResponse.ts @@ -0,0 +1,44 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RolleResponse } from '../models/RolleResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class FindRollenResponse { + 'moeglicheRollen': Array; + 'total': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "moeglicheRollen", + "baseName": "moeglicheRollen", + "type": "Array", + "format": "" + }, + { + "name": "total", + "baseName": "total", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return FindRollenResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts b/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts new file mode 100644 index 0000000..66c3e7f --- /dev/null +++ b/loadtest/api-client/generated/models/FindSchulstrukturknotenResponse.ts @@ -0,0 +1,44 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { HttpFile } from '../http/http.ts'; + +export class FindSchulstrukturknotenResponse { + 'moeglicheSsks': Array; + 'total': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "moeglicheSsks", + "baseName": "moeglicheSsks", + "type": "Array", + "format": "" + }, + { + "name": "total", + "baseName": "total", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return FindSchulstrukturknotenResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/Geschlecht.ts b/loadtest/api-client/generated/models/Geschlecht.ts new file mode 100644 index 0000000..88a428f --- /dev/null +++ b/loadtest/api-client/generated/models/Geschlecht.ts @@ -0,0 +1,20 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum Geschlecht { + M = 'm', + W = 'w', + D = 'd', + X = 'x' +} diff --git a/loadtest/api-client/generated/models/ImportDataItemResponse.ts b/loadtest/api-client/generated/models/ImportDataItemResponse.ts new file mode 100644 index 0000000..d993a1e --- /dev/null +++ b/loadtest/api-client/generated/models/ImportDataItemResponse.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class ImportDataItemResponse { + 'nachname': string; + 'vorname': string; + 'klasse': string | null; + 'validationErrors': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "nachname", + "baseName": "nachname", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "klasse", + "baseName": "klasse", + "type": "string", + "format": "" + }, + { + "name": "validationErrors", + "baseName": "validationErrors", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ImportDataItemResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/ImportUploadResponse.ts b/loadtest/api-client/generated/models/ImportUploadResponse.ts new file mode 100644 index 0000000..cf79299 --- /dev/null +++ b/loadtest/api-client/generated/models/ImportUploadResponse.ts @@ -0,0 +1,77 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class ImportUploadResponse { + /** + * The import transaction number. it will be needed to execute the import and download the result + */ + 'importvorgangId': string; + /** + * It states if the import transaction contain errors. + */ + 'isValid': boolean; + /** + * The total number of data items in the CSV file. + */ + 'totalImportDataItems': number; + /** + * The total number of data items in the CSV file that are invalid. + */ + 'totalInvalidImportDataItems': number; + 'invalidImportDataItems': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "importvorgangId", + "baseName": "importvorgangId", + "type": "string", + "format": "" + }, + { + "name": "isValid", + "baseName": "isValid", + "type": "boolean", + "format": "" + }, + { + "name": "totalImportDataItems", + "baseName": "totalImportDataItems", + "type": "number", + "format": "" + }, + { + "name": "totalInvalidImportDataItems", + "baseName": "totalInvalidImportDataItems", + "type": "number", + "format": "" + }, + { + "name": "invalidImportDataItems", + "baseName": "invalidImportDataItems", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ImportUploadResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts b/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts new file mode 100644 index 0000000..b758b13 --- /dev/null +++ b/loadtest/api-client/generated/models/ImportvorgangByIdBodyParams.ts @@ -0,0 +1,53 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class ImportvorgangByIdBodyParams { + /** + * The id of an import transaction + */ + 'importvorgangId': string; + 'organisationId': string; + 'rolleId': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "importvorgangId", + "baseName": "importvorgangId", + "type": "string", + "format": "" + }, + { + "name": "organisationId", + "baseName": "organisationId", + "type": "string", + "format": "" + }, + { + "name": "rolleId", + "baseName": "rolleId", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ImportvorgangByIdBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/LockUserBodyParams.ts b/loadtest/api-client/generated/models/LockUserBodyParams.ts new file mode 100644 index 0000000..2d59712 --- /dev/null +++ b/loadtest/api-client/generated/models/LockUserBodyParams.ts @@ -0,0 +1,53 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class LockUserBodyParams { + 'lock': boolean; + 'lockedBy': string; + /** + * Required if Befristung is set + */ + 'lockedUntil'?: Date; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "lock", + "baseName": "lock", + "type": "boolean", + "format": "" + }, + { + "name": "lockedBy", + "baseName": "locked_by", + "type": "string", + "format": "" + }, + { + "name": "lockedUntil", + "baseName": "locked_until", + "type": "Date", + "format": "date-time" + } ]; + + static getAttributeTypeMap() { + return LockUserBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/LoeschungResponse.ts b/loadtest/api-client/generated/models/LoeschungResponse.ts new file mode 100644 index 0000000..f3bb012 --- /dev/null +++ b/loadtest/api-client/generated/models/LoeschungResponse.ts @@ -0,0 +1,36 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class LoeschungResponse { + 'zeitpunkt': Date; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "zeitpunkt", + "baseName": "zeitpunkt", + "type": "Date", + "format": "date-time" + } ]; + + static getAttributeTypeMap() { + return LoeschungResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/ObjectSerializer.ts b/loadtest/api-client/generated/models/ObjectSerializer.ts new file mode 100644 index 0000000..a71f068 --- /dev/null +++ b/loadtest/api-client/generated/models/ObjectSerializer.ts @@ -0,0 +1,584 @@ +export * from '../models/AddSystemrechtBodyParams.ts'; +export * from '../models/AssignHardwareTokenBodyParams.ts'; +export * from '../models/AssignHardwareTokenResponse.ts'; +export * from '../models/CreateOrganisationBodyParams.ts'; +export * from '../models/CreatePersonMigrationBodyParams.ts'; +export * from '../models/CreateRolleBodyParams.ts'; +export * from '../models/DBiamPersonResponse.ts'; +export * from '../models/DBiamPersonenkontextResponse.ts'; +export * from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; +export * from '../models/DBiamPersonenuebersichtResponse.ts'; +export * from '../models/DBiamPersonenzuordnungResponse.ts'; +export * from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; +export * from '../models/DbiamCreatePersonenkontextBodyParams.ts'; +export * from '../models/DbiamImportError.ts'; +export * from '../models/DbiamOrganisationError.ts'; +export * from '../models/DbiamPersonError.ts'; +export * from '../models/DbiamPersonenkontextBodyParams.ts'; +export * from '../models/DbiamPersonenkontextError.ts'; +export * from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; +export * from '../models/DbiamPersonenkontexteUpdateError.ts'; +export * from '../models/DbiamRolleError.ts'; +export * from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; +export * from '../models/DeleteRevisionBodyParams.ts'; +export * from '../models/EmailAddressStatus.ts'; +export * from '../models/FindRollenResponse.ts'; +export * from '../models/FindSchulstrukturknotenResponse.ts'; +export * from '../models/Geschlecht.ts'; +export * from '../models/ImportDataItemResponse.ts'; +export * from '../models/ImportUploadResponse.ts'; +export * from '../models/ImportvorgangByIdBodyParams.ts'; +export * from '../models/LockUserBodyParams.ts'; +export * from '../models/LoeschungResponse.ts'; +export * from '../models/OrganisationByIdBodyParams.ts'; +export * from '../models/OrganisationByNameBodyParams.ts'; +export * from '../models/OrganisationResponse.ts'; +export * from '../models/OrganisationResponseLegacy.ts'; +export * from '../models/OrganisationRootChildrenResponse.ts'; +export * from '../models/OrganisationsTyp.ts'; +export * from '../models/ParentOrganisationenResponse.ts'; +export * from '../models/ParentOrganisationsByIdsBodyParams.ts'; +export * from '../models/Person.ts'; +export * from '../models/PersonBirthParams.ts'; +export * from '../models/PersonBirthResponse.ts'; +export * from '../models/PersonControllerFindPersonenkontexte200Response.ts'; +export * from '../models/PersonEmailResponse.ts'; +export * from '../models/PersonFrontendControllerFindPersons200Response.ts'; +export * from '../models/PersonIdResponse.ts'; +export * from '../models/PersonInfoResponse.ts'; +export * from '../models/PersonLockResponse.ts'; +export * from '../models/PersonMetadataBodyParams.ts'; +export * from '../models/PersonNameParams.ts'; +export * from '../models/PersonNameResponse.ts'; +export * from '../models/PersonResponse.ts'; +export * from '../models/PersonResponseAutomapper.ts'; +export * from '../models/PersonendatensatzResponse.ts'; +export * from '../models/PersonendatensatzResponseAutomapper.ts'; +export * from '../models/PersonenkontextMigrationRuntype.ts'; +export * from '../models/PersonenkontextResponse.ts'; +export * from '../models/PersonenkontextRolleFieldsResponse.ts'; +export * from '../models/PersonenkontextWorkflowResponse.ts'; +export * from '../models/PersonenkontextdatensatzResponse.ts'; +export * from '../models/PersonenkontexteUpdateResponse.ts'; +export * from '../models/Personenstatus.ts'; +export * from '../models/PersonenuebersichtBodyParams.ts'; +export * from '../models/RawPagedResponse.ts'; +export * from '../models/RolleResponse.ts'; +export * from '../models/RolleServiceProviderBodyParams.ts'; +export * from '../models/RolleServiceProviderResponse.ts'; +export * from '../models/RolleWithServiceProvidersResponse.ts'; +export * from '../models/RollenArt.ts'; +export * from '../models/RollenMerkmal.ts'; +export * from '../models/RollenSystemRecht.ts'; +export * from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; +export * from '../models/ServiceProviderIdNameResponse.ts'; +export * from '../models/ServiceProviderKategorie.ts'; +export * from '../models/ServiceProviderResponse.ts'; +export * from '../models/ServiceProviderTarget.ts'; +export * from '../models/Sichtfreigabe.ts'; +export * from '../models/SystemrechtResponse.ts'; +export * from '../models/TokenInitBodyParams.ts'; +export * from '../models/TokenRequiredResponse.ts'; +export * from '../models/TokenStateResponse.ts'; +export * from '../models/TokenVerifyBodyParams.ts'; +export * from '../models/TraegerschaftTyp.ts'; +export * from '../models/UpdateOrganisationBodyParams.ts'; +export * from '../models/UpdatePersonBodyParams.ts'; +export * from '../models/UpdateRolleBodyParams.ts'; +export * from '../models/UserLockParams.ts'; +export * from '../models/UserinfoResponse.ts'; +export * from '../models/Vertrauensstufe.ts'; + +import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; +import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; +import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; +import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; +import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; +import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; +import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; +import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; +import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; +import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; +import { DbiamImportError, DbiamImportErrorI18nKeyEnum } from '../models/DbiamImportError.ts'; +import { DbiamOrganisationError, DbiamOrganisationErrorI18nKeyEnum } from '../models/DbiamOrganisationError.ts'; +import { DbiamPersonError, DbiamPersonErrorI18nKeyEnum } from '../models/DbiamPersonError.ts'; +import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; +import { DbiamPersonenkontextError, DbiamPersonenkontextErrorI18nKeyEnum } from '../models/DbiamPersonenkontextError.ts'; +import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; +import { DbiamPersonenkontexteUpdateError, DbiamPersonenkontexteUpdateErrorI18nKeyEnum } from '../models/DbiamPersonenkontexteUpdateError.ts'; +import { DbiamRolleError, DbiamRolleErrorI18nKeyEnum } from '../models/DbiamRolleError.ts'; +import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; +import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; +import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; +import { FindRollenResponse } from '../models/FindRollenResponse.ts'; +import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; +import { Geschlecht } from '../models/Geschlecht.ts'; +import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; +import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; +import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; +import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; +import { LoeschungResponse } from '../models/LoeschungResponse.ts'; +import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; +import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; +import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; +import { Person } from '../models/Person.ts'; +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; +import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; +import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; +import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; +import { PersonIdResponse } from '../models/PersonIdResponse.ts'; +import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; +import { PersonLockResponse } from '../models/PersonLockResponse.ts'; +import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { PersonNameResponse } from '../models/PersonNameResponse.ts'; +import { PersonResponse } from '../models/PersonResponse.ts'; +import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; +import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; +import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; +import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; +import { PersonenkontextResponse , PersonenkontextResponsePersonenstatusEnum , PersonenkontextResponseJahrgangsstufeEnum , PersonenkontextResponseSichtfreigabeEnum } from '../models/PersonenkontextResponse.ts'; +import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; +import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; +import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; +import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; +import { Personenstatus } from '../models/Personenstatus.ts'; +import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; +import { RawPagedResponse } from '../models/RawPagedResponse.ts'; +import { RolleResponse } from '../models/RolleResponse.ts'; +import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; +import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; +import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; +import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; +import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; +import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; +import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; +import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; +import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; +import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; +import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; +import { TokenStateResponse } from '../models/TokenStateResponse.ts'; +import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; +import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; +import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; +import { UserLockParams } from '../models/UserLockParams.ts'; +import { UserinfoResponse } from '../models/UserinfoResponse.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; + +/* tslint:disable:no-unused-variable */ +let primitives = [ + "string", + "boolean", + "double", + "integer", + "long", + "float", + "number", + "any" + ]; + +let enumsMap: Set = new Set([ + "DbiamImportErrorI18nKeyEnum", + "DbiamOrganisationErrorI18nKeyEnum", + "DbiamPersonErrorI18nKeyEnum", + "DbiamPersonenkontextErrorI18nKeyEnum", + "DbiamPersonenkontexteUpdateErrorI18nKeyEnum", + "DbiamRolleErrorI18nKeyEnum", + "EmailAddressStatus", + "Geschlecht", + "OrganisationsTyp", + "PersonenkontextMigrationRuntype", + "PersonenkontextResponsePersonenstatusEnum", + "PersonenkontextResponseJahrgangsstufeEnum", + "PersonenkontextResponseSichtfreigabeEnum", + "Personenstatus", + "RollenArt", + "RollenMerkmal", + "RollenSystemRecht", + "ServiceProviderKategorie", + "ServiceProviderTarget", + "Sichtfreigabe", + "TraegerschaftTyp", + "Vertrauensstufe", +]); + +let typeMap: {[index: string]: any} = { + "AddSystemrechtBodyParams": AddSystemrechtBodyParams, + "AssignHardwareTokenBodyParams": AssignHardwareTokenBodyParams, + "AssignHardwareTokenResponse": AssignHardwareTokenResponse, + "CreateOrganisationBodyParams": CreateOrganisationBodyParams, + "CreatePersonMigrationBodyParams": CreatePersonMigrationBodyParams, + "CreateRolleBodyParams": CreateRolleBodyParams, + "DBiamPersonResponse": DBiamPersonResponse, + "DBiamPersonenkontextResponse": DBiamPersonenkontextResponse, + "DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response": DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response, + "DBiamPersonenuebersichtResponse": DBiamPersonenuebersichtResponse, + "DBiamPersonenzuordnungResponse": DBiamPersonenzuordnungResponse, + "DbiamCreatePersonWithPersonenkontexteBodyParams": DbiamCreatePersonWithPersonenkontexteBodyParams, + "DbiamCreatePersonenkontextBodyParams": DbiamCreatePersonenkontextBodyParams, + "DbiamImportError": DbiamImportError, + "DbiamOrganisationError": DbiamOrganisationError, + "DbiamPersonError": DbiamPersonError, + "DbiamPersonenkontextBodyParams": DbiamPersonenkontextBodyParams, + "DbiamPersonenkontextError": DbiamPersonenkontextError, + "DbiamPersonenkontextMigrationBodyParams": DbiamPersonenkontextMigrationBodyParams, + "DbiamPersonenkontexteUpdateError": DbiamPersonenkontexteUpdateError, + "DbiamRolleError": DbiamRolleError, + "DbiamUpdatePersonenkontexteBodyParams": DbiamUpdatePersonenkontexteBodyParams, + "DeleteRevisionBodyParams": DeleteRevisionBodyParams, + "FindRollenResponse": FindRollenResponse, + "FindSchulstrukturknotenResponse": FindSchulstrukturknotenResponse, + "ImportDataItemResponse": ImportDataItemResponse, + "ImportUploadResponse": ImportUploadResponse, + "ImportvorgangByIdBodyParams": ImportvorgangByIdBodyParams, + "LockUserBodyParams": LockUserBodyParams, + "LoeschungResponse": LoeschungResponse, + "OrganisationByIdBodyParams": OrganisationByIdBodyParams, + "OrganisationByNameBodyParams": OrganisationByNameBodyParams, + "OrganisationResponse": OrganisationResponse, + "OrganisationResponseLegacy": OrganisationResponseLegacy, + "OrganisationRootChildrenResponse": OrganisationRootChildrenResponse, + "ParentOrganisationenResponse": ParentOrganisationenResponse, + "ParentOrganisationsByIdsBodyParams": ParentOrganisationsByIdsBodyParams, + "Person": Person, + "PersonBirthParams": PersonBirthParams, + "PersonBirthResponse": PersonBirthResponse, + "PersonControllerFindPersonenkontexte200Response": PersonControllerFindPersonenkontexte200Response, + "PersonEmailResponse": PersonEmailResponse, + "PersonFrontendControllerFindPersons200Response": PersonFrontendControllerFindPersons200Response, + "PersonIdResponse": PersonIdResponse, + "PersonInfoResponse": PersonInfoResponse, + "PersonLockResponse": PersonLockResponse, + "PersonMetadataBodyParams": PersonMetadataBodyParams, + "PersonNameParams": PersonNameParams, + "PersonNameResponse": PersonNameResponse, + "PersonResponse": PersonResponse, + "PersonResponseAutomapper": PersonResponseAutomapper, + "PersonendatensatzResponse": PersonendatensatzResponse, + "PersonendatensatzResponseAutomapper": PersonendatensatzResponseAutomapper, + "PersonenkontextResponse": PersonenkontextResponse, + "PersonenkontextRolleFieldsResponse": PersonenkontextRolleFieldsResponse, + "PersonenkontextWorkflowResponse": PersonenkontextWorkflowResponse, + "PersonenkontextdatensatzResponse": PersonenkontextdatensatzResponse, + "PersonenkontexteUpdateResponse": PersonenkontexteUpdateResponse, + "PersonenuebersichtBodyParams": PersonenuebersichtBodyParams, + "RawPagedResponse": RawPagedResponse, + "RolleResponse": RolleResponse, + "RolleServiceProviderBodyParams": RolleServiceProviderBodyParams, + "RolleServiceProviderResponse": RolleServiceProviderResponse, + "RolleWithServiceProvidersResponse": RolleWithServiceProvidersResponse, + "RollenSystemRechtServiceProviderIDResponse": RollenSystemRechtServiceProviderIDResponse, + "ServiceProviderIdNameResponse": ServiceProviderIdNameResponse, + "ServiceProviderResponse": ServiceProviderResponse, + "SystemrechtResponse": SystemrechtResponse, + "TokenInitBodyParams": TokenInitBodyParams, + "TokenRequiredResponse": TokenRequiredResponse, + "TokenStateResponse": TokenStateResponse, + "TokenVerifyBodyParams": TokenVerifyBodyParams, + "UpdateOrganisationBodyParams": UpdateOrganisationBodyParams, + "UpdatePersonBodyParams": UpdatePersonBodyParams, + "UpdateRolleBodyParams": UpdateRolleBodyParams, + "UserLockParams": UserLockParams, + "UserinfoResponse": UserinfoResponse, +} + +type MimeTypeDescriptor = { + type: string; + subtype: string; + subtypeTokens: string[]; +}; + +/** + * Every mime-type consists of a type, subtype, and optional parameters. + * The subtype can be composite, including information about the content format. + * For example: `application/json-patch+json`, `application/merge-patch+json`. + * + * This helper transforms a string mime-type into an internal representation. + * This simplifies the implementation of predicates that in turn define common rules for parsing or stringifying + * the payload. + */ +const parseMimeType = (mimeType: string): MimeTypeDescriptor => { + const [type, subtype] = mimeType.split('/'); + return { + type, + subtype, + subtypeTokens: subtype.split('+'), + }; +}; + +type MimeTypePredicate = (mimeType: string) => boolean; + +// This factory creates a predicate function that checks a string mime-type against defined rules. +const mimeTypePredicateFactory = (predicate: (descriptor: MimeTypeDescriptor) => boolean): MimeTypePredicate => (mimeType) => predicate(parseMimeType(mimeType)); + +// Use this factory when you need to define a simple predicate based only on type and, if applicable, subtype. +const mimeTypeSimplePredicateFactory = (type: string, subtype?: string): MimeTypePredicate => mimeTypePredicateFactory((descriptor) => { + if (descriptor.type !== type) return false; + if (subtype != null && descriptor.subtype !== subtype) return false; + return true; +}); + +// Creating a set of named predicates that will help us determine how to handle different mime-types +const isTextLikeMimeType = mimeTypeSimplePredicateFactory('text'); +const isJsonMimeType = mimeTypeSimplePredicateFactory('application', 'json'); +const isJsonLikeMimeType = mimeTypePredicateFactory((descriptor) => descriptor.type === 'application' && descriptor.subtypeTokens.some((item) => item === 'json')); +const isOctetStreamMimeType = mimeTypeSimplePredicateFactory('application', 'octet-stream'); +const isFormUrlencodedMimeType = mimeTypeSimplePredicateFactory('application', 'x-www-form-urlencoded'); + +// Defining a list of mime-types in the order of prioritization for handling. +const supportedMimeTypePredicatesWithPriority: MimeTypePredicate[] = [ + isJsonMimeType, + isJsonLikeMimeType, + isTextLikeMimeType, + isOctetStreamMimeType, + isFormUrlencodedMimeType, +]; + +const nullableSuffix = " | null"; +const optionalSuffix = " | undefined"; +const arrayPrefix = "Array<"; +const arraySuffix = ">"; +const mapPrefix = "{ [key: string]: "; +const mapSuffix = "; }"; + +export class ObjectSerializer { + public static findCorrectType(data: any, expectedType: string) { + if (data == undefined) { + return expectedType; + } else if (primitives.indexOf(expectedType.toLowerCase()) !== -1) { + return expectedType; + } else if (expectedType === "Date") { + return expectedType; + } else { + if (enumsMap.has(expectedType)) { + return expectedType; + } + + if (!typeMap[expectedType]) { + return expectedType; // w/e we don't know the type + } + + // Check the discriminator + let discriminatorProperty = typeMap[expectedType].discriminator; + if (discriminatorProperty == null) { + return expectedType; // the type does not have a discriminator. use it. + } else { + if (data[discriminatorProperty]) { + var discriminatorType = data[discriminatorProperty]; + let mapping = typeMap[expectedType].mapping; + if (mapping != undefined && mapping[discriminatorType]) { + return mapping[discriminatorType]; // use the type given in the discriminator + } else if(typeMap[discriminatorType]) { + return discriminatorType; + } else { + return expectedType; // discriminator did not map to a type + } + } else { + return expectedType; // discriminator was not present (or an empty string) + } + } + } + } + + public static serialize(data: any, type: string, format: string): any { + if (data == undefined) { + return data; + } else if (primitives.indexOf(type.toLowerCase()) !== -1) { + return data; + } else if (type.endsWith(nullableSuffix)) { + let subType: string = type.slice(0, -nullableSuffix.length); // Type | null => Type + return ObjectSerializer.serialize(data, subType, format); + } else if (type.endsWith(optionalSuffix)) { + let subType: string = type.slice(0, -optionalSuffix.length); // Type | undefined => Type + return ObjectSerializer.serialize(data, subType, format); + } else if (type.startsWith(arrayPrefix)) { + let subType: string = type.slice(arrayPrefix.length, -arraySuffix.length); // Array => Type + let transformedData: any[] = []; + for (let date of data) { + transformedData.push(ObjectSerializer.serialize(date, subType, format)); + } + return transformedData; + } else if (type.startsWith(mapPrefix)) { + let subType: string = type.slice(mapPrefix.length, -mapSuffix.length); // { [key: string]: Type; } => Type + let transformedData: { [key: string]: any } = {}; + for (let key in data) { + transformedData[key] = ObjectSerializer.serialize( + data[key], + subType, + format, + ); + } + return transformedData; + } else if (type === "Date") { + if (format == "date") { + let month = data.getMonth()+1 + month = month < 10 ? "0" + month.toString() : month.toString() + let day = data.getDate(); + day = day < 10 ? "0" + day.toString() : day.toString(); + + return data.getFullYear() + "-" + month + "-" + day; + } else { + return data.toISOString(); + } + } else { + if (enumsMap.has(type)) { + return data; + } + if (!typeMap[type]) { // in case we dont know the type + return data; + } + + // Get the actual type of this object + type = this.findCorrectType(data, type); + + // get the map for the correct type. + let attributeTypes = typeMap[type].getAttributeTypeMap(); + let instance: {[index: string]: any} = {}; + for (let attributeType of attributeTypes) { + instance[attributeType.baseName] = ObjectSerializer.serialize(data[attributeType.name], attributeType.type, attributeType.format); + } + return instance; + } + } + + public static deserialize(data: any, type: string, format: string): any { + // polymorphism may change the actual type. + type = ObjectSerializer.findCorrectType(data, type); + if (data == undefined) { + return data; + } else if (primitives.indexOf(type.toLowerCase()) !== -1) { + return data; + } else if (type.endsWith(nullableSuffix)) { + let subType: string = type.slice(0, -nullableSuffix.length); // Type | null => Type + return ObjectSerializer.deserialize(data, subType, format); + } else if (type.endsWith(optionalSuffix)) { + let subType: string = type.slice(0, -optionalSuffix.length); // Type | undefined => Type + return ObjectSerializer.deserialize(data, subType, format); + } else if (type.startsWith(arrayPrefix)) { + let subType: string = type.slice(arrayPrefix.length, -arraySuffix.length); // Array => Type + let transformedData: any[] = []; + for (let date of data) { + transformedData.push(ObjectSerializer.deserialize(date, subType, format)); + } + return transformedData; + } else if (type.startsWith(mapPrefix)) { + let subType: string = type.slice(mapPrefix.length, -mapSuffix.length); // { [key: string]: Type; } => Type + let transformedData: { [key: string]: any } = {}; + for (let key in data) { + transformedData[key] = ObjectSerializer.deserialize( + data[key], + subType, + format, + ); + } + return transformedData; + } else if (type === "Date") { + return new Date(data); + } else { + if (enumsMap.has(type)) {// is Enum + return data; + } + + if (!typeMap[type]) { // dont know the type + return data; + } + let instance = new typeMap[type](); + let attributeTypes = typeMap[type].getAttributeTypeMap(); + for (let attributeType of attributeTypes) { + let value = ObjectSerializer.deserialize(data[attributeType.baseName], attributeType.type, attributeType.format); + if (value !== undefined) { + instance[attributeType.name] = value; + } + } + return instance; + } + } + + + /** + * Normalize media type + * + * We currently do not handle any media types attributes, i.e. anything + * after a semicolon. All content is assumed to be UTF-8 compatible. + */ + public static normalizeMediaType(mediaType: string | undefined): string | undefined { + if (mediaType === undefined) { + return undefined; + } + return mediaType.split(";")[0].trim().toLowerCase(); + } + + /** + * From a list of possible media types, choose the one we can handle best. + * + * The order of the given media types does not have any impact on the choice + * made. + */ + public static getPreferredMediaType(mediaTypes: Array): string { + /** According to OAS 3 we should default to json */ + if (mediaTypes.length === 0) { + return "application/json"; + } + + const normalMediaTypes = mediaTypes.map(this.normalizeMediaType); + + for (const predicate of supportedMimeTypePredicatesWithPriority) { + for (const mediaType of normalMediaTypes) { + if (mediaType != null && predicate(mediaType)) { + return mediaType; + } + } + } + + throw new Error("None of the given media types are supported: " + mediaTypes.join(", ")); + } + + /** + * Convert data to a string according the given media type + */ + public static stringify(data: any, mediaType: string): string { + if (isTextLikeMimeType(mediaType)) { + return String(data); + } + + if (isJsonLikeMimeType(mediaType)) { + return JSON.stringify(data); + } + + throw new Error("The mediaType " + mediaType + " is not supported by ObjectSerializer.stringify."); + } + + /** + * Parse data from a string according to the given media type + */ + public static parse(rawData: string, mediaType: string | undefined) { + if (mediaType === undefined) { + throw new Error("Cannot parse content. No Content-Type defined."); + } + + if (isTextLikeMimeType(mediaType)) { + return rawData; + } + + if (isJsonLikeMimeType(mediaType)) { + return JSON.parse(rawData); + } + + throw new Error("The mediaType " + mediaType + " is not supported by ObjectSerializer.parse."); + } +} diff --git a/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts b/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts new file mode 100644 index 0000000..d8af300 --- /dev/null +++ b/loadtest/api-client/generated/models/OrganisationByIdBodyParams.ts @@ -0,0 +1,39 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class OrganisationByIdBodyParams { + /** + * The id of an organization + */ + 'organisationId': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "organisationId", + "baseName": "organisationId", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return OrganisationByIdBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts b/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts new file mode 100644 index 0000000..ca1ecff --- /dev/null +++ b/loadtest/api-client/generated/models/OrganisationByNameBodyParams.ts @@ -0,0 +1,46 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class OrganisationByNameBodyParams { + 'name': string; + /** + * The version for the organisation. + */ + 'version': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return OrganisationByNameBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/OrganisationResponse.ts b/loadtest/api-client/generated/models/OrganisationResponse.ts new file mode 100644 index 0000000..a2d9140 --- /dev/null +++ b/loadtest/api-client/generated/models/OrganisationResponse.ts @@ -0,0 +1,103 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { HttpFile } from '../http/http.ts'; + +export class OrganisationResponse { + 'id': string; + 'administriertVon': string | null; + 'kennung': string | null; + 'name': string; + 'namensergaenzung': string | null; + 'kuerzel': string; + 'typ': OrganisationsTyp; + 'traegerschaft': TraegerschaftTyp; + 'itslearningEnabled': boolean; + 'version': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "administriertVon", + "baseName": "administriertVon", + "type": "string", + "format": "" + }, + { + "name": "kennung", + "baseName": "kennung", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "namensergaenzung", + "baseName": "namensergaenzung", + "type": "string", + "format": "" + }, + { + "name": "kuerzel", + "baseName": "kuerzel", + "type": "string", + "format": "" + }, + { + "name": "typ", + "baseName": "typ", + "type": "OrganisationsTyp", + "format": "" + }, + { + "name": "traegerschaft", + "baseName": "traegerschaft", + "type": "TraegerschaftTyp", + "format": "" + }, + { + "name": "itslearningEnabled", + "baseName": "itslearningEnabled", + "type": "boolean", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return OrganisationResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts b/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts new file mode 100644 index 0000000..ee80d2d --- /dev/null +++ b/loadtest/api-client/generated/models/OrganisationResponseLegacy.ts @@ -0,0 +1,81 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { HttpFile } from '../http/http.ts'; + +export class OrganisationResponseLegacy { + 'id': string; + 'administriertVon': string | null; + 'kennung': string | null; + 'name': string; + 'namensergaenzung': string | null; + 'kuerzel': string; + 'typ': OrganisationsTyp; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "administriertVon", + "baseName": "administriertVon", + "type": "string", + "format": "" + }, + { + "name": "kennung", + "baseName": "kennung", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "namensergaenzung", + "baseName": "namensergaenzung", + "type": "string", + "format": "" + }, + { + "name": "kuerzel", + "baseName": "kuerzel", + "type": "string", + "format": "" + }, + { + "name": "typ", + "baseName": "typ", + "type": "OrganisationsTyp", + "format": "" + } ]; + + static getAttributeTypeMap() { + return OrganisationResponseLegacy.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts b/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts new file mode 100644 index 0000000..cac4d36 --- /dev/null +++ b/loadtest/api-client/generated/models/OrganisationRootChildrenResponse.ts @@ -0,0 +1,44 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class OrganisationRootChildrenResponse { + 'oeffentlich': OrganisationResponse; + 'ersatz': OrganisationResponse; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "oeffentlich", + "baseName": "oeffentlich", + "type": "OrganisationResponse", + "format": "" + }, + { + "name": "ersatz", + "baseName": "ersatz", + "type": "OrganisationResponse", + "format": "" + } ]; + + static getAttributeTypeMap() { + return OrganisationRootChildrenResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/OrganisationsTyp.ts b/loadtest/api-client/generated/models/OrganisationsTyp.ts new file mode 100644 index 0000000..da9e454 --- /dev/null +++ b/loadtest/api-client/generated/models/OrganisationsTyp.ts @@ -0,0 +1,24 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum OrganisationsTyp { + Root = 'ROOT', + Land = 'LAND', + Traeger = 'TRAEGER', + Schule = 'SCHULE', + Klasse = 'KLASSE', + Anbieter = 'ANBIETER', + SonstigeOrganisationEinrichtung = 'SONSTIGE ORGANISATION / EINRICHTUNG', + Unbestaetigt = 'UNBESTAETIGT' +} diff --git a/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts b/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts new file mode 100644 index 0000000..41f2418 --- /dev/null +++ b/loadtest/api-client/generated/models/ParentOrganisationenResponse.ts @@ -0,0 +1,37 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class ParentOrganisationenResponse { + 'parents': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "parents", + "baseName": "parents", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ParentOrganisationenResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts b/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts new file mode 100644 index 0000000..ac84a65 --- /dev/null +++ b/loadtest/api-client/generated/models/ParentOrganisationsByIdsBodyParams.ts @@ -0,0 +1,39 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class ParentOrganisationsByIdsBodyParams { + /** + * The ids of organizations + */ + 'organisationIds': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "organisationIds", + "baseName": "organisationIds", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ParentOrganisationsByIdsBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/Person.ts b/loadtest/api-client/generated/models/Person.ts new file mode 100644 index 0000000..29779a4 --- /dev/null +++ b/loadtest/api-client/generated/models/Person.ts @@ -0,0 +1,118 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; +import { PersonNameResponse } from '../models/PersonNameResponse.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +import { HttpFile } from '../http/http.ts'; + +export class Person { + 'id': string; + 'referrer': string | null; + 'mandant': string; + 'name': PersonNameResponse; + 'geburt': PersonBirthResponse | null; + 'stammorganisation': string | null; + 'geschlecht': string | null; + 'lokalisierung': string | null; + 'vertrauensstufe': Vertrauensstufe; + 'revision': string; + 'personalnummer': string | null; + 'dienststellen': Array | null; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "referrer", + "baseName": "referrer", + "type": "string", + "format": "" + }, + { + "name": "mandant", + "baseName": "mandant", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "PersonNameResponse", + "format": "" + }, + { + "name": "geburt", + "baseName": "geburt", + "type": "PersonBirthResponse", + "format": "" + }, + { + "name": "stammorganisation", + "baseName": "stammorganisation", + "type": "string", + "format": "" + }, + { + "name": "geschlecht", + "baseName": "geschlecht", + "type": "string", + "format": "" + }, + { + "name": "lokalisierung", + "baseName": "lokalisierung", + "type": "string", + "format": "" + }, + { + "name": "vertrauensstufe", + "baseName": "vertrauensstufe", + "type": "Vertrauensstufe", + "format": "" + }, + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + }, + { + "name": "personalnummer", + "baseName": "personalnummer", + "type": "string", + "format": "" + }, + { + "name": "dienststellen", + "baseName": "dienststellen", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return Person.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/PersonBirthParams.ts b/loadtest/api-client/generated/models/PersonBirthParams.ts new file mode 100644 index 0000000..ce9c18a --- /dev/null +++ b/loadtest/api-client/generated/models/PersonBirthParams.ts @@ -0,0 +1,43 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonBirthParams { + 'datum'?: Date; + 'geburtsort'?: string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "datum", + "baseName": "datum", + "type": "Date", + "format": "date-time" + }, + { + "name": "geburtsort", + "baseName": "geburtsort", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonBirthParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonBirthResponse.ts b/loadtest/api-client/generated/models/PersonBirthResponse.ts new file mode 100644 index 0000000..bc5459c --- /dev/null +++ b/loadtest/api-client/generated/models/PersonBirthResponse.ts @@ -0,0 +1,43 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonBirthResponse { + 'datum': Date | null; + 'geburtsort': string | null; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "datum", + "baseName": "datum", + "type": "Date", + "format": "date-time" + }, + { + "name": "geburtsort", + "baseName": "geburtsort", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonBirthResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts b/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts new file mode 100644 index 0000000..5835c06 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonControllerFindPersonenkontexte200Response.ts @@ -0,0 +1,58 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonControllerFindPersonenkontexte200Response { + 'total': number; + 'offset': number; + 'limit': number; + 'items': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "total", + "baseName": "total", + "type": "number", + "format": "" + }, + { + "name": "offset", + "baseName": "offset", + "type": "number", + "format": "" + }, + { + "name": "limit", + "baseName": "limit", + "type": "number", + "format": "" + }, + { + "name": "items", + "baseName": "items", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonControllerFindPersonenkontexte200Response.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonEmailResponse.ts b/loadtest/api-client/generated/models/PersonEmailResponse.ts new file mode 100644 index 0000000..b73c4da --- /dev/null +++ b/loadtest/api-client/generated/models/PersonEmailResponse.ts @@ -0,0 +1,46 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonEmailResponse { + 'status': EmailAddressStatus; + 'address': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "status", + "baseName": "status", + "type": "EmailAddressStatus", + "format": "" + }, + { + "name": "address", + "baseName": "address", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonEmailResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts b/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts new file mode 100644 index 0000000..f97b36a --- /dev/null +++ b/loadtest/api-client/generated/models/PersonFrontendControllerFindPersons200Response.ts @@ -0,0 +1,58 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonFrontendControllerFindPersons200Response { + 'total': number; + 'offset': number; + 'limit': number; + 'items': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "total", + "baseName": "total", + "type": "number", + "format": "" + }, + { + "name": "offset", + "baseName": "offset", + "type": "number", + "format": "" + }, + { + "name": "limit", + "baseName": "limit", + "type": "number", + "format": "" + }, + { + "name": "items", + "baseName": "items", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonFrontendControllerFindPersons200Response.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonIdResponse.ts b/loadtest/api-client/generated/models/PersonIdResponse.ts new file mode 100644 index 0000000..1637605 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonIdResponse.ts @@ -0,0 +1,36 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonIdResponse { + 'id': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonIdResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonInfoResponse.ts b/loadtest/api-client/generated/models/PersonInfoResponse.ts new file mode 100644 index 0000000..e33872d --- /dev/null +++ b/loadtest/api-client/generated/models/PersonInfoResponse.ts @@ -0,0 +1,70 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { Person } from '../models/Person.ts'; +import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonInfoResponse { + 'pid': string; + 'person': Person; + 'personenkontexte': Array; + 'gruppen': Array; + /** + * Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status) + */ + 'email': PersonEmailResponse | null; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "pid", + "baseName": "pid", + "type": "string", + "format": "" + }, + { + "name": "person", + "baseName": "person", + "type": "Person", + "format": "" + }, + { + "name": "personenkontexte", + "baseName": "personenkontexte", + "type": "Array", + "format": "" + }, + { + "name": "gruppen", + "baseName": "gruppen", + "type": "Array", + "format": "" + }, + { + "name": "email", + "baseName": "email", + "type": "PersonEmailResponse", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonInfoResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonLockResponse.ts b/loadtest/api-client/generated/models/PersonLockResponse.ts new file mode 100644 index 0000000..feaa1bd --- /dev/null +++ b/loadtest/api-client/generated/models/PersonLockResponse.ts @@ -0,0 +1,36 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonLockResponse { + 'message': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "message", + "baseName": "message", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonLockResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts b/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts new file mode 100644 index 0000000..4aea17e --- /dev/null +++ b/loadtest/api-client/generated/models/PersonMetadataBodyParams.ts @@ -0,0 +1,67 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonMetadataBodyParams { + 'familienname': string; + 'vorname': string; + 'personalnummer'?: string; + /** + * Date of the most recent changed Personalnummer + */ + 'lastModified': Date; + 'revision': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "familienname", + "baseName": "familienname", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "personalnummer", + "baseName": "personalnummer", + "type": "string", + "format": "" + }, + { + "name": "lastModified", + "baseName": "lastModified", + "type": "Date", + "format": "date-time" + }, + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonMetadataBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonNameParams.ts b/loadtest/api-client/generated/models/PersonNameParams.ts new file mode 100644 index 0000000..3d33126 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonNameParams.ts @@ -0,0 +1,99 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonNameParams { + 'familienname': string; + 'vorname': string; + 'initialenfamilienname'?: string; + 'initialenvorname'?: string; + 'rufname'?: string; + 'titel'?: string; + 'anrede'?: Array; + 'namenssuffix'?: Array; + 'namenspraefix'?: Array; + 'sortierindex'?: string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "familienname", + "baseName": "familienname", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "initialenfamilienname", + "baseName": "initialenfamilienname", + "type": "string", + "format": "" + }, + { + "name": "initialenvorname", + "baseName": "initialenvorname", + "type": "string", + "format": "" + }, + { + "name": "rufname", + "baseName": "rufname", + "type": "string", + "format": "" + }, + { + "name": "titel", + "baseName": "titel", + "type": "string", + "format": "" + }, + { + "name": "anrede", + "baseName": "anrede", + "type": "Array", + "format": "" + }, + { + "name": "namenssuffix", + "baseName": "namenssuffix", + "type": "Array", + "format": "" + }, + { + "name": "namenspraefix", + "baseName": "namenspraefix", + "type": "Array", + "format": "" + }, + { + "name": "sortierindex", + "baseName": "sortierindex", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonNameParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonNameResponse.ts b/loadtest/api-client/generated/models/PersonNameResponse.ts new file mode 100644 index 0000000..41a2413 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonNameResponse.ts @@ -0,0 +1,99 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonNameResponse { + 'familiennamen': string; + 'vorname': string; + 'initialenfamilienname': string | null; + 'initialenvorname': string | null; + 'rufname': string | null; + 'titel': string | null; + 'anrede': Array | null; + 'namenspraefix': Array | null; + 'namenssuffix': Array | null; + 'sortierindex': string | null; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "familiennamen", + "baseName": "familiennamen", + "type": "string", + "format": "" + }, + { + "name": "vorname", + "baseName": "vorname", + "type": "string", + "format": "" + }, + { + "name": "initialenfamilienname", + "baseName": "initialenfamilienname", + "type": "string", + "format": "" + }, + { + "name": "initialenvorname", + "baseName": "initialenvorname", + "type": "string", + "format": "" + }, + { + "name": "rufname", + "baseName": "rufname", + "type": "string", + "format": "" + }, + { + "name": "titel", + "baseName": "titel", + "type": "string", + "format": "" + }, + { + "name": "anrede", + "baseName": "anrede", + "type": "Array", + "format": "" + }, + { + "name": "namenspraefix", + "baseName": "namenspraefix", + "type": "Array", + "format": "" + }, + { + "name": "namenssuffix", + "baseName": "namenssuffix", + "type": "Array", + "format": "" + }, + { + "name": "sortierindex", + "baseName": "sortierindex", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonNameResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonResponse.ts b/loadtest/api-client/generated/models/PersonResponse.ts new file mode 100644 index 0000000..fbe0f57 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonResponse.ts @@ -0,0 +1,157 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { UserLockParams } from '../models/UserLockParams.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonResponse { + 'id': string; + 'referrer': string | null; + 'mandant': string; + 'name': PersonNameParams; + 'geburt': PersonBirthParams | null; + 'stammorganisation': string | null; + 'geschlecht': string | null; + 'lokalisierung': string | null; + 'vertrauensstufe': Vertrauensstufe; + 'revision': string; + /** + * Initiales Benutzerpasswort, muss nach der ersten Anmeldung geändert werden + */ + 'startpasswort': string; + 'personalnummer': string | null; + 'isLocked': boolean | null; + 'userLock': Array | null; + /** + * Date of the most recent changes for the person + */ + 'lastModified': Date; + /** + * Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status) + */ + 'email': PersonEmailResponse | null; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "referrer", + "baseName": "referrer", + "type": "string", + "format": "" + }, + { + "name": "mandant", + "baseName": "mandant", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "PersonNameParams", + "format": "" + }, + { + "name": "geburt", + "baseName": "geburt", + "type": "PersonBirthParams", + "format": "" + }, + { + "name": "stammorganisation", + "baseName": "stammorganisation", + "type": "string", + "format": "" + }, + { + "name": "geschlecht", + "baseName": "geschlecht", + "type": "string", + "format": "" + }, + { + "name": "lokalisierung", + "baseName": "lokalisierung", + "type": "string", + "format": "" + }, + { + "name": "vertrauensstufe", + "baseName": "vertrauensstufe", + "type": "Vertrauensstufe", + "format": "" + }, + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + }, + { + "name": "startpasswort", + "baseName": "startpasswort", + "type": "string", + "format": "" + }, + { + "name": "personalnummer", + "baseName": "personalnummer", + "type": "string", + "format": "" + }, + { + "name": "isLocked", + "baseName": "isLocked", + "type": "boolean", + "format": "" + }, + { + "name": "userLock", + "baseName": "userLock", + "type": "Array", + "format": "" + }, + { + "name": "lastModified", + "baseName": "lastModified", + "type": "Date", + "format": "date-time" + }, + { + "name": "email", + "baseName": "email", + "type": "PersonEmailResponse", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/PersonResponseAutomapper.ts b/loadtest/api-client/generated/models/PersonResponseAutomapper.ts new file mode 100644 index 0000000..8d51627 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonResponseAutomapper.ts @@ -0,0 +1,121 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonResponseAutomapper { + 'id': string; + 'referrer': string; + 'mandant': string; + 'name': PersonNameParams; + 'geburt': PersonBirthParams; + 'stammorganisation': string; + 'geschlecht': string; + 'lokalisierung': string; + 'vertrauensstufe': Vertrauensstufe; + 'revision': string; + /** + * Initiales Benutzerpasswort, muss nach der ersten Anmeldung geändert werden + */ + 'startpasswort': string; + 'personalnummer': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "referrer", + "baseName": "referrer", + "type": "string", + "format": "" + }, + { + "name": "mandant", + "baseName": "mandant", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "PersonNameParams", + "format": "" + }, + { + "name": "geburt", + "baseName": "geburt", + "type": "PersonBirthParams", + "format": "" + }, + { + "name": "stammorganisation", + "baseName": "stammorganisation", + "type": "string", + "format": "" + }, + { + "name": "geschlecht", + "baseName": "geschlecht", + "type": "string", + "format": "" + }, + { + "name": "lokalisierung", + "baseName": "lokalisierung", + "type": "string", + "format": "" + }, + { + "name": "vertrauensstufe", + "baseName": "vertrauensstufe", + "type": "Vertrauensstufe", + "format": "" + }, + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + }, + { + "name": "startpasswort", + "baseName": "startpasswort", + "type": "string", + "format": "" + }, + { + "name": "personalnummer", + "baseName": "personalnummer", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonResponseAutomapper.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/PersonendatensatzResponse.ts b/loadtest/api-client/generated/models/PersonendatensatzResponse.ts new file mode 100644 index 0000000..372bcf2 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonendatensatzResponse.ts @@ -0,0 +1,37 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonResponse } from '../models/PersonResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonendatensatzResponse { + 'person': PersonResponse; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "person", + "baseName": "person", + "type": "PersonResponse", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonendatensatzResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts b/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts new file mode 100644 index 0000000..a41ca39 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonendatensatzResponseAutomapper.ts @@ -0,0 +1,45 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonendatensatzResponseAutomapper { + 'person': PersonResponseAutomapper; + 'personenkontexte': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "person", + "baseName": "person", + "type": "PersonResponseAutomapper", + "format": "" + }, + { + "name": "personenkontexte", + "baseName": "personenkontexte", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonendatensatzResponseAutomapper.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts b/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts new file mode 100644 index 0000000..99d2ef9 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenkontextMigrationRuntype.ts @@ -0,0 +1,18 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum PersonenkontextMigrationRuntype { + Itslearning = 'ITSLEARNING', + Standard = 'STANDARD' +} diff --git a/loadtest/api-client/generated/models/PersonenkontextResponse.ts b/loadtest/api-client/generated/models/PersonenkontextResponse.ts new file mode 100644 index 0000000..1a8d9eb --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenkontextResponse.ts @@ -0,0 +1,128 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { LoeschungResponse } from '../models/LoeschungResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonenkontextResponse { + 'id': string; + 'referrer': string | null; + 'mandant': string; + 'organisation': any; + 'rollenart': string | null; + 'rollenname': string | null; + 'personenstatus': PersonenkontextResponsePersonenstatusEnum | null; + 'jahrgangsstufe': PersonenkontextResponseJahrgangsstufeEnum | null; + 'sichtfreigabe': PersonenkontextResponseSichtfreigabeEnum | null; + 'loeschung': LoeschungResponse | null; + 'revision': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "referrer", + "baseName": "referrer", + "type": "string", + "format": "" + }, + { + "name": "mandant", + "baseName": "mandant", + "type": "string", + "format": "" + }, + { + "name": "organisation", + "baseName": "organisation", + "type": "any", + "format": "" + }, + { + "name": "rollenart", + "baseName": "rollenart", + "type": "string", + "format": "" + }, + { + "name": "rollenname", + "baseName": "rollenname", + "type": "string", + "format": "" + }, + { + "name": "personenstatus", + "baseName": "personenstatus", + "type": "PersonenkontextResponsePersonenstatusEnum", + "format": "" + }, + { + "name": "jahrgangsstufe", + "baseName": "jahrgangsstufe", + "type": "PersonenkontextResponseJahrgangsstufeEnum", + "format": "" + }, + { + "name": "sichtfreigabe", + "baseName": "sichtfreigabe", + "type": "PersonenkontextResponseSichtfreigabeEnum", + "format": "" + }, + { + "name": "loeschung", + "baseName": "loeschung", + "type": "LoeschungResponse", + "format": "" + }, + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonenkontextResponse.attributeTypeMap; + } + + public constructor() { + } +} + +export enum PersonenkontextResponsePersonenstatusEnum { + Aktiv = 'AKTIV' +} +export enum PersonenkontextResponseJahrgangsstufeEnum { + _01 = '01', + _02 = '02', + _03 = '03', + _04 = '04', + _05 = '05', + _06 = '06', + _07 = '07', + _08 = '08', + _09 = '09', + _10 = '10' +} +export enum PersonenkontextResponseSichtfreigabeEnum { + Ja = 'ja', + Nein = 'nein' +} + diff --git a/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts b/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts new file mode 100644 index 0000000..fbf7b79 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenkontextRolleFieldsResponse.ts @@ -0,0 +1,44 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonenkontextRolleFieldsResponse { + 'organisationsId': string; + 'rolle': RollenSystemRechtServiceProviderIDResponse; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "organisationsId", + "baseName": "organisationsId", + "type": "string", + "format": "" + }, + { + "name": "rolle", + "baseName": "rolle", + "type": "RollenSystemRechtServiceProviderIDResponse", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonenkontextRolleFieldsResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts b/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts new file mode 100644 index 0000000..df75056 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenkontextWorkflowResponse.ts @@ -0,0 +1,81 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { RolleResponse } from '../models/RolleResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonenkontextWorkflowResponse { + /** + * List of available organisations. + */ + 'organisations': Array; + /** + * List of available roles. + */ + 'rollen': Array; + /** + * Selected organisation. + */ + 'selectedOrganisation': string | null; + /** + * Selected rolle. + */ + 'selectedRolle': string | null; + /** + * Indicates whether the commit action can be performed. + */ + 'canCommit': boolean; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "organisations", + "baseName": "organisations", + "type": "Array", + "format": "" + }, + { + "name": "rollen", + "baseName": "rollen", + "type": "Array", + "format": "" + }, + { + "name": "selectedOrganisation", + "baseName": "selectedOrganisation", + "type": "string", + "format": "" + }, + { + "name": "selectedRolle", + "baseName": "selectedRolle", + "type": "string", + "format": "" + }, + { + "name": "canCommit", + "baseName": "canCommit", + "type": "boolean", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonenkontextWorkflowResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts b/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts new file mode 100644 index 0000000..b9a66b7 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenkontextdatensatzResponse.ts @@ -0,0 +1,45 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonIdResponse } from '../models/PersonIdResponse.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonenkontextdatensatzResponse { + 'person': PersonIdResponse; + 'personenkontexte': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "person", + "baseName": "person", + "type": "PersonIdResponse", + "format": "" + }, + { + "name": "personenkontexte", + "baseName": "personenkontexte", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonenkontextdatensatzResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts b/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts new file mode 100644 index 0000000..99c05a1 --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenkontexteUpdateResponse.ts @@ -0,0 +1,37 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class PersonenkontexteUpdateResponse { + 'dBiamPersonenkontextResponses': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "dBiamPersonenkontextResponses", + "baseName": "dBiamPersonenkontextResponses", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonenkontexteUpdateResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/Personenstatus.ts b/loadtest/api-client/generated/models/Personenstatus.ts new file mode 100644 index 0000000..e72330e --- /dev/null +++ b/loadtest/api-client/generated/models/Personenstatus.ts @@ -0,0 +1,17 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum Personenstatus { + Aktiv = 'AKTIV' +} diff --git a/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts b/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts new file mode 100644 index 0000000..41e36db --- /dev/null +++ b/loadtest/api-client/generated/models/PersonenuebersichtBodyParams.ts @@ -0,0 +1,39 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class PersonenuebersichtBodyParams { + /** + * An array of IDs for the persons. + */ + 'personIds': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personIds", + "baseName": "personIds", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return PersonenuebersichtBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/RawPagedResponse.ts b/loadtest/api-client/generated/models/RawPagedResponse.ts new file mode 100644 index 0000000..507a79c --- /dev/null +++ b/loadtest/api-client/generated/models/RawPagedResponse.ts @@ -0,0 +1,57 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class RawPagedResponse { + 'total': number; + 'offset': number; + 'limit': number; + 'items': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "total", + "baseName": "total", + "type": "number", + "format": "" + }, + { + "name": "offset", + "baseName": "offset", + "type": "number", + "format": "" + }, + { + "name": "limit", + "baseName": "limit", + "type": "number", + "format": "" + }, + { + "name": "items", + "baseName": "items", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RawPagedResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/RolleResponse.ts b/loadtest/api-client/generated/models/RolleResponse.ts new file mode 100644 index 0000000..5dcda6b --- /dev/null +++ b/loadtest/api-client/generated/models/RolleResponse.ts @@ -0,0 +1,111 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { HttpFile } from '../http/http.ts'; + +export class RolleResponse { + 'id': string; + 'createdAt': Date; + 'updatedAt': Date; + 'name': string; + 'administeredBySchulstrukturknoten': string; + 'rollenart': RollenArt; + 'merkmale': Set; + 'systemrechte': Set; + 'administeredBySchulstrukturknotenName': string | null; + 'administeredBySchulstrukturknotenKennung': string | null; + 'version': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "createdAt", + "baseName": "createdAt", + "type": "Date", + "format": "date-time" + }, + { + "name": "updatedAt", + "baseName": "updatedAt", + "type": "Date", + "format": "date-time" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "administeredBySchulstrukturknoten", + "baseName": "administeredBySchulstrukturknoten", + "type": "string", + "format": "" + }, + { + "name": "rollenart", + "baseName": "rollenart", + "type": "RollenArt", + "format": "" + }, + { + "name": "merkmale", + "baseName": "merkmale", + "type": "Set", + "format": "" + }, + { + "name": "systemrechte", + "baseName": "systemrechte", + "type": "Set", + "format": "" + }, + { + "name": "administeredBySchulstrukturknotenName", + "baseName": "administeredBySchulstrukturknotenName", + "type": "string", + "format": "" + }, + { + "name": "administeredBySchulstrukturknotenKennung", + "baseName": "administeredBySchulstrukturknotenKennung", + "type": "string", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RolleResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts b/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts new file mode 100644 index 0000000..2ca1b10 --- /dev/null +++ b/loadtest/api-client/generated/models/RolleServiceProviderBodyParams.ts @@ -0,0 +1,49 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class RolleServiceProviderBodyParams { + /** + * An array of ids for the service providers. + */ + 'serviceProviderIds': Array; + /** + * The version for the rolle. + */ + 'version': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "serviceProviderIds", + "baseName": "serviceProviderIds", + "type": "Array", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RolleServiceProviderBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts b/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts new file mode 100644 index 0000000..9644206 --- /dev/null +++ b/loadtest/api-client/generated/models/RolleServiceProviderQueryParams.ts @@ -0,0 +1,39 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http'; + +export class RolleServiceProviderQueryParams { + /** + * An array of ids for the service providers. + */ + 'serviceProviderIds': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "serviceProviderIds", + "baseName": "serviceProviderIds", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RolleServiceProviderQueryParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts b/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts new file mode 100644 index 0000000..d0cf053 --- /dev/null +++ b/loadtest/api-client/generated/models/RolleServiceProviderResponse.ts @@ -0,0 +1,36 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class RolleServiceProviderResponse { + 'serviceProviderIds': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "serviceProviderIds", + "baseName": "serviceProviderIds", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RolleServiceProviderResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts b/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts new file mode 100644 index 0000000..e69a09b --- /dev/null +++ b/loadtest/api-client/generated/models/RolleWithServiceProvidersResponse.ts @@ -0,0 +1,119 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class RolleWithServiceProvidersResponse { + 'id': string; + 'createdAt': Date; + 'updatedAt': Date; + 'name': string; + 'administeredBySchulstrukturknoten': string; + 'rollenart': RollenArt; + 'merkmale': Set; + 'systemrechte': Set; + 'administeredBySchulstrukturknotenName': string | null; + 'administeredBySchulstrukturknotenKennung': string | null; + 'version': number; + 'serviceProviders': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "createdAt", + "baseName": "createdAt", + "type": "Date", + "format": "date-time" + }, + { + "name": "updatedAt", + "baseName": "updatedAt", + "type": "Date", + "format": "date-time" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "administeredBySchulstrukturknoten", + "baseName": "administeredBySchulstrukturknoten", + "type": "string", + "format": "" + }, + { + "name": "rollenart", + "baseName": "rollenart", + "type": "RollenArt", + "format": "" + }, + { + "name": "merkmale", + "baseName": "merkmale", + "type": "Set", + "format": "" + }, + { + "name": "systemrechte", + "baseName": "systemrechte", + "type": "Set", + "format": "" + }, + { + "name": "administeredBySchulstrukturknotenName", + "baseName": "administeredBySchulstrukturknotenName", + "type": "string", + "format": "" + }, + { + "name": "administeredBySchulstrukturknotenKennung", + "baseName": "administeredBySchulstrukturknotenKennung", + "type": "string", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "number", + "format": "" + }, + { + "name": "serviceProviders", + "baseName": "serviceProviders", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RolleWithServiceProvidersResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/RollenArt.ts b/loadtest/api-client/generated/models/RollenArt.ts new file mode 100644 index 0000000..3f0c4fe --- /dev/null +++ b/loadtest/api-client/generated/models/RollenArt.ts @@ -0,0 +1,22 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum RollenArt { + Lern = 'LERN', + Lehr = 'LEHR', + Extern = 'EXTERN', + Orgadmin = 'ORGADMIN', + Leit = 'LEIT', + Sysadmin = 'SYSADMIN' +} diff --git a/loadtest/api-client/generated/models/RollenMerkmal.ts b/loadtest/api-client/generated/models/RollenMerkmal.ts new file mode 100644 index 0000000..3ef8425 --- /dev/null +++ b/loadtest/api-client/generated/models/RollenMerkmal.ts @@ -0,0 +1,18 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum RollenMerkmal { + BefristungPflicht = 'BEFRISTUNG_PFLICHT', + KopersPflicht = 'KOPERS_PFLICHT' +} diff --git a/loadtest/api-client/generated/models/RollenSystemRecht.ts b/loadtest/api-client/generated/models/RollenSystemRecht.ts new file mode 100644 index 0000000..bf77883 --- /dev/null +++ b/loadtest/api-client/generated/models/RollenSystemRecht.ts @@ -0,0 +1,27 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum RollenSystemRecht { + RollenVerwalten = 'ROLLEN_VERWALTEN', + PersonenSofortLoeschen = 'PERSONEN_SOFORT_LOESCHEN', + PersonenVerwalten = 'PERSONEN_VERWALTEN', + SchulenVerwalten = 'SCHULEN_VERWALTEN', + KlassenVerwalten = 'KLASSEN_VERWALTEN', + SchultraegerVerwalten = 'SCHULTRAEGER_VERWALTEN', + MigrationDurchfuehren = 'MIGRATION_DURCHFUEHREN', + PersonSynchronisieren = 'PERSON_SYNCHRONISIEREN', + CronDurchfuehren = 'CRON_DURCHFUEHREN', + PersonenAnlegen = 'PERSONEN_ANLEGEN', + ImportDurchfuehren = 'IMPORT_DURCHFUEHREN' +} diff --git a/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts b/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts new file mode 100644 index 0000000..1a7691f --- /dev/null +++ b/loadtest/api-client/generated/models/RollenSystemRechtServiceProviderIDResponse.ts @@ -0,0 +1,43 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class RollenSystemRechtServiceProviderIDResponse { + 'systemrechte': Array; + 'serviceProviderIds': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "systemrechte", + "baseName": "systemrechte", + "type": "Array", + "format": "" + }, + { + "name": "serviceProviderIds", + "baseName": "serviceProviderIds", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return RollenSystemRechtServiceProviderIDResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts b/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts new file mode 100644 index 0000000..22d551d --- /dev/null +++ b/loadtest/api-client/generated/models/ServiceProviderIdNameResponse.ts @@ -0,0 +1,43 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class ServiceProviderIdNameResponse { + 'id': string; + 'name': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ServiceProviderIdNameResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/ServiceProviderKategorie.ts b/loadtest/api-client/generated/models/ServiceProviderKategorie.ts new file mode 100644 index 0000000..e8ba017 --- /dev/null +++ b/loadtest/api-client/generated/models/ServiceProviderKategorie.ts @@ -0,0 +1,21 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum ServiceProviderKategorie { + Email = 'EMAIL', + Unterricht = 'UNTERRICHT', + Verwaltung = 'VERWALTUNG', + Hinweise = 'HINWEISE', + Angebote = 'ANGEBOTE' +} diff --git a/loadtest/api-client/generated/models/ServiceProviderResponse.ts b/loadtest/api-client/generated/models/ServiceProviderResponse.ts new file mode 100644 index 0000000..1886b78 --- /dev/null +++ b/loadtest/api-client/generated/models/ServiceProviderResponse.ts @@ -0,0 +1,85 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; +import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; +import { HttpFile } from '../http/http.ts'; + +export class ServiceProviderResponse { + 'id': string; + 'name': string; + 'target': ServiceProviderTarget; + /** + * Can be undefined, if `target` is not equal to `URL` + */ + 'url': string; + 'kategorie': ServiceProviderKategorie; + 'hasLogo': boolean; + 'requires2fa': boolean; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "id", + "baseName": "id", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "target", + "baseName": "target", + "type": "ServiceProviderTarget", + "format": "" + }, + { + "name": "url", + "baseName": "url", + "type": "string", + "format": "" + }, + { + "name": "kategorie", + "baseName": "kategorie", + "type": "ServiceProviderKategorie", + "format": "" + }, + { + "name": "hasLogo", + "baseName": "hasLogo", + "type": "boolean", + "format": "" + }, + { + "name": "requires2fa", + "baseName": "requires2fa", + "type": "boolean", + "format": "" + } ]; + + static getAttributeTypeMap() { + return ServiceProviderResponse.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/ServiceProviderTarget.ts b/loadtest/api-client/generated/models/ServiceProviderTarget.ts new file mode 100644 index 0000000..ffb8911 --- /dev/null +++ b/loadtest/api-client/generated/models/ServiceProviderTarget.ts @@ -0,0 +1,19 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum ServiceProviderTarget { + Url = 'URL', + Email = 'EMAIL', + SchulportalAdministration = 'SCHULPORTAL_ADMINISTRATION' +} diff --git a/loadtest/api-client/generated/models/Sichtfreigabe.ts b/loadtest/api-client/generated/models/Sichtfreigabe.ts new file mode 100644 index 0000000..54f3ca3 --- /dev/null +++ b/loadtest/api-client/generated/models/Sichtfreigabe.ts @@ -0,0 +1,18 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum Sichtfreigabe { + Ja = 'ja', + Nein = 'nein' +} diff --git a/loadtest/api-client/generated/models/SystemrechtResponse.ts b/loadtest/api-client/generated/models/SystemrechtResponse.ts new file mode 100644 index 0000000..655bef0 --- /dev/null +++ b/loadtest/api-client/generated/models/SystemrechtResponse.ts @@ -0,0 +1,65 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { HttpFile } from '../http/http.ts'; + +export class SystemrechtResponse { + 'ROLLEN_VERWALTEN': Array; + 'KLASSEN_VERWALTEN': Array; + 'SCHULEN_VERWALTEN': Array; + 'PERSONEN_VERWALTEN': Array; + 'SCHULTRAEGER_VERWALTEN': Array; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "ROLLEN_VERWALTEN", + "baseName": "ROLLEN_VERWALTEN", + "type": "Array", + "format": "" + }, + { + "name": "KLASSEN_VERWALTEN", + "baseName": "KLASSEN_VERWALTEN", + "type": "Array", + "format": "" + }, + { + "name": "SCHULEN_VERWALTEN", + "baseName": "SCHULEN_VERWALTEN", + "type": "Array", + "format": "" + }, + { + "name": "PERSONEN_VERWALTEN", + "baseName": "PERSONEN_VERWALTEN", + "type": "Array", + "format": "" + }, + { + "name": "SCHULTRAEGER_VERWALTEN", + "baseName": "SCHULTRAEGER_VERWALTEN", + "type": "Array", + "format": "" + } ]; + + static getAttributeTypeMap() { + return SystemrechtResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/TokenInitBodyParams.ts b/loadtest/api-client/generated/models/TokenInitBodyParams.ts new file mode 100644 index 0000000..6e7d05a --- /dev/null +++ b/loadtest/api-client/generated/models/TokenInitBodyParams.ts @@ -0,0 +1,36 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class TokenInitBodyParams { + 'personId': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return TokenInitBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/TokenRequiredResponse.ts b/loadtest/api-client/generated/models/TokenRequiredResponse.ts new file mode 100644 index 0000000..9c5326c --- /dev/null +++ b/loadtest/api-client/generated/models/TokenRequiredResponse.ts @@ -0,0 +1,36 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class TokenRequiredResponse { + 'required': boolean; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "required", + "baseName": "required", + "type": "boolean", + "format": "" + } ]; + + static getAttributeTypeMap() { + return TokenRequiredResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/TokenStateResponse.ts b/loadtest/api-client/generated/models/TokenStateResponse.ts new file mode 100644 index 0000000..5c8d000 --- /dev/null +++ b/loadtest/api-client/generated/models/TokenStateResponse.ts @@ -0,0 +1,50 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class TokenStateResponse { + 'hasToken': boolean; + 'tokenKind': string; + 'serial': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "hasToken", + "baseName": "hasToken", + "type": "boolean", + "format": "" + }, + { + "name": "tokenKind", + "baseName": "tokenKind", + "type": "string", + "format": "" + }, + { + "name": "serial", + "baseName": "serial", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return TokenStateResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts b/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts new file mode 100644 index 0000000..9b9c188 --- /dev/null +++ b/loadtest/api-client/generated/models/TokenVerifyBodyParams.ts @@ -0,0 +1,43 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class TokenVerifyBodyParams { + 'personId': string; + 'otp': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "otp", + "baseName": "otp", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return TokenVerifyBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/TraegerschaftTyp.ts b/loadtest/api-client/generated/models/TraegerschaftTyp.ts new file mode 100644 index 0000000..cbf6ed9 --- /dev/null +++ b/loadtest/api-client/generated/models/TraegerschaftTyp.ts @@ -0,0 +1,22 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum TraegerschaftTyp { + _01 = '01', + _02 = '02', + _03 = '03', + _04 = '04', + _05 = '05', + _06 = '06' +} diff --git a/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts b/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts new file mode 100644 index 0000000..153d33a --- /dev/null +++ b/loadtest/api-client/generated/models/UpdateOrganisationBodyParams.ts @@ -0,0 +1,99 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { HttpFile } from '../http/http.ts'; + +export class UpdateOrganisationBodyParams { + 'administriertVon'?: string; + 'zugehoerigZu'?: string; + /** + * Required, if `typ` is equal to `SCHULE` + */ + 'kennung'?: string; + 'name': string; + 'namensergaenzung'?: string; + 'kuerzel'?: string; + 'typ': OrganisationsTyp; + 'traegerschaft'?: TraegerschaftTyp; + 'emailAdress'?: string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "administriertVon", + "baseName": "administriertVon", + "type": "string", + "format": "" + }, + { + "name": "zugehoerigZu", + "baseName": "zugehoerigZu", + "type": "string", + "format": "" + }, + { + "name": "kennung", + "baseName": "kennung", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "namensergaenzung", + "baseName": "namensergaenzung", + "type": "string", + "format": "" + }, + { + "name": "kuerzel", + "baseName": "kuerzel", + "type": "string", + "format": "" + }, + { + "name": "typ", + "baseName": "typ", + "type": "OrganisationsTyp", + "format": "" + }, + { + "name": "traegerschaft", + "baseName": "traegerschaft", + "type": "TraegerschaftTyp", + "format": "" + }, + { + "name": "emailAdress", + "baseName": "emailAdress", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return UpdateOrganisationBodyParams.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts b/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts new file mode 100644 index 0000000..e4b7f9c --- /dev/null +++ b/loadtest/api-client/generated/models/UpdatePersonBodyParams.ts @@ -0,0 +1,98 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { Geschlecht } from '../models/Geschlecht.ts'; +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +import { HttpFile } from '../http/http.ts'; + +export class UpdatePersonBodyParams { + 'referrer'?: string; + 'stammorganisation'?: string; + 'name': PersonNameParams; + 'geburt'?: PersonBirthParams; + 'geschlecht'?: Geschlecht; + 'lokalisierung'?: string; + 'vertrauensstufe'?: Vertrauensstufe; + 'auskunftssperre'?: boolean; + 'revision': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "referrer", + "baseName": "referrer", + "type": "string", + "format": "" + }, + { + "name": "stammorganisation", + "baseName": "stammorganisation", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "PersonNameParams", + "format": "" + }, + { + "name": "geburt", + "baseName": "geburt", + "type": "PersonBirthParams", + "format": "" + }, + { + "name": "geschlecht", + "baseName": "geschlecht", + "type": "Geschlecht", + "format": "" + }, + { + "name": "lokalisierung", + "baseName": "lokalisierung", + "type": "string", + "format": "" + }, + { + "name": "vertrauensstufe", + "baseName": "vertrauensstufe", + "type": "Vertrauensstufe", + "format": "" + }, + { + "name": "auskunftssperre", + "baseName": "auskunftssperre", + "type": "boolean", + "format": "" + }, + { + "name": "revision", + "baseName": "revision", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return UpdatePersonBodyParams.attributeTypeMap; + } + + public constructor() { + } +} + + diff --git a/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts b/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts new file mode 100644 index 0000000..365e5ee --- /dev/null +++ b/loadtest/api-client/generated/models/UpdateRolleBodyParams.ts @@ -0,0 +1,66 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { HttpFile } from '../http/http.ts'; + +export class UpdateRolleBodyParams { + 'name': string; + 'merkmale': Set; + 'systemrechte': Set; + 'serviceProviderIds': Set; + 'version': number; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "merkmale", + "baseName": "merkmale", + "type": "Set", + "format": "" + }, + { + "name": "systemrechte", + "baseName": "systemrechte", + "type": "Set", + "format": "" + }, + { + "name": "serviceProviderIds", + "baseName": "serviceProviderIds", + "type": "Set", + "format": "" + }, + { + "name": "version", + "baseName": "version", + "type": "number", + "format": "" + } ]; + + static getAttributeTypeMap() { + return UpdateRolleBodyParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/UserLockParams.ts b/loadtest/api-client/generated/models/UserLockParams.ts new file mode 100644 index 0000000..3baf533 --- /dev/null +++ b/loadtest/api-client/generated/models/UserLockParams.ts @@ -0,0 +1,64 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export class UserLockParams { + 'personId': string | null; + 'lockedBy': string | null; + 'createdAt': string | null; + 'lockedUntil': string | null; + 'lockOccasion': string | null; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "lockedBy", + "baseName": "locked_by", + "type": "string", + "format": "" + }, + { + "name": "createdAt", + "baseName": "created_at", + "type": "string", + "format": "" + }, + { + "name": "lockedUntil", + "baseName": "locked_until", + "type": "string", + "format": "" + }, + { + "name": "lockOccasion", + "baseName": "lock_occasion", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return UserLockParams.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/UserinfoResponse.ts b/loadtest/api-client/generated/models/UserinfoResponse.ts new file mode 100644 index 0000000..50da4fb --- /dev/null +++ b/loadtest/api-client/generated/models/UserinfoResponse.ts @@ -0,0 +1,184 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; +import { HttpFile } from '../http/http.ts'; + +export class UserinfoResponse { + 'sub': string; + 'personId': string | null; + 'name': string | null; + 'givenName': string | null; + 'familyName': string | null; + 'middleName': string | null; + 'nickname': string | null; + 'preferredUsername': string | null; + 'profile': string | null; + 'picture': string | null; + 'website': string | null; + 'email': string | null; + 'emailVerified': boolean | null; + 'gender': string | null; + 'birthdate': string | null; + 'zoneinfo': string | null; + 'locale': string | null; + 'phoneNumber': string | null; + 'updatedAt': string | null; + 'passwordUpdatedAt': string | null; + 'personenkontexte': Array; + 'acr': string; + + static readonly discriminator: string | undefined = undefined; + + static readonly mapping: {[index: string]: string} | undefined = undefined; + + static readonly attributeTypeMap: Array<{name: string, baseName: string, type: string, format: string}> = [ + { + "name": "sub", + "baseName": "sub", + "type": "string", + "format": "" + }, + { + "name": "personId", + "baseName": "personId", + "type": "string", + "format": "" + }, + { + "name": "name", + "baseName": "name", + "type": "string", + "format": "" + }, + { + "name": "givenName", + "baseName": "given_name", + "type": "string", + "format": "" + }, + { + "name": "familyName", + "baseName": "family_name", + "type": "string", + "format": "" + }, + { + "name": "middleName", + "baseName": "middle_name", + "type": "string", + "format": "" + }, + { + "name": "nickname", + "baseName": "nickname", + "type": "string", + "format": "" + }, + { + "name": "preferredUsername", + "baseName": "preferred_username", + "type": "string", + "format": "" + }, + { + "name": "profile", + "baseName": "profile", + "type": "string", + "format": "" + }, + { + "name": "picture", + "baseName": "picture", + "type": "string", + "format": "" + }, + { + "name": "website", + "baseName": "website", + "type": "string", + "format": "" + }, + { + "name": "email", + "baseName": "email", + "type": "string", + "format": "" + }, + { + "name": "emailVerified", + "baseName": "email_verified", + "type": "boolean", + "format": "" + }, + { + "name": "gender", + "baseName": "gender", + "type": "string", + "format": "" + }, + { + "name": "birthdate", + "baseName": "birthdate", + "type": "string", + "format": "" + }, + { + "name": "zoneinfo", + "baseName": "zoneinfo", + "type": "string", + "format": "" + }, + { + "name": "locale", + "baseName": "locale", + "type": "string", + "format": "" + }, + { + "name": "phoneNumber", + "baseName": "phone_number", + "type": "string", + "format": "" + }, + { + "name": "updatedAt", + "baseName": "updated_at", + "type": "string", + "format": "" + }, + { + "name": "passwordUpdatedAt", + "baseName": "password_updated_at", + "type": "string", + "format": "" + }, + { + "name": "personenkontexte", + "baseName": "personenkontexte", + "type": "Array", + "format": "" + }, + { + "name": "acr", + "baseName": "acr", + "type": "string", + "format": "" + } ]; + + static getAttributeTypeMap() { + return UserinfoResponse.attributeTypeMap; + } + + public constructor() { + } +} diff --git a/loadtest/api-client/generated/models/Vertrauensstufe.ts b/loadtest/api-client/generated/models/Vertrauensstufe.ts new file mode 100644 index 0000000..6000809 --- /dev/null +++ b/loadtest/api-client/generated/models/Vertrauensstufe.ts @@ -0,0 +1,20 @@ +/** + * dBildungs IAM + * The dBildungs IAM server API description + * + * OpenAPI spec version: 1.0 + * + * + * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). + * https://openapi-generator.tech + * Do not edit the class manually. + */ + +import { HttpFile } from '../http/http.ts'; + +export enum Vertrauensstufe { + Kein = 'KEIN', + Unbe = 'UNBE', + Teil = 'TEIL', + Voll = 'VOLL' +} diff --git a/loadtest/api-client/generated/models/all.ts b/loadtest/api-client/generated/models/all.ts new file mode 100644 index 0000000..7274dca --- /dev/null +++ b/loadtest/api-client/generated/models/all.ts @@ -0,0 +1,90 @@ +export * from '../models/AddSystemrechtBodyParams.ts' +export * from '../models/AssignHardwareTokenBodyParams.ts' +export * from '../models/AssignHardwareTokenResponse.ts' +export * from '../models/CreateOrganisationBodyParams.ts' +export * from '../models/CreatePersonMigrationBodyParams.ts' +export * from '../models/CreateRolleBodyParams.ts' +export * from '../models/DBiamPersonResponse.ts' +export * from '../models/DBiamPersonenkontextResponse.ts' +export * from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts' +export * from '../models/DBiamPersonenuebersichtResponse.ts' +export * from '../models/DBiamPersonenzuordnungResponse.ts' +export * from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts' +export * from '../models/DbiamCreatePersonenkontextBodyParams.ts' +export * from '../models/DbiamImportError.ts' +export * from '../models/DbiamOrganisationError.ts' +export * from '../models/DbiamPersonError.ts' +export * from '../models/DbiamPersonenkontextBodyParams.ts' +export * from '../models/DbiamPersonenkontextError.ts' +export * from '../models/DbiamPersonenkontextMigrationBodyParams.ts' +export * from '../models/DbiamPersonenkontexteUpdateError.ts' +export * from '../models/DbiamRolleError.ts' +export * from '../models/DbiamUpdatePersonenkontexteBodyParams.ts' +export * from '../models/DeleteRevisionBodyParams.ts' +export * from '../models/EmailAddressStatus.ts' +export * from '../models/FindRollenResponse.ts' +export * from '../models/FindSchulstrukturknotenResponse.ts' +export * from '../models/Geschlecht.ts' +export * from '../models/ImportDataItemResponse.ts' +export * from '../models/ImportUploadResponse.ts' +export * from '../models/ImportvorgangByIdBodyParams.ts' +export * from '../models/LockUserBodyParams.ts' +export * from '../models/LoeschungResponse.ts' +export * from '../models/OrganisationByIdBodyParams.ts' +export * from '../models/OrganisationByNameBodyParams.ts' +export * from '../models/OrganisationResponse.ts' +export * from '../models/OrganisationResponseLegacy.ts' +export * from '../models/OrganisationRootChildrenResponse.ts' +export * from '../models/OrganisationsTyp.ts' +export * from '../models/ParentOrganisationenResponse.ts' +export * from '../models/ParentOrganisationsByIdsBodyParams.ts' +export * from '../models/Person.ts' +export * from '../models/PersonBirthParams.ts' +export * from '../models/PersonBirthResponse.ts' +export * from '../models/PersonControllerFindPersonenkontexte200Response.ts' +export * from '../models/PersonEmailResponse.ts' +export * from '../models/PersonFrontendControllerFindPersons200Response.ts' +export * from '../models/PersonIdResponse.ts' +export * from '../models/PersonInfoResponse.ts' +export * from '../models/PersonLockResponse.ts' +export * from '../models/PersonMetadataBodyParams.ts' +export * from '../models/PersonNameParams.ts' +export * from '../models/PersonNameResponse.ts' +export * from '../models/PersonResponse.ts' +export * from '../models/PersonResponseAutomapper.ts' +export * from '../models/PersonendatensatzResponse.ts' +export * from '../models/PersonendatensatzResponseAutomapper.ts' +export * from '../models/PersonenkontextMigrationRuntype.ts' +export * from '../models/PersonenkontextResponse.ts' +export * from '../models/PersonenkontextRolleFieldsResponse.ts' +export * from '../models/PersonenkontextWorkflowResponse.ts' +export * from '../models/PersonenkontextdatensatzResponse.ts' +export * from '../models/PersonenkontexteUpdateResponse.ts' +export * from '../models/Personenstatus.ts' +export * from '../models/PersonenuebersichtBodyParams.ts' +export * from '../models/RawPagedResponse.ts' +export * from '../models/RolleResponse.ts' +export * from '../models/RolleServiceProviderBodyParams.ts' +export * from '../models/RolleServiceProviderResponse.ts' +export * from '../models/RolleWithServiceProvidersResponse.ts' +export * from '../models/RollenArt.ts' +export * from '../models/RollenMerkmal.ts' +export * from '../models/RollenSystemRecht.ts' +export * from '../models/RollenSystemRechtServiceProviderIDResponse.ts' +export * from '../models/ServiceProviderIdNameResponse.ts' +export * from '../models/ServiceProviderKategorie.ts' +export * from '../models/ServiceProviderResponse.ts' +export * from '../models/ServiceProviderTarget.ts' +export * from '../models/Sichtfreigabe.ts' +export * from '../models/SystemrechtResponse.ts' +export * from '../models/TokenInitBodyParams.ts' +export * from '../models/TokenRequiredResponse.ts' +export * from '../models/TokenStateResponse.ts' +export * from '../models/TokenVerifyBodyParams.ts' +export * from '../models/TraegerschaftTyp.ts' +export * from '../models/UpdateOrganisationBodyParams.ts' +export * from '../models/UpdatePersonBodyParams.ts' +export * from '../models/UpdateRolleBodyParams.ts' +export * from '../models/UserLockParams.ts' +export * from '../models/UserinfoResponse.ts' +export * from '../models/Vertrauensstufe.ts' diff --git a/loadtest/api-client/generated/package.json b/loadtest/api-client/generated/package.json new file mode 100644 index 0000000..ea85331 --- /dev/null +++ b/loadtest/api-client/generated/package.json @@ -0,0 +1,42 @@ +{ + "name": "", + "version": "", + "description": "OpenAPI client for ", + "author": "OpenAPI-Generator Contributors", + "repository": { + "type": "git", + "url": "https://github.com/GIT_USER_ID/GIT_REPO_ID.git" + }, + "keywords": [ + "fetch", + "typescript", + "openapi-client", + "openapi-generator" + ], + "license": "Unlicense", + "main": "./dist/index.js", + "type": "commonjs", + "exports": { + ".": { + "require": "./dist/index.js", + "types": "./dist/index.d.js" + } + }, + "files": [ + "dist" + ], + "typings": "./dist/index.d.ts", + "scripts": { + "build": "tsc", + "prepare": "npm run build" + }, + "dependencies": { + "whatwg-fetch": "^3.0.0", + "es6-promise": "^4.2.4", + "url-parse": "^1.4.3" + }, + "devDependencies": { + "typescript": "^4.0", + "@types/url-parse": "1.4.4" + } +} diff --git a/loadtest/api-client/generated/rxjsStub.ts b/loadtest/api-client/generated/rxjsStub.ts new file mode 100644 index 0000000..4c73715 --- /dev/null +++ b/loadtest/api-client/generated/rxjsStub.ts @@ -0,0 +1,27 @@ +export class Observable { + constructor(private promise: Promise) {} + + toPromise() { + return this.promise; + } + + pipe(callback: (value: T) => S | Promise): Observable { + return new Observable(this.promise.then(callback)); + } +} + +export function from(promise: Promise) { + return new Observable(promise); +} + +export function of(value: T) { + return new Observable(Promise.resolve(value)); +} + +export function mergeMap(callback: (value: T) => Observable) { + return (value: T) => callback(value).toPromise(); +} + +export function map(callback: any) { + return callback; +} diff --git a/loadtest/api-client/generated/servers.ts b/loadtest/api-client/generated/servers.ts new file mode 100644 index 0000000..f47dbd7 --- /dev/null +++ b/loadtest/api-client/generated/servers.ts @@ -0,0 +1,55 @@ +import { RequestContext, HttpMethod } from "./http/http.ts"; + +export interface BaseServerConfiguration { + makeRequestContext(endpoint: string, httpMethod: HttpMethod): RequestContext; +} + +/** + * + * Represents the configuration of a server including its + * url template and variable configuration based on the url. + * + */ +export class ServerConfiguration implements BaseServerConfiguration { + public constructor(private url: string, private variableConfiguration: T) {} + + /** + * Sets the value of the variables of this server. Variables are included in + * the `url` of this ServerConfiguration in the form `{variableName}` + * + * @param variableConfiguration a partial variable configuration for the + * variables contained in the url + */ + public setVariables(variableConfiguration: Partial) { + Object.assign(this.variableConfiguration, variableConfiguration); + } + + public getConfiguration(): T { + return this.variableConfiguration + } + + private getUrl() { + let replacedUrl = this.url; + for (const key in this.variableConfiguration) { + var re = new RegExp("{" + key + "}","g"); + replacedUrl = replacedUrl.replace(re, this.variableConfiguration[key]); + } + return replacedUrl + } + + /** + * Creates a new request context for this server using the url with variables + * replaced with their respective values and the endpoint of the request appended. + * + * @param endpoint the endpoint to be queried on the server + * @param httpMethod httpMethod to be used + * + */ + public makeRequestContext(endpoint: string, httpMethod: HttpMethod): RequestContext { + return new RequestContext(this.getUrl() + endpoint, httpMethod); + } +} + +export const server1 = new ServerConfiguration<{ }>("", { }) + +export const servers = [server1]; diff --git a/loadtest/api-client/generated/tsconfig.json b/loadtest/api-client/generated/tsconfig.json new file mode 100644 index 0000000..aa173eb --- /dev/null +++ b/loadtest/api-client/generated/tsconfig.json @@ -0,0 +1,28 @@ +{ + "compilerOptions": { + "strict": true, + /* Basic Options */ + "target": "es5", + "moduleResolution": "node", + "declaration": true, + + /* Additional Checks */ + "noUnusedLocals": false, /* Report errors on unused locals. */ // TODO: reenable (unused imports!) + "noUnusedParameters": false, /* Report errors on unused parameters. */ // TODO: set to true again + "noImplicitReturns": true, /* Report error when not all code paths in function return a value. */ + "noFallthroughCasesInSwitch": true, /* Report errors for fallthrough cases in switch statement. */ + + "removeComments": true, + "sourceMap": true, + "outDir": "./dist", + "noLib": false, + "lib": [ "es6", "dom" ], + }, + "exclude": [ + "dist", + "node_modules" + ], + "filesGlob": [ + "./**/*.ts", + ] +} diff --git a/loadtest/api-client/generated/types/ObjectParamAPI.ts b/loadtest/api-client/generated/types/ObjectParamAPI.ts new file mode 100644 index 0000000..6cd77a5 --- /dev/null +++ b/loadtest/api-client/generated/types/ObjectParamAPI.ts @@ -0,0 +1,2437 @@ +import { ResponseContext, RequestContext, HttpFile, HttpInfo } from '../http/http.ts'; +import { Configuration} from '../configuration.ts' + +import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; +import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; +import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; +import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; +import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; +import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; +import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; +import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; +import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; +import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; +import { DbiamImportError } from '../models/DbiamImportError.ts'; +import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; +import { DbiamPersonError } from '../models/DbiamPersonError.ts'; +import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; +import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; +import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; +import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; +import { DbiamRolleError } from '../models/DbiamRolleError.ts'; +import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; +import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; +import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; +import { FindRollenResponse } from '../models/FindRollenResponse.ts'; +import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; +import { Geschlecht } from '../models/Geschlecht.ts'; +import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; +import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; +import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; +import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; +import { LoeschungResponse } from '../models/LoeschungResponse.ts'; +import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; +import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; +import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; +import { Person } from '../models/Person.ts'; +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; +import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; +import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; +import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; +import { PersonIdResponse } from '../models/PersonIdResponse.ts'; +import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; +import { PersonLockResponse } from '../models/PersonLockResponse.ts'; +import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { PersonNameResponse } from '../models/PersonNameResponse.ts'; +import { PersonResponse } from '../models/PersonResponse.ts'; +import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; +import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; +import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; +import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; +import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; +import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; +import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; +import { Personenstatus } from '../models/Personenstatus.ts'; +import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; +import { RawPagedResponse } from '../models/RawPagedResponse.ts'; +import { RolleResponse } from '../models/RolleResponse.ts'; +import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; +import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; +import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; +import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; +import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; +import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; +import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; +import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; +import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; +import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; +import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; +import { TokenStateResponse } from '../models/TokenStateResponse.ts'; +import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; +import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; +import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; +import { UserLockParams } from '../models/UserLockParams.ts'; +import { UserinfoResponse } from '../models/UserinfoResponse.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; + +import { ObservableAuthApi } from "./ObservableAPI.ts"; +import { AuthApiRequestFactory, AuthApiResponseProcessor} from "../apis/AuthApi.ts"; + +export interface AuthApiAuthenticationControllerInfoRequest { +} + +export interface AuthApiAuthenticationControllerLoginRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof AuthApiauthenticationControllerLogin + */ + redirectUrl?: string +} + +export interface AuthApiAuthenticationControllerLogoutRequest { +} + +export interface AuthApiAuthenticationControllerResetPasswordRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof AuthApiauthenticationControllerResetPassword + */ + redirectUrl: string + /** + * + * Defaults to: undefined + * @type string + * @memberof AuthApiauthenticationControllerResetPassword + */ + loginHint: string +} + +export class ObjectAuthApi { + private api: ObservableAuthApi + + public constructor(configuration: Configuration, requestFactory?: AuthApiRequestFactory, responseProcessor?: AuthApiResponseProcessor) { + this.api = new ObservableAuthApi(configuration, requestFactory, responseProcessor); + } + + /** + * Info about logged in user. + * @param param the request object + */ + public authenticationControllerInfoWithHttpInfo(param: AuthApiAuthenticationControllerInfoRequest = {}, options?: Configuration): Promise> { + return this.api.authenticationControllerInfoWithHttpInfo( options).toPromise(); + } + + /** + * Info about logged in user. + * @param param the request object + */ + public authenticationControllerInfo(param: AuthApiAuthenticationControllerInfoRequest = {}, options?: Configuration): Promise { + return this.api.authenticationControllerInfo( options).toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param param the request object + */ + public authenticationControllerLoginWithHttpInfo(param: AuthApiAuthenticationControllerLoginRequest = {}, options?: Configuration): Promise> { + return this.api.authenticationControllerLoginWithHttpInfo(param.redirectUrl, options).toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param param the request object + */ + public authenticationControllerLogin(param: AuthApiAuthenticationControllerLoginRequest = {}, options?: Configuration): Promise { + return this.api.authenticationControllerLogin(param.redirectUrl, options).toPromise(); + } + + /** + * Used to log out the current user. + * @param param the request object + */ + public authenticationControllerLogoutWithHttpInfo(param: AuthApiAuthenticationControllerLogoutRequest = {}, options?: Configuration): Promise> { + return this.api.authenticationControllerLogoutWithHttpInfo( options).toPromise(); + } + + /** + * Used to log out the current user. + * @param param the request object + */ + public authenticationControllerLogout(param: AuthApiAuthenticationControllerLogoutRequest = {}, options?: Configuration): Promise { + return this.api.authenticationControllerLogout( options).toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param param the request object + */ + public authenticationControllerResetPasswordWithHttpInfo(param: AuthApiAuthenticationControllerResetPasswordRequest, options?: Configuration): Promise> { + return this.api.authenticationControllerResetPasswordWithHttpInfo(param.redirectUrl, param.loginHint, options).toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param param the request object + */ + public authenticationControllerResetPassword(param: AuthApiAuthenticationControllerResetPasswordRequest, options?: Configuration): Promise { + return this.api.authenticationControllerResetPassword(param.redirectUrl, param.loginHint, options).toPromise(); + } + +} + +import { ObservableClass2FAApi } from "./ObservableAPI.ts"; +import { Class2FAApiRequestFactory, Class2FAApiResponseProcessor} from "../apis/Class2FAApi.ts"; + +export interface Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest { + /** + * + * @type AssignHardwareTokenBodyParams + * @memberof Class2FAApiprivacyIdeaAdministrationControllerAssignHardwareToken + */ + assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams +} + +export interface Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof Class2FAApiprivacyIdeaAdministrationControllerGetTwoAuthState + */ + personId: string +} + +export interface Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest { + /** + * + * @type TokenInitBodyParams + * @memberof Class2FAApiprivacyIdeaAdministrationControllerInitializeSoftwareToken + */ + tokenInitBodyParams: TokenInitBodyParams +} + +export interface Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof Class2FAApiprivacyIdeaAdministrationControllerRequiresTwoFactorAuthentication + */ + personId: string +} + +export interface Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof Class2FAApiprivacyIdeaAdministrationControllerResetToken + */ + personId: string +} + +export interface Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest { + /** + * + * @type TokenVerifyBodyParams + * @memberof Class2FAApiprivacyIdeaAdministrationControllerVerifyToken + */ + tokenVerifyBodyParams: TokenVerifyBodyParams +} + +export class ObjectClass2FAApi { + private api: ObservableClass2FAApi + + public constructor(configuration: Configuration, requestFactory?: Class2FAApiRequestFactory, responseProcessor?: Class2FAApiResponseProcessor) { + this.api = new ObservableClass2FAApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest, options?: Configuration): Promise> { + return this.api.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(param.assignHardwareTokenBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerAssignHardwareToken(param: Class2FAApiPrivacyIdeaAdministrationControllerAssignHardwareTokenRequest, options?: Configuration): Promise { + return this.api.privacyIdeaAdministrationControllerAssignHardwareToken(param.assignHardwareTokenBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest, options?: Configuration): Promise> { + return this.api.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerGetTwoAuthState(param: Class2FAApiPrivacyIdeaAdministrationControllerGetTwoAuthStateRequest, options?: Configuration): Promise { + return this.api.privacyIdeaAdministrationControllerGetTwoAuthState(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest, options?: Configuration): Promise> { + return this.api.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(param.tokenInitBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerInitializeSoftwareToken(param: Class2FAApiPrivacyIdeaAdministrationControllerInitializeSoftwareTokenRequest, options?: Configuration): Promise { + return this.api.privacyIdeaAdministrationControllerInitializeSoftwareToken(param.tokenInitBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest, options?: Configuration): Promise> { + return this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(param: Class2FAApiPrivacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationRequest, options?: Configuration): Promise { + return this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerResetTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest, options?: Configuration): Promise> { + return this.api.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerResetToken(param: Class2FAApiPrivacyIdeaAdministrationControllerResetTokenRequest, options?: Configuration): Promise { + return this.api.privacyIdeaAdministrationControllerResetToken(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(param: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest, options?: Configuration): Promise> { + return this.api.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(param.tokenVerifyBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public privacyIdeaAdministrationControllerVerifyToken(param: Class2FAApiPrivacyIdeaAdministrationControllerVerifyTokenRequest, options?: Configuration): Promise { + return this.api.privacyIdeaAdministrationControllerVerifyToken(param.tokenVerifyBodyParams, options).toPromise(); + } + +} + +import { ObservableCronApi } from "./ObservableAPI.ts"; +import { CronApiRequestFactory, CronApiResponseProcessor} from "../apis/CronApi.ts"; + +export interface CronApiCronControllerKoPersUserLockRequest { +} + +export interface CronApiCronControllerPersonWithoutOrgDeleteRequest { +} + +export interface CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest { +} + +export interface CronApiCronControllerUnlockUsersWithExpiredLocksRequest { +} + +export class ObjectCronApi { + private api: ObservableCronApi + + public constructor(configuration: Configuration, requestFactory?: CronApiRequestFactory, responseProcessor?: CronApiResponseProcessor) { + this.api = new ObservableCronApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public cronControllerKoPersUserLockWithHttpInfo(param: CronApiCronControllerKoPersUserLockRequest = {}, options?: Configuration): Promise> { + return this.api.cronControllerKoPersUserLockWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerKoPersUserLock(param: CronApiCronControllerKoPersUserLockRequest = {}, options?: Configuration): Promise { + return this.api.cronControllerKoPersUserLock( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerPersonWithoutOrgDeleteWithHttpInfo(param: CronApiCronControllerPersonWithoutOrgDeleteRequest = {}, options?: Configuration): Promise> { + return this.api.cronControllerPersonWithoutOrgDeleteWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerPersonWithoutOrgDelete(param: CronApiCronControllerPersonWithoutOrgDeleteRequest = {}, options?: Configuration): Promise { + return this.api.cronControllerPersonWithoutOrgDelete( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(param: CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest = {}, options?: Configuration): Promise> { + return this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(param: CronApiCronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersRequest = {}, options?: Configuration): Promise { + return this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(param: CronApiCronControllerUnlockUsersWithExpiredLocksRequest = {}, options?: Configuration): Promise> { + return this.api.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public cronControllerUnlockUsersWithExpiredLocks(param: CronApiCronControllerUnlockUsersWithExpiredLocksRequest = {}, options?: Configuration): Promise { + return this.api.cronControllerUnlockUsersWithExpiredLocks( options).toPromise(); + } + +} + +import { ObservableDbiamPersonenkontexteApi } from "./ObservableAPI.ts"; +import { DbiamPersonenkontexteApiRequestFactory, DbiamPersonenkontexteApiResponseProcessor} from "../apis/DbiamPersonenkontexteApi.ts"; + +export interface DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest { + /** + * + * @type DbiamPersonenkontextMigrationBodyParams + * @memberof DbiamPersonenkontexteApidBiamPersonenkontextControllerCreatePersonenkontextMigration + */ + dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams +} + +export interface DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest { + /** + * The ID for the person. + * Defaults to: undefined + * @type string + * @memberof DbiamPersonenkontexteApidBiamPersonenkontextControllerFindPersonenkontextsByPerson + */ + personId: string +} + +export class ObjectDbiamPersonenkontexteApi { + private api: ObservableDbiamPersonenkontexteApi + + public constructor(configuration: Configuration, requestFactory?: DbiamPersonenkontexteApiRequestFactory, responseProcessor?: DbiamPersonenkontexteApiResponseProcessor) { + this.api = new ObservableDbiamPersonenkontexteApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest, options?: Configuration): Promise> { + return this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(param.dbiamPersonenkontextMigrationBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigration(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerCreatePersonenkontextMigrationRequest, options?: Configuration): Promise { + return this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigration(param.dbiamPersonenkontextMigrationBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest, options?: Configuration): Promise>> { + return this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPerson(param: DbiamPersonenkontexteApiDBiamPersonenkontextControllerFindPersonenkontextsByPersonRequest, options?: Configuration): Promise> { + return this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(param.personId, options).toPromise(); + } + +} + +import { ObservableDbiamPersonenuebersichtApi } from "./ObservableAPI.ts"; +import { DbiamPersonenuebersichtApiRequestFactory, DbiamPersonenuebersichtApiResponseProcessor} from "../apis/DbiamPersonenuebersichtApi.ts"; + +export interface DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest { + /** + * + * @type PersonenuebersichtBodyParams + * @memberof DbiamPersonenuebersichtApidBiamPersonenuebersichtControllerFindPersonenuebersichten + */ + personenuebersichtBodyParams: PersonenuebersichtBodyParams +} + +export interface DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest { + /** + * The ID for the person. + * Defaults to: undefined + * @type string + * @memberof DbiamPersonenuebersichtApidBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson + */ + personId: string +} + +export class ObjectDbiamPersonenuebersichtApi { + private api: ObservableDbiamPersonenuebersichtApi + + public constructor(configuration: Configuration, requestFactory?: DbiamPersonenuebersichtApiRequestFactory, responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor) { + this.api = new ObservableDbiamPersonenuebersichtApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest, options?: Configuration): Promise> { + return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(param.personenuebersichtBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichten(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenRequest, options?: Configuration): Promise { + return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichten(param.personenuebersichtBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest, options?: Configuration): Promise> { + return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(param: DbiamPersonenuebersichtApiDBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonRequest, options?: Configuration): Promise { + return this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(param.personId, options).toPromise(); + } + +} + +import { ObservableImportApi } from "./ObservableAPI.ts"; +import { ImportApiRequestFactory, ImportApiResponseProcessor} from "../apis/ImportApi.ts"; + +export interface ImportApiImportControllerDeleteImportTransactionRequest { + /** + * The id of an import transaction + * Defaults to: undefined + * @type string + * @memberof ImportApiimportControllerDeleteImportTransaction + */ + importvorgangId: string +} + +export interface ImportApiImportControllerExecuteImportRequest { + /** + * + * @type ImportvorgangByIdBodyParams + * @memberof ImportApiimportControllerExecuteImport + */ + importvorgangByIdBodyParams: ImportvorgangByIdBodyParams +} + +export interface ImportApiImportControllerUploadFileRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof ImportApiimportControllerUploadFile + */ + organisationId: string + /** + * + * Defaults to: undefined + * @type string + * @memberof ImportApiimportControllerUploadFile + */ + rolleId: string + /** + * + * Defaults to: undefined + * @type HttpFile + * @memberof ImportApiimportControllerUploadFile + */ + file: HttpFile +} + +export class ObjectImportApi { + private api: ObservableImportApi + + public constructor(configuration: Configuration, requestFactory?: ImportApiRequestFactory, responseProcessor?: ImportApiResponseProcessor) { + this.api = new ObservableImportApi(configuration, requestFactory, responseProcessor); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public importControllerDeleteImportTransactionWithHttpInfo(param: ImportApiImportControllerDeleteImportTransactionRequest, options?: Configuration): Promise> { + return this.api.importControllerDeleteImportTransactionWithHttpInfo(param.importvorgangId, options).toPromise(); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public importControllerDeleteImportTransaction(param: ImportApiImportControllerDeleteImportTransactionRequest, options?: Configuration): Promise { + return this.api.importControllerDeleteImportTransaction(param.importvorgangId, options).toPromise(); + } + + /** + * @param param the request object + */ + public importControllerExecuteImportWithHttpInfo(param: ImportApiImportControllerExecuteImportRequest, options?: Configuration): Promise> { + return this.api.importControllerExecuteImportWithHttpInfo(param.importvorgangByIdBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public importControllerExecuteImport(param: ImportApiImportControllerExecuteImportRequest, options?: Configuration): Promise { + return this.api.importControllerExecuteImport(param.importvorgangByIdBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public importControllerUploadFileWithHttpInfo(param: ImportApiImportControllerUploadFileRequest, options?: Configuration): Promise> { + return this.api.importControllerUploadFileWithHttpInfo(param.organisationId, param.rolleId, param.file, options).toPromise(); + } + + /** + * @param param the request object + */ + public importControllerUploadFile(param: ImportApiImportControllerUploadFileRequest, options?: Configuration): Promise { + return this.api.importControllerUploadFile(param.organisationId, param.rolleId, param.file, options).toPromise(); + } + +} + +import { ObservableOrganisationenApi } from "./ObservableAPI.ts"; +import { OrganisationenApiRequestFactory, OrganisationenApiResponseProcessor} from "../apis/OrganisationenApi.ts"; + +export interface OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerAddAdministrierteOrganisation + */ + organisationId: string + /** + * + * @type OrganisationByIdBodyParams + * @memberof OrganisationenApiorganisationControllerAddAdministrierteOrganisation + */ + organisationByIdBodyParams: OrganisationByIdBodyParams +} + +export interface OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerAddZugehoerigeOrganisation + */ + organisationId: string + /** + * + * @type OrganisationByIdBodyParams + * @memberof OrganisationenApiorganisationControllerAddZugehoerigeOrganisation + */ + organisationByIdBodyParams: OrganisationByIdBodyParams +} + +export interface OrganisationenApiOrganisationControllerCreateOrganisationRequest { + /** + * + * @type CreateOrganisationBodyParams + * @memberof OrganisationenApiorganisationControllerCreateOrganisation + */ + createOrganisationBodyParams: CreateOrganisationBodyParams +} + +export interface OrganisationenApiOrganisationControllerDeleteKlasseRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerDeleteKlasse + */ + organisationId: string +} + +export interface OrganisationenApiOrganisationControllerEnableForitslearningRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerEnableForitslearning + */ + organisationId: string +} + +export interface OrganisationenApiOrganisationControllerFindOrganisationByIdRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganisationById + */ + organisationId: string +} + +export interface OrganisationenApiOrganisationControllerFindOrganizationsRequest { + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + limit?: number + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + kennung?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + name?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + searchString?: string + /** + * + * Defaults to: undefined + * @type OrganisationsTyp + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + typ?: OrganisationsTyp + /** + * + * Defaults to: undefined + * @type Array<RollenSystemRecht> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + systemrechte?: Array + /** + * + * Defaults to: undefined + * @type Array<OrganisationsTyp> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + excludeTyp?: Array + /** + * + * Defaults to: undefined + * @type Array<string> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + administriertVon?: Array + /** + * Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + * Defaults to: undefined + * @type Array<string> + * @memberof OrganisationenApiorganisationControllerFindOrganizations + */ + organisationIds?: Array +} + +export interface OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + organisationId: string + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + limit?: number + /** + * + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerGetAdministrierteOrganisationen + */ + searchFilter?: string +} + +export interface OrganisationenApiOrganisationControllerGetParentsByIdsRequest { + /** + * + * @type ParentOrganisationsByIdsBodyParams + * @memberof OrganisationenApiorganisationControllerGetParentsByIds + */ + parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams +} + +export interface OrganisationenApiOrganisationControllerGetRootChildrenRequest { +} + +export interface OrganisationenApiOrganisationControllerGetRootOrganisationRequest { +} + +export interface OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerGetZugehoerigeOrganisationen + */ + organisationId: string +} + +export interface OrganisationenApiOrganisationControllerUpdateOrganisationRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerUpdateOrganisation + */ + organisationId: string + /** + * + * @type UpdateOrganisationBodyParams + * @memberof OrganisationenApiorganisationControllerUpdateOrganisation + */ + updateOrganisationBodyParams: UpdateOrganisationBodyParams +} + +export interface OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest { + /** + * The id of an organization + * Defaults to: undefined + * @type string + * @memberof OrganisationenApiorganisationControllerUpdateOrganisationName + */ + organisationId: string + /** + * + * @type OrganisationByNameBodyParams + * @memberof OrganisationenApiorganisationControllerUpdateOrganisationName + */ + organisationByNameBodyParams: OrganisationByNameBodyParams +} + +export class ObjectOrganisationenApi { + private api: ObservableOrganisationenApi + + public constructor(configuration: Configuration, requestFactory?: OrganisationenApiRequestFactory, responseProcessor?: OrganisationenApiResponseProcessor) { + this.api = new ObservableOrganisationenApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public organisationControllerAddAdministrierteOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest, options?: Configuration): Promise> { + return this.api.organisationControllerAddAdministrierteOrganisationWithHttpInfo(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerAddAdministrierteOrganisation(param: OrganisationenApiOrganisationControllerAddAdministrierteOrganisationRequest, options?: Configuration): Promise { + return this.api.organisationControllerAddAdministrierteOrganisation(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerAddZugehoerigeOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest, options?: Configuration): Promise> { + return this.api.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerAddZugehoerigeOrganisation(param: OrganisationenApiOrganisationControllerAddZugehoerigeOrganisationRequest, options?: Configuration): Promise { + return this.api.organisationControllerAddZugehoerigeOrganisation(param.organisationId, param.organisationByIdBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerCreateOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerCreateOrganisationRequest, options?: Configuration): Promise> { + return this.api.organisationControllerCreateOrganisationWithHttpInfo(param.createOrganisationBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerCreateOrganisation(param: OrganisationenApiOrganisationControllerCreateOrganisationRequest, options?: Configuration): Promise { + return this.api.organisationControllerCreateOrganisation(param.createOrganisationBodyParams, options).toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param param the request object + */ + public organisationControllerDeleteKlasseWithHttpInfo(param: OrganisationenApiOrganisationControllerDeleteKlasseRequest, options?: Configuration): Promise> { + return this.api.organisationControllerDeleteKlasseWithHttpInfo(param.organisationId, options).toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param param the request object + */ + public organisationControllerDeleteKlasse(param: OrganisationenApiOrganisationControllerDeleteKlasseRequest, options?: Configuration): Promise { + return this.api.organisationControllerDeleteKlasse(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerEnableForitslearningWithHttpInfo(param: OrganisationenApiOrganisationControllerEnableForitslearningRequest, options?: Configuration): Promise> { + return this.api.organisationControllerEnableForitslearningWithHttpInfo(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerEnableForitslearning(param: OrganisationenApiOrganisationControllerEnableForitslearningRequest, options?: Configuration): Promise { + return this.api.organisationControllerEnableForitslearning(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganisationByIdWithHttpInfo(param: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest, options?: Configuration): Promise> { + return this.api.organisationControllerFindOrganisationByIdWithHttpInfo(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganisationById(param: OrganisationenApiOrganisationControllerFindOrganisationByIdRequest, options?: Configuration): Promise { + return this.api.organisationControllerFindOrganisationById(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganizationsWithHttpInfo(param: OrganisationenApiOrganisationControllerFindOrganizationsRequest = {}, options?: Configuration): Promise>> { + return this.api.organisationControllerFindOrganizationsWithHttpInfo(param.offset, param.limit, param.kennung, param.name, param.searchString, param.typ, param.systemrechte, param.excludeTyp, param.administriertVon, param.organisationIds, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerFindOrganizations(param: OrganisationenApiOrganisationControllerFindOrganizationsRequest = {}, options?: Configuration): Promise> { + return this.api.organisationControllerFindOrganizations(param.offset, param.limit, param.kennung, param.name, param.searchString, param.typ, param.systemrechte, param.excludeTyp, param.administriertVon, param.organisationIds, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetAdministrierteOrganisationenWithHttpInfo(param: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest, options?: Configuration): Promise>> { + return this.api.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(param.organisationId, param.offset, param.limit, param.searchFilter, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetAdministrierteOrganisationen(param: OrganisationenApiOrganisationControllerGetAdministrierteOrganisationenRequest, options?: Configuration): Promise> { + return this.api.organisationControllerGetAdministrierteOrganisationen(param.organisationId, param.offset, param.limit, param.searchFilter, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetParentsByIdsWithHttpInfo(param: OrganisationenApiOrganisationControllerGetParentsByIdsRequest, options?: Configuration): Promise> { + return this.api.organisationControllerGetParentsByIdsWithHttpInfo(param.parentOrganisationsByIdsBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetParentsByIds(param: OrganisationenApiOrganisationControllerGetParentsByIdsRequest, options?: Configuration): Promise { + return this.api.organisationControllerGetParentsByIds(param.parentOrganisationsByIdsBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootChildrenWithHttpInfo(param: OrganisationenApiOrganisationControllerGetRootChildrenRequest = {}, options?: Configuration): Promise> { + return this.api.organisationControllerGetRootChildrenWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootChildren(param: OrganisationenApiOrganisationControllerGetRootChildrenRequest = {}, options?: Configuration): Promise { + return this.api.organisationControllerGetRootChildren( options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerGetRootOrganisationRequest = {}, options?: Configuration): Promise> { + return this.api.organisationControllerGetRootOrganisationWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetRootOrganisation(param: OrganisationenApiOrganisationControllerGetRootOrganisationRequest = {}, options?: Configuration): Promise { + return this.api.organisationControllerGetRootOrganisation( options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(param: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest, options?: Configuration): Promise>> { + return this.api.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerGetZugehoerigeOrganisationen(param: OrganisationenApiOrganisationControllerGetZugehoerigeOrganisationenRequest, options?: Configuration): Promise> { + return this.api.organisationControllerGetZugehoerigeOrganisationen(param.organisationId, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisationWithHttpInfo(param: OrganisationenApiOrganisationControllerUpdateOrganisationRequest, options?: Configuration): Promise> { + return this.api.organisationControllerUpdateOrganisationWithHttpInfo(param.organisationId, param.updateOrganisationBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisation(param: OrganisationenApiOrganisationControllerUpdateOrganisationRequest, options?: Configuration): Promise { + return this.api.organisationControllerUpdateOrganisation(param.organisationId, param.updateOrganisationBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisationNameWithHttpInfo(param: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest, options?: Configuration): Promise> { + return this.api.organisationControllerUpdateOrganisationNameWithHttpInfo(param.organisationId, param.organisationByNameBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public organisationControllerUpdateOrganisationName(param: OrganisationenApiOrganisationControllerUpdateOrganisationNameRequest, options?: Configuration): Promise { + return this.api.organisationControllerUpdateOrganisationName(param.organisationId, param.organisationByNameBodyParams, options).toPromise(); + } + +} + +import { ObservablePersonAdministrationApi } from "./ObservableAPI.ts"; +import { PersonAdministrationApiRequestFactory, PersonAdministrationApiResponseProcessor} from "../apis/PersonAdministrationApi.ts"; + +export interface PersonAdministrationApiPersonAdministrationControllerFindRollenRequest { + /** + * Rolle name used to filter for rollen in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonAdministrationApipersonAdministrationControllerFindRollen + */ + rolleName?: string + /** + * The limit of items for the request. + * Defaults to: undefined + * @type number + * @memberof PersonAdministrationApipersonAdministrationControllerFindRollen + */ + limit?: number +} + +export class ObjectPersonAdministrationApi { + private api: ObservablePersonAdministrationApi + + public constructor(configuration: Configuration, requestFactory?: PersonAdministrationApiRequestFactory, responseProcessor?: PersonAdministrationApiResponseProcessor) { + this.api = new ObservablePersonAdministrationApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public personAdministrationControllerFindRollenWithHttpInfo(param: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = {}, options?: Configuration): Promise> { + return this.api.personAdministrationControllerFindRollenWithHttpInfo(param.rolleName, param.limit, options).toPromise(); + } + + /** + * @param param the request object + */ + public personAdministrationControllerFindRollen(param: PersonAdministrationApiPersonAdministrationControllerFindRollenRequest = {}, options?: Configuration): Promise { + return this.api.personAdministrationControllerFindRollen(param.rolleName, param.limit, options).toPromise(); + } + +} + +import { ObservablePersonInfoApi } from "./ObservableAPI.ts"; +import { PersonInfoApiRequestFactory, PersonInfoApiResponseProcessor} from "../apis/PersonInfoApi.ts"; + +export interface PersonInfoApiPersonInfoControllerInfoRequest { +} + +export class ObjectPersonInfoApi { + private api: ObservablePersonInfoApi + + public constructor(configuration: Configuration, requestFactory?: PersonInfoApiRequestFactory, responseProcessor?: PersonInfoApiResponseProcessor) { + this.api = new ObservablePersonInfoApi(configuration, requestFactory, responseProcessor); + } + + /** + * Info about logged in person. + * @param param the request object + */ + public personInfoControllerInfoWithHttpInfo(param: PersonInfoApiPersonInfoControllerInfoRequest = {}, options?: Configuration): Promise> { + return this.api.personInfoControllerInfoWithHttpInfo( options).toPromise(); + } + + /** + * Info about logged in person. + * @param param the request object + */ + public personInfoControllerInfo(param: PersonInfoApiPersonInfoControllerInfoRequest = {}, options?: Configuration): Promise { + return this.api.personInfoControllerInfo( options).toPromise(); + } + +} + +import { ObservablePersonenApi } from "./ObservableAPI.ts"; +import { PersonenApiRequestFactory, PersonenApiResponseProcessor} from "../apis/PersonenApi.ts"; + +export interface PersonenApiPersonControllerCreatePersonMigrationRequest { + /** + * + * @type CreatePersonMigrationBodyParams + * @memberof PersonenApipersonControllerCreatePersonMigration + */ + createPersonMigrationBodyParams: CreatePersonMigrationBodyParams +} + +export interface PersonenApiPersonControllerCreatePersonenkontextRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerCreatePersonenkontext + */ + personId: string +} + +export interface PersonenApiPersonControllerDeletePersonByIdRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerDeletePersonById + */ + personId: string +} + +export interface PersonenApiPersonControllerFindPersonByIdRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonById + */ + personId: string +} + +export interface PersonenApiPersonControllerFindPersonenkontexteRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + personId: string + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + limit?: number + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + personId2?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + referrer?: string + /** + * + * Defaults to: undefined + * @type Personenstatus + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + personenstatus?: Personenstatus + /** + * + * Defaults to: undefined + * @type Sichtfreigabe + * @memberof PersonenApipersonControllerFindPersonenkontexte + */ + sichtfreigabe?: Sichtfreigabe +} + +export interface PersonenApiPersonControllerFindPersonsRequest { + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersons + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenApipersonControllerFindPersons + */ + limit?: number + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + referrer?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + familienname?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + vorname?: string + /** + * + * Defaults to: 'nein' + * @type 'ja' | 'nein' + * @memberof PersonenApipersonControllerFindPersons + */ + sichtfreigabe?: 'ja' | 'nein' + /** + * List of Organisation ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenApipersonControllerFindPersons + */ + organisationIDs?: Array + /** + * List of Role ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenApipersonControllerFindPersons + */ + rolleIDs?: Array + /** + * Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerFindPersons + */ + suchFilter?: string + /** + * Order to sort by. + * Defaults to: undefined + * @type 'asc' | 'desc' + * @memberof PersonenApipersonControllerFindPersons + */ + sortOrder?: 'asc' | 'desc' + /** + * Field to sort by. + * Defaults to: undefined + * @type 'familienname' | 'vorname' | 'personalnummer' | 'referrer' + * @memberof PersonenApipersonControllerFindPersons + */ + sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer' +} + +export interface PersonenApiPersonControllerLockPersonRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerLockPerson + */ + personId: string + /** + * + * @type LockUserBodyParams + * @memberof PersonenApipersonControllerLockPerson + */ + lockUserBodyParams: LockUserBodyParams +} + +export interface PersonenApiPersonControllerResetPasswordByPersonIdRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerResetPasswordByPersonId + */ + personId: string +} + +export interface PersonenApiPersonControllerSyncPersonRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerSyncPerson + */ + personId: string +} + +export interface PersonenApiPersonControllerUpdateMetadataRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerUpdateMetadata + */ + personId: string + /** + * + * @type PersonMetadataBodyParams + * @memberof PersonenApipersonControllerUpdateMetadata + */ + personMetadataBodyParams: PersonMetadataBodyParams +} + +export interface PersonenApiPersonControllerUpdatePersonRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenApipersonControllerUpdatePerson + */ + personId: string + /** + * + * @type UpdatePersonBodyParams + * @memberof PersonenApipersonControllerUpdatePerson + */ + updatePersonBodyParams: UpdatePersonBodyParams +} + +export class ObjectPersonenApi { + private api: ObservablePersonenApi + + public constructor(configuration: Configuration, requestFactory?: PersonenApiRequestFactory, responseProcessor?: PersonenApiResponseProcessor) { + this.api = new ObservablePersonenApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public personControllerCreatePersonMigrationWithHttpInfo(param: PersonenApiPersonControllerCreatePersonMigrationRequest, options?: Configuration): Promise> { + return this.api.personControllerCreatePersonMigrationWithHttpInfo(param.createPersonMigrationBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerCreatePersonMigration(param: PersonenApiPersonControllerCreatePersonMigrationRequest, options?: Configuration): Promise { + return this.api.personControllerCreatePersonMigration(param.createPersonMigrationBodyParams, options).toPromise(); + } + + /** + * + * @param param the request object + */ + public personControllerCreatePersonenkontextWithHttpInfo(param: PersonenApiPersonControllerCreatePersonenkontextRequest, options?: Configuration): Promise> { + return this.api.personControllerCreatePersonenkontextWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * + * @param param the request object + */ + public personControllerCreatePersonenkontext(param: PersonenApiPersonControllerCreatePersonenkontextRequest, options?: Configuration): Promise { + return this.api.personControllerCreatePersonenkontext(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerDeletePersonByIdWithHttpInfo(param: PersonenApiPersonControllerDeletePersonByIdRequest, options?: Configuration): Promise> { + return this.api.personControllerDeletePersonByIdWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerDeletePersonById(param: PersonenApiPersonControllerDeletePersonByIdRequest, options?: Configuration): Promise { + return this.api.personControllerDeletePersonById(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonByIdWithHttpInfo(param: PersonenApiPersonControllerFindPersonByIdRequest, options?: Configuration): Promise> { + return this.api.personControllerFindPersonByIdWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonById(param: PersonenApiPersonControllerFindPersonByIdRequest, options?: Configuration): Promise { + return this.api.personControllerFindPersonById(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonenkontexteWithHttpInfo(param: PersonenApiPersonControllerFindPersonenkontexteRequest, options?: Configuration): Promise> { + return this.api.personControllerFindPersonenkontexteWithHttpInfo(param.personId, param.offset, param.limit, param.personId2, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonenkontexte(param: PersonenApiPersonControllerFindPersonenkontexteRequest, options?: Configuration): Promise { + return this.api.personControllerFindPersonenkontexte(param.personId, param.offset, param.limit, param.personId2, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersonsWithHttpInfo(param: PersonenApiPersonControllerFindPersonsRequest = {}, options?: Configuration): Promise>> { + return this.api.personControllerFindPersonsWithHttpInfo(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerFindPersons(param: PersonenApiPersonControllerFindPersonsRequest = {}, options?: Configuration): Promise> { + return this.api.personControllerFindPersons(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerLockPersonWithHttpInfo(param: PersonenApiPersonControllerLockPersonRequest, options?: Configuration): Promise> { + return this.api.personControllerLockPersonWithHttpInfo(param.personId, param.lockUserBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerLockPerson(param: PersonenApiPersonControllerLockPersonRequest, options?: Configuration): Promise { + return this.api.personControllerLockPerson(param.personId, param.lockUserBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerResetPasswordByPersonIdWithHttpInfo(param: PersonenApiPersonControllerResetPasswordByPersonIdRequest, options?: Configuration): Promise> { + return this.api.personControllerResetPasswordByPersonIdWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerResetPasswordByPersonId(param: PersonenApiPersonControllerResetPasswordByPersonIdRequest, options?: Configuration): Promise { + return this.api.personControllerResetPasswordByPersonId(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerSyncPersonWithHttpInfo(param: PersonenApiPersonControllerSyncPersonRequest, options?: Configuration): Promise> { + return this.api.personControllerSyncPersonWithHttpInfo(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerSyncPerson(param: PersonenApiPersonControllerSyncPersonRequest, options?: Configuration): Promise { + return this.api.personControllerSyncPerson(param.personId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdateMetadataWithHttpInfo(param: PersonenApiPersonControllerUpdateMetadataRequest, options?: Configuration): Promise> { + return this.api.personControllerUpdateMetadataWithHttpInfo(param.personId, param.personMetadataBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdateMetadata(param: PersonenApiPersonControllerUpdateMetadataRequest, options?: Configuration): Promise { + return this.api.personControllerUpdateMetadata(param.personId, param.personMetadataBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdatePersonWithHttpInfo(param: PersonenApiPersonControllerUpdatePersonRequest, options?: Configuration): Promise> { + return this.api.personControllerUpdatePersonWithHttpInfo(param.personId, param.updatePersonBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personControllerUpdatePerson(param: PersonenApiPersonControllerUpdatePersonRequest, options?: Configuration): Promise { + return this.api.personControllerUpdatePerson(param.personId, param.updatePersonBodyParams, options).toPromise(); + } + +} + +import { ObservablePersonenFrontendApi } from "./ObservableAPI.ts"; +import { PersonenFrontendApiRequestFactory, PersonenFrontendApiResponseProcessor} from "../apis/PersonenFrontendApi.ts"; + +export interface PersonenFrontendApiPersonFrontendControllerFindPersonsRequest { + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + limit?: number + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + referrer?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + familienname?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + vorname?: string + /** + * + * Defaults to: 'nein' + * @type 'ja' | 'nein' + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + sichtfreigabe?: 'ja' | 'nein' + /** + * List of Organisation ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + organisationIDs?: Array + /** + * List of Role ID used to filter for Persons. + * Defaults to: undefined + * @type Array<string> + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + rolleIDs?: Array + /** + * Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * Defaults to: undefined + * @type string + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + suchFilter?: string + /** + * Order to sort by. + * Defaults to: undefined + * @type 'asc' | 'desc' + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + sortOrder?: 'asc' | 'desc' + /** + * Field to sort by. + * Defaults to: undefined + * @type 'familienname' | 'vorname' | 'personalnummer' | 'referrer' + * @memberof PersonenFrontendApipersonFrontendControllerFindPersons + */ + sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer' +} + +export class ObjectPersonenFrontendApi { + private api: ObservablePersonenFrontendApi + + public constructor(configuration: Configuration, requestFactory?: PersonenFrontendApiRequestFactory, responseProcessor?: PersonenFrontendApiResponseProcessor) { + this.api = new ObservablePersonenFrontendApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public personFrontendControllerFindPersonsWithHttpInfo(param: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = {}, options?: Configuration): Promise> { + return this.api.personFrontendControllerFindPersonsWithHttpInfo(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); + } + + /** + * @param param the request object + */ + public personFrontendControllerFindPersons(param: PersonenFrontendApiPersonFrontendControllerFindPersonsRequest = {}, options?: Configuration): Promise { + return this.api.personFrontendControllerFindPersons(param.offset, param.limit, param.referrer, param.familienname, param.vorname, param.sichtfreigabe, param.organisationIDs, param.rolleIDs, param.suchFilter, param.sortOrder, param.sortField, options).toPromise(); + } + +} + +import { ObservablePersonenkontextApi } from "./ObservableAPI.ts"; +import { PersonenkontextApiRequestFactory, PersonenkontextApiResponseProcessor} from "../apis/PersonenkontextApi.ts"; + +export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest { + /** + * The ID for the person. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit + */ + personId: string + /** + * + * @type DbiamUpdatePersonenkontexteBodyParams + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit + */ + dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCommit + */ + personalnummer?: string +} + +export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest { + /** + * + * @type DbiamCreatePersonWithPersonenkontexteBodyParams + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte + */ + dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams +} + +export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest { + /** + * RolleId used to filter for schulstrukturknoten in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + */ + rolleId: string + /** + * Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + */ + sskName?: string + /** + * The limit of items for the request. + * Defaults to: undefined + * @type number + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten + */ + limit?: number +} + +export interface PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest { + /** + * ID of the organisation to filter the rollen later + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + organisationId?: string + /** + * ID of the rolle. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + rolleId?: string + /** + * Rolle name used to filter for rollen in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + rolleName?: string + /** + * Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + organisationName?: string + /** + * The limit of items for the request. + * Defaults to: undefined + * @type number + * @memberof PersonenkontextApidbiamPersonenkontextWorkflowControllerProcessStep + */ + limit?: number +} + +export class ObjectPersonenkontextApi { + private api: ObservablePersonenkontextApi + + public constructor(configuration: Configuration, requestFactory?: PersonenkontextApiRequestFactory, responseProcessor?: PersonenkontextApiResponseProcessor) { + this.api = new ObservablePersonenkontextApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest, options?: Configuration): Promise> { + return this.api.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(param.personId, param.dbiamUpdatePersonenkontexteBodyParams, param.personalnummer, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCommit(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCommitRequest, options?: Configuration): Promise { + return this.api.dbiamPersonenkontextWorkflowControllerCommit(param.personId, param.dbiamUpdatePersonenkontexteBodyParams, param.personalnummer, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest, options?: Configuration): Promise> { + return this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(param.dbiamCreatePersonWithPersonenkontexteBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteRequest, options?: Configuration): Promise { + return this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(param.dbiamCreatePersonWithPersonenkontexteBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest, options?: Configuration): Promise> { + return this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(param.rolleId, param.sskName, param.limit, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenRequest, options?: Configuration): Promise { + return this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(param.rolleId, param.sskName, param.limit, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = {}, options?: Configuration): Promise> { + return this.api.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(param.organisationId, param.rolleId, param.rolleName, param.organisationName, param.limit, options).toPromise(); + } + + /** + * @param param the request object + */ + public dbiamPersonenkontextWorkflowControllerProcessStep(param: PersonenkontextApiDbiamPersonenkontextWorkflowControllerProcessStepRequest = {}, options?: Configuration): Promise { + return this.api.dbiamPersonenkontextWorkflowControllerProcessStep(param.organisationId, param.rolleId, param.rolleName, param.organisationName, param.limit, options).toPromise(); + } + +} + +import { ObservablePersonenkontexteApi } from "./ObservableAPI.ts"; +import { PersonenkontexteApiRequestFactory, PersonenkontexteApiResponseProcessor} from "../apis/PersonenkontexteApi.ts"; + +export interface PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest { + /** + * The id for the personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerDeletePersonenkontextById + */ + personenkontextId: string + /** + * + * @type DeleteRevisionBodyParams + * @memberof PersonenkontexteApipersonenkontextControllerDeletePersonenkontextById + */ + deleteRevisionBodyParams: DeleteRevisionBodyParams +} + +export interface PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest { + /** + * The id for the personenkontext. + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontextById + */ + personenkontextId: string +} + +export interface PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest { + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + limit?: number + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + personId?: string + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + referrer?: string + /** + * + * Defaults to: undefined + * @type Personenstatus + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + personenstatus?: Personenstatus + /** + * + * Defaults to: undefined + * @type Sichtfreigabe + * @memberof PersonenkontexteApipersonenkontextControllerFindPersonenkontexte + */ + sichtfreigabe?: Sichtfreigabe +} + +export interface PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest { + /** + * The id for the account. + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerHatSystemRecht + */ + personId: string + /** + * + * Defaults to: undefined + * @type RollenSystemRecht + * @memberof PersonenkontexteApipersonenkontextControllerHatSystemRecht + */ + systemRecht: RollenSystemRecht +} + +export interface PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest { + /** + * + * Defaults to: undefined + * @type string + * @memberof PersonenkontexteApipersonenkontextControllerUpdatePersonenkontextWithId + */ + personenkontextId: string +} + +export class ObjectPersonenkontexteApi { + private api: ObservablePersonenkontexteApi + + public constructor(configuration: Configuration, requestFactory?: PersonenkontexteApiRequestFactory, responseProcessor?: PersonenkontexteApiResponseProcessor) { + this.api = new ObservablePersonenkontexteApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest, options?: Configuration): Promise> { + return this.api.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(param.personenkontextId, param.deleteRevisionBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerDeletePersonenkontextById(param: PersonenkontexteApiPersonenkontextControllerDeletePersonenkontextByIdRequest, options?: Configuration): Promise { + return this.api.personenkontextControllerDeletePersonenkontextById(param.personenkontextId, param.deleteRevisionBodyParams, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontextByIdWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest, options?: Configuration): Promise> { + return this.api.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(param.personenkontextId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontextById(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontextByIdRequest, options?: Configuration): Promise { + return this.api.personenkontextControllerFindPersonenkontextById(param.personenkontextId, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontexteWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = {}, options?: Configuration): Promise>> { + return this.api.personenkontextControllerFindPersonenkontexteWithHttpInfo(param.offset, param.limit, param.personId, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerFindPersonenkontexte(param: PersonenkontexteApiPersonenkontextControllerFindPersonenkontexteRequest = {}, options?: Configuration): Promise> { + return this.api.personenkontextControllerFindPersonenkontexte(param.offset, param.limit, param.personId, param.referrer, param.personenstatus, param.sichtfreigabe, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerHatSystemRechtWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest, options?: Configuration): Promise> { + return this.api.personenkontextControllerHatSystemRechtWithHttpInfo(param.personId, param.systemRecht, options).toPromise(); + } + + /** + * @param param the request object + */ + public personenkontextControllerHatSystemRecht(param: PersonenkontexteApiPersonenkontextControllerHatSystemRechtRequest, options?: Configuration): Promise { + return this.api.personenkontextControllerHatSystemRecht(param.personId, param.systemRecht, options).toPromise(); + } + + /** + * + * @param param the request object + */ + public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(param: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest, options?: Configuration): Promise> { + return this.api.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(param.personenkontextId, options).toPromise(); + } + + /** + * + * @param param the request object + */ + public personenkontextControllerUpdatePersonenkontextWithId(param: PersonenkontexteApiPersonenkontextControllerUpdatePersonenkontextWithIdRequest, options?: Configuration): Promise { + return this.api.personenkontextControllerUpdatePersonenkontextWithId(param.personenkontextId, options).toPromise(); + } + +} + +import { ObservableProviderApi } from "./ObservableAPI.ts"; +import { ProviderApiRequestFactory, ProviderApiResponseProcessor} from "../apis/ProviderApi.ts"; + +export interface ProviderApiProviderControllerGetAllServiceProvidersRequest { +} + +export interface ProviderApiProviderControllerGetAvailableServiceProvidersRequest { +} + +export interface ProviderApiProviderControllerGetServiceProviderLogoRequest { + /** + * The id of the service provider + * Defaults to: undefined + * @type string + * @memberof ProviderApiproviderControllerGetServiceProviderLogo + */ + angebotId: string +} + +export class ObjectProviderApi { + private api: ObservableProviderApi + + public constructor(configuration: Configuration, requestFactory?: ProviderApiRequestFactory, responseProcessor?: ProviderApiResponseProcessor) { + this.api = new ObservableProviderApi(configuration, requestFactory, responseProcessor); + } + + /** + * Get all service-providers. + * + * @param param the request object + */ + public providerControllerGetAllServiceProvidersWithHttpInfo(param: ProviderApiProviderControllerGetAllServiceProvidersRequest = {}, options?: Configuration): Promise>> { + return this.api.providerControllerGetAllServiceProvidersWithHttpInfo( options).toPromise(); + } + + /** + * Get all service-providers. + * + * @param param the request object + */ + public providerControllerGetAllServiceProviders(param: ProviderApiProviderControllerGetAllServiceProvidersRequest = {}, options?: Configuration): Promise> { + return this.api.providerControllerGetAllServiceProviders( options).toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + * @param param the request object + */ + public providerControllerGetAvailableServiceProvidersWithHttpInfo(param: ProviderApiProviderControllerGetAvailableServiceProvidersRequest = {}, options?: Configuration): Promise>> { + return this.api.providerControllerGetAvailableServiceProvidersWithHttpInfo( options).toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + * @param param the request object + */ + public providerControllerGetAvailableServiceProviders(param: ProviderApiProviderControllerGetAvailableServiceProvidersRequest = {}, options?: Configuration): Promise> { + return this.api.providerControllerGetAvailableServiceProviders( options).toPromise(); + } + + /** + * @param param the request object + */ + public providerControllerGetServiceProviderLogoWithHttpInfo(param: ProviderApiProviderControllerGetServiceProviderLogoRequest, options?: Configuration): Promise> { + return this.api.providerControllerGetServiceProviderLogoWithHttpInfo(param.angebotId, options).toPromise(); + } + + /** + * @param param the request object + */ + public providerControllerGetServiceProviderLogo(param: ProviderApiProviderControllerGetServiceProviderLogoRequest, options?: Configuration): Promise { + return this.api.providerControllerGetServiceProviderLogo(param.angebotId, options).toPromise(); + } + +} + +import { ObservableRolleApi } from "./ObservableAPI.ts"; +import { RolleApiRequestFactory, RolleApiResponseProcessor} from "../apis/RolleApi.ts"; + +export interface RolleApiRolleControllerAddSystemRechtRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerAddSystemRecht + */ + rolleId: string + /** + * + * @type AddSystemrechtBodyParams + * @memberof RolleApirolleControllerAddSystemRecht + */ + addSystemrechtBodyParams: AddSystemrechtBodyParams +} + +export interface RolleApiRolleControllerCreateRolleRequest { + /** + * + * @type CreateRolleBodyParams + * @memberof RolleApirolleControllerCreateRolle + */ + createRolleBodyParams: CreateRolleBodyParams +} + +export interface RolleApiRolleControllerDeleteRolleRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerDeleteRolle + */ + rolleId: string +} + +export interface RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerFindRolleByIdWithServiceProviders + */ + rolleId: string +} + +export interface RolleApiRolleControllerFindRollenRequest { + /** + * The offset of the paginated list. + * Defaults to: undefined + * @type number + * @memberof RolleApirolleControllerFindRollen + */ + offset?: number + /** + * The requested limit for the page size. + * Defaults to: undefined + * @type number + * @memberof RolleApirolleControllerFindRollen + */ + limit?: number + /** + * The name for the role. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerFindRollen + */ + searchStr?: string +} + +export interface RolleApiRolleControllerGetRolleServiceProviderIdsRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerGetRolleServiceProviderIds + */ + rolleId: string +} + +export interface RolleApiRolleControllerRemoveServiceProviderByIdRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerRemoveServiceProviderById + */ + rolleId: string + /** + * + * @type RolleServiceProviderBodyParams + * @memberof RolleApirolleControllerRemoveServiceProviderById + */ + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams +} + +export interface RolleApiRolleControllerUpdateRolleRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerUpdateRolle + */ + rolleId: string + /** + * + * @type UpdateRolleBodyParams + * @memberof RolleApirolleControllerUpdateRolle + */ + updateRolleBodyParams: UpdateRolleBodyParams +} + +export interface RolleApiRolleControllerUpdateServiceProvidersByIdRequest { + /** + * The id for the rolle. + * Defaults to: undefined + * @type string + * @memberof RolleApirolleControllerUpdateServiceProvidersById + */ + rolleId: string + /** + * + * @type RolleServiceProviderBodyParams + * @memberof RolleApirolleControllerUpdateServiceProvidersById + */ + rolleServiceProviderBodyParams: RolleServiceProviderBodyParams +} + +export class ObjectRolleApi { + private api: ObservableRolleApi + + public constructor(configuration: Configuration, requestFactory?: RolleApiRequestFactory, responseProcessor?: RolleApiResponseProcessor) { + this.api = new ObservableRolleApi(configuration, requestFactory, responseProcessor); + } + + /** + * Add systemrecht to a rolle. + * + * @param param the request object + */ + public rolleControllerAddSystemRechtWithHttpInfo(param: RolleApiRolleControllerAddSystemRechtRequest, options?: Configuration): Promise> { + return this.api.rolleControllerAddSystemRechtWithHttpInfo(param.rolleId, param.addSystemrechtBodyParams, options).toPromise(); + } + + /** + * Add systemrecht to a rolle. + * + * @param param the request object + */ + public rolleControllerAddSystemRecht(param: RolleApiRolleControllerAddSystemRechtRequest, options?: Configuration): Promise { + return this.api.rolleControllerAddSystemRecht(param.rolleId, param.addSystemrechtBodyParams, options).toPromise(); + } + + /** + * Create a new rolle. + * + * @param param the request object + */ + public rolleControllerCreateRolleWithHttpInfo(param: RolleApiRolleControllerCreateRolleRequest, options?: Configuration): Promise> { + return this.api.rolleControllerCreateRolleWithHttpInfo(param.createRolleBodyParams, options).toPromise(); + } + + /** + * Create a new rolle. + * + * @param param the request object + */ + public rolleControllerCreateRolle(param: RolleApiRolleControllerCreateRolleRequest, options?: Configuration): Promise { + return this.api.rolleControllerCreateRolle(param.createRolleBodyParams, options).toPromise(); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public rolleControllerDeleteRolleWithHttpInfo(param: RolleApiRolleControllerDeleteRolleRequest, options?: Configuration): Promise> { + return this.api.rolleControllerDeleteRolleWithHttpInfo(param.rolleId, options).toPromise(); + } + + /** + * Delete a role by id. + * + * @param param the request object + */ + public rolleControllerDeleteRolle(param: RolleApiRolleControllerDeleteRolleRequest, options?: Configuration): Promise { + return this.api.rolleControllerDeleteRolle(param.rolleId, options).toPromise(); + } + + /** + * Get rolle by id. + * + * @param param the request object + */ + public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(param: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest, options?: Configuration): Promise> { + return this.api.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(param.rolleId, options).toPromise(); + } + + /** + * Get rolle by id. + * + * @param param the request object + */ + public rolleControllerFindRolleByIdWithServiceProviders(param: RolleApiRolleControllerFindRolleByIdWithServiceProvidersRequest, options?: Configuration): Promise { + return this.api.rolleControllerFindRolleByIdWithServiceProviders(param.rolleId, options).toPromise(); + } + + /** + * List all rollen. + * + * @param param the request object + */ + public rolleControllerFindRollenWithHttpInfo(param: RolleApiRolleControllerFindRollenRequest = {}, options?: Configuration): Promise>> { + return this.api.rolleControllerFindRollenWithHttpInfo(param.offset, param.limit, param.searchStr, options).toPromise(); + } + + /** + * List all rollen. + * + * @param param the request object + */ + public rolleControllerFindRollen(param: RolleApiRolleControllerFindRollenRequest = {}, options?: Configuration): Promise> { + return this.api.rolleControllerFindRollen(param.offset, param.limit, param.searchStr, options).toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param param the request object + */ + public rolleControllerGetRolleServiceProviderIdsWithHttpInfo(param: RolleApiRolleControllerGetRolleServiceProviderIdsRequest, options?: Configuration): Promise> { + return this.api.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(param.rolleId, options).toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param param the request object + */ + public rolleControllerGetRolleServiceProviderIds(param: RolleApiRolleControllerGetRolleServiceProviderIdsRequest, options?: Configuration): Promise { + return this.api.rolleControllerGetRolleServiceProviderIds(param.rolleId, options).toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param param the request object + */ + public rolleControllerRemoveServiceProviderByIdWithHttpInfo(param: RolleApiRolleControllerRemoveServiceProviderByIdRequest, options?: Configuration): Promise> { + return this.api.rolleControllerRemoveServiceProviderByIdWithHttpInfo(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param param the request object + */ + public rolleControllerRemoveServiceProviderById(param: RolleApiRolleControllerRemoveServiceProviderByIdRequest, options?: Configuration): Promise { + return this.api.rolleControllerRemoveServiceProviderById(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); + } + + /** + * Update rolle. + * + * @param param the request object + */ + public rolleControllerUpdateRolleWithHttpInfo(param: RolleApiRolleControllerUpdateRolleRequest, options?: Configuration): Promise> { + return this.api.rolleControllerUpdateRolleWithHttpInfo(param.rolleId, param.updateRolleBodyParams, options).toPromise(); + } + + /** + * Update rolle. + * + * @param param the request object + */ + public rolleControllerUpdateRolle(param: RolleApiRolleControllerUpdateRolleRequest, options?: Configuration): Promise { + return this.api.rolleControllerUpdateRolle(param.rolleId, param.updateRolleBodyParams, options).toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param param the request object + */ + public rolleControllerUpdateServiceProvidersByIdWithHttpInfo(param: RolleApiRolleControllerUpdateServiceProvidersByIdRequest, options?: Configuration): Promise>> { + return this.api.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param param the request object + */ + public rolleControllerUpdateServiceProvidersById(param: RolleApiRolleControllerUpdateServiceProvidersByIdRequest, options?: Configuration): Promise> { + return this.api.rolleControllerUpdateServiceProvidersById(param.rolleId, param.rolleServiceProviderBodyParams, options).toPromise(); + } + +} + +import { ObservableStatusApi } from "./ObservableAPI.ts"; +import { StatusApiRequestFactory, StatusApiResponseProcessor} from "../apis/StatusApi.ts"; + +export interface StatusApiStatusControllerGetStatusRequest { +} + +export class ObjectStatusApi { + private api: ObservableStatusApi + + public constructor(configuration: Configuration, requestFactory?: StatusApiRequestFactory, responseProcessor?: StatusApiResponseProcessor) { + this.api = new ObservableStatusApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param param the request object + */ + public statusControllerGetStatusWithHttpInfo(param: StatusApiStatusControllerGetStatusRequest = {}, options?: Configuration): Promise> { + return this.api.statusControllerGetStatusWithHttpInfo( options).toPromise(); + } + + /** + * @param param the request object + */ + public statusControllerGetStatus(param: StatusApiStatusControllerGetStatusRequest = {}, options?: Configuration): Promise { + return this.api.statusControllerGetStatus( options).toPromise(); + } + +} diff --git a/loadtest/api-client/generated/types/ObservableAPI.ts b/loadtest/api-client/generated/types/ObservableAPI.ts new file mode 100644 index 0000000..906831c --- /dev/null +++ b/loadtest/api-client/generated/types/ObservableAPI.ts @@ -0,0 +1,2623 @@ +import { ResponseContext, RequestContext, HttpFile, HttpInfo } from '../http/http.ts'; +import { Configuration} from '../configuration.ts' +import { Observable, of, from } from '../rxjsStub.ts'; +import {mergeMap, map} from '../rxjsStub.ts'; +import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; +import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; +import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; +import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; +import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; +import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; +import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; +import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; +import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; +import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; +import { DbiamImportError } from '../models/DbiamImportError.ts'; +import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; +import { DbiamPersonError } from '../models/DbiamPersonError.ts'; +import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; +import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; +import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; +import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; +import { DbiamRolleError } from '../models/DbiamRolleError.ts'; +import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; +import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; +import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; +import { FindRollenResponse } from '../models/FindRollenResponse.ts'; +import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; +import { Geschlecht } from '../models/Geschlecht.ts'; +import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; +import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; +import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; +import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; +import { LoeschungResponse } from '../models/LoeschungResponse.ts'; +import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; +import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; +import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; +import { Person } from '../models/Person.ts'; +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; +import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; +import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; +import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; +import { PersonIdResponse } from '../models/PersonIdResponse.ts'; +import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; +import { PersonLockResponse } from '../models/PersonLockResponse.ts'; +import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { PersonNameResponse } from '../models/PersonNameResponse.ts'; +import { PersonResponse } from '../models/PersonResponse.ts'; +import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; +import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; +import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; +import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; +import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; +import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; +import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; +import { Personenstatus } from '../models/Personenstatus.ts'; +import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; +import { RawPagedResponse } from '../models/RawPagedResponse.ts'; +import { RolleResponse } from '../models/RolleResponse.ts'; +import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; +import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; +import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; +import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; +import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; +import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; +import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; +import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; +import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; +import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; +import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; +import { TokenStateResponse } from '../models/TokenStateResponse.ts'; +import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; +import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; +import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; +import { UserLockParams } from '../models/UserLockParams.ts'; +import { UserinfoResponse } from '../models/UserinfoResponse.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; + +import { AuthApiRequestFactory, AuthApiResponseProcessor} from "../apis/AuthApi.ts"; +export class ObservableAuthApi { + private requestFactory: AuthApiRequestFactory; + private responseProcessor: AuthApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: AuthApiRequestFactory, + responseProcessor?: AuthApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new AuthApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new AuthApiResponseProcessor(); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfoWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.authenticationControllerInfo(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerInfoWithHttpInfo(rsp))); + })); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfo(_options?: Configuration): Observable { + return this.authenticationControllerInfoWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLoginWithHttpInfo(redirectUrl?: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.authenticationControllerLogin(redirectUrl, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerLoginWithHttpInfo(rsp))); + })); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLogin(redirectUrl?: string, _options?: Configuration): Observable { + return this.authenticationControllerLoginWithHttpInfo(redirectUrl, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogoutWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.authenticationControllerLogout(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerLogoutWithHttpInfo(rsp))); + })); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogout(_options?: Configuration): Observable { + return this.authenticationControllerLogoutWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPasswordWithHttpInfo(redirectUrl: string, loginHint: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.authenticationControllerResetPassword(redirectUrl, loginHint, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.authenticationControllerResetPasswordWithHttpInfo(rsp))); + })); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPassword(redirectUrl: string, loginHint: string, _options?: Configuration): Observable { + return this.authenticationControllerResetPasswordWithHttpInfo(redirectUrl, loginHint, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { Class2FAApiRequestFactory, Class2FAApiResponseProcessor} from "../apis/Class2FAApi.ts"; +export class ObservableClass2FAApi { + private requestFactory: Class2FAApiRequestFactory; + private responseProcessor: Class2FAApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: Class2FAApiRequestFactory, + responseProcessor?: Class2FAApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new Class2FAApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new Class2FAApiResponseProcessor(); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(rsp))); + })); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Observable { + return this.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerGetTwoAuthState(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(rsp))); + })); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthState(personId: string, _options?: Configuration): Observable { + return this.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(rsp))); + })); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Observable { + return this.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(rsp))); + })); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId: string, _options?: Configuration): Observable { + return this.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerResetToken(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(rsp))); + })); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetToken(personId: string, _options?: Configuration): Observable { + return this.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(rsp))); + })); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Observable { + return this.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { CronApiRequestFactory, CronApiResponseProcessor} from "../apis/CronApi.ts"; +export class ObservableCronApi { + private requestFactory: CronApiRequestFactory; + private responseProcessor: CronApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: CronApiRequestFactory, + responseProcessor?: CronApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new CronApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new CronApiResponseProcessor(); + } + + /** + */ + public cronControllerKoPersUserLockWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.cronControllerKoPersUserLock(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerKoPersUserLockWithHttpInfo(rsp))); + })); + } + + /** + */ + public cronControllerKoPersUserLock(_options?: Configuration): Observable { + return this.cronControllerKoPersUserLockWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + */ + public cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.cronControllerPersonWithoutOrgDelete(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerPersonWithoutOrgDeleteWithHttpInfo(rsp))); + })); + } + + /** + */ + public cronControllerPersonWithoutOrgDelete(_options?: Configuration): Observable { + return this.cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(rsp))); + })); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options?: Configuration): Observable { + return this.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.cronControllerUnlockUsersWithExpiredLocks(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(rsp))); + })); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocks(_options?: Configuration): Observable { + return this.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { DbiamPersonenkontexteApiRequestFactory, DbiamPersonenkontexteApiResponseProcessor} from "../apis/DbiamPersonenkontexteApi.ts"; +export class ObservableDbiamPersonenkontexteApi { + private requestFactory: DbiamPersonenkontexteApiRequestFactory; + private responseProcessor: DbiamPersonenkontexteApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenkontexteApiRequestFactory, + responseProcessor?: DbiamPersonenkontexteApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new DbiamPersonenkontexteApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new DbiamPersonenkontexteApiResponseProcessor(); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(rsp))); + })); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Observable { + return this.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId: string, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId: string, _options?: Configuration): Observable> { + return this.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + +} + +import { DbiamPersonenuebersichtApiRequestFactory, DbiamPersonenuebersichtApiResponseProcessor} from "../apis/DbiamPersonenuebersichtApi.ts"; +export class ObservableDbiamPersonenuebersichtApi { + private requestFactory: DbiamPersonenuebersichtApiRequestFactory; + private responseProcessor: DbiamPersonenuebersichtApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenuebersichtApiRequestFactory, + responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new DbiamPersonenuebersichtApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new DbiamPersonenuebersichtApiResponseProcessor(); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(rsp))); + })); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Observable { + return this.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId: string, _options?: Configuration): Observable { + return this.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { ImportApiRequestFactory, ImportApiResponseProcessor} from "../apis/ImportApi.ts"; +export class ObservableImportApi { + private requestFactory: ImportApiRequestFactory; + private responseProcessor: ImportApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: ImportApiRequestFactory, + responseProcessor?: ImportApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new ImportApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new ImportApiResponseProcessor(); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransactionWithHttpInfo(importvorgangId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.importControllerDeleteImportTransaction(importvorgangId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.importControllerDeleteImportTransactionWithHttpInfo(rsp))); + })); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransaction(importvorgangId: string, _options?: Configuration): Observable { + return this.importControllerDeleteImportTransactionWithHttpInfo(importvorgangId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.importControllerExecuteImport(importvorgangByIdBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.importControllerExecuteImportWithHttpInfo(rsp))); + })); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImport(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Observable { + return this.importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFileWithHttpInfo(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.importControllerUploadFile(organisationId, rolleId, file, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.importControllerUploadFileWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFile(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Observable { + return this.importControllerUploadFileWithHttpInfo(organisationId, rolleId, file, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { OrganisationenApiRequestFactory, OrganisationenApiResponseProcessor} from "../apis/OrganisationenApi.ts"; +export class ObservableOrganisationenApi { + private requestFactory: OrganisationenApiRequestFactory; + private responseProcessor: OrganisationenApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: OrganisationenApiRequestFactory, + responseProcessor?: OrganisationenApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new OrganisationenApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new OrganisationenApiResponseProcessor(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerAddAdministrierteOrganisation(organisationId, organisationByIdBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerAddAdministrierteOrganisationWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable { + return this.organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerAddZugehoerigeOrganisation(organisationId, organisationByIdBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Observable { + return this.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerCreateOrganisation(createOrganisationBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerCreateOrganisationWithHttpInfo(rsp))); + })); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisation(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Observable { + return this.organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasseWithHttpInfo(organisationId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerDeleteKlasse(organisationId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerDeleteKlasseWithHttpInfo(rsp))); + })); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasse(organisationId: string, _options?: Configuration): Observable { + return this.organisationControllerDeleteKlasseWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearningWithHttpInfo(organisationId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerEnableForitslearning(organisationId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerEnableForitslearningWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearning(organisationId: string, _options?: Configuration): Observable { + return this.organisationControllerEnableForitslearningWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationByIdWithHttpInfo(organisationId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerFindOrganisationById(organisationId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerFindOrganisationByIdWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationById(organisationId: string, _options?: Configuration): Observable { + return this.organisationControllerFindOrganisationByIdWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizationsWithHttpInfo(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.organisationControllerFindOrganizations(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerFindOrganizationsWithHttpInfo(rsp))); + })); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizations(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Observable> { + return this.organisationControllerFindOrganizationsWithHttpInfo(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.organisationControllerGetAdministrierteOrganisationen(organisationId, offset, limit, searchFilter, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationen(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Observable> { + return this.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId, offset, limit, searchFilter, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetParentsByIdsWithHttpInfo(rsp))); + })); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Observable { + return this.organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + */ + public organisationControllerGetRootChildrenWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerGetRootChildren(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetRootChildrenWithHttpInfo(rsp))); + })); + } + + /** + */ + public organisationControllerGetRootChildren(_options?: Configuration): Observable { + return this.organisationControllerGetRootChildrenWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + */ + public organisationControllerGetRootOrganisationWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerGetRootOrganisation(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetRootOrganisationWithHttpInfo(rsp))); + })); + } + + /** + */ + public organisationControllerGetRootOrganisation(_options?: Configuration): Observable { + return this.organisationControllerGetRootOrganisationWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId: string, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.organisationControllerGetZugehoerigeOrganisationen(organisationId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationen(organisationId: string, _options?: Configuration): Observable> { + return this.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisationWithHttpInfo(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerUpdateOrganisation(organisationId, updateOrganisationBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerUpdateOrganisationWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisation(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Observable { + return this.organisationControllerUpdateOrganisationWithHttpInfo(organisationId, updateOrganisationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.organisationControllerUpdateOrganisationName(organisationId, organisationByNameBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.organisationControllerUpdateOrganisationNameWithHttpInfo(rsp))); + })); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationName(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Observable { + return this.organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId, organisationByNameBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { PersonAdministrationApiRequestFactory, PersonAdministrationApiResponseProcessor} from "../apis/PersonAdministrationApi.ts"; +export class ObservablePersonAdministrationApi { + private requestFactory: PersonAdministrationApiRequestFactory; + private responseProcessor: PersonAdministrationApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonAdministrationApiRequestFactory, + responseProcessor?: PersonAdministrationApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new PersonAdministrationApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new PersonAdministrationApiResponseProcessor(); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollenWithHttpInfo(rolleName?: string, limit?: number, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personAdministrationControllerFindRollen(rolleName, limit, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personAdministrationControllerFindRollenWithHttpInfo(rsp))); + })); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollen(rolleName?: string, limit?: number, _options?: Configuration): Observable { + return this.personAdministrationControllerFindRollenWithHttpInfo(rolleName, limit, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { PersonInfoApiRequestFactory, PersonInfoApiResponseProcessor} from "../apis/PersonInfoApi.ts"; +export class ObservablePersonInfoApi { + private requestFactory: PersonInfoApiRequestFactory; + private responseProcessor: PersonInfoApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonInfoApiRequestFactory, + responseProcessor?: PersonInfoApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new PersonInfoApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new PersonInfoApiResponseProcessor(); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfoWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personInfoControllerInfo(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personInfoControllerInfoWithHttpInfo(rsp))); + })); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfo(_options?: Configuration): Observable { + return this.personInfoControllerInfoWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { PersonenApiRequestFactory, PersonenApiResponseProcessor} from "../apis/PersonenApi.ts"; +export class ObservablePersonenApi { + private requestFactory: PersonenApiRequestFactory; + private responseProcessor: PersonenApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenApiRequestFactory, + responseProcessor?: PersonenApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new PersonenApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new PersonenApiResponseProcessor(); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerCreatePersonMigration(createPersonMigrationBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerCreatePersonMigrationWithHttpInfo(rsp))); + })); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigration(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Observable { + return this.personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontextWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerCreatePersonenkontext(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerCreatePersonenkontextWithHttpInfo(rsp))); + })); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontext(personId: string, _options?: Configuration): Observable { + return this.personControllerCreatePersonenkontextWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonByIdWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerDeletePersonById(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerDeletePersonByIdWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonById(personId: string, _options?: Configuration): Observable { + return this.personControllerDeletePersonByIdWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonByIdWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerFindPersonById(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerFindPersonByIdWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonById(personId: string, _options?: Configuration): Observable { + return this.personControllerFindPersonByIdWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexteWithHttpInfo(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerFindPersonenkontexte(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerFindPersonenkontexteWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexte(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable { + return this.personControllerFindPersonenkontexteWithHttpInfo(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.personControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerFindPersonsWithHttpInfo(rsp))); + })); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable> { + return this.personControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPersonWithHttpInfo(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerLockPerson(personId, lockUserBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerLockPersonWithHttpInfo(rsp))); + })); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPerson(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Observable { + return this.personControllerLockPersonWithHttpInfo(personId, lockUserBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonIdWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerResetPasswordByPersonId(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerResetPasswordByPersonIdWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonId(personId: string, _options?: Configuration): Observable { + return this.personControllerResetPasswordByPersonIdWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId + */ + public personControllerSyncPersonWithHttpInfo(personId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerSyncPerson(personId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerSyncPersonWithHttpInfo(rsp))); + })); + } + + /** + * @param personId + */ + public personControllerSyncPerson(personId: string, _options?: Configuration): Observable { + return this.personControllerSyncPersonWithHttpInfo(personId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadataWithHttpInfo(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerUpdateMetadata(personId, personMetadataBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerUpdateMetadataWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadata(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Observable { + return this.personControllerUpdateMetadataWithHttpInfo(personId, personMetadataBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePersonWithHttpInfo(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personControllerUpdatePerson(personId, updatePersonBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personControllerUpdatePersonWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePerson(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Observable { + return this.personControllerUpdatePersonWithHttpInfo(personId, updatePersonBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { PersonenFrontendApiRequestFactory, PersonenFrontendApiResponseProcessor} from "../apis/PersonenFrontendApi.ts"; +export class ObservablePersonenFrontendApi { + private requestFactory: PersonenFrontendApiRequestFactory; + private responseProcessor: PersonenFrontendApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenFrontendApiRequestFactory, + responseProcessor?: PersonenFrontendApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new PersonenFrontendApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new PersonenFrontendApiResponseProcessor(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personFrontendControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personFrontendControllerFindPersonsWithHttpInfo(rsp))); + })); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Observable { + return this.personFrontendControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { PersonenkontextApiRequestFactory, PersonenkontextApiResponseProcessor} from "../apis/PersonenkontextApi.ts"; +export class ObservablePersonenkontextApi { + private requestFactory: PersonenkontextApiRequestFactory; + private responseProcessor: PersonenkontextApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontextApiRequestFactory, + responseProcessor?: PersonenkontextApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new PersonenkontextApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new PersonenkontextApiResponseProcessor(); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerCommit(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommit(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Observable { + return this.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(rsp))); + })); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Observable { + return this.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId, sskName, limit, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rsp))); + })); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Observable { + return this.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId, sskName, limit, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.dbiamPersonenkontextWorkflowControllerProcessStep(organisationId, rolleId, rolleName, organisationName, limit, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(rsp))); + })); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStep(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Observable { + return this.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId, rolleId, rolleName, organisationName, limit, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { PersonenkontexteApiRequestFactory, PersonenkontexteApiResponseProcessor} from "../apis/PersonenkontexteApi.ts"; +export class ObservablePersonenkontexteApi { + private requestFactory: PersonenkontexteApiRequestFactory; + private responseProcessor: PersonenkontexteApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontexteApiRequestFactory, + responseProcessor?: PersonenkontexteApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new PersonenkontexteApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new PersonenkontexteApiResponseProcessor(); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personenkontextControllerDeletePersonenkontextById(personenkontextId, deleteRevisionBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(rsp))); + })); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextById(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Observable { + return this.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId, deleteRevisionBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personenkontextControllerFindPersonenkontextById(personenkontextId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(rsp))); + })); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextById(personenkontextId: string, _options?: Configuration): Observable { + return this.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexteWithHttpInfo(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.personenkontextControllerFindPersonenkontexte(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerFindPersonenkontexteWithHttpInfo(rsp))); + })); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexte(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Observable> { + return this.personenkontextControllerFindPersonenkontexteWithHttpInfo(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRechtWithHttpInfo(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personenkontextControllerHatSystemRecht(personId, systemRecht, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerHatSystemRechtWithHttpInfo(rsp))); + })); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRecht(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Observable { + return this.personenkontextControllerHatSystemRechtWithHttpInfo(personId, systemRecht, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.personenkontextControllerUpdatePersonenkontextWithId(personenkontextId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(rsp))); + })); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithId(personenkontextId: string, _options?: Configuration): Observable { + return this.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { ProviderApiRequestFactory, ProviderApiResponseProcessor} from "../apis/ProviderApi.ts"; +export class ObservableProviderApi { + private requestFactory: ProviderApiRequestFactory; + private responseProcessor: ProviderApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: ProviderApiRequestFactory, + responseProcessor?: ProviderApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new ProviderApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new ProviderApiResponseProcessor(); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProvidersWithHttpInfo(_options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.providerControllerGetAllServiceProviders(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.providerControllerGetAllServiceProvidersWithHttpInfo(rsp))); + })); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProviders(_options?: Configuration): Observable> { + return this.providerControllerGetAllServiceProvidersWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProvidersWithHttpInfo(_options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.providerControllerGetAvailableServiceProviders(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.providerControllerGetAvailableServiceProvidersWithHttpInfo(rsp))); + })); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProviders(_options?: Configuration): Observable> { + return this.providerControllerGetAvailableServiceProvidersWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogoWithHttpInfo(angebotId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.providerControllerGetServiceProviderLogo(angebotId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.providerControllerGetServiceProviderLogoWithHttpInfo(rsp))); + })); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogo(angebotId: string, _options?: Configuration): Observable { + return this.providerControllerGetServiceProviderLogoWithHttpInfo(angebotId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} + +import { RolleApiRequestFactory, RolleApiResponseProcessor} from "../apis/RolleApi.ts"; +export class ObservableRolleApi { + private requestFactory: RolleApiRequestFactory; + private responseProcessor: RolleApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: RolleApiRequestFactory, + responseProcessor?: RolleApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new RolleApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new RolleApiResponseProcessor(); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRechtWithHttpInfo(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerAddSystemRecht(rolleId, addSystemrechtBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerAddSystemRechtWithHttpInfo(rsp))); + })); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRecht(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Observable { + return this.rolleControllerAddSystemRechtWithHttpInfo(rolleId, addSystemrechtBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerCreateRolle(createRolleBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerCreateRolleWithHttpInfo(rsp))); + })); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolle(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Observable { + return this.rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolleWithHttpInfo(rolleId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerDeleteRolle(rolleId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerDeleteRolleWithHttpInfo(rsp))); + })); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolle(rolleId: string, _options?: Configuration): Observable { + return this.rolleControllerDeleteRolleWithHttpInfo(rolleId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerFindRolleByIdWithServiceProviders(rolleId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rsp))); + })); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProviders(rolleId: string, _options?: Configuration): Observable { + return this.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollenWithHttpInfo(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.rolleControllerFindRollen(offset, limit, searchStr, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerFindRollenWithHttpInfo(rsp))); + })); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollen(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Observable> { + return this.rolleControllerFindRollenWithHttpInfo(offset, limit, searchStr, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId: string, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerGetRolleServiceProviderIds(rolleId, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rsp))); + })); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIds(rolleId: string, _options?: Configuration): Observable { + return this.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerRemoveServiceProviderById(rolleId, rolleServiceProviderBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerRemoveServiceProviderByIdWithHttpInfo(rsp))); + })); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable { + return this.rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolleWithHttpInfo(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.rolleControllerUpdateRolle(rolleId, updateRolleBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerUpdateRolleWithHttpInfo(rsp))); + })); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolle(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Observable { + return this.rolleControllerUpdateRolleWithHttpInfo(rolleId, updateRolleBodyParams, _options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable>> { + const requestContextPromise = this.requestFactory.rolleControllerUpdateServiceProvidersById(rolleId, rolleServiceProviderBodyParams, _options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rsp))); + })); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Observable> { + return this.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options).pipe(map((apiResponse: HttpInfo>) => apiResponse.data)); + } + +} + +import { StatusApiRequestFactory, StatusApiResponseProcessor} from "../apis/StatusApi.ts"; +export class ObservableStatusApi { + private requestFactory: StatusApiRequestFactory; + private responseProcessor: StatusApiResponseProcessor; + private configuration: Configuration; + + public constructor( + configuration: Configuration, + requestFactory?: StatusApiRequestFactory, + responseProcessor?: StatusApiResponseProcessor + ) { + this.configuration = configuration; + this.requestFactory = requestFactory || new StatusApiRequestFactory(configuration); + this.responseProcessor = responseProcessor || new StatusApiResponseProcessor(); + } + + /** + */ + public statusControllerGetStatusWithHttpInfo(_options?: Configuration): Observable> { + const requestContextPromise = this.requestFactory.statusControllerGetStatus(_options); + + // build promise chain + let middlewarePreObservable = from(requestContextPromise); + for (const middleware of this.configuration.middleware) { + middlewarePreObservable = middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => middleware.pre(ctx))); + } + + return middlewarePreObservable.pipe(mergeMap((ctx: RequestContext) => this.configuration.httpApi.send(ctx))). + pipe(mergeMap((response: ResponseContext) => { + let middlewarePostObservable = of(response); + for (const middleware of this.configuration.middleware) { + middlewarePostObservable = middlewarePostObservable.pipe(mergeMap((rsp: ResponseContext) => middleware.post(rsp))); + } + return middlewarePostObservable.pipe(map((rsp: ResponseContext) => this.responseProcessor.statusControllerGetStatusWithHttpInfo(rsp))); + })); + } + + /** + */ + public statusControllerGetStatus(_options?: Configuration): Observable { + return this.statusControllerGetStatusWithHttpInfo(_options).pipe(map((apiResponse: HttpInfo) => apiResponse.data)); + } + +} diff --git a/loadtest/api-client/generated/types/PromiseAPI.ts b/loadtest/api-client/generated/types/PromiseAPI.ts new file mode 100644 index 0000000..9978c90 --- /dev/null +++ b/loadtest/api-client/generated/types/PromiseAPI.ts @@ -0,0 +1,1715 @@ +import { ResponseContext, RequestContext, HttpFile, HttpInfo } from '../http/http.ts'; +import { Configuration} from '../configuration.ts' + +import { AddSystemrechtBodyParams } from '../models/AddSystemrechtBodyParams.ts'; +import { AssignHardwareTokenBodyParams } from '../models/AssignHardwareTokenBodyParams.ts'; +import { AssignHardwareTokenResponse } from '../models/AssignHardwareTokenResponse.ts'; +import { CreateOrganisationBodyParams } from '../models/CreateOrganisationBodyParams.ts'; +import { CreatePersonMigrationBodyParams } from '../models/CreatePersonMigrationBodyParams.ts'; +import { CreateRolleBodyParams } from '../models/CreateRolleBodyParams.ts'; +import { DBiamPersonResponse } from '../models/DBiamPersonResponse.ts'; +import { DBiamPersonenkontextResponse } from '../models/DBiamPersonenkontextResponse.ts'; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from '../models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response.ts'; +import { DBiamPersonenuebersichtResponse } from '../models/DBiamPersonenuebersichtResponse.ts'; +import { DBiamPersonenzuordnungResponse } from '../models/DBiamPersonenzuordnungResponse.ts'; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from '../models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts'; +import { DbiamCreatePersonenkontextBodyParams } from '../models/DbiamCreatePersonenkontextBodyParams.ts'; +import { DbiamImportError } from '../models/DbiamImportError.ts'; +import { DbiamOrganisationError } from '../models/DbiamOrganisationError.ts'; +import { DbiamPersonError } from '../models/DbiamPersonError.ts'; +import { DbiamPersonenkontextBodyParams } from '../models/DbiamPersonenkontextBodyParams.ts'; +import { DbiamPersonenkontextError } from '../models/DbiamPersonenkontextError.ts'; +import { DbiamPersonenkontextMigrationBodyParams } from '../models/DbiamPersonenkontextMigrationBodyParams.ts'; +import { DbiamPersonenkontexteUpdateError } from '../models/DbiamPersonenkontexteUpdateError.ts'; +import { DbiamRolleError } from '../models/DbiamRolleError.ts'; +import { DbiamUpdatePersonenkontexteBodyParams } from '../models/DbiamUpdatePersonenkontexteBodyParams.ts'; +import { DeleteRevisionBodyParams } from '../models/DeleteRevisionBodyParams.ts'; +import { EmailAddressStatus } from '../models/EmailAddressStatus.ts'; +import { FindRollenResponse } from '../models/FindRollenResponse.ts'; +import { FindSchulstrukturknotenResponse } from '../models/FindSchulstrukturknotenResponse.ts'; +import { Geschlecht } from '../models/Geschlecht.ts'; +import { ImportDataItemResponse } from '../models/ImportDataItemResponse.ts'; +import { ImportUploadResponse } from '../models/ImportUploadResponse.ts'; +import { ImportvorgangByIdBodyParams } from '../models/ImportvorgangByIdBodyParams.ts'; +import { LockUserBodyParams } from '../models/LockUserBodyParams.ts'; +import { LoeschungResponse } from '../models/LoeschungResponse.ts'; +import { OrganisationByIdBodyParams } from '../models/OrganisationByIdBodyParams.ts'; +import { OrganisationByNameBodyParams } from '../models/OrganisationByNameBodyParams.ts'; +import { OrganisationResponse } from '../models/OrganisationResponse.ts'; +import { OrganisationResponseLegacy } from '../models/OrganisationResponseLegacy.ts'; +import { OrganisationRootChildrenResponse } from '../models/OrganisationRootChildrenResponse.ts'; +import { OrganisationsTyp } from '../models/OrganisationsTyp.ts'; +import { ParentOrganisationenResponse } from '../models/ParentOrganisationenResponse.ts'; +import { ParentOrganisationsByIdsBodyParams } from '../models/ParentOrganisationsByIdsBodyParams.ts'; +import { Person } from '../models/Person.ts'; +import { PersonBirthParams } from '../models/PersonBirthParams.ts'; +import { PersonBirthResponse } from '../models/PersonBirthResponse.ts'; +import { PersonControllerFindPersonenkontexte200Response } from '../models/PersonControllerFindPersonenkontexte200Response.ts'; +import { PersonEmailResponse } from '../models/PersonEmailResponse.ts'; +import { PersonFrontendControllerFindPersons200Response } from '../models/PersonFrontendControllerFindPersons200Response.ts'; +import { PersonIdResponse } from '../models/PersonIdResponse.ts'; +import { PersonInfoResponse } from '../models/PersonInfoResponse.ts'; +import { PersonLockResponse } from '../models/PersonLockResponse.ts'; +import { PersonMetadataBodyParams } from '../models/PersonMetadataBodyParams.ts'; +import { PersonNameParams } from '../models/PersonNameParams.ts'; +import { PersonNameResponse } from '../models/PersonNameResponse.ts'; +import { PersonResponse } from '../models/PersonResponse.ts'; +import { PersonResponseAutomapper } from '../models/PersonResponseAutomapper.ts'; +import { PersonendatensatzResponse } from '../models/PersonendatensatzResponse.ts'; +import { PersonendatensatzResponseAutomapper } from '../models/PersonendatensatzResponseAutomapper.ts'; +import { PersonenkontextMigrationRuntype } from '../models/PersonenkontextMigrationRuntype.ts'; +import { PersonenkontextResponse } from '../models/PersonenkontextResponse.ts'; +import { PersonenkontextRolleFieldsResponse } from '../models/PersonenkontextRolleFieldsResponse.ts'; +import { PersonenkontextWorkflowResponse } from '../models/PersonenkontextWorkflowResponse.ts'; +import { PersonenkontextdatensatzResponse } from '../models/PersonenkontextdatensatzResponse.ts'; +import { PersonenkontexteUpdateResponse } from '../models/PersonenkontexteUpdateResponse.ts'; +import { Personenstatus } from '../models/Personenstatus.ts'; +import { PersonenuebersichtBodyParams } from '../models/PersonenuebersichtBodyParams.ts'; +import { RawPagedResponse } from '../models/RawPagedResponse.ts'; +import { RolleResponse } from '../models/RolleResponse.ts'; +import { RolleServiceProviderBodyParams } from '../models/RolleServiceProviderBodyParams.ts'; +import { RolleServiceProviderResponse } from '../models/RolleServiceProviderResponse.ts'; +import { RolleWithServiceProvidersResponse } from '../models/RolleWithServiceProvidersResponse.ts'; +import { RollenArt } from '../models/RollenArt.ts'; +import { RollenMerkmal } from '../models/RollenMerkmal.ts'; +import { RollenSystemRecht } from '../models/RollenSystemRecht.ts'; +import { RollenSystemRechtServiceProviderIDResponse } from '../models/RollenSystemRechtServiceProviderIDResponse.ts'; +import { ServiceProviderIdNameResponse } from '../models/ServiceProviderIdNameResponse.ts'; +import { ServiceProviderKategorie } from '../models/ServiceProviderKategorie.ts'; +import { ServiceProviderResponse } from '../models/ServiceProviderResponse.ts'; +import { ServiceProviderTarget } from '../models/ServiceProviderTarget.ts'; +import { Sichtfreigabe } from '../models/Sichtfreigabe.ts'; +import { SystemrechtResponse } from '../models/SystemrechtResponse.ts'; +import { TokenInitBodyParams } from '../models/TokenInitBodyParams.ts'; +import { TokenRequiredResponse } from '../models/TokenRequiredResponse.ts'; +import { TokenStateResponse } from '../models/TokenStateResponse.ts'; +import { TokenVerifyBodyParams } from '../models/TokenVerifyBodyParams.ts'; +import { TraegerschaftTyp } from '../models/TraegerschaftTyp.ts'; +import { UpdateOrganisationBodyParams } from '../models/UpdateOrganisationBodyParams.ts'; +import { UpdatePersonBodyParams } from '../models/UpdatePersonBodyParams.ts'; +import { UpdateRolleBodyParams } from '../models/UpdateRolleBodyParams.ts'; +import { UserLockParams } from '../models/UserLockParams.ts'; +import { UserinfoResponse } from '../models/UserinfoResponse.ts'; +import { Vertrauensstufe } from '../models/Vertrauensstufe.ts'; +import { ObservableAuthApi } from './ObservableAPI.ts'; + +import { AuthApiRequestFactory, AuthApiResponseProcessor} from "../apis/AuthApi.ts"; +export class PromiseAuthApi { + private api: ObservableAuthApi + + public constructor( + configuration: Configuration, + requestFactory?: AuthApiRequestFactory, + responseProcessor?: AuthApiResponseProcessor + ) { + this.api = new ObservableAuthApi(configuration, requestFactory, responseProcessor); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfoWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.authenticationControllerInfoWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Info about logged in user. + */ + public authenticationControllerInfo(_options?: Configuration): Promise { + const result = this.api.authenticationControllerInfo(_options); + return result.toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLoginWithHttpInfo(redirectUrl?: string, _options?: Configuration): Promise> { + const result = this.api.authenticationControllerLoginWithHttpInfo(redirectUrl, _options); + return result.toPromise(); + } + + /** + * Used to start OIDC authentication. + * @param [redirectUrl] + */ + public authenticationControllerLogin(redirectUrl?: string, _options?: Configuration): Promise { + const result = this.api.authenticationControllerLogin(redirectUrl, _options); + return result.toPromise(); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogoutWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.authenticationControllerLogoutWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Used to log out the current user. + */ + public authenticationControllerLogout(_options?: Configuration): Promise { + const result = this.api.authenticationControllerLogout(_options); + return result.toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPasswordWithHttpInfo(redirectUrl: string, loginHint: string, _options?: Configuration): Promise> { + const result = this.api.authenticationControllerResetPasswordWithHttpInfo(redirectUrl, loginHint, _options); + return result.toPromise(); + } + + /** + * Redirect to Keycloak password reset. + * @param redirectUrl + * @param loginHint + */ + public authenticationControllerResetPassword(redirectUrl: string, loginHint: string, _options?: Configuration): Promise { + const result = this.api.authenticationControllerResetPassword(redirectUrl, loginHint, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableClass2FAApi } from './ObservableAPI.ts'; + +import { Class2FAApiRequestFactory, Class2FAApiResponseProcessor} from "../apis/Class2FAApi.ts"; +export class PromiseClass2FAApi { + private api: ObservableClass2FAApi + + public constructor( + configuration: Configuration, + requestFactory?: Class2FAApiRequestFactory, + responseProcessor?: Class2FAApiResponseProcessor + ) { + this.api = new ObservableClass2FAApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Promise> { + const result = this.api.privacyIdeaAdministrationControllerAssignHardwareTokenWithHttpInfo(assignHardwareTokenBodyParams, _options); + return result.toPromise(); + } + + /** + * @param assignHardwareTokenBodyParams + */ + public privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams: AssignHardwareTokenBodyParams, _options?: Configuration): Promise { + const result = this.api.privacyIdeaAdministrationControllerAssignHardwareToken(assignHardwareTokenBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.privacyIdeaAdministrationControllerGetTwoAuthStateWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerGetTwoAuthState(personId: string, _options?: Configuration): Promise { + const result = this.api.privacyIdeaAdministrationControllerGetTwoAuthState(personId, _options); + return result.toPromise(); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Promise> { + const result = this.api.privacyIdeaAdministrationControllerInitializeSoftwareTokenWithHttpInfo(tokenInitBodyParams, _options); + return result.toPromise(); + } + + /** + * @param tokenInitBodyParams + */ + public privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams: TokenInitBodyParams, _options?: Configuration): Promise { + const result = this.api.privacyIdeaAdministrationControllerInitializeSoftwareToken(tokenInitBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthenticationWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId: string, _options?: Configuration): Promise { + const result = this.api.privacyIdeaAdministrationControllerRequiresTwoFactorAuthentication(personId, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.privacyIdeaAdministrationControllerResetTokenWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public privacyIdeaAdministrationControllerResetToken(personId: string, _options?: Configuration): Promise { + const result = this.api.privacyIdeaAdministrationControllerResetToken(personId, _options); + return result.toPromise(); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Promise> { + const result = this.api.privacyIdeaAdministrationControllerVerifyTokenWithHttpInfo(tokenVerifyBodyParams, _options); + return result.toPromise(); + } + + /** + * @param tokenVerifyBodyParams + */ + public privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams: TokenVerifyBodyParams, _options?: Configuration): Promise { + const result = this.api.privacyIdeaAdministrationControllerVerifyToken(tokenVerifyBodyParams, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableCronApi } from './ObservableAPI.ts'; + +import { CronApiRequestFactory, CronApiResponseProcessor} from "../apis/CronApi.ts"; +export class PromiseCronApi { + private api: ObservableCronApi + + public constructor( + configuration: Configuration, + requestFactory?: CronApiRequestFactory, + responseProcessor?: CronApiResponseProcessor + ) { + this.api = new ObservableCronApi(configuration, requestFactory, responseProcessor); + } + + /** + */ + public cronControllerKoPersUserLockWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.cronControllerKoPersUserLockWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerKoPersUserLock(_options?: Configuration): Promise { + const result = this.api.cronControllerKoPersUserLock(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.cronControllerPersonWithoutOrgDeleteWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerPersonWithoutOrgDelete(_options?: Configuration): Promise { + const result = this.api.cronControllerPersonWithoutOrgDelete(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsersWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options?: Configuration): Promise { + const result = this.api.cronControllerRemovePersonenKontexteWithExpiredBefristungFromUsers(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.cronControllerUnlockUsersWithExpiredLocksWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public cronControllerUnlockUsersWithExpiredLocks(_options?: Configuration): Promise { + const result = this.api.cronControllerUnlockUsersWithExpiredLocks(_options); + return result.toPromise(); + } + + +} + + + +import { ObservableDbiamPersonenkontexteApi } from './ObservableAPI.ts'; + +import { DbiamPersonenkontexteApiRequestFactory, DbiamPersonenkontexteApiResponseProcessor} from "../apis/DbiamPersonenkontexteApi.ts"; +export class PromiseDbiamPersonenkontexteApi { + private api: ObservableDbiamPersonenkontexteApi + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenkontexteApiRequestFactory, + responseProcessor?: DbiamPersonenkontexteApiResponseProcessor + ) { + this.api = new ObservableDbiamPersonenkontexteApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Promise> { + const result = this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigrationWithHttpInfo(dbiamPersonenkontextMigrationBodyParams, _options); + return result.toPromise(); + } + + /** + * @param dbiamPersonenkontextMigrationBodyParams + */ + public dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams: DbiamPersonenkontextMigrationBodyParams, _options?: Configuration): Promise { + const result = this.api.dBiamPersonenkontextControllerCreatePersonenkontextMigration(dbiamPersonenkontextMigrationBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId: string, _options?: Configuration): Promise>> { + const result = this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPersonWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId: string, _options?: Configuration): Promise> { + const result = this.api.dBiamPersonenkontextControllerFindPersonenkontextsByPerson(personId, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableDbiamPersonenuebersichtApi } from './ObservableAPI.ts'; + +import { DbiamPersonenuebersichtApiRequestFactory, DbiamPersonenuebersichtApiResponseProcessor} from "../apis/DbiamPersonenuebersichtApi.ts"; +export class PromiseDbiamPersonenuebersichtApi { + private api: ObservableDbiamPersonenuebersichtApi + + public constructor( + configuration: Configuration, + requestFactory?: DbiamPersonenuebersichtApiRequestFactory, + responseProcessor?: DbiamPersonenuebersichtApiResponseProcessor + ) { + this.api = new ObservableDbiamPersonenuebersichtApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Promise> { + const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenWithHttpInfo(personenuebersichtBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personenuebersichtBodyParams + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams: PersonenuebersichtBodyParams, _options?: Configuration): Promise { + const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichten(personenuebersichtBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPersonWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + */ + public dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId: string, _options?: Configuration): Promise { + const result = this.api.dBiamPersonenuebersichtControllerFindPersonenuebersichtenByPerson(personId, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableImportApi } from './ObservableAPI.ts'; + +import { ImportApiRequestFactory, ImportApiResponseProcessor} from "../apis/ImportApi.ts"; +export class PromiseImportApi { + private api: ObservableImportApi + + public constructor( + configuration: Configuration, + requestFactory?: ImportApiRequestFactory, + responseProcessor?: ImportApiResponseProcessor + ) { + this.api = new ObservableImportApi(configuration, requestFactory, responseProcessor); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransactionWithHttpInfo(importvorgangId: string, _options?: Configuration): Promise> { + const result = this.api.importControllerDeleteImportTransactionWithHttpInfo(importvorgangId, _options); + return result.toPromise(); + } + + /** + * Delete a role by id. + * + * @param importvorgangId The id of an import transaction + */ + public importControllerDeleteImportTransaction(importvorgangId: string, _options?: Configuration): Promise { + const result = this.api.importControllerDeleteImportTransaction(importvorgangId, _options); + return result.toPromise(); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Promise> { + const result = this.api.importControllerExecuteImportWithHttpInfo(importvorgangByIdBodyParams, _options); + return result.toPromise(); + } + + /** + * @param importvorgangByIdBodyParams + */ + public importControllerExecuteImport(importvorgangByIdBodyParams: ImportvorgangByIdBodyParams, _options?: Configuration): Promise { + const result = this.api.importControllerExecuteImport(importvorgangByIdBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFileWithHttpInfo(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Promise> { + const result = this.api.importControllerUploadFileWithHttpInfo(organisationId, rolleId, file, _options); + return result.toPromise(); + } + + /** + * @param organisationId + * @param rolleId + * @param file + */ + public importControllerUploadFile(organisationId: string, rolleId: string, file: HttpFile, _options?: Configuration): Promise { + const result = this.api.importControllerUploadFile(organisationId, rolleId, file, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableOrganisationenApi } from './ObservableAPI.ts'; + +import { OrganisationenApiRequestFactory, OrganisationenApiResponseProcessor} from "../apis/OrganisationenApi.ts"; +export class PromiseOrganisationenApi { + private api: ObservableOrganisationenApi + + public constructor( + configuration: Configuration, + requestFactory?: OrganisationenApiRequestFactory, + responseProcessor?: OrganisationenApiResponseProcessor + ) { + this.api = new ObservableOrganisationenApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise> { + const result = this.api.organisationControllerAddAdministrierteOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddAdministrierteOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { + const result = this.api.organisationControllerAddAdministrierteOrganisation(organisationId, organisationByIdBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise> { + const result = this.api.organisationControllerAddZugehoerigeOrganisationWithHttpInfo(organisationId, organisationByIdBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByIdBodyParams + */ + public organisationControllerAddZugehoerigeOrganisation(organisationId: string, organisationByIdBodyParams: OrganisationByIdBodyParams, _options?: Configuration): Promise { + const result = this.api.organisationControllerAddZugehoerigeOrganisation(organisationId, organisationByIdBodyParams, _options); + return result.toPromise(); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Promise> { + const result = this.api.organisationControllerCreateOrganisationWithHttpInfo(createOrganisationBodyParams, _options); + return result.toPromise(); + } + + /** + * @param createOrganisationBodyParams + */ + public organisationControllerCreateOrganisation(createOrganisationBodyParams: CreateOrganisationBodyParams, _options?: Configuration): Promise { + const result = this.api.organisationControllerCreateOrganisation(createOrganisationBodyParams, _options); + return result.toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasseWithHttpInfo(organisationId: string, _options?: Configuration): Promise> { + const result = this.api.organisationControllerDeleteKlasseWithHttpInfo(organisationId, _options); + return result.toPromise(); + } + + /** + * Delete an organisation of type Klasse by id. + * + * @param organisationId The id of an organization + */ + public organisationControllerDeleteKlasse(organisationId: string, _options?: Configuration): Promise { + const result = this.api.organisationControllerDeleteKlasse(organisationId, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearningWithHttpInfo(organisationId: string, _options?: Configuration): Promise> { + const result = this.api.organisationControllerEnableForitslearningWithHttpInfo(organisationId, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerEnableForitslearning(organisationId: string, _options?: Configuration): Promise { + const result = this.api.organisationControllerEnableForitslearning(organisationId, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationByIdWithHttpInfo(organisationId: string, _options?: Configuration): Promise> { + const result = this.api.organisationControllerFindOrganisationByIdWithHttpInfo(organisationId, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerFindOrganisationById(organisationId: string, _options?: Configuration): Promise { + const result = this.api.organisationControllerFindOrganisationById(organisationId, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizationsWithHttpInfo(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Promise>> { + const result = this.api.organisationControllerFindOrganizationsWithHttpInfo(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [kennung] + * @param [name] + * @param [searchString] + * @param [typ] + * @param [systemrechte] + * @param [excludeTyp] + * @param [administriertVon] + * @param [organisationIds] Liefert Organisationen mit den angegebenen IDs, selbst wenn andere Filterkriterien nicht zutreffen (ODER-verknüpft mit anderen Kriterien). + */ + public organisationControllerFindOrganizations(offset?: number, limit?: number, kennung?: string, name?: string, searchString?: string, typ?: OrganisationsTyp, systemrechte?: Array, excludeTyp?: Array, administriertVon?: Array, organisationIds?: Array, _options?: Configuration): Promise> { + const result = this.api.organisationControllerFindOrganizations(offset, limit, kennung, name, searchString, typ, systemrechte, excludeTyp, administriertVon, organisationIds, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Promise>> { + const result = this.api.organisationControllerGetAdministrierteOrganisationenWithHttpInfo(organisationId, offset, limit, searchFilter, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchFilter] + */ + public organisationControllerGetAdministrierteOrganisationen(organisationId: string, offset?: number, limit?: number, searchFilter?: string, _options?: Configuration): Promise> { + const result = this.api.organisationControllerGetAdministrierteOrganisationen(organisationId, offset, limit, searchFilter, _options); + return result.toPromise(); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Promise> { + const result = this.api.organisationControllerGetParentsByIdsWithHttpInfo(parentOrganisationsByIdsBodyParams, _options); + return result.toPromise(); + } + + /** + * @param parentOrganisationsByIdsBodyParams + */ + public organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams: ParentOrganisationsByIdsBodyParams, _options?: Configuration): Promise { + const result = this.api.organisationControllerGetParentsByIds(parentOrganisationsByIdsBodyParams, _options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootChildrenWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.organisationControllerGetRootChildrenWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootChildren(_options?: Configuration): Promise { + const result = this.api.organisationControllerGetRootChildren(_options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootOrganisationWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.organisationControllerGetRootOrganisationWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public organisationControllerGetRootOrganisation(_options?: Configuration): Promise { + const result = this.api.organisationControllerGetRootOrganisation(_options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId: string, _options?: Configuration): Promise>> { + const result = this.api.organisationControllerGetZugehoerigeOrganisationenWithHttpInfo(organisationId, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + */ + public organisationControllerGetZugehoerigeOrganisationen(organisationId: string, _options?: Configuration): Promise> { + const result = this.api.organisationControllerGetZugehoerigeOrganisationen(organisationId, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisationWithHttpInfo(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Promise> { + const result = this.api.organisationControllerUpdateOrganisationWithHttpInfo(organisationId, updateOrganisationBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param updateOrganisationBodyParams + */ + public organisationControllerUpdateOrganisation(organisationId: string, updateOrganisationBodyParams: UpdateOrganisationBodyParams, _options?: Configuration): Promise { + const result = this.api.organisationControllerUpdateOrganisation(organisationId, updateOrganisationBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Promise> { + const result = this.api.organisationControllerUpdateOrganisationNameWithHttpInfo(organisationId, organisationByNameBodyParams, _options); + return result.toPromise(); + } + + /** + * @param organisationId The id of an organization + * @param organisationByNameBodyParams + */ + public organisationControllerUpdateOrganisationName(organisationId: string, organisationByNameBodyParams: OrganisationByNameBodyParams, _options?: Configuration): Promise { + const result = this.api.organisationControllerUpdateOrganisationName(organisationId, organisationByNameBodyParams, _options); + return result.toPromise(); + } + + +} + + + +import { ObservablePersonAdministrationApi } from './ObservableAPI.ts'; + +import { PersonAdministrationApiRequestFactory, PersonAdministrationApiResponseProcessor} from "../apis/PersonAdministrationApi.ts"; +export class PromisePersonAdministrationApi { + private api: ObservablePersonAdministrationApi + + public constructor( + configuration: Configuration, + requestFactory?: PersonAdministrationApiRequestFactory, + responseProcessor?: PersonAdministrationApiResponseProcessor + ) { + this.api = new ObservablePersonAdministrationApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollenWithHttpInfo(rolleName?: string, limit?: number, _options?: Configuration): Promise> { + const result = this.api.personAdministrationControllerFindRollenWithHttpInfo(rolleName, limit, _options); + return result.toPromise(); + } + + /** + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [limit] The limit of items for the request. + */ + public personAdministrationControllerFindRollen(rolleName?: string, limit?: number, _options?: Configuration): Promise { + const result = this.api.personAdministrationControllerFindRollen(rolleName, limit, _options); + return result.toPromise(); + } + + +} + + + +import { ObservablePersonInfoApi } from './ObservableAPI.ts'; + +import { PersonInfoApiRequestFactory, PersonInfoApiResponseProcessor} from "../apis/PersonInfoApi.ts"; +export class PromisePersonInfoApi { + private api: ObservablePersonInfoApi + + public constructor( + configuration: Configuration, + requestFactory?: PersonInfoApiRequestFactory, + responseProcessor?: PersonInfoApiResponseProcessor + ) { + this.api = new ObservablePersonInfoApi(configuration, requestFactory, responseProcessor); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfoWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.personInfoControllerInfoWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Info about logged in person. + */ + public personInfoControllerInfo(_options?: Configuration): Promise { + const result = this.api.personInfoControllerInfo(_options); + return result.toPromise(); + } + + +} + + + +import { ObservablePersonenApi } from './ObservableAPI.ts'; + +import { PersonenApiRequestFactory, PersonenApiResponseProcessor} from "../apis/PersonenApi.ts"; +export class PromisePersonenApi { + private api: ObservablePersonenApi + + public constructor( + configuration: Configuration, + requestFactory?: PersonenApiRequestFactory, + responseProcessor?: PersonenApiResponseProcessor + ) { + this.api = new ObservablePersonenApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Promise> { + const result = this.api.personControllerCreatePersonMigrationWithHttpInfo(createPersonMigrationBodyParams, _options); + return result.toPromise(); + } + + /** + * @param createPersonMigrationBodyParams + */ + public personControllerCreatePersonMigration(createPersonMigrationBodyParams: CreatePersonMigrationBodyParams, _options?: Configuration): Promise { + const result = this.api.personControllerCreatePersonMigration(createPersonMigrationBodyParams, _options); + return result.toPromise(); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontextWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.personControllerCreatePersonenkontextWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * + * @param personId + */ + public personControllerCreatePersonenkontext(personId: string, _options?: Configuration): Promise { + const result = this.api.personControllerCreatePersonenkontext(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonByIdWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.personControllerDeletePersonByIdWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerDeletePersonById(personId: string, _options?: Configuration): Promise { + const result = this.api.personControllerDeletePersonById(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonByIdWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.personControllerFindPersonByIdWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerFindPersonById(personId: string, _options?: Configuration): Promise { + const result = this.api.personControllerFindPersonById(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexteWithHttpInfo(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise> { + const result = this.api.personControllerFindPersonenkontexteWithHttpInfo(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId2] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personControllerFindPersonenkontexte(personId: string, offset?: number, limit?: number, personId2?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise { + const result = this.api.personControllerFindPersonenkontexte(personId, offset, limit, personId2, referrer, personenstatus, sichtfreigabe, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise>> { + const result = this.api.personControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise> { + const result = this.api.personControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); + return result.toPromise(); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPersonWithHttpInfo(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Promise> { + const result = this.api.personControllerLockPersonWithHttpInfo(personId, lockUserBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId + * @param lockUserBodyParams + */ + public personControllerLockPerson(personId: string, lockUserBodyParams: LockUserBodyParams, _options?: Configuration): Promise { + const result = this.api.personControllerLockPerson(personId, lockUserBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonIdWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.personControllerResetPasswordByPersonIdWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + */ + public personControllerResetPasswordByPersonId(personId: string, _options?: Configuration): Promise { + const result = this.api.personControllerResetPasswordByPersonId(personId, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public personControllerSyncPersonWithHttpInfo(personId: string, _options?: Configuration): Promise> { + const result = this.api.personControllerSyncPersonWithHttpInfo(personId, _options); + return result.toPromise(); + } + + /** + * @param personId + */ + public personControllerSyncPerson(personId: string, _options?: Configuration): Promise { + const result = this.api.personControllerSyncPerson(personId, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadataWithHttpInfo(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Promise> { + const result = this.api.personControllerUpdateMetadataWithHttpInfo(personId, personMetadataBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param personMetadataBodyParams + */ + public personControllerUpdateMetadata(personId: string, personMetadataBodyParams: PersonMetadataBodyParams, _options?: Configuration): Promise { + const result = this.api.personControllerUpdateMetadata(personId, personMetadataBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePersonWithHttpInfo(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Promise> { + const result = this.api.personControllerUpdatePersonWithHttpInfo(personId, updatePersonBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param updatePersonBodyParams + */ + public personControllerUpdatePerson(personId: string, updatePersonBodyParams: UpdatePersonBodyParams, _options?: Configuration): Promise { + const result = this.api.personControllerUpdatePerson(personId, updatePersonBodyParams, _options); + return result.toPromise(); + } + + +} + + + +import { ObservablePersonenFrontendApi } from './ObservableAPI.ts'; + +import { PersonenFrontendApiRequestFactory, PersonenFrontendApiResponseProcessor} from "../apis/PersonenFrontendApi.ts"; +export class PromisePersonenFrontendApi { + private api: ObservablePersonenFrontendApi + + public constructor( + configuration: Configuration, + requestFactory?: PersonenFrontendApiRequestFactory, + responseProcessor?: PersonenFrontendApiResponseProcessor + ) { + this.api = new ObservablePersonenFrontendApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersonsWithHttpInfo(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise> { + const result = this.api.personFrontendControllerFindPersonsWithHttpInfo(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [referrer] + * @param [familienname] + * @param [vorname] + * @param [sichtfreigabe] + * @param [organisationIDs] List of Organisation ID used to filter for Persons. + * @param [rolleIDs] List of Role ID used to filter for Persons. + * @param [suchFilter] Search filter used to filter for Persons. It could be the vorname, familienname, referrer or the personalnummer. + * @param [sortOrder] Order to sort by. + * @param [sortField] Field to sort by. + */ + public personFrontendControllerFindPersons(offset?: number, limit?: number, referrer?: string, familienname?: string, vorname?: string, sichtfreigabe?: 'ja' | 'nein', organisationIDs?: Array, rolleIDs?: Array, suchFilter?: string, sortOrder?: 'asc' | 'desc', sortField?: 'familienname' | 'vorname' | 'personalnummer' | 'referrer', _options?: Configuration): Promise { + const result = this.api.personFrontendControllerFindPersons(offset, limit, referrer, familienname, vorname, sichtfreigabe, organisationIDs, rolleIDs, suchFilter, sortOrder, sortField, _options); + return result.toPromise(); + } + + +} + + + +import { ObservablePersonenkontextApi } from './ObservableAPI.ts'; + +import { PersonenkontextApiRequestFactory, PersonenkontextApiResponseProcessor} from "../apis/PersonenkontextApi.ts"; +export class PromisePersonenkontextApi { + private api: ObservablePersonenkontextApi + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontextApiRequestFactory, + responseProcessor?: PersonenkontextApiResponseProcessor + ) { + this.api = new ObservablePersonenkontextApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Promise> { + const result = this.api.dbiamPersonenkontextWorkflowControllerCommitWithHttpInfo(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options); + return result.toPromise(); + } + + /** + * @param personId The ID for the person. + * @param dbiamUpdatePersonenkontexteBodyParams + * @param [personalnummer] + */ + public dbiamPersonenkontextWorkflowControllerCommit(personId: string, dbiamUpdatePersonenkontexteBodyParams: DbiamUpdatePersonenkontexteBodyParams, personalnummer?: string, _options?: Configuration): Promise { + const result = this.api.dbiamPersonenkontextWorkflowControllerCommit(personId, dbiamUpdatePersonenkontexteBodyParams, personalnummer, _options); + return result.toPromise(); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Promise> { + const result = this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexteWithHttpInfo(dbiamCreatePersonWithPersonenkontexteBodyParams, _options); + return result.toPromise(); + } + + /** + * @param dbiamCreatePersonWithPersonenkontexteBodyParams + */ + public dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams: DbiamCreatePersonWithPersonenkontexteBodyParams, _options?: Configuration): Promise { + const result = this.api.dbiamPersonenkontextWorkflowControllerCreatePersonWithPersonenkontexte(dbiamCreatePersonWithPersonenkontexteBodyParams, _options); + return result.toPromise(); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Promise> { + const result = this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknotenWithHttpInfo(rolleId, sskName, limit, _options); + return result.toPromise(); + } + + /** + * @param rolleId RolleId used to filter for schulstrukturknoten in personenkontext. + * @param [sskName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId: string, sskName?: string, limit?: number, _options?: Configuration): Promise { + const result = this.api.dbiamPersonenkontextWorkflowControllerFindSchulstrukturknoten(rolleId, sskName, limit, _options); + return result.toPromise(); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Promise> { + const result = this.api.dbiamPersonenkontextWorkflowControllerProcessStepWithHttpInfo(organisationId, rolleId, rolleName, organisationName, limit, _options); + return result.toPromise(); + } + + /** + * @param [organisationId] ID of the organisation to filter the rollen later + * @param [rolleId] ID of the rolle. + * @param [rolleName] Rolle name used to filter for rollen in personenkontext. + * @param [organisationName] Organisation/SSK name used to filter for schulstrukturknoten in personenkontext. + * @param [limit] The limit of items for the request. + */ + public dbiamPersonenkontextWorkflowControllerProcessStep(organisationId?: string, rolleId?: string, rolleName?: string, organisationName?: string, limit?: number, _options?: Configuration): Promise { + const result = this.api.dbiamPersonenkontextWorkflowControllerProcessStep(organisationId, rolleId, rolleName, organisationName, limit, _options); + return result.toPromise(); + } + + +} + + + +import { ObservablePersonenkontexteApi } from './ObservableAPI.ts'; + +import { PersonenkontexteApiRequestFactory, PersonenkontexteApiResponseProcessor} from "../apis/PersonenkontexteApi.ts"; +export class PromisePersonenkontexteApi { + private api: ObservablePersonenkontexteApi + + public constructor( + configuration: Configuration, + requestFactory?: PersonenkontexteApiRequestFactory, + responseProcessor?: PersonenkontexteApiResponseProcessor + ) { + this.api = new ObservablePersonenkontexteApi(configuration, requestFactory, responseProcessor); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Promise> { + const result = this.api.personenkontextControllerDeletePersonenkontextByIdWithHttpInfo(personenkontextId, deleteRevisionBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personenkontextId The id for the personenkontext. + * @param deleteRevisionBodyParams + */ + public personenkontextControllerDeletePersonenkontextById(personenkontextId: string, deleteRevisionBodyParams: DeleteRevisionBodyParams, _options?: Configuration): Promise { + const result = this.api.personenkontextControllerDeletePersonenkontextById(personenkontextId, deleteRevisionBodyParams, _options); + return result.toPromise(); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Promise> { + const result = this.api.personenkontextControllerFindPersonenkontextByIdWithHttpInfo(personenkontextId, _options); + return result.toPromise(); + } + + /** + * @param personenkontextId The id for the personenkontext. + */ + public personenkontextControllerFindPersonenkontextById(personenkontextId: string, _options?: Configuration): Promise { + const result = this.api.personenkontextControllerFindPersonenkontextById(personenkontextId, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexteWithHttpInfo(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise>> { + const result = this.api.personenkontextControllerFindPersonenkontexteWithHttpInfo(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options); + return result.toPromise(); + } + + /** + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [personId] + * @param [referrer] + * @param [personenstatus] + * @param [sichtfreigabe] + */ + public personenkontextControllerFindPersonenkontexte(offset?: number, limit?: number, personId?: string, referrer?: string, personenstatus?: Personenstatus, sichtfreigabe?: Sichtfreigabe, _options?: Configuration): Promise> { + const result = this.api.personenkontextControllerFindPersonenkontexte(offset, limit, personId, referrer, personenstatus, sichtfreigabe, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRechtWithHttpInfo(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Promise> { + const result = this.api.personenkontextControllerHatSystemRechtWithHttpInfo(personId, systemRecht, _options); + return result.toPromise(); + } + + /** + * @param personId The id for the account. + * @param systemRecht + */ + public personenkontextControllerHatSystemRecht(personId: string, systemRecht: RollenSystemRecht, _options?: Configuration): Promise { + const result = this.api.personenkontextControllerHatSystemRecht(personId, systemRecht, _options); + return result.toPromise(); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId: string, _options?: Configuration): Promise> { + const result = this.api.personenkontextControllerUpdatePersonenkontextWithIdWithHttpInfo(personenkontextId, _options); + return result.toPromise(); + } + + /** + * + * @param personenkontextId + */ + public personenkontextControllerUpdatePersonenkontextWithId(personenkontextId: string, _options?: Configuration): Promise { + const result = this.api.personenkontextControllerUpdatePersonenkontextWithId(personenkontextId, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableProviderApi } from './ObservableAPI.ts'; + +import { ProviderApiRequestFactory, ProviderApiResponseProcessor} from "../apis/ProviderApi.ts"; +export class PromiseProviderApi { + private api: ObservableProviderApi + + public constructor( + configuration: Configuration, + requestFactory?: ProviderApiRequestFactory, + responseProcessor?: ProviderApiResponseProcessor + ) { + this.api = new ObservableProviderApi(configuration, requestFactory, responseProcessor); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProvidersWithHttpInfo(_options?: Configuration): Promise>> { + const result = this.api.providerControllerGetAllServiceProvidersWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Get all service-providers. + * + */ + public providerControllerGetAllServiceProviders(_options?: Configuration): Promise> { + const result = this.api.providerControllerGetAllServiceProviders(_options); + return result.toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProvidersWithHttpInfo(_options?: Configuration): Promise>> { + const result = this.api.providerControllerGetAvailableServiceProvidersWithHttpInfo(_options); + return result.toPromise(); + } + + /** + * Get service-providers available for logged-in user. + * + */ + public providerControllerGetAvailableServiceProviders(_options?: Configuration): Promise> { + const result = this.api.providerControllerGetAvailableServiceProviders(_options); + return result.toPromise(); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogoWithHttpInfo(angebotId: string, _options?: Configuration): Promise> { + const result = this.api.providerControllerGetServiceProviderLogoWithHttpInfo(angebotId, _options); + return result.toPromise(); + } + + /** + * @param angebotId The id of the service provider + */ + public providerControllerGetServiceProviderLogo(angebotId: string, _options?: Configuration): Promise { + const result = this.api.providerControllerGetServiceProviderLogo(angebotId, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableRolleApi } from './ObservableAPI.ts'; + +import { RolleApiRequestFactory, RolleApiResponseProcessor} from "../apis/RolleApi.ts"; +export class PromiseRolleApi { + private api: ObservableRolleApi + + public constructor( + configuration: Configuration, + requestFactory?: RolleApiRequestFactory, + responseProcessor?: RolleApiResponseProcessor + ) { + this.api = new ObservableRolleApi(configuration, requestFactory, responseProcessor); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRechtWithHttpInfo(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Promise> { + const result = this.api.rolleControllerAddSystemRechtWithHttpInfo(rolleId, addSystemrechtBodyParams, _options); + return result.toPromise(); + } + + /** + * Add systemrecht to a rolle. + * + * @param rolleId The id for the rolle. + * @param addSystemrechtBodyParams + */ + public rolleControllerAddSystemRecht(rolleId: string, addSystemrechtBodyParams: AddSystemrechtBodyParams, _options?: Configuration): Promise { + const result = this.api.rolleControllerAddSystemRecht(rolleId, addSystemrechtBodyParams, _options); + return result.toPromise(); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Promise> { + const result = this.api.rolleControllerCreateRolleWithHttpInfo(createRolleBodyParams, _options); + return result.toPromise(); + } + + /** + * Create a new rolle. + * + * @param createRolleBodyParams + */ + public rolleControllerCreateRolle(createRolleBodyParams: CreateRolleBodyParams, _options?: Configuration): Promise { + const result = this.api.rolleControllerCreateRolle(createRolleBodyParams, _options); + return result.toPromise(); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolleWithHttpInfo(rolleId: string, _options?: Configuration): Promise> { + const result = this.api.rolleControllerDeleteRolleWithHttpInfo(rolleId, _options); + return result.toPromise(); + } + + /** + * Delete a role by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerDeleteRolle(rolleId: string, _options?: Configuration): Promise { + const result = this.api.rolleControllerDeleteRolle(rolleId, _options); + return result.toPromise(); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId: string, _options?: Configuration): Promise> { + const result = this.api.rolleControllerFindRolleByIdWithServiceProvidersWithHttpInfo(rolleId, _options); + return result.toPromise(); + } + + /** + * Get rolle by id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerFindRolleByIdWithServiceProviders(rolleId: string, _options?: Configuration): Promise { + const result = this.api.rolleControllerFindRolleByIdWithServiceProviders(rolleId, _options); + return result.toPromise(); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollenWithHttpInfo(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Promise>> { + const result = this.api.rolleControllerFindRollenWithHttpInfo(offset, limit, searchStr, _options); + return result.toPromise(); + } + + /** + * List all rollen. + * + * @param [offset] The offset of the paginated list. + * @param [limit] The requested limit for the page size. + * @param [searchStr] The name for the role. + */ + public rolleControllerFindRollen(offset?: number, limit?: number, searchStr?: string, _options?: Configuration): Promise> { + const result = this.api.rolleControllerFindRollen(offset, limit, searchStr, _options); + return result.toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId: string, _options?: Configuration): Promise> { + const result = this.api.rolleControllerGetRolleServiceProviderIdsWithHttpInfo(rolleId, _options); + return result.toPromise(); + } + + /** + * Get service-providers for a rolle by its id. + * + * @param rolleId The id for the rolle. + */ + public rolleControllerGetRolleServiceProviderIds(rolleId: string, _options?: Configuration): Promise { + const result = this.api.rolleControllerGetRolleServiceProviderIds(rolleId, _options); + return result.toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise> { + const result = this.api.rolleControllerRemoveServiceProviderByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options); + return result.toPromise(); + } + + /** + * Remove a service-provider from a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerRemoveServiceProviderById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise { + const result = this.api.rolleControllerRemoveServiceProviderById(rolleId, rolleServiceProviderBodyParams, _options); + return result.toPromise(); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolleWithHttpInfo(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Promise> { + const result = this.api.rolleControllerUpdateRolleWithHttpInfo(rolleId, updateRolleBodyParams, _options); + return result.toPromise(); + } + + /** + * Update rolle. + * + * @param rolleId The id for the rolle. + * @param updateRolleBodyParams + */ + public rolleControllerUpdateRolle(rolleId: string, updateRolleBodyParams: UpdateRolleBodyParams, _options?: Configuration): Promise { + const result = this.api.rolleControllerUpdateRolle(rolleId, updateRolleBodyParams, _options); + return result.toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise>> { + const result = this.api.rolleControllerUpdateServiceProvidersByIdWithHttpInfo(rolleId, rolleServiceProviderBodyParams, _options); + return result.toPromise(); + } + + /** + * Add a service-provider to a rolle by id. + * + * @param rolleId The id for the rolle. + * @param rolleServiceProviderBodyParams + */ + public rolleControllerUpdateServiceProvidersById(rolleId: string, rolleServiceProviderBodyParams: RolleServiceProviderBodyParams, _options?: Configuration): Promise> { + const result = this.api.rolleControllerUpdateServiceProvidersById(rolleId, rolleServiceProviderBodyParams, _options); + return result.toPromise(); + } + + +} + + + +import { ObservableStatusApi } from './ObservableAPI.ts'; + +import { StatusApiRequestFactory, StatusApiResponseProcessor} from "../apis/StatusApi.ts"; +export class PromiseStatusApi { + private api: ObservableStatusApi + + public constructor( + configuration: Configuration, + requestFactory?: StatusApiRequestFactory, + responseProcessor?: StatusApiResponseProcessor + ) { + this.api = new ObservableStatusApi(configuration, requestFactory, responseProcessor); + } + + /** + */ + public statusControllerGetStatusWithHttpInfo(_options?: Configuration): Promise> { + const result = this.api.statusControllerGetStatusWithHttpInfo(_options); + return result.toPromise(); + } + + /** + */ + public statusControllerGetStatus(_options?: Configuration): Promise { + const result = this.api.statusControllerGetStatus(_options); + return result.toPromise(); + } + + +} + + + diff --git a/loadtest/api-client/generated/util.ts b/loadtest/api-client/generated/util.ts new file mode 100644 index 0000000..96ea3df --- /dev/null +++ b/loadtest/api-client/generated/util.ts @@ -0,0 +1,37 @@ +/** + * Returns if a specific http code is in a given code range + * where the code range is defined as a combination of digits + * and "X" (the letter X) with a length of 3 + * + * @param codeRange string with length 3 consisting of digits and "X" (the letter X) + * @param code the http status code to be checked against the code range + */ +export function isCodeInRange(codeRange: string, code: number): boolean { + // This is how the default value is encoded in OAG + if (codeRange === "0") { + return true; + } + if (codeRange == code.toString()) { + return true; + } else { + const codeString = code.toString(); + if (codeString.length != codeRange.length) { + return false; + } + for (let i = 0; i < codeString.length; i++) { + if (codeRange.charAt(i) != "X" && codeRange.charAt(i) != codeString.charAt(i)) { + return false; + } + } + return true; + } +} + +/** +* Returns if it can consume form +* +* @param consumes array +*/ +export function canConsumeForm(contentTypes: string[]): boolean { + return contentTypes.indexOf('multipart/form-data') !== -1 +} diff --git a/loadtest/api-client/openapispec.json b/loadtest/api-client/openapispec.json index 7235f36..bd6fe75 100644 --- a/loadtest/api-client/openapispec.json +++ b/loadtest/api-client/openapispec.json @@ -1546,6 +1546,65 @@ "security": [{ "oauth2": ["openid"] }, { "bearer": [] }] } }, + "/api/organisationen/{organisationId}/enable-for-its-learning": { + "put": { + "operationId": "OrganisationController_enableForitslearning", + "parameters": [ + { + "name": "organisationId", + "required": true, + "in": "path", + "description": "The id of an organization", + "schema": { "nullable": false, "type": "string" } + } + ], + "responses": { + "200": { + "description": "The organization was successfully enabled for itslearning.", + "headers": { + "X-Paging-Offset": { + "description": "The offset of the first item from the list. List starts with index 0." + }, + "X-Paging-Limit": { + "description": "The maximum amount of items returned in one request." + }, + "X-Paging-Total": { + "description": "The total amount of items in the list." + }, + "X-Paging-pageTotal": { + "description": "The total amount of items in the paginated list." + } + }, + "content": { + "application/json": { + "schema": { + "$ref": "#/components/schemas/OrganisationResponseLegacy" + } + } + } + }, + "400": { + "description": "The organisation could not be modified.", + "content": { + "application/json": { + "schema": { + "$ref": "#/components/schemas/DbiamOrganisationError" + } + } + } + }, + "401": { + "description": "Not authorized to modify the organisation." + }, + "403": { "description": "Not permitted to modify the organisation." }, + "500": { + "description": "Internal server error while modifying the organisation." + } + }, + "tags": ["organisationen"], + "security": [{ "oauth2": ["openid"] }, { "bearer": [] }] + } + }, "/api/rolle": { "get": { "operationId": "RolleController_findRollen", @@ -1633,7 +1692,14 @@ } } }, - "400": { "description": "The input was not valid." }, + "400": { + "description": "The input was not valid.", + "content": { + "application/json": { + "schema": { "$ref": "#/components/schemas/DbiamRolleError" } + } + } + }, "401": { "description": "Not authorized to create the rolle." }, "403": { "description": "Insufficient permissions to create the rolle." @@ -2891,6 +2957,28 @@ "security": [{ "oauth2": ["openid"] }, { "bearer": [] }] } }, + "/api/cron/unlock": { + "put": { + "operationId": "CronController_unlockUsersWithExpiredLocks", + "parameters": [], + "responses": { + "200": { + "description": "The users were successfully unlocked.", + "content": { + "application/json": { "schema": { "type": "boolean" } } + } + }, + "401": { "description": "Not authorized to unlock users." }, + "403": { "description": "Insufficient permissions to unlock users." }, + "404": { "description": "Insufficient permissions to unlock users." }, + "500": { + "description": "Internal server error while trying to unlock users." + } + }, + "tags": ["cron"], + "security": [{ "oauth2": ["openid"] }, { "bearer": [] }] + } + }, "/api/import/upload": { "post": { "operationId": "ImportController_uploadFile", @@ -3013,6 +3101,14 @@ "tags": ["import"], "security": [{ "oauth2": ["openid"] }, { "bearer": [] }] } + }, + "/api/status": { + "get": { + "operationId": "StatusController_getStatus", + "parameters": [], + "responses": { "200": { "description": "" } }, + "tags": ["status"] + } } }, "info": { @@ -3161,9 +3257,16 @@ "personId": { "type": "string", "nullable": true }, "locked_by": { "type": "string", "nullable": true }, "created_at": { "type": "string", "nullable": true }, - "locked_until": { "type": "string", "nullable": true } + "locked_until": { "type": "string", "nullable": true }, + "lock_occasion": { "type": "string", "nullable": true } }, - "required": ["personId", "locked_by", "created_at", "locked_until"] + "required": [ + "personId", + "locked_by", + "created_at", + "locked_until", + "lock_occasion" + ] }, "EmailAddressStatus": { "type": "string", @@ -3204,7 +3307,8 @@ "isLocked": { "type": "boolean", "nullable": true }, "userLock": { "nullable": true, - "allOf": [{ "$ref": "#/components/schemas/UserLockParams" }] + "type": "array", + "items": { "$ref": "#/components/schemas/UserLockParams" } }, "lastModified": { "format": "date-time", @@ -3273,7 +3377,8 @@ "organisation": { "$ref": "#/components/schemas/CreatedPersonenkontextOrganisation" }, - "roleName": { "type": "string", "nullable": true }, + "rollenart": { "type": "string", "nullable": true }, + "rollenname": { "type": "string", "nullable": true }, "personenstatus": { "type": "string", "enum": ["AKTIV"], @@ -3311,7 +3416,8 @@ "referrer", "mandant", "organisation", - "roleName", + "rollenart", + "rollenname", "personenstatus", "jahrgangsstufe", "sichtfreigabe", @@ -3553,7 +3659,12 @@ "$ref": "#/components/schemas/Vertrauensstufe" }, "revision": { "type": "string" }, - "personalnummer": { "type": "string", "nullable": true } + "personalnummer": { "type": "string", "nullable": true }, + "dienststellen": { + "nullable": true, + "type": "array", + "items": { "type": "string" } + } }, "required": [ "id", @@ -3566,7 +3677,8 @@ "lokalisierung", "vertrauensstufe", "revision", - "personalnummer" + "personalnummer", + "dienststellen" ] }, "PersonInfoResponse": { @@ -3578,9 +3690,14 @@ "type": "array", "items": { "$ref": "#/components/schemas/PersonenkontextResponse" } }, - "gruppen": { "type": "array", "items": { "type": "string" } } + "gruppen": { "type": "array", "items": { "type": "string" } }, + "email": { + "nullable": true, + "description": "Contains status and address. Returns email-address verified by OX (enabled) if available, otherwise returns most recently updated one (no prioritized status)", + "allOf": [{ "$ref": "#/components/schemas/PersonEmailResponse" }] + } }, - "required": ["pid", "person", "personenkontexte", "gruppen"] + "required": ["pid", "person", "personenkontexte", "gruppen", "email"] }, "TraegerschaftTyp": { "type": "string", @@ -3614,7 +3731,9 @@ "namensergaenzung": { "type": "string", "nullable": true }, "kuerzel": { "type": "string" }, "typ": { "$ref": "#/components/schemas/OrganisationsTyp" }, - "traegerschaft": { "$ref": "#/components/schemas/TraegerschaftTyp" } + "traegerschaft": { "$ref": "#/components/schemas/TraegerschaftTyp" }, + "itslearningEnabled": { "type": "boolean" }, + "version": { "type": "number" } }, "required": [ "id", @@ -3624,7 +3743,9 @@ "namensergaenzung", "kuerzel", "typ", - "traegerschaft" + "traegerschaft", + "itslearningEnabled", + "version" ] }, "DbiamOrganisationError": { @@ -3648,7 +3769,8 @@ "NAME_REQUIRED_FOR_KLASSE", "NAME_ENTHAELT_LEERZEICHEN", "KENNUNG_ENTHAELT_LEERZEICHEN", - "EMAIL_ADRESS_ON_ORGANISATION_TYP" + "EMAIL_ADRESS_ON_ORGANISATION_TYP", + "NEWER_VERSION_ORGANISATION" ] }, "code": { @@ -3720,6 +3842,7 @@ "MIGRATION_DURCHFUEHREN", "PERSON_SYNCHRONISIEREN", "CRON_DURCHFUEHREN", + "PERSONEN_ANLEGEN", "IMPORT_DURCHFUEHREN" ] }, @@ -3736,8 +3859,14 @@ }, "OrganisationByNameBodyParams": { "type": "object", - "properties": { "name": { "type": "string" } }, - "required": ["name"] + "properties": { + "name": { "type": "string" }, + "version": { + "type": "number", + "description": "The version for the organisation." + } + }, + "required": ["name", "version"] }, "OrganisationResponseLegacy": { "type": "object", @@ -3890,6 +4019,28 @@ "version" ] }, + "DbiamRolleError": { + "type": "object", + "properties": { + "i18nKey": { + "type": "string", + "enum": [ + "ROLLE_ERROR", + "ADD_SYSTEMRECHT_ERROR", + "ROLLE_HAT_PERSONENKONTEXTE_ERROR", + "UPDATE_MERKMALE_ERROR", + "ROLLENNAME_ENTHAELT_LEERZEICHEN", + "NEWER_VERSION_OF_ROLLE_AVAILABLE", + "ROLLE_NAME_UNIQUE_ON_SSK" + ] + }, + "code": { + "type": "number", + "description": "Corresponds to HTTP Status code like 200, 404, 500" + } + }, + "required": ["i18nKey", "code"] + }, "AddSystemrechtBodyParams": { "type": "object", "properties": { @@ -3986,27 +4137,6 @@ "version" ] }, - "DbiamRolleError": { - "type": "object", - "properties": { - "i18nKey": { - "type": "string", - "enum": [ - "ROLLE_ERROR", - "ADD_SYSTEMRECHT_ERROR", - "ROLLE_HAT_PERSONENKONTEXTE_ERROR", - "UPDATE_MERKMALE_ERROR", - "ROLLENNAME_ENTHAELT_LEERZEICHEN", - "NEWER_VERSION_OF_ROLLE_AVAILABLE" - ] - }, - "code": { - "type": "number", - "description": "Corresponds to HTTP Status code like 200, 404, 500" - } - }, - "required": ["i18nKey", "code"] - }, "PersonResponseAutomapper": { "type": "object", "properties": { @@ -4479,7 +4609,8 @@ "CSV_PARSING_ERROR", "CSV_FILE_EMPTY_ERROR", "IMPORT_TEXT_FILE_CREATION_ERROR", - "IMPORT_NUR_LERN_AN_SCHULE_ERROR" + "IMPORT_NUR_LERN_AN_SCHULE_ERROR", + "CSV_FILE_INVALID_HEADER_ERROR" ] }, "code": { diff --git a/loadtest/global.d.ts b/loadtest/global.d.ts new file mode 100644 index 0000000..a4738fa --- /dev/null +++ b/loadtest/global.d.ts @@ -0,0 +1,3 @@ +declare type Result = + | { ok: true; value: T } + | { ok: false; error: E }; diff --git a/loadtest/pages/login.ts b/loadtest/pages/login.ts index b9ef2cd..a3fcfaf 100644 --- a/loadtest/pages/login.ts +++ b/loadtest/pages/login.ts @@ -37,6 +37,30 @@ class LoginPage implements PageObject { }); } + initialLogin(user: LoginData, newPassword: string) { + group("initial login", () => { + let response; + this.navigate(); + response = this.goToKeycloakLogin(); + response = this.submitForm(response, user); + const resetUrl = response.headers["Location"]; + response = get(resetUrl, { + tags: { name: removeQueryString(resetUrl) }, + }); + response.submitForm({ + fields: { + username: user.username, + password: "", + "password-new": newPassword, + "password-confirm": newPassword, + }, + }); + if (response.status !== 200 && response.status !== 302) { + fail("login failed"); + } + }); + } + goToKeycloakLogin() { const response = getLogin(["redirectUrl=/"]); loadLinkedResourcesAndCheck(response); diff --git a/loadtest/pages/user-details.ts b/loadtest/pages/user-details.ts index 67863e3..fe16aab 100644 --- a/loadtest/pages/user-details.ts +++ b/loadtest/pages/user-details.ts @@ -1,5 +1,5 @@ import { group } from "k6"; -import { DBiamPersonenzuordnungResponse } from "../api-client/generated/index.ts"; +import { DBiamPersonenzuordnungResponse } from "../api-client/generated/models/DBiamPersonenzuordnungResponse"; import { getLoginInfo, getParentOrganisationenByIds, diff --git a/loadtest/pages/user-list.ts b/loadtest/pages/user-list.ts index bd7d22f..e895fd3 100644 --- a/loadtest/pages/user-list.ts +++ b/loadtest/pages/user-list.ts @@ -1,8 +1,6 @@ -import { - DBiamPersonenuebersichtResponse, - OrganisationResponse, - RolleWithServiceProvidersResponse, -} from "../api-client/generated/index.ts"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse"; +import { FindRollenResponse } from "../api-client/generated/models/FindRollenResponse"; +import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse"; import { getLoginInfo, getOrganisationen, @@ -17,7 +15,7 @@ import { PageObject } from "./index.ts"; type FetchedData = { organisationen: OrganisationResponse[]; personenuebersichten: DBiamPersonenuebersichtResponse[]; - rollen: RolleWithServiceProvidersResponse[]; + rollen: FindRollenResponse; }; class UserListPage implements PageObject { name = "UserList"; diff --git a/loadtest/usecases/1_login.ts b/loadtest/usecases/1_login.ts index 6f81a69..7b41268 100644 --- a/loadtest/usecases/1_login.ts +++ b/loadtest/usecases/1_login.ts @@ -1,23 +1,40 @@ import { check, group } from "k6"; import { RefinedResponse, ResponseType } from "k6/http"; import { Counter, Trend } from "k6/metrics"; +import { logout } from "../pages/index.ts"; import { loginPage } from "../pages/login.ts"; import { defaultHttpCheck, defaultTimingCheck } from "../util/checks.ts"; import { getDefaultOptions } from "../util/config.ts"; +import { login } from "../util/page.ts"; +import { createLogins, deleteAllTestUsers } from "../util/resource-helper.ts"; import { wrapTestFunction } from "../util/usecase-wrapper.ts"; -import { getDefaultUserMix } from "../util/users.ts"; +import { LoginData, UserMix } from "../util/users.ts"; const successfulLoginCounter = new Counter("successful_logins_counter"); const successfulLoginDuration = new Trend("successful_logins_duration", true); -const users = getDefaultUserMix(); +type TestData = { + users: Array; +}; export const options = { ...getDefaultOptions(), }; - +const admin = new UserMix({ SYSADMIN: 1 }); +export function setup() { + login(admin.getLogin()); + deleteAllTestUsers(); + const users = createLogins({ LEHR: 100 }); + logout(); + return { users }; +} +export function teardown() { + login(admin.getLogin()); + deleteAllTestUsers(); + logout(); +} export default wrapTestFunction(main); -function main() { +function main({ users }: TestData) { /** * URL for final login, which we obtain from keycloak during oidc-login */ @@ -34,7 +51,7 @@ function main() { group("submit form", () => { // submit form - const user = users.getLogin(); + const user = users[__VU - 1]; keycloakFormResponse = loginPage.submitForm(loginPageResponse, user); check(keycloakFormResponse, { "submitting login form to kc succeeded": () => diff --git a/loadtest/usecases/1_show-start.ts b/loadtest/usecases/1_show-start.ts index 69116e4..5970d29 100644 --- a/loadtest/usecases/1_show-start.ts +++ b/loadtest/usecases/1_show-start.ts @@ -2,12 +2,12 @@ import { group, sleep } from "k6"; import { getDefaultOptions } from "../util/config.ts"; import { login } from "../util/page.ts"; import { wrapTestFunction } from "../util/usecase-wrapper.ts"; -import { getDefaultUserMix } from "../util/users.ts"; +import { getDefaultAdminMix } from "../util/users.ts"; -const users = getDefaultUserMix(); +const users = getDefaultAdminMix(); export const options = { - ...getDefaultOptions(users), + ...getDefaultOptions(), }; export default wrapTestFunction(main); diff --git a/loadtest/usecases/1_show-user-list.ts b/loadtest/usecases/1_show-user-list.ts index 8ea76aa..7de3943 100644 --- a/loadtest/usecases/1_show-user-list.ts +++ b/loadtest/usecases/1_show-user-list.ts @@ -1,5 +1,5 @@ -import { group, sleep } from "k6"; -import { DBiamPersonenuebersichtResponse } from "../api-client/generated/index.ts"; +import { group } from "k6"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse"; import { userListPage } from "../pages/user-list.ts"; import { getLoginInfo, @@ -34,7 +34,7 @@ function main(users = getDefaultAdminMix()) { getLoginInfo(); orgId = pickRandomItem(organisationen).id; personenuebersicht = pickRandomItem(personenuebersichten); - rolleId = pickRandomItem(rollen).id; + rolleId = pickRandomItem(rollen.moeglicheRollen).id; }); group("hit pages", () => { diff --git a/loadtest/usecases/2_create-delete-new-user.ts b/loadtest/usecases/2_create-delete-new-user.ts index 325747f..8a6ea65 100644 --- a/loadtest/usecases/2_create-delete-new-user.ts +++ b/loadtest/usecases/2_create-delete-new-user.ts @@ -1,4 +1,5 @@ -import { group, sleep } from "k6"; +import { check, fail, group, sleep } from "k6"; +import { RollenArt } from "../api-client/generated/index.ts"; import { logout } from "../pages/index.ts"; import { UserDetailsPage } from "../pages/user-details.ts"; import { userListPage } from "../pages/user-list.ts"; @@ -10,7 +11,12 @@ import { postPersonenkontextWorkflow, } from "../util/api.ts"; import { getDefaultOptions } from "../util/config.ts"; -import { getFutureDate, getRandomName, pickRandomItem } from "../util/data.ts"; +import { + getFutureDate, + getRandomName, + getRandomPersNummer, + pickRandomItem, +} from "../util/data.ts"; import { goToUserList, login } from "../util/page.ts"; import { deleteAllTestUsers } from "../util/resource-helper.ts"; import { wrapTestFunction } from "../util/usecase-wrapper.ts"; @@ -20,16 +26,18 @@ export const options = { ...getDefaultOptions(), }; +const admin = new UserMix({ SYSADMIN: 1 }); + export function teardown() { - const admin = new UserMix({ SYSADMIN: 1 }); login(admin.getLogin()); deleteAllTestUsers(); logout(); } export default wrapTestFunction(main); +const users = getDefaultAdminMix(); -function main(users = getDefaultAdminMix()) { +function main() { goToUserList(users.getLogin()); group("load page", () => { @@ -37,20 +45,7 @@ function main(users = getDefaultAdminMix()) { }); const createdPerson = group("go through creation workflow", () => { - const { organisations } = getPersonenkontextWorkflowStep(["limit=25"]); - const organisation = pickRandomItem(organisations); - typeIntoAutocomplete(organisation.name, (name) => { - getPersonenkontextWorkflowStep([`organisationName=${name}`, "limit=25"]); - sleep(0.1); - }); - const klassen = getAdministeredOrganisationenById(organisation.id); - const { rollen } = getPersonenkontextWorkflowStep([ - `organisationId=${organisation.id}`, - "limit=25", - ]); - const rolle = pickRandomItem( - rollen.filter((r) => r.name === "LiV" || r.name === "SuS"), - ); + const { organisation, rolle, klasse } = getParams(); typeIntoAutocomplete(rolle.name, (name) => { getPersonenkontextWorkflowStep([ `organisationId=${organisation.id}`, @@ -75,9 +70,7 @@ function main(users = getDefaultAdminMix()) { }, ], }; - let klasse: { id: string; name: string } | null = null; - if (rolle.name === "SuS") { - klasse = pickRandomItem(klassen); + if (rolle.rollenart === RollenArt.Lern) { typeIntoAutocomplete(klasse.name, (name) => { getAdministeredOrganisationenById(organisation.id, [ `searchFilter=${name}`, @@ -89,11 +82,16 @@ function main(users = getDefaultAdminMix()) { rolleId: rolle.id, }); } else { - body.personalnummer = "1237562"; + body.personalnummer = getRandomPersNummer(); } return postPersonenkontextWorkflow(body); }); + check(createdPerson, { + "created person": (v) => v?.person != undefined, + "created kontexte": (v) => v?.dBiamPersonenkontextResponses?.length > 0, + }); + group("navigate back", () => { userListPage.navigate(); new UserDetailsPage(createdPerson.person.id).navigate(); @@ -109,3 +107,34 @@ function typeIntoAutocomplete(name: string, callback: (name: string) => void) { callback(name.slice(0, characters)); } } + +// assumes that there is at least one valid org in organisations +function getParams() { + const { organisations } = getPersonenkontextWorkflowStep(["limit=25"]); + for (let index = 0; index < organisations.length; index++) { + const organisation = pickRandomItem(organisations); + typeIntoAutocomplete(organisation.name, (name) => { + getPersonenkontextWorkflowStep([`organisationName=${name}`, "limit=25"]); + sleep(0.1); + }); + const klassen = getAdministeredOrganisationenById(organisation.id); + const { rollen } = getPersonenkontextWorkflowStep([ + `organisationId=${organisation.id}`, + "limit=25", + ]); + + if (klassen.length == 0 || rollen.length == 0) continue; + + const rolle = pickRandomItem( + rollen.filter( + (r) => r.rollenart === RollenArt.Lehr || r.rollenart === RollenArt.Lern, + ), + ); + const klasse = pickRandomItem(klassen); + + if (!klasse || !rolle) continue; + + return { organisation, rolle, klasse }; + } + fail("no org for user creation found"); +} diff --git a/loadtest/usecases/3_create-class.ts b/loadtest/usecases/3_create-class.ts index 8cc1592..941cbea 100644 --- a/loadtest/usecases/3_create-class.ts +++ b/loadtest/usecases/3_create-class.ts @@ -1,8 +1,6 @@ import { check, group } from "k6"; -import { - OrganisationResponse, - OrganisationsTyp, -} from "../api-client/generated/index.ts"; +import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse.ts"; +import { OrganisationsTyp } from "../api-client/generated/models/OrganisationsTyp.ts"; import { logout } from "../pages/index.ts"; import { userListPage } from "../pages/user-list.ts"; import { diff --git a/loadtest/usecases/3_lock_unlock_user.ts b/loadtest/usecases/3_lock_unlock_user.ts index 3ad02ab..58d2e13 100644 --- a/loadtest/usecases/3_lock_unlock_user.ts +++ b/loadtest/usecases/3_lock_unlock_user.ts @@ -1,6 +1,6 @@ import { check, fail, group } from "k6"; import { vu } from "k6/execution"; -import { DBiamPersonenuebersichtResponse } from "../api-client/generated/index.ts"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse.ts"; import { logout } from "../pages/index.ts"; import { UserDetailsPage } from "../pages/user-details.ts"; import { userListPage } from "../pages/user-list.ts"; diff --git a/loadtest/usecases/3_reset-password.ts b/loadtest/usecases/3_reset-password.ts index d600d65..8230756 100644 --- a/loadtest/usecases/3_reset-password.ts +++ b/loadtest/usecases/3_reset-password.ts @@ -1,6 +1,6 @@ import { check, fail, group } from "k6"; import { vu } from "k6/execution"; -import { DBiamPersonenuebersichtResponse } from "../api-client/generated/index.ts"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse.ts"; import { logout } from "../pages/index.ts"; import { UserDetailsPage } from "../pages/user-details.ts"; import { userListPage } from "../pages/user-list.ts"; diff --git a/loadtest/util/api.ts b/loadtest/util/api.ts index e0e8a71..7490f10 100644 --- a/loadtest/util/api.ts +++ b/loadtest/util/api.ts @@ -11,25 +11,23 @@ import { ResponseType, url, } from "k6/http"; -import { - CreateOrganisationBodyParams, - DbiamCreatePersonWithPersonenkontexteBodyParams, - DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response, - DBiamPersonenuebersichtResponse, - DBiamPersonResponse, - FindRollenResponse, - LockUserBodyParams, - OrganisationResponse, - ParentOrganisationenResponse, - PersonendatensatzResponse, - PersonenkontextWorkflowResponse, - PersonFrontendControllerFindPersons200Response, - PersonInfoResponse, - ServiceProviderResponse, - TokenRequiredResponse, - TokenStateResponse, - UserinfoResponse, -} from "../api-client/generated/index.ts"; +import { CreateOrganisationBodyParams } from "../api-client/generated/models/CreateOrganisationBodyParams"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams"; +import { DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response } from "../api-client/generated/models/DBiamPersonenuebersichtControllerFindPersonenuebersichten200Response"; +import { DBiamPersonenuebersichtResponse } from "../api-client/generated/models/DBiamPersonenuebersichtResponse"; +import { DBiamPersonResponse } from "../api-client/generated/models/DBiamPersonResponse"; +import { FindRollenResponse } from "../api-client/generated/models/FindRollenResponse"; +import { LockUserBodyParams } from "../api-client/generated/models/LockUserBodyParams"; +import { OrganisationResponse } from "../api-client/generated/models/OrganisationResponse"; +import { ParentOrganisationenResponse } from "../api-client/generated/models/ParentOrganisationenResponse"; +import { PersonendatensatzResponse } from "../api-client/generated/models/PersonendatensatzResponse"; +import { PersonenkontextWorkflowResponse } from "../api-client/generated/models/PersonenkontextWorkflowResponse"; +import { PersonFrontendControllerFindPersons200Response } from "../api-client/generated/models/PersonFrontendControllerFindPersons200Response"; +import { PersonInfoResponse } from "../api-client/generated/models/PersonInfoResponse"; +import { ServiceProviderResponse } from "../api-client/generated/models/ServiceProviderResponse"; +import { TokenRequiredResponse } from "../api-client/generated/models/TokenRequiredResponse"; +import { TokenStateResponse } from "../api-client/generated/models/TokenStateResponse"; +import { UserinfoResponse } from "../api-client/generated/models/UserinfoResponse"; import { defaultHttpCheck, defaultTimingCheck, @@ -53,6 +51,14 @@ export function removeQueryString(url: string): string { return url.split("?")[0]; } +export function transformQueryToTag(pairs?: Array): string { + if (!pairs || pairs.length == 0) return ""; + return pairs + .filter((p) => !p.endsWith("=")) + .map((p) => p.slice(0, p.indexOf("="))) + .join(); +} + export function makeHttpRequest( verb: "get" | "post" | "put" | "delete", resource: string, @@ -60,21 +66,26 @@ export function makeHttpRequest( query: Array; body: RequestBody; params: RefinedParams; + url: ReturnType; }>, ) { const queryString = options?.query ? makeQueryString(options.query) : ""; - const url = `${backendUrl}${resource}${queryString}`; + const url = options?.url + ? options.url + : `${backendUrl}${resource}${queryString}`; const response = request(verb.toUpperCase(), url, options?.body, { ...options?.params, + timeout: "70s", tags: { name: `${backendUrl}${resource}`, resource, + query: transformQueryToTag(options?.query), }, }); if (response.error || response.error_code) - prettyLog( + console.error( { - url: response.url, + url: removeQueryString(response.url), status: response.status, statusText: response.status_text, headers: response.headers, @@ -192,7 +203,7 @@ export function deleteKlasse(id: string) { export function getPersonenIds( personen?: PersonFrontendControllerFindPersons200Response, ): Set { - if (!personen) personen = getPersonen(); + if (!personen) personen = getPersonen(["limit=30"]); return new Set(personen.items.map(({ person }) => person.id)); } @@ -215,7 +226,9 @@ export function getPersonInfo(query?: Array) { } export function deletePersonById(id: string) { - const response = makeHttpRequest("delete", `personen/${id}`); + const response = makeHttpRequest("delete", `personen/${id}`, { + url: url`${backendUrl}personen/${id}`, + }); check(response, { "got expected status": getStatusChecker(204), ...defaultTimingCheck, @@ -322,7 +335,6 @@ export function getResetPassword(query: Array) { } export function putPersonLock(personId: string, lock: boolean) { - // TODO: befristung const lockUserBodyParams: LockUserBodyParams = { lock, //@ts-expect-error openapi generator converts this to camelcase diff --git a/loadtest/util/checks.ts b/loadtest/util/checks.ts index 11c897d..d36aa69 100644 --- a/loadtest/util/checks.ts +++ b/loadtest/util/checks.ts @@ -15,8 +15,7 @@ export function getTimeChecker(maxTime: number) { } export const defaultTimingCheck = { - "took <250ms": getTimeChecker(250), - "took <2000ms": getTimeChecker(2000), + "took <1000ms": getTimeChecker(1000), }; export const defaultHttpCheck = { diff --git a/loadtest/util/config.ts b/loadtest/util/config.ts index bae02b0..1be5af7 100644 --- a/loadtest/util/config.ts +++ b/loadtest/util/config.ts @@ -5,6 +5,7 @@ export enum CONFIG { SPIKE = "spike", STRESS = "stress", BREAKPOINT = "breakpoint", + PLATEAU = "plateau", DEBUG = "debug", } export function getConfig(): CONFIG { @@ -12,6 +13,7 @@ export function getConfig(): CONFIG { if (config == CONFIG.SPIKE.toString()) return CONFIG.SPIKE; if (config == CONFIG.STRESS.toString()) return CONFIG.STRESS; if (config == CONFIG.BREAKPOINT.toString()) return CONFIG.BREAKPOINT; + if (config == CONFIG.PLATEAU.toString()) return CONFIG.PLATEAU; if (config == CONFIG.DEBUG.toString()) return CONFIG.DEBUG; throw Error(`Invalid value for config '${config}'`); } @@ -42,12 +44,23 @@ export function getDefaultOptions() { }; case CONFIG.BREAKPOINT: return { - stages: [{ duration: "10m", target: 10 * maxVUs }], + stages: [{ duration: "10m", target: maxVUs }], thresholds: { http_req_failed: [{ threshold: "rate<0.10", abortOnFail: true }], http_req_duration: [{ threshold: "p(95)<5000", abortOnFail: true }], }, }; + case CONFIG.PLATEAU: + return { + stages: [ + // ramp up + { duration: "1m", target: maxVUs }, + // plateau + { duration: "5m", target: maxVUs }, + // ramp down + { duration: "1m", target: 0 }, + ], + }; case CONFIG.DEBUG: return { stages: [{ duration: "1s", target: maxVUs }], diff --git a/loadtest/util/resource-helper.ts b/loadtest/util/resource-helper.ts index 811ee4c..721da22 100644 --- a/loadtest/util/resource-helper.ts +++ b/loadtest/util/resource-helper.ts @@ -1,12 +1,12 @@ import { fail } from "k6"; import { batch, BatchRequest } from "k6/http"; -import { - CreateOrganisationBodyParams, - DbiamCreatePersonWithPersonenkontexteBodyParams, - DBiamPersonResponse, - OrganisationsTyp, - RollenArt, -} from "../api-client/generated/index.ts"; +import { CreateOrganisationBodyParams } from "../api-client/generated/models/CreateOrganisationBodyParams.ts"; +import { DbiamCreatePersonWithPersonenkontexteBodyParams } from "../api-client/generated/models/DbiamCreatePersonWithPersonenkontexteBodyParams.ts"; +import { DBiamPersonResponse } from "../api-client/generated/models/DBiamPersonResponse.ts"; +import { OrganisationsTyp } from "../api-client/generated/models/OrganisationsTyp.ts"; +import { RollenArt } from "../api-client/generated/models/RollenArt.ts"; +import { logout } from "../pages/index.ts"; +import { loginPage } from "../pages/login.ts"; import { getAdministeredOrganisationenById, getOrganisationen, @@ -14,8 +14,9 @@ import { getRollen, makeHttpRequest, } from "./api.ts"; -import { getBackendUrl } from "./config.ts"; +import { getBackendUrl, MAX_VUS } from "./config.ts"; import { getRandomName, NAME_PREFIX } from "./data.ts"; +import { LoginData, UserMix, UserRatio } from "./users.ts"; const orgParams: CreateOrganisationBodyParams = { name: `${NAME_PREFIX}-Test-Schule`, @@ -23,6 +24,61 @@ const orgParams: CreateOrganisationBodyParams = { typ: OrganisationsTyp.Schule, }; +export function createLogins(ratio: Partial): Array { + if (!ratio) fail("no user ratio defined"); + const testOrg = createAndFindTestOrg(); + const { moeglicheRollen } = getRollen(["rolleName="]); + const requests: Array = []; + const befristung = new Date(Date.now() + 1000 * 60 * 60 * 4); + const requestedRoles = Object.keys(ratio) as Array; + const rollen = requestedRoles + .map((rolle: RollenArt) => + moeglicheRollen.find((r) => r.rollenart == rolle), + ) + .filter((r) => r != undefined); + if (requestedRoles.length > rollen.length) + fail("mismatch between requested and possible roles"); + + const users = new UserMix(ratio); + while (requests.length < MAX_VUS) { + const rolle = rollen.find((r) => r.rollenart == users.getCurrentRole())!; + const creationParams: DbiamCreatePersonWithPersonenkontexteBodyParams = { + ...getRandomName(), + befristung: befristung, + createPersonenkontexte: [ + { + organisationId: testOrg.id, + rolleId: rolle.id, + }, + ], + }; + const body = JSON.stringify(creationParams); + requests.push({ + method: "POST", + url: `${getBackendUrl()}personenkontext-workflow`, + body, + params: { + headers: { "Content-Type": "application/json" }, + }, + }); + } + console.log(`creating ${requests.length} users`); + const persons = batch(requests).map( + (r) => r.json() as unknown as DBiamPersonResponse, + ); + logout(); + const loginData: Array = []; + persons.forEach((person, index) => { + const username = person.person.referrer!; + const password = person.person.startpasswort; + const newPassword = password + index.toString(); + loginPage.initialLogin({ username, password }, newPassword); + loginData.push({ username, password: newPassword }); + logout(); + }); + return loginData; +} + export function createTestUsers(n: number): Array { const creationStartTime = Date.now(); console.log(`creating ${n} users`); diff --git a/loadtest/util/users.ts b/loadtest/util/users.ts index f906ffb..845d3cb 100644 --- a/loadtest/util/users.ts +++ b/loadtest/util/users.ts @@ -1,41 +1,34 @@ import { SharedArray } from "k6/data"; +import { RollenArt } from "../api-client/generated/models/RollenArt.ts"; const DATAPATH = "../data/users.json"; export type User = { username: string; password: string; - role: ROLE; + role: RollenArt; }; -export enum ROLE { - LERN = "LERN", - LEHR = "LEHR", - EXTERN = "EXTERN", - ORGADMIN = "ORGADMIN", - LEIT = "LEIT", - SYSADMIN = "SYSADMIN", -} export type LoginData = Pick; // map a role to an absolute number of users -function mapRoleToCount(role: ROLE): number { +function mapRoleToCount(role: RollenArt): number { switch (role) { - case ROLE.LERN: + case RollenArt.Lern: return 2_000; - case ROLE.LEHR: + case RollenArt.Lehr: return 500; - case ROLE.EXTERN: + case RollenArt.Extern: return 0; - case ROLE.ORGADMIN: + case RollenArt.Orgadmin: return 0; - case ROLE.LEIT: + case RollenArt.Leit: return 1000; - case ROLE.SYSADMIN: + case RollenArt.Sysadmin: return 12; } } -type UserRatio = Record; +export type UserRatio = Record; class LoopIterator { readPosition = 0; @@ -49,40 +42,43 @@ class LoopIterator { /** * Map of roles to looping iterators of usernames and passwords from users.json */ -const groupedUsers = new Map>(); +const groupedUsers = new Map>(); const users = JSON.parse(open(DATAPATH)) as Array; -for (const [key, role] of Object.entries(ROLE)) { +for (const [key, role] of Object.entries(RollenArt)) { const backingArray = new SharedArray(key, () => - users.filter((user: User) => user.role == role), + users.filter((user: User) => { + return user.role == role; + }), ); const iterator = new LoopIterator(backingArray); groupedUsers.set(role, iterator); } +export function getDefaultAdminRatio(): Partial { + return { + SYSADMIN: mapRoleToCount(RollenArt.Sysadmin), + LEIT: mapRoleToCount(RollenArt.Leit), + }; +} + export function getDefaultAdminMix(maxUsers?: number): UserMix { - return new UserMix( - { - SYSADMIN: mapRoleToCount(ROLE.SYSADMIN), - LEIT: mapRoleToCount(ROLE.LEIT), - }, - maxUsers, - ); + return new UserMix(getDefaultAdminRatio(), maxUsers); } export function getDefaultUserMix(maxUsers?: number): UserMix { return new UserMix( { - LEHR: mapRoleToCount(ROLE.LEHR), - LERN: mapRoleToCount(ROLE.LERN), + LEHR: mapRoleToCount(RollenArt.Lehr), + LERN: mapRoleToCount(RollenArt.Lern), }, maxUsers, ); } export class UserMix { - activeRoles: Array; - rolePool: LoopIterator; - tracker: Map; + activeRoles: Array; + rolePool: LoopIterator; + tracker: Map; initialTracker: typeof this.tracker; maxUsers?: number; @@ -90,7 +86,7 @@ export class UserMix { this.activeRoles = []; this.tracker = new Map(); this.initialTracker = new Map(); - for (const role of Object.values(ROLE)) { + for (const role of Object.values(RollenArt) as Array) { if (ratio[role]) { this.activeRoles.push(role); this.initialTracker.set(role, ratio[role]); @@ -111,22 +107,22 @@ export class UserMix { getUser(): User { const currentRole = this.getCurrentRole(); - const user = groupedUsers.get(currentRole); + const user = groupedUsers.get(currentRole)?.next(); if (!user) throw new Error( `user with requested role ${currentRole} is not present in ${DATAPATH}`, ); - return user.next(); + return user; } - getCurrentRole(): ROLE { + getCurrentRole(): RollenArt { if (this.isExhausted()) this.initializeTracker(); const [currentRole, currentRoleCount] = this.getCurrentRoleAndCount(); this.tracker.set(currentRole, currentRoleCount - 1); return currentRole; } - getCurrentRoleAndCount(): [ROLE, number] { + getCurrentRoleAndCount(): [RollenArt, number] { const role = this.rolePool.next(); const count = this.tracker.get(role)!; return [role, count];